![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | wyvern.mp3 | 22-Apr-2007 16:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | wyte.mp3 | 22-Apr-2007 16:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | wyszynski.mp3 | 22-Apr-2007 16:08 | 17K | |
![[SND]](/icons/sound2.gif) | wystan.mp3 | 22-Apr-2007 16:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | wynn.mp3 | 22-Apr-2007 16:08 | 5.2K | |
![[SND]](/icons/sound2.gif) | wynkenblynkenandnod.mp3 | 22-Apr-2007 16:08 | 17K | |
![[SND]](/icons/sound2.gif) | wynd.mp3 | 22-Apr-2007 16:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | wyn.mp3 | 22-Apr-2007 16:08 | 5.2K | |
![[SND]](/icons/sound2.gif) | wyliecoat.mp3 | 22-Apr-2007 16:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | wylers.mp3 | 22-Apr-2007 16:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | wyler.mp3 | 22-Apr-2007 16:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | wykehamist.mp3 | 22-Apr-2007 16:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | wykeham.mp3 | 22-Apr-2007 16:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | wye.mp3 | 22-Apr-2007 16:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | wychelm.mp3 | 22-Apr-2007 16:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | wychalder.mp3 | 22-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | wych.mp3 | 22-Apr-2007 16:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | wyborowa.mp3 | 22-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | wyatt.mp3 | 22-Apr-2007 16:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | wyandotte.mp3 | 22-Apr-2007 16:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | wuzzup.mp3 | 22-Apr-2007 16:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | wuzhou.mp3 | 22-Apr-2007 16:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | wuxueqian.mp3 | 22-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | wuxian.mp3 | 22-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | wuxi.mp3 | 22-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | wuwei.mp3 | 22-Apr-2007 16:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | wutsai.mp3 | 22-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | wuti.mp3 | 22-Apr-2007 16:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | wuther.mp3 | 22-Apr-2007 16:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | wusulijiang.mp3 | 22-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | wussy.mp3 | 22-Apr-2007 16:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | wuss.mp3 | 22-Apr-2007 16:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | wushu.mp3 | 22-Apr-2007 16:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | wus.mp3 | 22-Apr-2007 16:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | wurzel.mp3 | 22-Apr-2007 16:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | wurtzite.mp3 | 22-Apr-2007 16:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | wurtzilite.mp3 | 22-Apr-2007 16:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | wurst.mp3 | 22-Apr-2007 16:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | wurm.mp3 | 22-Apr-2007 16:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | wurlitzer.mp3 | 22-Apr-2007 16:06 | 17K | |
![[SND]](/icons/sound2.gif) | wurley.mp3 | 22-Apr-2007 16:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | wunk.mp3 | 22-Apr-2007 16:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | wunderkinder.mp3 | 22-Apr-2007 16:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | wunderkind.mp3 | 22-Apr-2007 16:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | wunderbar.mp3 | 22-Apr-2007 16:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | wump.mp3 | 22-Apr-2007 16:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | wulumuqi.mp3 | 22-Apr-2007 16:06 | 17K | |
![[SND]](/icons/sound2.gif) | wulfstan.mp3 | 22-Apr-2007 16:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | wulfenite.mp3 | 22-Apr-2007 16:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | wulanfu.mp3 | 22-Apr-2007 16:06 | 17K | |
![[SND]](/icons/sound2.gif) | wujin.mp3 | 22-Apr-2007 16:06 | 17K | |
![[SND]](/icons/sound2.gif) | wuhsi.mp3 | 22-Apr-2007 16:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | wuhou.mp3 | 22-Apr-2007 16:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | wudu.mp3 | 22-Apr-2007 16:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | wudi.mp3 | 22-Apr-2007 16:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | wud.mp3 | 22-Apr-2007 16:05 | 6.3K | |
![[SND]](/icons/sound2.gif) | ws.mp3 | 22-Apr-2007 16:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | wryneck.mp3 | 22-Apr-2007 16:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | wryly.mp3 | 22-Apr-2007 16:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | wryest.mp3 | 22-Apr-2007 16:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | wryer.mp3 | 22-Apr-2007 16:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | wry.mp3 | 22-Apr-2007 16:05 | 6.3K | |
![[SND]](/icons/sound2.gif) | wrung.mp3 | 22-Apr-2007 16:05 | 5.5K | |
![[SND]](/icons/sound2.gif) | wroughty.mp3 | 22-Apr-2007 16:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | wrought.mp3 | 22-Apr-2007 16:05 | 4.8K | |
![[SND]](/icons/sound2.gif) | wroth.mp3 | 22-Apr-2007 16:05 | 5.7K | |
![[SND]](/icons/sound2.gif) | wrote.mp3 | 22-Apr-2007 16:05 | 5.0K | |
![[SND]](/icons/sound2.gif) | wronskian.mp3 | 22-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | wrongun.mp3 | 22-Apr-2007 16:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | wrongous.mp3 | 22-Apr-2007 16:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | wrongo.mp3 | 22-Apr-2007 16:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | wrongly.mp3 | 22-Apr-2007 16:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | wronging.mp3 | 22-Apr-2007 16:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | wrongheaded.mp3 | 22-Apr-2007 16:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | wrongfully.mp3 | 22-Apr-2007 16:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | wrongful.mp3 | 22-Apr-2007 16:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | wrongest.mp3 | 22-Apr-2007 16:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | wronger.mp3 | 22-Apr-2007 16:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | wronged.mp3 | 22-Apr-2007 16:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrongdoing.mp3 | 22-Apr-2007 16:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | wrongdoer.mp3 | 22-Apr-2007 16:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | wrong.mp3 | 22-Apr-2007 16:04 | 6.3K | |
![[SND]](/icons/sound2.gif) | wrong-foot.mp3 | 22-Apr-2007 16:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | written.mp3 | 22-Apr-2007 16:04 | 5.7K | |
![[SND]](/icons/sound2.gif) | writing.mp3 | 22-Apr-2007 16:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | writhen.mp3 | 22-Apr-2007 16:04 | 5.5K | |
![[SND]](/icons/sound2.gif) | writhe.mp3 | 22-Apr-2007 16:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | writerly.mp3 | 22-Apr-2007 16:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | writer.mp3 | 22-Apr-2007 16:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | write.mp3 | 22-Apr-2007 16:04 | 5.4K | |
![[SND]](/icons/sound2.gif) | write-up.mp3 | 22-Apr-2007 16:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | write-off.mp3 | 22-Apr-2007 16:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | write-in.mp3 | 22-Apr-2007 16:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | write-down.mp3 | 22-Apr-2007 16:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | writable.mp3 | 22-Apr-2007 16:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | writ.mp3 | 22-Apr-2007 16:03 | 4.5K | |
![[SND]](/icons/sound2.gif) | wristy.mp3 | 22-Apr-2007 16:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | wristwatch.mp3 | 22-Apr-2007 16:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | wristlock.mp3 | 22-Apr-2007 16:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | wristlet.mp3 | 22-Apr-2007 16:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | wrister.mp3 | 22-Apr-2007 16:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | wristband.mp3 | 22-Apr-2007 16:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | wrist.mp3 | 22-Apr-2007 16:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | wriothesley.mp3 | 22-Apr-2007 16:03 | 17K | |
![[SND]](/icons/sound2.gif) | wrinkly.mp3 | 22-Apr-2007 16:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | wrinkling.mp3 | 22-Apr-2007 16:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | wrinkle.mp3 | 22-Apr-2007 16:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | wringing.mp3 | 22-Apr-2007 16:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | wringer.mp3 | 22-Apr-2007 16:03 | 5.4K | |
![[SND]](/icons/sound2.gif) | wring.mp3 | 22-Apr-2007 16:03 | 5.4K | |
![[SND]](/icons/sound2.gif) | wrigleys.mp3 | 22-Apr-2007 16:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | wrightson.mp3 | 22-Apr-2007 16:03 | 17K | |
![[SND]](/icons/sound2.gif) | wright.mp3 | 22-Apr-2007 16:03 | 5.0K | |
![[SND]](/icons/sound2.gif) | wriggly.mp3 | 22-Apr-2007 16:03 | 5.9K | |
![[SND]](/icons/sound2.gif) | wriggling.mp3 | 22-Apr-2007 16:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | wriggler.mp3 | 22-Apr-2007 16:03 | 5.9K | |
![[SND]](/icons/sound2.gif) | wriggle.mp3 | 22-Apr-2007 16:03 | 5.2K | |
![[SND]](/icons/sound2.gif) | wriest.mp3 | 22-Apr-2007 16:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrier.mp3 | 22-Apr-2007 16:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrick.mp3 | 22-Apr-2007 16:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | wretched.mp3 | 22-Apr-2007 16:03 | 5.9K | |
![[SND]](/icons/sound2.gif) | wretch.mp3 | 22-Apr-2007 16:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | wrestling.mp3 | 22-Apr-2007 16:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | wrestler.mp3 | 22-Apr-2007 16:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | wrestle.mp3 | 22-Apr-2007 16:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | wrest.mp3 | 22-Apr-2007 16:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | wrens.mp3 | 22-Apr-2007 16:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrennery.mp3 | 22-Apr-2007 16:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | wrenchingly.mp3 | 22-Apr-2007 16:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | wrench.mp3 | 22-Apr-2007 16:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | wren.mp3 | 22-Apr-2007 16:02 | 5.4K | |
![[SND]](/icons/sound2.gif) | wrekin.mp3 | 22-Apr-2007 16:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrecking.mp3 | 22-Apr-2007 16:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | wreckful.mp3 | 22-Apr-2007 16:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | wrecker.mp3 | 22-Apr-2007 16:02 | 5.5K | |
![[SND]](/icons/sound2.gif) | wreckem.mp3 | 22-Apr-2007 16:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrecked.mp3 | 22-Apr-2007 16:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | wreckage.mp3 | 22-Apr-2007 16:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | wreck.mp3 | 22-Apr-2007 16:02 | 4.8K | |
![[SND]](/icons/sound2.gif) | wreathy.mp3 | 22-Apr-2007 16:02 | 5.9K | |
![[SND]](/icons/sound2.gif) | wreaths.mp3 | 22-Apr-2007 16:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | wreathen.mp3 | 22-Apr-2007 16:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | wreathe.mp3 | 22-Apr-2007 16:02 | 5.7K | |
![[SND]](/icons/sound2.gif) | wreath.mp3 | 22-Apr-2007 16:02 | 5.0K | |
![[SND]](/icons/sound2.gif) | wreak.mp3 | 22-Apr-2007 16:02 | 4.6K | |
![[SND]](/icons/sound2.gif) | wrathy.mp3 | 22-Apr-2007 16:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | wrathfully.mp3 | 22-Apr-2007 16:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | wrathful.mp3 | 22-Apr-2007 16:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | wrath.mp3 | 22-Apr-2007 16:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | wrastle.mp3 | 22-Apr-2007 16:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrasse.mp3 | 22-Apr-2007 16:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | wrapt.mp3 | 22-Apr-2007 16:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrapping.mp3 | 22-Apr-2007 16:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | wrapper.mp3 | 22-Apr-2007 16:01 | 5.9K | |
![[SND]](/icons/sound2.gif) | wrapped.mp3 | 22-Apr-2007 16:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrappage.mp3 | 22-Apr-2007 16:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | wrapling.mp3 | 22-Apr-2007 16:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | wraparound.mp3 | 22-Apr-2007 16:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | wrap.mp3 | 22-Apr-2007 16:01 | 4.6K | |
![[SND]](/icons/sound2.gif) | wrap-up.mp3 | 22-Apr-2007 16:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | wrangling.mp3 | 22-Apr-2007 16:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | wrangler.mp3 | 22-Apr-2007 16:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | wrangle.mp3 | 22-Apr-2007 16:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | wrangellsteliasnationalpark.mp3 | 22-Apr-2007 16:01 | 27K | |
![[SND]](/icons/sound2.gif) | wrang.mp3 | 22-Apr-2007 16:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | wran.mp3 | 22-Apr-2007 16:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | wraiths.mp3 | 22-Apr-2007 16:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | wraithlike.mp3 | 22-Apr-2007 16:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | wraith.mp3 | 22-Apr-2007 16:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | wraggletaggle.mp3 | 22-Apr-2007 16:01 | 17K | |
![[SND]](/icons/sound2.gif) | wraf.mp3 | 22-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | wrackful.mp3 | 22-Apr-2007 16:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | wrack.mp3 | 22-Apr-2007 16:00 | 4.8K | |
![[SND]](/icons/sound2.gif) | wrac.mp3 | 22-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | wraac.mp3 | 22-Apr-2007 16:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | wppsi.mp3 | 22-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | wp.mp3 | 22-Apr-2007 16:00 | 17K | |
![[SND]](/icons/sound2.gif) | wozzlewater.mp3 | 22-Apr-2007 16:00 | 17K | |
![[SND]](/icons/sound2.gif) | wowser.mp3 | 22-Apr-2007 16:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | wowee.mp3 | 22-Apr-2007 16:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | wow.mp3 | 22-Apr-2007 16:00 | 5.5K | |
![[SND]](/icons/sound2.gif) | wove paper.mp3 | 22-Apr-2007 16:00 | 11K | |
![[SND]](/icons/sound2.gif) | woven.mp3 | 22-Apr-2007 16:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | wove.mp3 | 22-Apr-2007 16:00 | 5.2K | |
![[SND]](/icons/sound2.gif) | wourali.mp3 | 22-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | woundy.mp3 | 22-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | woundwort.mp3 | 22-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | woundless.mp3 | 22-Apr-2007 16:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | woundlaboratory.mp3 | 22-Apr-2007 16:00 | 17K | |
![[SND]](/icons/sound2.gif) | woundfin.mp3 | 22-Apr-2007 16:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | wounded.mp3 | 22-Apr-2007 16:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | wound.mp3 | 22-Apr-2007 16:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | woulfebottle.mp3 | 22-Apr-2007 16:00 | 17K | |
![[SND]](/icons/sound2.gif) | wouldst.mp3 | 22-Apr-2007 16:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | wouldnt.mp3 | 22-Apr-2007 15:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | wouldn't.mp3 | 22-Apr-2007 15:59 | 5.2K | |
![[SND]](/icons/sound2.gif) | wouldest.mp3 | 22-Apr-2007 15:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | would.mp3 | 22-Apr-2007 15:59 | 5.5K | |
![[SND]](/icons/sound2.gif) | would-be.mp3 | 22-Apr-2007 15:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | wotcher.mp3 | 22-Apr-2007 15:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | wotan.mp3 | 22-Apr-2007 15:59 | 17K | |
![[SND]](/icons/sound2.gif) | wot.mp3 | 22-Apr-2007 15:59 | 4.8K | |
![[SND]](/icons/sound2.gif) | wortle.mp3 | 22-Apr-2007 15:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | worthy.mp3 | 22-Apr-2007 15:59 | 5.7K | |
![[SND]](/icons/sound2.gif) | worthwhile.mp3 | 22-Apr-2007 15:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | worthless.mp3 | 22-Apr-2007 15:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | worthiness.mp3 | 22-Apr-2007 15:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | worthily.mp3 | 22-Apr-2007 15:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | worthful.mp3 | 22-Apr-2007 15:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | worth.mp3 | 22-Apr-2007 15:59 | 5.0K | |
![[SND]](/icons/sound2.gif) | wort.mp3 | 22-Apr-2007 15:59 | 5.0K | |
![[SND]](/icons/sound2.gif) | worsted.mp3 | 22-Apr-2007 15:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | worst.mp3 | 22-Apr-2007 15:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | worssett.mp3 | 22-Apr-2007 15:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | worsley.mp3 | 22-Apr-2007 15:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | worshipless.mp3 | 22-Apr-2007 15:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | worshipfully.mp3 | 22-Apr-2007 15:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | worshipful.mp3 | 22-Apr-2007 15:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | worshiper.mp3 | 22-Apr-2007 15:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | worship.mp3 | 22-Apr-2007 15:58 | 5.4K | |
![[SND]](/icons/sound2.gif) | worset.mp3 | 22-Apr-2007 15:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | worser.mp3 | 22-Apr-2007 15:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | worsening.mp3 | 22-Apr-2007 15:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | worsen.mp3 | 22-Apr-2007 15:58 | 5.9K | |
![[SND]](/icons/sound2.gif) | worse.mp3 | 22-Apr-2007 15:58 | 5.5K | |
![[SND]](/icons/sound2.gif) | worrywart.mp3 | 22-Apr-2007 15:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | worrying.mp3 | 22-Apr-2007 15:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | worry.mp3 | 22-Apr-2007 15:58 | 5.9K | |
![[SND]](/icons/sound2.gif) | worrit.mp3 | 22-Apr-2007 15:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | worrisome.mp3 | 22-Apr-2007 15:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | worriment.mp3 | 22-Apr-2007 15:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | worriless.mp3 | 22-Apr-2007 15:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | worrier.mp3 | 22-Apr-2007 15:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | worriedly.mp3 | 22-Apr-2007 15:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | worried.mp3 | 22-Apr-2007 15:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | worn.mp3 | 22-Apr-2007 15:58 | 5.5K | |
![[SND]](/icons/sound2.gif) | worn-out.mp3 | 22-Apr-2007 15:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | wormy.mp3 | 22-Apr-2007 15:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | wormwood.mp3 | 22-Apr-2007 15:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | wormseed.mp3 | 22-Apr-2007 15:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | wormlike.mp3 | 22-Apr-2007 15:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | wormhole.mp3 | 22-Apr-2007 15:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | wormery.mp3 | 22-Apr-2007 15:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | wormer.mp3 | 22-Apr-2007 15:57 | 5.2K | |
![[SND]](/icons/sound2.gif) | worm.mp3 | 22-Apr-2007 15:57 | 5.5K | |
![[SND]](/icons/sound2.gif) | worm-eaten.mp3 | 22-Apr-2007 15:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | worm's-eye.mp3 | 22-Apr-2007 15:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | worldwide.mp3 | 22-Apr-2007 15:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | worldwariii.mp3 | 22-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | worldwarii.mp3 | 22-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | worldwari.mp3 | 22-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | worldview.mp3 | 22-Apr-2007 15:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | worldly.mp3 | 22-Apr-2007 15:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | worldly-wise.mp3 | 22-Apr-2007 15:56 | 11K | |
![[SND]](/icons/sound2.gif) | worldly-minded.mp3 | 22-Apr-2007 15:56 | 11K | |
![[SND]](/icons/sound2.gif) | worldling.mp3 | 22-Apr-2007 15:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | worlddayofprayer.mp3 | 22-Apr-2007 15:56 | 17K | |
![[SND]](/icons/sound2.gif) | world.mp3 | 22-Apr-2007 15:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | world-weary.mp3 | 22-Apr-2007 15:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | world-shaking.mp3 | 22-Apr-2007 15:56 | 11K | |
![[SND]](/icons/sound2.gif) | world-beater.mp3 | 22-Apr-2007 15:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | workwoman.mp3 | 22-Apr-2007 15:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | workweek.mp3 | 22-Apr-2007 15:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | workup.mp3 | 22-Apr-2007 15:56 | 4.8K | |
![[SND]](/icons/sound2.gif) | worktable.mp3 | 22-Apr-2007 15:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | workstudyprogram.mp3 | 22-Apr-2007 15:56 | 17K | |
![[SND]](/icons/sound2.gif) | workstation.mp3 | 22-Apr-2007 15:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | workshop.mp3 | 22-Apr-2007 15:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | workroom.mp3 | 22-Apr-2007 15:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | workplace.mp3 | 22-Apr-2007 15:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | workpiece.mp3 | 22-Apr-2007 15:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | workpeople.mp3 | 22-Apr-2007 15:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | workout.mp3 | 22-Apr-2007 15:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | workmate.mp3 | 22-Apr-2007 15:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | workmanship.mp3 | 22-Apr-2007 15:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | workmanly.mp3 | 22-Apr-2007 15:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | workmanlike.mp3 | 22-Apr-2007 15:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | workman.mp3 | 22-Apr-2007 15:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | workload.mp3 | 22-Apr-2007 15:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | workless.mp3 | 22-Apr-2007 15:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | workingwoman.mp3 | 22-Apr-2007 15:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | workingman.mp3 | 22-Apr-2007 15:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | working.mp3 | 22-Apr-2007 15:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | workhouse.mp3 | 22-Apr-2007 15:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | workhorse.mp3 | 22-Apr-2007 15:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | workforce.mp3 | 22-Apr-2007 15:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | workfolks.mp3 | 22-Apr-2007 15:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | workfolk.mp3 | 22-Apr-2007 15:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | workfare.mp3 | 22-Apr-2007 15:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | worker.mp3 | 22-Apr-2007 15:55 | 6.1K | |
![[SND]](/icons/sound2.gif) | worked.mp3 | 22-Apr-2007 15:55 | 5.2K | |
![[SND]](/icons/sound2.gif) | workday.mp3 | 22-Apr-2007 15:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | workbox.mp3 | 22-Apr-2007 15:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | workbook.mp3 | 22-Apr-2007 15:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | workboat.mp3 | 22-Apr-2007 15:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | workbench.mp3 | 22-Apr-2007 15:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | workbasket.mp3 | 22-Apr-2007 15:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | workbag.mp3 | 22-Apr-2007 15:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | workaphile.mp3 | 22-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | workaholism.mp3 | 22-Apr-2007 15:55 | 10K | |
![[SND]](/icons/sound2.gif) | workaholic.mp3 | 22-Apr-2007 15:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | workaday.mp3 | 22-Apr-2007 15:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | workableness.mp3 | 22-Apr-2007 15:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | workable.mp3 | 22-Apr-2007 15:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | workability.mp3 | 22-Apr-2007 15:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | work.mp3 | 22-Apr-2007 15:54 | 4.3K | |
![[SND]](/icons/sound2.gif) | work-up.mp3 | 22-Apr-2007 15:56 | 4.8K | |
![[SND]](/icons/sound2.gif) | work-around.mp3 | 22-Apr-2007 15:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | wore.mp3 | 22-Apr-2007 15:54 | 5.4K | |
![[SND]](/icons/sound2.gif) | wordy.mp3 | 22-Apr-2007 15:54 | 4.8K | |
![[SND]](/icons/sound2.gif) | wordsmithery.mp3 | 22-Apr-2007 15:54 | 10K | |
![[SND]](/icons/sound2.gif) | wordsmith.mp3 | 22-Apr-2007 15:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | wordsmanship.mp3 | 22-Apr-2007 15:54 | 17K | |
![[SND]](/icons/sound2.gif) | wordplay.mp3 | 22-Apr-2007 15:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | wordmonger.mp3 | 22-Apr-2007 15:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | wordless.mp3 | 22-Apr-2007 15:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | wording.mp3 | 22-Apr-2007 15:54 | 11K | |
![[SND]](/icons/sound2.gif) | wordiness.mp3 | 22-Apr-2007 15:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | wordily.mp3 | 22-Apr-2007 15:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | wordbook.mp3 | 22-Apr-2007 15:54 | 6.3K | |
![[SND]](/icons/sound2.gif) | wordage.mp3 | 22-Apr-2007 15:54 | 5.7K | |
![[SND]](/icons/sound2.gif) | word.mp3 | 22-Apr-2007 15:54 | 5.2K | |
![[SND]](/icons/sound2.gif) | word-of-mouth.mp3 | 22-Apr-2007 15:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | word-mongering.mp3 | 22-Apr-2007 15:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | word-hoard.mp3 | 22-Apr-2007 15:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | worcesterpearmain.mp3 | 22-Apr-2007 15:54 | 17K | |
![[SND]](/icons/sound2.gif) | worb.mp3 | 22-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | wopwops.mp3 | 22-Apr-2007 15:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | wop.mp3 | 22-Apr-2007 15:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | woozy.mp3 | 22-Apr-2007 15:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | wooz.mp3 | 22-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | wootz.mp3 | 22-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | woosh.mp3 | 22-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | woorali.mp3 | 22-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | woopwoop.mp3 | 22-Apr-2007 15:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | woopsie.mp3 | 22-Apr-2007 15:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | woops.mp3 | 22-Apr-2007 15:53 | 5.4K | |
![[SND]](/icons/sound2.gif) | woopie.mp3 | 22-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | woonerf.mp3 | 22-Apr-2007 15:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | woomerang.mp3 | 22-Apr-2007 15:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | woomera.mp3 | 22-Apr-2007 15:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | wooly.mp3 | 22-Apr-2007 15:53 | 5.0K | |
![[SND]](/icons/sound2.gif) | wooltonpie.mp3 | 22-Apr-2007 15:53 | 17K | |
![[SND]](/icons/sound2.gif) | woolsorter's disease.mp3 | 22-Apr-2007 15:53 | 16K | |
![[SND]](/icons/sound2.gif) | woolskin.mp3 | 22-Apr-2007 15:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | woolshed.mp3 | 22-Apr-2007 15:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | woolsack.mp3 | 22-Apr-2007 15:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | woolpack.mp3 | 22-Apr-2007 15:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | wooloomoolooyank.mp3 | 22-Apr-2007 15:53 | 17K | |
![[SND]](/icons/sound2.gif) | woolman.mp3 | 22-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | woollybutt.mp3 | 22-Apr-2007 15:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | woolly adelgid.mp3 | 22-Apr-2007 15:52 | 11K | |
![[SND]](/icons/sound2.gif) | woolly.mp3 | 22-Apr-2007 15:52 | 5.0K | |
![[SND]](/icons/sound2.gif) | woolly-headed.mp3 | 22-Apr-2007 15:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | woollily.mp3 | 22-Apr-2007 15:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | woollen.mp3 | 22-Apr-2007 15:52 | 5.2K | |
![[SND]](/icons/sound2.gif) | woolled.mp3 | 22-Apr-2007 15:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | woolite.mp3 | 22-Apr-2007 15:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | woolies.mp3 | 22-Apr-2007 15:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | woolgathering.mp3 | 22-Apr-2007 15:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | woolgatherer.mp3 | 22-Apr-2007 15:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | woolgather.mp3 | 22-Apr-2007 15:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | wooler.mp3 | 22-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | woolen.mp3 | 22-Apr-2007 15:52 | 5.2K | |
![[SND]](/icons/sound2.gif) | wooled.mp3 | 22-Apr-2007 15:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | woolco.mp3 | 22-Apr-2007 15:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | wool.mp3 | 22-Apr-2007 15:52 | 5.4K | |
![[SND]](/icons/sound2.gif) | wookyhole.mp3 | 22-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | woofter.mp3 | 22-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | woofs.mp3 | 22-Apr-2007 15:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | wooflewater.mp3 | 22-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | woofled.mp3 | 22-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | woofits.mp3 | 22-Apr-2007 15:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | woofing.mp3 | 22-Apr-2007 15:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | woofie.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | woofer.mp3 | 22-Apr-2007 15:51 | 5.4K | |
![[SND]](/icons/sound2.gif) | woof.mp3 | 22-Apr-2007 15:51 | 4.1K | |
![[SND]](/icons/sound2.gif) | wooer.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | woody.mp3 | 22-Apr-2007 15:51 | 5.2K | |
![[SND]](/icons/sound2.gif) | woodworm.mp3 | 22-Apr-2007 15:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | woodworking.mp3 | 22-Apr-2007 15:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | woodworker.mp3 | 22-Apr-2007 15:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | woodwork.mp3 | 22-Apr-2007 15:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | woodwollyfoot.mp3 | 22-Apr-2007 15:51 | 17K | |
![[SND]](/icons/sound2.gif) | woodwind.mp3 | 22-Apr-2007 15:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | woodward.mp3 | 22-Apr-2007 15:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | woodwall.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | woodville.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | woodsy.mp3 | 22-Apr-2007 15:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | woodstove.mp3 | 22-Apr-2007 15:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | woodsman.mp3 | 22-Apr-2007 15:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | woodsia.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | woodshed.mp3 | 22-Apr-2007 15:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | woodser.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | woods.mp3 | 22-Apr-2007 15:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | woodruff.mp3 | 22-Apr-2007 15:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | woodrow.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | woodpile.mp3 | 22-Apr-2007 15:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | woodpecker.mp3 | 22-Apr-2007 15:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | woodnote.mp3 | 22-Apr-2007 15:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | woodman.mp3 | 22-Apr-2007 15:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | woodlot.mp3 | 22-Apr-2007 15:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | woodlore.mp3 | 22-Apr-2007 15:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | woodlander.mp3 | 22-Apr-2007 15:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | woodland.mp3 | 22-Apr-2007 15:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | woodie.mp3 | 22-Apr-2007 15:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | woodhenge.mp3 | 22-Apr-2007 15:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | woodenware.mp3 | 22-Apr-2007 15:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | woodenness.mp3 | 22-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | woodenheaded.mp3 | 22-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | woodenhead.mp3 | 22-Apr-2007 15:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | wooden.mp3 | 22-Apr-2007 15:50 | 5.0K | |
![[SND]](/icons/sound2.gif) | wooded.mp3 | 22-Apr-2007 15:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | woodcutting.mp3 | 22-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | woodcutter.mp3 | 22-Apr-2007 15:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | woodcut.mp3 | 22-Apr-2007 15:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | woodcraft.mp3 | 22-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | woodcock.mp3 | 22-Apr-2007 15:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | woodchuck.mp3 | 22-Apr-2007 15:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | woodchopper.mp3 | 22-Apr-2007 15:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | woodchat shrike.mp3 | 22-Apr-2007 15:49 | 12K | |
![[SND]](/icons/sound2.gif) | woodburytype.mp3 | 22-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | woodblock.mp3 | 22-Apr-2007 15:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | woodbine.mp3 | 22-Apr-2007 15:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | wood betony.mp3 | 22-Apr-2007 15:49 | 11K | |
![[SND]](/icons/sound2.gif) | wood.mp3 | 22-Apr-2007 15:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | wood-carver.mp3 | 22-Apr-2007 15:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | wood-boring.mp3 | 22-Apr-2007 15:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | woo.mp3 | 22-Apr-2007 15:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | wonton.mp3 | 22-Apr-2007 15:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | wonted.mp3 | 22-Apr-2007 15:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | wont.mp3 | 22-Apr-2007 15:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | wonna.mp3 | 22-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | wonky.mp3 | 22-Apr-2007 15:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | wonk.mp3 | 22-Apr-2007 15:49 | 4.6K | |
![[SND]](/icons/sound2.gif) | wonju.mp3 | 22-Apr-2007 15:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | wongawonga.mp3 | 22-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | wong.mp3 | 22-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | wonelly.mp3 | 22-Apr-2007 15:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | wondrous.mp3 | 22-Apr-2007 15:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | wonderwork.mp3 | 22-Apr-2007 15:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | wonderment.mp3 | 22-Apr-2007 15:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | wonderland.mp3 | 22-Apr-2007 15:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | wondering.mp3 | 22-Apr-2007 15:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | wonderfulness.mp3 | 22-Apr-2007 15:48 | 10K | |
![[SND]](/icons/sound2.gif) | wonderfully.mp3 | 22-Apr-2007 15:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | wonderful.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | wonderer.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | wonderberry.mp3 | 22-Apr-2007 15:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | wonder.mp3 | 22-Apr-2007 15:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | wonder-working.mp3 | 22-Apr-2007 15:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | wonder-worker.mp3 | 22-Apr-2007 15:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | won.mp3 | 22-Apr-2007 15:48 | 5.5K | |
![[SND]](/icons/sound2.gif) | won't.mp3 | 22-Apr-2007 15:49 | 5.5K | |
![[SND]](/icons/sound2.gif) | womyn.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | womp.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | womon.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | wommera.mp3 | 22-Apr-2007 15:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | womera.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | womens.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | womenkind.mp3 | 22-Apr-2007 15:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | womenfolks.mp3 | 22-Apr-2007 15:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | womenfolk.mp3 | 22-Apr-2007 15:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | women.mp3 | 22-Apr-2007 15:48 | 5.5K | |
![[SND]](/icons/sound2.gif) | womby.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | womble.mp3 | 22-Apr-2007 15:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | wombed.mp3 | 22-Apr-2007 15:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | wombat.mp3 | 22-Apr-2007 15:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | womba.mp3 | 22-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | womb.mp3 | 22-Apr-2007 15:47 | 5.4K | |
![[SND]](/icons/sound2.gif) | womanpower.mp3 | 22-Apr-2007 15:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | womanly.mp3 | 22-Apr-2007 15:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | womanlike.mp3 | 22-Apr-2007 15:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | womanless.mp3 | 22-Apr-2007 15:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | womankind.mp3 | 22-Apr-2007 15:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | womanizer.mp3 | 22-Apr-2007 15:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | womanize.mp3 | 22-Apr-2007 15:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | womanist.mp3 | 22-Apr-2007 15:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | womanism.mp3 | 22-Apr-2007 15:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | womanish.mp3 | 22-Apr-2007 15:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | womanhood.mp3 | 22-Apr-2007 15:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | womanfully.mp3 | 22-Apr-2007 15:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | womanaut.mp3 | 22-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | woman.mp3 | 22-Apr-2007 15:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | wolvish.mp3 | 22-Apr-2007 15:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | wolves.mp3 | 22-Apr-2007 15:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | wolverine.mp3 | 22-Apr-2007 15:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | wolver.mp3 | 22-Apr-2007 15:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | wolly.mp3 | 22-Apr-2007 15:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | wollastonite.mp3 | 22-Apr-2007 15:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | wolfschmidt.mp3 | 22-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | wolfsbane.mp3 | 22-Apr-2007 15:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | wolfrayetstar.mp3 | 22-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | wolframvoneschenbach.mp3 | 22-Apr-2007 15:46 | 18K | |
![[SND]](/icons/sound2.gif) | wolframium.mp3 | 22-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | wolframite.mp3 | 22-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | wolframic.mp3 | 22-Apr-2007 15:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | wolframate.mp3 | 22-Apr-2007 15:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | wolfram.mp3 | 22-Apr-2007 15:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | wolfowitz.mp3 | 22-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | wolfman.mp3 | 22-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | wolflike.mp3 | 22-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | wolfkin.mp3 | 22-Apr-2007 15:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | wolfit.mp3 | 22-Apr-2007 15:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | wolfish.mp3 | 22-Apr-2007 15:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | wolfhound.mp3 | 22-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | wolfgang.mp3 | 22-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | wolfflin.mp3 | 22-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | wolffish.mp3 | 22-Apr-2007 15:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | wolffian.mp3 | 22-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | wolfferrari.mp3 | 22-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | wolff.mp3 | 22-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | wolfer.mp3 | 22-Apr-2007 15:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | wolfendenreport.mp3 | 22-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | wolfberry.mp3 | 22-Apr-2007 15:45 | 10K | |
![[SND]](/icons/sound2.gif) | wolf.mp3 | 22-Apr-2007 15:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | wold.mp3 | 22-Apr-2007 15:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | wokkaboard.mp3 | 22-Apr-2007 15:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | woken.mp3 | 22-Apr-2007 15:45 | 5.7K | |
![[SND]](/icons/sound2.gif) | woke.mp3 | 22-Apr-2007 15:45 | 5.0K | |
![[SND]](/icons/sound2.gif) | wokas.mp3 | 22-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | wok.mp3 | 22-Apr-2007 15:45 | 4.6K | |
![[SND]](/icons/sound2.gif) | woiwode.mp3 | 22-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | wohler.mp3 | 22-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | woggle.mp3 | 22-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | wogging.mp3 | 22-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | wog.mp3 | 22-Apr-2007 15:45 | 5.7K | |
![[SND]](/icons/sound2.gif) | woful.mp3 | 22-Apr-2007 15:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | woffle.mp3 | 22-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | woesome.mp3 | 22-Apr-2007 15:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | woefulness.mp3 | 22-Apr-2007 15:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | woefully.mp3 | 22-Apr-2007 15:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | woeful.mp3 | 22-Apr-2007 15:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | woefits.mp3 | 22-Apr-2007 15:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | woebegone.mp3 | 22-Apr-2007 15:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | woe.mp3 | 22-Apr-2007 15:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | wodge.mp3 | 22-Apr-2007 15:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | wocas.mp3 | 22-Apr-2007 15:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | woburnabbey.mp3 | 22-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | wobegone.mp3 | 22-Apr-2007 15:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | wobbyone.mp3 | 22-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | wobbly.mp3 | 22-Apr-2007 15:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | wobbling.mp3 | 22-Apr-2007 15:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | wobbliness.mp3 | 22-Apr-2007 15:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | wobbler.mp3 | 22-Apr-2007 15:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | wobblefats.mp3 | 22-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | wobble.mp3 | 22-Apr-2007 15:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | wobbegong.mp3 | 22-Apr-2007 15:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | wob.mp3 | 22-Apr-2007 15:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | woald.mp3 | 22-Apr-2007 15:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | woadwaxen.mp3 | 22-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | woaded.mp3 | 22-Apr-2007 15:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | woad.mp3 | 22-Apr-2007 15:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | wo.mp3 | 22-Apr-2007 15:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | wladyslawii.mp3 | 22-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | wladimir.mp3 | 22-Apr-2007 15:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | wlach.mp3 | 22-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | wizzo.mp3 | 22-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | wizz.mp3 | 22-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | wizening.mp3 | 22-Apr-2007 15:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | wizened.mp3 | 22-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | wizen.mp3 | 22-Apr-2007 15:43 | 5.7K | |
![[SND]](/icons/sound2.gif) | wizardry.mp3 | 22-Apr-2007 15:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | wizardly.mp3 | 22-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | wizard.mp3 | 22-Apr-2007 15:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | wiz.mp3 | 22-Apr-2007 15:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | wives.mp3 | 22-Apr-2007 15:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | wivern.mp3 | 22-Apr-2007 15:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | wive.mp3 | 22-Apr-2007 15:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | witty.mp3 | 22-Apr-2007 15:43 | 4.5K | |
![[SND]](/icons/sound2.gif) | wittol.mp3 | 22-Apr-2007 15:43 | 4.3K | |
![[SND]](/icons/sound2.gif) | wittingly.mp3 | 22-Apr-2007 15:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | witting.mp3 | 22-Apr-2007 15:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | wittiness.mp3 | 22-Apr-2007 15:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | wittily.mp3 | 22-Apr-2007 15:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | witticism.mp3 | 22-Apr-2007 15:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | witter.mp3 | 22-Apr-2007 15:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | witted.mp3 | 22-Apr-2007 15:42 | 5.0K | |
![[SND]](/icons/sound2.gif) | witt.mp3 | 22-Apr-2007 15:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | witster.mp3 | 22-Apr-2007 15:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | witness.mp3 | 22-Apr-2007 15:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | witness-box.mp3 | 22-Apr-2007 15:42 | 10K | |
![[SND]](/icons/sound2.gif) | witloof.mp3 | 22-Apr-2007 15:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | witling.mp3 | 22-Apr-2007 15:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | witless.mp3 | 22-Apr-2007 15:42 | 6.3K | |
![[SND]](/icons/sound2.gif) | witigo.mp3 | 22-Apr-2007 15:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | withywind.mp3 | 22-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | withy.mp3 | 22-Apr-2007 15:42 | 4.8K | |
![[SND]](/icons/sound2.gif) | withstood.mp3 | 22-Apr-2007 15:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | withstand.mp3 | 22-Apr-2007 15:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | withoutdoors.mp3 | 22-Apr-2007 15:42 | 10K | |
![[SND]](/icons/sound2.gif) | without.mp3 | 22-Apr-2007 15:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | withindoors.mp3 | 22-Apr-2007 15:41 | 12K | |
![[SND]](/icons/sound2.gif) | within.mp3 | 22-Apr-2007 15:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | withhold.mp3 | 22-Apr-2007 15:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | withheld.mp3 | 22-Apr-2007 15:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | withershins.mp3 | 22-Apr-2007 15:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | withers.mp3 | 22-Apr-2007 15:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | witherite.mp3 | 22-Apr-2007 15:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | witheringly.mp3 | 22-Apr-2007 15:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | withering.mp3 | 22-Apr-2007 15:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | withered.mp3 | 22-Apr-2007 15:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | wither.mp3 | 22-Apr-2007 15:41 | 4.6K | |
![[SND]](/icons/sound2.gif) | withe.mp3 | 22-Apr-2007 15:41 | 4.5K | |
![[SND]](/icons/sound2.gif) | withdrew.mp3 | 22-Apr-2007 15:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | withdrawnness.mp3 | 22-Apr-2007 15:41 | 10K | |
![[SND]](/icons/sound2.gif) | withdrawn.mp3 | 22-Apr-2007 15:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | withdrawing.mp3 | 22-Apr-2007 15:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | withdrawal.mp3 | 22-Apr-2007 15:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | withdrawable.mp3 | 22-Apr-2007 15:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | withdraw.mp3 | 22-Apr-2007 15:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | withal.mp3 | 22-Apr-2007 15:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | with.mp3 | 22-Apr-2007 15:41 | 4.1K | |
![[SND]](/icons/sound2.gif) | with-it.mp3 | 22-Apr-2007 15:41 | 4.1K | |
![[SND]](/icons/sound2.gif) | witenagemote.mp3 | 22-Apr-2007 15:41 | 10K | |
![[SND]](/icons/sound2.gif) | witenagemot.mp3 | 22-Apr-2007 15:41 | 10K | |
![[SND]](/icons/sound2.gif) | wite.mp3 | 22-Apr-2007 15:41 | 4.6K | |
![[SND]](/icons/sound2.gif) | witchy.mp3 | 22-Apr-2007 15:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | witchweed.mp3 | 22-Apr-2007 15:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | witchofagnesi.mp3 | 22-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | witch of Agnesi.mp3 | 22-Apr-2007 15:40 | 14K | |
![[SND]](/icons/sound2.gif) | witchman.mp3 | 22-Apr-2007 15:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | witchlike.mp3 | 22-Apr-2007 15:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | witching.mp3 | 22-Apr-2007 15:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | witch hazel.mp3 | 22-Apr-2007 15:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | witchgrass.mp3 | 22-Apr-2007 15:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | witchettygrub.mp3 | 22-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | witches'-broom.mp3 | 22-Apr-2007 15:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | witchery.mp3 | 22-Apr-2007 15:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | witchcraft.mp3 | 22-Apr-2007 15:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | witch.mp3 | 22-Apr-2007 15:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | witblits.mp3 | 22-Apr-2007 15:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | witan.mp3 | 22-Apr-2007 15:40 | 5.9K | |
![[SND]](/icons/sound2.gif) | wit.mp3 | 22-Apr-2007 15:40 | 4.5K | |
![[SND]](/icons/sound2.gif) | wistfully.mp3 | 22-Apr-2007 15:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | wistful.mp3 | 22-Apr-2007 15:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | wisteria.mp3 | 22-Apr-2007 15:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | wistaria.mp3 | 22-Apr-2007 15:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | wist.mp3 | 22-Apr-2007 15:40 | 5.4K | |
![[SND]](/icons/sound2.gif) | wispy.mp3 | 22-Apr-2007 15:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | wispish.mp3 | 22-Apr-2007 15:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | wispiness.mp3 | 22-Apr-2007 15:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | wispily.mp3 | 22-Apr-2007 15:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | wisp.mp3 | 22-Apr-2007 15:39 | 5.2K | |
![[SND]](/icons/sound2.gif) | wislanyzalew.mp3 | 22-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | wiskottaldrichsyndrome.mp3 | 22-Apr-2007 15:39 | 27K | |
![[SND]](/icons/sound2.gif) | wisk.mp3 | 22-Apr-2007 15:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | wishywashy.mp3 | 22-Apr-2007 15:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | wishy-washy.mp3 | 22-Apr-2007 15:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | wishwash.mp3 | 22-Apr-2007 15:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | wishing.mp3 | 22-Apr-2007 15:39 | 6.1K | |
![[SND]](/icons/sound2.gif) | wishfully.mp3 | 22-Apr-2007 15:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | wishful.mp3 | 22-Apr-2007 15:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | wishbone.mp3 | 22-Apr-2007 15:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | wisha.mp3 | 22-Apr-2007 15:39 | 4.3K | |
![[SND]](/icons/sound2.gif) | wish.mp3 | 22-Apr-2007 15:39 | 5.4K | |
![[SND]](/icons/sound2.gif) | wish-wash.mp3 | 22-Apr-2007 15:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | wisewoman.mp3 | 22-Apr-2007 15:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | wisent.mp3 | 22-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | wisenheimer.mp3 | 22-Apr-2007 15:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | wiseling.mp3 | 22-Apr-2007 15:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | wise guy.mp3 | 22-Apr-2007 15:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | wised-up.mp3 | 22-Apr-2007 15:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | wisecrack.mp3 | 22-Apr-2007 15:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | wiseass.mp3 | 22-Apr-2007 15:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | wiseacre.mp3 | 22-Apr-2007 15:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | wise.mp3 | 22-Apr-2007 15:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | wisdom.mp3 | 22-Apr-2007 15:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | wisden.mp3 | 22-Apr-2007 15:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | wiscr.mp3 | 22-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | wisc.mp3 | 22-Apr-2007 15:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | wisby.mp3 | 22-Apr-2007 15:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | wisbech.mp3 | 22-Apr-2007 15:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | wis.mp3 | 22-Apr-2007 15:38 | 5.2K | |
![[SND]](/icons/sound2.gif) | wiry.mp3 | 22-Apr-2007 15:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | wirral.mp3 | 22-Apr-2007 15:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | wirrah.mp3 | 22-Apr-2007 15:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | wirra.mp3 | 22-Apr-2007 15:38 | 4.6K | |
![[SND]](/icons/sound2.gif) | wiring.mp3 | 22-Apr-2007 15:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | wiriness.mp3 | 22-Apr-2007 15:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | wirily.mp3 | 22-Apr-2007 15:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | wirier.mp3 | 22-Apr-2007 15:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | wirgman.mp3 | 22-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | wirewoundgun.mp3 | 22-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | wireworm.mp3 | 22-Apr-2007 15:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | wirework.mp3 | 22-Apr-2007 15:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | wiretapper.mp3 | 22-Apr-2007 15:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | wiretap.mp3 | 22-Apr-2007 15:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | wiresonde.mp3 | 22-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | wirer.mp3 | 22-Apr-2007 15:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | wirephoto.mp3 | 22-Apr-2007 15:37 | 9.6K | |
![[SND]](/icons/sound2.gif) | wireman.mp3 | 22-Apr-2007 15:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | wirelike.mp3 | 22-Apr-2007 15:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | wireless.mp3 | 22-Apr-2007 15:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | wirehaired.mp3 | 22-Apr-2007 15:37 | 9.6K | |
![[SND]](/icons/sound2.gif) | wirehair.mp3 | 22-Apr-2007 15:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | wiredrawn.mp3 | 22-Apr-2007 15:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | wiredrawer.mp3 | 22-Apr-2007 15:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | wiredraw.mp3 | 22-Apr-2007 15:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | wired.mp3 | 22-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | wire.mp3 | 22-Apr-2007 15:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | wire-pulling.mp3 | 22-Apr-2007 15:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | wire-puller.mp3 | 22-Apr-2007 15:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | wiradjuri.mp3 | 22-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | wipo.mp3 | 22-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | wiper.mp3 | 22-Apr-2007 15:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | wipeout.mp3 | 22-Apr-2007 15:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | wipe.mp3 | 22-Apr-2007 15:36 | 4.5K | |
![[SND]](/icons/sound2.gif) | winze.mp3 | 22-Apr-2007 15:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | winy.mp3 | 22-Apr-2007 15:36 | 5.4K | |
![[SND]](/icons/sound2.gif) | wintun.mp3 | 22-Apr-2007 15:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | wintu.mp3 | 22-Apr-2007 15:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | wintry.mp3 | 22-Apr-2007 15:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | wintriness.mp3 | 22-Apr-2007 15:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | wintling.mp3 | 22-Apr-2007 15:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | wintle.mp3 | 22-Apr-2007 15:36 | 4.6K | |
![[SND]](/icons/sound2.gif) | wintery.mp3 | 22-Apr-2007 15:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | wintertime.mp3 | 22-Apr-2007 15:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | wintertide.mp3 | 22-Apr-2007 15:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | winters.mp3 | 22-Apr-2007 15:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | winterly.mp3 | 22-Apr-2007 15:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | winterize.mp3 | 22-Apr-2007 15:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | winterization.mp3 | 22-Apr-2007 15:36 | 11K | |
![[SND]](/icons/sound2.gif) | wintering.mp3 | 22-Apr-2007 15:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | winterim.mp3 | 22-Apr-2007 15:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | wintergreen.mp3 | 22-Apr-2007 15:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | winterer.mp3 | 22-Apr-2007 15:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | winterbourne.mp3 | 22-Apr-2007 15:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | winterberry.mp3 | 22-Apr-2007 15:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | winter.mp3 | 22-Apr-2007 15:35 | 5.2K | |
![[SND]](/icons/sound2.gif) | winter-kill.mp3 | 22-Apr-2007 15:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | winstonsalem.mp3 | 22-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | winston.mp3 | 22-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | winstanley.mp3 | 22-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | winsome.mp3 | 22-Apr-2007 15:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | winsey.mp3 | 22-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | wino.mp3 | 22-Apr-2007 15:35 | 5.7K | |
![[SND]](/icons/sound2.gif) | winny.mp3 | 22-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | winnower.mp3 | 22-Apr-2007 15:35 | 5.5K | |
![[SND]](/icons/sound2.gif) | winnow.mp3 | 22-Apr-2007 15:35 | 5.0K | |
![[SND]](/icons/sound2.gif) | winnock.mp3 | 22-Apr-2007 15:35 | 4.3K | |
![[SND]](/icons/sound2.gif) | winnipesaukee.mp3 | 22-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | winnipegosis.mp3 | 22-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | winningly.mp3 | 22-Apr-2007 15:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | winningest.mp3 | 22-Apr-2007 15:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | winning.mp3 | 22-Apr-2007 15:34 | 5.2K | |
![[SND]](/icons/sound2.gif) | winnet.mp3 | 22-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | winner.mp3 | 22-Apr-2007 15:34 | 4.6K | |
![[SND]](/icons/sound2.gif) | winnepesaukee.mp3 | 22-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | winnebago.mp3 | 22-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | winndixie.mp3 | 22-Apr-2007 15:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | winnable.mp3 | 22-Apr-2007 15:34 | 5.5K | |
![[SND]](/icons/sound2.gif) | winlestrae.mp3 | 22-Apr-2007 15:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | winless.mp3 | 22-Apr-2007 15:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | winky.mp3 | 22-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | winkling.mp3 | 22-Apr-2007 15:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | winkler.mp3 | 22-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | winkle.mp3 | 22-Apr-2007 15:34 | 5.5K | |
![[SND]](/icons/sound2.gif) | winkie.mp3 | 22-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | winker.mp3 | 22-Apr-2007 15:34 | 5.4K | |
![[SND]](/icons/sound2.gif) | winkelried.mp3 | 22-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | winkel.mp3 | 22-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | wink.mp3 | 22-Apr-2007 15:34 | 4.5K | |
![[SND]](/icons/sound2.gif) | winifredmyers.mp3 | 22-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | winifred.mp3 | 22-Apr-2007 15:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | winie.mp3 | 22-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | wingy.mp3 | 22-Apr-2007 15:34 | 5.4K | |
![[SND]](/icons/sound2.gif) | wingspread.mp3 | 22-Apr-2007 15:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | wingspan.mp3 | 22-Apr-2007 15:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | wings.mp3 | 22-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | wingover.mp3 | 22-Apr-2007 15:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | wingman.mp3 | 22-Apr-2007 15:33 | 5.9K | |
![[SND]](/icons/sound2.gif) | winglike.mp3 | 22-Apr-2007 15:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | winglet.mp3 | 22-Apr-2007 15:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | wingless.mp3 | 22-Apr-2007 15:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | winger.mp3 | 22-Apr-2007 15:33 | 5.0K | |
![[SND]](/icons/sound2.gif) | winged bean.mp3 | 22-Apr-2007 15:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | winged.mp3 | 22-Apr-2007 15:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | winge.mp3 | 22-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | wingdoodle.mp3 | 22-Apr-2007 15:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | wingding.mp3 | 22-Apr-2007 15:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | wingco.mp3 | 22-Apr-2007 15:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | wingbow.mp3 | 22-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | wingback.mp3 | 22-Apr-2007 15:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | wing.mp3 | 22-Apr-2007 15:33 | 4.8K | |
![[SND]](/icons/sound2.gif) | wing-footed.mp3 | 22-Apr-2007 15:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | winfrey.mp3 | 22-Apr-2007 15:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | winfred.mp3 | 22-Apr-2007 15:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | winfield.mp3 | 22-Apr-2007 15:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | winey.mp3 | 22-Apr-2007 15:33 | 5.4K | |
![[SND]](/icons/sound2.gif) | wineskin.mp3 | 22-Apr-2007 15:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | wineshop.mp3 | 22-Apr-2007 15:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | winesbergohio.mp3 | 22-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | winesap.mp3 | 22-Apr-2007 15:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | winery.mp3 | 22-Apr-2007 15:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | winepress.mp3 | 22-Apr-2007 15:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | winemaker.mp3 | 22-Apr-2007 15:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | winegrower.mp3 | 22-Apr-2007 15:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | wineglassful.mp3 | 22-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | wineglass.mp3 | 22-Apr-2007 15:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | winefat.mp3 | 22-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | wineberry.mp3 | 22-Apr-2007 15:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | wine.mp3 | 22-Apr-2007 15:32 | 5.5K | |
![[SND]](/icons/sound2.gif) | windz.mp3 | 22-Apr-2007 15:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | windy.mp3 | 22-Apr-2007 15:32 | 5.5K | |
![[SND]](/icons/sound2.gif) | windway.mp3 | 22-Apr-2007 15:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | windward.mp3 | 22-Apr-2007 15:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | windwanker.mp3 | 22-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | windvane.mp3 | 22-Apr-2007 15:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | windvalley.mp3 | 22-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | windup.mp3 | 22-Apr-2007 15:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | windturbine.mp3 | 22-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | windtunnel.mp3 | 22-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | windtight.mp3 | 22-Apr-2007 15:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | windthrow.mp3 | 22-Apr-2007 15:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | windtee.mp3 | 22-Apr-2007 15:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | windswift.mp3 | 22-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | windswept.mp3 | 22-Apr-2007 15:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | windsurfing.mp3 | 22-Apr-2007 15:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | windsurf.mp3 | 22-Apr-2007 15:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | windsucking.mp3 | 22-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | windsucker.mp3 | 22-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | windstorm.mp3 | 22-Apr-2007 15:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | windsprint.mp3 | 22-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | windsock.mp3 | 22-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | windship.mp3 | 22-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | windshield.mp3 | 22-Apr-2007 15:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | windshelf.mp3 | 22-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | windshear.mp3 | 22-Apr-2007 15:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | windshaken.mp3 | 22-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | windshake.mp3 | 22-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | windscreen.mp3 | 22-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | windscorpion.mp3 | 22-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | windscale.mp3 | 22-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | windsail.mp3 | 22-Apr-2007 15:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | windrower.mp3 | 22-Apr-2007 15:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | windrow.mp3 | 22-Apr-2007 15:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | windrose.mp3 | 22-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | wind rose.mp3 | 22-Apr-2007 15:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | windrode.mp3 | 22-Apr-2007 15:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | windriverrange.mp3 | 22-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | windpump.mp3 | 22-Apr-2007 15:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | windpuff.mp3 | 22-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | windproof.mp3 | 22-Apr-2007 15:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | windpower.mp3 | 22-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | windpoppy.mp3 | 22-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | windpollinated.mp3 | 22-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | windplant.mp3 | 22-Apr-2007 15:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | windpipe.mp3 | 22-Apr-2007 15:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | windowy.mp3 | 22-Apr-2007 15:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | windowsill.mp3 | 22-Apr-2007 15:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | windows.mp3 | 22-Apr-2007 15:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | windowpane.mp3 | 22-Apr-2007 15:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | windowlessmonad.mp3 | 22-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | windowless.mp3 | 22-Apr-2007 15:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | windowing.mp3 | 22-Apr-2007 15:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | windowed.mp3 | 22-Apr-2007 15:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | window.mp3 | 22-Apr-2007 15:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | window-shop.mp3 | 22-Apr-2007 15:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | window-dress.mp3 | 22-Apr-2007 15:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | windmotor.mp3 | 22-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | windmill.mp3 | 22-Apr-2007 15:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | windmeter.mp3 | 22-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | windmachine.mp3 | 22-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | windload.mp3 | 22-Apr-2007 15:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | windlestraw.mp3 | 22-Apr-2007 15:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | windless.mp3 | 22-Apr-2007 15:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | windle.mp3 | 22-Apr-2007 15:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | windlass.mp3 | 22-Apr-2007 15:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | windjamming.mp3 | 22-Apr-2007 15:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | windjammer.mp3 | 22-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | windinstrument.mp3 | 22-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | winding.mp3 | 22-Apr-2007 15:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | winding-up.mp3 | 22-Apr-2007 15:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | winding-sheet.mp3 | 22-Apr-2007 15:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | windiness.mp3 | 22-Apr-2007 15:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | windindicator.mp3 | 22-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | windily.mp3 | 22-Apr-2007 15:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | windigo.mp3 | 22-Apr-2007 15:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | windies.mp3 | 22-Apr-2007 15:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | windhover.mp3 | 22-Apr-2007 15:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | windharp.mp3 | 22-Apr-2007 15:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | windglider.mp3 | 22-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | windgenerator.mp3 | 22-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | windge.mp3 | 22-Apr-2007 15:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | windgauge.mp3 | 22-Apr-2007 15:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | windgap.mp3 | 22-Apr-2007 15:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | windgall.mp3 | 22-Apr-2007 15:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | windforce.mp3 | 22-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | windflower.mp3 | 22-Apr-2007 15:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | windflaw.mp3 | 22-Apr-2007 15:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | windfarm.mp3 | 22-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | windfall.mp3 | 22-Apr-2007 15:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | windex.mp3 | 22-Apr-2007 15:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | winderupper.mp3 | 22-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | winderosion.mp3 | 22-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | winder.mp3 | 22-Apr-2007 15:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | windenergy.mp3 | 22-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | windegg.mp3 | 22-Apr-2007 15:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | winded.mp3 | 22-Apr-2007 15:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | winddown.mp3 | 22-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | windcone.mp3 | 22-Apr-2007 15:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | windcolic.mp3 | 22-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | windchimes.mp3 | 22-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | windchillfactor.mp3 | 22-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | windchill.mp3 | 22-Apr-2007 15:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | windchest.mp3 | 22-Apr-2007 15:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | windcheater.mp3 | 22-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | windcavenationalpark.mp3 | 22-Apr-2007 15:27 | 18K | |
![[SND]](/icons/sound2.gif) | windburned.mp3 | 22-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | windburn.mp3 | 22-Apr-2007 15:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | windbroken.mp3 | 22-Apr-2007 15:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | windbreak.mp3 | 22-Apr-2007 15:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | windbox.mp3 | 22-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | windbound.mp3 | 22-Apr-2007 15:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | windborne.mp3 | 22-Apr-2007 15:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | windblown.mp3 | 22-Apr-2007 15:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | windblast.mp3 | 22-Apr-2007 15:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | windbell.mp3 | 22-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | windband.mp3 | 22-Apr-2007 15:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | windbag.mp3 | 22-Apr-2007 15:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | windage.mp3 | 22-Apr-2007 15:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | windable.mp3 | 22-Apr-2007 15:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | wind.mp3 | 22-Apr-2007 15:27 | 5.2K | |
![[SND]](/icons/sound2.gif) | wind-pollinated.mp3 | 22-Apr-2007 15:30 | 13K | |
![[SND]](/icons/sound2.gif) | wind-broken.mp3 | 22-Apr-2007 15:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | wind-borne.mp3 | 22-Apr-2007 15:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | wind-bell.mp3 | 22-Apr-2007 15:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | winco.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | winchman.mp3 | 22-Apr-2007 15:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | winchell.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | winch.mp3 | 22-Apr-2007 15:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | winceyette.mp3 | 22-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | wincey.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | wince.mp3 | 22-Apr-2007 15:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | win.mp3 | 22-Apr-2007 15:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | wimyn.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | wimshurstmachine.mp3 | 22-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | wimsey.mp3 | 22-Apr-2007 15:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | wimpy.mp3 | 22-Apr-2007 15:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | wimpling.mp3 | 22-Apr-2007 15:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | wimple.mp3 | 22-Apr-2007 15:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | wimpishness.mp3 | 22-Apr-2007 15:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | wimpish.mp3 | 22-Apr-2007 15:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | wimpiness.mp3 | 22-Apr-2007 15:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | wimp.mp3 | 22-Apr-2007 15:26 | 4.3K | |
![[SND]](/icons/sound2.gif) | wimmin.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | wimby.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | wimbrel.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | wimbling.mp3 | 22-Apr-2007 15:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | wimble.mp3 | 22-Apr-2007 15:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | wily.mp3 | 22-Apr-2007 15:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | wilt.mp3 | 22-Apr-2007 15:25 | 4.8K | |
![[SND]](/icons/sound2.gif) | wilsonism.mp3 | 22-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | wilno.mp3 | 22-Apr-2007 15:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | wilmstumor.mp3 | 22-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | wilmot.mp3 | 22-Apr-2007 15:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | wilmer.mp3 | 22-Apr-2007 15:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | wilma.mp3 | 22-Apr-2007 15:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | willywilly.mp3 | 22-Apr-2007 15:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | willywacks.mp3 | 22-Apr-2007 15:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | willynilly.mp3 | 22-Apr-2007 15:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | willyloman.mp3 | 22-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | willyard.mp3 | 22-Apr-2007 15:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | willy.mp3 | 22-Apr-2007 15:25 | 5.5K | |
![[SND]](/icons/sound2.gif) | willy-nilly.mp3 | 22-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | wills.mp3 | 22-Apr-2007 15:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | willpower.mp3 | 22-Apr-2007 15:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | willowy.mp3 | 22-Apr-2007 15:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | willowware.mp3 | 22-Apr-2007 15:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | willowwacks.mp3 | 22-Apr-2007 15:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | willowlike.mp3 | 22-Apr-2007 15:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | willower.mp3 | 22-Apr-2007 15:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | willow.mp3 | 22-Apr-2007 15:24 | 5.5K | |
![[SND]](/icons/sound2.gif) | willoughbypatterne.mp3 | 22-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | willothewisp.mp3 | 22-Apr-2007 15:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | willless.mp3 | 22-Apr-2007 15:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | williwaw.mp3 | 22-Apr-2007 15:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | willingly.mp3 | 22-Apr-2007 15:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | willingdon.mp3 | 22-Apr-2007 15:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | willing.mp3 | 22-Apr-2007 15:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | williewaught.mp3 | 22-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | williewagtail.mp3 | 22-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | willies.mp3 | 22-Apr-2007 15:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | williefudd.mp3 | 22-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | willie.mp3 | 22-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | williamson.mp3 | 22-Apr-2007 15:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | williams.mp3 | 22-Apr-2007 15:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | williamofmalmesbury.mp3 | 22-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | willfully.mp3 | 22-Apr-2007 15:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | willful.mp3 | 22-Apr-2007 15:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | willey.mp3 | 22-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | willet.mp3 | 22-Apr-2007 15:23 | 4.6K | |
![[SND]](/icons/sound2.gif) | willendorf.mp3 | 22-Apr-2007 15:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | willemite.mp3 | 22-Apr-2007 15:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | willemi.mp3 | 22-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | willed.mp3 | 22-Apr-2007 15:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | willaert.mp3 | 22-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | willable.mp3 | 22-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | willa.mp3 | 22-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | will.mp3 | 22-Apr-2007 15:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | will-o'-the-wisp.mp3 | 22-Apr-2007 15:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | will-less.mp3 | 22-Apr-2007 15:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | wilkiebard.mp3 | 22-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | wilkesbarre.mp3 | 22-Apr-2007 15:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | wiliness.mp3 | 22-Apr-2007 15:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | wilily.mp3 | 22-Apr-2007 15:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | wilhelmstrasse.mp3 | 22-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | wilhelmine.mp3 | 22-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | wilhelm.mp3 | 22-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wilga.mp3 | 22-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wilful.mp3 | 22-Apr-2007 15:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | wilfred.mp3 | 22-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wilf.mp3 | 22-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wile.mp3 | 22-Apr-2007 15:21 | 6.1K | |
![[SND]](/icons/sound2.gif) | wildwood.mp3 | 22-Apr-2007 15:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | wildsmith.mp3 | 22-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | wildness.mp3 | 22-Apr-2007 15:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | wildly.mp3 | 22-Apr-2007 15:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | wildling.mp3 | 22-Apr-2007 15:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | wildlife.mp3 | 22-Apr-2007 15:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | wildland.mp3 | 22-Apr-2007 15:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | wildish.mp3 | 22-Apr-2007 15:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | wilding.mp3 | 22-Apr-2007 15:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | wildfowling.mp3 | 22-Apr-2007 15:21 | 9.8K | |
![[SND]](/icons/sound2.gif) | wildfowler.mp3 | 22-Apr-2007 15:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | wildfowl.mp3 | 22-Apr-2007 15:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | wildflower.mp3 | 22-Apr-2007 15:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | wildfire.mp3 | 22-Apr-2007 15:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | wilderness.mp3 | 22-Apr-2007 15:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | wilderment.mp3 | 22-Apr-2007 15:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | wilder.mp3 | 22-Apr-2007 15:21 | 6.1K | |
![[SND]](/icons/sound2.gif) | wildebeest.mp3 | 22-Apr-2007 15:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | wildcatter.mp3 | 22-Apr-2007 15:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | wildcat.mp3 | 22-Apr-2007 15:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | wild.mp3 | 22-Apr-2007 15:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | wild-eyed.mp3 | 22-Apr-2007 15:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | wilcox.mp3 | 22-Apr-2007 15:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | wilco.mp3 | 22-Apr-2007 15:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | wilburite.mp3 | 22-Apr-2007 15:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | wilbert.mp3 | 22-Apr-2007 15:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | wilander.mp3 | 22-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | wikkid.mp3 | 22-Apr-2007 15:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | wikiwiki.mp3 | 22-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | wikiup.mp3 | 22-Apr-2007 15:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | wigwam.mp3 | 22-Apr-2007 15:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | wigwag.mp3 | 22-Apr-2007 15:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | wigmorehall.mp3 | 22-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | wigman.mp3 | 22-Apr-2007 15:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | wiglet.mp3 | 22-Apr-2007 15:20 | 5.5K | |
![[SND]](/icons/sound2.gif) | wightmancup.mp3 | 22-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | wight.mp3 | 22-Apr-2007 15:20 | 4.6K | |
![[SND]](/icons/sound2.gif) | wiggy.mp3 | 22-Apr-2007 15:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | wiggly.mp3 | 22-Apr-2007 15:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | wiggling.mp3 | 22-Apr-2007 15:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | wigglesworth.mp3 | 22-Apr-2007 15:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | wiggler.mp3 | 22-Apr-2007 15:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | wiggle.mp3 | 22-Apr-2007 15:19 | 4.8K | |
![[SND]](/icons/sound2.gif) | wigging.mp3 | 22-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wiggery.mp3 | 22-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wigged.mp3 | 22-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wigged-out.mp3 | 22-Apr-2007 15:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | wigeon.mp3 | 22-Apr-2007 15:19 | 5.7K | |
![[SND]](/icons/sound2.gif) | wigan.mp3 | 22-Apr-2007 15:19 | 5.2K | |
![[SND]](/icons/sound2.gif) | wig.mp3 | 22-Apr-2007 15:19 | 4.8K | |
![[SND]](/icons/sound2.gif) | wifty.mp3 | 22-Apr-2007 15:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | wifie.mp3 | 22-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wiffleball.mp3 | 22-Apr-2007 15:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | wiff.mp3 | 22-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wifey.mp3 | 22-Apr-2007 15:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | wifely.mp3 | 22-Apr-2007 15:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | wifeliness.mp3 | 22-Apr-2007 15:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | wifelike.mp3 | 22-Apr-2007 15:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | wifeless.mp3 | 22-Apr-2007 15:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | wifehood.mp3 | 22-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wife.mp3 | 22-Apr-2007 15:19 | 5.0K | |
![[SND]](/icons/sound2.gif) | wiesenthal.mp3 | 22-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | wienie.mp3 | 22-Apr-2007 15:18 | 5.0K | |
![[SND]](/icons/sound2.gif) | wienerwurst.mp3 | 22-Apr-2007 15:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | wienerschnitzel.mp3 | 22-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | wienersangerknaben.mp3 | 22-Apr-2007 15:18 | 27K | |
![[SND]](/icons/sound2.gif) | wienerneustadt.mp3 | 22-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | wiener.mp3 | 22-Apr-2007 15:18 | 5.2K | |
![[SND]](/icons/sound2.gif) | wieldy.mp3 | 22-Apr-2007 15:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | wield.mp3 | 22-Apr-2007 15:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | wiegenlied.mp3 | 22-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | wiegehts.mp3 | 22-Apr-2007 15:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | width.mp3 | 22-Apr-2007 15:18 | 3.2K | |
![[SND]](/icons/sound2.gif) | widsith.mp3 | 22-Apr-2007 15:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | widowhood.mp3 | 22-Apr-2007 15:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | widowerhood.mp3 | 22-Apr-2007 15:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | widower.mp3 | 22-Apr-2007 15:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | widowbird.mp3 | 22-Apr-2007 15:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | widow.mp3 | 22-Apr-2007 15:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | widnes.mp3 | 22-Apr-2007 15:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | widmark.mp3 | 22-Apr-2007 15:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | widish.mp3 | 22-Apr-2007 15:17 | 6.4K | |
![[SND]](/icons/sound2.gif) | widgie.mp3 | 22-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | widget.mp3 | 22-Apr-2007 15:17 | 5.4K | |
![[SND]](/icons/sound2.gif) | widgeon.mp3 | 22-Apr-2007 15:17 | 5.7K | |
![[SND]](/icons/sound2.gif) | widespread.mp3 | 22-Apr-2007 15:17 | 10K | |
![[SND]](/icons/sound2.gif) | wideout.mp3 | 22-Apr-2007 15:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | widening.mp3 | 22-Apr-2007 15:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | widener.mp3 | 22-Apr-2007 15:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | widen.mp3 | 22-Apr-2007 15:17 | 6.4K | |
![[SND]](/icons/sound2.gif) | widemouthed.mp3 | 22-Apr-2007 15:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | widely.mp3 | 22-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | wideband.mp3 | 22-Apr-2007 15:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | wideawake.mp3 | 22-Apr-2007 15:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | wide.mp3 | 22-Apr-2007 15:17 | 5.9K | |
![[SND]](/icons/sound2.gif) | wide-spreading.mp3 | 22-Apr-2007 15:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | wide-ranging.mp3 | 22-Apr-2007 15:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | wide-open.mp3 | 22-Apr-2007 15:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | wide-eyed.mp3 | 22-Apr-2007 15:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | wide-body.mp3 | 22-Apr-2007 15:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | wide-angle.mp3 | 22-Apr-2007 15:17 | 10K | |
![[SND]](/icons/sound2.gif) | widdy.mp3 | 22-Apr-2007 15:17 | 4.3K | |
![[SND]](/icons/sound2.gif) | widdle.mp3 | 22-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | widdershins.mp3 | 22-Apr-2007 15:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | widder.mp3 | 22-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | wicopy.mp3 | 22-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | wickthing.mp3 | 22-Apr-2007 15:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | wickliffe.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | wickiup.mp3 | 22-Apr-2007 15:16 | 5.4K | |
![[SND]](/icons/sound2.gif) | wicking.mp3 | 22-Apr-2007 15:16 | 5.4K | |
![[SND]](/icons/sound2.gif) | wicketkeeper.mp3 | 22-Apr-2007 15:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | wicket.mp3 | 22-Apr-2007 15:16 | 4.8K | |
![[SND]](/icons/sound2.gif) | wickerwork.mp3 | 22-Apr-2007 15:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | wicker.mp3 | 22-Apr-2007 15:16 | 4.8K | |
![[SND]](/icons/sound2.gif) | wickedness.mp3 | 22-Apr-2007 15:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | wicked.mp3 | 22-Apr-2007 15:16 | 5.0K | |
![[SND]](/icons/sound2.gif) | wickape.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | wick.mp3 | 22-Apr-2007 15:16 | 3.9K | |
![[SND]](/icons/sound2.gif) | wibblywobbly.mp3 | 22-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | wiak.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | whyteandmackay.mp3 | 22-Apr-2007 15:16 | 27K | |
![[SND]](/icons/sound2.gif) | whys.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | whyre.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | whymper.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | whyll.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | whyever.mp3 | 22-Apr-2007 15:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | whydunit.mp3 | 22-Apr-2007 15:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | whydah.mp3 | 22-Apr-2007 15:16 | 3.9K | |
![[SND]](/icons/sound2.gif) | whyalla.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | why.mp3 | 22-Apr-2007 15:16 | 5.5K | |
![[SND]](/icons/sound2.gif) | whup.mp3 | 22-Apr-2007 15:15 | 5.0K | |
![[SND]](/icons/sound2.gif) | whump.mp3 | 22-Apr-2007 15:15 | 3.8K | |
![[SND]](/icons/sound2.gif) | whowho.mp3 | 22-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | whove.mp3 | 22-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | whosoever.mp3 | 22-Apr-2007 15:15 | 11K | |
![[SND]](/icons/sound2.gif) | whosoeer.mp3 | 22-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | whoso.mp3 | 22-Apr-2007 15:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | whosit.mp3 | 22-Apr-2007 15:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | whosis.mp3 | 22-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | whosever.mp3 | 22-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | whosesoever.mp3 | 22-Apr-2007 15:15 | 11K | |
![[SND]](/icons/sound2.gif) | whose.mp3 | 22-Apr-2007 15:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | whos.mp3 | 22-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | whortleberry.mp3 | 22-Apr-2007 15:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | whort.mp3 | 22-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | whorled.mp3 | 22-Apr-2007 15:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | whorl.mp3 | 22-Apr-2007 15:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | whorish.mp3 | 22-Apr-2007 15:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | whorfianhypothesis.mp3 | 22-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | whorf.mp3 | 22-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | whoreson.mp3 | 22-Apr-2007 15:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | whorepuni.mp3 | 22-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | whoremonger.mp3 | 22-Apr-2007 15:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | whoremaster.mp3 | 22-Apr-2007 15:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | whorehouse.mp3 | 22-Apr-2007 15:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | whoredom.mp3 | 22-Apr-2007 15:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | whore.mp3 | 22-Apr-2007 15:14 | 5.2K | |
![[SND]](/icons/sound2.gif) | whopsy.mp3 | 22-Apr-2007 15:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | whopping.mp3 | 22-Apr-2007 15:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | whopper.mp3 | 22-Apr-2007 15:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | whop.mp3 | 22-Apr-2007 15:14 | 2.9K | |
![[SND]](/icons/sound2.gif) | whoozit.mp3 | 22-Apr-2007 15:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | whoosy.mp3 | 22-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | whoosis.mp3 | 22-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | whooshed.mp3 | 22-Apr-2007 15:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | whoosh.mp3 | 22-Apr-2007 15:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | whoopsy.mp3 | 22-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | whoops.mp3 | 22-Apr-2007 15:14 | 5.4K | |
![[SND]](/icons/sound2.gif) | whoopla.mp3 | 22-Apr-2007 15:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | whoopingcough.mp3 | 22-Apr-2007 15:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | whooperdooper.mp3 | 22-Apr-2007 15:14 | 17K | |
![[SND]](/icons/sound2.gif) | whooper.mp3 | 22-Apr-2007 15:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | whoopee.mp3 | 22-Apr-2007 15:14 | 5.4K | |
![[SND]](/icons/sound2.gif) | whoopdedo.mp3 | 22-Apr-2007 15:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | whoop.mp3 | 22-Apr-2007 15:14 | 3.8K | |
![[SND]](/icons/sound2.gif) | whoop-de-doo.mp3 | 22-Apr-2007 15:14 | 12K | |
![[SND]](/icons/sound2.gif) | whoop-de-do.mp3 | 22-Apr-2007 15:14 | 12K | |
![[SND]](/icons/sound2.gif) | whoomp.mp3 | 22-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | whoof.mp3 | 22-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | whoo.mp3 | 22-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | whomsoever.mp3 | 22-Apr-2007 15:14 | 9.5K | |
![[SND]](/icons/sound2.gif) | whomso.mp3 | 22-Apr-2007 15:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | whomp.mp3 | 22-Apr-2007 15:13 | 4.1K | |
![[SND]](/icons/sound2.gif) | whomever.mp3 | 22-Apr-2007 15:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | whom.mp3 | 22-Apr-2007 15:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | wholly.mp3 | 22-Apr-2007 15:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | wholl.mp3 | 22-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | wholism.mp3 | 22-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | wholesome.mp3 | 22-Apr-2007 15:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | wholesaler.mp3 | 22-Apr-2007 15:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | wholesale.mp3 | 22-Apr-2007 15:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | wholemeal.mp3 | 22-Apr-2007 15:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | wholely.mp3 | 22-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | wholehearted.mp3 | 22-Apr-2007 15:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | wholefamndamily.mp3 | 22-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | whole.mp3 | 22-Apr-2007 15:13 | 5.4K | |
![[SND]](/icons/sound2.gif) | whole-souled.mp3 | 22-Apr-2007 15:13 | 11K | |
![[SND]](/icons/sound2.gif) | whole-life.mp3 | 22-Apr-2007 15:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | whoever.mp3 | 22-Apr-2007 15:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | whoeer.mp3 | 22-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | whodunnit.mp3 | 22-Apr-2007 15:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | whodunit.mp3 | 22-Apr-2007 15:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | whod.mp3 | 22-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | whoa.mp3 | 22-Apr-2007 15:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | who.mp3 | 22-Apr-2007 15:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | who's who.mp3 | 22-Apr-2007 15:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | who'd.mp3 | 22-Apr-2007 15:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | whizzy.mp3 | 22-Apr-2007 15:13 | 5.7K | |
![[SND]](/icons/sound2.gif) | whizzo.mp3 | 22-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | whizzer.mp3 | 22-Apr-2007 15:13 | 5.2K | |
![[SND]](/icons/sound2.gif) | whizzbang.mp3 | 22-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | whizz.mp3 | 22-Apr-2007 15:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | whizbang.mp3 | 22-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | whiz.mp3 | 22-Apr-2007 15:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | whity.mp3 | 22-Apr-2007 15:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | whitworth.mp3 | 22-Apr-2007 15:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitweek.mp3 | 22-Apr-2007 15:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | whittuesday.mp3 | 22-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | whittret.mp3 | 22-Apr-2007 15:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | whittling.mp3 | 22-Apr-2007 15:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | whittler.mp3 | 22-Apr-2007 15:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | whittled.mp3 | 22-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | whittle.mp3 | 22-Apr-2007 15:12 | 5.2K | |
![[SND]](/icons/sound2.gif) | whittington.mp3 | 22-Apr-2007 15:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitter.mp3 | 22-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | whitrack.mp3 | 22-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | whitlow.mp3 | 22-Apr-2007 15:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | whitleybay.mp3 | 22-Apr-2007 15:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | whitleather.mp3 | 22-Apr-2007 15:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | whitlam.mp3 | 22-Apr-2007 15:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | whitish.mp3 | 22-Apr-2007 15:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | whiting.mp3 | 22-Apr-2007 15:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | whitherward.mp3 | 22-Apr-2007 15:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | whithersoever.mp3 | 22-Apr-2007 15:11 | 11K | |
![[SND]](/icons/sound2.gif) | whither.mp3 | 22-Apr-2007 15:11 | 4.8K | |
![[SND]](/icons/sound2.gif) | whitey.mp3 | 22-Apr-2007 15:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | whitewood.mp3 | 22-Apr-2007 15:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | whitewing.mp3 | 22-Apr-2007 15:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | whitewashing.mp3 | 22-Apr-2007 15:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | whitewash.mp3 | 22-Apr-2007 15:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitewall.mp3 | 22-Apr-2007 15:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | whitethroat.mp3 | 22-Apr-2007 15:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitetail.mp3 | 22-Apr-2007 15:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | whitesmith.mp3 | 22-Apr-2007 15:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | white slaver.mp3 | 22-Apr-2007 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | whiteseabass.mp3 | 22-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | whiteout.mp3 | 22-Apr-2007 15:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | whitening.mp3 | 22-Apr-2007 15:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | whiteness.mp3 | 22-Apr-2007 15:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | whitener.mp3 | 22-Apr-2007 15:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | whiten.mp3 | 22-Apr-2007 15:10 | 5.9K | |
![[SND]](/icons/sound2.gif) | whiteman.mp3 | 22-Apr-2007 15:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitely.mp3 | 22-Apr-2007 15:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | white list.mp3 | 22-Apr-2007 15:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | whitelead.mp3 | 22-Apr-2007 15:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | whitelaw.mp3 | 22-Apr-2007 15:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | whitehead.mp3 | 22-Apr-2007 15:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | whitefly.mp3 | 22-Apr-2007 15:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitefish.mp3 | 22-Apr-2007 15:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | whiteface.mp3 | 22-Apr-2007 15:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | whited.mp3 | 22-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | whitecap.mp3 | 22-Apr-2007 15:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | whiteboys.mp3 | 22-Apr-2007 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | whiteboard.mp3 | 22-Apr-2007 15:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitebeard.mp3 | 22-Apr-2007 15:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | whitebass.mp3 | 22-Apr-2007 15:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | whitebait.mp3 | 22-Apr-2007 15:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | white amur.mp3 | 22-Apr-2007 15:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | white.mp3 | 22-Apr-2007 15:09 | 4.5K | |
![[SND]](/icons/sound2.gif) | white-throated sparrow.mp3 | 22-Apr-2007 15:11 | 16K | |
![[SND]](/icons/sound2.gif) | white-tailed deer.mp3 | 22-Apr-2007 15:11 | 13K | |
![[SND]](/icons/sound2.gif) | white-shoe.mp3 | 22-Apr-2007 15:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | white-livered.mp3 | 22-Apr-2007 15:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | white-listed.mp3 | 22-Apr-2007 15:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | white-knuckled.mp3 | 22-Apr-2007 15:10 | 10K | |
![[SND]](/icons/sound2.gif) | white-knuckle.mp3 | 22-Apr-2007 15:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | white-hot.mp3 | 22-Apr-2007 15:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | white-headed.mp3 | 22-Apr-2007 15:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | white-glove.mp3 | 22-Apr-2007 15:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | white-footed mouse.mp3 | 22-Apr-2007 15:10 | 14K | |
![[SND]](/icons/sound2.gif) | white-faced.mp3 | 22-Apr-2007 15:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | white-crowned sparrow.mp3 | 22-Apr-2007 15:10 | 15K | |
![[SND]](/icons/sound2.gif) | white-collar.mp3 | 22-Apr-2007 15:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | white-bread.mp3 | 22-Apr-2007 15:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | whitbread.mp3 | 22-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | whitakersalmanack.mp3 | 22-Apr-2007 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | whitaker.mp3 | 22-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | whit.mp3 | 22-Apr-2007 15:09 | 4.3K | |
![[SND]](/icons/sound2.gif) | whistling.mp3 | 22-Apr-2007 15:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | whistler.mp3 | 22-Apr-2007 15:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | whistled.mp3 | 22-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | whistleable.mp3 | 22-Apr-2007 15:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | whistle.mp3 | 22-Apr-2007 15:09 | 5.2K | |
![[SND]](/icons/sound2.gif) | whistle-stop.mp3 | 22-Apr-2007 15:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | whistle-blowing.mp3 | 22-Apr-2007 15:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | whistle-blower.mp3 | 22-Apr-2007 15:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | whist.mp3 | 22-Apr-2007 15:08 | 5.2K | |
![[SND]](/icons/sound2.gif) | whispery.mp3 | 22-Apr-2007 15:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | whisperous.mp3 | 22-Apr-2007 15:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | whisperingly.mp3 | 22-Apr-2007 15:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | whispering.mp3 | 22-Apr-2007 15:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | whisperer.mp3 | 22-Apr-2007 15:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | whispered.mp3 | 22-Apr-2007 15:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | whisper.mp3 | 22-Apr-2007 15:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | whisp.mp3 | 22-Apr-2007 15:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | whisky.mp3 | 22-Apr-2007 15:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | whiskeyfied.mp3 | 22-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | whiskey.mp3 | 22-Apr-2007 15:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | whiskery.mp3 | 22-Apr-2007 15:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | whiskered.mp3 | 22-Apr-2007 15:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | whisker.mp3 | 22-Apr-2007 15:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | whisk.mp3 | 22-Apr-2007 15:08 | 5.2K | |
![[SND]](/icons/sound2.gif) | whisht.mp3 | 22-Apr-2007 15:08 | 5.2K | |
![[SND]](/icons/sound2.gif) | whish.mp3 | 22-Apr-2007 15:08 | 5.2K | |
![[SND]](/icons/sound2.gif) | whirry.mp3 | 22-Apr-2007 15:08 | 5.7K | |
![[SND]](/icons/sound2.gif) | whirr.mp3 | 22-Apr-2007 15:08 | 5.2K | |
![[SND]](/icons/sound2.gif) | whirlybird.mp3 | 22-Apr-2007 15:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | whirly.mp3 | 22-Apr-2007 15:08 | 5.7K | |
![[SND]](/icons/sound2.gif) | whirlwind.mp3 | 22-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | whirlpool.mp3 | 22-Apr-2007 15:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | whirling disease.mp3 | 22-Apr-2007 15:08 | 13K | |
![[SND]](/icons/sound2.gif) | whirligig.mp3 | 22-Apr-2007 15:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | whirleybird.mp3 | 22-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | whirler.mp3 | 22-Apr-2007 15:07 | 5.7K | |
![[SND]](/icons/sound2.gif) | whirl.mp3 | 22-Apr-2007 15:07 | 5.0K | |
![[SND]](/icons/sound2.gif) | whir.mp3 | 22-Apr-2007 15:07 | 5.2K | |
![[SND]](/icons/sound2.gif) | whipworm.mp3 | 22-Apr-2007 15:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | whiptail.mp3 | 22-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | whipstock.mp3 | 22-Apr-2007 15:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | whipstitch.mp3 | 22-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | whipster.mp3 | 22-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | whipsnade.mp3 | 22-Apr-2007 15:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | whipsawed.mp3 | 22-Apr-2007 15:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | whipsaw.mp3 | 22-Apr-2007 15:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | whipray.mp3 | 22-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | whippy.mp3 | 22-Apr-2007 15:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | whippoorwill.mp3 | 22-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | whippletree.mp3 | 22-Apr-2007 15:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | whipping.mp3 | 22-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | whippet.mp3 | 22-Apr-2007 15:07 | 5.0K | |
![[SND]](/icons/sound2.gif) | whippersnapper.mp3 | 22-Apr-2007 15:07 | 9.6K | |
![[SND]](/icons/sound2.gif) | whippers-in.mp3 | 22-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | whipper-in.mp3 | 22-Apr-2007 15:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | whipped.mp3 | 22-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | whiplike.mp3 | 22-Apr-2007 15:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | whiplash.mp3 | 22-Apr-2007 15:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | whipcord.mp3 | 22-Apr-2007 15:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | whip.mp3 | 22-Apr-2007 15:06 | 4.3K | |
![[SND]](/icons/sound2.gif) | whip-round.mp3 | 22-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | whip-poor-will.mp3 | 22-Apr-2007 15:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | whiny.mp3 | 22-Apr-2007 15:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | whinstone.mp3 | 22-Apr-2007 15:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | whinny.mp3 | 22-Apr-2007 15:06 | 4.5K | |
![[SND]](/icons/sound2.gif) | whiningly.mp3 | 22-Apr-2007 15:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | whings.mp3 | 22-Apr-2007 15:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | whinger.mp3 | 22-Apr-2007 15:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | whinge.mp3 | 22-Apr-2007 15:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | whingding.mp3 | 22-Apr-2007 15:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | whing-ding.mp3 | 22-Apr-2007 15:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | whiney.mp3 | 22-Apr-2007 15:06 | 10K | |
![[SND]](/icons/sound2.gif) | whine.mp3 | 22-Apr-2007 15:06 | 5.5K | |
![[SND]](/icons/sound2.gif) | whinchat.mp3 | 22-Apr-2007 15:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | whin.mp3 | 22-Apr-2007 15:06 | 4.8K | |
![[SND]](/icons/sound2.gif) | whimwham.mp3 | 22-Apr-2007 15:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | whimsy.mp3 | 22-Apr-2007 15:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | whimsicalness.mp3 | 22-Apr-2007 15:06 | 10K | |
![[SND]](/icons/sound2.gif) | whimsically.mp3 | 22-Apr-2007 15:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | whimsicality.mp3 | 22-Apr-2007 15:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | whimsical.mp3 | 22-Apr-2007 15:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | whimsey.mp3 | 22-Apr-2007 15:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | whimpering.mp3 | 22-Apr-2007 15:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | whimper.mp3 | 22-Apr-2007 15:06 | 5.5K | |
![[SND]](/icons/sound2.gif) | whimp.mp3 | 22-Apr-2007 15:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | whimbrel.mp3 | 22-Apr-2007 15:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | whim.mp3 | 22-Apr-2007 15:06 | 5.0K | |
![[SND]](/icons/sound2.gif) | whim-wham.mp3 | 22-Apr-2007 15:06 | 6.6K | |
![[SND]](/icons/sound2.gif) | whilst.mp3 | 22-Apr-2007 15:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | whilom.mp3 | 22-Apr-2007 15:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | whillikers.mp3 | 22-Apr-2007 15:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | whilk.mp3 | 22-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | whiles.mp3 | 22-Apr-2007 15:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | while.mp3 | 22-Apr-2007 15:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | whigmaleerie.mp3 | 22-Apr-2007 15:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | whiffy.mp3 | 22-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | whifflow.mp3 | 22-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | whiffling.mp3 | 22-Apr-2007 15:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | whiffletree.mp3 | 22-Apr-2007 15:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | whiffler.mp3 | 22-Apr-2007 15:05 | 4.8K | |
![[SND]](/icons/sound2.gif) | whiffled.mp3 | 22-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | whiffle.mp3 | 22-Apr-2007 15:05 | 5.0K | |
![[SND]](/icons/sound2.gif) | whiffet.mp3 | 22-Apr-2007 15:05 | 4.3K | |
![[SND]](/icons/sound2.gif) | whiffer.mp3 | 22-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | whiff.mp3 | 22-Apr-2007 15:05 | 4.5K | |
![[SND]](/icons/sound2.gif) | whieldonware.mp3 | 22-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | whidah.mp3 | 22-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | whid.mp3 | 22-Apr-2007 15:05 | 5.5K | |
![[SND]](/icons/sound2.gif) | whickering.mp3 | 22-Apr-2007 15:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | whicker.mp3 | 22-Apr-2007 15:05 | 4.8K | |
![[SND]](/icons/sound2.gif) | whichsoever.mp3 | 22-Apr-2007 15:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | whichever.mp3 | 22-Apr-2007 15:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | which.mp3 | 22-Apr-2007 15:04 | 5.4K | |
![[SND]](/icons/sound2.gif) | wheylike.mp3 | 22-Apr-2007 15:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | wheyish.mp3 | 22-Apr-2007 15:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | wheyey.mp3 | 22-Apr-2007 15:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | whey.mp3 | 22-Apr-2007 15:04 | 5.4K | |
![[SND]](/icons/sound2.gif) | whey-faced.mp3 | 22-Apr-2007 15:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | whey-face.mp3 | 22-Apr-2007 15:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | whewellite.mp3 | 22-Apr-2007 15:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | whew.mp3 | 22-Apr-2007 15:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | whetstone.mp3 | 22-Apr-2007 15:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | whether.mp3 | 22-Apr-2007 15:04 | 5.2K | |
![[SND]](/icons/sound2.gif) | whet.mp3 | 22-Apr-2007 15:04 | 4.1K | |
![[SND]](/icons/sound2.gif) | wherryman.mp3 | 22-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | wherry.mp3 | 22-Apr-2007 15:04 | 5.4K | |
![[SND]](/icons/sound2.gif) | wherret.mp3 | 22-Apr-2007 15:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | wherewithal.mp3 | 22-Apr-2007 15:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | wherewith.mp3 | 22-Apr-2007 15:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | wherever.mp3 | 22-Apr-2007 15:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | whereve.mp3 | 22-Apr-2007 15:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | whereupon.mp3 | 22-Apr-2007 15:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | whereunto.mp3 | 22-Apr-2007 15:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | whereto.mp3 | 22-Apr-2007 15:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | wherethrough.mp3 | 22-Apr-2007 15:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | wheresoever.mp3 | 22-Apr-2007 15:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | wheresoeer.mp3 | 22-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | wheres.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | wherere.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whereon.mp3 | 22-Apr-2007 15:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | whereof.mp3 | 22-Apr-2007 15:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | wherell.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whereinto.mp3 | 22-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | whereinsoever.mp3 | 22-Apr-2007 15:03 | 17K | |
![[SND]](/icons/sound2.gif) | wherein.mp3 | 22-Apr-2007 15:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | wherefrom.mp3 | 22-Apr-2007 15:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | wherefore.mp3 | 22-Apr-2007 15:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | whereer.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whered.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whereby.mp3 | 22-Apr-2007 15:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | whereat.mp3 | 22-Apr-2007 15:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | whereas.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whereabouts.mp3 | 22-Apr-2007 15:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | whereabout.mp3 | 22-Apr-2007 15:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | where.mp3 | 22-Apr-2007 15:03 | 5.2K | |
![[SND]](/icons/sound2.gif) | whenve.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whenua.mp3 | 22-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | whensoever.mp3 | 22-Apr-2007 15:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | whens.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whenre.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whenll.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | wheneye.mp3 | 22-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | whenever.mp3 | 22-Apr-2007 15:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | wheneer.mp3 | 22-Apr-2007 15:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | whend.mp3 | 22-Apr-2007 15:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | whenchy.mp3 | 22-Apr-2007 15:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | whencesoever.mp3 | 22-Apr-2007 15:02 | 10K | |
![[SND]](/icons/sound2.gif) | whence.mp3 | 22-Apr-2007 15:02 | 5.7K | |
![[SND]](/icons/sound2.gif) | whenas.mp3 | 22-Apr-2007 15:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | when.mp3 | 22-Apr-2007 15:02 | 5.5K | |
![[SND]](/icons/sound2.gif) | whelp.mp3 | 22-Apr-2007 15:02 | 4.8K | |
![[SND]](/icons/sound2.gif) | whelm.mp3 | 22-Apr-2007 15:02 | 5.0K | |
![[SND]](/icons/sound2.gif) | whelked.mp3 | 22-Apr-2007 15:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | whelk.mp3 | 22-Apr-2007 15:02 | 5.0K | |
![[SND]](/icons/sound2.gif) | wheezy.mp3 | 22-Apr-2007 15:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | wheeziness.mp3 | 22-Apr-2007 15:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | wheezily.mp3 | 22-Apr-2007 15:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | wheeze.mp3 | 22-Apr-2007 15:02 | 5.7K | |
![[SND]](/icons/sound2.gif) | wheesht.mp3 | 22-Apr-2007 15:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | wheen.mp3 | 22-Apr-2007 15:02 | 5.2K | |
![[SND]](/icons/sound2.gif) | wheely.mp3 | 22-Apr-2007 15:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | wheelwright.mp3 | 22-Apr-2007 15:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | wheelwork.mp3 | 22-Apr-2007 15:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | wheelsman.mp3 | 22-Apr-2007 15:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | wheelman.mp3 | 22-Apr-2007 15:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | wheelless.mp3 | 22-Apr-2007 15:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | wheeling.mp3 | 22-Apr-2007 15:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | wheelie.mp3 | 22-Apr-2007 15:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | wheelhouse.mp3 | 22-Apr-2007 15:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | wheelhorse.mp3 | 22-Apr-2007 15:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | wheeler.mp3 | 22-Apr-2007 15:01 | 5.5K | |
![[SND]](/icons/sound2.gif) | wheeler-dealer.mp3 | 22-Apr-2007 15:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | wheeled.mp3 | 22-Apr-2007 15:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | wheelchair.mp3 | 22-Apr-2007 15:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | wheelbase.mp3 | 22-Apr-2007 15:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | wheelbarrow.mp3 | 22-Apr-2007 15:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | wheel.mp3 | 22-Apr-2007 15:01 | 5.2K | |
![[SND]](/icons/sound2.gif) | wheel-thrown.mp3 | 22-Apr-2007 15:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | wheedling.mp3 | 22-Apr-2007 15:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | wheedle.mp3 | 22-Apr-2007 15:01 | 4.6K | |
![[SND]](/icons/sound2.gif) | whee.mp3 | 22-Apr-2007 15:01 | 5.2K | |
![[SND]](/icons/sound2.gif) | wheatland.mp3 | 22-Apr-2007 15:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | wheaties.mp3 | 22-Apr-2007 15:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | wheatgrass.mp3 | 22-Apr-2007 15:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | wheaten.mp3 | 22-Apr-2007 15:01 | 5.4K | |
![[SND]](/icons/sound2.gif) | wheatear.mp3 | 22-Apr-2007 15:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | wheat.mp3 | 22-Apr-2007 15:01 | 4.5K | |
![[SND]](/icons/sound2.gif) | wheal.mp3 | 22-Apr-2007 15:01 | 5.0K | |
![[SND]](/icons/sound2.gif) | whazood.mp3 | 22-Apr-2007 15:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | whaur.mp3 | 22-Apr-2007 15:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | whaup.mp3 | 22-Apr-2007 15:00 | 5.7K | |
![[SND]](/icons/sound2.gif) | whatzis.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatyoumaycallit.mp3 | 22-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | whatve.mp3 | 22-Apr-2007 15:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | whatta.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatsoever.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatsoeer.mp3 | 22-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | whatsit.mp3 | 22-Apr-2007 15:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | whatsisname.mp3 | 22-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | whatsisface.mp3 | 22-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | whatsis.mp3 | 22-Apr-2007 15:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | whats.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatnot.mp3 | 22-Apr-2007 15:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | whatness.mp3 | 22-Apr-2007 15:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | whatman.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatll.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatever.mp3 | 22-Apr-2007 15:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | whateer.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatdya.mp3 | 22-Apr-2007 15:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | whatd.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | whatchamacallit.mp3 | 22-Apr-2007 15:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | whatcha.mp3 | 22-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | what all.mp3 | 22-Apr-2007 14:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | what.mp3 | 22-Apr-2007 15:00 | 3.9K | |
![[SND]](/icons/sound2.gif) | what-is-it.mp3 | 22-Apr-2007 15:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | what-if.mp3 | 22-Apr-2007 15:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | whassit.mp3 | 22-Apr-2007 14:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | wharves.mp3 | 22-Apr-2007 14:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | wharve.mp3 | 22-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | wharfmaster.mp3 | 22-Apr-2007 14:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | wharfinger.mp3 | 22-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | wharfie.mp3 | 22-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | wharfage.mp3 | 22-Apr-2007 14:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | wharf.mp3 | 22-Apr-2007 14:59 | 5.2K | |
![[SND]](/icons/sound2.gif) | whare.mp3 | 22-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | whapo.mp3 | 22-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | whap.mp3 | 22-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | whank.mp3 | 22-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | whanger.mp3 | 22-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | whangee.mp3 | 22-Apr-2007 14:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | whangdoodle.mp3 | 22-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | whangarei.mp3 | 22-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | whang.mp3 | 22-Apr-2007 14:59 | 5.4K | |
![[SND]](/icons/sound2.gif) | whanau.mp3 | 22-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | whammy.mp3 | 22-Apr-2007 14:59 | 5.4K | |
![[SND]](/icons/sound2.gif) | whammo.mp3 | 22-Apr-2007 14:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | whammers.mp3 | 22-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | whambang.mp3 | 22-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | wham.mp3 | 22-Apr-2007 14:59 | 5.5K | |
![[SND]](/icons/sound2.gif) | whaling.mp3 | 22-Apr-2007 14:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | whales.mp3 | 22-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | whalery.mp3 | 22-Apr-2007 14:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | whaler.mp3 | 22-Apr-2007 14:58 | 5.7K | |
![[SND]](/icons/sound2.gif) | whaleman.mp3 | 22-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | whalelike.mp3 | 22-Apr-2007 14:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | whalebone.mp3 | 22-Apr-2007 14:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | whaleboat.mp3 | 22-Apr-2007 14:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | whaleback.mp3 | 22-Apr-2007 14:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | whale.mp3 | 22-Apr-2007 14:58 | 5.2K | |
![[SND]](/icons/sound2.gif) | whae.mp3 | 22-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | whacky.mp3 | 22-Apr-2007 14:58 | 5.7K | |
![[SND]](/icons/sound2.gif) | whacko.mp3 | 22-Apr-2007 14:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | whacking.mp3 | 22-Apr-2007 14:58 | 5.9K | |
![[SND]](/icons/sound2.gif) | whacker.mp3 | 22-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | whacked-out.mp3 | 22-Apr-2007 14:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | whack.mp3 | 22-Apr-2007 14:58 | 4.3K | |
![[SND]](/icons/sound2.gif) | whachamacallit.mp3 | 22-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | wha.mp3 | 22-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | wf.mp3 | 22-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | weyl.mp3 | 22-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | weyerhaeuser.mp3 | 22-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | wey.mp3 | 22-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | weve.mp3 | 22-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | wetware.mp3 | 22-Apr-2007 14:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | wettish.mp3 | 22-Apr-2007 14:57 | 5.9K | |
![[SND]](/icons/sound2.gif) | wettin.mp3 | 22-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | wetterhorn.mp3 | 22-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | wetter.mp3 | 22-Apr-2007 14:57 | 4.5K | |
![[SND]](/icons/sound2.gif) | wettable.mp3 | 22-Apr-2007 14:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | wettability.mp3 | 22-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | wetsu.mp3 | 22-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | wetland.mp3 | 22-Apr-2007 14:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | wether.mp3 | 22-Apr-2007 14:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | wetback.mp3 | 22-Apr-2007 14:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | weta.mp3 | 22-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | wet.mp3 | 22-Apr-2007 14:57 | 4.1K | |
![[SND]](/icons/sound2.gif) | westwinddrift.mp3 | 22-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | westwards.mp3 | 22-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | westwardly.mp3 | 22-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | westward.mp3 | 22-Apr-2007 14:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | westwall.mp3 | 22-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | westriding.mp3 | 22-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | westpolitik.mp3 | 22-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | westover.mp3 | 22-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | westonsupermare.mp3 | 22-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | westoncell.mp3 | 22-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | westmost.mp3 | 22-Apr-2007 14:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | westmifflin.mp3 | 22-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | westmark.mp3 | 22-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | westing.mp3 | 22-Apr-2007 14:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | westham.mp3 | 22-Apr-2007 14:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | westernmost.mp3 | 22-Apr-2007 14:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | westernize.mp3 | 22-Apr-2007 14:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | westernization.mp3 | 22-Apr-2007 14:56 | 12K | |
![[SND]](/icons/sound2.gif) | westernism.mp3 | 22-Apr-2007 14:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | westerner.mp3 | 22-Apr-2007 14:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | western.mp3 | 22-Apr-2007 14:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | westerman.mp3 | 22-Apr-2007 14:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | westerly.mp3 | 22-Apr-2007 14:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | westering.mp3 | 22-Apr-2007 14:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | wester.mp3 | 22-Apr-2007 14:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | westcott.mp3 | 22-Apr-2007 14:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | westbromwichalbion.mp3 | 22-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | westbromwich.mp3 | 22-Apr-2007 14:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | westbound.mp3 | 22-Apr-2007 14:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | westar.mp3 | 22-Apr-2007 14:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | westallis.mp3 | 22-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | west.mp3 | 22-Apr-2007 14:55 | 5.5K | |
![[SND]](/icons/sound2.gif) | wessis.mp3 | 22-Apr-2007 14:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | weskit.mp3 | 22-Apr-2007 14:54 | 6.3K | |
![[SND]](/icons/sound2.gif) | wesker.mp3 | 22-Apr-2007 14:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | wesermunde.mp3 | 22-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | wes.mp3 | 22-Apr-2007 14:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | werwolf.mp3 | 22-Apr-2007 14:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | wertmuller.mp3 | 22-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | wertherism.mp3 | 22-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | wertherian.mp3 | 22-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | wert.mp3 | 22-Apr-2007 14:54 | 4.5K | |
![[SND]](/icons/sound2.gif) | werste.mp3 | 22-Apr-2007 14:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | wersh.mp3 | 22-Apr-2007 14:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | wernickesaphasia.mp3 | 22-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | wernickekorsakoffsyndrome.mp3 | 22-Apr-2007 14:54 | 18K | |
![[SND]](/icons/sound2.gif) | wernerite.mp3 | 22-Apr-2007 14:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | wernerian.mp3 | 22-Apr-2007 14:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | wergild.mp3 | 22-Apr-2007 14:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | wergeld.mp3 | 22-Apr-2007 14:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | wergeland.mp3 | 22-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | werf.mp3 | 22-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | werewolves.mp3 | 22-Apr-2007 14:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | werewolf.mp3 | 22-Apr-2007 14:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | werent.mp3 | 22-Apr-2007 14:53 | 27K | |
![[SND]](/icons/sound2.gif) | weren't.mp3 | 22-Apr-2007 14:53 | 4.8K | |
![[SND]](/icons/sound2.gif) | were.mp3 | 22-Apr-2007 14:53 | 5.0K | |
![[SND]](/icons/sound2.gif) | wer.mp3 | 22-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | wept.mp3 | 22-Apr-2007 14:53 | 5.5K | |
![[SND]](/icons/sound2.gif) | wenzhou.mp3 | 22-Apr-2007 14:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | wenyen.mp3 | 22-Apr-2007 14:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | wenwies.mp3 | 22-Apr-2007 14:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | wentletrap.mp3 | 22-Apr-2007 14:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | went.mp3 | 22-Apr-2007 14:53 | 5.2K | |
![[SND]](/icons/sound2.gif) | wenonah.mp3 | 22-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | wenny.mp3 | 22-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | wenhuibao.mp3 | 22-Apr-2007 14:53 | 27K | |
![[SND]](/icons/sound2.gif) | wendys.mp3 | 22-Apr-2007 14:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | wendy.mp3 | 22-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | wendigo.mp3 | 22-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | wendell.mp3 | 22-Apr-2007 14:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | wend.mp3 | 22-Apr-2007 14:52 | 5.4K | |
![[SND]](/icons/sound2.gif) | wenchy.mp3 | 22-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | wenchow.mp3 | 22-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | wench.mp3 | 22-Apr-2007 14:52 | 5.4K | |
![[SND]](/icons/sound2.gif) | wenceslaus.mp3 | 22-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | wen.mp3 | 22-Apr-2007 14:52 | 5.2K | |
![[SND]](/icons/sound2.gif) | wemyss.mp3 | 22-Apr-2007 14:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | welwyngardencity.mp3 | 22-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | welwitschia.mp3 | 22-Apr-2007 14:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | weltschmerz.mp3 | 22-Apr-2007 14:52 | 10K | |
![[SND]](/icons/sound2.gif) | weltpolitik.mp3 | 22-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | welterweight.mp3 | 22-Apr-2007 14:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | weltering.mp3 | 22-Apr-2007 14:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | welter.mp3 | 22-Apr-2007 14:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | weltansicht.mp3 | 22-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | weltanschauungs.mp3 | 22-Apr-2007 14:51 | 12K | |
![[SND]](/icons/sound2.gif) | weltanschauungen.mp3 | 22-Apr-2007 14:51 | 14K | |
![[SND]](/icons/sound2.gif) | weltanschauung.mp3 | 22-Apr-2007 14:51 | 13K | |
![[SND]](/icons/sound2.gif) | welt.mp3 | 22-Apr-2007 14:51 | 5.2K | |
![[SND]](/icons/sound2.gif) | welshy.mp3 | 22-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | welsbachburner.mp3 | 22-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | wels.mp3 | 22-Apr-2007 14:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | welly.mp3 | 22-Apr-2007 14:51 | 5.2K | |
![[SND]](/icons/sound2.gif) | wellspring.mp3 | 22-Apr-2007 14:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | wellsite.mp3 | 22-Apr-2007 14:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | wellsfargo.mp3 | 22-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | wellread.mp3 | 22-Apr-2007 14:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | wellness.mp3 | 22-Apr-2007 14:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | wellman.mp3 | 22-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | wellingtonia.mp3 | 22-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | wellingborough.mp3 | 22-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | wellies.mp3 | 22-Apr-2007 14:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | wellie.mp3 | 22-Apr-2007 14:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | wellhead.mp3 | 22-Apr-2007 14:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | wellesz.mp3 | 22-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | weller.mp3 | 22-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | wellborn.mp3 | 22-Apr-2007 14:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | wellaway.mp3 | 22-Apr-2007 14:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | wellandshipcanal.mp3 | 22-Apr-2007 14:49 | 17K | |
![[SND]](/icons/sound2.gif) | welladay.mp3 | 22-Apr-2007 14:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | well.mp3 | 22-Apr-2007 14:48 | 5.0K | |
![[SND]](/icons/sound2.gif) | well-worn.mp3 | 22-Apr-2007 14:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | well-wishing.mp3 | 22-Apr-2007 14:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | well-wisher.mp3 | 22-Apr-2007 14:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | well-turned.mp3 | 22-Apr-2007 14:51 | 10K | |
![[SND]](/icons/sound2.gif) | well-to-do.mp3 | 22-Apr-2007 14:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | well-timed.mp3 | 22-Apr-2007 14:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | well-thought-of.mp3 | 22-Apr-2007 14:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | well-taken.mp3 | 22-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | well-spoken.mp3 | 22-Apr-2007 14:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | well-set.mp3 | 22-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | well-rounded.mp3 | 22-Apr-2007 14:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | well-read.mp3 | 22-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | well-placed.mp3 | 22-Apr-2007 14:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | well-ordering.mp3 | 22-Apr-2007 14:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | well-ordered.mp3 | 22-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | well-oiled.mp3 | 22-Apr-2007 14:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | well-off.mp3 | 22-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | well-nigh.mp3 | 22-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | well-meant.mp3 | 22-Apr-2007 14:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | well-meaning.mp3 | 22-Apr-2007 14:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | well-known.mp3 | 22-Apr-2007 14:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | well-knit.mp3 | 22-Apr-2007 14:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | well-intentioned.mp3 | 22-Apr-2007 14:50 | 10K | |
![[SND]](/icons/sound2.gif) | well-informed.mp3 | 22-Apr-2007 14:50 | 11K | |
![[SND]](/icons/sound2.gif) | well-heeled.mp3 | 22-Apr-2007 14:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | well-handled.mp3 | 22-Apr-2007 14:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | well-grounded.mp3 | 22-Apr-2007 14:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | well-groomed.mp3 | 22-Apr-2007 14:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | well-founded.mp3 | 22-Apr-2007 14:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | well-found.mp3 | 22-Apr-2007 14:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | well-fixed.mp3 | 22-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | well-favored.mp3 | 22-Apr-2007 14:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | well-endowed.mp3 | 22-Apr-2007 14:49 | 11K | |
![[SND]](/icons/sound2.gif) | well-done.mp3 | 22-Apr-2007 14:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | well-disposed.mp3 | 22-Apr-2007 14:49 | 11K | |
![[SND]](/icons/sound2.gif) | well-defined.mp3 | 22-Apr-2007 14:49 | 11K | |
![[SND]](/icons/sound2.gif) | well-conditioned.mp3 | 22-Apr-2007 14:49 | 11K | |
![[SND]](/icons/sound2.gif) | well-bred.mp3 | 22-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | well-beloved.mp3 | 22-Apr-2007 14:49 | 10K | |
![[SND]](/icons/sound2.gif) | well-being.mp3 | 22-Apr-2007 14:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | well-balanced.mp3 | 22-Apr-2007 14:49 | 11K | |
![[SND]](/icons/sound2.gif) | well-appointed.mp3 | 22-Apr-2007 14:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | well-advised.mp3 | 22-Apr-2007 14:48 | 11K | |
![[SND]](/icons/sound2.gif) | well-adjusted.mp3 | 22-Apr-2007 14:48 | 11K | |
![[SND]](/icons/sound2.gif) | welkom.mp3 | 22-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | welkin.mp3 | 22-Apr-2007 14:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | welk.mp3 | 22-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | weli.mp3 | 22-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | welfarite.mp3 | 22-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | welfarist.mp3 | 22-Apr-2007 14:48 | 10K | |
![[SND]](/icons/sound2.gif) | welfarism.mp3 | 22-Apr-2007 14:48 | 10K | |
![[SND]](/icons/sound2.gif) | welfare.mp3 | 22-Apr-2007 14:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | weldon.mp3 | 22-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | weldment.mp3 | 22-Apr-2007 14:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | welder.mp3 | 22-Apr-2007 14:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | weldable.mp3 | 22-Apr-2007 14:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | weld.mp3 | 22-Apr-2007 14:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | welcome.mp3 | 22-Apr-2007 14:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | welchman.mp3 | 22-Apr-2007 14:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | welch.mp3 | 22-Apr-2007 14:48 | 5.5K | |
![[SND]](/icons/sound2.gif) | welby.mp3 | 22-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | weka.mp3 | 22-Apr-2007 14:48 | 5.0K | |
![[SND]](/icons/sound2.gif) | wejack.mp3 | 22-Apr-2007 14:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | weizsacker.mp3 | 22-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | weissnichtwo.mp3 | 22-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | weissmuller.mp3 | 22-Apr-2007 14:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | weisshorn.mp3 | 22-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | weissbeer.mp3 | 22-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | weismannism.mp3 | 22-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | weisenheimer.mp3 | 22-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | weirton.mp3 | 22-Apr-2007 14:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | weirdy.mp3 | 22-Apr-2007 14:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | weirdo.mp3 | 22-Apr-2007 14:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | weirdie.mp3 | 22-Apr-2007 14:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | weird.mp3 | 22-Apr-2007 14:47 | 5.5K | |
![[SND]](/icons/sound2.gif) | weir.mp3 | 22-Apr-2007 14:47 | 5.7K | |
![[SND]](/icons/sound2.gif) | weinie.mp3 | 22-Apr-2007 14:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | weingartner.mp3 | 22-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | weiner.mp3 | 22-Apr-2007 14:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | weinbergsalamtheory.mp3 | 22-Apr-2007 14:47 | 27K | |
![[SND]](/icons/sound2.gif) | weilsdisease.mp3 | 22-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | weighty.mp3 | 22-Apr-2007 14:46 | 5.5K | |
![[SND]](/icons/sound2.gif) | weights.mp3 | 22-Apr-2007 14:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | weightman.mp3 | 22-Apr-2007 14:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | weightless.mp3 | 22-Apr-2007 14:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | weightism.mp3 | 22-Apr-2007 14:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | weighting.mp3 | 22-Apr-2007 14:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | weightiness.mp3 | 22-Apr-2007 14:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | weightily.mp3 | 22-Apr-2007 14:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | weighted.mp3 | 22-Apr-2007 14:46 | 5.2K | |
![[SND]](/icons/sound2.gif) | weight.mp3 | 22-Apr-2007 14:46 | 4.8K | |
![[SND]](/icons/sound2.gif) | weighman.mp3 | 22-Apr-2007 14:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | weighable.mp3 | 22-Apr-2007 14:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | weigh.mp3 | 22-Apr-2007 14:46 | 5.4K | |
![[SND]](/icons/sound2.gif) | weigh-in.mp3 | 22-Apr-2007 14:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | weigela.mp3 | 22-Apr-2007 14:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | weierstrass.mp3 | 22-Apr-2007 14:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | weichsel.mp3 | 22-Apr-2007 14:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | wehrmacht.mp3 | 22-Apr-2007 14:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | weft.mp3 | 22-Apr-2007 14:46 | 5.7K | |
![[SND]](/icons/sound2.gif) | weft-knitted.mp3 | 22-Apr-2007 14:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | weewee.mp3 | 22-Apr-2007 14:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | weevily.mp3 | 22-Apr-2007 14:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | weevilly.mp3 | 22-Apr-2007 14:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | weevil.mp3 | 22-Apr-2007 14:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | weever.mp3 | 22-Apr-2007 14:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | weetabix.mp3 | 22-Apr-2007 14:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | weet.mp3 | 22-Apr-2007 14:45 | 5.0K | |
![[SND]](/icons/sound2.gif) | weepy.mp3 | 22-Apr-2007 14:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | weeping.mp3 | 22-Apr-2007 14:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | weepie.mp3 | 22-Apr-2007 14:45 | 5.9K | |
![[SND]](/icons/sound2.gif) | weeper.mp3 | 22-Apr-2007 14:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | weep.mp3 | 22-Apr-2007 14:45 | 4.5K | |
![[SND]](/icons/sound2.gif) | weeny.mp3 | 22-Apr-2007 14:45 | 5.2K | |
![[SND]](/icons/sound2.gif) | weensy.mp3 | 22-Apr-2007 14:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | weenie.mp3 | 22-Apr-2007 14:45 | 5.5K | |
![[SND]](/icons/sound2.gif) | weener.mp3 | 22-Apr-2007 14:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | weenchy.mp3 | 22-Apr-2007 14:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | ween.mp3 | 22-Apr-2007 14:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | weelkes.mp3 | 22-Apr-2007 14:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | weel.mp3 | 22-Apr-2007 14:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | weeknights.mp3 | 22-Apr-2007 14:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | weeknight.mp3 | 22-Apr-2007 14:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | weekly.mp3 | 22-Apr-2007 14:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | weeklong.mp3 | 22-Apr-2007 14:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | weekley.mp3 | 22-Apr-2007 14:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | weekends.mp3 | 22-Apr-2007 14:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | weekender.mp3 | 22-Apr-2007 14:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | weekend.mp3 | 22-Apr-2007 14:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | weekdays.mp3 | 22-Apr-2007 14:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | weekday.mp3 | 22-Apr-2007 14:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | week.mp3 | 22-Apr-2007 14:44 | 4.8K | |
![[SND]](/icons/sound2.gif) | weejuns.mp3 | 22-Apr-2007 14:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | weefrees.mp3 | 22-Apr-2007 14:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | weedy.mp3 | 22-Apr-2007 14:44 | 5.4K | |
![[SND]](/icons/sound2.gif) | weedless.mp3 | 22-Apr-2007 14:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | weedicide.mp3 | 22-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | weeder.mp3 | 22-Apr-2007 14:44 | 5.9K | |
![[SND]](/icons/sound2.gif) | weeded.mp3 | 22-Apr-2007 14:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | weed.mp3 | 22-Apr-2007 14:44 | 5.7K | |
![[SND]](/icons/sound2.gif) | wee.mp3 | 22-Apr-2007 14:44 | 5.9K | |
![[SND]](/icons/sound2.gif) | wedlock.mp3 | 22-Apr-2007 14:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | wedgy.mp3 | 22-Apr-2007 14:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | wedgie.mp3 | 22-Apr-2007 14:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | wedged.mp3 | 22-Apr-2007 14:44 | 5.7K | |
![[SND]](/icons/sound2.gif) | wedge.mp3 | 22-Apr-2007 14:44 | 5.2K | |
![[SND]](/icons/sound2.gif) | wedeln.mp3 | 22-Apr-2007 14:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | wedel.mp3 | 22-Apr-2007 14:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | wedekind.mp3 | 22-Apr-2007 14:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | wedding.mp3 | 22-Apr-2007 14:43 | 5.2K | |
![[SND]](/icons/sound2.gif) | weddellsea.mp3 | 22-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | wedded.mp3 | 22-Apr-2007 14:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | wed.mp3 | 22-Apr-2007 14:43 | 5.2K | |
![[SND]](/icons/sound2.gif) | wechslerscales.mp3 | 22-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | webworm.mp3 | 22-Apr-2007 14:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | webwork.mp3 | 22-Apr-2007 14:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | websterite.mp3 | 22-Apr-2007 14:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | websterian.mp3 | 22-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | webmaster.mp3 | 22-Apr-2007 14:43 | 19K | |
![[SND]](/icons/sound2.gif) | weblike.mp3 | 22-Apr-2007 14:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | webley.mp3 | 22-Apr-2007 14:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | webishebeli.mp3 | 22-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | webfoot.mp3 | 22-Apr-2007 14:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | webfed.mp3 | 22-Apr-2007 14:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | weberianapparatus.mp3 | 22-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | weber.mp3 | 22-Apr-2007 14:42 | 5.0K | |
![[SND]](/icons/sound2.gif) | webelos.mp3 | 22-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | webcast.mp3 | 22-Apr-2007 14:42 | 11K | |
![[SND]](/icons/sound2.gif) | webcam.mp3 | 22-Apr-2007 14:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | webby.mp3 | 22-Apr-2007 14:42 | 4.8K | |
![[SND]](/icons/sound2.gif) | webbing.mp3 | 22-Apr-2007 14:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | webbeshebeli.mp3 | 22-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | webber.mp3 | 22-Apr-2007 14:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | webbed.mp3 | 22-Apr-2007 14:42 | 5.4K | |
![[SND]](/icons/sound2.gif) | web.mp3 | 22-Apr-2007 14:42 | 4.3K | |
![[SND]](/icons/sound2.gif) | web-offset.mp3 | 22-Apr-2007 14:43 | 11K | |
![[SND]](/icons/sound2.gif) | web-footed.mp3 | 22-Apr-2007 14:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | weazen.mp3 | 22-Apr-2007 14:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | weazand.mp3 | 22-Apr-2007 14:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | weaverbird.mp3 | 22-Apr-2007 14:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | weaver.mp3 | 22-Apr-2007 14:42 | 5.0K | |
![[SND]](/icons/sound2.gif) | weave.mp3 | 22-Apr-2007 14:42 | 5.5K | |
![[SND]](/icons/sound2.gif) | weathery.mp3 | 22-Apr-2007 14:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | weatherworn.mp3 | 22-Apr-2007 14:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | weatherproof.mp3 | 22-Apr-2007 14:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | weatherperson.mp3 | 22-Apr-2007 14:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | weatherometer.mp3 | 22-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | weatherman.mp3 | 22-Apr-2007 14:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | weatherly.mp3 | 22-Apr-2007 14:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | weatherize.mp3 | 22-Apr-2007 14:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | weatherization.mp3 | 22-Apr-2007 14:41 | 11K | |
![[SND]](/icons/sound2.gif) | weathering.mp3 | 22-Apr-2007 14:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | weatherglass.mp3 | 22-Apr-2007 14:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | weathered.mp3 | 22-Apr-2007 14:41 | 5.7K | |
![[SND]](/icons/sound2.gif) | weathercock.mp3 | 22-Apr-2007 14:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | weathercaster.mp3 | 22-Apr-2007 14:41 | 9.8K | |
![[SND]](/icons/sound2.gif) | weathercast.mp3 | 22-Apr-2007 14:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | weatherby.mp3 | 22-Apr-2007 14:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | weatherboarding.mp3 | 22-Apr-2007 14:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | weatherboard.mp3 | 22-Apr-2007 14:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | weatherability.mp3 | 22-Apr-2007 14:41 | 10K | |
![[SND]](/icons/sound2.gif) | weather.mp3 | 22-Apr-2007 14:41 | 5.4K | |
![[SND]](/icons/sound2.gif) | weather-wise.mp3 | 22-Apr-2007 14:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | weather-bound.mp3 | 22-Apr-2007 14:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | weather-beaten.mp3 | 22-Apr-2007 14:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | weason.mp3 | 22-Apr-2007 14:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | weasely.mp3 | 22-Apr-2007 14:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | weaselly.mp3 | 22-Apr-2007 14:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | weaseling.mp3 | 22-Apr-2007 14:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | weasel.mp3 | 22-Apr-2007 14:41 | 5.7K | |
![[SND]](/icons/sound2.gif) | weasand.mp3 | 22-Apr-2007 14:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | weary.mp3 | 22-Apr-2007 14:41 | 5.0K | |
![[SND]](/icons/sound2.gif) | wearproof.mp3 | 22-Apr-2007 14:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | wearout.mp3 | 22-Apr-2007 14:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | wearisome.mp3 | 22-Apr-2007 14:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | wearingly.mp3 | 22-Apr-2007 14:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | wearing.mp3 | 22-Apr-2007 14:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | weariness.mp3 | 22-Apr-2007 14:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | wearily.mp3 | 22-Apr-2007 14:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | weariless.mp3 | 22-Apr-2007 14:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | wearifully.mp3 | 22-Apr-2007 14:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | weariful.mp3 | 22-Apr-2007 14:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | wearable.mp3 | 22-Apr-2007 14:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | wearability.mp3 | 22-Apr-2007 14:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | wear.mp3 | 22-Apr-2007 14:40 | 5.4K | |
![[SND]](/icons/sound2.gif) | weaponry.mp3 | 22-Apr-2007 14:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | weaponless.mp3 | 22-Apr-2007 14:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | weaponize.mp3 | 22-Apr-2007 14:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | weaponization.mp3 | 22-Apr-2007 14:40 | 10K | |
![[SND]](/icons/sound2.gif) | weaponeer.mp3 | 22-Apr-2007 14:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | weapon.mp3 | 22-Apr-2007 14:40 | 5.4K | |
![[SND]](/icons/sound2.gif) | weanling.mp3 | 22-Apr-2007 14:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | weaner.mp3 | 22-Apr-2007 14:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | wean.mp3 | 22-Apr-2007 14:40 | 6.1K | |
![[SND]](/icons/sound2.gif) | wealthy.mp3 | 22-Apr-2007 14:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | wealthiness.mp3 | 22-Apr-2007 14:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | wealthily.mp3 | 22-Apr-2007 14:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | wealth.mp3 | 22-Apr-2007 14:40 | 4.8K | |
![[SND]](/icons/sound2.gif) | wealden.mp3 | 22-Apr-2007 14:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | weald.mp3 | 22-Apr-2007 14:40 | 5.9K | |
![[SND]](/icons/sound2.gif) | weal.mp3 | 22-Apr-2007 14:40 | 4.8K | |
![[SND]](/icons/sound2.gif) | weakside.mp3 | 22-Apr-2007 14:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | weakon.mp3 | 22-Apr-2007 14:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | weakness.mp3 | 22-Apr-2007 14:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | weakly.mp3 | 22-Apr-2007 14:39 | 5.7K | |
![[SND]](/icons/sound2.gif) | weakling.mp3 | 22-Apr-2007 14:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | weakish.mp3 | 22-Apr-2007 14:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | weakhearted.mp3 | 22-Apr-2007 14:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | weakfish.mp3 | 22-Apr-2007 14:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | weakening.mp3 | 22-Apr-2007 14:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | weakener.mp3 | 22-Apr-2007 14:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | weaken.mp3 | 22-Apr-2007 14:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | weak.mp3 | 22-Apr-2007 14:39 | 4.8K | |
![[SND]](/icons/sound2.gif) | weak-minded.mp3 | 22-Apr-2007 14:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | weak-kneed.mp3 | 22-Apr-2007 14:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | we.mp3 | 22-Apr-2007 14:39 | 4.1K | |
![[SND]](/icons/sound2.gif) | we've.mp3 | 22-Apr-2007 14:57 | 5.9K | |
![[SND]](/icons/sound2.gif) | we're.mp3 | 22-Apr-2007 14:53 | 5.0K | |
![[SND]](/icons/sound2.gif) | we'll.mp3 | 22-Apr-2007 14:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | we'd.mp3 | 22-Apr-2007 14:43 | 5.0K | |
![[SND]](/icons/sound2.gif) | wazzock.mp3 | 22-Apr-2007 14:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | wazoo.mp3 | 22-Apr-2007 14:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | wazirabad.mp3 | 22-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | wazir.mp3 | 22-Apr-2007 14:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | wayzgoose.mp3 | 22-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | wayworn.mp3 | 22-Apr-2007 14:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | wayward.mp3 | 22-Apr-2007 14:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | wayside.mp3 | 22-Apr-2007 14:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | ways.mp3 | 22-Apr-2007 14:39 | 5.7K | |
![[SND]](/icons/sound2.gif) | waypoint.mp3 | 22-Apr-2007 14:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | wayno.mp3 | 22-Apr-2007 14:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | wayless.mp3 | 22-Apr-2007 14:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | wayleggo.mp3 | 22-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | waylay.mp3 | 22-Apr-2007 14:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | waylaid.mp3 | 22-Apr-2007 14:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | waygoing.mp3 | 22-Apr-2007 14:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | wayfaring.mp3 | 22-Apr-2007 14:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | wayfarer.mp3 | 22-Apr-2007 14:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | waybill.mp3 | 22-Apr-2007 14:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | way.mp3 | 22-Apr-2007 14:38 | 5.0K | |
![[SND]](/icons/sound2.gif) | way-out.mp3 | 22-Apr-2007 14:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | waxy.mp3 | 22-Apr-2007 14:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | waxwork.mp3 | 22-Apr-2007 14:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | waxwing.mp3 | 22-Apr-2007 14:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | waxweed.mp3 | 22-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | waxlike.mp3 | 22-Apr-2007 14:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | waxing.mp3 | 22-Apr-2007 14:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | waxer.mp3 | 22-Apr-2007 14:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | waxen.mp3 | 22-Apr-2007 14:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | waxed.mp3 | 22-Apr-2007 14:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | waxbill.mp3 | 22-Apr-2007 14:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | waxberry.mp3 | 22-Apr-2007 14:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | wax.mp3 | 22-Apr-2007 14:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | wawl.mp3 | 22-Apr-2007 14:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | wawa.mp3 | 22-Apr-2007 14:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | waw.mp3 | 22-Apr-2007 14:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | wavy.mp3 | 22-Apr-2007 14:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | waviness.mp3 | 22-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | wavily.mp3 | 22-Apr-2007 14:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | wavey.mp3 | 22-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | waveshape.mp3 | 22-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | waves.mp3 | 22-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | wavery.mp3 | 22-Apr-2007 14:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | waverley.mp3 | 22-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | waveringly.mp3 | 22-Apr-2007 14:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | wavering.mp3 | 22-Apr-2007 14:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | waverer.mp3 | 22-Apr-2007 14:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | waver.mp3 | 22-Apr-2007 14:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | wavellite.mp3 | 22-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | wavelike.mp3 | 22-Apr-2007 14:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | wavelet.mp3 | 22-Apr-2007 14:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | waveless.mp3 | 22-Apr-2007 14:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | wavelength.mp3 | 22-Apr-2007 14:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | waveguide.mp3 | 22-Apr-2007 14:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | waveform.mp3 | 22-Apr-2007 14:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | waved.mp3 | 22-Apr-2007 14:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | wave.mp3 | 22-Apr-2007 14:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | waur.mp3 | 22-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | waulk.mp3 | 22-Apr-2007 14:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | waul.mp3 | 22-Apr-2007 14:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | waukrife.mp3 | 22-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | wauk.mp3 | 22-Apr-2007 14:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | wattsdunton.mp3 | 22-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | wattmeter.mp3 | 22-Apr-2007 14:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | wattling.mp3 | 22-Apr-2007 14:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | wattlesscomponent.mp3 | 22-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | wattled.mp3 | 22-Apr-2007 14:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | wattlebird.mp3 | 22-Apr-2007 14:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | wattle.mp3 | 22-Apr-2007 14:36 | 4.8K | |
![[SND]](/icons/sound2.gif) | watter.mp3 | 22-Apr-2007 14:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | wattage.mp3 | 22-Apr-2007 14:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | watt.mp3 | 22-Apr-2007 14:36 | 4.3K | |
![[SND]](/icons/sound2.gif) | watt-hour.mp3 | 22-Apr-2007 14:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | watsonwatt.mp3 | 22-Apr-2007 14:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | watsonia.mp3 | 22-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | wats.mp3 | 22-Apr-2007 14:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | watlingisland.mp3 | 22-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | watkins.mp3 | 22-Apr-2007 14:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | waterzooi.mp3 | 22-Apr-2007 14:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | watery.mp3 | 22-Apr-2007 14:35 | 6.3K | |
![[SND]](/icons/sound2.gif) | waterworn.mp3 | 22-Apr-2007 14:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | waterworks.mp3 | 22-Apr-2007 14:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | water witching.mp3 | 22-Apr-2007 14:33 | 9.3K | |
![[SND]](/icons/sound2.gif) | water witcher.mp3 | 22-Apr-2007 14:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | waterwheel.mp3 | 22-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | waterweed.mp3 | 22-Apr-2007 14:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | waterway.mp3 | 22-Apr-2007 14:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | waterward.mp3 | 22-Apr-2007 14:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | waterville.mp3 | 22-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | watertonglacierinternationalpeacepark.mp3 | 22-Apr-2007 14:35 | 27K | |
![[SND]](/icons/sound2.gif) | watertight.mp3 | 22-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | waterthrush.mp3 | 22-Apr-2007 14:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | waterspout.mp3 | 22-Apr-2007 14:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | waterslide.mp3 | 22-Apr-2007 14:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | waterskiing.mp3 | 22-Apr-2007 14:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | waterside.mp3 | 22-Apr-2007 14:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | watershed.mp3 | 22-Apr-2007 14:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | waterscape.mp3 | 22-Apr-2007 14:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | waterproofing.mp3 | 22-Apr-2007 14:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | waterproof.mp3 | 22-Apr-2007 14:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | waterpower.mp3 | 22-Apr-2007 14:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | watermelon.mp3 | 22-Apr-2007 14:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | watermark.mp3 | 22-Apr-2007 14:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | watermanship.mp3 | 22-Apr-2007 14:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | waterman.mp3 | 22-Apr-2007 14:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | waterlogged.mp3 | 22-Apr-2007 14:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | waterlog.mp3 | 22-Apr-2007 14:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | waterline.mp3 | 22-Apr-2007 14:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | waterless.mp3 | 22-Apr-2007 14:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | waterleafs.mp3 | 22-Apr-2007 14:34 | 9.5K | |
![[SND]](/icons/sound2.gif) | waterleaf.mp3 | 22-Apr-2007 14:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | waterish.mp3 | 22-Apr-2007 14:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | watering.mp3 | 22-Apr-2007 14:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | wateriness.mp3 | 22-Apr-2007 14:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | waterily.mp3 | 22-Apr-2007 14:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | watergate.mp3 | 22-Apr-2007 14:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | waterfront.mp3 | 22-Apr-2007 14:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | waterfowling.mp3 | 22-Apr-2007 14:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | waterfowler.mp3 | 22-Apr-2007 14:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | waterfowl.mp3 | 22-Apr-2007 14:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | waterflood.mp3 | 22-Apr-2007 14:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | waterfall.mp3 | 22-Apr-2007 14:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | waterer.mp3 | 22-Apr-2007 14:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | watered.mp3 | 22-Apr-2007 14:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | watercress.mp3 | 22-Apr-2007 14:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | watercraft.mp3 | 22-Apr-2007 14:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | watercourse.mp3 | 22-Apr-2007 14:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | watercooler.mp3 | 22-Apr-2007 14:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | watercolorist.mp3 | 22-Apr-2007 14:33 | 10K | |
![[SND]](/icons/sound2.gif) | watercolor.mp3 | 22-Apr-2007 14:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | waterbuck.mp3 | 22-Apr-2007 14:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | waterbouget.mp3 | 22-Apr-2007 14:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | waterborne.mp3 | 22-Apr-2007 14:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | waterbird.mp3 | 22-Apr-2007 14:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | waterage.mp3 | 22-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | water.mp3 | 22-Apr-2007 14:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | water-soak.mp3 | 22-Apr-2007 14:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | water-skier.mp3 | 22-Apr-2007 14:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | water-resistant.mp3 | 22-Apr-2007 14:34 | 11K | |
![[SND]](/icons/sound2.gif) | water-repellent.mp3 | 22-Apr-2007 14:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | watenstedtsalzgitter.mp3 | 22-Apr-2007 14:32 | 18K | |
![[SND]](/icons/sound2.gif) | watchword.mp3 | 22-Apr-2007 14:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | watchtower.mp3 | 22-Apr-2007 14:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | watchman.mp3 | 22-Apr-2007 14:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | watchmaking.mp3 | 22-Apr-2007 14:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | watchmaker.mp3 | 22-Apr-2007 14:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | watchless.mp3 | 22-Apr-2007 14:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | watching.mp3 | 22-Apr-2007 14:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | watchfully.mp3 | 22-Apr-2007 14:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | watchful.mp3 | 22-Apr-2007 14:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | watcher.mp3 | 22-Apr-2007 14:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | watchdog.mp3 | 22-Apr-2007 14:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | watchcase.mp3 | 22-Apr-2007 14:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | watchband.mp3 | 22-Apr-2007 14:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | watchable.mp3 | 22-Apr-2007 14:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | watch.mp3 | 22-Apr-2007 14:32 | 5.7K | |
![[SND]](/icons/sound2.gif) | watap.mp3 | 22-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | wat.mp3 | 22-Apr-2007 14:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | wasty.mp3 | 22-Apr-2007 14:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | wastwater.mp3 | 22-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | wastrel.mp3 | 22-Apr-2007 14:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | wastoid.mp3 | 22-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | wasting.mp3 | 22-Apr-2007 14:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | wastewater.mp3 | 22-Apr-2007 14:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | wastery.mp3 | 22-Apr-2007 14:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | waster.mp3 | 22-Apr-2007 14:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | wasteplex.mp3 | 22-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | wastepaper.mp3 | 22-Apr-2007 14:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | wasteland.mp3 | 22-Apr-2007 14:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | wastefully.mp3 | 22-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | wasteful.mp3 | 22-Apr-2007 14:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | wasted.mp3 | 22-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | wastebasket.mp3 | 22-Apr-2007 14:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | waste.mp3 | 22-Apr-2007 14:31 | 5.5K | |
![[SND]](/icons/sound2.gif) | wastage.mp3 | 22-Apr-2007 14:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | wast.mp3 | 22-Apr-2007 14:31 | 5.0K | |
![[SND]](/icons/sound2.gif) | wassup.mp3 | 22-Apr-2007 14:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | wassilychair.mp3 | 22-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | wassailer.mp3 | 22-Apr-2007 14:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | wassail bowl.mp3 | 22-Apr-2007 14:31 | 10K | |
![[SND]](/icons/sound2.gif) | wassail.mp3 | 22-Apr-2007 14:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | wasplike.mp3 | 22-Apr-2007 14:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | wasp.mp3 | 22-Apr-2007 14:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | wasp-waisted.mp3 | 22-Apr-2007 14:31 | 11K | |
![[SND]](/icons/sound2.gif) | wasnt.mp3 | 22-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | wasn't.mp3 | 22-Apr-2007 14:31 | 5.5K | |
![[SND]](/icons/sound2.gif) | washy.mp3 | 22-Apr-2007 14:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | washwoman.mp3 | 22-Apr-2007 14:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | washup.mp3 | 22-Apr-2007 14:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | washtub.mp3 | 22-Apr-2007 14:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | washstand.mp3 | 22-Apr-2007 14:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | washroom.mp3 | 22-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | washrag.mp3 | 22-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | washout.mp3 | 22-Apr-2007 14:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | washoe.mp3 | 22-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | washo.mp3 | 22-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | washnwear.mp3 | 22-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | washingtonologist.mp3 | 22-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | washingtonia.mp3 | 22-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | washing.mp3 | 22-Apr-2007 14:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | washiness.mp3 | 22-Apr-2007 14:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | washhouse.mp3 | 22-Apr-2007 14:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | washeteria.mp3 | 22-Apr-2007 14:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | washery.mp3 | 22-Apr-2007 14:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | washerwoman.mp3 | 22-Apr-2007 14:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | washerman.mp3 | 22-Apr-2007 14:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | washer.mp3 | 22-Apr-2007 14:30 | 5.7K | |
![[SND]](/icons/sound2.gif) | washed-up.mp3 | 22-Apr-2007 14:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | washed-out.mp3 | 22-Apr-2007 14:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | washcloth.mp3 | 22-Apr-2007 14:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | washbowl.mp3 | 22-Apr-2007 14:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | washboard.mp3 | 22-Apr-2007 14:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | washbasin.mp3 | 22-Apr-2007 14:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | washateria.mp3 | 22-Apr-2007 14:29 | 9.8K | |
![[SND]](/icons/sound2.gif) | washable.mp3 | 22-Apr-2007 14:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | washability.mp3 | 22-Apr-2007 14:29 | 10K | |
![[SND]](/icons/sound2.gif) | wash.mp3 | 22-Apr-2007 14:29 | 5.5K | |
![[SND]](/icons/sound2.gif) | wase.mp3 | 22-Apr-2007 14:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | wasatchrange.mp3 | 22-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | wasabi.mp3 | 22-Apr-2007 14:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | was.mp3 | 22-Apr-2007 14:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | wary.mp3 | 22-Apr-2007 14:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | warty.mp3 | 22-Apr-2007 14:29 | 4.6K | |
![[SND]](/icons/sound2.gif) | wartweed.mp3 | 22-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | wartless.mp3 | 22-Apr-2007 14:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | wartime.mp3 | 22-Apr-2007 14:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | warthog.mp3 | 22-Apr-2007 14:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | warted.mp3 | 22-Apr-2007 14:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | wartburg.mp3 | 22-Apr-2007 14:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | wart.mp3 | 22-Apr-2007 14:28 | 4.5K | |
![[SND]](/icons/sound2.gif) | warstle.mp3 | 22-Apr-2007 14:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | warsle.mp3 | 22-Apr-2007 14:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | warship.mp3 | 22-Apr-2007 14:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | warsaw grouper.mp3 | 22-Apr-2007 14:28 | 11K | |
![[SND]](/icons/sound2.gif) | warsaw.mp3 | 22-Apr-2007 14:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | warrior.mp3 | 22-Apr-2007 14:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | warring.mp3 | 22-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | warrigal.mp3 | 22-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | warrensvilleheights.mp3 | 22-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | warrener.mp3 | 22-Apr-2007 14:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | warren.mp3 | 22-Apr-2007 14:28 | 5.5K | |
![[SND]](/icons/sound2.gif) | warranty.mp3 | 22-Apr-2007 14:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | warrantor.mp3 | 22-Apr-2007 14:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | warrantless.mp3 | 22-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | warranter.mp3 | 22-Apr-2007 14:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | warrantee.mp3 | 22-Apr-2007 14:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | warrantably.mp3 | 22-Apr-2007 14:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | warrantable.mp3 | 22-Apr-2007 14:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | warrant.mp3 | 22-Apr-2007 14:28 | 5.5K | |
![[SND]](/icons/sound2.gif) | warragal.mp3 | 22-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | warplane.mp3 | 22-Apr-2007 14:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | warping.mp3 | 22-Apr-2007 14:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | warper.mp3 | 22-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | warped.mp3 | 22-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | warpath.mp3 | 22-Apr-2007 14:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | warpage.mp3 | 22-Apr-2007 14:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | warp.mp3 | 22-Apr-2007 14:27 | 4.5K | |
![[SND]](/icons/sound2.gif) | warp-knitted.mp3 | 22-Apr-2007 14:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | warofattrition.mp3 | 22-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | warnography.mp3 | 22-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | warningly.mp3 | 22-Apr-2007 14:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | warning.mp3 | 22-Apr-2007 14:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | warnerbrothers.mp3 | 22-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | warner.mp3 | 22-Apr-2007 14:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | warn.mp3 | 22-Apr-2007 14:27 | 5.0K | |
![[SND]](/icons/sound2.gif) | warmth.mp3 | 22-Apr-2007 14:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | warmouth.mp3 | 22-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | warmongering.mp3 | 22-Apr-2007 14:27 | 10K | |
![[SND]](/icons/sound2.gif) | warmonger.mp3 | 22-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | warmness.mp3 | 22-Apr-2007 14:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | warmly.mp3 | 22-Apr-2007 14:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | warmish.mp3 | 22-Apr-2007 14:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | warminsterbroom.mp3 | 22-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | warming pan.mp3 | 22-Apr-2007 14:27 | 11K | |
![[SND]](/icons/sound2.gif) | warming.mp3 | 22-Apr-2007 14:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | warmhearted.mp3 | 22-Apr-2007 14:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | warmer.mp3 | 22-Apr-2007 14:26 | 5.5K | |
![[SND]](/icons/sound2.gif) | warmed-over.mp3 | 22-Apr-2007 14:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | warm.mp3 | 22-Apr-2007 14:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | warm-up.mp3 | 22-Apr-2007 14:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | warm-blooded.mp3 | 22-Apr-2007 14:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | warlpiri.mp3 | 22-Apr-2007 14:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | warlordism.mp3 | 22-Apr-2007 14:26 | 10K | |
![[SND]](/icons/sound2.gif) | warlord.mp3 | 22-Apr-2007 14:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | warlock.mp3 | 22-Apr-2007 14:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | warlike.mp3 | 22-Apr-2007 14:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | warless.mp3 | 22-Apr-2007 14:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | wark.mp3 | 22-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | warison.mp3 | 22-Apr-2007 14:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | waring.mp3 | 22-Apr-2007 14:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | wariness.mp3 | 22-Apr-2007 14:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | warily.mp3 | 22-Apr-2007 14:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | warhorse.mp3 | 22-Apr-2007 14:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | warhead.mp3 | 22-Apr-2007 14:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | wargasm.mp3 | 22-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | warfarin.mp3 | 22-Apr-2007 14:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | warfare.mp3 | 22-Apr-2007 14:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | wareroom.mp3 | 22-Apr-2007 14:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | warehousing.mp3 | 22-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | warehouser.mp3 | 22-Apr-2007 14:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | warehouseman.mp3 | 22-Apr-2007 14:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | warehouse.mp3 | 22-Apr-2007 14:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | ware.mp3 | 22-Apr-2007 14:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | wardship.mp3 | 22-Apr-2007 14:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | wards.mp3 | 22-Apr-2007 14:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | wardroom.mp3 | 22-Apr-2007 14:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | wardrobe.mp3 | 22-Apr-2007 14:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | wardress.mp3 | 22-Apr-2007 14:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | wardourstreet.mp3 | 22-Apr-2007 14:25 | 17K | |
![[SND]](/icons/sound2.gif) | wardmote.mp3 | 22-Apr-2007 14:25 | 17K | |
![[SND]](/icons/sound2.gif) | wardiancase.mp3 | 22-Apr-2007 14:25 | 17K | |
![[SND]](/icons/sound2.gif) | warder.mp3 | 22-Apr-2007 14:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | wardenship.mp3 | 22-Apr-2007 14:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | wardenry.mp3 | 22-Apr-2007 14:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | warden.mp3 | 22-Apr-2007 14:25 | 5.5K | |
![[SND]](/icons/sound2.gif) | warded.mp3 | 22-Apr-2007 14:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | ward.mp3 | 22-Apr-2007 14:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | warby.mp3 | 22-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | warbonnet.mp3 | 22-Apr-2007 14:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | warbling.mp3 | 22-Apr-2007 14:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | warbler.mp3 | 22-Apr-2007 14:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | warbled.mp3 | 22-Apr-2007 14:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | warble.mp3 | 22-Apr-2007 14:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | warb.mp3 | 22-Apr-2007 14:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | waratah.mp3 | 22-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | waragi.mp3 | 22-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | war.mp3 | 22-Apr-2007 14:24 | 5.5K | |
![[SND]](/icons/sound2.gif) | wapsed.mp3 | 22-Apr-2007 14:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | wapping.mp3 | 22-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | wapperjaw.mp3 | 22-Apr-2007 14:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | wappenshaw.mp3 | 22-Apr-2007 14:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | wappenschawing.mp3 | 22-Apr-2007 14:24 | 11K | |
![[SND]](/icons/sound2.gif) | wapiti.mp3 | 22-Apr-2007 14:24 | 5.9K | |
![[SND]](/icons/sound2.gif) | wapentake.mp3 | 22-Apr-2007 14:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | wapatoo.mp3 | 22-Apr-2007 14:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | wap.mp3 | 22-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | wanyuanhu.mp3 | 22-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | wany.mp3 | 22-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | wanxian.mp3 | 22-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | wantonness.mp3 | 22-Apr-2007 14:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | wanton.mp3 | 22-Apr-2007 14:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | wantless.mp3 | 22-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | wanting.mp3 | 22-Apr-2007 14:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | wanted.mp3 | 22-Apr-2007 14:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | wantage.mp3 | 22-Apr-2007 14:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | wantable.mp3 | 22-Apr-2007 14:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | wanta.mp3 | 22-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | want.mp3 | 22-Apr-2007 14:23 | 5.0K | |
![[SND]](/icons/sound2.gif) | wannish.mp3 | 22-Apr-2007 14:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | wannigan.mp3 | 22-Apr-2007 14:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | wanness.mp3 | 22-Apr-2007 14:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | wanneeickel.mp3 | 22-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | wannabe.mp3 | 22-Apr-2007 14:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | wanna.mp3 | 22-Apr-2007 14:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | wankle.mp3 | 22-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | wankie.mp3 | 22-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | wanker.mp3 | 22-Apr-2007 14:23 | 5.9K | |
![[SND]](/icons/sound2.gif) | wankel.mp3 | 22-Apr-2007 14:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | wank.mp3 | 22-Apr-2007 14:23 | 5.2K | |
![[SND]](/icons/sound2.gif) | wanion.mp3 | 22-Apr-2007 14:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | wanigan.mp3 | 22-Apr-2007 14:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | wanhsien.mp3 | 22-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | wangyangming.mp3 | 22-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | wangling.mp3 | 22-Apr-2007 14:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | wangler.mp3 | 22-Apr-2007 14:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | wangle.mp3 | 22-Apr-2007 14:23 | 5.7K | |
![[SND]](/icons/sound2.gif) | wangfujingstreet.mp3 | 22-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | wanger.mp3 | 22-Apr-2007 14:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | wangdangdoodle.mp3 | 22-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | wangchuk.mp3 | 22-Apr-2007 14:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | wangchingwei.mp3 | 22-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | wanganshi.mp3 | 22-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | waney.mp3 | 22-Apr-2007 14:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wane.mp3 | 22-Apr-2007 14:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | wandsman.mp3 | 22-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | wandorobo.mp3 | 22-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | wandoo.mp3 | 22-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | wandle.mp3 | 22-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | wanderoo.mp3 | 22-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | wandering.mp3 | 22-Apr-2007 14:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | wanderer.mp3 | 22-Apr-2007 14:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | wander.mp3 | 22-Apr-2007 14:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | wanda.mp3 | 22-Apr-2007 14:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wand.mp3 | 22-Apr-2007 14:22 | 5.2K | |
![[SND]](/icons/sound2.gif) | wanchuan.mp3 | 22-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | wanchancy.mp3 | 22-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | wanabe.mp3 | 22-Apr-2007 14:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wana.mp3 | 22-Apr-2007 14:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | wan.mp3 | 22-Apr-2007 14:21 | 5.0K | |
![[SND]](/icons/sound2.gif) | wamus.mp3 | 22-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | wampus.mp3 | 22-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | wampumpeag.mp3 | 22-Apr-2007 14:21 | 9.8K | |
![[SND]](/icons/sound2.gif) | wampum.mp3 | 22-Apr-2007 14:21 | 5.9K | |
![[SND]](/icons/sound2.gif) | wampish.mp3 | 22-Apr-2007 14:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | wampee.mp3 | 22-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | wammus.mp3 | 22-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | wame.mp3 | 22-Apr-2007 14:21 | 5.7K | |
![[SND]](/icons/sound2.gif) | wambling.mp3 | 22-Apr-2007 14:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | wamble.mp3 | 22-Apr-2007 14:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | wambenger.mp3 | 22-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | wambaugh.mp3 | 22-Apr-2007 14:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | wamba.mp3 | 22-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | walyo.mp3 | 22-Apr-2007 14:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | waly.mp3 | 22-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | walworthroad.mp3 | 22-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | walvisbay.mp3 | 22-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | waltz.mp3 | 22-Apr-2007 14:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | walthervondervogelweide.mp3 | 22-Apr-2007 14:21 | 18K | |
![[SND]](/icons/sound2.gif) | walther.mp3 | 22-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | walthamforest.mp3 | 22-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | walters.mp3 | 22-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | walter.mp3 | 22-Apr-2007 14:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | walt.mp3 | 22-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | walsingham.mp3 | 22-Apr-2007 14:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | walrus.mp3 | 22-Apr-2007 14:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | walras.mp3 | 22-Apr-2007 14:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | walpurgis.mp3 | 22-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | walnut.mp3 | 22-Apr-2007 14:20 | 5.9K | |
![[SND]](/icons/sound2.gif) | walmart.mp3 | 22-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | wallydraigle.mp3 | 22-Apr-2007 14:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | wallydrag.mp3 | 22-Apr-2007 14:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | wallyball.mp3 | 22-Apr-2007 14:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | wally.mp3 | 22-Apr-2007 14:20 | 5.4K | |
![[SND]](/icons/sound2.gif) | wallsend.mp3 | 22-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | wallpaper.mp3 | 22-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | wallower.mp3 | 22-Apr-2007 14:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | wallow.mp3 | 22-Apr-2007 14:19 | 6.3K | |
![[SND]](/icons/sound2.gif) | walloping.mp3 | 22-Apr-2007 14:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | walloper.mp3 | 22-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | wallop.mp3 | 22-Apr-2007 14:19 | 5.0K | |
![[SND]](/icons/sound2.gif) | wallisandfutunaislands.mp3 | 22-Apr-2007 14:19 | 27K | |
![[SND]](/icons/sound2.gif) | walling.mp3 | 22-Apr-2007 14:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wallflower.mp3 | 22-Apr-2007 14:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | walleyed.mp3 | 22-Apr-2007 14:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | walleye.mp3 | 22-Apr-2007 14:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | wallet.mp3 | 22-Apr-2007 14:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | wallensis.mp3 | 22-Apr-2007 14:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | walled.mp3 | 22-Apr-2007 14:19 | 5.7K | |
![[SND]](/icons/sound2.gif) | wallboard.mp3 | 22-Apr-2007 14:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | wallaroo.mp3 | 22-Apr-2007 14:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | wallah.mp3 | 22-Apr-2007 14:19 | 5.2K | |
![[SND]](/icons/sound2.gif) | wallaceism.mp3 | 22-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | wallaby.mp3 | 22-Apr-2007 14:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | wallaba.mp3 | 22-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | walla.mp3 | 22-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | wall.mp3 | 22-Apr-2007 14:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | wall-like.mp3 | 22-Apr-2007 14:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | walkytalky.mp3 | 22-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | walkway.mp3 | 22-Apr-2007 14:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | walkure.mp3 | 22-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | walkover.mp3 | 22-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | walkout.mp3 | 22-Apr-2007 14:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | walkingbass.mp3 | 22-Apr-2007 14:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | walking.mp3 | 22-Apr-2007 14:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | walkietalkie.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | walkielookie.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | walkie-talkie.mp3 | 22-Apr-2007 14:17 | 10K | |
![[SND]](/icons/sound2.gif) | walker.mp3 | 22-Apr-2007 14:17 | 5.2K | |
![[SND]](/icons/sound2.gif) | walkaway.mp3 | 22-Apr-2007 14:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | walkathon.mp3 | 22-Apr-2007 14:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | walkabout.mp3 | 22-Apr-2007 14:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | walkable.mp3 | 22-Apr-2007 14:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | walk.mp3 | 22-Apr-2007 14:17 | 4.3K | |
![[SND]](/icons/sound2.gif) | walk-up.mp3 | 22-Apr-2007 14:18 | 5.9K | |
![[SND]](/icons/sound2.gif) | walk-through.mp3 | 22-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | walk-on.mp3 | 22-Apr-2007 14:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | walk-in.mp3 | 22-Apr-2007 14:17 | 6.6K | |
![[SND]](/icons/sound2.gif) | waling.mp3 | 22-Apr-2007 14:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | wali.mp3 | 22-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | walgreens.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | walfishbay.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | waley.mp3 | 22-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | waler.mp3 | 22-Apr-2007 14:17 | 5.5K | |
![[SND]](/icons/sound2.gif) | wale.mp3 | 22-Apr-2007 14:17 | 5.2K | |
![[SND]](/icons/sound2.gif) | waldsterben.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | waldstein.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | waldorfsalad.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | waldorfastoria.mp3 | 22-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | waldgrave.mp3 | 22-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | waldglas.mp3 | 22-Apr-2007 14:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | waldenpond.mp3 | 22-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | waldenbooks.mp3 | 22-Apr-2007 14:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | waldemari.mp3 | 22-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | walcheren.mp3 | 22-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | walcha.mp3 | 22-Apr-2007 14:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | walburga.mp3 | 22-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | walays.mp3 | 22-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | walachia.mp3 | 22-Apr-2007 14:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | walach.mp3 | 22-Apr-2007 14:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | wakonda.mp3 | 22-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | waking.mp3 | 22-Apr-2007 14:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | wakey.mp3 | 22-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | wakerife.mp3 | 22-Apr-2007 14:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | wakening.mp3 | 22-Apr-2007 14:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | wakener.mp3 | 22-Apr-2007 14:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | waken.mp3 | 22-Apr-2007 14:15 | 5.2K | |
![[SND]](/icons/sound2.gif) | wakeless.mp3 | 22-Apr-2007 14:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | wakefully.mp3 | 22-Apr-2007 14:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | wakeful.mp3 | 22-Apr-2007 14:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | waked.mp3 | 22-Apr-2007 14:15 | 5.0K | |
![[SND]](/icons/sound2.gif) | wakeboard.mp3 | 22-Apr-2007 14:15 | 15K | |
![[SND]](/icons/sound2.gif) | wake.mp3 | 22-Apr-2007 14:15 | 4.5K | |
![[SND]](/icons/sound2.gif) | wake-up.mp3 | 22-Apr-2007 14:15 | 5.4K | |
![[SND]](/icons/sound2.gif) | wake-robin.mp3 | 22-Apr-2007 14:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | wakanda.mp3 | 22-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | wajda.mp3 | 22-Apr-2007 14:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | waiver.mp3 | 22-Apr-2007 14:15 | 5.4K | |
![[SND]](/icons/sound2.gif) | waive.mp3 | 22-Apr-2007 14:15 | 5.2K | |
![[SND]](/icons/sound2.gif) | waitz.mp3 | 22-Apr-2007 14:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | waitstaff.mp3 | 22-Apr-2007 14:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | waitron.mp3 | 22-Apr-2007 14:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | waitressing.mp3 | 22-Apr-2007 14:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | waitress.mp3 | 22-Apr-2007 14:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | waitperson.mp3 | 22-Apr-2007 14:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | waitomocaves.mp3 | 22-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | waiting game.mp3 | 22-Apr-2007 14:14 | 10K | |
![[SND]](/icons/sound2.gif) | waiting.mp3 | 22-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | waitering.mp3 | 22-Apr-2007 14:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | waiter.mp3 | 22-Apr-2007 14:14 | 4.5K | |
![[SND]](/icons/sound2.gif) | waitangiday.mp3 | 22-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | waitandsee.mp3 | 22-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | wait.mp3 | 22-Apr-2007 14:14 | 4.3K | |
![[SND]](/icons/sound2.gif) | wait-list.mp3 | 22-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | waistline.mp3 | 22-Apr-2007 14:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | waisted.mp3 | 22-Apr-2007 14:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | waistcoating.mp3 | 22-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | waistcoated.mp3 | 22-Apr-2007 14:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | waistcoat.mp3 | 22-Apr-2007 14:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | waistband.mp3 | 22-Apr-2007 14:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | waist.mp3 | 22-Apr-2007 14:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | wais.mp3 | 22-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | wairsh.mp3 | 22-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | wainwright.mp3 | 22-Apr-2007 14:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | wainscotting.mp3 | 22-Apr-2007 14:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | wainscoting.mp3 | 22-Apr-2007 14:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | wainscot.mp3 | 22-Apr-2007 14:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | wain.mp3 | 22-Apr-2007 14:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | wailsome.mp3 | 22-Apr-2007 14:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | wailing.mp3 | 22-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | wailfully.mp3 | 22-Apr-2007 14:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | wailful.mp3 | 22-Apr-2007 14:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | wailer.mp3 | 22-Apr-2007 14:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | wail.mp3 | 22-Apr-2007 14:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | waikaremoana.mp3 | 22-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | waiflike.mp3 | 22-Apr-2007 14:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | waifish.mp3 | 22-Apr-2007 14:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | waif.mp3 | 22-Apr-2007 14:13 | 5.7K | |
![[SND]](/icons/sound2.gif) | waiata.mp3 | 22-Apr-2007 14:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | wahwah.mp3 | 22-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | wahpekute.mp3 | 22-Apr-2007 14:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | wahoo.mp3 | 22-Apr-2007 14:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | wahine.mp3 | 22-Apr-2007 14:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | wahiawa.mp3 | 22-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | wah.mp3 | 22-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | wah-wah.mp3 | 22-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | wagtail.mp3 | 22-Apr-2007 14:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | wagonload.mp3 | 22-Apr-2007 14:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | wagonlit.mp3 | 22-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | wagonette.mp3 | 22-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | wagoner.mp3 | 22-Apr-2007 14:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | wagonage.mp3 | 22-Apr-2007 14:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | wagon.mp3 | 22-Apr-2007 14:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | wagon-lits.mp3 | 22-Apr-2007 14:12 | 14K | |
![[SND]](/icons/sound2.gif) | wagon-lit.mp3 | 22-Apr-2007 14:12 | 10K | |
![[SND]](/icons/sound2.gif) | wagnerjauregg.mp3 | 22-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | wagnerism.mp3 | 22-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | wagneract.mp3 | 22-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | wagh.mp3 | 22-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | waggon.mp3 | 22-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | waggly.mp3 | 22-Apr-2007 14:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | waggling.mp3 | 22-Apr-2007 14:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | waggler.mp3 | 22-Apr-2007 14:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | waggle.mp3 | 22-Apr-2007 14:12 | 5.2K | |
![[SND]](/icons/sound2.gif) | waggish.mp3 | 22-Apr-2007 14:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | waggery.mp3 | 22-Apr-2007 14:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | wagger.mp3 | 22-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | waggawagga.mp3 | 22-Apr-2007 14:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | wagga.mp3 | 22-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | wageworker.mp3 | 22-Apr-2007 14:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | wagering.mp3 | 22-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | wagerer.mp3 | 22-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | wager.mp3 | 22-Apr-2007 14:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | wageless.mp3 | 22-Apr-2007 14:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | wage.mp3 | 22-Apr-2007 14:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | wag.mp3 | 22-Apr-2007 14:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | wafture.mp3 | 22-Apr-2007 14:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | waftage.mp3 | 22-Apr-2007 14:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | waft.mp3 | 22-Apr-2007 14:11 | 5.2K | |
![[SND]](/icons/sound2.gif) | waffling.mp3 | 22-Apr-2007 14:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | wafflestompers.mp3 | 22-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | wafflestomper.mp3 | 22-Apr-2007 14:11 | 11K | |
![[SND]](/icons/sound2.gif) | waffler.mp3 | 22-Apr-2007 14:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | waffle.mp3 | 22-Apr-2007 14:11 | 5.7K | |
![[SND]](/icons/sound2.gif) | waffenss.mp3 | 22-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | waff.mp3 | 22-Apr-2007 14:11 | 5.0K | |
![[SND]](/icons/sound2.gif) | wafering.mp3 | 22-Apr-2007 14:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | wafer.mp3 | 22-Apr-2007 14:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | wafd.mp3 | 22-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | waesucks.mp3 | 22-Apr-2007 14:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | wae.mp3 | 22-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | wady.mp3 | 22-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | wadset.mp3 | 22-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | wadna.mp3 | 22-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | wadmol.mp3 | 22-Apr-2007 14:10 | 6.8K | |
![[SND]](/icons/sound2.gif) | wadmedani.mp3 | 22-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | wadmal.mp3 | 22-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | wadihalfa.mp3 | 22-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | wadi.mp3 | 22-Apr-2007 14:10 | 5.7K | |
![[SND]](/icons/sound2.gif) | wadge.mp3 | 22-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | wader.mp3 | 22-Apr-2007 14:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | wadegilessystem.mp3 | 22-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | wadeable.mp3 | 22-Apr-2007 14:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | wade.mp3 | 22-Apr-2007 14:10 | 6.1K | |
![[SND]](/icons/sound2.gif) | waddy.mp3 | 22-Apr-2007 14:10 | 5.4K | |
![[SND]](/icons/sound2.gif) | waddling.mp3 | 22-Apr-2007 14:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | waddler.mp3 | 22-Apr-2007 14:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | waddle.mp3 | 22-Apr-2007 14:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | waddington.mp3 | 22-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | wadding.mp3 | 22-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | waddie.mp3 | 22-Apr-2007 14:10 | 5.4K | |
![[SND]](/icons/sound2.gif) | waddesdonmanor.mp3 | 22-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | wadai.mp3 | 22-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | wadable.mp3 | 22-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | wad.mp3 | 22-Apr-2007 14:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | wackytabbacky.mp3 | 22-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | wacky.mp3 | 22-Apr-2007 14:09 | 6.1K | |
![[SND]](/icons/sound2.gif) | wacko.mp3 | 22-Apr-2007 14:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | wackiness.mp3 | 22-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | wackily.mp3 | 22-Apr-2007 14:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | wacker.mp3 | 22-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | wacke.mp3 | 22-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | wackadoo.mp3 | 22-Apr-2007 14:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | wack.mp3 | 22-Apr-2007 14:09 | 4.6K | |
![[SND]](/icons/sound2.gif) | waccoon.mp3 | 22-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | wabbly.mp3 | 22-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | wabble.mp3 | 22-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | wabbit.mp3 | 22-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | wabanaki.mp3 | 22-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | wab.mp3 | 22-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | waazooed.mp3 | 22-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | waals.mp3 | 22-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | waaf.mp3 | 22-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | waac.mp3 | 22-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | wa.mp3 | 22-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | w.mp3 | 22-Apr-2007 14:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wyomingite.mp3 | 22-Apr-2007 16:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | Wyoming.mp3 | 22-Apr-2007 16:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wyndham.mp3 | 22-Apr-2007 16:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wylie.mp3 | 22-Apr-2007 16:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wyld.mp3 | 22-Apr-2007 16:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wyeth.mp3 | 22-Apr-2007 16:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wycliffite.mp3 | 22-Apr-2007 16:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | Wycliffian.mp3 | 22-Apr-2007 16:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | Wycliffe.mp3 | 22-Apr-2007 16:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | Wycherley.mp3 | 22-Apr-2007 16:07 | 6.3K | |
![[SND]](/icons/sound2.gif) | Wyat.mp3 | 22-Apr-2007 16:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | Wyandot.mp3 | 22-Apr-2007 16:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | Wutsin.mp3 | 22-Apr-2007 16:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | Wuthrich.mp3 | 22-Apr-2007 16:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wusih.mp3 | 22-Apr-2007 16:07 | 10K | |
![[SND]](/icons/sound2.gif) | Wurzburg.mp3 | 22-Apr-2007 16:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wurttemberg.mp3 | 22-Apr-2007 16:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | Wuppertal.mp3 | 22-Apr-2007 16:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | Wupatki National Monument.mp3 | 22-Apr-2007 16:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | Wundt.mp3 | 22-Apr-2007 16:06 | 5.0K | |
![[SND]](/icons/sound2.gif) | Wulfila.mp3 | 22-Apr-2007 16:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wuhu.mp3 | 22-Apr-2007 16:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Wuhsien.mp3 | 22-Apr-2007 16:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | Wuhan.mp3 | 22-Apr-2007 16:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wuchow.mp3 | 22-Apr-2007 16:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wuchang.mp3 | 22-Apr-2007 16:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wu.mp3 | 22-Apr-2007 16:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wu-ti.mp3 | 22-Apr-2007 16:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wu-lu-mu-ch'i.mp3 | 22-Apr-2007 16:06 | 13K | |
![[SND]](/icons/sound2.gif) | Wroclaw.mp3 | 22-Apr-2007 16:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | Writings.mp3 | 22-Apr-2007 16:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wrexham.mp3 | 22-Apr-2007 16:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wrath, Cape.mp3 | 22-Apr-2007 16:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | Wrangell.mp3 | 22-Apr-2007 16:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wrangell-Saint Elias National Park.mp3 | 22-Apr-2007 16:01 | 11K | |
![[SND]](/icons/sound2.gif) | Wrangel.mp3 | 22-Apr-2007 16:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wounded Knee.mp3 | 22-Apr-2007 16:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | Wotton.mp3 | 22-Apr-2007 15:59 | 5.2K | |
![[SND]](/icons/sound2.gif) | Worthing.mp3 | 22-Apr-2007 15:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | Worth, Lake.mp3 | 22-Apr-2007 15:59 | 5.0K | |
![[SND]](/icons/sound2.gif) | Worms.mp3 | 22-Apr-2007 15:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wordsworthian.mp3 | 22-Apr-2007 15:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wordsworth.mp3 | 22-Apr-2007 15:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | Worde.mp3 | 22-Apr-2007 15:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | Worcestershire sauce.mp3 | 22-Apr-2007 15:54 | 12K | |
![[SND]](/icons/sound2.gif) | Worcestershire.mp3 | 22-Apr-2007 15:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | Worcester.mp3 | 22-Apr-2007 15:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | Wooster.mp3 | 22-Apr-2007 15:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | Woonsocket.mp3 | 22-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Woolworth.mp3 | 22-Apr-2007 15:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | Woolwich.mp3 | 22-Apr-2007 15:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | Woolley.mp3 | 22-Apr-2007 15:52 | 5.5K | |
![[SND]](/icons/sound2.gif) | Woollcott.mp3 | 22-Apr-2007 15:52 | 5.5K | |
![[SND]](/icons/sound2.gif) | Woolf.mp3 | 22-Apr-2007 15:52 | 5.2K | |
![[SND]](/icons/sound2.gif) | Woodstock.mp3 | 22-Apr-2007 15:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | Woodridge.mp3 | 22-Apr-2007 15:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | Woodlark.mp3 | 22-Apr-2007 15:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | Woodbury.mp3 | 22-Apr-2007 15:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wonsan.mp3 | 22-Apr-2007 15:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wolverhampton.mp3 | 22-Apr-2007 15:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | Wolsey.mp3 | 22-Apr-2007 15:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | Wolseley.mp3 | 22-Apr-2007 15:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wolof.mp3 | 22-Apr-2007 15:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wollstonecraft.mp3 | 22-Apr-2007 15:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | Wollongong.mp3 | 22-Apr-2007 15:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | Wollaston.mp3 | 22-Apr-2007 15:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wolfsburg.mp3 | 22-Apr-2007 15:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Wolfram von Eschenbach.mp3 | 22-Apr-2007 15:46 | 15K | |
![[SND]](/icons/sound2.gif) | Wolffian duct.mp3 | 22-Apr-2007 15:46 | 11K | |
![[SND]](/icons/sound2.gif) | Wolfe.mp3 | 22-Apr-2007 15:45 | 5.4K | |
![[SND]](/icons/sound2.gif) | Wolds, The.mp3 | 22-Apr-2007 15:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wolcott.mp3 | 22-Apr-2007 15:45 | 5.7K | |
![[SND]](/icons/sound2.gif) | Woffington.mp3 | 22-Apr-2007 15:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | Woese.mp3 | 22-Apr-2007 15:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wodzislaw Slaski.mp3 | 22-Apr-2007 15:44 | 16K | |
![[SND]](/icons/sound2.gif) | Woden.mp3 | 22-Apr-2007 15:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wodehouse.mp3 | 22-Apr-2007 15:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Woburn.mp3 | 22-Apr-2007 15:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wloclawek.mp3 | 22-Apr-2007 15:44 | 10K | |
![[SND]](/icons/sound2.gif) | Witwatersrand.mp3 | 22-Apr-2007 15:43 | 11K | |
![[SND]](/icons/sound2.gif) | Wittig.mp3 | 22-Apr-2007 15:43 | 4.6K | |
![[SND]](/icons/sound2.gif) | Wittgensteinian.mp3 | 22-Apr-2007 15:43 | 11K | |
![[SND]](/icons/sound2.gif) | Wittgenstein.mp3 | 22-Apr-2007 15:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | Wittenberg.mp3 | 22-Apr-2007 15:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Witten.mp3 | 22-Apr-2007 15:42 | 4.8K | |
![[SND]](/icons/sound2.gif) | Wittekind.mp3 | 22-Apr-2007 15:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | Witte.mp3 | 22-Apr-2007 15:42 | 5.0K | |
![[SND]](/icons/sound2.gif) | Witte, de.mp3 | 22-Apr-2007 15:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | Withlacoochee.mp3 | 22-Apr-2007 15:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | Wister.mp3 | 22-Apr-2007 15:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wissler.mp3 | 22-Apr-2007 15:40 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wissenschaft.mp3 | 22-Apr-2007 15:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | Wissahickon Creek.mp3 | 22-Apr-2007 15:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | Wismar.mp3 | 22-Apr-2007 15:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wisla.mp3 | 22-Apr-2007 15:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wiseman.mp3 | 22-Apr-2007 15:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | Wisdom of Solomon.mp3 | 22-Apr-2007 15:38 | 13K | |
![[SND]](/icons/sound2.gif) | Wisconsinite.mp3 | 22-Apr-2007 15:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wisconsin Dells.mp3 | 22-Apr-2007 15:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | Wisconsin.mp3 | 22-Apr-2007 15:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | Winyah Bay.mp3 | 22-Apr-2007 15:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | Winthrop.mp3 | 22-Apr-2007 15:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | Winterthur.mp3 | 22-Apr-2007 15:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | Winston-Salem.mp3 | 22-Apr-2007 15:35 | 10K | |
![[SND]](/icons/sound2.gif) | Winsor.mp3 | 22-Apr-2007 15:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | Winslow.mp3 | 22-Apr-2007 15:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | Winooski.mp3 | 22-Apr-2007 15:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | Winona.mp3 | 22-Apr-2007 15:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | Winnipesaukee, Lake.mp3 | 22-Apr-2007 15:35 | 9.6K | |
![[SND]](/icons/sound2.gif) | Winnipegosis, Lake.mp3 | 22-Apr-2007 15:35 | 11K | |
![[SND]](/icons/sound2.gif) | Winnipegger.mp3 | 22-Apr-2007 15:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | Winnipeg.mp3 | 22-Apr-2007 15:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | Winnie.mp3 | 22-Apr-2007 15:34 | 4.5K | |
![[SND]](/icons/sound2.gif) | Winnebago, Lake.mp3 | 22-Apr-2007 15:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | Wingate.mp3 | 22-Apr-2007 15:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | Windward Islands.mp3 | 22-Apr-2007 15:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | Windsurfer.mp3 | 22-Apr-2007 15:31 | 10K | |
![[SND]](/icons/sound2.gif) | Windsor chair.mp3 | 22-Apr-2007 15:31 | 11K | |
![[SND]](/icons/sound2.gif) | Windsor.mp3 | 22-Apr-2007 15:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | Windischgratz.mp3 | 22-Apr-2007 15:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | Windhoek.mp3 | 22-Apr-2007 15:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | Windham.mp3 | 22-Apr-2007 15:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | Windermere.mp3 | 22-Apr-2007 15:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | Windbreaker.mp3 | 22-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | Windaus.mp3 | 22-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | Windau.mp3 | 22-Apr-2007 15:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | Winckelmann.mp3 | 22-Apr-2007 15:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | Winchester.mp3 | 22-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | Wimbledon.mp3 | 22-Apr-2007 15:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wiltshire.mp3 | 22-Apr-2007 15:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | Wilton.mp3 | 22-Apr-2007 15:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | Wilsonian.mp3 | 22-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | Wilson.mp3 | 22-Apr-2007 15:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wilson's disease.mp3 | 22-Apr-2007 15:25 | 14K | |
![[SND]](/icons/sound2.gif) | Wilms' tumor.mp3 | 22-Apr-2007 15:25 | 12K | |
![[SND]](/icons/sound2.gif) | Wilmington.mp3 | 22-Apr-2007 15:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wilmette.mp3 | 22-Apr-2007 15:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | Willstatter.mp3 | 22-Apr-2007 15:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | Willoughby.mp3 | 22-Apr-2007 15:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | Willoch.mp3 | 22-Apr-2007 15:24 | 5.2K | |
![[SND]](/icons/sound2.gif) | Willkie.mp3 | 22-Apr-2007 15:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | Willis.mp3 | 22-Apr-2007 15:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | Williams syndrome.mp3 | 22-Apr-2007 15:23 | 12K | |
![[SND]](/icons/sound2.gif) | Williamsport.mp3 | 22-Apr-2007 15:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | Williamson, Mount.mp3 | 22-Apr-2007 15:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | Williamsburg.mp3 | 22-Apr-2007 15:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | William of Malmesbury.mp3 | 22-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | William Tell.mp3 | 22-Apr-2007 15:23 | 10K | |
![[SND]](/icons/sound2.gif) | William.mp3 | 22-Apr-2007 15:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | Willesden.mp3 | 22-Apr-2007 15:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | Willemstad.mp3 | 22-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | Willcocks.mp3 | 22-Apr-2007 15:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | Willard.mp3 | 22-Apr-2007 15:23 | 5.7K | |
![[SND]](/icons/sound2.gif) | Willapa Bay.mp3 | 22-Apr-2007 15:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | Willamette.mp3 | 22-Apr-2007 15:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wilkinson.mp3 | 22-Apr-2007 15:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wilkins.mp3 | 22-Apr-2007 15:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wilkes Land.mp3 | 22-Apr-2007 15:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | Wilkes.mp3 | 22-Apr-2007 15:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wilkes-Barre.mp3 | 22-Apr-2007 15:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wilhelmshaven.mp3 | 22-Apr-2007 15:22 | 11K | |
![[SND]](/icons/sound2.gif) | Wilhelmina.mp3 | 22-Apr-2007 15:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | Wiley.mp3 | 22-Apr-2007 15:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | Wildean.mp3 | 22-Apr-2007 15:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wilde.mp3 | 22-Apr-2007 15:21 | 5.9K | |
![[SND]](/icons/sound2.gif) | Wilbur.mp3 | 22-Apr-2007 15:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | Wilberforce.mp3 | 22-Apr-2007 15:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | Wigtownshire.mp3 | 22-Apr-2007 15:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | Wigtown.mp3 | 22-Apr-2007 15:20 | 5.9K | |
![[SND]](/icons/sound2.gif) | Wigner.mp3 | 22-Apr-2007 15:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wight, Isle of.mp3 | 22-Apr-2007 15:20 | 4.6K | |
![[SND]](/icons/sound2.gif) | Wiggin.mp3 | 22-Apr-2007 15:19 | 5.7K | |
![[SND]](/icons/sound2.gif) | Wiffle.mp3 | 22-Apr-2007 15:19 | 5.0K | |
![[SND]](/icons/sound2.gif) | Wiesel.mp3 | 22-Apr-2007 15:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wieschaus.mp3 | 22-Apr-2007 15:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wiesbaden.mp3 | 22-Apr-2007 15:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Wiener schnitzel.mp3 | 22-Apr-2007 15:18 | 10K | |
![[SND]](/icons/sound2.gif) | Wien.mp3 | 22-Apr-2007 15:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | Wieman.mp3 | 22-Apr-2007 15:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wieland.mp3 | 22-Apr-2007 15:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | Widukind.mp3 | 22-Apr-2007 15:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | Widor.mp3 | 22-Apr-2007 15:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | Wicklow.mp3 | 22-Apr-2007 15:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | Wichita.mp3 | 22-Apr-2007 15:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wiccan.mp3 | 22-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | Wicca.mp3 | 22-Apr-2007 15:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wi-Fi.mp3 | 22-Apr-2007 15:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | Whorfian hypothesis.mp3 | 22-Apr-2007 15:15 | 16K | |
![[SND]](/icons/sound2.gif) | Whittier.mp3 | 22-Apr-2007 15:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | Whittaker.mp3 | 22-Apr-2007 15:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | Whitsuntide.mp3 | 22-Apr-2007 15:12 | 12K | |
![[SND]](/icons/sound2.gif) | Whitsunday.mp3 | 22-Apr-2007 15:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | Whitsun.mp3 | 22-Apr-2007 15:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | Whitney.mp3 | 22-Apr-2007 15:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | Whitney, Mount.mp3 | 22-Apr-2007 15:12 | 5.2K | |
![[SND]](/icons/sound2.gif) | Whitmonday.mp3 | 22-Apr-2007 15:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | Whitmanian.mp3 | 22-Apr-2007 15:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | Whitmanesque.mp3 | 22-Apr-2007 15:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | Whitman.mp3 | 22-Apr-2007 15:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | Whitehorse.mp3 | 22-Apr-2007 15:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | Whitehall.mp3 | 22-Apr-2007 15:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | Whitefriars.mp3 | 22-Apr-2007 15:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | Whitefield.mp3 | 22-Apr-2007 15:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | Whitechapel.mp3 | 22-Apr-2007 15:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | White House.mp3 | 22-Apr-2007 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | Whitby.mp3 | 22-Apr-2007 15:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | Whistlerian.mp3 | 22-Apr-2007 15:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | Whipple.mp3 | 22-Apr-2007 15:07 | 5.4K | |
![[SND]](/icons/sound2.gif) | Whiggism.mp3 | 22-Apr-2007 15:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | Whiggish.mp3 | 22-Apr-2007 15:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | Whiggery.mp3 | 22-Apr-2007 15:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | Whig.mp3 | 22-Apr-2007 15:05 | 5.9K | |
![[SND]](/icons/sound2.gif) | Whidbey Island.mp3 | 22-Apr-2007 15:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wheelock.mp3 | 22-Apr-2007 15:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wheeler Peak.mp3 | 22-Apr-2007 15:01 | 5.5K | |
![[SND]](/icons/sound2.gif) | Wheatstone bridge.mp3 | 22-Apr-2007 15:01 | 11K | |
![[SND]](/icons/sound2.gif) | Wheatstone.mp3 | 22-Apr-2007 15:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wheaton.mp3 | 22-Apr-2007 15:01 | 5.5K | |
![[SND]](/icons/sound2.gif) | Wheatley.mp3 | 22-Apr-2007 15:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | Whately.mp3 | 22-Apr-2007 15:00 | 5.5K | |
![[SND]](/icons/sound2.gif) | Wharton.mp3 | 22-Apr-2007 14:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | Whangpoo.mp3 | 22-Apr-2007 14:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | Weymouth.mp3 | 22-Apr-2007 14:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | Weygand.mp3 | 22-Apr-2007 14:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | Weyden.mp3 | 22-Apr-2007 14:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wexford.mp3 | 22-Apr-2007 14:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wethersfield.mp3 | 22-Apr-2007 14:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | Wet, de.mp3 | 22-Apr-2007 14:57 | 5.7K | |
![[SND]](/icons/sound2.gif) | Westralia.mp3 | 22-Apr-2007 14:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | Westport.mp3 | 22-Apr-2007 14:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | Westphalian ham.mp3 | 22-Apr-2007 14:56 | 14K | |
![[SND]](/icons/sound2.gif) | Westphalian.mp3 | 22-Apr-2007 14:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | Westphalia.mp3 | 22-Apr-2007 14:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | Weston.mp3 | 22-Apr-2007 14:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | Weston-super-Mare.mp3 | 22-Apr-2007 14:56 | 14K | |
![[SND]](/icons/sound2.gif) | Westmorland.mp3 | 22-Apr-2007 14:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | Westmont.mp3 | 22-Apr-2007 14:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | Westminster.mp3 | 22-Apr-2007 14:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | Westmeath.mp3 | 22-Apr-2007 14:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | Westland.mp3 | 22-Apr-2007 14:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | Westlake.mp3 | 22-Apr-2007 14:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | Westinghouse.mp3 | 22-Apr-2007 14:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | Westie.mp3 | 22-Apr-2007 14:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | Westfield.mp3 | 22-Apr-2007 14:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | Westfalen.mp3 | 22-Apr-2007 14:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | Westerville.mp3 | 22-Apr-2007 14:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | Western Ghats.mp3 | 22-Apr-2007 14:55 | 5.5K | |
![[SND]](/icons/sound2.gif) | Westermarck.mp3 | 22-Apr-2007 14:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | West Sussex.mp3 | 22-Apr-2007 14:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | West Quoddy Head.mp3 | 22-Apr-2007 14:55 | 5.5K | |
![[SND]](/icons/sound2.gif) | West Lothian.mp3 | 22-Apr-2007 14:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | West Haven.mp3 | 22-Apr-2007 14:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | West Ham.mp3 | 22-Apr-2007 14:55 | 5.9K | |
![[SND]](/icons/sound2.gif) | West Covina.mp3 | 22-Apr-2007 14:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | West Bromwich.mp3 | 22-Apr-2007 14:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | West Bend.mp3 | 22-Apr-2007 14:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | West Banker.mp3 | 22-Apr-2007 14:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | Wessex.mp3 | 22-Apr-2007 14:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wesleyanism.mp3 | 22-Apr-2007 14:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | Wesleyan.mp3 | 22-Apr-2007 14:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wesley.mp3 | 22-Apr-2007 14:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | Weslaco.mp3 | 22-Apr-2007 14:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | Weser.mp3 | 22-Apr-2007 14:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wes-Kaap.mp3 | 22-Apr-2007 14:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wertfreiheit.mp3 | 22-Apr-2007 14:54 | 11K | |
![[SND]](/icons/sound2.gif) | Werra.mp3 | 22-Apr-2007 14:54 | 5.5K | |
![[SND]](/icons/sound2.gif) | Wernicke's area.mp3 | 22-Apr-2007 14:54 | 12K | |
![[SND]](/icons/sound2.gif) | Werner.mp3 | 22-Apr-2007 14:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | Werfel.mp3 | 22-Apr-2007 14:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wenzel.mp3 | 22-Apr-2007 14:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wentworth.mp3 | 22-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Wensleydale.mp3 | 22-Apr-2007 14:53 | 9.8K | |
![[SND]](/icons/sound2.gif) | Wendish.mp3 | 22-Apr-2007 14:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wenceslas.mp3 | 22-Apr-2007 14:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wenatchee.mp3 | 22-Apr-2007 14:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | Wen Jiabao.mp3 | 22-Apr-2007 14:52 | 15K | |
![[SND]](/icons/sound2.gif) | Wen-chou.mp3 | 22-Apr-2007 14:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wembley.mp3 | 22-Apr-2007 14:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | Welwyn Garden City.mp3 | 22-Apr-2007 14:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | Welty.mp3 | 22-Apr-2007 14:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | Weltbild.mp3 | 22-Apr-2007 14:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | Welshwoman.mp3 | 22-Apr-2007 14:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | Welsh rarebit.mp3 | 22-Apr-2007 14:51 | 10K | |
![[SND]](/icons/sound2.gif) | Welshpool.mp3 | 22-Apr-2007 14:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | Welshman.mp3 | 22-Apr-2007 14:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | Welsh.mp3 | 22-Apr-2007 14:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | Wellsian.mp3 | 22-Apr-2007 14:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | Wells.mp3 | 22-Apr-2007 14:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wellington.mp3 | 22-Apr-2007 14:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wellesley.mp3 | 22-Apr-2007 14:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | Welles.mp3 | 22-Apr-2007 14:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wellerism.mp3 | 22-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | Welland.mp3 | 22-Apr-2007 14:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | Weizmann.mp3 | 22-Apr-2007 14:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | Weismann.mp3 | 22-Apr-2007 14:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | Weinberger.mp3 | 22-Apr-2007 14:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | Weinberg.mp3 | 22-Apr-2007 14:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | Weimaraner.mp3 | 22-Apr-2007 14:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | Weimar.mp3 | 22-Apr-2007 14:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | Weill.mp3 | 22-Apr-2007 14:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | Weil.mp3 | 22-Apr-2007 14:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | Weihai.mp3 | 22-Apr-2007 14:47 | 9.5K | |
![[SND]](/icons/sound2.gif) | Weifang.mp3 | 22-Apr-2007 14:46 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wei.mp3 | 22-Apr-2007 14:46 | 5.7K | |
![[SND]](/icons/sound2.gif) | Wegener.mp3 | 22-Apr-2007 14:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | Weems.mp3 | 22-Apr-2007 14:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wednesdays.mp3 | 22-Apr-2007 14:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | Wednesday.mp3 | 22-Apr-2007 14:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wedgwood.mp3 | 22-Apr-2007 14:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Weddell seal.mp3 | 22-Apr-2007 14:43 | 11K | |
![[SND]](/icons/sound2.gif) | Weddell Sea.mp3 | 22-Apr-2007 14:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | Webster Groves.mp3 | 22-Apr-2007 14:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | Webster.mp3 | 22-Apr-2007 14:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | Webern.mp3 | 22-Apr-2007 14:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | Weberian.mp3 | 22-Apr-2007 14:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | Webb.mp3 | 22-Apr-2007 14:42 | 5.4K | |
![[SND]](/icons/sound2.gif) | Waziristan.mp3 | 22-Apr-2007 14:39 | 11K | |
![[SND]](/icons/sound2.gif) | Wayne.mp3 | 22-Apr-2007 14:38 | 5.7K | |
![[SND]](/icons/sound2.gif) | Wayland.mp3 | 22-Apr-2007 14:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wavell.mp3 | 22-Apr-2007 14:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | Wauwatosa.mp3 | 22-Apr-2007 14:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | Wausau.mp3 | 22-Apr-2007 14:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | Waukesha.mp3 | 22-Apr-2007 14:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | Waukegan.mp3 | 22-Apr-2007 14:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | Waugh.mp3 | 22-Apr-2007 14:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | Watusi.mp3 | 22-Apr-2007 14:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | Watts.mp3 | 22-Apr-2007 14:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | Watts-Dunton.mp3 | 22-Apr-2007 14:36 | 10K | |
![[SND]](/icons/sound2.gif) | Watterson.mp3 | 22-Apr-2007 14:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wattenscheid.mp3 | 22-Apr-2007 14:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | Watteau.mp3 | 22-Apr-2007 14:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | Watsonville.mp3 | 22-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | Watson.mp3 | 22-Apr-2007 14:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | Watson-Watt.mp3 | 22-Apr-2007 14:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | Watson-Crick.mp3 | 22-Apr-2007 14:35 | 9.6K | |
![[SND]](/icons/sound2.gif) | Watford.mp3 | 22-Apr-2007 14:35 | 5.9K | |
![[SND]](/icons/sound2.gif) | Watertown.mp3 | 22-Apr-2007 14:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | Waterton-Glacier International Peace Park.mp3 | 22-Apr-2007 14:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | Waters.mp3 | 22-Apr-2007 14:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | Waterloo.mp3 | 22-Apr-2007 14:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | Waterford.mp3 | 22-Apr-2007 14:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wateree.mp3 | 22-Apr-2007 14:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | Waterbury.mp3 | 22-Apr-2007 14:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | Watenstedt-Salzgitter.mp3 | 22-Apr-2007 14:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | Watauga.mp3 | 22-Apr-2007 14:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wasserstein.mp3 | 22-Apr-2007 14:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | Wassermann reaction.mp3 | 22-Apr-2007 14:31 | 14K | |
![[SND]](/icons/sound2.gif) | Wassermann.mp3 | 22-Apr-2007 14:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | Waspy.mp3 | 22-Apr-2007 14:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | Waspish.mp3 | 22-Apr-2007 14:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | Waspdom.mp3 | 22-Apr-2007 14:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | Wasmosy.mp3 | 22-Apr-2007 14:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | Washita.mp3 | 22-Apr-2007 14:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | Washington pie.mp3 | 22-Apr-2007 14:30 | 13K | |
![[SND]](/icons/sound2.gif) | Washingtonian.mp3 | 22-Apr-2007 14:30 | 10K | |
![[SND]](/icons/sound2.gif) | Washington.mp3 | 22-Apr-2007 14:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wash, The.mp3 | 22-Apr-2007 14:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wasatch Range.mp3 | 22-Apr-2007 14:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Warwickshire.mp3 | 22-Apr-2007 14:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Warwick.mp3 | 22-Apr-2007 14:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | Warton.mp3 | 22-Apr-2007 14:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | Warthe.mp3 | 22-Apr-2007 14:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | Warta.mp3 | 22-Apr-2007 14:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | Warszawa.mp3 | 22-Apr-2007 14:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | Warschau.mp3 | 22-Apr-2007 14:28 | 9.8K | |
![[SND]](/icons/sound2.gif) | Warrington.mp3 | 22-Apr-2007 14:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | Warner Robins.mp3 | 22-Apr-2007 14:27 | 13K | |
![[SND]](/icons/sound2.gif) | Warley.mp3 | 22-Apr-2007 14:26 | 6.1K | |
![[SND]](/icons/sound2.gif) | Warholian.mp3 | 22-Apr-2007 14:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | Warhol.mp3 | 22-Apr-2007 14:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | Warburton Creek.mp3 | 22-Apr-2007 14:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | Warburg.mp3 | 22-Apr-2007 14:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | Warbeck.mp3 | 22-Apr-2007 14:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | Warangal.mp3 | 22-Apr-2007 14:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wapusk National Park.mp3 | 22-Apr-2007 14:24 | 11K | |
![[SND]](/icons/sound2.gif) | Wapsipinicon.mp3 | 22-Apr-2007 14:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wanstead and Woodford.mp3 | 22-Apr-2007 14:23 | 13K | |
![[SND]](/icons/sound2.gif) | Wanne-Eickel.mp3 | 22-Apr-2007 14:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | Wankel engine.mp3 | 22-Apr-2007 14:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | Wanganui.mp3 | 22-Apr-2007 14:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wang Ching-wei.mp3 | 22-Apr-2007 14:22 | 14K | |
![[SND]](/icons/sound2.gif) | Wang.mp3 | 22-Apr-2007 14:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wandsworth.mp3 | 22-Apr-2007 14:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | Wanderlust.mp3 | 22-Apr-2007 14:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | Wanderjahr.mp3 | 22-Apr-2007 14:22 | 11K | |
![[SND]](/icons/sound2.gif) | Wanamaker.mp3 | 22-Apr-2007 14:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | Wampanoag.mp3 | 22-Apr-2007 14:21 | 11K | |
![[SND]](/icons/sound2.gif) | Walvis Bay.mp3 | 22-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | Walton.mp3 | 22-Apr-2007 14:21 | 5.9K | |
![[SND]](/icons/sound2.gif) | Walther von der Vogelweide.mp3 | 22-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | Walthamstow.mp3 | 22-Apr-2007 14:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | Waltham Forest.mp3 | 22-Apr-2007 14:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | Waltham.mp3 | 22-Apr-2007 14:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | Walter Mittyish.mp3 | 22-Apr-2007 14:20 | 12K | |
![[SND]](/icons/sound2.gif) | Walter Mitty.mp3 | 22-Apr-2007 14:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | Walsall.mp3 | 22-Apr-2007 14:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | Walpurgisnacht.mp3 | 22-Apr-2007 14:20 | 14K | |
![[SND]](/icons/sound2.gif) | Walpurgis Night.mp3 | 22-Apr-2007 14:20 | 13K | |
![[SND]](/icons/sound2.gif) | Walpolian.mp3 | 22-Apr-2007 14:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | Walpole.mp3 | 22-Apr-2007 14:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wallowa Mountains.mp3 | 22-Apr-2007 14:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wallops Island.mp3 | 22-Apr-2007 14:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | Walloon.mp3 | 22-Apr-2007 14:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wallis Islands.mp3 | 22-Apr-2007 14:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wallis.mp3 | 22-Apr-2007 14:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Wallingford.mp3 | 22-Apr-2007 14:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | Waller.mp3 | 22-Apr-2007 14:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wallenstein.mp3 | 22-Apr-2007 14:19 | 9.6K | |
![[SND]](/icons/sound2.gif) | Wallenberg.mp3 | 22-Apr-2007 14:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | Wallasey.mp3 | 22-Apr-2007 14:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wallachian.mp3 | 22-Apr-2007 14:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Wallachia.mp3 | 22-Apr-2007 14:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Wallach.mp3 | 22-Apr-2007 14:18 | 5.5K | |
![[SND]](/icons/sound2.gif) | Wallace.mp3 | 22-Apr-2007 14:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wallace's line.mp3 | 22-Apr-2007 14:18 | 11K | |
![[SND]](/icons/sound2.gif) | Walla Walla.mp3 | 22-Apr-2007 14:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wall Streeter.mp3 | 22-Apr-2007 14:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | Wall Street.mp3 | 22-Apr-2007 14:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Walkyrie.mp3 | 22-Apr-2007 14:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | Walkman.mp3 | 22-Apr-2007 14:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | Walhalla.mp3 | 22-Apr-2007 14:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | Walesa.mp3 | 22-Apr-2007 14:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | Wales.mp3 | 22-Apr-2007 14:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | Waldorf salad.mp3 | 22-Apr-2007 14:17 | 12K | |
![[SND]](/icons/sound2.gif) | Waldo.mp3 | 22-Apr-2007 14:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | Waldheim.mp3 | 22-Apr-2007 14:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | Waldersee.mp3 | 22-Apr-2007 14:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | Waldensian.mp3 | 22-Apr-2007 14:16 | 10K | |
![[SND]](/icons/sound2.gif) | Waldenses.mp3 | 22-Apr-2007 14:16 | 11K | |
![[SND]](/icons/sound2.gif) | Waldenburg.mp3 | 22-Apr-2007 14:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | Walden Pond.mp3 | 22-Apr-2007 14:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | Waldemar.mp3 | 22-Apr-2007 14:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | Waldeck.mp3 | 22-Apr-2007 14:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | Wald.mp3 | 22-Apr-2007 14:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | Walcott.mp3 | 22-Apr-2007 14:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | Walbrzych.mp3 | 22-Apr-2007 14:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | Waksman.mp3 | 22-Apr-2007 14:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | Wakefield.mp3 | 22-Apr-2007 14:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | Wake Island.mp3 | 22-Apr-2007 14:15 | 4.3K | |
![[SND]](/icons/sound2.gif) | Wakayama.mp3 | 22-Apr-2007 14:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wakashan.mp3 | 22-Apr-2007 14:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | Waite.mp3 | 22-Apr-2007 14:14 | 4.8K | |
![[SND]](/icons/sound2.gif) | Waitaki.mp3 | 22-Apr-2007 14:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | Waipahu.mp3 | 22-Apr-2007 14:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | Waimea Canyon.mp3 | 22-Apr-2007 14:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | Waimalu.mp3 | 22-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | Waikiki.mp3 | 22-Apr-2007 14:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | Waikato.mp3 | 22-Apr-2007 14:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | Waialeale, Mount.mp3 | 22-Apr-2007 14:13 | 11K | |
![[SND]](/icons/sound2.gif) | Wahhabite.mp3 | 22-Apr-2007 14:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | Wahhabism.mp3 | 22-Apr-2007 14:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wahhabi.mp3 | 22-Apr-2007 14:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wahabi.mp3 | 22-Apr-2007 14:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | Wagram.mp3 | 22-Apr-2007 14:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | Wagnerite.mp3 | 22-Apr-2007 14:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | Wagnerian.mp3 | 22-Apr-2007 14:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | Wagner.mp3 | 22-Apr-2007 14:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | Wagner-Jauregg.mp3 | 22-Apr-2007 14:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | Waf.mp3 | 22-Apr-2007 14:11 | 5.4K | |
![[SND]](/icons/sound2.gif) | Wadi el-'Arabah.mp3 | 22-Apr-2007 14:10 | 12K | |
![[SND]](/icons/sound2.gif) | Wade-Giles.mp3 | 22-Apr-2007 14:10 | 11K | |
![[SND]](/icons/sound2.gif) | Waddington, Mount.mp3 | 22-Apr-2007 14:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | Waddenzee.mp3 | 22-Apr-2007 14:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | Wad Medani.mp3 | 22-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | Waco.mp3 | 22-Apr-2007 14:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | Wace.mp3 | 22-Apr-2007 14:09 | 6.1K | |
![[SND]](/icons/sound2.gif) | Wac.mp3 | 22-Apr-2007 14:09 | 4.6K | |
![[SND]](/icons/sound2.gif) | Wabash.mp3 | 22-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | Waals, van der.mp3 | 22-Apr-2007 14:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | Waal.mp3 | 22-Apr-2007 14:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | Waadt.mp3 | 22-Apr-2007 14:08 | 4.8K | |
![[SND]](/icons/sound2.gif) | WYSIWYG.mp3 | 22-Apr-2007 16:08 | 7.9K | |
|