![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | szymanowski.mp3 | 21-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | szigeti.mp3 | 21-Apr-2007 21:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | szewinska.mp3 | 21-Apr-2007 21:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | szeryng.mp3 | 21-Apr-2007 21:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | szeping.mp3 | 21-Apr-2007 21:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | szentgyorgyi.mp3 | 21-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | szechwan.mp3 | 21-Apr-2007 21:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | szabadka.mp3 | 21-Apr-2007 21:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | syzygy.mp3 | 21-Apr-2007 21:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | syzran.mp3 | 21-Apr-2007 21:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | syver.mp3 | 21-Apr-2007 21:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | systyle.mp3 | 21-Apr-2007 21:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | systox.mp3 | 21-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | systolic.mp3 | 21-Apr-2007 21:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | systole.mp3 | 21-Apr-2007 21:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | systemoid.mp3 | 21-Apr-2007 21:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | systemless.mp3 | 21-Apr-2007 21:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | systemize.mp3 | 21-Apr-2007 21:10 | 10K | |
![[SND]](/icons/sound2.gif) | systemization.mp3 | 21-Apr-2007 21:10 | 11K | |
![[SND]](/icons/sound2.gif) | systemist.mp3 | 21-Apr-2007 21:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | systemic lupus erythematosus.mp3 | 21-Apr-2007 21:10 | 23K | |
![[SND]](/icons/sound2.gif) | systemicity.mp3 | 21-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | systemically.mp3 | 21-Apr-2007 21:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | systemic.mp3 | 21-Apr-2007 21:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | systemeinternationaldunites.mp3 | 21-Apr-2007 21:10 | 27K | |
![[SND]](/icons/sound2.gif) | systemed.mp3 | 21-Apr-2007 21:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | systematology.mp3 | 21-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | systematize.mp3 | 21-Apr-2007 21:10 | 11K | |
![[SND]](/icons/sound2.gif) | systematization.mp3 | 21-Apr-2007 21:10 | 12K | |
![[SND]](/icons/sound2.gif) | systematist.mp3 | 21-Apr-2007 21:10 | 10K | |
![[SND]](/icons/sound2.gif) | systematism.mp3 | 21-Apr-2007 21:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | systematics.mp3 | 21-Apr-2007 21:10 | 10K | |
![[SND]](/icons/sound2.gif) | systematicness.mp3 | 21-Apr-2007 21:10 | 12K | |
![[SND]](/icons/sound2.gif) | systematically.mp3 | 21-Apr-2007 21:10 | 10K | |
![[SND]](/icons/sound2.gif) | systematic.mp3 | 21-Apr-2007 21:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | system.mp3 | 21-Apr-2007 21:10 | 6.8K | |
![[SND]](/icons/sound2.gif) | systaltic.mp3 | 21-Apr-2007 21:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | syssarcosis.mp3 | 21-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | sysop.mp3 | 21-Apr-2007 21:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | sysgen.mp3 | 21-Apr-2007 21:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | sys.mp3 | 21-Apr-2007 21:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | syrupy.mp3 | 21-Apr-2007 21:09 | 27K | |
![[SND]](/icons/sound2.gif) | syrup.mp3 | 21-Apr-2007 21:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | syrtismajor.mp3 | 21-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | syrtis.mp3 | 21-Apr-2007 21:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | syrtic.mp3 | 21-Apr-2007 21:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | syrphid fly.mp3 | 21-Apr-2007 21:09 | 11K | |
![[SND]](/icons/sound2.gif) | syrphid.mp3 | 21-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | syroco.mp3 | 21-Apr-2007 21:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | syro.mp3 | 21-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | syrinx.mp3 | 21-Apr-2007 21:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | syringomyelic.mp3 | 21-Apr-2007 21:09 | 13K | |
![[SND]](/icons/sound2.gif) | syringomyelia.mp3 | 21-Apr-2007 21:09 | 14K | |
![[SND]](/icons/sound2.gif) | syringitis.mp3 | 21-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | syringes.mp3 | 21-Apr-2007 21:09 | 9.8K | |
![[SND]](/icons/sound2.gif) | syringeal.mp3 | 21-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | syringe.mp3 | 21-Apr-2007 21:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | syringa.mp3 | 21-Apr-2007 21:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | syriacism.mp3 | 21-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | syrette.mp3 | 21-Apr-2007 21:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | syren.mp3 | 21-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | syrdarya.mp3 | 21-Apr-2007 21:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | syra.mp3 | 21-Apr-2007 21:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | syphon.mp3 | 21-Apr-2007 21:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | sypho.mp3 | 21-Apr-2007 21:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | syphilous.mp3 | 21-Apr-2007 21:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | syphiloma.mp3 | 21-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | syphilology.mp3 | 21-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | syphiloid.mp3 | 21-Apr-2007 21:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | syphilo.mp3 | 21-Apr-2007 21:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | syphilize.mp3 | 21-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | syphilitic.mp3 | 21-Apr-2007 21:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | syphilis.mp3 | 21-Apr-2007 21:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | syphilid.mp3 | 21-Apr-2007 21:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | syphil.mp3 | 21-Apr-2007 21:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sypher.mp3 | 21-Apr-2007 21:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | syph.mp3 | 21-Apr-2007 21:08 | 5.5K | |
![[SND]](/icons/sound2.gif) | syonpark.mp3 | 21-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | synura.mp3 | 21-Apr-2007 21:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | syntype.mp3 | 21-Apr-2007 21:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | syntrophoblast.mp3 | 21-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | syntony.mp3 | 21-Apr-2007 21:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | syntonous.mp3 | 21-Apr-2007 21:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | syntonize.mp3 | 21-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | syntonism.mp3 | 21-Apr-2007 21:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | syntonic.mp3 | 21-Apr-2007 21:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | synthpop.mp3 | 21-Apr-2007 21:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | synthol.mp3 | 21-Apr-2007 21:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | synthetograph.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synthetize.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synthetist.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synthetism.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synthetics.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | syntheticism.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synthetically.mp3 | 21-Apr-2007 21:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | synthetic.mp3 | 21-Apr-2007 21:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | synthetase.mp3 | 21-Apr-2007 21:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | synthesizer.mp3 | 21-Apr-2007 21:07 | 10K | |
![[SND]](/icons/sound2.gif) | synthesize.mp3 | 21-Apr-2007 21:07 | 10K | |
![[SND]](/icons/sound2.gif) | synthesist.mp3 | 21-Apr-2007 21:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | synthesis.mp3 | 21-Apr-2007 21:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | syntheses.mp3 | 21-Apr-2007 21:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | synthase.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synth.mp3 | 21-Apr-2007 21:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | syntexis.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synteresis.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | synteny.mp3 | 21-Apr-2007 21:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | syntechnic.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | syntaxic.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | syntax.mp3 | 21-Apr-2007 21:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | syntality.mp3 | 21-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | syntagmatic.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | syntagma.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | syntactics.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | syntactic.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synspermy.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synsepalous.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synsacrum.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synroc.mp3 | 21-Apr-2007 21:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | synpetalous.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synovium.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synovitis.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synovia.mp3 | 21-Apr-2007 21:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | synovectomy.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synousiacs.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synostosis.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synosteosis.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synoptist.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synoptic.mp3 | 21-Apr-2007 21:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | synopsize.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synopsis.mp3 | 21-Apr-2007 21:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | synophthalmia.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synonymy.mp3 | 21-Apr-2007 21:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | synonymous.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synonymize.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synonymist.mp3 | 21-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | synonymics.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synonym.mp3 | 21-Apr-2007 21:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | synoicous.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synoecize.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synoecism.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synoecete.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synodofwhitby.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synodic.mp3 | 21-Apr-2007 21:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | synod.mp3 | 21-Apr-2007 21:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | synnema.mp3 | 21-Apr-2007 21:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | synmetal.mp3 | 21-Apr-2007 21:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | synkinesis.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synkaryon.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synizesis.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | syngraft.mp3 | 21-Apr-2007 21:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | syngenesis.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | syngenesious.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | syngeneic.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synge.mp3 | 21-Apr-2007 21:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | syngamy.mp3 | 21-Apr-2007 21:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | synfuel.mp3 | 21-Apr-2007 21:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | synesthesia.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synesis.mp3 | 21-Apr-2007 21:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | synergy.mp3 | 21-Apr-2007 21:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | synergize.mp3 | 21-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | synergistic.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synergist.mp3 | 21-Apr-2007 21:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | synergism.mp3 | 21-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | synergid.mp3 | 21-Apr-2007 21:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | synergic.mp3 | 21-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | synergetic.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synergamy.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | syneresis.mp3 | 21-Apr-2007 21:04 | 10K | |
![[SND]](/icons/sound2.gif) | synedrial.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synectics.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synecology.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synecious.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synechthry.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synechism.mp3 | 21-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | synechia.mp3 | 21-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | synecdochism.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | synecdoche.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | syne.mp3 | 21-Apr-2007 21:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | syndrome.mp3 | 21-Apr-2007 21:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | syndiotactic.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | syndicator.mp3 | 21-Apr-2007 21:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | syndicate.mp3 | 21-Apr-2007 21:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | syndicalism.mp3 | 21-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | syndical.mp3 | 21-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | syndic.mp3 | 21-Apr-2007 21:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | syndeton.mp3 | 21-Apr-2007 21:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | syndetic.mp3 | 21-Apr-2007 21:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | syndet.mp3 | 21-Apr-2007 21:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | syndesmosis.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syndesmectomy.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syndesm.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syndesis.mp3 | 21-Apr-2007 21:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | synderesis.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syndactylus.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syndactyl.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | synd.mp3 | 21-Apr-2007 21:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | syncytium.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syncrude.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syncrisis.mp3 | 21-Apr-2007 21:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | syncretize.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syncretism.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syncope.mp3 | 21-Apr-2007 21:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | syncopation.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syncopated.mp3 | 21-Apr-2007 21:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | syncopate.mp3 | 21-Apr-2007 21:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | syncom.mp3 | 21-Apr-2007 21:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | synclinorium.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | syncline.mp3 | 21-Apr-2007 21:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | synclinal.mp3 | 21-Apr-2007 21:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | synclavier.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | synclastic.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | synchrotron.mp3 | 21-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | synchroscope.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchropter.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchrony.mp3 | 21-Apr-2007 21:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | synchronous.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchronoscope.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchronize.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchronism.mp3 | 21-Apr-2007 21:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | synchronicity.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchronic.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchroneity.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synchronal.mp3 | 21-Apr-2007 21:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | synchromism.mp3 | 21-Apr-2007 21:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | synchro.mp3 | 21-Apr-2007 21:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | synchondrosis.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | syncerebrum.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | syncategorematic.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | syncarpous.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | syncarp.mp3 | 21-Apr-2007 21:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | sync.mp3 | 21-Apr-2007 21:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | synaxis.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synaxary.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synaxarium.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synaxarion.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synastry.mp3 | 21-Apr-2007 21:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | synarthrosis.mp3 | 21-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | synarthrodia.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synarchy.mp3 | 21-Apr-2007 21:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | synaptosome.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synaptonemalcomplex.mp3 | 21-Apr-2007 21:01 | 27K | |
![[SND]](/icons/sound2.gif) | synaptonemal complex.mp3 | 21-Apr-2007 21:01 | 18K | |
![[SND]](/icons/sound2.gif) | synaptology.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synaptene.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synapte.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synapsis.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synapse.mp3 | 21-Apr-2007 21:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | synanthy.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synanthropic.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synanthous.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synantherous.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synanon.mp3 | 21-Apr-2007 21:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | synaloepha.mp3 | 21-Apr-2007 21:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | synallagmatic.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synalgia.mp3 | 21-Apr-2007 21:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | synagogue.mp3 | 21-Apr-2007 21:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | synaesthesis.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synaesthesia.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synaeresis.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | synactic.mp3 | 21-Apr-2007 21:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | syn.mp3 | 21-Apr-2007 21:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | symptosis.mp3 | 21-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | symptomology.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symptomless.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symptomize.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symptomatology.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symptomatize.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symptomatic.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symptom.mp3 | 21-Apr-2007 21:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | symposium.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symposiarch.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symposial.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symposiac.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | sympodium.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symploce.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symplegades.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symplast.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symphysis.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symphysiotomy.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symphysial.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symphyllous.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symphony.mp3 | 21-Apr-2007 21:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | symphonize.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symphonist.mp3 | 21-Apr-2007 21:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | symphonious.mp3 | 21-Apr-2007 21:00 | 10K | |
![[SND]](/icons/sound2.gif) | symphoniefantastique.mp3 | 21-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | symphonic.mp3 | 21-Apr-2007 20:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | symphonia.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | symphonette.mp3 | 21-Apr-2007 20:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | symphily.mp3 | 21-Apr-2007 20:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | symphilism.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | symphilid.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | symphile.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympetalous.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympatric.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympatico.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympathy.mp3 | 21-Apr-2007 20:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | sympathomimetic.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympatholytic.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympathizer.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympathize.mp3 | 21-Apr-2007 20:59 | 11K | |
![[SND]](/icons/sound2.gif) | sympathique.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympathin.mp3 | 21-Apr-2007 20:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | sympathetically.mp3 | 21-Apr-2007 20:59 | 10K | |
![[SND]](/icons/sound2.gif) | sympathetic.mp3 | 21-Apr-2007 20:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | sympathetectomy.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | sympathectomy.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | symons.mp3 | 21-Apr-2007 20:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | symonds.mp3 | 21-Apr-2007 20:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | symmetry.mp3 | 21-Apr-2007 20:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | symmetrophobia.mp3 | 21-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | symmetrize.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symmetricdifference.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symmetrical.mp3 | 21-Apr-2007 20:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | symmetrel.mp3 | 21-Apr-2007 20:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | symmetalism.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symmachus.mp3 | 21-Apr-2007 20:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | symington.mp3 | 21-Apr-2007 20:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | symbolophobia.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symbololatry.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symbology.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symbolize.mp3 | 21-Apr-2007 20:58 | 9.8K | |
![[SND]](/icons/sound2.gif) | symbolization.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symbolist.mp3 | 21-Apr-2007 20:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | symbolism.mp3 | 21-Apr-2007 20:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | symbolics.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symbolic.mp3 | 21-Apr-2007 20:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | symboleography.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symbol.mp3 | 21-Apr-2007 20:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | symbiosis.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symbiont.mp3 | 21-Apr-2007 20:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | symbionese.mp3 | 21-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | symar.mp3 | 21-Apr-2007 20:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | sym.mp3 | 21-Apr-2007 20:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylvite.mp3 | 21-Apr-2007 20:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylvis.mp3 | 21-Apr-2007 20:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | sylvinite.mp3 | 21-Apr-2007 20:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | sylvie.mp3 | 21-Apr-2007 20:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylviculture.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | sylvicacid.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | sylvianfissure.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | sylvia.mp3 | 21-Apr-2007 20:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylvestral.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | sylvester.mp3 | 21-Apr-2007 20:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | sylvatic.mp3 | 21-Apr-2007 20:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | sylvanus.mp3 | 21-Apr-2007 20:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | sylvanite.mp3 | 21-Apr-2007 20:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | sylvania.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | sylvaner.mp3 | 21-Apr-2007 20:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | sylvana.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | sylvan.mp3 | 21-Apr-2007 20:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylva.mp3 | 21-Apr-2007 20:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylt.mp3 | 21-Apr-2007 20:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylphid.mp3 | 21-Apr-2007 20:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sylph.mp3 | 21-Apr-2007 20:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | syllogize.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | syllogistic.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | syllogist.mp3 | 21-Apr-2007 20:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | syllogism.mp3 | 21-Apr-2007 20:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | syllepsis.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | syllabus.mp3 | 21-Apr-2007 20:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | syllabub.mp3 | 21-Apr-2007 20:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | syllabography.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | syllable.mp3 | 21-Apr-2007 20:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | syllabize.mp3 | 21-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | syllabism.mp3 | 21-Apr-2007 20:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | syllabify.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | syllabicity.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | syllabication.mp3 | 21-Apr-2007 20:56 | 11K | |
![[SND]](/icons/sound2.gif) | syllabicate.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | syllabic.mp3 | 21-Apr-2007 20:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | syllabi.mp3 | 21-Apr-2007 20:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | syllabary.mp3 | 21-Apr-2007 20:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | syllabarium.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | syli.mp3 | 21-Apr-2007 20:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | syl.mp3 | 21-Apr-2007 20:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | syktyvkar.mp3 | 21-Apr-2007 20:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | syke.mp3 | 21-Apr-2007 20:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | syff.mp3 | 21-Apr-2007 20:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | syenite.mp3 | 21-Apr-2007 20:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | sydneyite.mp3 | 21-Apr-2007 20:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | sydenhamschorea.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | syd.mp3 | 21-Apr-2007 20:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | sycosis.mp3 | 21-Apr-2007 20:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | sycophantism.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | sycophantish.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | sycophantic.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | sycophant.mp3 | 21-Apr-2007 20:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | sycophancy.mp3 | 21-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | syconoid.mp3 | 21-Apr-2007 20:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | syconium.mp3 | 21-Apr-2007 20:55 | 17K | |
![[SND]](/icons/sound2.gif) | sycon.mp3 | 21-Apr-2007 20:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | sychem.mp3 | 21-Apr-2007 20:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | sycee.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | syce.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sycamore.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sycamine.mp3 | 21-Apr-2007 20:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | sybo.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sybil.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sybaritic.mp3 | 21-Apr-2007 20:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | sybaris.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sy.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | swy.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | swung.mp3 | 21-Apr-2007 20:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | swum.mp3 | 21-Apr-2007 20:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | swozzled.mp3 | 21-Apr-2007 20:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | swounds.mp3 | 21-Apr-2007 20:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | swound.mp3 | 21-Apr-2007 20:55 | 27K | |
![[SND]](/icons/sound2.gif) | swotter.mp3 | 21-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | swot.mp3 | 21-Apr-2007 20:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | sworn.mp3 | 21-Apr-2007 20:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | swore.mp3 | 21-Apr-2007 20:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | swordweed.mp3 | 21-Apr-2007 20:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | swordsman.mp3 | 21-Apr-2007 20:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | sword of Damocles.mp3 | 21-Apr-2007 20:54 | 14K | |
![[SND]](/icons/sound2.gif) | swordman.mp3 | 21-Apr-2007 20:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | sword.mp3 | 21-Apr-2007 20:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | swop.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swoozled.mp3 | 21-Apr-2007 20:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | swoosh.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swoopstake.mp3 | 21-Apr-2007 20:54 | 17K | |
![[SND]](/icons/sound2.gif) | swoop.mp3 | 21-Apr-2007 20:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | swoony.mp3 | 21-Apr-2007 20:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | swoon.mp3 | 21-Apr-2007 20:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | swonken.mp3 | 21-Apr-2007 20:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | swonk.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swollen.mp3 | 21-Apr-2007 20:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | swobble.mp3 | 21-Apr-2007 20:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | swob.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swizzled.mp3 | 21-Apr-2007 20:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | swizzle.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swizz.mp3 | 21-Apr-2007 20:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | swivet.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swiveller.mp3 | 21-Apr-2007 20:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | swivel.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swivel-hipped.mp3 | 21-Apr-2007 20:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | swive.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | switzer.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swithin.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swither.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | swith.mp3 | 21-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | switchman.mp3 | 21-Apr-2007 20:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | switcheroo.mp3 | 21-Apr-2007 20:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | switcher.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | switchedoff.mp3 | 21-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | switchblade.mp3 | 21-Apr-2007 20:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | switch.mp3 | 21-Apr-2007 20:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | switch-hit.mp3 | 21-Apr-2007 20:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | swissification.mp3 | 21-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | swisser.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swishy.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swish.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swirly.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swirl.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swipple.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swipes.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swipe.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swinney.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swinnerton.mp3 | 21-Apr-2007 20:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | swink.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swinish.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swingy.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swingometer.mp3 | 21-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | swingman.mp3 | 21-Apr-2007 20:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | swingle.mp3 | 21-Apr-2007 20:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | swinging.mp3 | 21-Apr-2007 20:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | swinger.mp3 | 21-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | swingeing.mp3 | 21-Apr-2007 20:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | swinge.mp3 | 21-Apr-2007 20:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | swing.mp3 | 21-Apr-2007 20:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | swinery.mp3 | 21-Apr-2007 20:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | swine.mp3 | 21-Apr-2007 20:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | swindon.mp3 | 21-Apr-2007 20:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | swindler.mp3 | 21-Apr-2007 20:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | swindled.mp3 | 21-Apr-2007 20:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | swindle.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swinburne.mp3 | 21-Apr-2007 20:52 | 17K | |
![[SND]](/icons/sound2.gif) | swimsuit.mp3 | 21-Apr-2007 20:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | swimmy.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swimmingly.mp3 | 21-Apr-2007 20:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | swimming.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swimmeret.mp3 | 21-Apr-2007 20:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | swim.mp3 | 21-Apr-2007 20:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | swilling.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swill.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swigged.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swig.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swiftlet.mp3 | 21-Apr-2007 20:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | swiftie.mp3 | 21-Apr-2007 20:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | swifter.mp3 | 21-Apr-2007 20:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | swiftair.mp3 | 21-Apr-2007 20:52 | 17K | |
![[SND]](/icons/sound2.gif) | swift.mp3 | 21-Apr-2007 20:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | swidden.mp3 | 21-Apr-2007 20:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | sweyn.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swey.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweven.mp3 | 21-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | swerve.mp3 | 21-Apr-2007 20:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | swept.mp3 | 21-Apr-2007 20:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | swept-back.mp3 | 21-Apr-2007 20:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | swensker.mp3 | 21-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | swensens.mp3 | 21-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | sweltry.mp3 | 21-Apr-2007 20:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sweltering.mp3 | 21-Apr-2007 20:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | swelter.mp3 | 21-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | swelp.mp3 | 21-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | swellmobsman.mp3 | 21-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | swellish.mp3 | 21-Apr-2007 20:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | swelling.mp3 | 21-Apr-2007 20:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | swelled-headed.mp3 | 21-Apr-2007 20:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | swelldom.mp3 | 21-Apr-2007 20:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | swell.mp3 | 21-Apr-2007 20:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | swell-front.mp3 | 21-Apr-2007 20:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sweir.mp3 | 21-Apr-2007 20:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sweetwort.mp3 | 21-Apr-2007 20:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | sweet william.mp3 | 21-Apr-2007 20:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | sweetwater.mp3 | 21-Apr-2007 20:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sweetnlow.mp3 | 21-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | sweetmouth.mp3 | 21-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | sweetman.mp3 | 21-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | sweetish.mp3 | 21-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweeting.mp3 | 21-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweetie.mp3 | 21-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweetheart.mp3 | 21-Apr-2007 20:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | sweetening.mp3 | 21-Apr-2007 20:50 | 17K | |
![[SND]](/icons/sound2.gif) | sweetener.mp3 | 21-Apr-2007 20:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | sweeten.mp3 | 21-Apr-2007 20:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | sweetbrier.mp3 | 21-Apr-2007 20:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | sweetbriar.mp3 | 21-Apr-2007 20:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | sweet.mp3 | 21-Apr-2007 20:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | sweet-talk.mp3 | 21-Apr-2007 20:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | sweer.mp3 | 21-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweepy.mp3 | 21-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweepstakes.mp3 | 21-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sweeps.mp3 | 21-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweepo.mp3 | 21-Apr-2007 20:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | sweepingly.mp3 | 21-Apr-2007 20:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | sweeping.mp3 | 21-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sweeper.mp3 | 21-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweepea.mp3 | 21-Apr-2007 20:50 | 17K | |
![[SND]](/icons/sound2.gif) | sweep.mp3 | 21-Apr-2007 20:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | sweep-second hand.mp3 | 21-Apr-2007 20:50 | 14K | |
![[SND]](/icons/sound2.gif) | sweeny.mp3 | 21-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweelinck.mp3 | 21-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | swedenborgian.mp3 | 21-Apr-2007 20:50 | 17K | |
![[SND]](/icons/sound2.gif) | swedenborg.mp3 | 21-Apr-2007 20:50 | 17K | |
![[SND]](/icons/sound2.gif) | sweaty.mp3 | 21-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweatweed.mp3 | 21-Apr-2007 20:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | sweatshirt.mp3 | 21-Apr-2007 20:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | sweater.mp3 | 21-Apr-2007 20:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | sweater-vest.mp3 | 21-Apr-2007 20:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | sweated.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sweatband.mp3 | 21-Apr-2007 20:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | sweat.mp3 | 21-Apr-2007 20:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | swear.mp3 | 21-Apr-2007 20:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | sweal.mp3 | 21-Apr-2007 20:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | swazzled.mp3 | 21-Apr-2007 20:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | swazzle.mp3 | 21-Apr-2007 20:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | swaziterritory.mp3 | 21-Apr-2007 20:49 | 17K | |
![[SND]](/icons/sound2.gif) | swaziland.mp3 | 21-Apr-2007 20:49 | 17K | |
![[SND]](/icons/sound2.gif) | swayed.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sway.mp3 | 21-Apr-2007 20:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | swave.mp3 | 21-Apr-2007 20:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | swatter.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | swats.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | swati.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | swathe.mp3 | 21-Apr-2007 20:49 | 27K | |
![[SND]](/icons/sound2.gif) | swath.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | swatchel.mp3 | 21-Apr-2007 20:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | swatch.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | swat.mp3 | 21-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | swastika.mp3 | 21-Apr-2007 20:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | swashing.mp3 | 21-Apr-2007 20:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | swashbuckling.mp3 | 21-Apr-2007 20:49 | 17K | |
![[SND]](/icons/sound2.gif) | swashbuckler.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swashbuckle.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swash.mp3 | 21-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | swartzite.mp3 | 21-Apr-2007 20:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | swartzer.mp3 | 21-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | swartkransapeman.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swarthy.mp3 | 21-Apr-2007 20:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | swarth.mp3 | 21-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | swartgevaar.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swart.mp3 | 21-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | swarovski.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swarmer.mp3 | 21-Apr-2007 20:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | swarm.mp3 | 21-Apr-2007 20:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | swarf.mp3 | 21-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | sware.mp3 | 21-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | sward.mp3 | 21-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | swaraj.mp3 | 21-Apr-2007 20:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | swaption.mp3 | 21-Apr-2007 20:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | swapo.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swap.mp3 | 21-Apr-2007 20:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | swanupping.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swanson.mp3 | 21-Apr-2007 20:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | swansea.mp3 | 21-Apr-2007 20:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | swansdown.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swanscombeman.mp3 | 21-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | swannery.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swanndri.mp3 | 21-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | swanky.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swank.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swang.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swanee.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swan.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swamy.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swampy.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swampscott.mp3 | 21-Apr-2007 20:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | swamper.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swamped.mp3 | 21-Apr-2007 20:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | swamp.mp3 | 21-Apr-2007 20:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | swammerdam.mp3 | 21-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | swami.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swam.mp3 | 21-Apr-2007 20:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | swallowwort.mp3 | 21-Apr-2007 20:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | swallow.mp3 | 21-Apr-2007 20:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | swallet.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swalk.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swaledale.mp3 | 21-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | swale.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swak.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swainsonshawk.mp3 | 21-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | swain.mp3 | 21-Apr-2007 20:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | swailer.mp3 | 21-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | swahili.mp3 | 21-Apr-2007 20:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | swagman.mp3 | 21-Apr-2007 20:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | swaggie.mp3 | 21-Apr-2007 20:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | swaggering.mp3 | 21-Apr-2007 20:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | swagger.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swage.mp3 | 21-Apr-2007 20:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | swag.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swadish.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swadeshi.mp3 | 21-Apr-2007 20:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | swaddy.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swaddle.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swad.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swacked.mp3 | 21-Apr-2007 20:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | swabby.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swabber.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | swab.mp3 | 21-Apr-2007 20:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | svevo.mp3 | 21-Apr-2007 20:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | svetlana.mp3 | 21-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | svetambara.mp3 | 21-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | sverige.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | sverdrup.mp3 | 21-Apr-2007 20:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | svengali.mp3 | 21-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | svelte.mp3 | 21-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | svedberg.mp3 | 21-Apr-2007 20:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | svarabhakti.mp3 | 21-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | svanbergite.mp3 | 21-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | svalbard.mp3 | 21-Apr-2007 20:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | suzy.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | suzie.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | suzerainty.mp3 | 21-Apr-2007 20:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | suzerain.mp3 | 21-Apr-2007 20:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | suwon.mp3 | 21-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | suwannee.mp3 | 21-Apr-2007 20:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | suvorov.mp3 | 21-Apr-2007 20:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | suva.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | suumcuique.mp3 | 21-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | suture.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | suttung.mp3 | 21-Apr-2007 20:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | suttoninashfield.mp3 | 21-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | suttonhoo.mp3 | 21-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | suttoncoldfield.mp3 | 21-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | sutton.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | suttner.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sutter.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | suttee.mp3 | 21-Apr-2007 20:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | suttapitaka.mp3 | 21-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | sutra.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sutler.mp3 | 21-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sutlej.mp3 | 21-Apr-2007 20:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | sutherlandfalls.mp3 | 21-Apr-2007 20:44 | 17K | |
![[SND]](/icons/sound2.gif) | sutherland.mp3 | 21-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | sute.mp3 | 21-Apr-2007 20:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | sutcliffe.mp3 | 21-Apr-2007 20:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | susy.mp3 | 21-Apr-2007 20:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | susurrus.mp3 | 21-Apr-2007 20:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | susurrous.mp3 | 21-Apr-2007 20:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | susurration.mp3 | 21-Apr-2007 20:44 | 17K | |
![[SND]](/icons/sound2.gif) | susurrate.mp3 | 21-Apr-2007 20:44 | 17K | |
![[SND]](/icons/sound2.gif) | susurrant.mp3 | 21-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | susu.mp3 | 21-Apr-2007 20:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | sustineoalas.mp3 | 21-Apr-2007 20:44 | 17K | |
![[SND]](/icons/sound2.gif) | sustention.mp3 | 21-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | sustentation.mp3 | 21-Apr-2007 20:44 | 17K | |
![[SND]](/icons/sound2.gif) | sustentaculum.mp3 | 21-Apr-2007 20:44 | 17K | |
![[SND]](/icons/sound2.gif) | sustentacular cell.mp3 | 21-Apr-2007 20:44 | 15K | |
![[SND]](/icons/sound2.gif) | sustentacular.mp3 | 21-Apr-2007 20:44 | 17K | |
![[SND]](/icons/sound2.gif) | sustenance.mp3 | 21-Apr-2007 20:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | sustaining.mp3 | 21-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | sustainer.mp3 | 21-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | sustained-release.mp3 | 21-Apr-2007 20:43 | 13K | |
![[SND]](/icons/sound2.gif) | sustainable.mp3 | 21-Apr-2007 20:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | sustain.mp3 | 21-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | sussy.mp3 | 21-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | susso.mp3 | 21-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | sussex.mp3 | 21-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | sussed.mp3 | 21-Apr-2007 20:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | suss.mp3 | 21-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | susquehanna.mp3 | 21-Apr-2007 20:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | suspire.mp3 | 21-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | suspiration.mp3 | 21-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | suspicious.mp3 | 21-Apr-2007 20:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | suspicional.mp3 | 21-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | suspicion.mp3 | 21-Apr-2007 20:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | suspensory.mp3 | 21-Apr-2007 20:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | suspensor.mp3 | 21-Apr-2007 20:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | suspensoid.mp3 | 21-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | suspensive.mp3 | 21-Apr-2007 20:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | suspension.mp3 | 21-Apr-2007 20:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | suspensible.mp3 | 21-Apr-2007 20:42 | 17K | |
![[SND]](/icons/sound2.gif) | suspenser.mp3 | 21-Apr-2007 20:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | suspense.mp3 | 21-Apr-2007 20:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | suspender.mp3 | 21-Apr-2007 20:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | suspend.mp3 | 21-Apr-2007 20:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | suspect.mp3 | 21-Apr-2007 20:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | suslik.mp3 | 21-Apr-2007 20:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | susie.mp3 | 21-Apr-2007 20:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | susian.mp3 | 21-Apr-2007 20:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | sushi.mp3 | 21-Apr-2007 20:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | sush.mp3 | 21-Apr-2007 20:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | susette.mp3 | 21-Apr-2007 20:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | susceptive.mp3 | 21-Apr-2007 20:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | susceptible.mp3 | 21-Apr-2007 20:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | susceptibility.mp3 | 21-Apr-2007 20:42 | 11K | |
![[SND]](/icons/sound2.gif) | susceptance.mp3 | 21-Apr-2007 20:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | susanne.mp3 | 21-Apr-2007 20:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | susanna.mp3 | 21-Apr-2007 20:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | susann.mp3 | 21-Apr-2007 20:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | susan.mp3 | 21-Apr-2007 20:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | sus.mp3 | 21-Apr-2007 20:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | survivor.mp3 | 21-Apr-2007 20:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | surviving.mp3 | 21-Apr-2007 20:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | survive.mp3 | 21-Apr-2007 20:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | survivance.mp3 | 21-Apr-2007 20:41 | 17K | |
![[SND]](/icons/sound2.gif) | survival.mp3 | 21-Apr-2007 20:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | survivable.mp3 | 21-Apr-2007 20:41 | 17K | |
![[SND]](/icons/sound2.gif) | surveyor.mp3 | 21-Apr-2007 20:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | surveying.mp3 | 21-Apr-2007 20:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | survey.mp3 | 21-Apr-2007 20:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | surveillant.mp3 | 21-Apr-2007 20:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | surveillance.mp3 | 21-Apr-2007 20:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | surveil.mp3 | 21-Apr-2007 20:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | surtsey.mp3 | 21-Apr-2007 20:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | surtout.mp3 | 21-Apr-2007 20:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | surtitle.mp3 | 21-Apr-2007 20:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | surtees.mp3 | 21-Apr-2007 20:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | surtax.mp3 | 21-Apr-2007 20:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | surt.mp3 | 21-Apr-2007 20:40 | 18K | |
![[SND]](/icons/sound2.gif) | sursumcorda.mp3 | 21-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | surroyal.mp3 | 21-Apr-2007 20:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | surroundings.mp3 | 21-Apr-2007 20:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | surrounding.mp3 | 21-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | surround.mp3 | 21-Apr-2007 20:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | surrogate.mp3 | 21-Apr-2007 20:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | surrogacy.mp3 | 21-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | surrey.mp3 | 21-Apr-2007 20:40 | 5.9K | |
![[SND]](/icons/sound2.gif) | surreptitious.mp3 | 21-Apr-2007 20:40 | 10K | |
![[SND]](/icons/sound2.gif) | surrentum.mp3 | 21-Apr-2007 20:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | surrender.mp3 | 21-Apr-2007 20:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | surrebuttal.mp3 | 21-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | surrealistic.mp3 | 21-Apr-2007 20:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | surrealism.mp3 | 21-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | surreal.mp3 | 21-Apr-2007 20:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | surratt.mp3 | 21-Apr-2007 20:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | surra.mp3 | 21-Apr-2007 20:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | surprisingly.mp3 | 21-Apr-2007 20:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | surprising.mp3 | 21-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | surprised.mp3 | 21-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | surprise.mp3 | 21-Apr-2007 20:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | surprisal.mp3 | 21-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | surprint.mp3 | 21-Apr-2007 20:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | surplusage.mp3 | 21-Apr-2007 20:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | surplus.mp3 | 21-Apr-2007 20:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | surplice.mp3 | 21-Apr-2007 15:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sur place.mp3 | 21-Apr-2007 15:48 | 10K | |
![[SND]](/icons/sound2.gif) | surpassing.mp3 | 21-Apr-2007 15:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | surpass.mp3 | 21-Apr-2007 15:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | surname.mp3 | 21-Apr-2007 15:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | surmullet.mp3 | 21-Apr-2007 15:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | surmount.mp3 | 21-Apr-2007 15:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | surmise.mp3 | 21-Apr-2007 15:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | surly.mp3 | 21-Apr-2007 15:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | surloin.mp3 | 21-Apr-2007 15:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | surjective.mp3 | 21-Apr-2007 15:50 | 17K | |
![[SND]](/icons/sound2.gif) | surjection.mp3 | 21-Apr-2007 15:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | suricate.mp3 | 21-Apr-2007 15:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | surgy.mp3 | 21-Apr-2007 15:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | surgicenter.mp3 | 21-Apr-2007 15:50 | 17K | |
![[SND]](/icons/sound2.gif) | surgical.mp3 | 21-Apr-2007 15:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | surgery.mp3 | 21-Apr-2007 15:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | surgeon.mp3 | 21-Apr-2007 15:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | surge.mp3 | 21-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | surfy.mp3 | 21-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | surfperch.mp3 | 21-Apr-2007 15:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | surfnturf.mp3 | 21-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | surfman.mp3 | 21-Apr-2007 15:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | surfing.mp3 | 21-Apr-2007 15:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | surfie.mp3 | 21-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | surficial.mp3 | 21-Apr-2007 15:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | surfeit.mp3 | 21-Apr-2007 15:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | surfari.mp3 | 21-Apr-2007 15:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | surfactant.mp3 | 21-Apr-2007 15:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | surfacing.mp3 | 21-Apr-2007 15:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | surfaceman.mp3 | 21-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | surface.mp3 | 21-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | surfable.mp3 | 21-Apr-2007 15:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | surf.mp3 | 21-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | surety.mp3 | 21-Apr-2007 15:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | surete.mp3 | 21-Apr-2007 15:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | surely.mp3 | 21-Apr-2007 15:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | sure.mp3 | 21-Apr-2007 15:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | sure-handed.mp3 | 21-Apr-2007 15:49 | 10K | |
![[SND]](/icons/sound2.gif) | sure-footed.mp3 | 21-Apr-2007 15:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | sure-enough.mp3 | 21-Apr-2007 15:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | surd.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | surculose.mp3 | 21-Apr-2007 15:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | surcoat.mp3 | 21-Apr-2007 15:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | surcingle.mp3 | 21-Apr-2007 15:48 | 17K | |
![[SND]](/icons/sound2.gif) | surcharge.mp3 | 21-Apr-2007 15:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | surcease.mp3 | 21-Apr-2007 15:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | surbased.mp3 | 21-Apr-2007 15:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | surbase.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | surat.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | sural.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | surakarta.mp3 | 21-Apr-2007 15:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | surajahdowlah.mp3 | 21-Apr-2007 15:48 | 17K | |
![[SND]](/icons/sound2.gif) | surah.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | surabaya.mp3 | 21-Apr-2007 15:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | sura.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | sur.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | suqutra.mp3 | 21-Apr-2007 15:48 | 17K | |
![[SND]](/icons/sound2.gif) | suquamish.mp3 | 21-Apr-2007 15:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | suq.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | supremum.mp3 | 21-Apr-2007 15:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | supremo.mp3 | 21-Apr-2007 15:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | supreme.mp3 | 21-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | suprematism.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | supremacy.mp3 | 21-Apr-2007 15:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | supremacist.mp3 | 21-Apr-2007 15:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | supralapsarianism.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | suprachiasmatic nucleus.mp3 | 21-Apr-2007 15:47 | 13K | |
![[SND]](/icons/sound2.gif) | supra.mp3 | 21-Apr-2007 15:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | suppurative.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | suppuration.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | suppurate.mp3 | 21-Apr-2007 15:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | suppressor.mp3 | 21-Apr-2007 15:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | suppressive.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | suppressioveri.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | suppression.mp3 | 21-Apr-2007 15:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | suppressible.mp3 | 21-Apr-2007 15:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | suppresser.mp3 | 21-Apr-2007 15:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | suppressant.mp3 | 21-Apr-2007 15:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | suppress.mp3 | 21-Apr-2007 15:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | suppository.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | suppositive.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | supposititious.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | suppositious.mp3 | 21-Apr-2007 15:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | suppositional.mp3 | 21-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | supposition.mp3 | 21-Apr-2007 15:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | supposing.mp3 | 21-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | supposedly.mp3 | 21-Apr-2007 15:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | supposed.mp3 | 21-Apr-2007 15:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | suppose.mp3 | 21-Apr-2007 15:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | supposal.mp3 | 21-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | supposable.mp3 | 21-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | supportive.mp3 | 21-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | supporting.mp3 | 21-Apr-2007 15:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | supporter.mp3 | 21-Apr-2007 15:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | supportable.mp3 | 21-Apr-2007 15:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | support.mp3 | 21-Apr-2007 15:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | supply.mp3 | 21-Apr-2007 15:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | supply-sider.mp3 | 21-Apr-2007 15:46 | 11K | |
![[SND]](/icons/sound2.gif) | supply-side.mp3 | 21-Apr-2007 15:46 | 11K | |
![[SND]](/icons/sound2.gif) | supplier.mp3 | 21-Apr-2007 15:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | supplication.mp3 | 21-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | supplicate.mp3 | 21-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | supplicant.mp3 | 21-Apr-2007 15:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | suppliant.mp3 | 21-Apr-2007 15:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | suppliancy.mp3 | 21-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | suppliance.mp3 | 21-Apr-2007 15:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | suppletory.mp3 | 21-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | suppletive.mp3 | 21-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | suppletion.mp3 | 21-Apr-2007 15:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | suppleness.mp3 | 21-Apr-2007 15:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | supplementation.mp3 | 21-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | supplementary.mp3 | 21-Apr-2007 15:45 | 10K | |
![[SND]](/icons/sound2.gif) | supplemental.mp3 | 21-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | supplement.mp3 | 21-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | supplely.mp3 | 21-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | supple.mp3 | 21-Apr-2007 15:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | supplant.mp3 | 21-Apr-2007 15:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | suppiluliumasi.mp3 | 21-Apr-2007 15:45 | 27K | |
![[SND]](/icons/sound2.gif) | suppie.mp3 | 21-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | supper.mp3 | 21-Apr-2007 15:45 | 5.9K | |
![[SND]](/icons/sound2.gif) | suppedaneum.mp3 | 21-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | suppe.mp3 | 21-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | suppawn.mp3 | 21-Apr-2007 15:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | suplex.mp3 | 21-Apr-2007 15:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | supine.mp3 | 21-Apr-2007 15:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | supinator.mp3 | 21-Apr-2007 15:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | supination.mp3 | 21-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | supinate.mp3 | 21-Apr-2007 15:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | supervisory.mp3 | 21-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | supervisor.mp3 | 21-Apr-2007 15:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | supervision.mp3 | 21-Apr-2007 15:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | supervise.mp3 | 21-Apr-2007 15:44 | 10K | |
![[SND]](/icons/sound2.gif) | supervene.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | supervalustoresinc.mp3 | 21-Apr-2007 15:44 | 27K | |
![[SND]](/icons/sound2.gif) | supervaccine.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | supertranscendentness.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | superterrene.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | superstruct.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | superstitious.mp3 | 21-Apr-2007 15:44 | 11K | |
![[SND]](/icons/sound2.gif) | superstition.mp3 | 21-Apr-2007 15:44 | 10K | |
![[SND]](/icons/sound2.gif) | supersonic.mp3 | 21-Apr-2007 15:44 | 10K | |
![[SND]](/icons/sound2.gif) | supersession.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | supersedure.mp3 | 21-Apr-2007 15:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | supersedeas.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | supersede.mp3 | 21-Apr-2007 15:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | superscription.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | superscript.mp3 | 21-Apr-2007 15:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | superscribe.mp3 | 21-Apr-2007 15:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | supersaur.mp3 | 21-Apr-2007 15:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | superposition.mp3 | 21-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | superpose.mp3 | 21-Apr-2007 15:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | superphylum.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | superordination.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | superordinate.mp3 | 21-Apr-2007 15:43 | 27K | |
![[SND]](/icons/sound2.gif) | supernumerary.mp3 | 21-Apr-2007 15:43 | 11K | |
![[SND]](/icons/sound2.gif) | supernaturality.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | supernatural.mp3 | 21-Apr-2007 15:43 | 11K | |
![[SND]](/icons/sound2.gif) | supernatant.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | supernal.mp3 | 21-Apr-2007 15:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | supernaculum.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | supermaxilla.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | supermarket.mp3 | 21-Apr-2007 15:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | superman.mp3 | 21-Apr-2007 15:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | superlunary.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | superluminal.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | superlative.mp3 | 21-Apr-2007 15:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | superjacent.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | superiority.mp3 | 21-Apr-2007 15:43 | 11K | |
![[SND]](/icons/sound2.gif) | superior.mp3 | 21-Apr-2007 15:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | superintendent.mp3 | 21-Apr-2007 15:43 | 11K | |
![[SND]](/icons/sound2.gif) | superintendency.mp3 | 21-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | superintendence.mp3 | 21-Apr-2007 15:43 | 12K | |
![[SND]](/icons/sound2.gif) | superintend.mp3 | 21-Apr-2007 15:42 | 11K | |
![[SND]](/icons/sound2.gif) | superi.mp3 | 21-Apr-2007 15:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | superhighway.mp3 | 21-Apr-2007 15:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | superhigh frequency.mp3 | 21-Apr-2007 15:42 | 13K | |
![[SND]](/icons/sound2.gif) | superheat.mp3 | 21-Apr-2007 15:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | supergene.mp3 | 21-Apr-2007 15:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | superfuse.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | superfortress.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | superfluous.mp3 | 21-Apr-2007 15:42 | 10K | |
![[SND]](/icons/sound2.gif) | superfluity.mp3 | 21-Apr-2007 15:42 | 11K | |
![[SND]](/icons/sound2.gif) | superfix.mp3 | 21-Apr-2007 15:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | superficies.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | superficially.mp3 | 21-Apr-2007 15:42 | 10K | |
![[SND]](/icons/sound2.gif) | superficial.mp3 | 21-Apr-2007 15:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | superfetation.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | superfecta.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | superette.mp3 | 21-Apr-2007 15:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | superetendard.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | supererogatory.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | supererogation.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | supererogate.mp3 | 21-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | superduper.mp3 | 21-Apr-2007 15:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | supercrat.mp3 | 21-Apr-2007 15:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | supercomputer.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | supercilium.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | supercilious.mp3 | 21-Apr-2007 15:41 | 11K | |
![[SND]](/icons/sound2.gif) | superciliary.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | supercede.mp3 | 21-Apr-2007 15:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | supercargo.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | supercalifragilisticexpialidocious.mp3 | 21-Apr-2007 15:41 | 27K | |
![[SND]](/icons/sound2.gif) | supercalc.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | superb.mp3 | 21-Apr-2007 15:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | superannuation.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | superannuated.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | superannuate.mp3 | 21-Apr-2007 15:41 | 11K | |
![[SND]](/icons/sound2.gif) | superadd.mp3 | 21-Apr-2007 15:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | superabundant.mp3 | 21-Apr-2007 15:41 | 11K | |
![[SND]](/icons/sound2.gif) | superabundance.mp3 | 21-Apr-2007 15:41 | 12K | |
![[SND]](/icons/sound2.gif) | superable.mp3 | 21-Apr-2007 15:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | super.mp3 | 21-Apr-2007 15:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | supe.mp3 | 21-Apr-2007 15:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | sup.mp3 | 21-Apr-2007 15:41 | 5.7K | |
![[SND]](/icons/sound2.gif) | suovetaurilia.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | suoloco.mp3 | 21-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | suo loco.mp3 | 21-Apr-2007 15:40 | 11K | |
![[SND]](/icons/sound2.gif) | suojure.mp3 | 21-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | sunyatsen.mp3 | 21-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | sunyata.mp3 | 21-Apr-2007 15:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | sunwen.mp3 | 21-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | sunward.mp3 | 21-Apr-2007 15:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | suntlacrimaererum.mp3 | 21-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | sunt lacrimae rerum.mp3 | 21-Apr-2007 15:40 | 16K | |
![[SND]](/icons/sound2.gif) | suntanned.mp3 | 21-Apr-2007 15:40 | 10K | |
![[SND]](/icons/sound2.gif) | suntan.mp3 | 21-Apr-2007 15:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | sunshine.mp3 | 21-Apr-2007 15:40 | 9.5K | |
![[SND]](/icons/sound2.gif) | sunset.mp3 | 21-Apr-2007 15:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | sunscald.mp3 | 21-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | sunroom.mp3 | 21-Apr-2007 15:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | sunrise.mp3 | 21-Apr-2007 15:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | sunripen.mp3 | 21-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | sunoco.mp3 | 21-Apr-2007 15:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | sunnyvale.mp3 | 21-Apr-2007 15:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | sunnyasee.mp3 | 21-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | sunnyade.mp3 | 21-Apr-2007 15:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | sunny.mp3 | 21-Apr-2007 15:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | sunny-side up.mp3 | 21-Apr-2007 15:40 | 10K | |
![[SND]](/icons/sound2.gif) | sunnogacy.mp3 | 21-Apr-2007 15:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | sunnite.mp3 | 21-Apr-2007 15:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | sunningdaleagreement.mp3 | 21-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sunna.mp3 | 21-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sunn.mp3 | 21-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sunlight.mp3 | 21-Apr-2007 15:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | sunless.mp3 | 21-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sunkist.mp3 | 21-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sunket.mp3 | 21-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sunken.mp3 | 21-Apr-2007 15:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | sunk.mp3 | 21-Apr-2007 15:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | suni.mp3 | 21-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sunglass.mp3 | 21-Apr-2007 15:39 | 10K | |
![[SND]](/icons/sound2.gif) | sungkiang.mp3 | 21-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sunghua.mp3 | 21-Apr-2007 15:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | sungari.mp3 | 21-Apr-2007 15:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | sung.mp3 | 21-Apr-2007 15:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | sunflower.mp3 | 21-Apr-2007 15:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | sundsvall.mp3 | 21-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sundry.mp3 | 21-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sundriesman.mp3 | 21-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sundries.mp3 | 21-Apr-2007 15:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | sundown.mp3 | 21-Apr-2007 15:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | sundog.mp3 | 21-Apr-2007 15:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | sunderland.mp3 | 21-Apr-2007 15:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | sunder.mp3 | 21-Apr-2007 15:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sundays.mp3 | 21-Apr-2007 15:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | sundanese.mp3 | 21-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sundaislands.mp3 | 21-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sundae.mp3 | 21-Apr-2007 15:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sunchoke.mp3 | 21-Apr-2007 15:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | sunburyonthames.mp3 | 21-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sunburned.mp3 | 21-Apr-2007 15:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | sunburn.mp3 | 21-Apr-2007 15:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | sunbow.mp3 | 21-Apr-2007 15:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | sunblock.mp3 | 21-Apr-2007 15:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | sunberry.mp3 | 21-Apr-2007 15:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | sunbelt.mp3 | 21-Apr-2007 15:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | sunbeam.mp3 | 21-Apr-2007 15:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | sunbathe.mp3 | 21-Apr-2007 15:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | sunapeetrout.mp3 | 21-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sun.mp3 | 21-Apr-2007 15:38 | 5.7K | |
![[SND]](/icons/sound2.gif) | sun-grebe.mp3 | 21-Apr-2007 15:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | sumy.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumptuous.mp3 | 21-Apr-2007 15:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | sumptuary.mp3 | 21-Apr-2007 15:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | sumption.mp3 | 21-Apr-2007 15:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | sumpter.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumpin.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumph.mp3 | 21-Apr-2007 15:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | sump.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumodom.mp3 | 21-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sumner.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | summumgenus.mp3 | 21-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | summumbonum.mp3 | 21-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | summons.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | summon.mp3 | 21-Apr-2007 15:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | summitry.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | summiteer.mp3 | 21-Apr-2007 15:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | summit.mp3 | 21-Apr-2007 15:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | summist.mp3 | 21-Apr-2007 15:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | summings-up.mp3 | 21-Apr-2007 15:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | summing-up.mp3 | 21-Apr-2007 15:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | summilexic.mp3 | 21-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | summery.mp3 | 21-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | summerset.mp3 | 21-Apr-2007 15:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | summersault.mp3 | 21-Apr-2007 15:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | summerly.mp3 | 21-Apr-2007 15:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | summerize.mp3 | 21-Apr-2007 15:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | summer.mp3 | 21-Apr-2007 15:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | summative.mp3 | 21-Apr-2007 15:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | summation.mp3 | 21-Apr-2007 15:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | summatheologica.mp3 | 21-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | summate.mp3 | 21-Apr-2007 15:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | summat.mp3 | 21-Apr-2007 15:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | summary.mp3 | 21-Apr-2007 15:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | summarize.mp3 | 21-Apr-2007 15:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | summarization.mp3 | 21-Apr-2007 15:36 | 11K | |
![[SND]](/icons/sound2.gif) | summarily.mp3 | 21-Apr-2007 15:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | summand.mp3 | 21-Apr-2007 15:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | summagenera.mp3 | 21-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | summacumlaude.mp3 | 21-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | summable.mp3 | 21-Apr-2007 15:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | summa.mp3 | 21-Apr-2007 15:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumless.mp3 | 21-Apr-2007 15:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumgait.mp3 | 21-Apr-2007 15:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | sumerology.mp3 | 21-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sumerian.mp3 | 21-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sumer.mp3 | 21-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumbul.mp3 | 21-Apr-2007 15:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | sumbitch.mp3 | 21-Apr-2007 15:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | sumbawa.mp3 | 21-Apr-2007 15:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | sumba.mp3 | 21-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sumac.mp3 | 21-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sum.mp3 | 21-Apr-2007 15:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | sum-up.mp3 | 21-Apr-2007 15:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | sulzberger.mp3 | 21-Apr-2007 15:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulu.mp3 | 21-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sultry.mp3 | 21-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sultaness.mp3 | 21-Apr-2007 15:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | sultanate.mp3 | 21-Apr-2007 15:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | sultana.mp3 | 21-Apr-2007 15:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | sultan.mp3 | 21-Apr-2007 15:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | sulpician.mp3 | 21-Apr-2007 15:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulphydryl.mp3 | 21-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sulphurous.mp3 | 21-Apr-2007 15:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sulphuric acid.mp3 | 21-Apr-2007 15:35 | 13K | |
![[SND]](/icons/sound2.gif) | sulphur.mp3 | 21-Apr-2007 15:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | sulphonation.mp3 | 21-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sulphonate.mp3 | 21-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sulphon.mp3 | 21-Apr-2007 15:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | sulphite.mp3 | 21-Apr-2007 15:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | sulphide.mp3 | 21-Apr-2007 15:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sulphate.mp3 | 21-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sulpha.mp3 | 21-Apr-2007 15:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | sulph.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sullyprudhomme.mp3 | 21-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sully.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sullomvoe.mp3 | 21-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sullen.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sullage.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sulla.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sull.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sulky.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sulkiness.mp3 | 21-Apr-2007 15:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | sulk.mp3 | 21-Apr-2007 15:34 | 5.7K | |
![[SND]](/icons/sound2.gif) | sulindac.mp3 | 21-Apr-2007 15:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulfuryl.mp3 | 21-Apr-2007 15:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulfury.mp3 | 21-Apr-2007 15:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | sulfurous.mp3 | 21-Apr-2007 15:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sulfurize.mp3 | 21-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sulfuric acid.mp3 | 21-Apr-2007 15:33 | 13K | |
![[SND]](/icons/sound2.gif) | sulfuric.mp3 | 21-Apr-2007 15:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulfuret.mp3 | 21-Apr-2007 15:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | sulfureous.mp3 | 21-Apr-2007 15:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulfurate.mp3 | 21-Apr-2007 15:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | sulfur.mp3 | 21-Apr-2007 15:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | sulfonylurea.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfonyl.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfonium.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfonic.mp3 | 21-Apr-2007 15:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | sulfone.mp3 | 21-Apr-2007 15:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sulfonation.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfonate.mp3 | 21-Apr-2007 15:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | sulfonamide.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfonal.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfon.mp3 | 21-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sulfocarbanilide.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfo.mp3 | 21-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sulfitingagent.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfite.mp3 | 21-Apr-2007 15:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | sulfisoxazole.mp3 | 21-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sulfinyl.mp3 | 21-Apr-2007 15:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sulfinpyrazone.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfide.mp3 | 21-Apr-2007 15:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulfhydryl.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfazin.mp3 | 21-Apr-2007 15:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulfatize.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfate.mp3 | 21-Apr-2007 15:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | sulfatase.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfasalazine.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfapyrazine.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfantimonide.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfanilyl.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfanilicacid.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfanilamide.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfamylon.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfamicacid.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfamethoxazole.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfamethazine.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfamerazine.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulfa.mp3 | 21-Apr-2007 15:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | sulf.mp3 | 21-Apr-2007 15:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | suleimani.mp3 | 21-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sulcus.mp3 | 21-Apr-2007 15:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | sulcate.mp3 | 21-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | sulaimanrange.mp3 | 21-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sukuma.mp3 | 21-Apr-2007 15:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | sukkur.mp3 | 21-Apr-2007 15:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sukkoth.mp3 | 21-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | sukkah.mp3 | 21-Apr-2007 15:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | sukiyaki.mp3 | 21-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sukhumi.mp3 | 21-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sukhoi.mp3 | 21-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sukarno.mp3 | 21-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | suk.mp3 | 21-Apr-2007 15:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | suji.mp3 | 21-Apr-2007 15:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | suiyuan.mp3 | 21-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | suitor.mp3 | 21-Apr-2007 15:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | suiting.mp3 | 21-Apr-2007 15:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | suited.mp3 | 21-Apr-2007 15:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | suite.mp3 | 21-Apr-2007 15:31 | 5.5K | |
![[SND]](/icons/sound2.gif) | suitcase.mp3 | 21-Apr-2007 15:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | suitable.mp3 | 21-Apr-2007 15:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | suit.mp3 | 21-Apr-2007 15:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | suint.mp3 | 21-Apr-2007 15:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | suimate.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suilline.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suikerbos.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suijuris.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suigeneris.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suicidology.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suicidogenic.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suicide.mp3 | 21-Apr-2007 15:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | suicidal.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | sui.mp3 | 21-Apr-2007 15:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | suharto.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | sugh.mp3 | 21-Apr-2007 15:30 | 45K | |
![[SND]](/icons/sound2.gif) | suggin.mp3 | 21-Apr-2007 15:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | suggestor.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suggestopaedia.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suggestology.mp3 | 21-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | suggestive.mp3 | 21-Apr-2007 15:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | suggestion.mp3 | 21-Apr-2007 15:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | suggestiofalsi.mp3 | 21-Apr-2007 15:30 | 27K | |
![[SND]](/icons/sound2.gif) | suggestible.mp3 | 21-Apr-2007 15:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | suggest.mp3 | 21-Apr-2007 15:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | suger.mp3 | 21-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | sugary.mp3 | 21-Apr-2007 15:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | sugaroflead.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | sugarloaf.mp3 | 21-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | sugared.mp3 | 21-Apr-2007 15:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | sugarberry.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | sugarallie.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | sugar.mp3 | 21-Apr-2007 15:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | sugan.mp3 | 21-Apr-2007 15:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | sug.mp3 | 21-Apr-2007 15:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | sufu.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | sufism.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | sufi.mp3 | 21-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | suffusion.mp3 | 21-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | suffuse.mp3 | 21-Apr-2007 15:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | suffumigate.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | suffruticose.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | suffrutex.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | suffrutescent.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | suffragist.mp3 | 21-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | suffragette.mp3 | 21-Apr-2007 15:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | suffrage.mp3 | 21-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | suffragan.mp3 | 21-Apr-2007 15:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | suffocate.mp3 | 21-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sufflate.mp3 | 21-Apr-2007 15:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | suffix.mp3 | 21-Apr-2007 15:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | sufficient.mp3 | 21-Apr-2007 15:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | sufficiency.mp3 | 21-Apr-2007 15:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | suffice.mp3 | 21-Apr-2007 15:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | suffete.mp3 | 21-Apr-2007 15:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | suffering.mp3 | 21-Apr-2007 15:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | sufferer.mp3 | 21-Apr-2007 15:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | sufferance.mp3 | 21-Apr-2007 15:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | sufferable.mp3 | 21-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | suffer.mp3 | 21-Apr-2007 15:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | suff.mp3 | 21-Apr-2007 15:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | suf.mp3 | 21-Apr-2007 15:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | sueypow.mp3 | 21-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | suevian.mp3 | 21-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | suetonius.mp3 | 21-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | suet.mp3 | 21-Apr-2007 15:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | sueism.mp3 | 21-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | suedette.mp3 | 21-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | sueded.mp3 | 21-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | suede.mp3 | 21-Apr-2007 15:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | sue.mp3 | 21-Apr-2007 15:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | sudsy.mp3 | 21-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | sudsing.mp3 | 21-Apr-2007 15:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | sudser.mp3 | 21-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | suds.mp3 | 21-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | sudra.mp3 | 21-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | sudoriparous.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudorific.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudoriferous.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudor.mp3 | 21-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | sudge.mp3 | 21-Apr-2007 15:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | sudetenland.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudeten.mp3 | 21-Apr-2007 15:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | sudermann.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | suddenly.mp3 | 21-Apr-2007 15:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | sudden.mp3 | 21-Apr-2007 15:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | sudd.mp3 | 21-Apr-2007 15:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | sudbury.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudatory.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudatorium.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudation.mp3 | 21-Apr-2007 15:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | sudatio.mp3 | 21-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sudarium.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | sudanic.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | sudanese.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | sudamina.mp3 | 21-Apr-2007 15:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | sudafed.mp3 | 21-Apr-2007 15:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | sud.mp3 | 21-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | sucusucu.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | suctorian.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | suctorial.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | suction.mp3 | 21-Apr-2007 15:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | sucrose.mp3 | 21-Apr-2007 15:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | sucrets.mp3 | 21-Apr-2007 15:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | sucre.mp3 | 21-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | sucrase.mp3 | 21-Apr-2007 15:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | sucralfate.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | sucky.mp3 | 21-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | suckling.mp3 | 21-Apr-2007 15:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | suckler.mp3 | 21-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | suckle.mp3 | 21-Apr-2007 15:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | sucking.mp3 | 21-Apr-2007 15:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | sucketfork.mp3 | 21-Apr-2007 15:26 | 17K | |
![[SND]](/icons/sound2.gif) | suckerel.mp3 | 21-Apr-2007 15:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | sucker.mp3 | 21-Apr-2007 15:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | suck.mp3 | 21-Apr-2007 15:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | suck-up.mp3 | 21-Apr-2007 15:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | suchness.mp3 | 21-Apr-2007 15:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | such.mp3 | 21-Apr-2007 15:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | succussion.mp3 | 21-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | succussatory.mp3 | 21-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | succuss.mp3 | 21-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | succursal.mp3 | 21-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | succumb.mp3 | 21-Apr-2007 15:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | succulent.mp3 | 21-Apr-2007 15:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | succubus.mp3 | 21-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | succubous.mp3 | 21-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | succuba.mp3 | 21-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | succoth.mp3 | 21-Apr-2007 15:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | succotash.mp3 | 21-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | succose.mp3 | 21-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | succory.mp3 | 21-Apr-2007 15:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | succorance.mp3 | 21-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | succor.mp3 | 21-Apr-2007 15:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | succinyl.mp3 | 21-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | succinic acid.mp3 | 21-Apr-2007 15:24 | 12K | |
![[SND]](/icons/sound2.gif) | succinic.mp3 | 21-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | succinctorium.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succinctness.mp3 | 21-Apr-2007 15:24 | 10K | |
![[SND]](/icons/sound2.gif) | succinct.mp3 | 21-Apr-2007 15:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | succinate.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | successor.mp3 | 21-Apr-2007 15:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | successive.mp3 | 21-Apr-2007 15:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | succession.mp3 | 21-Apr-2007 15:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | successfully.mp3 | 21-Apr-2007 15:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | successful.mp3 | 21-Apr-2007 15:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | success.mp3 | 21-Apr-2007 15:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | succesfou.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succes fou.mp3 | 21-Apr-2007 15:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | succesdestime.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succesdescandale.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succeeding.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succeeder.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succeed.mp3 | 21-Apr-2007 15:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | succedent.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succedaneum.mp3 | 21-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | succah.mp3 | 21-Apr-2007 15:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | succade.mp3 | 21-Apr-2007 15:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | sucaryl.mp3 | 21-Apr-2007 15:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | suc.mp3 | 21-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | subway.mp3 | 21-Apr-2007 15:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | subvoce.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | subvert.mp3 | 21-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | subversive.mp3 | 21-Apr-2007 15:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | subversionary.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | subversion.mp3 | 21-Apr-2007 15:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | subverbo.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | subvention.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | subvene.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | suburbicarian.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | suburbia.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | suburbanize.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | suburbanity.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | suburbanite.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | suburban.mp3 | 21-Apr-2007 15:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | suburb.mp3 | 21-Apr-2007 15:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | subulate.mp3 | 21-Apr-2007 15:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | subtreasury.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | subtrahend.mp3 | 21-Apr-2007 15:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | subtractor.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | subtractive.mp3 | 21-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | subtraction.mp3 | 21-Apr-2007 15:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | subtracter.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subtract.mp3 | 21-Apr-2007 15:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | subtotal.mp3 | 21-Apr-2007 15:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | subtopic.mp3 | 21-Apr-2007 15:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | subtopia.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subtly.mp3 | 21-Apr-2007 15:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | subtlety.mp3 | 21-Apr-2007 15:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | subtle.mp3 | 21-Apr-2007 15:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | subtitle.mp3 | 21-Apr-2007 15:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | subtilty.mp3 | 21-Apr-2007 15:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | subtilize.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subtilisin.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subtile.mp3 | 21-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | subterrene.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subterraneous.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subterranean.mp3 | 21-Apr-2007 15:22 | 10K | |
![[SND]](/icons/sound2.gif) | subterrane.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subterfuge.mp3 | 21-Apr-2007 15:22 | 10K | |
![[SND]](/icons/sound2.gif) | subter.mp3 | 21-Apr-2007 15:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | subtense.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subtend.mp3 | 21-Apr-2007 15:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | subsystem.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subsurface.mp3 | 21-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | subsumption.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | subsume.mp3 | 21-Apr-2007 15:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | substructure.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substruction.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substratum.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substrate.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substitutivity.mp3 | 21-Apr-2007 15:21 | 18K | |
![[SND]](/icons/sound2.gif) | substitutive.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substitution.mp3 | 21-Apr-2007 15:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | substitute.mp3 | 21-Apr-2007 15:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | substituent.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantivize.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantiveright.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantive.mp3 | 21-Apr-2007 15:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | substantival.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantiate.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantianigra.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantially.mp3 | 21-Apr-2007 15:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | substantialize.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantialism.mp3 | 21-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | substantial.mp3 | 21-Apr-2007 15:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | substance.mp3 | 21-Apr-2007 15:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | subspecies.mp3 | 21-Apr-2007 15:21 | 11K | |
![[SND]](/icons/sound2.gif) | subspecie.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subspecialty.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subsolar point.mp3 | 21-Apr-2007 15:20 | 12K | |
![[SND]](/icons/sound2.gif) | subsistent.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subsistence.mp3 | 21-Apr-2007 15:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | subsist.mp3 | 21-Apr-2007 15:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | subsilentio.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subsidy.mp3 | 21-Apr-2007 15:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | subsidize.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subsidiary.mp3 | 21-Apr-2007 15:20 | 10K | |
![[SND]](/icons/sound2.gif) | subsidence.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subside.mp3 | 21-Apr-2007 15:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | subservient.mp3 | 21-Apr-2007 15:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | subservience.mp3 | 21-Apr-2007 15:20 | 11K | |
![[SND]](/icons/sound2.gif) | subserve.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subsequently.mp3 | 21-Apr-2007 15:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | subsequent.mp3 | 21-Apr-2007 15:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | subsequence.mp3 | 21-Apr-2007 15:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | subsellium.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subsegment.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subsection.mp3 | 21-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | subscription.mp3 | 21-Apr-2007 15:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | subscript.mp3 | 21-Apr-2007 15:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | subscriber.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | subscribe.mp3 | 21-Apr-2007 15:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | subrosa.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | sub rosa.mp3 | 21-Apr-2007 15:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | subrogate.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | subroc.mp3 | 21-Apr-2007 15:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | subreption.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | subprincipal.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | subpoenaducestecum.mp3 | 21-Apr-2007 15:19 | 18K | |
![[SND]](/icons/sound2.gif) | subpoenaadtestificandum.mp3 | 21-Apr-2007 15:19 | 27K | |
![[SND]](/icons/sound2.gif) | subpoena ad testificandum.mp3 | 21-Apr-2007 15:19 | 18K | |
![[SND]](/icons/sound2.gif) | subpoena.mp3 | 21-Apr-2007 15:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | subotica.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | suborn.mp3 | 21-Apr-2007 15:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | subordinationism.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | subordination.mp3 | 21-Apr-2007 15:19 | 11K | |
![[SND]](/icons/sound2.gif) | subordinatingconjunction.mp3 | 21-Apr-2007 15:19 | 18K | |
![[SND]](/icons/sound2.gif) | subordinated.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | subordinate.mp3 | 21-Apr-2007 15:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | subnuclear.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | subnomine.mp3 | 21-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | submodo.mp3 | 21-Apr-2007 15:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | submittal.mp3 | 21-Apr-2007 15:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | submit.mp3 | 21-Apr-2007 15:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | submissive.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | submission.mp3 | 21-Apr-2007 15:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | submiss.mp3 | 21-Apr-2007 15:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | submersion.mp3 | 21-Apr-2007 15:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | submersible.mp3 | 21-Apr-2007 15:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | submersed.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | submerse.mp3 | 21-Apr-2007 15:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | submergible.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | submergence.mp3 | 21-Apr-2007 15:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | submerged.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | submerge.mp3 | 21-Apr-2007 15:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | submentum.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | submaxillary.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | submariner.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | submarine.mp3 | 21-Apr-2007 15:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | subman.mp3 | 21-Apr-2007 15:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | submachine gun.mp3 | 21-Apr-2007 15:18 | 11K | |
![[SND]](/icons/sound2.gif) | sublunary.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | sublingual.mp3 | 21-Apr-2007 15:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | sublimity.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | sublimit.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | sublimination.mp3 | 21-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | subliminal.mp3 | 21-Apr-2007 15:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | sublimeporte.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | sublime.mp3 | 21-Apr-2007 15:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | sublimate.mp3 | 21-Apr-2007 15:17 | 27K | |
![[SND]](/icons/sound2.gif) | sublet.mp3 | 21-Apr-2007 15:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | sublate.mp3 | 21-Apr-2007 15:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | sublapsarianism.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subkingdom.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjunctive.mp3 | 21-Apr-2007 15:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | subjunction.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjugate.mp3 | 21-Apr-2007 15:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | subjudice.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjoinder.mp3 | 21-Apr-2007 15:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | subjoin.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjectivize.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjectivity.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjectivism.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjective.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subjection.mp3 | 21-Apr-2007 15:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | subjectify.mp3 | 21-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | subject.mp3 | 21-Apr-2007 15:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | subjacent.mp3 | 21-Apr-2007 15:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | subito.mp3 | 21-Apr-2007 15:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | subitize.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subinfeudatory.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subinfeudation.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subinfeudate.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subhuman.mp3 | 21-Apr-2007 15:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | subhedral.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subheading.mp3 | 21-Apr-2007 15:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | subgum.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subgingival.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subfuscous.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subfusc.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subfix.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subfinem.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subfamily.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | suberose.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | suberize.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | suberization.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | suberin.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | suberic.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | subereous.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | suberate.mp3 | 21-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | suber.mp3 | 21-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | subeditor.mp3 | 21-Apr-2007 15:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | subdued.mp3 | 21-Apr-2007 15:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | subdue.mp3 | 21-Apr-2007 15:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | subduction.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subduct.mp3 | 21-Apr-2007 15:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | subdual.mp3 | 21-Apr-2007 15:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | subdivision.mp3 | 21-Apr-2007 15:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | subdivide.mp3 | 21-Apr-2007 15:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | subdeb.mp3 | 21-Apr-2007 15:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | subdeanery.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subdean.mp3 | 21-Apr-2007 15:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | subdeaconate.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subdeacon.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subcontractor.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subcontract.mp3 | 21-Apr-2007 15:15 | 36K | |
![[SND]](/icons/sound2.gif) | subconscious.mp3 | 21-Apr-2007 15:15 | 10K | |
![[SND]](/icons/sound2.gif) | subclavius.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subclavian.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subcinctorium.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subcheese.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subception.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subbing.mp3 | 21-Apr-2007 15:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | subbass.mp3 | 21-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | subaquatic.mp3 | 21-Apr-2007 15:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | subalternate.mp3 | 21-Apr-2007 15:14 | 17K | |
![[SND]](/icons/sound2.gif) | subaltern.mp3 | 21-Apr-2007 15:14 | 36K | |
![[SND]](/icons/sound2.gif) | subah.mp3 | 21-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | subaerial.mp3 | 21-Apr-2007 15:14 | 17K | |
![[SND]](/icons/sound2.gif) | subadar.mp3 | 21-Apr-2007 15:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | subacutesclerosingpanencephalitis.mp3 | 21-Apr-2007 15:14 | 36K | |
![[SND]](/icons/sound2.gif) | subacute sclerosing panencephalitis.mp3 | 21-Apr-2007 15:14 | 27K | |
![[SND]](/icons/sound2.gif) | subacid.mp3 | 21-Apr-2007 15:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | sub.mp3 | 21-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | suavity.mp3 | 21-Apr-2007 15:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | suaviterinmodofortiterinre.mp3 | 21-Apr-2007 15:14 | 27K | |
![[SND]](/icons/sound2.gif) | suaviter in modo, fortiter in re.mp3 | 21-Apr-2007 15:14 | 28K | |
![[SND]](/icons/sound2.gif) | suave.mp3 | 21-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | suasion.mp3 | 21-Apr-2007 15:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | suarez.mp3 | 21-Apr-2007 15:14 | 17K | |
![[SND]](/icons/sound2.gif) | suable.mp3 | 21-Apr-2007 15:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | su.mp3 | 21-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | styx.mp3 | 21-Apr-2007 15:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | stythe.mp3 | 21-Apr-2007 15:13 | 27K | |
![[SND]](/icons/sound2.gif) | styron.mp3 | 21-Apr-2007 15:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | styrofoam.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | styria.mp3 | 21-Apr-2007 15:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | styrene.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | styrax.mp3 | 21-Apr-2007 15:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | styralylacetate.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | styracaceous.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | styr.mp3 | 21-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | styptic.mp3 | 21-Apr-2007 15:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | stypsis.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | styphnicacid.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | stymy.mp3 | 21-Apr-2007 15:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | stymphalianbirds.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | stymie.mp3 | 21-Apr-2007 15:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | stylus.mp3 | 21-Apr-2007 15:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | stylous.mp3 | 21-Apr-2007 15:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | stylostixis.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | stylops.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | stylopodium.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | stylopize.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | stylolite.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | styloid.mp3 | 21-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | stylohyoid.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylography.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylographic.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylograph.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylobate.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylo.mp3 | 21-Apr-2007 15:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | stylize.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylites.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylite.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylistics.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | stylistic.mp3 | 21-Apr-2007 15:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | stylist.mp3 | 21-Apr-2007 15:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | stylish.mp3 | 21-Apr-2007 15:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | styling.mp3 | 21-Apr-2007 15:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | stylin.mp3 | 21-Apr-2007 15:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | styliform.mp3 | 21-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | styli.mp3 | 21-Apr-2007 15:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | stylet.mp3 | 21-Apr-2007 15:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | styler.mp3 | 21-Apr-2007 15:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | style.mp3 | 21-Apr-2007 15:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | stylate.mp3 | 21-Apr-2007 15:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | stylar.mp3 | 21-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | styl.mp3 | 21-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | stygian.mp3 | 21-Apr-2007 15:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | sty.mp3 | 21-Apr-2007 15:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | stvitussdance.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | stuyvesant.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | stutz.mp3 | 21-Apr-2007 15:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | stuttgart.mp3 | 21-Apr-2007 15:11 | 27K | |
![[SND]](/icons/sound2.gif) | stutter.mp3 | 21-Apr-2007 15:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | stushie.mp3 | 21-Apr-2007 15:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | sturtsdesertpea.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | sturt.mp3 | 21-Apr-2007 15:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | sturmunddrang.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | sturmer.mp3 | 21-Apr-2007 15:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | sturmabteilung.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | sturluson.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | sturks.mp3 | 21-Apr-2007 15:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | sturine.mp3 | 21-Apr-2007 15:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | sturgis.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | sturgeon.mp3 | 21-Apr-2007 15:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | sturdy.mp3 | 21-Apr-2007 15:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | sturbridge.mp3 | 21-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | stupor.mp3 | 21-Apr-2007 15:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | stupidity.mp3 | 21-Apr-2007 15:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | stupid.mp3 | 21-Apr-2007 15:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | stupendous.mp3 | 21-Apr-2007 15:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | stupefyingly.mp3 | 21-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | stupefy.mp3 | 21-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | stupefactive.mp3 | 21-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | stupefaction.mp3 | 21-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | stupefacient.mp3 | 21-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | stupe.mp3 | 21-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | stupa.mp3 | 21-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | stunted.mp3 | 21-Apr-2007 15:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | stunt.mp3 | 21-Apr-2007 15:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | stunsail.mp3 | 21-Apr-2007 15:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | stunning.mp3 | 21-Apr-2007 15:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | stunner.mp3 | 21-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | stunned.mp3 | 21-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | stunk.mp3 | 21-Apr-2007 15:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | stung.mp3 | 21-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | stundism.mp3 | 21-Apr-2007 15:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | stun.mp3 | 21-Apr-2007 15:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | stumpy.mp3 | 21-Apr-2007 15:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | stumper.mp3 | 21-Apr-2007 15:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | stumpage.mp3 | 21-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | stump.mp3 | 21-Apr-2007 15:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | stump-tailed macaque.mp3 | 21-Apr-2007 15:10 | 14K | |
![[SND]](/icons/sound2.gif) | stummick.mp3 | 21-Apr-2007 15:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | stumer.mp3 | 21-Apr-2007 15:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | stumbling block.mp3 | 21-Apr-2007 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | stumble.mp3 | 21-Apr-2007 15:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | stum.mp3 | 21-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | stultify.mp3 | 21-Apr-2007 15:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | stulmosfire.mp3 | 21-Apr-2007 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | stull.mp3 | 21-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | stuka.mp3 | 21-Apr-2007 15:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | stuiver.mp3 | 21-Apr-2007 15:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | stuggy.mp3 | 21-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | stuffy.mp3 | 21-Apr-2007 15:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | stuffing.mp3 | 21-Apr-2007 15:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | stuffie.mp3 | 21-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | stuffer.mp3 | 21-Apr-2007 15:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | stuff.mp3 | 21-Apr-2007 15:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | study.mp3 | 21-Apr-2007 15:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | studslonigan.mp3 | 21-Apr-2007 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | studsley.mp3 | 21-Apr-2007 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | studly.mp3 | 21-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | studious.mp3 | 21-Apr-2007 15:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | studio.mp3 | 21-Apr-2007 15:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | studied.mp3 | 21-Apr-2007 15:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | studette.mp3 | 21-Apr-2007 15:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | student.mp3 | 21-Apr-2007 15:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | student's t distribution.mp3 | 21-Apr-2007 15:09 | 18K | |
![[SND]](/icons/sound2.gif) | studebaker.mp3 | 21-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | studdingsail.mp3 | 21-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | studding sail.mp3 | 21-Apr-2007 15:08 | 10K | |
![[SND]](/icons/sound2.gif) | studding.mp3 | 21-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | studdie.mp3 | 21-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | studdedtire.mp3 | 21-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | stud.mp3 | 21-Apr-2007 15:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | stuck.mp3 | 21-Apr-2007 15:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | stuck-up.mp3 | 21-Apr-2007 15:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | stuccoed.mp3 | 21-Apr-2007 15:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | stucco.mp3 | 21-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | stubby.mp3 | 21-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | stubbs.mp3 | 21-Apr-2007 15:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | stubborn.mp3 | 21-Apr-2007 15:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | stubble.mp3 | 21-Apr-2007 15:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | stubbie.mp3 | 21-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | stubbed.mp3 | 21-Apr-2007 15:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | stub.mp3 | 21-Apr-2007 15:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | stu.mp3 | 21-Apr-2007 15:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sttrinians.mp3 | 21-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | stswithinsday.mp3 | 21-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | stsophia.mp3 | 21-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | strymon.mp3 | 21-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | strychninism.mp3 | 21-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | strychnine.mp3 | 21-Apr-2007 15:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | struve.mp3 | 21-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | strutting.mp3 | 21-Apr-2007 15:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | struthious.mp3 | 21-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | struth.mp3 | 21-Apr-2007 15:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | strut.mp3 | 21-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | strunz.mp3 | 21-Apr-2007 15:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | strunt.mp3 | 21-Apr-2007 15:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | strung.mp3 | 21-Apr-2007 15:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | strumpet.mp3 | 21-Apr-2007 15:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | strumous.mp3 | 21-Apr-2007 15:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | strumose.mp3 | 21-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | strumectomy.mp3 | 21-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | struma.mp3 | 21-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | strum.mp3 | 21-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | struldbrug.mp3 | 21-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | struggling.mp3 | 21-Apr-2007 15:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | struggle.mp3 | 21-Apr-2007 15:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | strudel.mp3 | 21-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | structurize.mp3 | 21-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | structurism.mp3 | 21-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | structureless.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | structured.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | structure.mp3 | 21-Apr-2007 15:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | structuralize.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | structuralism.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | structural.mp3 | 21-Apr-2007 15:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | struck.mp3 | 21-Apr-2007 15:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | strozzi.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | stroy.mp3 | 21-Apr-2007 15:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | strow.mp3 | 21-Apr-2007 15:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | strove.mp3 | 21-Apr-2007 15:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | stroud.mp3 | 21-Apr-2007 15:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | strother.mp3 | 21-Apr-2007 15:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | stroppy.mp3 | 21-Apr-2007 15:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | stropper.mp3 | 21-Apr-2007 15:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | strophulus.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | strophoid.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | strophiole.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | strophic.mp3 | 21-Apr-2007 15:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | strophe.mp3 | 21-Apr-2007 15:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | strophanthus.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | strophanthin.mp3 | 21-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | strop.mp3 | 21-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | strook.mp3 | 21-Apr-2007 15:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | strontium.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strontianite.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strontian.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strontia.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strongylosis.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strongyloidiasis.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strongyle.mp3 | 21-Apr-2007 15:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | strongman.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strongly.mp3 | 21-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | strongish.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | stronghold.mp3 | 21-Apr-2007 15:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | strongers.mp3 | 21-Apr-2007 15:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | stronger.mp3 | 21-Apr-2007 15:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | strong.mp3 | 21-Apr-2007 15:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | strong-minded.mp3 | 21-Apr-2007 15:05 | 10K | |
![[SND]](/icons/sound2.gif) | strong-arm.mp3 | 21-Apr-2007 15:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | stromeyerite.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | strome.mp3 | 21-Apr-2007 15:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | strombolianvolcano.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | stromboli.mp3 | 21-Apr-2007 15:05 | 17K | |
![[SND]](/icons/sound2.gif) | stromb.mp3 | 21-Apr-2007 15:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | stromatolite.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stromateoid.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stromateid.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stroma.mp3 | 21-Apr-2007 15:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | stroller.mp3 | 21-Apr-2007 15:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | stroll.mp3 | 21-Apr-2007 15:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | strokesman.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stroker.mp3 | 21-Apr-2007 15:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | stroke.mp3 | 21-Apr-2007 15:04 | 5.9K | |
![[SND]](/icons/sound2.gif) | strohs.mp3 | 21-Apr-2007 15:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | stroheim.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stroganoff.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stroessner.mp3 | 21-Apr-2007 15:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | strode.mp3 | 21-Apr-2007 15:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | strobotron.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stroboscopic.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stroboscope.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | stroboradiograph.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | strobilus.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | strobilation.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | strobilaceous.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | strobila.mp3 | 21-Apr-2007 15:04 | 17K | |
![[SND]](/icons/sound2.gif) | strobic.mp3 | 21-Apr-2007 15:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | strobe.mp3 | 21-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | strob.mp3 | 21-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | stroam.mp3 | 21-Apr-2007 15:03 | 17K | |
![[SND]](/icons/sound2.gif) | strix.mp3 | 21-Apr-2007 15:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | strive.mp3 | 21-Apr-2007 15:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | stripy.mp3 | 21-Apr-2007 15:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | stripteuse.mp3 | 21-Apr-2007 15:03 | 17K | |
![[SND]](/icons/sound2.gif) | stript.mp3 | 21-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | strips.mp3 | 21-Apr-2007 15:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | stripper.mp3 | 21-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | stripped.mp3 | 21-Apr-2007 15:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | stripped-down.mp3 | 21-Apr-2007 15:03 | 10K | |
![[SND]](/icons/sound2.gif) | strippable.mp3 | 21-Apr-2007 15:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | stripling.mp3 | 21-Apr-2007 15:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | striping.mp3 | 21-Apr-2007 15:03 | 17K | |
![[SND]](/icons/sound2.gif) | stripey.mp3 | 21-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | striper.mp3 | 21-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | stripedbass.mp3 | 21-Apr-2007 15:03 | 17K | |
![[SND]](/icons/sound2.gif) | striped.mp3 | 21-Apr-2007 15:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | stripe.mp3 | 21-Apr-2007 15:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | strip.mp3 | 21-Apr-2007 15:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | strip-chart recorder.mp3 | 21-Apr-2007 15:03 | 13K | |
![[SND]](/icons/sound2.gif) | stringy.mp3 | 21-Apr-2007 15:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | stringing.mp3 | 21-Apr-2007 15:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | stringhalt.mp3 | 21-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | stringer.mp3 | 21-Apr-2007 15:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | stringent.mp3 | 21-Apr-2007 15:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | stringendo.mp3 | 21-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | stringency.mp3 | 21-Apr-2007 15:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | stringed.mp3 | 21-Apr-2007 15:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | stringbass.mp3 | 21-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | string.mp3 | 21-Apr-2007 15:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | strine.mp3 | 21-Apr-2007 15:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | strindberg.mp3 | 21-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | strimon.mp3 | 21-Apr-2007 15:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | strikingly.mp3 | 21-Apr-2007 15:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | striking.mp3 | 21-Apr-2007 15:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | striker.mp3 | 21-Apr-2007 15:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | strikeless.mp3 | 21-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | strikebound.mp3 | 21-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | strike.mp3 | 21-Apr-2007 15:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | strike-slip.mp3 | 21-Apr-2007 15:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | strikable.mp3 | 21-Apr-2007 15:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | strijdom.mp3 | 21-Apr-2007 15:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | strigose.mp3 | 21-Apr-2007 15:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | strigil.mp3 | 21-Apr-2007 15:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | strigiform.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | striges.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | strife.mp3 | 21-Apr-2007 15:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | stridulous.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | stridulate.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | stridor.mp3 | 21-Apr-2007 15:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | strident.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | stride.mp3 | 21-Apr-2007 15:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | stricture.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | strictness.mp3 | 21-Apr-2007 15:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | strictly.mp3 | 21-Apr-2007 15:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | striction.mp3 | 21-Apr-2007 15:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | strict.mp3 | 21-Apr-2007 15:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | strickle.mp3 | 21-Apr-2007 15:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | stricken.mp3 | 21-Apr-2007 15:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | strick.mp3 | 21-Apr-2007 15:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | strib.mp3 | 21-Apr-2007 15:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | striation.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | striated.mp3 | 21-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | stria.mp3 | 21-Apr-2007 15:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | strewth.mp3 | 21-Apr-2007 15:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | strewn.mp3 | 21-Apr-2007 15:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | strewment.mp3 | 21-Apr-2007 15:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | strew.mp3 | 21-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | streusel.mp3 | 21-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | stretto.mp3 | 21-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | stretta.mp3 | 21-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | stretford.mp3 | 21-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | stretchy.mp3 | 21-Apr-2007 15:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | stretcher.mp3 | 21-Apr-2007 15:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | stretchable.mp3 | 21-Apr-2007 15:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | stretchability.mp3 | 21-Apr-2007 15:00 | 10K | |
![[SND]](/icons/sound2.gif) | stretch.mp3 | 21-Apr-2007 15:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | stretch-out.mp3 | 21-Apr-2007 15:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | stressor.mp3 | 21-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | stressless.mp3 | 21-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | stressful.mp3 | 21-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | stressed.mp3 | 21-Apr-2007 15:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | stressed-out.mp3 | 21-Apr-2007 15:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | stress.mp3 | 21-Apr-2007 15:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | stresemann.mp3 | 21-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | streptozotocin.mp3 | 21-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | streptovaricin.mp3 | 21-Apr-2007 15:00 | 18K | |
![[SND]](/icons/sound2.gif) | streptothricin.mp3 | 21-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | streptonigrin.mp3 | 21-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | streptomycin.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | streptomycete.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | streptomyces.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | streptolysin.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | streptodornase.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | streptococcus.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | streptocarpus.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepto.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepsipterous.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepsipteron.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepsipteran.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepsipteral.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepogenin.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepitous.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strepitoso.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strephon.mp3 | 21-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | strep.mp3 | 21-Apr-2007 14:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | strenuous.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strengthless.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strengthen.mp3 | 21-Apr-2007 14:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | strength.mp3 | 21-Apr-2007 14:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | strengite.mp3 | 21-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | strelitzia.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streisand.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streicher.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | strega.mp3 | 21-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | streetward.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streetscape.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streetporter.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streeter.mp3 | 21-Apr-2007 14:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | streetcar.mp3 | 21-Apr-2007 14:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | street.mp3 | 21-Apr-2007 14:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | street-smart.mp3 | 21-Apr-2007 14:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | streep.mp3 | 21-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | streel.mp3 | 21-Apr-2007 14:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | streeking.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streek.mp3 | 21-Apr-2007 14:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | streamy.mp3 | 21-Apr-2007 14:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | streamwood.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streamlet.mp3 | 21-Apr-2007 14:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | streaming.mp3 | 21-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | streamer.mp3 | 21-Apr-2007 14:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | stream.mp3 | 21-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | streaky.mp3 | 21-Apr-2007 14:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | streaking.mp3 | 21-Apr-2007 14:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | streaker.mp3 | 21-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | streaked.mp3 | 21-Apr-2007 14:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | streak.mp3 | 21-Apr-2007 14:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | strayhorn.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stray.mp3 | 21-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | strawy.mp3 | 21-Apr-2007 14:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | strawson.mp3 | 21-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | strawberrybass.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | strawberry.mp3 | 21-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | straw.mp3 | 21-Apr-2007 14:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | stravinsky.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stravinskian.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stravage.mp3 | 21-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | strauss.mp3 | 21-Apr-2007 14:57 | 27K | |
![[SND]](/icons/sound2.gif) | straus.mp3 | 21-Apr-2007 14:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | stratus.mp3 | 21-Apr-2007 14:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | stratum.mp3 | 21-Apr-2007 14:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | stratton.mp3 | 21-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | stratovision.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stratosphere.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stratose.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stratopause.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stratofortress.mp3 | 21-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | stratocruiser.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratocracy.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | strato.mp3 | 21-Apr-2007 14:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | stratigraphy.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratify.mp3 | 21-Apr-2007 14:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | stratiformis.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratiform.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratifiedchargeengine.mp3 | 21-Apr-2007 14:56 | 27K | |
![[SND]](/icons/sound2.gif) | stratificationalgrammar.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratificational grammar.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratification.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | straticulate.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | strati.mp3 | 21-Apr-2007 14:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | strathspey.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | strathmore.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | strathconon.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | strathclyde.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | strath.mp3 | 21-Apr-2007 14:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | stratfordonavon.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratfordderedcliffe.mp3 | 21-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | stratford.mp3 | 21-Apr-2007 14:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | stratemeyer.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strategy.mp3 | 21-Apr-2007 14:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | strategize.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strategist.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strategics.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strategically.mp3 | 21-Apr-2007 14:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | strategic.mp3 | 21-Apr-2007 14:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | stratal.mp3 | 21-Apr-2007 14:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | stratagem.mp3 | 21-Apr-2007 14:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | strata.mp3 | 21-Apr-2007 14:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | strass.mp3 | 21-Apr-2007 14:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | strasbourg.mp3 | 21-Apr-2007 14:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | strasberg.mp3 | 21-Apr-2007 14:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | strapping.mp3 | 21-Apr-2007 14:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | strapper.mp3 | 21-Apr-2007 14:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | strapped.mp3 | 21-Apr-2007 14:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | strappado.mp3 | 21-Apr-2007 14:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | strapless.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strap.mp3 | 21-Apr-2007 14:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | stranraer.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strangury.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strangulation.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strangulate.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strangles.mp3 | 21-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | strangler.mp3 | 21-Apr-2007 14:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | strangle.mp3 | 21-Apr-2007 14:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | strangioso.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | stranger.mp3 | 21-Apr-2007 14:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | strangeness.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | strangely.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | strangelove.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | strange.mp3 | 21-Apr-2007 14:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | strang.mp3 | 21-Apr-2007 14:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | strandloper.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | strander.mp3 | 21-Apr-2007 14:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | stranded.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | strand.mp3 | 21-Apr-2007 14:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | stramonium.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | stramineous.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | stramash.mp3 | 21-Apr-2007 14:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | stralsund.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | strake.mp3 | 21-Apr-2007 14:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | straitsdollar.mp3 | 21-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | straiten.mp3 | 21-Apr-2007 14:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | strait.mp3 | 21-Apr-2007 14:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | strainer.mp3 | 21-Apr-2007 14:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | strained.mp3 | 21-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | strain.mp3 | 21-Apr-2007 14:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | straightway.mp3 | 21-Apr-2007 14:53 | 9.8K | |
![[SND]](/icons/sound2.gif) | straightforward.mp3 | 21-Apr-2007 14:53 | 10K | |
![[SND]](/icons/sound2.gif) | straighten.mp3 | 21-Apr-2007 14:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | straight.mp3 | 21-Apr-2007 14:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | straight-out.mp3 | 21-Apr-2007 14:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | straight-line.mp3 | 21-Apr-2007 14:53 | 11K | |
![[SND]](/icons/sound2.gif) | straight-facedly.mp3 | 21-Apr-2007 14:53 | 12K | |
![[SND]](/icons/sound2.gif) | straight-faced.mp3 | 21-Apr-2007 14:53 | 11K | |
![[SND]](/icons/sound2.gif) | straight-arm.mp3 | 21-Apr-2007 14:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | straight-ahead.mp3 | 21-Apr-2007 14:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | straggly.mp3 | 21-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | straggling.mp3 | 21-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | straggler.mp3 | 21-Apr-2007 14:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | straggle.mp3 | 21-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | strafford.mp3 | 21-Apr-2007 14:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | strafe.mp3 | 21-Apr-2007 14:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | stradivarius.mp3 | 21-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | stradivari.mp3 | 21-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | stradella.mp3 | 21-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | straddling.mp3 | 21-Apr-2007 14:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | straddler.mp3 | 21-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | straddle.mp3 | 21-Apr-2007 14:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | strad.mp3 | 21-Apr-2007 14:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | strack.mp3 | 21-Apr-2007 14:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | strachey.mp3 | 21-Apr-2007 14:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | strabotomy.mp3 | 21-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | strabo.mp3 | 21-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | strabismus.mp3 | 21-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | stquentin.mp3 | 21-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | stpierre.mp3 | 21-Apr-2007 14:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | stpetersburg.mp3 | 21-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | stpancras.mp3 | 21-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | stozzled.mp3 | 21-Apr-2007 14:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | stowp.mp3 | 21-Apr-2007 14:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | stownlins.mp3 | 21-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | stowe.mp3 | 21-Apr-2007 14:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | stowage.mp3 | 21-Apr-2007 14:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | stow.mp3 | 21-Apr-2007 14:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | stover.mp3 | 21-Apr-2007 14:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | stove.mp3 | 21-Apr-2007 14:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | stoutish.mp3 | 21-Apr-2007 14:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | stouten.mp3 | 21-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | stout.mp3 | 21-Apr-2007 14:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoushie.mp3 | 21-Apr-2007 14:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | stoush.mp3 | 21-Apr-2007 14:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | stourhead.mp3 | 21-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | stourbridge.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | stoup.mp3 | 21-Apr-2007 14:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | stound.mp3 | 21-Apr-2007 14:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoughton.mp3 | 21-Apr-2007 14:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | stouen.mp3 | 21-Apr-2007 14:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | stouch.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | stotter.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | stotious.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | stotinka.mp3 | 21-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | stoting.mp3 | 21-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | stot.mp3 | 21-Apr-2007 14:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | stoss.mp3 | 21-Apr-2007 14:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | stoshious.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | storyville.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | storyteller.mp3 | 21-Apr-2007 14:51 | 10K | |
![[SND]](/icons/sound2.gif) | storyette.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | story.mp3 | 21-Apr-2007 14:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | storting.mp3 | 21-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | storry.mp3 | 21-Apr-2007 14:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | stornoway.mp3 | 21-Apr-2007 14:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | stormy.mp3 | 21-Apr-2007 14:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | stormont.mp3 | 21-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | stormless.mp3 | 21-Apr-2007 14:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | storming.mp3 | 21-Apr-2007 14:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | stormer.mp3 | 21-Apr-2007 14:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | storm.mp3 | 21-Apr-2007 14:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | stork.mp3 | 21-Apr-2007 14:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | storiology.mp3 | 21-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | storiette.mp3 | 21-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | storied.mp3 | 21-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | storiated.mp3 | 21-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | storey.mp3 | 21-Apr-2007 14:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | storekeeper.mp3 | 21-Apr-2007 14:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | storehouse.mp3 | 21-Apr-2007 14:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | storebaelt.mp3 | 21-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | store.mp3 | 21-Apr-2007 14:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | store-bought.mp3 | 21-Apr-2007 14:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | storch.mp3 | 21-Apr-2007 14:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | storax.mp3 | 21-Apr-2007 14:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | storage.mp3 | 21-Apr-2007 14:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | storable.mp3 | 21-Apr-2007 14:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | stopt.mp3 | 21-Apr-2007 14:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | stoppo.mp3 | 21-Apr-2007 14:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | stopple.mp3 | 21-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | stopping.mp3 | 21-Apr-2007 14:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | stopper.mp3 | 21-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | stopped.mp3 | 21-Apr-2007 14:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoppard.mp3 | 21-Apr-2007 14:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | stoppage.mp3 | 21-Apr-2007 14:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | stoppable.mp3 | 21-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | stoping.mp3 | 21-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | stoph.mp3 | 21-Apr-2007 14:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | stopes.mp3 | 21-Apr-2007 14:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoper.mp3 | 21-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | stope.mp3 | 21-Apr-2007 14:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | stop.mp3 | 21-Apr-2007 14:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | stop-out.mp3 | 21-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | stop-motion.mp3 | 21-Apr-2007 14:49 | 10K | |
![[SND]](/icons/sound2.gif) | stop-and-go.mp3 | 21-Apr-2007 14:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | stop-action.mp3 | 21-Apr-2007 14:49 | 12K | |
![[SND]](/icons/sound2.gif) | stooshie.mp3 | 21-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | stoor.mp3 | 21-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | stoopnagel.mp3 | 21-Apr-2007 14:49 | 17K | |
![[SND]](/icons/sound2.gif) | stooper.mp3 | 21-Apr-2007 14:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoop.mp3 | 21-Apr-2007 14:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | stooly.mp3 | 21-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | stoolie.mp3 | 21-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | stool.mp3 | 21-Apr-2007 14:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | stookie.mp3 | 21-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | stook.mp3 | 21-Apr-2007 14:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | stooge.mp3 | 21-Apr-2007 14:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | stood.mp3 | 21-Apr-2007 14:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | stonyhurstcollege.mp3 | 21-Apr-2007 14:48 | 18K | |
![[SND]](/icons/sound2.gif) | stony.mp3 | 21-Apr-2007 14:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | stonking.mp3 | 21-Apr-2007 14:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | stonkered.mp3 | 21-Apr-2007 14:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | stonker.mp3 | 21-Apr-2007 14:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | stonk.mp3 | 21-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | stonies.mp3 | 21-Apr-2007 14:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoney.mp3 | 21-Apr-2007 14:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | stones.mp3 | 21-Apr-2007 14:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoner.mp3 | 21-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | stoneofscone.mp3 | 21-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | stoneman.mp3 | 21-Apr-2007 14:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | stoneless.mp3 | 21-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | stoneham.mp3 | 21-Apr-2007 14:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | stoned.mp3 | 21-Apr-2007 14:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | stonebass.mp3 | 21-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | stone.mp3 | 21-Apr-2007 14:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | stone-ground.mp3 | 21-Apr-2007 14:48 | 11K | |
![[SND]](/icons/sound2.gif) | stone-deaf.mp3 | 21-Apr-2007 14:48 | 10K | |
![[SND]](/icons/sound2.gif) | stone-cold.mp3 | 21-Apr-2007 14:48 | 10K | |
![[SND]](/icons/sound2.gif) | stone-blind.mp3 | 21-Apr-2007 14:48 | 11K | |
![[SND]](/icons/sound2.gif) | stomy.mp3 | 21-Apr-2007 14:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | stompie.mp3 | 21-Apr-2007 14:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | stomp.mp3 | 21-Apr-2007 14:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | stomous.mp3 | 21-Apr-2007 14:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | stomodeum.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomodaeum.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stome.mp3 | 21-Apr-2007 14:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | stomatous.mp3 | 21-Apr-2007 14:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | stomatotomy.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomatoscope.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomatopod.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomatoplasty.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomatomy.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomatology.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomato.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomatitis.mp3 | 21-Apr-2007 14:47 | 17K | |
![[SND]](/icons/sound2.gif) | stomatic.mp3 | 21-Apr-2007 14:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | stomate.mp3 | 21-Apr-2007 14:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | stomatal.mp3 | 21-Apr-2007 14:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | stomata.mp3 | 21-Apr-2007 14:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | stomat.mp3 | 21-Apr-2007 14:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | stomal.mp3 | 21-Apr-2007 14:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | stomack.mp3 | 21-Apr-2007 14:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | stomachy.mp3 | 21-Apr-2007 14:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | stomachic.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stomachful.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stomacher.mp3 | 21-Apr-2007 14:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | stomachal.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stomachache.mp3 | 21-Apr-2007 14:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | stomach.mp3 | 21-Apr-2007 14:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | stoma.mp3 | 21-Apr-2007 14:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | stolypin.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stolonization.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stoloniferous.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stolonate.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stolon.mp3 | 21-Apr-2007 14:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | stollen.mp3 | 21-Apr-2007 14:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | stolid.mp3 | 21-Apr-2007 14:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | stolichnaya.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stolen.mp3 | 21-Apr-2007 14:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | stole.mp3 | 21-Apr-2007 14:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | stola.mp3 | 21-Apr-2007 14:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | stol.mp3 | 21-Apr-2007 14:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | stokowski.mp3 | 21-Apr-2007 14:46 | 17K | |
![[SND]](/icons/sound2.gif) | stokin.mp3 | 21-Apr-2007 14:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | stokesia.mp3 | 21-Apr-2007 14:45 | 17K | |
![[SND]](/icons/sound2.gif) | stokesaycastle.mp3 | 21-Apr-2007 14:45 | 18K | |
![[SND]](/icons/sound2.gif) | stokes.mp3 | 21-Apr-2007 14:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoker.mp3 | 21-Apr-2007 14:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | stokepoges.mp3 | 21-Apr-2007 14:45 | 17K | |
![[SND]](/icons/sound2.gif) | stokenewington.mp3 | 21-Apr-2007 14:45 | 17K | |
![[SND]](/icons/sound2.gif) | stokemandeville.mp3 | 21-Apr-2007 14:45 | 17K | |
![[SND]](/icons/sound2.gif) | stoked.mp3 | 21-Apr-2007 14:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | stoke.mp3 | 21-Apr-2007 14:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | stoiter.mp3 | 21-Apr-2007 14:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | stoit.mp3 | 21-Apr-2007 14:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | stoichiometry.mp3 | 21-Apr-2007 14:45 | 17K | |
![[SND]](/icons/sound2.gif) | stoichiometric.mp3 | 21-Apr-2007 14:45 | 27K | |
![[SND]](/icons/sound2.gif) | stoichiology.mp3 | 21-Apr-2007 14:45 | 17K | |
![[SND]](/icons/sound2.gif) | stoical.mp3 | 21-Apr-2007 14:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | stoic.mp3 | 21-Apr-2007 14:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | stogy.mp3 | 21-Apr-2007 14:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | stoep.mp3 | 21-Apr-2007 14:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | stoechiometry.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stoechiometric.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stoechiology.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stodgy.mp3 | 21-Apr-2007 14:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | stodge.mp3 | 21-Apr-2007 14:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | stoddert.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stoddard.mp3 | 21-Apr-2007 14:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | stocky.mp3 | 21-Apr-2007 14:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | stockwood.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stocktonontees.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stockton.mp3 | 21-Apr-2007 14:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | stockport.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stockman.mp3 | 21-Apr-2007 14:44 | 27K | |
![[SND]](/icons/sound2.gif) | stockless.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stockjobber.mp3 | 21-Apr-2007 14:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | stockist.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stockish.mp3 | 21-Apr-2007 14:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | stockinger.mp3 | 21-Apr-2007 14:44 | 17K | |
![[SND]](/icons/sound2.gif) | stockinged.mp3 | 21-Apr-2007 14:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | stocking.mp3 | 21-Apr-2007 14:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | stockinette.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stockholder.mp3 | 21-Apr-2007 14:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | stockhausen.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stocker.mp3 | 21-Apr-2007 14:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | stockateer.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stockade.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stock.mp3 | 21-Apr-2007 14:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | stock-in-trade.mp3 | 21-Apr-2007 14:44 | 11K | |
![[SND]](/icons/sound2.gif) | stocious.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stochastic.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stoccado.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stob.mp3 | 21-Apr-2007 14:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | stoating.mp3 | 21-Apr-2007 14:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | stoat.mp3 | 21-Apr-2007 14:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | stoa.mp3 | 21-Apr-2007 14:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | stnazaire.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stmoritz.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stmirren.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stmihiel.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stmarys.mp3 | 21-Apr-2007 14:43 | 17K | |
![[SND]](/icons/sound2.gif) | stmarylebow.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stmartin.mp3 | 21-Apr-2007 14:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | stmalo.mp3 | 21-Apr-2007 14:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | stlukessummer.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stluciecherry.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stlucia.mp3 | 21-Apr-2007 14:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | stlouis.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stlo.mp3 | 21-Apr-2007 14:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | stleonard.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stleger.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stlaurent.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stkitts.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stjohnperse.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stjerome.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stjean.mp3 | 21-Apr-2007 14:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | stjames.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stiver.mp3 | 21-Apr-2007 14:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | stivel.mp3 | 21-Apr-2007 14:42 | 17K | |
![[SND]](/icons/sound2.gif) | stithy.mp3 | 21-Apr-2007 14:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | stitching.mp3 | 21-Apr-2007 14:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | stitchery.mp3 | 21-Apr-2007 14:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | stitched.mp3 | 21-Apr-2007 14:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | stitch.mp3 | 21-Apr-2007 14:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | stishovite.mp3 | 21-Apr-2007 14:41 | 17K | |
![[SND]](/icons/sound2.gif) | stishie.mp3 | 21-Apr-2007 14:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | stirrup.mp3 | 21-Apr-2007 14:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | stirring.mp3 | 21-Apr-2007 14:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | stirrer.mp3 | 21-Apr-2007 14:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | stirps.mp3 | 21-Apr-2007 14:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | stirpiculture.mp3 | 21-Apr-2007 14:41 | 17K | |
![[SND]](/icons/sound2.gif) | stirp.mp3 | 21-Apr-2007 14:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | stirling.mp3 | 21-Apr-2007 14:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | stirk.mp3 | 21-Apr-2007 14:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | stir.mp3 | 21-Apr-2007 14:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | stir-fry.mp3 | 21-Apr-2007 14:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | stipuliform.mp3 | 21-Apr-2007 14:41 | 17K | |
![[SND]](/icons/sound2.gif) | stipule.mp3 | 21-Apr-2007 14:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | stipulation.mp3 | 21-Apr-2007 14:41 | 17K | |
![[SND]](/icons/sound2.gif) | stipulate.mp3 | 21-Apr-2007 14:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | stipple.mp3 | 21-Apr-2007 14:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | stipo.mp3 | 21-Apr-2007 14:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | stipitiform.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stipitate.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stipes.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stipendiary.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stipend.mp3 | 21-Apr-2007 14:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | stipel.mp3 | 21-Apr-2007 14:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | stipe.mp3 | 21-Apr-2007 14:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | stint.mp3 | 21-Apr-2007 14:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | stinnes.mp3 | 21-Apr-2007 14:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | stinky.mp3 | 21-Apr-2007 14:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | stinko.mp3 | 21-Apr-2007 14:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | stinking.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stinkie.mp3 | 21-Apr-2007 14:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | stinkerroo.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stinker.mp3 | 21-Apr-2007 14:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | stinkaroo.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stinkard.mp3 | 21-Apr-2007 14:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | stink.mp3 | 21-Apr-2007 14:40 | 6.1K | |
![[SND]](/icons/sound2.gif) | stingy.mp3 | 21-Apr-2007 14:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | stingo.mp3 | 21-Apr-2007 14:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | stinglessbee.mp3 | 21-Apr-2007 14:40 | 17K | |
![[SND]](/icons/sound2.gif) | stinginess.mp3 | 21-Apr-2007 14:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | stinger.mp3 | 21-Apr-2007 14:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | stingaree.mp3 | 21-Apr-2007 14:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | sting.mp3 | 21-Apr-2007 14:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | stimy.mp3 | 21-Apr-2007 14:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | stimulus.mp3 | 21-Apr-2007 14:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | stimulose.mp3 | 21-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | stimulative.mp3 | 21-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | stimulation.mp3 | 21-Apr-2007 14:39 | 10K | |
![[SND]](/icons/sound2.gif) | stimulating.mp3 | 21-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | stimulate.mp3 | 21-Apr-2007 14:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | stimulant.mp3 | 21-Apr-2007 14:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | stimson.mp3 | 21-Apr-2007 14:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | stimoceiver.mp3 | 21-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | stime.mp3 | 21-Apr-2007 14:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | stilyaga.mp3 | 21-Apr-2007 14:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | stilwell.mp3 | 21-Apr-2007 14:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | stilus.mp3 | 21-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | stilton.mp3 | 21-Apr-2007 14:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | stilted.mp3 | 21-Apr-2007 14:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | stilt.mp3 | 21-Apr-2007 14:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | stilly.mp3 | 21-Apr-2007 14:39 | 27K | |
![[SND]](/icons/sound2.gif) | stillwater.mp3 | 21-Apr-2007 14:39 | 17K | |
![[SND]](/icons/sound2.gif) | stillsonwrench.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stillness.mp3 | 21-Apr-2007 14:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | stillman.mp3 | 21-Apr-2007 14:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | stillion.mp3 | 21-Apr-2007 14:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | stilliform.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stillicide.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stiller.mp3 | 21-Apr-2007 14:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | stillage.mp3 | 21-Apr-2007 14:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | still.mp3 | 21-Apr-2007 14:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | still-hunt.mp3 | 21-Apr-2007 14:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | stilicho.mp3 | 21-Apr-2007 14:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | stiletto.mp3 | 21-Apr-2007 14:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | stile.mp3 | 21-Apr-2007 14:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | stilbite.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stilbestrol.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stilbene.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stilb.mp3 | 21-Apr-2007 14:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | stijlde.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stigmatize.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stigmatist.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stigmatism.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stigmatic.mp3 | 21-Apr-2007 14:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | stigmasterol.mp3 | 21-Apr-2007 14:38 | 17K | |
![[SND]](/icons/sound2.gif) | stigma.mp3 | 21-Apr-2007 14:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | stifling.mp3 | 21-Apr-2007 14:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | stifle.mp3 | 21-Apr-2007 14:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | stiffy.mp3 | 21-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | stiffie.mp3 | 21-Apr-2007 14:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | stiffener.mp3 | 21-Apr-2007 14:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | stiffen.mp3 | 21-Apr-2007 14:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | stiff.mp3 | 21-Apr-2007 14:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | stiff-necked.mp3 | 21-Apr-2007 14:37 | 9.8K | |
![[SND]](/icons/sound2.gif) | stiff-arm.mp3 | 21-Apr-2007 14:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | sticky.mp3 | 21-Apr-2007 14:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | stickweed.mp3 | 21-Apr-2007 14:37 | 17K | |
![[SND]](/icons/sound2.gif) | stickum.mp3 | 21-Apr-2007 14:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | sticktoitive.mp3 | 21-Apr-2007 14:37 | 17K | |
![[SND]](/icons/sound2.gif) | sticksing.mp3 | 21-Apr-2007 14:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | stickman.mp3 | 21-Apr-2007 14:37 | 17K | |
![[SND]](/icons/sound2.gif) | stickler.mp3 | 21-Apr-2007 14:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | stickle.mp3 | 21-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | stickit.mp3 | 21-Apr-2007 14:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | sticking.mp3 | 21-Apr-2007 14:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | stickiness.mp3 | 21-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | stickie.mp3 | 21-Apr-2007 14:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | stickful.mp3 | 21-Apr-2007 14:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | sticker.mp3 | 21-Apr-2007 14:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | stickatitive.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stick.mp3 | 21-Apr-2007 14:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | stick-in-the-mud.mp3 | 21-Apr-2007 14:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | stichous.mp3 | 21-Apr-2007 14:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | stichomythia.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stichometry.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stichic.mp3 | 21-Apr-2007 14:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | sticharion.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stich.mp3 | 21-Apr-2007 14:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | stibnite.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stibium.mp3 | 21-Apr-2007 14:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | stibine.mp3 | 21-Apr-2007 14:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | stibial.mp3 | 21-Apr-2007 14:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | stheno.mp3 | 21-Apr-2007 14:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | sthenic.mp3 | 21-Apr-2007 14:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | sthenia.mp3 | 21-Apr-2007 14:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | sthenelus.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | sthelier.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | sthelena.mp3 | 21-Apr-2007 14:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | stgotthard.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stgermainenlaye.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stgermaindespres.mp3 | 21-Apr-2007 14:36 | 17K | |
![[SND]](/icons/sound2.gif) | stgermain.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stgallen.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | steyr.mp3 | 21-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | stey.mp3 | 21-Apr-2007 14:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | stewed.mp3 | 21-Apr-2007 14:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | stewartisland.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stewardess.mp3 | 21-Apr-2007 14:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | steward.mp3 | 21-Apr-2007 14:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | stew.mp3 | 21-Apr-2007 14:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | stevioside.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stevinus.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stevin.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stevia.mp3 | 21-Apr-2007 14:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | stevenspoint.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stevens.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stevengraph.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | stevenage.mp3 | 21-Apr-2007 14:35 | 17K | |
![[SND]](/icons/sound2.gif) | steven.mp3 | 21-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | stevedore.mp3 | 21-Apr-2007 14:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | steve.mp3 | 21-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | steustatius.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | steubenville.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | steuben.mp3 | 21-Apr-2007 14:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | stettinius.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | stetson.mp3 | 21-Apr-2007 14:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | stetienne.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | stethoscopic.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | stethoscope.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | stethometer.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | stethograph.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | stetho.mp3 | 21-Apr-2007 14:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | stet.mp3 | 21-Apr-2007 14:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | stertorous.mp3 | 21-Apr-2007 14:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | stertor.mp3 | 21-Apr-2007 14:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sterope.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | sterol.mp3 | 21-Apr-2007 14:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | steroidogenesis.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | steroid.mp3 | 21-Apr-2007 14:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | sternward.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | sternutatory.mp3 | 21-Apr-2007 14:34 | 17K | |
![[SND]](/icons/sound2.gif) | sternutator.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sternutation.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sternum.mp3 | 21-Apr-2007 14:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sternson.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sternocleidomastoid.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sternoclavicular.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sterno.mp3 | 21-Apr-2007 14:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | sternite.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sterne.mp3 | 21-Apr-2007 14:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | sternberg.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sternal.mp3 | 21-Apr-2007 14:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | sterna.mp3 | 21-Apr-2007 14:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | stern.mp3 | 21-Apr-2007 14:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | stern-wheeler.mp3 | 21-Apr-2007 14:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | sterlitamak.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sterling.mp3 | 21-Apr-2007 14:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | sterlet.mp3 | 21-Apr-2007 14:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | sterks.mp3 | 21-Apr-2007 14:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sterilize.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sterilization.mp3 | 21-Apr-2007 14:33 | 17K | |
![[SND]](/icons/sound2.gif) | sterility.mp3 | 21-Apr-2007 14:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | sterile.mp3 | 21-Apr-2007 14:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | sterilant.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | sterigma.mp3 | 21-Apr-2007 14:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | steric.mp3 | 21-Apr-2007 14:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | stereotypy.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotypical.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotypic.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotyped.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotype.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotropism.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotomy.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotaxis.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereotaxic.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereoscopy.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereoscopic.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereoscope.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereopticon.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereopsis.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereophony.mp3 | 21-Apr-2007 14:32 | 17K | |
![[SND]](/icons/sound2.gif) | stereophonics.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereophonic.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereophone.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereometry.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereology.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereography.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereographicprojection.mp3 | 21-Apr-2007 14:31 | 27K | |
![[SND]](/icons/sound2.gif) | stereographer.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereograph.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereogram.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereognosis.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereochromy.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereochrome.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereobate.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stereo.mp3 | 21-Apr-2007 14:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | stere.mp3 | 21-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sterculiaceous.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | sterculia.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stercoricolous.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stercoral.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | stercoraceous.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | steradian.mp3 | 21-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | ster.mp3 | 21-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | stepstool.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stepper.mp3 | 21-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | steppenwolf.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stepped.mp3 | 21-Apr-2007 14:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | stepped-up.mp3 | 21-Apr-2007 14:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | steppe.mp3 | 21-Apr-2007 14:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | stepney.mp3 | 21-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | stepmother.mp3 | 21-Apr-2007 14:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | steplike.mp3 | 21-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | stepladder.mp3 | 21-Apr-2007 14:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | stepinfetchit.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stephenson.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stephens.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stephendedalus.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stephanotis.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stephanite.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | stephanie.mp3 | 21-Apr-2007 14:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | stepfather.mp3 | 21-Apr-2007 14:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | stepanakert.mp3 | 21-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | step.mp3 | 21-Apr-2007 14:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | step-up.mp3 | 21-Apr-2007 14:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | step-down.mp3 | 21-Apr-2007 14:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | stentorphone.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stentorophonic.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stentorious.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stentorian.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stentor.mp3 | 21-Apr-2007 14:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | stenotypy.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenotype.mp3 | 21-Apr-2007 14:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | stenotopic.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenothermophilic.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenothermophile.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenotherm.mp3 | 21-Apr-2007 14:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | stenosis.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenosed.mp3 | 21-Apr-2007 14:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | stenophyllous.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenophagous.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenopeic.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenoky.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenohygric.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenohaline.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenography.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenographer.mp3 | 21-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | stenograph.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stenochromy.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stenochrome.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stenocephalic.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stenobathic.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stenobath.mp3 | 21-Apr-2007 14:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | steno.mp3 | 21-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | stenkarazin.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stengel.mp3 | 21-Apr-2007 14:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | stengah.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stendhal.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stencilize.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stencil.mp3 | 21-Apr-2007 14:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | stench.mp3 | 21-Apr-2007 14:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | sten.mp3 | 21-Apr-2007 14:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | stemwinding.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stemwinder.mp3 | 21-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | stemson.mp3 | 21-Apr-2007 14:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | stemple.mp3 | 21-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | stemmy.mp3 | 21-Apr-2007 14:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | stemmery.mp3 | 21-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | stemmer.mp3 | 21-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | stemmed.mp3 | 21-Apr-2007 14:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | stemma.mp3 | 21-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | stemilion.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stem.mp3 | 21-Apr-2007 14:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | stem-winding.mp3 | 21-Apr-2007 14:28 | 11K | |
![[SND]](/icons/sound2.gif) | stem-winder.mp3 | 21-Apr-2007 14:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | stelmosfire.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stellular.mp3 | 21-Apr-2007 14:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | stellite.mp3 | 21-Apr-2007 14:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | stellionate.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stellify.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stelliform.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stelliferous.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stellerseider.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stellenbosch.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stellate.mp3 | 21-Apr-2007 14:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | stellarwind.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stellarator.mp3 | 21-Apr-2007 14:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | stellar.mp3 | 21-Apr-2007 14:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | stellaartois.mp3 | 21-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | stella.mp3 | 21-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | stele.mp3 | 21-Apr-2007 14:27 | 27K | |
![[SND]](/icons/sound2.gif) | stelazine.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | stela.mp3 | 21-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | steinway.mp3 | 21-Apr-2007 14:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | steinmetz.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steinman.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steinlager.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steinkirk.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steinkern.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steinitz.mp3 | 21-Apr-2007 14:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | steinheimman.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steinhager.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steiner.mp3 | 21-Apr-2007 14:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | steinem.mp3 | 21-Apr-2007 14:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | steinbok.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steinberg.mp3 | 21-Apr-2007 14:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | stein.mp3 | 21-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | steiermark.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | steier.mp3 | 21-Apr-2007 14:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | steichen.mp3 | 21-Apr-2007 14:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | stegosaur.mp3 | 21-Apr-2007 14:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | stegomyia.mp3 | 21-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | stegodon.mp3 | 21-Apr-2007 14:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | stego.mp3 | 21-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | steffens.mp3 | 21-Apr-2007 14:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | stefansson.mp3 | 21-Apr-2007 14:25 | 17K | |
![[SND]](/icons/sound2.gif) | stefano.mp3 | 21-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | stefanie.mp3 | 21-Apr-2007 14:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | stefandusan.mp3 | 21-Apr-2007 14:25 | 17K | |
![[SND]](/icons/sound2.gif) | stefanboltzmannlaw.mp3 | 21-Apr-2007 14:25 | 17K | |
![[SND]](/icons/sound2.gif) | stefan.mp3 | 21-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | steeve.mp3 | 21-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | steersman.mp3 | 21-Apr-2007 14:25 | 17K | |
![[SND]](/icons/sound2.gif) | steering.mp3 | 21-Apr-2007 14:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | steerer.mp3 | 21-Apr-2007 14:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | steerage.mp3 | 21-Apr-2007 14:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | steerable.mp3 | 21-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | steer.mp3 | 21-Apr-2007 14:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | steepy.mp3 | 21-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | steeple.mp3 | 21-Apr-2007 14:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | steepen.mp3 | 21-Apr-2007 14:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | steep.mp3 | 21-Apr-2007 14:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | steenth.mp3 | 21-Apr-2007 14:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | steenkirk.mp3 | 21-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | steenbok.mp3 | 21-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | steen.mp3 | 21-Apr-2007 14:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | steelyard.mp3 | 21-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | steely.mp3 | 21-Apr-2007 14:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | steelman.mp3 | 21-Apr-2007 14:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | steelie.mp3 | 21-Apr-2007 14:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | steelhead.mp3 | 21-Apr-2007 14:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | steel.mp3 | 21-Apr-2007 14:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | steel-trap.mp3 | 21-Apr-2007 14:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | steek.mp3 | 21-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | steed.mp3 | 21-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | stedfast.mp3 | 21-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | stechkin.mp3 | 21-Apr-2007 14:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | stechhelm.mp3 | 21-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | stech.mp3 | 21-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | steatosis.mp3 | 21-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | steatorrhea.mp3 | 21-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | steatopygia.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | steatolysis.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | steato.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | steatite.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | stearylalcohol.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | stearoptene.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | stearo.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | stearin.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | stearic acid.mp3 | 21-Apr-2007 14:23 | 12K | |
![[SND]](/icons/sound2.gif) | stearic.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | stearate.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | stear.mp3 | 21-Apr-2007 14:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | steapsin.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | steannedebeaupre.mp3 | 21-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | steamy.mp3 | 21-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | steamship.mp3 | 21-Apr-2007 14:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | steaming.mp3 | 21-Apr-2007 14:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | steamie.mp3 | 21-Apr-2007 14:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | steamfitter.mp3 | 21-Apr-2007 14:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | steamer.mp3 | 21-Apr-2007 14:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | steamboat.mp3 | 21-Apr-2007 14:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | steam.mp3 | 21-Apr-2007 14:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | stealthy.mp3 | 21-Apr-2007 14:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | stealth.mp3 | 21-Apr-2007 14:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | stealing.mp3 | 21-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | stealer.mp3 | 21-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | stealage.mp3 | 21-Apr-2007 14:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | stealable.mp3 | 21-Apr-2007 14:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | steal.mp3 | 21-Apr-2007 14:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | steakdiane.mp3 | 21-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | steakaupoivre.mp3 | 21-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | steak.mp3 | 21-Apr-2007 14:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | steady.mp3 | 21-Apr-2007 14:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | steading.mp3 | 21-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | steadiness.mp3 | 21-Apr-2007 14:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | steadily.mp3 | 21-Apr-2007 14:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | steadier.mp3 | 21-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | steadfast.mp3 | 21-Apr-2007 14:22 | 10K | |
![[SND]](/icons/sound2.gif) | stead.mp3 | 21-Apr-2007 14:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | stdenis.mp3 | 21-Apr-2007 14:22 | 27K | |
![[SND]](/icons/sound2.gif) | stcyrlecole.mp3 | 21-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | stcroix.mp3 | 21-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | stcloud.mp3 | 21-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | stclair.mp3 | 21-Apr-2007 14:22 | 27K | |
![[SND]](/icons/sound2.gif) | stcatharines.mp3 | 21-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | stbrieuc.mp3 | 21-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | stbernard.mp3 | 21-Apr-2007 14:21 | 27K | |
![[SND]](/icons/sound2.gif) | staysail.mp3 | 21-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | stayman.mp3 | 21-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | stayer.mp3 | 21-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | stay.mp3 | 21-Apr-2007 14:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | stay-at-home.mp3 | 21-Apr-2007 14:21 | 11K | |
![[SND]](/icons/sound2.gif) | staw.mp3 | 21-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | stavropol.mp3 | 21-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | staviskyaffair.mp3 | 21-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | staving.mp3 | 21-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | stavesacre.mp3 | 21-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | staves.mp3 | 21-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | staver.mp3 | 21-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | stave.mp3 | 21-Apr-2007 14:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | stavanger.mp3 | 21-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | stauroscope.mp3 | 21-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | stauropegion.mp3 | 21-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | staurolite.mp3 | 21-Apr-2007 14:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | staunton.mp3 | 21-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | staunch.mp3 | 21-Apr-2007 14:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | staun.mp3 | 21-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | staumrel.mp3 | 21-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | staugustine.mp3 | 21-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | stauffenberg.mp3 | 21-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | staudinger.mp3 | 21-Apr-2007 14:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | statvolt.mp3 | 21-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | statutory.mp3 | 21-Apr-2007 14:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | statute.mp3 | 21-Apr-2007 14:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | statutable.mp3 | 21-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | status quo ante bellum.mp3 | 21-Apr-2007 14:20 | 16K | |
![[SND]](/icons/sound2.gif) | statusquoante.mp3 | 21-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | status quo ante.mp3 | 21-Apr-2007 14:20 | 14K | |
![[SND]](/icons/sound2.gif) | statusquo.mp3 | 21-Apr-2007 14:20 | 36K | |
![[SND]](/icons/sound2.gif) | status.mp3 | 21-Apr-2007 14:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | statured.mp3 | 21-Apr-2007 14:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | stature.mp3 | 21-Apr-2007 14:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | statuette.mp3 | 21-Apr-2007 14:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | statuesque.mp3 | 21-Apr-2007 14:20 | 10K | |
![[SND]](/icons/sound2.gif) | statued.mp3 | 21-Apr-2007 14:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | statue.mp3 | 21-Apr-2007 14:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | statuary.mp3 | 21-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | stats.mp3 | 21-Apr-2007 14:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | statoscope.mp3 | 21-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | stator.mp3 | 21-Apr-2007 14:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | statolith.mp3 | 21-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | statolatry.mp3 | 21-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | statohm.mp3 | 21-Apr-2007 14:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | statocyst.mp3 | 21-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | stato.mp3 | 21-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | statler.mp3 | 21-Apr-2007 14:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | stative.mp3 | 21-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | statius.mp3 | 21-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | statistics.mp3 | 21-Apr-2007 14:19 | 10K | |
![[SND]](/icons/sound2.gif) | statistician.mp3 | 21-Apr-2007 14:19 | 11K | |
![[SND]](/icons/sound2.gif) | statistical.mp3 | 21-Apr-2007 14:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | statistic.mp3 | 21-Apr-2007 14:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | statist.mp3 | 21-Apr-2007 14:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | statism.mp3 | 21-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | stationery.mp3 | 21-Apr-2007 14:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | stationer.mp3 | 21-Apr-2007 14:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | stationary.mp3 | 21-Apr-2007 14:19 | 10K | |
![[SND]](/icons/sound2.gif) | station.mp3 | 21-Apr-2007 14:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | statie.mp3 | 21-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | statics.mp3 | 21-Apr-2007 14:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | statice.mp3 | 21-Apr-2007 14:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | static.mp3 | 21-Apr-2007 14:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | stathenry.mp3 | 21-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | statfarad.mp3 | 21-Apr-2007 14:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | statesville.mp3 | 21-Apr-2007 14:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | statesman.mp3 | 21-Apr-2007 14:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | stater.mp3 | 21-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | stateowned.mp3 | 21-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | stateo.mp3 | 21-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | statenisland.mp3 | 21-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | statement.mp3 | 21-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | stately.mp3 | 21-Apr-2007 14:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | stateless.mp3 | 21-Apr-2007 14:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | statehooder.mp3 | 21-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | statehood.mp3 | 21-Apr-2007 14:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | stated.mp3 | 21-Apr-2007 14:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | statecraft.mp3 | 21-Apr-2007 14:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | state.mp3 | 21-Apr-2007 14:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | statcoulomb.mp3 | 21-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | statant.mp3 | 21-Apr-2007 14:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | statampere.mp3 | 21-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | statal.mp3 | 21-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | stat.mp3 | 21-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | stassfurtite.mp3 | 21-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | stassen.mp3 | 21-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | stasis.mp3 | 21-Apr-2007 14:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | stasimon.mp3 | 21-Apr-2007 14:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | stasidion.mp3 | 21-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | stasi.mp3 | 21-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | stash.mp3 | 21-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | stase.mp3 | 21-Apr-2007 14:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | staryoskol.mp3 | 21-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | starwort.mp3 | 21-Apr-2007 14:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | starveling.mp3 | 21-Apr-2007 14:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | starve.mp3 | 21-Apr-2007 14:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | starvation.mp3 | 21-Apr-2007 14:17 | 10K | |
![[SND]](/icons/sound2.gif) | startsy.mp3 | 21-Apr-2007 14:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | startling.mp3 | 21-Apr-2007 14:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | startle.mp3 | 21-Apr-2007 14:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | starter.mp3 | 21-Apr-2007 14:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | start.mp3 | 21-Apr-2007 14:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | start-up.mp3 | 21-Apr-2007 14:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | starrygrasswort.mp3 | 21-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | starry.mp3 | 21-Apr-2007 14:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | starry-eyed.mp3 | 21-Apr-2007 14:16 | 9.8K | |
![[SND]](/icons/sound2.gif) | starrer.mp3 | 21-Apr-2007 14:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | starred.mp3 | 21-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | starling.mp3 | 21-Apr-2007 14:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | starlight.mp3 | 21-Apr-2007 14:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | starlet.mp3 | 21-Apr-2007 14:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | starko.mp3 | 21-Apr-2007 14:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | starkist.mp3 | 21-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | starkers.mp3 | 21-Apr-2007 14:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | starka.mp3 | 21-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | stark.mp3 | 21-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | staring.mp3 | 21-Apr-2007 14:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | starfish.mp3 | 21-Apr-2007 14:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | starets.mp3 | 21-Apr-2007 14:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | starer.mp3 | 21-Apr-2007 14:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | staredecisis.mp3 | 21-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | stare.mp3 | 21-Apr-2007 14:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | stardust.mp3 | 21-Apr-2007 14:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | stardom.mp3 | 21-Apr-2007 14:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | starchy.mp3 | 21-Apr-2007 14:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | starched.mp3 | 21-Apr-2007 14:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | starch.mp3 | 21-Apr-2007 14:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | starcarr.mp3 | 21-Apr-2007 14:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | starboarder.mp3 | 21-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | starboard.mp3 | 21-Apr-2007 14:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | starazagora.mp3 | 21-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | star.mp3 | 21-Apr-2007 14:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | star-spangled.mp3 | 21-Apr-2007 14:17 | 10K | |
![[SND]](/icons/sound2.gif) | star-of-Bethlehem.mp3 | 21-Apr-2007 14:16 | 16K | |
![[SND]](/icons/sound2.gif) | star-nosed mole.mp3 | 21-Apr-2007 14:16 | 13K | |
![[SND]](/icons/sound2.gif) | star-chamber.mp3 | 21-Apr-2007 14:15 | 11K | |
![[SND]](/icons/sound2.gif) | stapling.mp3 | 21-Apr-2007 14:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | stapler.mp3 | 21-Apr-2007 14:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | staple.mp3 | 21-Apr-2007 14:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | staphylotomy.mp3 | 21-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | staphylorrhaphy.mp3 | 21-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | staphyloma.mp3 | 21-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | staphylo.mp3 | 21-Apr-2007 14:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | staphylitis.mp3 | 21-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | staphylinid.mp3 | 21-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | staph.mp3 | 21-Apr-2007 14:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | stapes.mp3 | 21-Apr-2007 14:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | stapelia.mp3 | 21-Apr-2007 14:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | stapedial.mp3 | 21-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | stapedectomy.mp3 | 21-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | stap.mp3 | 21-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | stanza.mp3 | 21-Apr-2007 14:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | stanwyck.mp3 | 21-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | stanstedairport.mp3 | 21-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | stanovoi.mp3 | 21-Apr-2007 14:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | stannum.mp3 | 21-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | stannous.mp3 | 21-Apr-2007 14:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | stannite.mp3 | 21-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | stanniferous.mp3 | 21-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | stannic.mp3 | 21-Apr-2007 14:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | stannate.mp3 | 21-Apr-2007 14:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | stannary.mp3 | 21-Apr-2007 14:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | stann.mp3 | 21-Apr-2007 14:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | stanky.mp3 | 21-Apr-2007 14:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | stank.mp3 | 21-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | stanislawow.mp3 | 21-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | stanislavski.mp3 | 21-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | stanislaus.mp3 | 21-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | stanine.mp3 | 21-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | staniel.mp3 | 21-Apr-2007 14:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | stanhope.mp3 | 21-Apr-2007 14:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | stang.mp3 | 21-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | stanfordbinettest.mp3 | 21-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | stanford.mp3 | 21-Apr-2007 14:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | stane.mp3 | 21-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | stand up.mp3 | 21-Apr-2007 14:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | standstill.mp3 | 21-Apr-2007 14:13 | 10K | |
![[SND]](/icons/sound2.gif) | standpoint.mp3 | 21-Apr-2007 14:13 | 10K | |
![[SND]](/icons/sound2.gif) | standpattism.mp3 | 21-Apr-2007 14:13 | 12K | |
![[SND]](/icons/sound2.gif) | standpatter.mp3 | 21-Apr-2007 14:13 | 10K | |
![[SND]](/icons/sound2.gif) | standish.mp3 | 21-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | standing O.mp3 | 21-Apr-2007 14:12 | 10K | |
![[SND]](/icons/sound2.gif) | standing.mp3 | 21-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | stander.mp3 | 21-Apr-2007 14:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | standee.mp3 | 21-Apr-2007 14:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | standardize.mp3 | 21-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | standardization.mp3 | 21-Apr-2007 14:12 | 12K | |
![[SND]](/icons/sound2.gif) | standard.mp3 | 21-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | standard-issue.mp3 | 21-Apr-2007 14:12 | 12K | |
![[SND]](/icons/sound2.gif) | standard-bearer.mp3 | 21-Apr-2007 14:12 | 11K | |
![[SND]](/icons/sound2.gif) | stand.mp3 | 21-Apr-2007 14:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | stand-upper.mp3 | 21-Apr-2007 14:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | stand-up.mp3 | 21-Apr-2007 14:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | stand-down.mp3 | 21-Apr-2007 14:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | stand-alone.mp3 | 21-Apr-2007 14:12 | 10K | |
![[SND]](/icons/sound2.gif) | stanchless.mp3 | 21-Apr-2007 14:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | stanchion.mp3 | 21-Apr-2007 14:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | stanch.mp3 | 21-Apr-2007 14:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | stance.mp3 | 21-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | stan.mp3 | 21-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | stamp mill.mp3 | 21-Apr-2007 14:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | stamping ground.mp3 | 21-Apr-2007 14:12 | 12K | |
![[SND]](/icons/sound2.gif) | stamper.mp3 | 21-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | stampede.mp3 | 21-Apr-2007 14:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | stamp.mp3 | 21-Apr-2007 14:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | stamnos.mp3 | 21-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | stammrel.mp3 | 21-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | stammer.mp3 | 21-Apr-2007 14:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | stammel.mp3 | 21-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | staminody.mp3 | 21-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | staminodium.mp3 | 21-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | staminiferous.mp3 | 21-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | stamini.mp3 | 21-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | staminate.mp3 | 21-Apr-2007 14:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | staminal.mp3 | 21-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | stamina.mp3 | 21-Apr-2007 14:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | stamin.mp3 | 21-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | stamford.mp3 | 21-Apr-2007 14:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | stamen.mp3 | 21-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | stambul.mp3 | 21-Apr-2007 14:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | stamba.mp3 | 21-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | stalworth.mp3 | 21-Apr-2007 14:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | stalwart.mp3 | 21-Apr-2007 14:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | stallone.mp3 | 21-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | stallion.mp3 | 21-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | stallage.mp3 | 21-Apr-2007 14:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | stall.mp3 | 21-Apr-2007 14:10 | 6.8K | |
![[SND]](/icons/sound2.gif) | stall-feed.mp3 | 21-Apr-2007 14:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | stall-fed.mp3 | 21-Apr-2007 14:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | stalky.mp3 | 21-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | stalkless.mp3 | 21-Apr-2007 14:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | stalking horse.mp3 | 21-Apr-2007 14:10 | 11K | |
![[SND]](/icons/sound2.gif) | stalker.mp3 | 21-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | stalked.mp3 | 21-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | stalk.mp3 | 21-Apr-2007 14:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | stalinogrod.mp3 | 21-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | stalinist.mp3 | 21-Apr-2007 14:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | stalinism.mp3 | 21-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | stale.mp3 | 21-Apr-2007 14:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | stalbans.mp3 | 21-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | stalagmometer.mp3 | 21-Apr-2007 14:10 | 17K | |
![[SND]](/icons/sound2.gif) | stalagmite.mp3 | 21-Apr-2007 14:09 | 9.8K | |
![[SND]](/icons/sound2.gif) | stalag.mp3 | 21-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | stalactitic.mp3 | 21-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | stalactite.mp3 | 21-Apr-2007 14:09 | 10K | |
![[SND]](/icons/sound2.gif) | stalactiform.mp3 | 21-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | stalactic.mp3 | 21-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | stakhanovite.mp3 | 21-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | stakhanovism.mp3 | 21-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | stake.mp3 | 21-Apr-2007 14:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | staith.mp3 | 21-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | staircase.mp3 | 21-Apr-2007 14:09 | 11K | |
![[SND]](/icons/sound2.gif) | stair.mp3 | 21-Apr-2007 14:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | stair-climbing.mp3 | 21-Apr-2007 14:09 | 12K | |
![[SND]](/icons/sound2.gif) | stair-climber.mp3 | 21-Apr-2007 14:09 | 11K | |
![[SND]](/icons/sound2.gif) | stainless.mp3 | 21-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | staines.mp3 | 21-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | stainer.mp3 | 21-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | stain.mp3 | 21-Apr-2007 14:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | staid.mp3 | 21-Apr-2007 14:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | stahlhelm.mp3 | 21-Apr-2007 14:09 | 17K | |
![[SND]](/icons/sound2.gif) | stahl.mp3 | 21-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | stagyrite.mp3 | 21-Apr-2007 14:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | stagy.mp3 | 21-Apr-2007 14:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | stagnicolous.mp3 | 21-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | stagnation.mp3 | 21-Apr-2007 14:08 | 10K | |
![[SND]](/icons/sound2.gif) | stagnate.mp3 | 21-Apr-2007 14:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | stagnant.mp3 | 21-Apr-2007 14:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | stagirite.mp3 | 21-Apr-2007 14:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | stagira.mp3 | 21-Apr-2007 14:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | staging.mp3 | 21-Apr-2007 14:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | staggy.mp3 | 21-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | staggery.mp3 | 21-Apr-2007 14:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | staggering.mp3 | 21-Apr-2007 14:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | staggerer.mp3 | 21-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | stagger.mp3 | 21-Apr-2007 14:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | staggard.mp3 | 21-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | stagflation.mp3 | 21-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | stagey.mp3 | 21-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | stager.mp3 | 21-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | staged.mp3 | 21-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | stage.mp3 | 21-Apr-2007 14:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | stage-manage.mp3 | 21-Apr-2007 14:08 | 10K | |
![[SND]](/icons/sound2.gif) | stag.mp3 | 21-Apr-2007 14:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | staffordshire.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | stafford.mp3 | 21-Apr-2007 14:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | staffer.mp3 | 21-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | staffage.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | staffa.mp3 | 21-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | staff.mp3 | 21-Apr-2007 14:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | staelholstein.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | staedtler.mp3 | 21-Apr-2007 14:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | stadtholder.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | stadle.mp3 | 21-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | stadium.mp3 | 21-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | stadiometer.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | stadimeter.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | stadial.mp3 | 21-Apr-2007 14:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | stadia.mp3 | 21-Apr-2007 14:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | stadholder.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | stadersplint.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | stade.mp3 | 21-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | staddle.mp3 | 21-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | stacy.mp3 | 21-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | stactometer.mp3 | 21-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | stacte.mp3 | 21-Apr-2007 14:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | stacking.mp3 | 21-Apr-2007 14:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | stackering.mp3 | 21-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | stacker.mp3 | 21-Apr-2007 14:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | stacked.mp3 | 21-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | stackable.mp3 | 21-Apr-2007 14:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | stack.mp3 | 21-Apr-2007 14:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | stacia.mp3 | 21-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | stache.mp3 | 21-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | stacey.mp3 | 21-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | staccato.mp3 | 21-Apr-2007 14:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | stablish.mp3 | 21-Apr-2007 14:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | stabling.mp3 | 21-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | stabler.mp3 | 21-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | stableman.mp3 | 21-Apr-2007 14:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | stable.mp3 | 21-Apr-2007 14:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | stabilograph.mp3 | 21-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | stabilizer.mp3 | 21-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | stabilize.mp3 | 21-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | stabilization.mp3 | 21-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | stability.mp3 | 21-Apr-2007 14:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | stabilimeter.mp3 | 21-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | stabile.mp3 | 21-Apr-2007 14:05 | 27K | |
![[SND]](/icons/sound2.gif) | stabex.mp3 | 21-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | stabbing.mp3 | 21-Apr-2007 14:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | stabber.mp3 | 21-Apr-2007 14:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | stabatmater.mp3 | 21-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | stab.mp3 | 21-Apr-2007 14:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | st.mp3 | 21-Apr-2007 14:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | ssumachien.mp3 | 21-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | sstar.mp3 | 21-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | ss.mp3 | 21-Apr-2007 14:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | sruti.mp3 | 21-Apr-2007 14:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | srivaishnavism.mp3 | 21-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | srinagar.mp3 | 21-Apr-2007 14:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | srilanka.mp3 | 21-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | srbija.mp3 | 21-Apr-2007 14:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | sranan.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squushy.mp3 | 21-Apr-2007 14:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | squush.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squshy.mp3 | 21-Apr-2007 14:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | sqush.mp3 | 21-Apr-2007 14:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | squooshy.mp3 | 21-Apr-2007 14:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | squizzed.mp3 | 21-Apr-2007 14:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | squiz.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squitter.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squitchgrass.mp3 | 21-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | squit.mp3 | 21-Apr-2007 14:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | squishy.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squish.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squirt.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squirrely.mp3 | 21-Apr-2007 14:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | squirrel.mp3 | 21-Apr-2007 14:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | squirmy.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squirmish.mp3 | 21-Apr-2007 14:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | squirm.mp3 | 21-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | squirly.mp3 | 21-Apr-2007 14:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | squirl.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squireling.mp3 | 21-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | squireen.mp3 | 21-Apr-2007 14:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | squiredom.mp3 | 21-Apr-2007 14:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | squirearchy.mp3 | 21-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | squirearch.mp3 | 21-Apr-2007 14:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | squire.mp3 | 21-Apr-2007 14:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | squinty.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squint.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squint-eyed.mp3 | 21-Apr-2007 14:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | squinny.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squinch.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squinancy.mp3 | 21-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | squillionaire.mp3 | 21-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | squillion.mp3 | 21-Apr-2007 14:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | squillagee.mp3 | 21-Apr-2007 14:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | squilla.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squill.mp3 | 21-Apr-2007 14:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | squilgee.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squiggle.mp3 | 21-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | squiffy.mp3 | 21-Apr-2007 14:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | squiffite.mp3 | 21-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | squiffer.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squiffed.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squiff.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squidgy.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squidge.mp3 | 21-Apr-2007 14:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | squid.mp3 | 21-Apr-2007 14:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | squib.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squeteague.mp3 | 21-Apr-2007 14:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | squelch.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squegger.mp3 | 21-Apr-2007 14:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | squeg.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squeezer.mp3 | 21-Apr-2007 14:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | squeeze.mp3 | 21-Apr-2007 14:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | squeezable.mp3 | 21-Apr-2007 14:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | squeegee.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squeamish.mp3 | 21-Apr-2007 14:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | squealer.mp3 | 21-Apr-2007 14:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | squeal.mp3 | 21-Apr-2007 14:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | squeaky.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squeaker.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squeak.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squawmish.mp3 | 21-Apr-2007 14:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | squawky.mp3 | 21-Apr-2007 14:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | squawker.mp3 | 21-Apr-2007 14:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | squawk.mp3 | 21-Apr-2007 14:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | squawfish.mp3 | 21-Apr-2007 14:01 | 10K | |
![[SND]](/icons/sound2.gif) | squaw.mp3 | 21-Apr-2007 14:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | squatty.mp3 | 21-Apr-2007 14:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | squattocracy.mp3 | 21-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | squatter.mp3 | 21-Apr-2007 14:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | squat.mp3 | 21-Apr-2007 14:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | squassation.mp3 | 21-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | squashy.mp3 | 21-Apr-2007 14:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | squash.mp3 | 21-Apr-2007 14:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | squarson.mp3 | 21-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | squarrose.mp3 | 21-Apr-2007 14:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | squarish.mp3 | 21-Apr-2007 14:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | squarial.mp3 | 21-Apr-2007 14:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | squaresville.mp3 | 21-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | square sail.mp3 | 21-Apr-2007 14:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | squarer.mp3 | 21-Apr-2007 14:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | squarely.mp3 | 21-Apr-2007 14:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | squaredom.mp3 | 21-Apr-2007 14:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | square.mp3 | 21-Apr-2007 14:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | square-toed.mp3 | 21-Apr-2007 14:01 | 10K | |
![[SND]](/icons/sound2.gif) | square-rigger.mp3 | 21-Apr-2007 14:01 | 10K | |
![[SND]](/icons/sound2.gif) | squanto.mp3 | 21-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | squander.mp3 | 21-Apr-2007 14:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | squamulose.mp3 | 21-Apr-2007 14:00 | 17K | |
![[SND]](/icons/sound2.gif) | squamous.mp3 | 21-Apr-2007 14:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | squamosal.mp3 | 21-Apr-2007 14:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | squamo.mp3 | 21-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | squamish.mp3 | 21-Apr-2007 14:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | squamiform.mp3 | 21-Apr-2007 14:00 | 17K | |
![[SND]](/icons/sound2.gif) | squamation.mp3 | 21-Apr-2007 14:00 | 17K | |
![[SND]](/icons/sound2.gif) | squamate.mp3 | 21-Apr-2007 14:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | squama.mp3 | 21-Apr-2007 14:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | squam.mp3 | 21-Apr-2007 14:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | squalor.mp3 | 21-Apr-2007 14:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | squaloid.mp3 | 21-Apr-2007 14:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | squally.mp3 | 21-Apr-2007 14:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | squall.mp3 | 21-Apr-2007 14:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | squalid.mp3 | 21-Apr-2007 14:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | squalene.mp3 | 21-Apr-2007 14:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | squailer.mp3 | 21-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | squail.mp3 | 21-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | squadsman.mp3 | 21-Apr-2007 13:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | squadron.mp3 | 21-Apr-2007 13:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | squadrol.mp3 | 21-Apr-2007 13:59 | 17K | |
![[SND]](/icons/sound2.gif) | squaddie.mp3 | 21-Apr-2007 13:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | squadder.mp3 | 21-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | squad.mp3 | 21-Apr-2007 13:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | squacco.mp3 | 21-Apr-2007 13:59 | 17K | |
![[SND]](/icons/sound2.gif) | squabby.mp3 | 21-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | squabble.mp3 | 21-Apr-2007 13:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | squab.mp3 | 21-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | spyri.mp3 | 21-Apr-2007 13:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | spyer.mp3 | 21-Apr-2007 13:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | spy.mp3 | 21-Apr-2007 13:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | spuytenduyvilcreek.mp3 | 21-Apr-2007 13:59 | 17K | |
![[SND]](/icons/sound2.gif) | sputum.mp3 | 21-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | sputtering.mp3 | 21-Apr-2007 13:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | sputter.mp3 | 21-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | sputnik.mp3 | 21-Apr-2007 13:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | spurtle.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spurt.mp3 | 21-Apr-2007 13:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | spurs.mp3 | 21-Apr-2007 13:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | spurry.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spurrier.mp3 | 21-Apr-2007 13:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | spurrey.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spurred.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spurn.mp3 | 21-Apr-2007 13:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | spurious.mp3 | 21-Apr-2007 13:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | spurge.mp3 | 21-Apr-2007 13:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | spur.mp3 | 21-Apr-2007 13:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | spunky.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spunkie.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spunk.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spunge.mp3 | 21-Apr-2007 13:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | spun.mp3 | 21-Apr-2007 13:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | spumous.mp3 | 21-Apr-2007 13:58 | 17K | |
![[SND]](/icons/sound2.gif) | spumone.mp3 | 21-Apr-2007 13:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | spumescent.mp3 | 21-Apr-2007 13:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | spume.mp3 | 21-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | spumante.mp3 | 21-Apr-2007 13:58 | 17K | |
![[SND]](/icons/sound2.gif) | spuky.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | spuggy.mp3 | 21-Apr-2007 13:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | spue.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | spudge.mp3 | 21-Apr-2007 13:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | spuddy.mp3 | 21-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | spuddle.mp3 | 21-Apr-2007 13:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | spudder.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | spud.mp3 | 21-Apr-2007 13:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | spuc.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | spry.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprung.mp3 | 21-Apr-2007 13:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | spruit.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | spruik.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprue.mp3 | 21-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprucy.mp3 | 21-Apr-2007 13:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | spruce.mp3 | 21-Apr-2007 13:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | spruance.mp3 | 21-Apr-2007 13:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | sprowsie.mp3 | 21-Apr-2007 13:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | sproutsy.mp3 | 21-Apr-2007 13:56 | 17K | |
![[SND]](/icons/sound2.gif) | sproutling.mp3 | 21-Apr-2007 13:56 | 17K | |
![[SND]](/icons/sound2.gif) | sprog.mp3 | 21-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | sprocket.mp3 | 21-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | sproat.mp3 | 21-Apr-2007 13:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | spritzy.mp3 | 21-Apr-2007 13:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | spritzig.mp3 | 21-Apr-2007 13:56 | 17K | |
![[SND]](/icons/sound2.gif) | spritzer.mp3 | 21-Apr-2007 13:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | spritz.mp3 | 21-Apr-2007 13:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | spritsail.mp3 | 21-Apr-2007 13:55 | 17K | |
![[SND]](/icons/sound2.gif) | sprite.mp3 | 21-Apr-2007 13:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | sprit.mp3 | 21-Apr-2007 13:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | sprinter.mp3 | 21-Apr-2007 13:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | sprint.mp3 | 21-Apr-2007 13:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | sprinkling.mp3 | 21-Apr-2007 13:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | sprinkler.mp3 | 21-Apr-2007 13:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprinkle.mp3 | 21-Apr-2007 13:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | springy.mp3 | 21-Apr-2007 13:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | springtime.mp3 | 21-Apr-2007 13:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | springtail.mp3 | 21-Apr-2007 13:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | springsteen.mp3 | 21-Apr-2007 13:55 | 17K | |
![[SND]](/icons/sound2.gif) | springlet.mp3 | 21-Apr-2007 13:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | springless.mp3 | 21-Apr-2007 13:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | springingbow.mp3 | 21-Apr-2007 13:55 | 17K | |
![[SND]](/icons/sound2.gif) | springing.mp3 | 21-Apr-2007 13:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | springhaas.mp3 | 21-Apr-2007 13:55 | 17K | |
![[SND]](/icons/sound2.gif) | springform pan.mp3 | 21-Apr-2007 13:55 | 14K | |
![[SND]](/icons/sound2.gif) | springerle.mp3 | 21-Apr-2007 13:54 | 17K | |
![[SND]](/icons/sound2.gif) | springer.mp3 | 21-Apr-2007 13:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | springe.mp3 | 21-Apr-2007 13:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | springdale.mp3 | 21-Apr-2007 13:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | springbok.mp3 | 21-Apr-2007 13:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | springald.mp3 | 21-Apr-2007 13:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | spring.mp3 | 21-Apr-2007 13:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | spring-load.mp3 | 21-Apr-2007 13:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | sprightly.mp3 | 21-Apr-2007 13:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | spright.mp3 | 21-Apr-2007 13:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | spriggy.mp3 | 21-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprig.mp3 | 21-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | spriest.mp3 | 21-Apr-2007 13:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | sprier.mp3 | 21-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprent.mp3 | 21-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprekelia.mp3 | 21-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | spree.mp3 | 21-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprechgesang.mp3 | 21-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | spreathed.mp3 | 21-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | spreadsheet.mp3 | 21-Apr-2007 13:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | spreader.mp3 | 21-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | spreadeagleism.mp3 | 21-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | spreadable.mp3 | 21-Apr-2007 13:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | spread.mp3 | 21-Apr-2007 13:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | spread-eagling.mp3 | 21-Apr-2007 13:53 | 10K | |
![[SND]](/icons/sound2.gif) | spread-eagle.mp3 | 21-Apr-2007 13:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | sprazer.mp3 | 21-Apr-2007 13:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | sprayey.mp3 | 21-Apr-2007 13:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | spray.mp3 | 21-Apr-2007 13:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | sprawly.mp3 | 21-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprawling.mp3 | 21-Apr-2007 13:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | sprawl.mp3 | 21-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprauncy.mp3 | 21-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | sprauchle.mp3 | 21-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | spratts.mp3 | 21-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | sprattle.mp3 | 21-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprat.mp3 | 21-Apr-2007 13:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | sprang.mp3 | 21-Apr-2007 13:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | spraints.mp3 | 21-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | sprain.mp3 | 21-Apr-2007 13:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | sprague.mp3 | 21-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprag.mp3 | 21-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | spraddlelegged.mp3 | 21-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | spraddle.mp3 | 21-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sprackle.mp3 | 21-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | sprachgefuhl.mp3 | 21-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | spouty.mp3 | 21-Apr-2007 13:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | spouting.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | spouter.mp3 | 21-Apr-2007 13:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | spouted.mp3 | 21-Apr-2007 13:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | spout.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | spouse.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | spousal.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | spotty.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | spottie.mp3 | 21-Apr-2007 13:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | spotter.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | spottedcuscus.mp3 | 21-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | spotted.mp3 | 21-Apr-2007 13:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | spottable.mp3 | 21-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | spotsylvania.mp3 | 21-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | spotlight.mp3 | 21-Apr-2007 13:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | spotless.mp3 | 21-Apr-2007 13:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | spot.mp3 | 21-Apr-2007 13:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | spot-check.mp3 | 21-Apr-2007 13:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | spory.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sporule.mp3 | 21-Apr-2007 13:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sporulate.mp3 | 21-Apr-2007 13:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | sporty.mp3 | 21-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sportster.mp3 | 21-Apr-2007 13:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sportsman.mp3 | 21-Apr-2007 13:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | sportsdom.mp3 | 21-Apr-2007 13:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | sports.mp3 | 21-Apr-2007 13:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | sportive.mp3 | 21-Apr-2007 13:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | sporting.mp3 | 21-Apr-2007 13:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | sportful.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporter.mp3 | 21-Apr-2007 13:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sport.mp3 | 21-Apr-2007 13:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | sport-utility vehicle.mp3 | 21-Apr-2007 13:50 | 16K | |
![[SND]](/icons/sound2.gif) | sporran.mp3 | 21-Apr-2007 13:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sporozoite.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporozoan.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporozoa.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporous.mp3 | 21-Apr-2007 13:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | sporotrichosis.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporopollenin.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporophyte.mp3 | 21-Apr-2007 13:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sporophyll.mp3 | 21-Apr-2007 13:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sporophore.mp3 | 21-Apr-2007 13:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | sporont.mp3 | 21-Apr-2007 13:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | sporogony.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporogeny.mp3 | 21-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | sporocyte.mp3 | 21-Apr-2007 13:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | sporocyst.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporocarp.mp3 | 21-Apr-2007 13:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | sporoblast.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporo.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | spork.mp3 | 21-Apr-2007 13:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sporiferous.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporidium.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporicide.mp3 | 21-Apr-2007 13:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | spori.mp3 | 21-Apr-2007 13:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | sporeling.mp3 | 21-Apr-2007 13:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | spore.mp3 | 21-Apr-2007 13:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | sporangium.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporangiospore.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporangiophore.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporadosiderite.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | sporadic.mp3 | 21-Apr-2007 13:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | sporades.mp3 | 21-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | spor.mp3 | 21-Apr-2007 13:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | spoor.mp3 | 21-Apr-2007 13:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | spoony.mp3 | 21-Apr-2007 13:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | spoonful.mp3 | 21-Apr-2007 13:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | spoonfeed.mp3 | 21-Apr-2007 13:48 | 17K | |
![[SND]](/icons/sound2.gif) | spooney.mp3 | 21-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | spoonerism.mp3 | 21-Apr-2007 13:48 | 17K | |
![[SND]](/icons/sound2.gif) | spooner.mp3 | 21-Apr-2007 13:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | spoonbow.mp3 | 21-Apr-2007 13:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | spoon.mp3 | 21-Apr-2007 13:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | spoon-feed.mp3 | 21-Apr-2007 13:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | spoon-fed.mp3 | 21-Apr-2007 13:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | spoon-billed.mp3 | 21-Apr-2007 13:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | spoom.mp3 | 21-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | spool.mp3 | 21-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | spooky.mp3 | 21-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | spookerican.mp3 | 21-Apr-2007 13:48 | 17K | |
![[SND]](/icons/sound2.gif) | spook.mp3 | 21-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | spooged.mp3 | 21-Apr-2007 13:48 | 17K | |
![[SND]](/icons/sound2.gif) | spooge.mp3 | 21-Apr-2007 13:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | spoofery.mp3 | 21-Apr-2007 13:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | spoof.mp3 | 21-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | spooch.mp3 | 21-Apr-2007 13:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | spoo.mp3 | 21-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | spontoon.mp3 | 21-Apr-2007 13:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | spontaneous.mp3 | 21-Apr-2007 13:48 | 10K | |
![[SND]](/icons/sound2.gif) | spontaneity.mp3 | 21-Apr-2007 13:48 | 36K | |
![[SND]](/icons/sound2.gif) | sponsorship.mp3 | 21-Apr-2007 13:48 | 11K | |
![[SND]](/icons/sound2.gif) | sponsored.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | sponsor.mp3 | 21-Apr-2007 13:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | sponson.mp3 | 21-Apr-2007 13:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | sponsion.mp3 | 21-Apr-2007 13:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | spongy.mp3 | 21-Apr-2007 13:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | spongocoel.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spongioblast.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spongin.mp3 | 21-Apr-2007 13:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | spongillafly.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spongiform encephalopathy.mp3 | 21-Apr-2007 13:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | sponger.mp3 | 21-Apr-2007 13:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | sponge.mp3 | 21-Apr-2007 13:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | spondylosis.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spondylolisthesis.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spondylitis.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spondyl.mp3 | 21-Apr-2007 13:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | spondulicks.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spondee.mp3 | 21-Apr-2007 13:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | spondaic.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spoliation.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spoliate.mp3 | 21-Apr-2007 13:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | spoliaopima.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spoleto.mp3 | 21-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | spokeswoman.mp3 | 21-Apr-2007 13:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | spokesperson.mp3 | 21-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | spokesman.mp3 | 21-Apr-2007 13:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | spoken.mp3 | 21-Apr-2007 13:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | spoke.mp3 | 21-Apr-2007 13:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | spokane.mp3 | 21-Apr-2007 13:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | spoilt.mp3 | 21-Apr-2007 13:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | spoilsman.mp3 | 21-Apr-2007 13:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | spoiler.mp3 | 21-Apr-2007 13:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | spoilation.mp3 | 21-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | spoilage.mp3 | 21-Apr-2007 13:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | spoil.mp3 | 21-Apr-2007 13:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | spohr.mp3 | 21-Apr-2007 13:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | spoffish.mp3 | 21-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | spodumene.mp3 | 21-Apr-2007 13:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | spodosol.mp3 | 21-Apr-2007 13:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | spode.mp3 | 21-Apr-2007 13:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | spluttery.mp3 | 21-Apr-2007 13:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | splutter.mp3 | 21-Apr-2007 13:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | splutch.mp3 | 21-Apr-2007 13:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | splurge.mp3 | 21-Apr-2007 13:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | splup.mp3 | 21-Apr-2007 13:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | spludge.mp3 | 21-Apr-2007 13:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | splotchy.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | splotch.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | splot.mp3 | 21-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | splosh.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | splore.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | splop.mp3 | 21-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | sploosh.mp3 | 21-Apr-2007 13:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | splooge.mp3 | 21-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | sploff.mp3 | 21-Apr-2007 13:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | splodge.mp3 | 21-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | splockenin.mp3 | 21-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | spljet.mp3 | 21-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | splivin.mp3 | 21-Apr-2007 13:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | splitting.mp3 | 21-Apr-2007 13:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | splitter.mp3 | 21-Apr-2007 13:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | splitsville.mp3 | 21-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | split.mp3 | 21-Apr-2007 13:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | split-level.mp3 | 21-Apr-2007 13:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | split-fingered fastball.mp3 | 21-Apr-2007 13:45 | 15K | |
![[SND]](/icons/sound2.gif) | split-brain.mp3 | 21-Apr-2007 13:45 | 10K | |
![[SND]](/icons/sound2.gif) | splish.mp3 | 21-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | splinter.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | splint.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | spline.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | spliff.mp3 | 21-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | splicer.mp3 | 21-Apr-2007 13:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | splice.mp3 | 21-Apr-2007 13:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | splib.mp3 | 21-Apr-2007 13:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | spleuchan.mp3 | 21-Apr-2007 13:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | splent.mp3 | 21-Apr-2007 13:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | splenomegaly.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splenoid.mp3 | 21-Apr-2007 13:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | spleno.mp3 | 21-Apr-2007 13:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | splenization.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splenius.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splenitive.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splenitis.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | spleniform.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splenic.mp3 | 21-Apr-2007 13:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | splenial.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splenetic.mp3 | 21-Apr-2007 13:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | splenectomy.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splenectomize.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splendour.mp3 | 21-Apr-2007 13:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | splendor.mp3 | 21-Apr-2007 13:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | splendiferous.mp3 | 21-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | splendid.mp3 | 21-Apr-2007 13:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | splendent.mp3 | 21-Apr-2007 13:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | splen.mp3 | 21-Apr-2007 13:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | spleeny.mp3 | 21-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | spleenwort.mp3 | 21-Apr-2007 13:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | spleenful.mp3 | 21-Apr-2007 13:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | spleen.mp3 | 21-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | spleef.mp3 | 21-Apr-2007 13:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | splayd.mp3 | 21-Apr-2007 13:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | splay.mp3 | 21-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | splatter.mp3 | 21-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | splashy.mp3 | 21-Apr-2007 13:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | splasher.mp3 | 21-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | splashdown.mp3 | 21-Apr-2007 13:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | splash.mp3 | 21-Apr-2007 13:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | splap.mp3 | 21-Apr-2007 13:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | splanchnotomy.mp3 | 21-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | splanchnopleure.mp3 | 21-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | splanchnology.mp3 | 21-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | splanchno.mp3 | 21-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | splanchnic.mp3 | 21-Apr-2007 13:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | splanch.mp3 | 21-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | splake.mp3 | 21-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | splad.mp3 | 21-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | spizzerinktum.mp3 | 21-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | spivvy.mp3 | 21-Apr-2007 13:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | spivvery.mp3 | 21-Apr-2007 13:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | spiv.mp3 | 21-Apr-2007 13:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | spitzflote.mp3 | 21-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | spitzenburg.mp3 | 21-Apr-2007 13:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | spitzbergen.mp3 | 21-Apr-2007 13:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | spitz.mp3 | 21-Apr-2007 13:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | spittoon.mp3 | 21-Apr-2007 13:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | spittlebug.mp3 | 21-Apr-2007 13:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | spittle.mp3 | 21-Apr-2007 13:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | spitter.mp3 | 21-Apr-2007 13:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | spitteler.mp3 | 21-Apr-2007 13:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | spitstick.mp3 | 21-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | spitsbergen.mp3 | 21-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | spitless.mp3 | 21-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | spithead.mp3 | 21-Apr-2007 13:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | spiteful.mp3 | 21-Apr-2007 13:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | spite.mp3 | 21-Apr-2007 13:42 | 6.3K | |
![[SND]](/icons/sound2.gif) | spitchered.mp3 | 21-Apr-2007 13:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | spitchcock.mp3 | 21-Apr-2007 13:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | spitalfields.mp3 | 21-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | spital.mp3 | 21-Apr-2007 13:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | spit.mp3 | 21-Apr-2007 13:42 | 5.4K | |
![[SND]](/icons/sound2.gif) | spissatus.mp3 | 21-Apr-2007 13:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | spiry.mp3 | 21-Apr-2007 13:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | spirulina.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirula.mp3 | 21-Apr-2007 13:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | spirt.mp3 | 21-Apr-2007 13:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | spironolactone.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirometer.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spiroid.mp3 | 21-Apr-2007 13:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | spirogyra.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirograph.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirochetosis.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirochete.mp3 | 21-Apr-2007 13:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | spiro.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirketting.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirivalve.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spiritusvinosus.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirituslenis.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spiritusfrumenti.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spiritusasper.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spiritus.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirituous.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spirituel.mp3 | 21-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | spiritualty.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spiritualize.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spirituality.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spiritualist.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spiritualism.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spiritual.mp3 | 21-Apr-2007 13:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | spiritous.mp3 | 21-Apr-2007 13:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | spiritoso.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spiritless.mp3 | 21-Apr-2007 13:40 | 9.5K | |
![[SND]](/icons/sound2.gif) | spiritism.mp3 | 21-Apr-2007 13:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | spiriting.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spirited.mp3 | 21-Apr-2007 13:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | spirit.mp3 | 21-Apr-2007 13:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | spirillum.mp3 | 21-Apr-2007 13:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | spiriferous.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spireme.mp3 | 21-Apr-2007 13:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | spirelet.mp3 | 21-Apr-2007 13:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | spired.mp3 | 21-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | spirea.mp3 | 21-Apr-2007 13:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | spire.mp3 | 21-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | spirantize.mp3 | 21-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | spirant.mp3 | 21-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiral of Archimedes.mp3 | 21-Apr-2007 13:39 | 15K | |
![[SND]](/icons/sound2.gif) | spirally.mp3 | 21-Apr-2007 13:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | spiral.mp3 | 21-Apr-2007 13:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | spiral-bound.mp3 | 21-Apr-2007 13:40 | 11K | |
![[SND]](/icons/sound2.gif) | spiraea.mp3 | 21-Apr-2007 13:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | spiraculum.mp3 | 21-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | spiracle.mp3 | 21-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | spira.mp3 | 21-Apr-2007 13:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | spir.mp3 | 21-Apr-2007 13:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | spionkop.mp3 | 21-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | spiny.mp3 | 21-Apr-2007 13:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiny-headed worm.mp3 | 21-Apr-2007 13:39 | 14K | |
![[SND]](/icons/sound2.gif) | spinule.mp3 | 21-Apr-2007 13:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | spinto.mp3 | 21-Apr-2007 13:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | spinthariscope.mp3 | 21-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | spinster.mp3 | 21-Apr-2007 13:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | spinozism.mp3 | 21-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | spinoza.mp3 | 21-Apr-2007 13:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | spinous.mp3 | 21-Apr-2007 13:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | spinosity.mp3 | 21-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | spinose.mp3 | 21-Apr-2007 13:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | spinor.mp3 | 21-Apr-2007 13:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | spinoneitaliano.mp3 | 21-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | spinode.mp3 | 21-Apr-2007 13:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | spino.mp3 | 21-Apr-2007 13:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | spinny.mp3 | 21-Apr-2007 13:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | spinning jenny.mp3 | 21-Apr-2007 13:38 | 10K | |
![[SND]](/icons/sound2.gif) | spinning.mp3 | 21-Apr-2007 13:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | spinney.mp3 | 21-Apr-2007 13:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | spinnery.mp3 | 21-Apr-2007 13:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | spinnerule.mp3 | 21-Apr-2007 13:38 | 17K | |
![[SND]](/icons/sound2.gif) | spinneret.mp3 | 21-Apr-2007 13:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | spinner.mp3 | 21-Apr-2007 13:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | spinnaker.mp3 | 21-Apr-2007 13:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | spink.mp3 | 21-Apr-2007 13:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | spiniform.mp3 | 21-Apr-2007 13:38 | 17K | |
![[SND]](/icons/sound2.gif) | spinifex.mp3 | 21-Apr-2007 13:38 | 17K | |
![[SND]](/icons/sound2.gif) | spiniferous.mp3 | 21-Apr-2007 13:38 | 17K | |
![[SND]](/icons/sound2.gif) | spini.mp3 | 21-Apr-2007 13:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | spingarn.mp3 | 21-Apr-2007 13:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | spinet.mp3 | 21-Apr-2007 13:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | spinescent.mp3 | 21-Apr-2007 13:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | spineless.mp3 | 21-Apr-2007 13:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | spinel.mp3 | 21-Apr-2007 13:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | spine.mp3 | 21-Apr-2007 13:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | spine-chilling.mp3 | 21-Apr-2007 13:38 | 10K | |
![[SND]](/icons/sound2.gif) | spindrift.mp3 | 21-Apr-2007 13:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | spindly.mp3 | 21-Apr-2007 13:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | spindling.mp3 | 21-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | spindleage.mp3 | 21-Apr-2007 13:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | spindle.mp3 | 21-Apr-2007 13:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | spindle-legged.mp3 | 21-Apr-2007 13:37 | 10K | |
![[SND]](/icons/sound2.gif) | spinar.mp3 | 21-Apr-2007 13:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | spinal.mp3 | 21-Apr-2007 13:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | spinach.mp3 | 21-Apr-2007 13:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | spinaceous.mp3 | 21-Apr-2007 13:37 | 17K | |
![[SND]](/icons/sound2.gif) | spinabifida.mp3 | 21-Apr-2007 13:37 | 17K | |
![[SND]](/icons/sound2.gif) | spina.mp3 | 21-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | spin.mp3 | 21-Apr-2007 13:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | spin-off.mp3 | 21-Apr-2007 13:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | spilth.mp3 | 21-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | spilt.mp3 | 21-Apr-2007 13:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | spillikin.mp3 | 21-Apr-2007 13:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | spiller.mp3 | 21-Apr-2007 13:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | spillane.mp3 | 21-Apr-2007 13:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | spillage.mp3 | 21-Apr-2007 13:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | spill.mp3 | 21-Apr-2007 13:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | spiling.mp3 | 21-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | spilikin.mp3 | 21-Apr-2007 13:37 | 17K | |
![[SND]](/icons/sound2.gif) | spile.mp3 | 21-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiky.mp3 | 21-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiker.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spikenard.mp3 | 21-Apr-2007 13:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | spikelet.mp3 | 21-Apr-2007 13:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | spike lavender.mp3 | 21-Apr-2007 13:36 | 10K | |
![[SND]](/icons/sound2.gif) | spikedace.mp3 | 21-Apr-2007 13:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | spiked.mp3 | 21-Apr-2007 13:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | spike.mp3 | 21-Apr-2007 13:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | spike-tooth harrow.mp3 | 21-Apr-2007 13:37 | 12K | |
![[SND]](/icons/sound2.gif) | spik.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spigot.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spignel.mp3 | 21-Apr-2007 13:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | spiggoty.mp3 | 21-Apr-2007 13:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | spig.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiflicated.mp3 | 21-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | spiflicate.mp3 | 21-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | spificated.mp3 | 21-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | spiffy.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiffing.mp3 | 21-Apr-2007 13:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | spiffed.mp3 | 21-Apr-2007 13:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | spiffed-up.mp3 | 21-Apr-2007 13:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | spiff.mp3 | 21-Apr-2007 13:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | spif.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spier.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spieler.mp3 | 21-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | spielberg.mp3 | 21-Apr-2007 13:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | spiel.mp3 | 21-Apr-2007 13:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiegeleisen.mp3 | 21-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | spiegel.mp3 | 21-Apr-2007 13:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | spidery.mp3 | 21-Apr-2007 13:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiderwort.mp3 | 21-Apr-2007 13:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | spiderling.mp3 | 21-Apr-2007 13:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | spider.mp3 | 21-Apr-2007 13:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | spicy.mp3 | 21-Apr-2007 13:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | spiculum.mp3 | 21-Apr-2007 13:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | spicule.mp3 | 21-Apr-2007 13:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | spiculate.mp3 | 21-Apr-2007 13:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | spicula.mp3 | 21-Apr-2007 13:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | spicknel.mp3 | 21-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | spick.mp3 | 21-Apr-2007 13:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | spicey.mp3 | 21-Apr-2007 13:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | spicery.mp3 | 21-Apr-2007 13:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | spiceberry.mp3 | 21-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | spice.mp3 | 21-Apr-2007 13:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | spiccato.mp3 | 21-Apr-2007 13:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | spicate.mp3 | 21-Apr-2007 13:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | spica.mp3 | 21-Apr-2007 13:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | spic.mp3 | 21-Apr-2007 13:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sphygmus.mp3 | 21-Apr-2007 13:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | sphygmophone.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphygmology.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphygmoid.mp3 | 21-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sphygmograph.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphygmogram.mp3 | 21-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sphygmo.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphygmic.mp3 | 21-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sphragistics.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphragistic.mp3 | 21-Apr-2007 13:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | sphinx.mp3 | 21-Apr-2007 13:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | sphingosine.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphingomyelin.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphingolipid.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphingid.mp3 | 21-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sphincter.mp3 | 21-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sphex.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | sphery.mp3 | 21-Apr-2007 13:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | spherulite.mp3 | 21-Apr-2007 13:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | spherule.mp3 | 21-Apr-2007 13:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | spheroplast.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | spherometer.mp3 | 21-Apr-2007 13:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | spheroidicity.mp3 | 21-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | spheroidal.mp3 | 21-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | spheroid.mp3 | 21-Apr-2007 13:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | sphero.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | spherics.mp3 | 21-Apr-2007 13:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sphericity.mp3 | 21-Apr-2007 13:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | spherical.mp3 | 21-Apr-2007 13:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | sphere.mp3 | 21-Apr-2007 13:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | spherator.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | spheral.mp3 | 21-Apr-2007 13:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | sphenopsid.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | sphenoid.mp3 | 21-Apr-2007 13:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | sphenography.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | sphenogram.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | sphenodon.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | spheno.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | sphenic.mp3 | 21-Apr-2007 13:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sphene.mp3 | 21-Apr-2007 13:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sphen.mp3 | 21-Apr-2007 13:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | sphecid.mp3 | 21-Apr-2007 13:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | sphalerite.mp3 | 21-Apr-2007 13:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | sphairee.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | sphagnum.mp3 | 21-Apr-2007 13:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sphagnous.mp3 | 21-Apr-2007 13:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | sphaero.mp3 | 21-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | sphaeristerium.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | sphacelus.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | sphacelate.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | spezia.mp3 | 21-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | speyer.mp3 | 21-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | spey.mp3 | 21-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | spew.mp3 | 21-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | speug.mp3 | 21-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | spetsnaz.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | spessartite.mp3 | 21-Apr-2007 13:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | sperrylite.mp3 | 21-Apr-2007 13:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | sperry.mp3 | 21-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sperm whale.mp3 | 21-Apr-2007 13:30 | 11K | |
![[SND]](/icons/sound2.gif) | spermous.mp3 | 21-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | spermophyte.mp3 | 21-Apr-2007 13:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | spermophile.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | spermogonium.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | spermo.mp3 | 21-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | spermiogenesis.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | spermine.mp3 | 21-Apr-2007 13:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | spermidine.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | spermicide.mp3 | 21-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | spermic.mp3 | 21-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | spermi.mp3 | 21-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | spermatozoon.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatozoid.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatozoal.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatotoxin.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatotoxic.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatorrhea.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatophyte.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatophore.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatoid.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatogonium.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatogenous.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatocyte.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatocide.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatoblast.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermato.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatium.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatid.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermaticide.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermatic.mp3 | 21-Apr-2007 13:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | spermatheca.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermat.mp3 | 21-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | spermary.mp3 | 21-Apr-2007 13:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | spermal.mp3 | 21-Apr-2007 13:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | spermagonium.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | spermaceti.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | sperm.mp3 | 21-Apr-2007 13:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | speranski.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | speos.mp3 | 21-Apr-2007 13:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | spentamainyu.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | spentaamesha.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | spent.mp3 | 21-Apr-2007 13:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | spenserian.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | spenser.mp3 | 21-Apr-2007 13:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | spense.mp3 | 21-Apr-2007 13:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | spengler.mp3 | 21-Apr-2007 13:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | spener.mp3 | 21-Apr-2007 13:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | spender.mp3 | 21-Apr-2007 13:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | spendable.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | spend.mp3 | 21-Apr-2007 13:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | spencerian.mp3 | 21-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | spencer.mp3 | 21-Apr-2007 13:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | spence.mp3 | 21-Apr-2007 13:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | spemann.mp3 | 21-Apr-2007 13:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | spelunker.mp3 | 21-Apr-2007 13:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | spelunk.mp3 | 21-Apr-2007 13:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | spelter.mp3 | 21-Apr-2007 13:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | spelt.mp3 | 21-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | spellman.mp3 | 21-Apr-2007 13:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | spelling.mp3 | 21-Apr-2007 13:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | spellican.mp3 | 21-Apr-2007 13:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | speller.mp3 | 21-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | spell.mp3 | 21-Apr-2007 13:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | spell-check.mp3 | 21-Apr-2007 13:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | spelk.mp3 | 21-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | speleology.mp3 | 21-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | spelaean.mp3 | 21-Apr-2007 13:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | spek.mp3 | 21-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | speiss.mp3 | 21-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | speidel.mp3 | 21-Apr-2007 13:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | speerings.mp3 | 21-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | speer.mp3 | 21-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | speel.mp3 | 21-Apr-2007 13:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | speedy.mp3 | 21-Apr-2007 13:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | speedster.mp3 | 21-Apr-2007 13:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | speedread.mp3 | 21-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | speedometer.mp3 | 21-Apr-2007 13:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | speedo.mp3 | 21-Apr-2007 13:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | speeding.mp3 | 21-Apr-2007 13:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | speedily.mp3 | 21-Apr-2007 13:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | speeder.mp3 | 21-Apr-2007 13:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | speedboat.mp3 | 21-Apr-2007 13:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | speed.mp3 | 21-Apr-2007 13:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | speed-reading.mp3 | 21-Apr-2007 13:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | speechread.mp3 | 21-Apr-2007 13:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | speechless.mp3 | 21-Apr-2007 13:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | speechify.mp3 | 21-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | speech.mp3 | 21-Apr-2007 13:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | spee.mp3 | 21-Apr-2007 13:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | sped.mp3 | 21-Apr-2007 13:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | speculum.mp3 | 21-Apr-2007 13:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | speculatory.mp3 | 21-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | speculator.mp3 | 21-Apr-2007 13:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | speculative.mp3 | 21-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | speculation.mp3 | 21-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | speculate.mp3 | 21-Apr-2007 13:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | specular.mp3 | 21-Apr-2007 13:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | specula.mp3 | 21-Apr-2007 13:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | spectrum.mp3 | 21-Apr-2007 13:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | spectroscopy.mp3 | 21-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | spectroscope.mp3 | 21-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | spectrometer.mp3 | 21-Apr-2007 13:27 | 10K | |
![[SND]](/icons/sound2.gif) | spectrology.mp3 | 21-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | spectrograph.mp3 | 21-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | spectrogram.mp3 | 21-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | spectro.mp3 | 21-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | spectrin.mp3 | 21-Apr-2007 13:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | spectre.mp3 | 21-Apr-2007 13:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | spectral.mp3 | 21-Apr-2007 13:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | spectra.mp3 | 21-Apr-2007 13:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | spector.mp3 | 21-Apr-2007 13:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | spectinomycin.mp3 | 21-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | specter.mp3 | 21-Apr-2007 13:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | spectatoritis.mp3 | 21-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | spectatorism.mp3 | 21-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | spectator.mp3 | 21-Apr-2007 13:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | spectate.mp3 | 21-Apr-2007 13:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | spectacular.mp3 | 21-Apr-2007 13:27 | 10K | |
![[SND]](/icons/sound2.gif) | spectacled.mp3 | 21-Apr-2007 13:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | spectacle.mp3 | 21-Apr-2007 13:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | specs.mp3 | 21-Apr-2007 13:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | specky.mp3 | 21-Apr-2007 13:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | speckle.mp3 | 21-Apr-2007 13:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | speck.mp3 | 21-Apr-2007 13:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | specious.mp3 | 21-Apr-2007 13:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | speciosity.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | speciology.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | specimen.mp3 | 21-Apr-2007 13:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | specify.mp3 | 21-Apr-2007 13:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | specificity.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | specification.mp3 | 21-Apr-2007 13:26 | 12K | |
![[SND]](/icons/sound2.gif) | specifically.mp3 | 21-Apr-2007 13:26 | 10K | |
![[SND]](/icons/sound2.gif) | specific.mp3 | 21-Apr-2007 13:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | specifiable.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | speciesism.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | species.mp3 | 21-Apr-2007 13:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | specie.mp3 | 21-Apr-2007 13:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | speciation.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | speciate.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | specialty.mp3 | 21-Apr-2007 13:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | specialog.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | specially.mp3 | 21-Apr-2007 13:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | specialized.mp3 | 21-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | specialize.mp3 | 21-Apr-2007 13:26 | 10K | |
![[SND]](/icons/sound2.gif) | speciality.mp3 | 21-Apr-2007 13:26 | 10K | |
![[SND]](/icons/sound2.gif) | specialitedelamaison.mp3 | 21-Apr-2007 13:26 | 18K | |
![[SND]](/icons/sound2.gif) | specialistic.mp3 | 21-Apr-2007 13:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | specialist.mp3 | 21-Apr-2007 13:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | specialism.mp3 | 21-Apr-2007 13:25 | 17K | |
![[SND]](/icons/sound2.gif) | special.mp3 | 21-Apr-2007 13:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | spec.mp3 | 21-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | spearwort.mp3 | 21-Apr-2007 13:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | spearman.mp3 | 21-Apr-2007 13:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | spearing.mp3 | 21-Apr-2007 13:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | spear.mp3 | 21-Apr-2007 13:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | spear-carrier.mp3 | 21-Apr-2007 13:25 | 11K | |
![[SND]](/icons/sound2.gif) | spean.mp3 | 21-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | speako.mp3 | 21-Apr-2007 13:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | speaking.mp3 | 21-Apr-2007 13:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | speakership.mp3 | 21-Apr-2007 13:25 | 17K | |
![[SND]](/icons/sound2.gif) | speaker.mp3 | 21-Apr-2007 13:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | speak.mp3 | 21-Apr-2007 13:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | speak-out.mp3 | 21-Apr-2007 13:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | spazzy.mp3 | 21-Apr-2007 13:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | spazz.mp3 | 21-Apr-2007 13:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | spaz.mp3 | 21-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | spay.mp3 | 21-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | spawning.mp3 | 21-Apr-2007 13:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | spawn.mp3 | 21-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | spavined.mp3 | 21-Apr-2007 13:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | spavin.mp3 | 21-Apr-2007 13:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | spaulder.mp3 | 21-Apr-2007 13:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | spatzle.mp3 | 21-Apr-2007 13:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | spatulate.mp3 | 21-Apr-2007 13:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | spatula.mp3 | 21-Apr-2007 13:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | spatter.mp3 | 21-Apr-2007 13:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | spatlese.mp3 | 21-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | spatiography.mp3 | 21-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | spatio.mp3 | 21-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | spatial.mp3 | 21-Apr-2007 13:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | spathulate.mp3 | 21-Apr-2007 13:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | spathose.mp3 | 21-Apr-2007 13:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | spathiphyllum.mp3 | 21-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | spathic.mp3 | 21-Apr-2007 13:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | spathe.mp3 | 21-Apr-2007 13:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | spathaceous.mp3 | 21-Apr-2007 13:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | spate.mp3 | 21-Apr-2007 13:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | spatchcock.mp3 | 21-Apr-2007 13:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | spat.mp3 | 21-Apr-2007 13:24 | 5.9K | |
![[SND]](/icons/sound2.gif) | spasur.mp3 | 21-Apr-2007 13:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | spastic.mp3 | 21-Apr-2007 13:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | spassy.mp3 | 21-Apr-2007 13:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | spassky.mp3 | 21-Apr-2007 13:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | spasmophilic.mp3 | 21-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | spasmophilia.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spasmolytic.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spasmolysis.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spasmodist.mp3 | 21-Apr-2007 13:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | spasmodic.mp3 | 21-Apr-2007 13:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | spasm.mp3 | 21-Apr-2007 13:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | spas.mp3 | 21-Apr-2007 13:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | sparver.mp3 | 21-Apr-2007 13:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | spartina.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spartiate.mp3 | 21-Apr-2007 13:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | sparti.mp3 | 21-Apr-2007 13:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | sparteine.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spartanburg.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spartan.mp3 | 21-Apr-2007 13:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | spartakiad.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spartacusleague.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | spartacus.mp3 | 21-Apr-2007 13:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | spartacist.mp3 | 21-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | sparse.mp3 | 21-Apr-2007 13:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | sparry.mp3 | 21-Apr-2007 13:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | sparrow.mp3 | 21-Apr-2007 13:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | sparring.mp3 | 21-Apr-2007 13:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | sparrer.mp3 | 21-Apr-2007 13:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | sparoid.mp3 | 21-Apr-2007 13:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | sparling.mp3 | 21-Apr-2007 13:22 | 17K | |
![[SND]](/icons/sound2.gif) | sparky.mp3 | 21-Apr-2007 13:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | sparkplug.mp3 | 21-Apr-2007 13:22 | 9.3K | |
![[SND]](/icons/sound2.gif) | sparko.mp3 | 21-Apr-2007 13:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | sparkly.mp3 | 21-Apr-2007 13:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | sparkling.mp3 | 21-Apr-2007 13:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | sparklet.mp3 | 21-Apr-2007 13:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | sparkler.mp3 | 21-Apr-2007 13:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | sparkle.mp3 | 21-Apr-2007 13:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | sparker.mp3 | 21-Apr-2007 13:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | spark.mp3 | 21-Apr-2007 13:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | sparingly.mp3 | 21-Apr-2007 13:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | sparing.mp3 | 21-Apr-2007 13:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | sparine.mp3 | 21-Apr-2007 13:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | sparid.mp3 | 21-Apr-2007 13:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | sparger.mp3 | 21-Apr-2007 13:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | sparge.mp3 | 21-Apr-2007 13:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | sparer.mp3 | 21-Apr-2007 13:22 | 17K | |
![[SND]](/icons/sound2.gif) | spare.mp3 | 21-Apr-2007 13:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | sparaxis.mp3 | 21-Apr-2007 13:22 | 17K | |
![[SND]](/icons/sound2.gif) | sparassis.mp3 | 21-Apr-2007 13:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | sparagmos.mp3 | 21-Apr-2007 13:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | sparable.mp3 | 21-Apr-2007 13:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | spar.mp3 | 21-Apr-2007 13:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | spansule.mp3 | 21-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | spanner.mp3 | 21-Apr-2007 13:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | spanless.mp3 | 21-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | spanking.mp3 | 21-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | spanker.mp3 | 21-Apr-2007 13:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | spank.mp3 | 21-Apr-2007 13:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | spaniel.mp3 | 21-Apr-2007 13:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | spangle.mp3 | 21-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | spang.mp3 | 21-Apr-2007 13:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | spandy.mp3 | 21-Apr-2007 13:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | spandrel.mp3 | 21-Apr-2007 13:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | spandex.mp3 | 21-Apr-2007 13:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | spandau.mp3 | 21-Apr-2007 13:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | spancel.mp3 | 21-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | span.mp3 | 21-Apr-2007 13:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | span-new.mp3 | 21-Apr-2007 13:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | spammed.mp3 | 21-Apr-2007 13:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | spalpeen.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spallation.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spallanzani.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spall.mp3 | 21-Apr-2007 13:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | spale.mp3 | 21-Apr-2007 13:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | spalding.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spaldeen.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spalato.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spake.mp3 | 21-Apr-2007 13:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | spait.mp3 | 21-Apr-2007 13:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | spaik.mp3 | 21-Apr-2007 13:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | spahn.mp3 | 21-Apr-2007 13:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | spahi.mp3 | 21-Apr-2007 13:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | spagyric.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spaginzy.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spaghettini.mp3 | 21-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | spaghetti.mp3 | 21-Apr-2007 13:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | spag.mp3 | 21-Apr-2007 13:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | spaetzle.mp3 | 21-Apr-2007 13:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | spae.mp3 | 21-Apr-2007 13:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | spado.mp3 | 21-Apr-2007 13:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | spadix.mp3 | 21-Apr-2007 13:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | spadille.mp3 | 21-Apr-2007 13:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | spadiceous.mp3 | 21-Apr-2007 13:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | spadger.mp3 | 21-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | spadeful.mp3 | 21-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | spadefoot toad.mp3 | 21-Apr-2007 13:19 | 13K | |
![[SND]](/icons/sound2.gif) | spade.mp3 | 21-Apr-2007 13:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | spade-bearded.mp3 | 21-Apr-2007 13:19 | 10K | |
![[SND]](/icons/sound2.gif) | spad.mp3 | 21-Apr-2007 13:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | spacy.mp3 | 21-Apr-2007 13:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | spackle.mp3 | 21-Apr-2007 13:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | spacious.mp3 | 21-Apr-2007 13:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | spacing.mp3 | 21-Apr-2007 13:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | spacial.mp3 | 21-Apr-2007 13:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | spacey.mp3 | 21-Apr-2007 13:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | spaceward.mp3 | 21-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | spacewalker.mp3 | 21-Apr-2007 13:19 | 9.6K | |
![[SND]](/icons/sound2.gif) | spacewalk.mp3 | 21-Apr-2007 13:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | spacetrack.mp3 | 21-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | spaceship.mp3 | 21-Apr-2007 13:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | spacer.mp3 | 21-Apr-2007 13:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | spacenet.mp3 | 21-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | spaceman.mp3 | 21-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | spaceless.mp3 | 21-Apr-2007 13:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | spacelab.mp3 | 21-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | spaced.mp3 | 21-Apr-2007 13:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | spaced-out.mp3 | 21-Apr-2007 13:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | spacecraft.mp3 | 21-Apr-2007 13:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | space.mp3 | 21-Apr-2007 13:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | space-time.mp3 | 21-Apr-2007 13:19 | 11K | |
![[SND]](/icons/sound2.gif) | space-age.mp3 | 21-Apr-2007 13:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | spaatz.mp3 | 21-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | spaak.mp3 | 21-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | spa.mp3 | 21-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | sozzled.mp3 | 21-Apr-2007 13:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | sozzle.mp3 | 21-Apr-2007 13:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | sozin.mp3 | 21-Apr-2007 13:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | soyuz.mp3 | 21-Apr-2007 13:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | soyinka.mp3 | 21-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | soybean.mp3 | 21-Apr-2007 13:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | soyabean.mp3 | 21-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | soya bean.mp3 | 21-Apr-2007 13:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | soy.mp3 | 21-Apr-2007 13:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | soxhletextractor.mp3 | 21-Apr-2007 13:18 | 18K | |
![[SND]](/icons/sound2.gif) | sox.mp3 | 21-Apr-2007 13:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | sowthistle.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sow thistle.mp3 | 21-Apr-2007 13:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | sown.mp3 | 21-Apr-2007 13:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | soweto.mp3 | 21-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | sowetan.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sower.mp3 | 21-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | sowens.mp3 | 21-Apr-2007 13:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | sowcar.mp3 | 21-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | sowbug.mp3 | 21-Apr-2007 13:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | sow bug.mp3 | 21-Apr-2007 13:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | sowbread.mp3 | 21-Apr-2007 13:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | sowbelly.mp3 | 21-Apr-2007 13:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | sowbane.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sowback.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sowar.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sow.mp3 | 21-Apr-2007 13:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | sovranty.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sovran.mp3 | 21-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | sovkhoz.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sovietology.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sovietize.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | sovietism.mp3 | 21-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | soviet.mp3 | 21-Apr-2007 13:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | sovereignty.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | sovereigntist.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | sovereign.mp3 | 21-Apr-2007 13:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | souzay.mp3 | 21-Apr-2007 13:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | souwester.mp3 | 21-Apr-2007 13:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | souvlaki.mp3 | 21-Apr-2007 13:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | souvenir.mp3 | 21-Apr-2007 13:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | souvannaphouma.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | soutter.mp3 | 21-Apr-2007 13:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | soutine.mp3 | 21-Apr-2007 13:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | southworth.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | southwestwards.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | southwestwardly.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | southwestward.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | southwesterner.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | southwestern.mp3 | 21-Apr-2007 13:16 | 10K | |
![[SND]](/icons/sound2.gif) | southwesterly.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | southwester.mp3 | 21-Apr-2007 13:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | southwest.mp3 | 21-Apr-2007 13:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | southwell.mp3 | 21-Apr-2007 13:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | southwark.mp3 | 21-Apr-2007 13:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | southwardly.mp3 | 21-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | southward.mp3 | 21-Apr-2007 13:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | southsouthwestward.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southsouthwest.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southsoutheastward.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southsoutheast.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southron.mp3 | 21-Apr-2007 13:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | southport.mp3 | 21-Apr-2007 13:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | southland.mp3 | 21-Apr-2007 13:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | southing.mp3 | 21-Apr-2007 13:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | southgate.mp3 | 21-Apr-2007 13:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | southfield.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southey.mp3 | 21-Apr-2007 13:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | southernly.mp3 | 21-Apr-2007 13:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | southernism.mp3 | 21-Apr-2007 13:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | southerner.mp3 | 21-Apr-2007 13:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | southern.mp3 | 21-Apr-2007 13:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | southerly.mp3 | 21-Apr-2007 13:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | souther.mp3 | 21-Apr-2007 13:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | southendonsea.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southeastwardly.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southeastward.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southeastern.mp3 | 21-Apr-2007 13:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | southeasterly.mp3 | 21-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | southeaster.mp3 | 21-Apr-2007 13:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | southeast.mp3 | 21-Apr-2007 13:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | southdown.mp3 | 21-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | southbridge.mp3 | 21-Apr-2007 13:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | southampton.mp3 | 21-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | southall.mp3 | 21-Apr-2007 13:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | south.mp3 | 21-Apr-2007 13:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | souterrain.mp3 | 21-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | souter.mp3 | 21-Apr-2007 13:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | soutenu.mp3 | 21-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | souteneur.mp3 | 21-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | soutane.mp3 | 21-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | soutache.mp3 | 21-Apr-2007 13:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | soussous.mp3 | 21-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sousou.mp3 | 21-Apr-2007 13:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | souslik.mp3 | 21-Apr-2007 13:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | soused.mp3 | 21-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | souse.mp3 | 21-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | souschef.mp3 | 21-Apr-2007 13:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | sousaphone.mp3 | 21-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | sousa.mp3 | 21-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sourish.mp3 | 21-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | sourdine.mp3 | 21-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | sourcing.mp3 | 21-Apr-2007 13:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | sourced.mp3 | 21-Apr-2007 13:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | source.mp3 | 21-Apr-2007 13:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | sourberry.mp3 | 21-Apr-2007 13:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | sour.mp3 | 21-Apr-2007 13:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | soupy.mp3 | 21-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | souple.mp3 | 21-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | souphanouvong.mp3 | 21-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | soupfinshark.mp3 | 21-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | souper.mp3 | 21-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | soupedup.mp3 | 21-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | souped-up.mp3 | 21-Apr-2007 13:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | soupe.mp3 | 21-Apr-2007 13:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | soupdujour.mp3 | 21-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | soup du jour.mp3 | 21-Apr-2007 13:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | soupcon.mp3 | 21-Apr-2007 13:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | soup.mp3 | 21-Apr-2007 13:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | sounion.mp3 | 21-Apr-2007 13:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | soundscape.mp3 | 21-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | soundness.mp3 | 21-Apr-2007 13:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | soundly.mp3 | 21-Apr-2007 13:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | soundless.mp3 | 21-Apr-2007 13:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | sounding.mp3 | 21-Apr-2007 13:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | sounder.mp3 | 21-Apr-2007 13:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | soundbow.mp3 | 21-Apr-2007 13:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | soundboard.mp3 | 21-Apr-2007 13:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | sound.mp3 | 21-Apr-2007 13:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | soumarque.mp3 | 21-Apr-2007 13:12 | 36K | |
![[SND]](/icons/sound2.gif) | soumakrug.mp3 | 21-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | soult.mp3 | 21-Apr-2007 13:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | soulless.mp3 | 21-Apr-2007 13:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | soulful.mp3 | 21-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | souled.mp3 | 21-Apr-2007 13:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | soul.mp3 | 21-Apr-2007 13:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | soukous.mp3 | 21-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | souk.mp3 | 21-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | soujge.mp3 | 21-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sought.mp3 | 21-Apr-2007 13:11 | 5.9K | |
![[SND]](/icons/sound2.gif) | sough.mp3 | 21-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | soufriere.mp3 | 21-Apr-2007 13:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | souffleur.mp3 | 21-Apr-2007 13:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | souffle.mp3 | 21-Apr-2007 13:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | soudanese.mp3 | 21-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | soudan.mp3 | 21-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | souchong.mp3 | 21-Apr-2007 13:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | soucar.mp3 | 21-Apr-2007 13:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | soubriquet.mp3 | 21-Apr-2007 13:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | soubrette.mp3 | 21-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | soubresaut.mp3 | 21-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | soubise.mp3 | 21-Apr-2007 13:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | souarinut.mp3 | 21-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | sou.mp3 | 21-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sottovoce.mp3 | 21-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | sottish.mp3 | 21-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sotted.mp3 | 21-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sots.mp3 | 21-Apr-2007 13:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | sotol.mp3 | 21-Apr-2007 13:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | soto.mp3 | 21-Apr-2007 13:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | sotie.mp3 | 21-Apr-2007 13:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sotho.mp3 | 21-Apr-2007 13:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | sothis.mp3 | 21-Apr-2007 13:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | sothic.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | sothern.mp3 | 21-Apr-2007 13:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | sothebys.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | soteriology.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | soter.mp3 | 21-Apr-2007 13:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sotelo.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | sot.mp3 | 21-Apr-2007 13:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sostenuto.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | sossled.mp3 | 21-Apr-2007 13:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | sosnowiec.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | sosh.mp3 | 21-Apr-2007 13:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | sosatie.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | sos.mp3 | 21-Apr-2007 13:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | sorva.mp3 | 21-Apr-2007 13:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorus.mp3 | 21-Apr-2007 13:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sort of.mp3 | 21-Apr-2007 13:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | sortition.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | sorting.mp3 | 21-Apr-2007 13:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | sortilege.mp3 | 21-Apr-2007 13:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | sortie.mp3 | 21-Apr-2007 13:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorteshomericae.mp3 | 21-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | sortesbiblicae.mp3 | 21-Apr-2007 13:09 | 17K | |
![[SND]](/icons/sound2.gif) | sorter.mp3 | 21-Apr-2007 13:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | sorted.mp3 | 21-Apr-2007 13:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sortable.mp3 | 21-Apr-2007 13:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | sorta.mp3 | 21-Apr-2007 13:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sort.mp3 | 21-Apr-2007 13:09 | 5.4K | |
![[SND]](/icons/sound2.gif) | sorsa.mp3 | 21-Apr-2007 13:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | sorry.mp3 | 21-Apr-2007 13:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | sorrowful.mp3 | 21-Apr-2007 13:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorrow.mp3 | 21-Apr-2007 13:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | sorrily.mp3 | 21-Apr-2007 13:09 | 17K | |
![[SND]](/icons/sound2.gif) | sorrento.mp3 | 21-Apr-2007 13:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | sorrentiro.mp3 | 21-Apr-2007 13:09 | 17K | |
![[SND]](/icons/sound2.gif) | sorrel.mp3 | 21-Apr-2007 13:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorra.mp3 | 21-Apr-2007 13:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorption.mp3 | 21-Apr-2007 13:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | sorosis.mp3 | 21-Apr-2007 13:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | sorosilicate.mp3 | 21-Apr-2007 13:09 | 17K | |
![[SND]](/icons/sound2.gif) | sorority.mp3 | 21-Apr-2007 13:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | sororicide.mp3 | 21-Apr-2007 13:09 | 17K | |
![[SND]](/icons/sound2.gif) | sororate.mp3 | 21-Apr-2007 13:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | sororal.mp3 | 21-Apr-2007 13:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | soroptimist.mp3 | 21-Apr-2007 13:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | sorollaybastida.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | sorokin.mp3 | 21-Apr-2007 13:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | soroche.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | sorocaba.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | sorn.mp3 | 21-Apr-2007 13:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorites.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | soring.mp3 | 21-Apr-2007 13:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | soricine.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | soria.mp3 | 21-Apr-2007 13:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | sori.mp3 | 21-Apr-2007 13:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorgo.mp3 | 21-Apr-2007 13:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorghum.mp3 | 21-Apr-2007 13:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | sorgho.mp3 | 21-Apr-2007 13:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorgeaffair.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | sorensen.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | soreness.mp3 | 21-Apr-2007 13:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | sorely.mp3 | 21-Apr-2007 13:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | sorel.mp3 | 21-Apr-2007 13:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | soredium.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | soredial.mp3 | 21-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | sore.mp3 | 21-Apr-2007 13:08 | 5.7K | |
![[SND]](/icons/sound2.gif) | sordor.mp3 | 21-Apr-2007 13:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | sordino.mp3 | 21-Apr-2007 13:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | sordid.mp3 | 21-Apr-2007 13:07 | 6.4K | |
![[SND]](/icons/sound2.gif) | sordes.mp3 | 21-Apr-2007 13:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | sordello.mp3 | 21-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | sorcery.mp3 | 21-Apr-2007 13:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | sorcerous.mp3 | 21-Apr-2007 13:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sorceress.mp3 | 21-Apr-2007 13:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | sorcerer.mp3 | 21-Apr-2007 13:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorbose.mp3 | 21-Apr-2007 13:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sorbonne.mp3 | 21-Apr-2007 13:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | sorbonist.mp3 | 21-Apr-2007 13:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | sorbol.mp3 | 21-Apr-2007 13:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sorbo.mp3 | 21-Apr-2007 13:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sorbitol.mp3 | 21-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | sorbite.mp3 | 21-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | sorbicacid.mp3 | 21-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | sorbic acid.mp3 | 21-Apr-2007 13:07 | 11K | |
![[SND]](/icons/sound2.gif) | sorbian.mp3 | 21-Apr-2007 13:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | sorbet.mp3 | 21-Apr-2007 13:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | sorbent.mp3 | 21-Apr-2007 13:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sorbefacient.mp3 | 21-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | sorbate.mp3 | 21-Apr-2007 13:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | sorb.mp3 | 21-Apr-2007 13:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | soralium.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | sora.mp3 | 21-Apr-2007 13:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sopwith.mp3 | 21-Apr-2007 13:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | sopron.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | soprano.mp3 | 21-Apr-2007 13:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | sopranist.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | sopranino.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | soppy.mp3 | 21-Apr-2007 13:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sopping.mp3 | 21-Apr-2007 13:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | soporose.mp3 | 21-Apr-2007 13:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | soporific.mp3 | 21-Apr-2007 13:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | soporiferous.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | sopor.mp3 | 21-Apr-2007 13:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sopite.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | sopie.mp3 | 21-Apr-2007 13:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sophy.mp3 | 21-Apr-2007 13:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sophrosyne.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | sophora.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | sophonias.mp3 | 21-Apr-2007 13:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | sophomoric.mp3 | 21-Apr-2007 13:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | sophomore.mp3 | 21-Apr-2007 13:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | sophocles.mp3 | 21-Apr-2007 13:06 | 17K | |
![[SND]](/icons/sound2.gif) | sophistry.mp3 | 21-Apr-2007 13:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | sophistication.mp3 | 21-Apr-2007 13:05 | 17K | |
![[SND]](/icons/sound2.gif) | sophisticated.mp3 | 21-Apr-2007 13:05 | 10K | |
![[SND]](/icons/sound2.gif) | sophisticate.mp3 | 21-Apr-2007 13:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | sophistical.mp3 | 21-Apr-2007 13:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | sophistic.mp3 | 21-Apr-2007 13:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | sophister.mp3 | 21-Apr-2007 13:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | sophist.mp3 | 21-Apr-2007 13:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | sophism.mp3 | 21-Apr-2007 13:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | sophie.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | sophia.mp3 | 21-Apr-2007 13:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | sophi.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | sopher.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | sophar.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | soph.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | soper.mp3 | 21-Apr-2007 13:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | sopaipilla.mp3 | 21-Apr-2007 13:05 | 17K | |
![[SND]](/icons/sound2.gif) | sopa.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | sop.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | sooty.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | soothsayer.mp3 | 21-Apr-2007 13:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | soothsay.mp3 | 21-Apr-2007 13:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | soothing.mp3 | 21-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | soothe.mp3 | 21-Apr-2007 13:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | sooth.mp3 | 21-Apr-2007 13:05 | 5.7K | |
![[SND]](/icons/sound2.gif) | sooterkin.mp3 | 21-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | soot.mp3 | 21-Apr-2007 13:04 | 5.5K | |
![[SND]](/icons/sound2.gif) | soor.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | soony.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | soonish.mp3 | 21-Apr-2007 13:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | soong.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sooner.mp3 | 21-Apr-2007 13:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | soon.mp3 | 21-Apr-2007 13:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | sool.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sooky.mp3 | 21-Apr-2007 13:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | sook.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | soojee.mp3 | 21-Apr-2007 13:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | soogiemoogie.mp3 | 21-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | soogee.mp3 | 21-Apr-2007 13:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | sooey.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | soo.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonya.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sony.mp3 | 21-Apr-2007 13:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sontag.mp3 | 21-Apr-2007 13:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | sonsy.mp3 | 21-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonsonate.mp3 | 21-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | sons of bitches.mp3 | 21-Apr-2007 13:03 | 10K | |
![[SND]](/icons/sound2.gif) | sonovox.mp3 | 21-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | sonorous.mp3 | 21-Apr-2007 13:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | sonority.mp3 | 21-Apr-2007 13:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | sonorific.mp3 | 21-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | sonorant.mp3 | 21-Apr-2007 13:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | sonora.mp3 | 21-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonometer.mp3 | 21-Apr-2007 13:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | sonoma.mp3 | 21-Apr-2007 13:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | sonography.mp3 | 21-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | sonograph.mp3 | 21-Apr-2007 13:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | sonogram.mp3 | 21-Apr-2007 13:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | son of a gun.mp3 | 21-Apr-2007 13:01 | 10K | |
![[SND]](/icons/sound2.gif) | son of a bitch.mp3 | 21-Apr-2007 13:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | sono.mp3 | 21-Apr-2007 13:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | sonny.mp3 | 21-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonno.mp3 | 21-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonnetize.mp3 | 21-Apr-2007 13:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | sonneteer.mp3 | 21-Apr-2007 13:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | sonnet.mp3 | 21-Apr-2007 13:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | sonnenfeldtdoctrine.mp3 | 21-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | sonly.mp3 | 21-Apr-2007 13:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | soniferous.mp3 | 21-Apr-2007 13:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | sonics.mp3 | 21-Apr-2007 13:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonicate.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | sonic.mp3 | 21-Apr-2007 13:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonia.mp3 | 21-Apr-2007 13:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | soni.mp3 | 21-Apr-2007 13:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | songziwen.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songzhiguang.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songwriter.mp3 | 21-Apr-2007 13:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | songstress.mp3 | 21-Apr-2007 13:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | songster.mp3 | 21-Apr-2007 13:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | songqingling.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songololo.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songmeiling.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songless.mp3 | 21-Apr-2007 13:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | songkok.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songkoi.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songka.mp3 | 21-Apr-2007 13:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | songjiang.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songhua.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songhai.mp3 | 21-Apr-2007 13:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | songful.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songcoi.mp3 | 21-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | songailing.mp3 | 21-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | song.mp3 | 21-Apr-2007 13:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | sonetlumiere.mp3 | 21-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | son et lumiere.mp3 | 21-Apr-2007 13:01 | 13K | |
![[SND]](/icons/sound2.gif) | sone.mp3 | 21-Apr-2007 13:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | sondra.mp3 | 21-Apr-2007 13:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonderkommando.mp3 | 21-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | sonderclass.mp3 | 21-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | sonde.mp3 | 21-Apr-2007 13:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | sondage.mp3 | 21-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | sonatina.mp3 | 21-Apr-2007 13:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | sonatadachiesa.mp3 | 21-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | sonatadacamera.mp3 | 21-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | sonata.mp3 | 21-Apr-2007 13:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonarman.mp3 | 21-Apr-2007 13:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | sonar.mp3 | 21-Apr-2007 13:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | sonant.mp3 | 21-Apr-2007 13:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonance.mp3 | 21-Apr-2007 13:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | sonal.mp3 | 21-Apr-2007 13:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | son.mp3 | 21-Apr-2007 13:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | son-in-law.mp3 | 21-Apr-2007 13:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | sompa.mp3 | 21-Apr-2007 13:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | somozadebayle.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somoza.mp3 | 21-Apr-2007 13:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | somocista.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somnus.mp3 | 21-Apr-2007 13:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | somnolent.mp3 | 21-Apr-2007 13:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | somnolence.mp3 | 21-Apr-2007 13:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | somnipathy.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somniloquy.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somnific.mp3 | 21-Apr-2007 13:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | somniferous.mp3 | 21-Apr-2007 13:00 | 10K | |
![[SND]](/icons/sound2.gif) | somnifacient.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somni.mp3 | 21-Apr-2007 13:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | somnambulist.mp3 | 21-Apr-2007 13:00 | 11K | |
![[SND]](/icons/sound2.gif) | somnambulism.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somnambulate.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somnambular.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somnambul.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | sommerfeld.mp3 | 21-Apr-2007 13:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | sommelier.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somme.mp3 | 21-Apr-2007 13:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | somma.mp3 | 21-Apr-2007 13:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | somite.mp3 | 21-Apr-2007 13:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | sominex.mp3 | 21-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | somic.mp3 | 21-Apr-2007 12:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | somewhere.mp3 | 21-Apr-2007 12:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | somewhat.mp3 | 21-Apr-2007 12:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | sometimey.mp3 | 21-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | sometimes.mp3 | 21-Apr-2007 12:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | sometime.mp3 | 21-Apr-2007 12:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | somethingth.mp3 | 21-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | somethingdiffrent.mp3 | 21-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | something.mp3 | 21-Apr-2007 12:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | somesthesia.mp3 | 21-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | somerville.mp3 | 21-Apr-2007 12:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | somersetshire.mp3 | 21-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | somerset.mp3 | 21-Apr-2007 12:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | somersault.mp3 | 21-Apr-2007 12:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | somer.mp3 | 21-Apr-2007 12:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | someplace.mp3 | 21-Apr-2007 12:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | someone.mp3 | 21-Apr-2007 12:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | somehow.mp3 | 21-Apr-2007 12:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | someday.mp3 | 21-Apr-2007 12:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | somebody.mp3 | 21-Apr-2007 12:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | some.mp3 | 21-Apr-2007 12:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | sombrous.mp3 | 21-Apr-2007 12:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | sombrero.mp3 | 21-Apr-2007 12:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | sombre.mp3 | 21-Apr-2007 12:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | somber.mp3 | 21-Apr-2007 12:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | somatotype.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatotropin.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatotropic hormone.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatotrophichormone.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatotonia.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatostatin.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatopleure.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatoplasm.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatometry.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatomedin.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatology.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatogenic.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatoform.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somato.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatizer.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatizationdisorder.mp3 | 21-Apr-2007 12:58 | 18K | |
![[SND]](/icons/sound2.gif) | somatist.mp3 | 21-Apr-2007 12:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | somaticize.mp3 | 21-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | somatic.mp3 | 21-Apr-2007 12:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | somata.mp3 | 21-Apr-2007 12:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | somat.mp3 | 21-Apr-2007 12:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | somaliland.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | somali.mp3 | 21-Apr-2007 12:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | soma.mp3 | 21-Apr-2007 12:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | solzhenitsyn.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solymani.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solwayfirth.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solvolysis.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solviturambulando.mp3 | 21-Apr-2007 12:57 | 27K | |
![[SND]](/icons/sound2.gif) | solvent.mp3 | 21-Apr-2007 12:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | solvency.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solveig.mp3 | 21-Apr-2007 12:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | solve.mp3 | 21-Apr-2007 12:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | solvay.mp3 | 21-Apr-2007 12:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | solvation.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solvate.mp3 | 21-Apr-2007 12:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | solvable.mp3 | 21-Apr-2007 12:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | solutrean.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solutizer.mp3 | 21-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | solution.mp3 | 21-Apr-2007 12:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | solute.mp3 | 21-Apr-2007 12:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | solus.mp3 | 21-Apr-2007 12:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | solunar.mp3 | 21-Apr-2007 12:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | solum.mp3 | 21-Apr-2007 12:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | soluble.mp3 | 21-Apr-2007 12:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | solubilize.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | solubility.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | solti.mp3 | 21-Apr-2007 12:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | solstitial.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | solstice.mp3 | 21-Apr-2007 12:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | solpugid.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | solothurn.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | so long.mp3 | 21-Apr-2007 12:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | solonetz.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | solonchak.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | solon.mp3 | 21-Apr-2007 12:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | solomonic.mp3 | 21-Apr-2007 12:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | solomongrundy.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | soloist.mp3 | 21-Apr-2007 12:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | solo.mp3 | 21-Apr-2007 12:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | solmization.mp3 | 21-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | sollicker.mp3 | 21-Apr-2007 12:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | sollers.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solleret.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | sollar.mp3 | 21-Apr-2007 12:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | solitudinarian.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solitude.mp3 | 21-Apr-2007 12:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | soliton.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solitary.mp3 | 21-Apr-2007 12:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | solitaire.mp3 | 21-Apr-2007 12:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | solipsism.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | soliped.mp3 | 21-Apr-2007 12:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | solion.mp3 | 21-Apr-2007 12:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | solingen.mp3 | 21-Apr-2007 12:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | soling.mp3 | 21-Apr-2007 12:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | solimoes.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solimani.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | soliloquy.mp3 | 21-Apr-2007 12:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | soliloquize.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | soliloquist.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solihull.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solifugid.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solifluction.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solifidian.mp3 | 21-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | solidus.mp3 | 21-Apr-2007 12:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | solidungulate.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solidly.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solidity.mp3 | 21-Apr-2007 12:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | solidify.mp3 | 21-Apr-2007 12:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | solidi.mp3 | 21-Apr-2007 12:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | solidary.mp3 | 21-Apr-2007 12:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | solidarize.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solidarity.mp3 | 21-Apr-2007 12:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | solidarism.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solidago.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solid.mp3 | 21-Apr-2007 12:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | solicitude.mp3 | 21-Apr-2007 12:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | solicitous.mp3 | 21-Apr-2007 12:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | solicitor.mp3 | 21-Apr-2007 12:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | solicitation.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solicitant.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solicit.mp3 | 21-Apr-2007 12:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | soli.mp3 | 21-Apr-2007 12:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | solgel.mp3 | 21-Apr-2007 12:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | solferino.mp3 | 21-Apr-2007 12:54 | 36K | |
![[SND]](/icons/sound2.gif) | solfeggio.mp3 | 21-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | solfege.mp3 | 21-Apr-2007 12:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | solfatara.mp3 | 21-Apr-2007 12:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | solfa.mp3 | 21-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | soleus.mp3 | 21-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | solesmes.mp3 | 21-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | soles.mp3 | 21-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | solera.mp3 | 21-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | solent.mp3 | 21-Apr-2007 12:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | solenoidal.mp3 | 21-Apr-2007 12:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | solenoid.mp3 | 21-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | solenogaster.mp3 | 21-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | solenodon.mp3 | 21-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | solenocyte.mp3 | 21-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | solenette.mp3 | 21-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | solen.mp3 | 21-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | solemnize.mp3 | 21-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | solemnity.mp3 | 21-Apr-2007 12:53 | 10K | |
![[SND]](/icons/sound2.gif) | solemnify.mp3 | 21-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | solemn.mp3 | 21-Apr-2007 12:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | solely.mp3 | 21-Apr-2007 12:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | solei.mp3 | 21-Apr-2007 12:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | soled.mp3 | 21-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | solecistic.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solecism.mp3 | 21-Apr-2007 12:52 | 11K | |
![[SND]](/icons/sound2.gif) | sole.mp3 | 21-Apr-2007 12:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | soldo.mp3 | 21-Apr-2007 12:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | soldiery.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | soldierly.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | soldiering.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | soldier.mp3 | 21-Apr-2007 12:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | soldi.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solderingiron.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solder.mp3 | 21-Apr-2007 12:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | soldcober.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | soldanella.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | soldan.mp3 | 21-Apr-2007 12:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | sold.mp3 | 21-Apr-2007 12:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | sold-out.mp3 | 21-Apr-2007 12:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | solatopee.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solatium.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solate.mp3 | 21-Apr-2007 12:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | solarwind.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solar plexus.mp3 | 21-Apr-2007 12:51 | 11K | |
![[SND]](/icons/sound2.gif) | solarize.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solarization.mp3 | 21-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | solarium.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solarism.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solaris.mp3 | 21-Apr-2007 12:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | solarimeter.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solar.mp3 | 21-Apr-2007 12:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | solanum.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solano.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solanine.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solander.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solanaceous.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | solan.mp3 | 21-Apr-2007 12:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | solace.mp3 | 21-Apr-2007 12:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | sola.mp3 | 21-Apr-2007 12:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | sol-faist.mp3 | 21-Apr-2007 12:53 | 9.8K | |
![[SND]](/icons/sound2.gif) | sol-fa.mp3 | 21-Apr-2007 12:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | sokotra.mp3 | 21-Apr-2007 12:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | sokoto.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | sokol.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | soken.mp3 | 21-Apr-2007 12:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sokemanry.mp3 | 21-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | sokeman.mp3 | 21-Apr-2007 12:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | soke.mp3 | 21-Apr-2007 12:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sojourn.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | soja.mp3 | 21-Apr-2007 12:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | soixanteneuf.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | soissons.mp3 | 21-Apr-2007 12:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | soiree.mp3 | 21-Apr-2007 12:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | soirdeparis.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | soilure.mp3 | 21-Apr-2007 12:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | soilless.mp3 | 21-Apr-2007 12:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | soilage.mp3 | 21-Apr-2007 12:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | soil.mp3 | 21-Apr-2007 12:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | soignee.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | soidisant.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | soho.mp3 | 21-Apr-2007 12:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | soh.mp3 | 21-Apr-2007 12:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sognefjord.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | soglow.mp3 | 21-Apr-2007 12:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | soglo.mp3 | 21-Apr-2007 12:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | soggy.mp3 | 21-Apr-2007 12:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sogenannt.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | sogdiana.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | sogdian.mp3 | 21-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | sogat.mp3 | 21-Apr-2007 12:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sog.mp3 | 21-Apr-2007 12:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | softy.mp3 | 21-Apr-2007 12:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | software.mp3 | 21-Apr-2007 12:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | softshell.mp3 | 21-Apr-2007 12:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | softsawder.mp3 | 21-Apr-2007 12:49 | 17K | |
![[SND]](/icons/sound2.gif) | softness.mp3 | 21-Apr-2007 12:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | softly.mp3 | 21-Apr-2007 12:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | softish.mp3 | 21-Apr-2007 12:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | softie.mp3 | 21-Apr-2007 12:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | softhearted.mp3 | 21-Apr-2007 12:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | softheaded.mp3 | 21-Apr-2007 12:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | softhead.mp3 | 21-Apr-2007 12:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | softhaporth.mp3 | 21-Apr-2007 12:49 | 17K | |
![[SND]](/icons/sound2.gif) | softgel.mp3 | 21-Apr-2007 12:48 | 17K | |
![[SND]](/icons/sound2.gif) | softening.mp3 | 21-Apr-2007 12:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | softener.mp3 | 21-Apr-2007 12:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | soften.mp3 | 21-Apr-2007 12:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | softcover.mp3 | 21-Apr-2007 12:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | softbound.mp3 | 21-Apr-2007 12:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | softballer.mp3 | 21-Apr-2007 12:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | softball.mp3 | 21-Apr-2007 12:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | softback.mp3 | 21-Apr-2007 12:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | softa.mp3 | 21-Apr-2007 12:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | soft.mp3 | 21-Apr-2007 12:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | soft-wooded.mp3 | 21-Apr-2007 12:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | soft-spoken.mp3 | 21-Apr-2007 12:49 | 11K | |
![[SND]](/icons/sound2.gif) | soft-soaper.mp3 | 21-Apr-2007 12:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | soft-soap.mp3 | 21-Apr-2007 12:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | soft-shoe.mp3 | 21-Apr-2007 12:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | soft-shelled.mp3 | 21-Apr-2007 12:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | soft-shell.mp3 | 21-Apr-2007 12:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | soft-pedal.mp3 | 21-Apr-2007 12:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | soft-liner.mp3 | 21-Apr-2007 12:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | soft-line.mp3 | 21-Apr-2007 12:49 | 11K | |
![[SND]](/icons/sound2.gif) | soft-land.mp3 | 21-Apr-2007 12:49 | 10K | |
![[SND]](/icons/sound2.gif) | soft-focus.mp3 | 21-Apr-2007 12:48 | 11K | |
![[SND]](/icons/sound2.gif) | soft-core.mp3 | 21-Apr-2007 12:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | soft-boiled.mp3 | 21-Apr-2007 12:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | sofrito.mp3 | 21-Apr-2007 12:48 | 17K | |
![[SND]](/icons/sound2.gif) | sofism.mp3 | 21-Apr-2007 12:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | sofi.mp3 | 21-Apr-2007 12:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | soffritto.mp3 | 21-Apr-2007 12:48 | 17K | |
![[SND]](/icons/sound2.gif) | soffit.mp3 | 21-Apr-2007 12:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | sofer.mp3 | 21-Apr-2007 12:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | sofar.mp3 | 21-Apr-2007 12:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | sofa.mp3 | 21-Apr-2007 12:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | soever.mp3 | 21-Apr-2007 12:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | soeur.mp3 | 21-Apr-2007 12:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | soerakarta.mp3 | 21-Apr-2007 12:47 | 17K | |
![[SND]](/icons/sound2.gif) | sodomy.mp3 | 21-Apr-2007 12:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | sodomize.mp3 | 21-Apr-2007 12:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | sodomitical.mp3 | 21-Apr-2007 12:47 | 10K | |
![[SND]](/icons/sound2.gif) | sodomitic.mp3 | 21-Apr-2007 12:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | sodomite.mp3 | 21-Apr-2007 12:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | sodomist.mp3 | 21-Apr-2007 12:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | sodomail.mp3 | 21-Apr-2007 12:47 | 17K | |
![[SND]](/icons/sound2.gif) | sodiumtripolyphosphate.mp3 | 21-Apr-2007 12:47 | 27K | |
![[SND]](/icons/sound2.gif) | sodium tripolyphosphate.mp3 | 21-Apr-2007 12:47 | 17K | |
![[SND]](/icons/sound2.gif) | sodium metasilicate.mp3 | 21-Apr-2007 12:47 | 15K | |
![[SND]](/icons/sound2.gif) | sodium lauryl sulfate.mp3 | 21-Apr-2007 12:47 | 17K | |
![[SND]](/icons/sound2.gif) | sodium fluoroacetate.mp3 | 21-Apr-2007 12:47 | 18K | |
![[SND]](/icons/sound2.gif) | sodiumdithionite.mp3 | 21-Apr-2007 12:47 | 17K | |
![[SND]](/icons/sound2.gif) | sodium borohydride.mp3 | 21-Apr-2007 12:47 | 15K | |
![[SND]](/icons/sound2.gif) | sodium.mp3 | 21-Apr-2007 12:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | sodio.mp3 | 21-Apr-2007 12:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | sodic.mp3 | 21-Apr-2007 12:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | sodger.mp3 | 21-Apr-2007 12:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | sodding.mp3 | 21-Apr-2007 12:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | soddenness.mp3 | 21-Apr-2007 12:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | soddening.mp3 | 21-Apr-2007 12:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | sodden.mp3 | 21-Apr-2007 12:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | sodbuster.mp3 | 21-Apr-2007 12:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | sodar.mp3 | 21-Apr-2007 12:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | sodamide.mp3 | 21-Apr-2007 12:46 | 17K | |
![[SND]](/icons/sound2.gif) | sodality.mp3 | 21-Apr-2007 12:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | sodalite.mp3 | 21-Apr-2007 12:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | sodalist.mp3 | 21-Apr-2007 12:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | soda jerk.mp3 | 21-Apr-2007 12:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | soda.mp3 | 21-Apr-2007 12:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | sod.mp3 | 21-Apr-2007 12:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | socred.mp3 | 21-Apr-2007 12:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | socony.mp3 | 21-Apr-2007 12:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | socman.mp3 | 21-Apr-2007 12:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | socle.mp3 | 21-Apr-2007 12:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | socko.mp3 | 21-Apr-2007 12:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | sockeyesalmon.mp3 | 21-Apr-2007 12:45 | 17K | |
![[SND]](/icons/sound2.gif) | sockeye salmon.mp3 | 21-Apr-2007 12:45 | 12K | |
![[SND]](/icons/sound2.gif) | socket.mp3 | 21-Apr-2007 12:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | sockeroo.mp3 | 21-Apr-2007 12:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | socker.mp3 | 21-Apr-2007 12:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | socked.mp3 | 21-Apr-2007 12:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | sockdologer.mp3 | 21-Apr-2007 12:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | sockdolager.mp3 | 21-Apr-2007 12:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | sock.mp3 | 21-Apr-2007 12:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | socius.mp3 | 21-Apr-2007 12:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | sociosexual.mp3 | 21-Apr-2007 12:45 | 11K | |
![[SND]](/icons/sound2.gif) | socioreligious.mp3 | 21-Apr-2007 12:45 | 13K | |
![[SND]](/icons/sound2.gif) | sociopsychological.mp3 | 21-Apr-2007 12:45 | 14K | |
![[SND]](/icons/sound2.gif) | sociopolitical.mp3 | 21-Apr-2007 12:45 | 12K | |
![[SND]](/icons/sound2.gif) | sociopathic.mp3 | 21-Apr-2007 12:45 | 10K | |
![[SND]](/icons/sound2.gif) | sociopath.mp3 | 21-Apr-2007 12:45 | 11K | |
![[SND]](/icons/sound2.gif) | sociometry.mp3 | 21-Apr-2007 12:45 | 10K | |
![[SND]](/icons/sound2.gif) | sociometric.mp3 | 21-Apr-2007 12:45 | 11K | |
![[SND]](/icons/sound2.gif) | sociology.mp3 | 21-Apr-2007 12:45 | 11K | |
![[SND]](/icons/sound2.gif) | sociologize.mp3 | 21-Apr-2007 12:45 | 17K | |
![[SND]](/icons/sound2.gif) | sociologistic.mp3 | 21-Apr-2007 12:45 | 17K | |
![[SND]](/icons/sound2.gif) | sociologist.mp3 | 21-Apr-2007 12:44 | 11K | |
![[SND]](/icons/sound2.gif) | sociologism.mp3 | 21-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | sociologically.mp3 | 21-Apr-2007 12:44 | 12K | |
![[SND]](/icons/sound2.gif) | sociological.mp3 | 21-Apr-2007 12:44 | 11K | |
![[SND]](/icons/sound2.gif) | sociologic.mp3 | 21-Apr-2007 12:44 | 10K | |
![[SND]](/icons/sound2.gif) | sociologese.mp3 | 21-Apr-2007 12:44 | 13K | |
![[SND]](/icons/sound2.gif) | sociolinguistics.mp3 | 21-Apr-2007 12:44 | 15K | |
![[SND]](/icons/sound2.gif) | sociolinguistic.mp3 | 21-Apr-2007 12:44 | 13K | |
![[SND]](/icons/sound2.gif) | sociolinguist.mp3 | 21-Apr-2007 12:44 | 13K | |
![[SND]](/icons/sound2.gif) | sociolect.mp3 | 21-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | sociohistorical.mp3 | 21-Apr-2007 12:44 | 14K | |
![[SND]](/icons/sound2.gif) | sociography.mp3 | 21-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | sociogram.mp3 | 21-Apr-2007 12:44 | 11K | |
![[SND]](/icons/sound2.gif) | sociogenic.mp3 | 21-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | socioeconomically.mp3 | 21-Apr-2007 12:44 | 14K | |
![[SND]](/icons/sound2.gif) | socioeconomic.mp3 | 21-Apr-2007 12:44 | 13K | |
![[SND]](/icons/sound2.gif) | socioculturally.mp3 | 21-Apr-2007 12:44 | 13K | |
![[SND]](/icons/sound2.gif) | sociocultural.mp3 | 21-Apr-2007 12:44 | 11K | |
![[SND]](/icons/sound2.gif) | sociocracy.mp3 | 21-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | sociobiology.mp3 | 21-Apr-2007 12:44 | 13K | |
![[SND]](/icons/sound2.gif) | sociobiologist.mp3 | 21-Apr-2007 12:44 | 15K | |
![[SND]](/icons/sound2.gif) | sociobiological.mp3 | 21-Apr-2007 12:44 | 14K | |
![[SND]](/icons/sound2.gif) | socio.mp3 | 21-Apr-2007 12:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | socii.mp3 | 21-Apr-2007 12:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | society.mp3 | 21-Apr-2007 12:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | societeanonyme.mp3 | 21-Apr-2007 12:43 | 17K | |
![[SND]](/icons/sound2.gif) | societally.mp3 | 21-Apr-2007 12:43 | 10K | |
![[SND]](/icons/sound2.gif) | societal.mp3 | 21-Apr-2007 12:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | socially.mp3 | 21-Apr-2007 12:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | socializer.mp3 | 21-Apr-2007 12:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | socialize.mp3 | 21-Apr-2007 12:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | socialization.mp3 | 21-Apr-2007 12:43 | 11K | |
![[SND]](/icons/sound2.gif) | sociality.mp3 | 21-Apr-2007 12:43 | 10K | |
![[SND]](/icons/sound2.gif) | socialite.mp3 | 21-Apr-2007 12:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | socialistically.mp3 | 21-Apr-2007 12:43 | 11K | |
![[SND]](/icons/sound2.gif) | socialistic.mp3 | 21-Apr-2007 12:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | socialist.mp3 | 21-Apr-2007 12:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | socialism.mp3 | 21-Apr-2007 12:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | social.mp3 | 21-Apr-2007 12:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | social-minded.mp3 | 21-Apr-2007 12:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | sociably.mp3 | 21-Apr-2007 12:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | sociable.mp3 | 21-Apr-2007 12:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | sociability.mp3 | 21-Apr-2007 12:42 | 10K | |
![[SND]](/icons/sound2.gif) | soche.mp3 | 21-Apr-2007 12:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | soch.mp3 | 21-Apr-2007 12:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | socceroos.mp3 | 21-Apr-2007 12:42 | 17K | |
![[SND]](/icons/sound2.gif) | soccer.mp3 | 21-Apr-2007 12:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | soccage.mp3 | 21-Apr-2007 12:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | socal.mp3 | 21-Apr-2007 12:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | socager.mp3 | 21-Apr-2007 12:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | socage.mp3 | 21-Apr-2007 12:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | soc.mp3 | 21-Apr-2007 12:42 | 27K | |
![[SND]](/icons/sound2.gif) | sobriquet.mp3 | 21-Apr-2007 12:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | sobriety.mp3 | 21-Apr-2007 12:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | sobranje.mp3 | 21-Apr-2007 12:42 | 17K | |
![[SND]](/icons/sound2.gif) | sobranie.mp3 | 21-Apr-2007 12:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | sobor.mp3 | 21-Apr-2007 12:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | sobole.mp3 | 21-Apr-2007 12:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | sobieski.mp3 | 21-Apr-2007 12:42 | 17K | |
![[SND]](/icons/sound2.gif) | sobhuzaii.mp3 | 21-Apr-2007 12:42 | 17K | |
![[SND]](/icons/sound2.gif) | sobersides.mp3 | 21-Apr-2007 12:42 | 11K | |
![[SND]](/icons/sound2.gif) | sobersidedness.mp3 | 21-Apr-2007 12:42 | 13K | |
![[SND]](/icons/sound2.gif) | sobersided.mp3 | 21-Apr-2007 12:41 | 10K | |
![[SND]](/icons/sound2.gif) | soberly.mp3 | 21-Apr-2007 12:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | soberize.mp3 | 21-Apr-2007 12:41 | 11K | |
![[SND]](/icons/sound2.gif) | sobering.mp3 | 21-Apr-2007 12:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | soberest.mp3 | 21-Apr-2007 12:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | soberer.mp3 | 21-Apr-2007 12:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | sober.mp3 | 21-Apr-2007 12:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | sobeit.mp3 | 21-Apr-2007 12:41 | 17K | |
![[SND]](/icons/sound2.gif) | sob.mp3 | 21-Apr-2007 12:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | soay.mp3 | 21-Apr-2007 12:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | soas.mp3 | 21-Apr-2007 12:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | soaring.mp3 | 21-Apr-2007 12:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | soar.mp3 | 21-Apr-2007 12:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | soapy.mp3 | 21-Apr-2007 12:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | soapwort.mp3 | 21-Apr-2007 12:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | soapweed.mp3 | 21-Apr-2007 12:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | soapsuds.mp3 | 21-Apr-2007 12:41 | 10K | |
![[SND]](/icons/sound2.gif) | soapstone.mp3 | 21-Apr-2007 12:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | soapolallie.mp3 | 21-Apr-2007 12:41 | 17K | |
![[SND]](/icons/sound2.gif) | soapless.mp3 | 21-Apr-2007 12:41 | 17K | |
![[SND]](/icons/sound2.gif) | soapiness.mp3 | 21-Apr-2007 12:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | soapily.mp3 | 21-Apr-2007 12:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | soapery.mp3 | 21-Apr-2007 12:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | soaper.mp3 | 21-Apr-2007 12:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | soapbox.mp3 | 21-Apr-2007 12:40 | 10K | |
![[SND]](/icons/sound2.gif) | soapberry.mp3 | 21-Apr-2007 12:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | soapbark.mp3 | 21-Apr-2007 12:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | soap.mp3 | 21-Apr-2007 12:40 | 5.9K | |
![[SND]](/icons/sound2.gif) | soap-operatic.mp3 | 21-Apr-2007 12:41 | 12K | |
![[SND]](/icons/sound2.gif) | soanlyranger.mp3 | 21-Apr-2007 12:40 | 17K | |
![[SND]](/icons/sound2.gif) | soane.mp3 | 21-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | soakingly.mp3 | 21-Apr-2007 12:40 | 17K | |
![[SND]](/icons/sound2.gif) | soaking.mp3 | 21-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | soaker.mp3 | 21-Apr-2007 12:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | soaked.mp3 | 21-Apr-2007 12:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | soakage.mp3 | 21-Apr-2007 12:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | soak.mp3 | 21-Apr-2007 12:40 | 5.9K | |
![[SND]](/icons/sound2.gif) | so.mp3 | 21-Apr-2007 12:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | so-called.mp3 | 21-Apr-2007 12:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | so-and-so.mp3 | 21-Apr-2007 12:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | so-and-so's.mp3 | 21-Apr-2007 12:40 | 11K | |
![[SND]](/icons/sound2.gif) | snye.mp3 | 21-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | snyder.mp3 | 21-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | sny.mp3 | 21-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | snurge.mp3 | 21-Apr-2007 12:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | snurfing.mp3 | 21-Apr-2007 12:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | snuggy.mp3 | 21-Apr-2007 12:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | snuggling.mp3 | 21-Apr-2007 12:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | snuggle.mp3 | 21-Apr-2007 12:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | snuggies.mp3 | 21-Apr-2007 12:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | snuggery.mp3 | 21-Apr-2007 12:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | snug.mp3 | 21-Apr-2007 12:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | snuffy.mp3 | 21-Apr-2007 12:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | snuffling.mp3 | 21-Apr-2007 12:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | snuffler.mp3 | 21-Apr-2007 12:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | snuffle.mp3 | 21-Apr-2007 12:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | snuffing.mp3 | 21-Apr-2007 12:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | snuffer.mp3 | 21-Apr-2007 12:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | snuffbox.mp3 | 21-Apr-2007 12:39 | 10K | |
![[SND]](/icons/sound2.gif) | snuff.mp3 | 21-Apr-2007 12:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | snuck.mp3 | 21-Apr-2007 12:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | snubby.mp3 | 21-Apr-2007 12:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | snubber.mp3 | 21-Apr-2007 12:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | snubbed.mp3 | 21-Apr-2007 12:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | snub.mp3 | 21-Apr-2007 12:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | snub-nosed.mp3 | 21-Apr-2007 12:39 | 10K | |
![[SND]](/icons/sound2.gif) | snozzled.mp3 | 21-Apr-2007 12:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | snozzle.mp3 | 21-Apr-2007 12:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | snowymountains.mp3 | 21-Apr-2007 12:38 | 17K | |
![[SND]](/icons/sound2.gif) | snowy.mp3 | 21-Apr-2007 12:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | snowsuit.mp3 | 21-Apr-2007 12:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | snowstorm.mp3 | 21-Apr-2007 12:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | snowslide.mp3 | 21-Apr-2007 12:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | snowshoer.mp3 | 21-Apr-2007 12:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | snowshoe.mp3 | 21-Apr-2007 12:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | snowshed.mp3 | 21-Apr-2007 12:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | snowscape.mp3 | 21-Apr-2007 12:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | snowplow.mp3 | 21-Apr-2007 12:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | snowpack.mp3 | 21-Apr-2007 12:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | snowmobilist.mp3 | 21-Apr-2007 12:38 | 11K | |
![[SND]](/icons/sound2.gif) | snowmobiling.mp3 | 21-Apr-2007 12:38 | 10K | |
![[SND]](/icons/sound2.gif) | snowmobiler.mp3 | 21-Apr-2007 12:38 | 10K | |
![[SND]](/icons/sound2.gif) | snowmobile.mp3 | 21-Apr-2007 12:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | snowmelt.mp3 | 21-Apr-2007 12:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | snowman.mp3 | 21-Apr-2007 12:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | snowmaking.mp3 | 21-Apr-2007 12:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | snowmaker.mp3 | 21-Apr-2007 12:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | snowless.mp3 | 21-Apr-2007 12:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | snowiness.mp3 | 21-Apr-2007 12:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | snowily.mp3 | 21-Apr-2007 12:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | snowflake.mp3 | 21-Apr-2007 12:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | snowfield.mp3 | 21-Apr-2007 12:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | snowfall.mp3 | 21-Apr-2007 12:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | snowed.mp3 | 21-Apr-2007 12:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | snowdrop.mp3 | 21-Apr-2007 12:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | snowdrift.mp3 | 21-Apr-2007 12:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | snowcat.mp3 | 21-Apr-2007 12:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | snowcapped.mp3 | 21-Apr-2007 12:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | snowcap.mp3 | 21-Apr-2007 12:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | snowbrush.mp3 | 21-Apr-2007 12:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | snowbound.mp3 | 21-Apr-2007 12:37 | 11K | |
![[SND]](/icons/sound2.gif) | snowboard.mp3 | 21-Apr-2007 12:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | snowblower.mp3 | 21-Apr-2007 12:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | snowbird.mp3 | 21-Apr-2007 12:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | snowberry.mp3 | 21-Apr-2007 12:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | snowbelt.mp3 | 21-Apr-2007 12:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | snowbank.mp3 | 21-Apr-2007 12:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | snowball.mp3 | 21-Apr-2007 12:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | snow.mp3 | 21-Apr-2007 12:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | snow-white.mp3 | 21-Apr-2007 12:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | snow-blinded.mp3 | 21-Apr-2007 12:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | snow-blind.mp3 | 21-Apr-2007 12:37 | 10K | |
![[SND]](/icons/sound2.gif) | snouty.mp3 | 21-Apr-2007 12:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | snoutish.mp3 | 21-Apr-2007 12:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | snouted.mp3 | 21-Apr-2007 12:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | snout.mp3 | 21-Apr-2007 12:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | snotty.mp3 | 21-Apr-2007 12:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | snottiness.mp3 | 21-Apr-2007 12:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | snottily.mp3 | 21-Apr-2007 12:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | snotter.mp3 | 21-Apr-2007 12:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | snotted.mp3 | 21-Apr-2007 12:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | snot.mp3 | 21-Apr-2007 12:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | snorty.mp3 | 21-Apr-2007 12:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | snorter.mp3 | 21-Apr-2007 12:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | snort.mp3 | 21-Apr-2007 12:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | snorristurluson.mp3 | 21-Apr-2007 12:36 | 17K | |
![[SND]](/icons/sound2.gif) | snorker.mp3 | 21-Apr-2007 12:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | snorkeling.mp3 | 21-Apr-2007 12:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | snorkeler.mp3 | 21-Apr-2007 12:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | snorkel.mp3 | 21-Apr-2007 12:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | snork.mp3 | 21-Apr-2007 12:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | snore.mp3 | 21-Apr-2007 12:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | snoqualmiefalls.mp3 | 21-Apr-2007 12:36 | 17K | |
![[SND]](/icons/sound2.gif) | snopes.mp3 | 21-Apr-2007 12:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | snop.mp3 | 21-Apr-2007 12:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | snoozling.mp3 | 21-Apr-2007 12:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | snoozle.mp3 | 21-Apr-2007 12:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | snoozer.mp3 | 21-Apr-2007 12:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | snooze.mp3 | 21-Apr-2007 12:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | snoozamorooed.mp3 | 21-Apr-2007 12:35 | 17K | |
![[SND]](/icons/sound2.gif) | snooty.mp3 | 21-Apr-2007 12:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | snootiness.mp3 | 21-Apr-2007 12:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | snootily.mp3 | 21-Apr-2007 12:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | snootful.mp3 | 21-Apr-2007 12:35 | 17K | |
![[SND]](/icons/sound2.gif) | snooted.mp3 | 21-Apr-2007 12:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | snoot.mp3 | 21-Apr-2007 12:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | snoose.mp3 | 21-Apr-2007 12:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | snoopy.mp3 | 21-Apr-2007 12:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | snoopily.mp3 | 21-Apr-2007 12:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | snooperscope.mp3 | 21-Apr-2007 12:35 | 17K | |
![[SND]](/icons/sound2.gif) | snooper.mp3 | 21-Apr-2007 12:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | snoop.mp3 | 21-Apr-2007 12:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | snooks.mp3 | 21-Apr-2007 12:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | snooker.mp3 | 21-Apr-2007 12:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | snook.mp3 | 21-Apr-2007 12:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | snood.mp3 | 21-Apr-2007 12:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | snollygoster.mp3 | 21-Apr-2007 12:35 | 17K | |
![[SND]](/icons/sound2.gif) | snoggered.mp3 | 21-Apr-2007 12:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | snog.mp3 | 21-Apr-2007 12:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | snoff.mp3 | 21-Apr-2007 12:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | snofari.mp3 | 21-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | snoek.mp3 | 21-Apr-2007 12:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | snodger.mp3 | 21-Apr-2007 12:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | snod.mp3 | 21-Apr-2007 12:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | snockered.mp3 | 21-Apr-2007 12:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | snocat.mp3 | 21-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | snobol.mp3 | 21-Apr-2007 12:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | snobography.mp3 | 21-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | snobocracy.mp3 | 21-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | snobby.mp3 | 21-Apr-2007 12:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | snobbism.mp3 | 21-Apr-2007 12:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | snobbish.mp3 | 21-Apr-2007 12:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | snobbery.mp3 | 21-Apr-2007 12:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | snob.mp3 | 21-Apr-2007 12:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | sno-cone.mp3 | 21-Apr-2007 12:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | snively.mp3 | 21-Apr-2007 12:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | snivelling.mp3 | 21-Apr-2007 12:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | sniveler.mp3 | 21-Apr-2007 12:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | snivel.mp3 | 21-Apr-2007 12:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | snitzy.mp3 | 21-Apr-2007 12:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | snitty.mp3 | 21-Apr-2007 12:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | snitchy.mp3 | 21-Apr-2007 12:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | snitch.mp3 | 21-Apr-2007 12:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | snit.mp3 | 21-Apr-2007 12:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | sniptious.mp3 | 21-Apr-2007 12:33 | 17K | |
![[SND]](/icons/sound2.gif) | snipsnapsnorum.mp3 | 21-Apr-2007 12:33 | 17K | |
![[SND]](/icons/sound2.gif) | snipsnap.mp3 | 21-Apr-2007 12:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | snips.mp3 | 21-Apr-2007 12:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | snippy.mp3 | 21-Apr-2007 12:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | snippily.mp3 | 21-Apr-2007 12:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | snippety.mp3 | 21-Apr-2007 12:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | snippet.mp3 | 21-Apr-2007 12:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | snippersnapper.mp3 | 21-Apr-2007 12:33 | 9.8K | |
![[SND]](/icons/sound2.gif) | sniperscope.mp3 | 21-Apr-2007 12:33 | 11K | |
![[SND]](/icons/sound2.gif) | sniper.mp3 | 21-Apr-2007 12:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | snipe.mp3 | 21-Apr-2007 12:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | snip.mp3 | 21-Apr-2007 12:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | sniglet.mp3 | 21-Apr-2007 12:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | sniggling.mp3 | 21-Apr-2007 12:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sniggle.mp3 | 21-Apr-2007 12:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | sniggering.mp3 | 21-Apr-2007 12:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sniggerer.mp3 | 21-Apr-2007 12:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | snigger.mp3 | 21-Apr-2007 12:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | snig.mp3 | 21-Apr-2007 12:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sniftingvalve.mp3 | 21-Apr-2007 12:33 | 17K | |
![[SND]](/icons/sound2.gif) | snifter.mp3 | 21-Apr-2007 12:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | sniffy.mp3 | 21-Apr-2007 12:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | sniffling.mp3 | 21-Apr-2007 12:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | sniffler.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sniffle.mp3 | 21-Apr-2007 12:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | sniffish.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sniffiness.mp3 | 21-Apr-2007 12:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | sniffily.mp3 | 21-Apr-2007 12:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | sniffer.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sniff.mp3 | 21-Apr-2007 12:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | snidey.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | snider.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | snide.mp3 | 21-Apr-2007 12:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | snicket.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | snickery.mp3 | 21-Apr-2007 12:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | snickersnee.mp3 | 21-Apr-2007 12:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | snickering.mp3 | 21-Apr-2007 12:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | snickerer.mp3 | 21-Apr-2007 12:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | snicker.mp3 | 21-Apr-2007 12:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | snick.mp3 | 21-Apr-2007 12:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | snib.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | snf.mp3 | 21-Apr-2007 12:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | snerf.mp3 | 21-Apr-2007 12:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | snellslaw.mp3 | 21-Apr-2007 12:32 | 17K | |
![[SND]](/icons/sound2.gif) | snellenschart.mp3 | 21-Apr-2007 12:31 | 17K | |
![[SND]](/icons/sound2.gif) | snell.mp3 | 21-Apr-2007 12:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | snegur.mp3 | 21-Apr-2007 12:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | snefru.mp3 | 21-Apr-2007 12:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | sneezy.mp3 | 21-Apr-2007 12:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | sneezewort.mp3 | 21-Apr-2007 12:31 | 17K | |
![[SND]](/icons/sound2.gif) | sneezeweed.mp3 | 21-Apr-2007 12:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | sneeze.mp3 | 21-Apr-2007 12:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | sneesh.mp3 | 21-Apr-2007 12:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sneer.mp3 | 21-Apr-2007 12:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | sned.mp3 | 21-Apr-2007 12:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sneck.mp3 | 21-Apr-2007 12:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | sneap.mp3 | 21-Apr-2007 12:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | sneaky.mp3 | 21-Apr-2007 12:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | sneaking.mp3 | 21-Apr-2007 12:31 | 17K | |
![[SND]](/icons/sound2.gif) | sneakiness.mp3 | 21-Apr-2007 12:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | sneakily.mp3 | 21-Apr-2007 12:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | sneakered.mp3 | 21-Apr-2007 12:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | sneaker.mp3 | 21-Apr-2007 12:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | sneaked.mp3 | 21-Apr-2007 12:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | sneak.mp3 | 21-Apr-2007 12:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | sncc.mp3 | 21-Apr-2007 12:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | snazzy.mp3 | 21-Apr-2007 12:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | snazz.mp3 | 21-Apr-2007 12:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | snavel.mp3 | 21-Apr-2007 12:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | snaved.mp3 | 21-Apr-2007 12:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | snathe.mp3 | 21-Apr-2007 12:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | snath.mp3 | 21-Apr-2007 12:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | snatchy.mp3 | 21-Apr-2007 12:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | snatcher.mp3 | 21-Apr-2007 12:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | snatch.mp3 | 21-Apr-2007 12:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | snash.mp3 | 21-Apr-2007 12:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | snart.mp3 | 21-Apr-2007 12:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | snarly.mp3 | 21-Apr-2007 12:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | snarler.mp3 | 21-Apr-2007 12:30 | 17K | |
![[SND]](/icons/sound2.gif) | snarl.mp3 | 21-Apr-2007 12:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | snarky.mp3 | 21-Apr-2007 12:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | snarkily.mp3 | 21-Apr-2007 12:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | snark.mp3 | 21-Apr-2007 12:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | snarf.mp3 | 21-Apr-2007 12:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | snare.mp3 | 21-Apr-2007 12:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | snapshot.mp3 | 21-Apr-2007 12:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | snapshooter.mp3 | 21-Apr-2007 12:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | snappy.mp3 | 21-Apr-2007 12:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | snappish.mp3 | 21-Apr-2007 12:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | snappiness.mp3 | 21-Apr-2007 12:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | snappily.mp3 | 21-Apr-2007 12:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | snapper.mp3 | 21-Apr-2007 12:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | snapper-back.mp3 | 21-Apr-2007 12:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | snapped.mp3 | 21-Apr-2007 12:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | snaphaunce.mp3 | 21-Apr-2007 12:29 | 17K | |
![[SND]](/icons/sound2.gif) | snapdragon.mp3 | 21-Apr-2007 12:29 | 10K | |
![[SND]](/icons/sound2.gif) | snapback.mp3 | 21-Apr-2007 12:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | snapaway.mp3 | 21-Apr-2007 12:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | snap.mp3 | 21-Apr-2007 12:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | snap-on.mp3 | 21-Apr-2007 12:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | snap-brim.mp3 | 21-Apr-2007 12:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | snaky.mp3 | 21-Apr-2007 12:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | snakily.mp3 | 21-Apr-2007 12:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | snakey.mp3 | 21-Apr-2007 12:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | snakeweed.mp3 | 21-Apr-2007 12:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | snakeskin.mp3 | 21-Apr-2007 12:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | snakeroot.mp3 | 21-Apr-2007 12:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | snakeriver.mp3 | 21-Apr-2007 12:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | snakelike.mp3 | 21-Apr-2007 12:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | snakelet.mp3 | 21-Apr-2007 12:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | snakeblenny.mp3 | 21-Apr-2007 12:29 | 17K | |
![[SND]](/icons/sound2.gif) | snakebitten.mp3 | 21-Apr-2007 12:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | snakebite.mp3 | 21-Apr-2007 12:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | snakebit.mp3 | 21-Apr-2007 12:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | snakebird.mp3 | 21-Apr-2007 12:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | snake.mp3 | 21-Apr-2007 12:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | snaillike.mp3 | 21-Apr-2007 12:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | snailery.mp3 | 21-Apr-2007 12:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | snail.mp3 | 21-Apr-2007 12:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | snail-paced.mp3 | 21-Apr-2007 12:28 | 11K | |
![[SND]](/icons/sound2.gif) | snaggy.mp3 | 21-Apr-2007 12:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | snaggletoothed.mp3 | 21-Apr-2007 12:28 | 10K | |
![[SND]](/icons/sound2.gif) | snaggletooth.mp3 | 21-Apr-2007 12:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | snagglepuss.mp3 | 21-Apr-2007 12:28 | 17K | |
![[SND]](/icons/sound2.gif) | snagger.mp3 | 21-Apr-2007 12:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | snagged.mp3 | 21-Apr-2007 12:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | snag.mp3 | 21-Apr-2007 12:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | snafu.mp3 | 21-Apr-2007 12:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | snaffling.mp3 | 21-Apr-2007 12:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | snaffle.mp3 | 21-Apr-2007 12:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | snackette.mp3 | 21-Apr-2007 12:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | snack.mp3 | 21-Apr-2007 12:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | smythsewing.mp3 | 21-Apr-2007 12:28 | 17K | |
![[SND]](/icons/sound2.gif) | smutty.mp3 | 21-Apr-2007 12:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | smuttiness.mp3 | 21-Apr-2007 12:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | smuttily.mp3 | 21-Apr-2007 12:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | smuttery.mp3 | 21-Apr-2007 12:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | smuthound.mp3 | 21-Apr-2007 12:27 | 17K | |
![[SND]](/icons/sound2.gif) | smutchy.mp3 | 21-Apr-2007 12:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | smutch.mp3 | 21-Apr-2007 12:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | smut.mp3 | 21-Apr-2007 12:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | smush.mp3 | 21-Apr-2007 12:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | smurfed.mp3 | 21-Apr-2007 12:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | smurf.mp3 | 21-Apr-2007 12:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | smur.mp3 | 21-Apr-2007 12:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | smuggling.mp3 | 21-Apr-2007 12:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | smuggler.mp3 | 21-Apr-2007 12:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | smuggle.mp3 | 21-Apr-2007 12:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | smug.mp3 | 21-Apr-2007 12:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | smudgy.mp3 | 21-Apr-2007 12:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | smudginess.mp3 | 21-Apr-2007 12:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | smudgily.mp3 | 21-Apr-2007 12:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | smudger.mp3 | 21-Apr-2007 12:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | smudge.mp3 | 21-Apr-2007 12:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | smriti.mp3 | 21-Apr-2007 12:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | smout.mp3 | 21-Apr-2007 12:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | smouse.mp3 | 21-Apr-2007 12:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | smouldering.mp3 | 21-Apr-2007 12:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | smoulder.mp3 | 21-Apr-2007 12:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | smouge.mp3 | 21-Apr-2007 12:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | smoudge.mp3 | 21-Apr-2007 12:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | smothery.mp3 | 21-Apr-2007 12:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | smothering.mp3 | 21-Apr-2007 12:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | smother.mp3 | 21-Apr-2007 12:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | smote.mp3 | 21-Apr-2007 12:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | smorzando.mp3 | 21-Apr-2007 12:26 | 17K | |
![[SND]](/icons/sound2.gif) | smorrebrod.mp3 | 21-Apr-2007 12:26 | 17K | |
![[SND]](/icons/sound2.gif) | smorgasbord.mp3 | 21-Apr-2007 12:26 | 10K | |
![[SND]](/icons/sound2.gif) | smop.mp3 | 21-Apr-2007 12:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | smoothy.mp3 | 21-Apr-2007 12:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | smoothie.mp3 | 21-Apr-2007 12:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | smoothening.mp3 | 21-Apr-2007 12:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | smoothen.mp3 | 21-Apr-2007 12:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | smoothbrome.mp3 | 21-Apr-2007 12:26 | 17K | |
![[SND]](/icons/sound2.gif) | smoothbore.mp3 | 21-Apr-2007 12:26 | 11K | |
![[SND]](/icons/sound2.gif) | smooth.mp3 | 21-Apr-2007 12:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | smooth-tongued.mp3 | 21-Apr-2007 12:26 | 11K | |
![[SND]](/icons/sound2.gif) | smoodge.mp3 | 21-Apr-2007 12:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | smoochy.mp3 | 21-Apr-2007 12:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | smooch.mp3 | 21-Apr-2007 12:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | smon.mp3 | 21-Apr-2007 12:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | smolt.mp3 | 21-Apr-2007 12:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | smolder.mp3 | 21-Apr-2007 12:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | smokyhill.mp3 | 21-Apr-2007 12:25 | 17K | |
![[SND]](/icons/sound2.gif) | smoky.mp3 | 21-Apr-2007 12:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | smoko.mp3 | 21-Apr-2007 12:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | smoking.mp3 | 21-Apr-2007 12:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | smokiness.mp3 | 21-Apr-2007 12:25 | 9.6K | |
![[SND]](/icons/sound2.gif) | smokily.mp3 | 21-Apr-2007 12:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | smokey.mp3 | 21-Apr-2007 12:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | smokestack.mp3 | 21-Apr-2007 12:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | smoker.mp3 | 21-Apr-2007 12:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | smokeo.mp3 | 21-Apr-2007 12:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | smokenders.mp3 | 21-Apr-2007 12:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | smokelike.mp3 | 21-Apr-2007 12:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | smokeless.mp3 | 21-Apr-2007 12:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | smokejack.mp3 | 21-Apr-2007 12:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | smokehouse.mp3 | 21-Apr-2007 12:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | smokefilledroom.mp3 | 21-Apr-2007 12:25 | 17K | |
![[SND]](/icons/sound2.gif) | smokeable.mp3 | 21-Apr-2007 12:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | smoke.mp3 | 21-Apr-2007 12:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | smoke-filled room.mp3 | 21-Apr-2007 12:25 | 15K | |
![[SND]](/icons/sound2.gif) | smokable.mp3 | 21-Apr-2007 12:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | smogless.mp3 | 21-Apr-2007 12:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | smoggy.mp3 | 21-Apr-2007 12:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | smog.mp3 | 21-Apr-2007 12:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | smocking.mp3 | 21-Apr-2007 12:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | smock.mp3 | 21-Apr-2007 12:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | smizz.mp3 | 21-Apr-2007 12:24 | 17K | |
![[SND]](/icons/sound2.gif) | smitty.mp3 | 21-Apr-2007 12:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | smittle.mp3 | 21-Apr-2007 12:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | smitten.mp3 | 21-Apr-2007 12:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | smiting.mp3 | 21-Apr-2007 12:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | smithy.mp3 | 21-Apr-2007 12:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | smithsonite.mp3 | 21-Apr-2007 12:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | smithsonianinstitution.mp3 | 21-Apr-2007 12:24 | 27K | |
![[SND]](/icons/sound2.gif) | smiths.mp3 | 21-Apr-2007 12:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | smithing.mp3 | 21-Apr-2007 12:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | smithfieldham.mp3 | 21-Apr-2007 12:24 | 17K | |
![[SND]](/icons/sound2.gif) | smithery.mp3 | 21-Apr-2007 12:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | smithereens.mp3 | 21-Apr-2007 12:24 | 11K | |
![[SND]](/icons/sound2.gif) | smith.mp3 | 21-Apr-2007 12:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | smiter.mp3 | 21-Apr-2007 12:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | smite.mp3 | 21-Apr-2007 12:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | smitch.mp3 | 21-Apr-2007 12:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | smit.mp3 | 21-Apr-2007 12:23 | 17K | |
![[SND]](/icons/sound2.gif) | smirnoff.mp3 | 21-Apr-2007 12:23 | 17K | |
![[SND]](/icons/sound2.gif) | smirky.mp3 | 21-Apr-2007 12:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | smirk.mp3 | 21-Apr-2007 12:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | smirch.mp3 | 21-Apr-2007 12:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | smir.mp3 | 21-Apr-2007 12:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | smintheus.mp3 | 21-Apr-2007 12:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | smilodon.mp3 | 21-Apr-2007 12:23 | 17K | |
![[SND]](/icons/sound2.gif) | smilingly.mp3 | 21-Apr-2007 12:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | smiling.mp3 | 21-Apr-2007 12:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | smiley.mp3 | 21-Apr-2007 12:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | smileless.mp3 | 21-Apr-2007 12:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | smile.mp3 | 21-Apr-2007 12:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | smilax.mp3 | 21-Apr-2007 12:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | smilacaceous.mp3 | 21-Apr-2007 12:23 | 17K | |
![[SND]](/icons/sound2.gif) | smiercase.mp3 | 21-Apr-2007 12:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | smidgeon.mp3 | 21-Apr-2007 12:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | smidgen.mp3 | 21-Apr-2007 12:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | smidge.mp3 | 21-Apr-2007 12:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | smice.mp3 | 21-Apr-2007 12:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | smew.mp3 | 21-Apr-2007 12:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | smersh.mp3 | 21-Apr-2007 12:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | smeltery.mp3 | 21-Apr-2007 12:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | smelter.mp3 | 21-Apr-2007 12:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | smelt.mp3 | 21-Apr-2007 12:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | smelly.mp3 | 21-Apr-2007 12:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | smellism.mp3 | 21-Apr-2007 12:22 | 17K | |
![[SND]](/icons/sound2.gif) | smelling.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smellie.mp3 | 21-Apr-2007 12:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | smeller.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smelled.mp3 | 21-Apr-2007 12:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | smell.mp3 | 21-Apr-2007 12:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | smegma.mp3 | 21-Apr-2007 12:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | smeg.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smeek.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smeech.mp3 | 21-Apr-2007 12:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | smedley.mp3 | 21-Apr-2007 12:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | smeddum.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smectitic.mp3 | 21-Apr-2007 12:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | smectite.mp3 | 21-Apr-2007 12:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | smectic.mp3 | 21-Apr-2007 12:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | smecker.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smeck.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smeaton.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smeary.mp3 | 21-Apr-2007 12:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | smeared.mp3 | 21-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | smearcase.mp3 | 21-Apr-2007 12:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | smear.mp3 | 21-Apr-2007 12:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | smeaker.mp3 | 21-Apr-2007 12:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | smaze.mp3 | 21-Apr-2007 12:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | smattering.mp3 | 21-Apr-2007 12:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | smatterer.mp3 | 21-Apr-2007 12:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | smatter.mp3 | 21-Apr-2007 12:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | smatch.mp3 | 21-Apr-2007 12:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | smashup.mp3 | 21-Apr-2007 12:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | smashmouth.mp3 | 21-Apr-2007 12:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | smashingly.mp3 | 21-Apr-2007 12:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | smashing.mp3 | 21-Apr-2007 12:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | smasheroo.mp3 | 21-Apr-2007 12:21 | 17K | |
![[SND]](/icons/sound2.gif) | smasher.mp3 | 21-Apr-2007 12:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | smashed.mp3 | 21-Apr-2007 12:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | smash.mp3 | 21-Apr-2007 12:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | smarty.mp3 | 21-Apr-2007 12:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | smarty-pants.mp3 | 21-Apr-2007 12:21 | 11K | |
![[SND]](/icons/sound2.gif) | smartweed.mp3 | 21-Apr-2007 12:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | smartness.mp3 | 21-Apr-2007 12:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | smart money.mp3 | 21-Apr-2007 12:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | smartly.mp3 | 21-Apr-2007 12:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | smartish.mp3 | 21-Apr-2007 12:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | smartie.mp3 | 21-Apr-2007 12:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | smartening.mp3 | 21-Apr-2007 12:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | smarten.mp3 | 21-Apr-2007 12:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | smartaleck.mp3 | 21-Apr-2007 12:20 | 17K | |
![[SND]](/icons/sound2.gif) | smart aleck.mp3 | 21-Apr-2007 12:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | smartalec.mp3 | 21-Apr-2007 12:20 | 17K | |
![[SND]](/icons/sound2.gif) | smart alec.mp3 | 21-Apr-2007 12:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | smart.mp3 | 21-Apr-2007 12:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | smart-mouthed.mp3 | 21-Apr-2007 12:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | smart-assed.mp3 | 21-Apr-2007 12:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | smart-ass.mp3 | 21-Apr-2007 12:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | smart-alecky.mp3 | 21-Apr-2007 12:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | smarmy.mp3 | 21-Apr-2007 12:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | smarminess.mp3 | 21-Apr-2007 12:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | smarmily.mp3 | 21-Apr-2007 12:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | smarm.mp3 | 21-Apr-2007 12:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | smaragdite.mp3 | 21-Apr-2007 12:20 | 17K | |
![[SND]](/icons/sound2.gif) | smaragdine.mp3 | 21-Apr-2007 12:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | smaragd.mp3 | 21-Apr-2007 12:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | smalto.mp3 | 21-Apr-2007 12:20 | 10K | |
![[SND]](/icons/sound2.gif) | smaltite.mp3 | 21-Apr-2007 12:20 | 17K | |
![[SND]](/icons/sound2.gif) | smalti.mp3 | 21-Apr-2007 12:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | smalt.mp3 | 21-Apr-2007 12:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | smalm.mp3 | 21-Apr-2007 12:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | smallsword.mp3 | 21-Apr-2007 12:19 | 10K | |
![[SND]](/icons/sound2.gif) | smalls.mp3 | 21-Apr-2007 12:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | smallpox.mp3 | 21-Apr-2007 12:19 | 10K | |
![[SND]](/icons/sound2.gif) | smallness.mp3 | 21-Apr-2007 12:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | smallmouthbass.mp3 | 21-Apr-2007 12:19 | 17K | |
![[SND]](/icons/sound2.gif) | smallmouth bass.mp3 | 21-Apr-2007 12:19 | 14K | |
![[SND]](/icons/sound2.gif) | smallish.mp3 | 21-Apr-2007 12:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | smallholding.mp3 | 21-Apr-2007 12:19 | 11K | |
![[SND]](/icons/sound2.gif) | smallholder.mp3 | 21-Apr-2007 12:19 | 10K | |
![[SND]](/icons/sound2.gif) | smallclothes.mp3 | 21-Apr-2007 12:19 | 11K | |
![[SND]](/icons/sound2.gif) | smallage.mp3 | 21-Apr-2007 12:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | small.mp3 | 21-Apr-2007 12:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | small-timer.mp3 | 21-Apr-2007 12:20 | 11K | |
![[SND]](/icons/sound2.gif) | small-time.mp3 | 21-Apr-2007 12:20 | 11K | |
![[SND]](/icons/sound2.gif) | small-scale.mp3 | 21-Apr-2007 12:19 | 10K | |
![[SND]](/icons/sound2.gif) | small-minded.mp3 | 21-Apr-2007 12:19 | 11K | |
![[SND]](/icons/sound2.gif) | small-fry.mp3 | 21-Apr-2007 12:19 | 9.6K | |
![[SND]](/icons/sound2.gif) | smak.mp3 | 21-Apr-2007 12:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | smadge.mp3 | 21-Apr-2007 12:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | smacky.mp3 | 21-Apr-2007 12:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | smacko.mp3 | 21-Apr-2007 12:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | smacking.mp3 | 21-Apr-2007 12:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | smackeroo.mp3 | 21-Apr-2007 12:19 | 17K | |
![[SND]](/icons/sound2.gif) | smacker.mp3 | 21-Apr-2007 12:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | smack.mp3 | 21-Apr-2007 12:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | smack-dab.mp3 | 21-Apr-2007 12:18 | 11K | |
![[SND]](/icons/sound2.gif) | slype.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slyly.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slyest.mp3 | 21-Apr-2007 12:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | slyer.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slyboots.mp3 | 21-Apr-2007 12:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | sly.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slutty.mp3 | 21-Apr-2007 12:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | sluttish.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | sluter.mp3 | 21-Apr-2007 12:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | slutch.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slut.mp3 | 21-Apr-2007 12:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | slushy.mp3 | 21-Apr-2007 12:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | slushed.mp3 | 21-Apr-2007 12:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | slush.mp3 | 21-Apr-2007 12:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | slurvian.mp3 | 21-Apr-2007 12:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | slurry.mp3 | 21-Apr-2007 12:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | slurpy.mp3 | 21-Apr-2007 12:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | slurpee.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slurp.mp3 | 21-Apr-2007 12:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | slurb.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slur.mp3 | 21-Apr-2007 12:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | slup.mp3 | 21-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | slunk.mp3 | 21-Apr-2007 12:17 | 6.6K | |
![[SND]](/icons/sound2.gif) | slungshot.mp3 | 21-Apr-2007 12:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | slung.mp3 | 21-Apr-2007 12:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | slumpflation.mp3 | 21-Apr-2007 12:17 | 10K | |
![[SND]](/icons/sound2.gif) | slump.mp3 | 21-Apr-2007 12:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | slummy.mp3 | 21-Apr-2007 12:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | slummer.mp3 | 21-Apr-2007 12:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | slumlord.mp3 | 21-Apr-2007 12:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | slumism.mp3 | 21-Apr-2007 12:17 | 17K | |
![[SND]](/icons/sound2.gif) | slumgullion.mp3 | 21-Apr-2007 12:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | slumgudgeon.mp3 | 21-Apr-2007 12:17 | 17K | |
![[SND]](/icons/sound2.gif) | slumbrous.mp3 | 21-Apr-2007 12:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | slumbery.mp3 | 21-Apr-2007 12:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | slumberous.mp3 | 21-Apr-2007 12:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | slumbering.mp3 | 21-Apr-2007 12:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | slumberer.mp3 | 21-Apr-2007 12:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | slumber.mp3 | 21-Apr-2007 12:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | slum.mp3 | 21-Apr-2007 12:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | sluit.mp3 | 21-Apr-2007 12:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | sluicy.mp3 | 21-Apr-2007 12:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | sluiceway.mp3 | 21-Apr-2007 12:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | sluice.mp3 | 21-Apr-2007 12:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | sluggish.mp3 | 21-Apr-2007 12:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | slugger.mp3 | 21-Apr-2007 12:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | slugged.mp3 | 21-Apr-2007 12:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | sluggardly.mp3 | 21-Apr-2007 12:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | sluggard.mp3 | 21-Apr-2007 12:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | slugfest.mp3 | 21-Apr-2007 12:16 | 10K | |
![[SND]](/icons/sound2.gif) | slugabed.mp3 | 21-Apr-2007 12:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | slug.mp3 | 21-Apr-2007 12:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | sluff.mp3 | 21-Apr-2007 12:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | slued.mp3 | 21-Apr-2007 12:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | slue.mp3 | 21-Apr-2007 12:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | sludgy.mp3 | 21-Apr-2007 12:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | sludging.mp3 | 21-Apr-2007 12:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | sludge.mp3 | 21-Apr-2007 12:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | slubbing.mp3 | 21-Apr-2007 12:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | slubbering.mp3 | 21-Apr-2007 12:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | slubberdegullion.mp3 | 21-Apr-2007 12:16 | 17K | |
![[SND]](/icons/sound2.gif) | slubber.mp3 | 21-Apr-2007 12:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | slub.mp3 | 21-Apr-2007 12:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | slsk.mp3 | 21-Apr-2007 12:16 | 17K | |
![[SND]](/icons/sound2.gif) | sloyd.mp3 | 21-Apr-2007 12:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | slowworm.mp3 | 21-Apr-2007 12:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | slowth.mp3 | 21-Apr-2007 12:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | slowpoke.mp3 | 21-Apr-2007 12:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | slowmo.mp3 | 21-Apr-2007 12:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | slowly.mp3 | 21-Apr-2007 12:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | slowish.mp3 | 21-Apr-2007 12:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | slowdown.mp3 | 21-Apr-2007 12:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | slow.mp3 | 21-Apr-2007 12:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | slow-witted.mp3 | 21-Apr-2007 12:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | slow-twitch.mp3 | 21-Apr-2007 12:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | slow-pitch.mp3 | 21-Apr-2007 12:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | slow-motion.mp3 | 21-Apr-2007 12:15 | 11K | |
![[SND]](/icons/sound2.gif) | slow-footed.mp3 | 21-Apr-2007 12:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | slovenly.mp3 | 21-Apr-2007 12:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | sloven.mp3 | 21-Apr-2007 12:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | sloughy.mp3 | 21-Apr-2007 12:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | slough of despond.mp3 | 21-Apr-2007 12:15 | 13K | |
![[SND]](/icons/sound2.gif) | sloughfoot.mp3 | 21-Apr-2007 12:15 | 17K | |
![[SND]](/icons/sound2.gif) | sloughed.mp3 | 21-Apr-2007 12:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | slough.mp3 | 21-Apr-2007 12:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | slouchy.mp3 | 21-Apr-2007 12:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | slouchiness.mp3 | 21-Apr-2007 12:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | slouchily.mp3 | 21-Apr-2007 12:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | slouch.mp3 | 21-Apr-2007 12:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | slotter.mp3 | 21-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | sloths.mp3 | 21-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | slothfully.mp3 | 21-Apr-2007 12:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | slothful.mp3 | 21-Apr-2007 12:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | sloth.mp3 | 21-Apr-2007 12:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | slote.mp3 | 21-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | slotback.mp3 | 21-Apr-2007 12:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | slot.mp3 | 21-Apr-2007 12:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | sloshy.mp3 | 21-Apr-2007 12:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | sloshed.mp3 | 21-Apr-2007 12:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | slosh.mp3 | 21-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | slopy.mp3 | 21-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | slopwork.mp3 | 21-Apr-2007 12:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | sloppy joe.mp3 | 21-Apr-2007 12:14 | 11K | |
![[SND]](/icons/sound2.gif) | sloppy.mp3 | 21-Apr-2007 12:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | sloppily.mp3 | 21-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | slopped.mp3 | 21-Apr-2007 12:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | slopitch.mp3 | 21-Apr-2007 12:14 | 17K | |
![[SND]](/icons/sound2.gif) | slopey.mp3 | 21-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sloper.mp3 | 21-Apr-2007 12:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | slope.mp3 | 21-Apr-2007 12:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | slop.mp3 | 21-Apr-2007 12:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | sloot.mp3 | 21-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sloosh.mp3 | 21-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sloop.mp3 | 21-Apr-2007 12:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | slonchways.mp3 | 21-Apr-2007 12:13 | 17K | |
![[SND]](/icons/sound2.gif) | slomo.mp3 | 21-Apr-2007 12:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | sloke.mp3 | 21-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sloid.mp3 | 21-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | slogger.mp3 | 21-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sloganize.mp3 | 21-Apr-2007 12:13 | 10K | |
![[SND]](/icons/sound2.gif) | sloganeering.mp3 | 21-Apr-2007 12:13 | 17K | |
![[SND]](/icons/sound2.gif) | sloganeer.mp3 | 21-Apr-2007 12:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | slogan.mp3 | 21-Apr-2007 12:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | slog.mp3 | 21-Apr-2007 12:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | sloe.mp3 | 21-Apr-2007 12:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | sloe-eyed.mp3 | 21-Apr-2007 12:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | slobby.mp3 | 21-Apr-2007 12:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | slobbish.mp3 | 21-Apr-2007 12:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | slobbery.mp3 | 21-Apr-2007 12:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | slobbering.mp3 | 21-Apr-2007 12:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | slobberer.mp3 | 21-Apr-2007 12:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | slobberchops.mp3 | 21-Apr-2007 12:12 | 17K | |
![[SND]](/icons/sound2.gif) | slobber.mp3 | 21-Apr-2007 12:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | slob.mp3 | 21-Apr-2007 12:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | sloat.mp3 | 21-Apr-2007 12:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | sloanie.mp3 | 21-Apr-2007 12:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | sloaneranger.mp3 | 21-Apr-2007 12:12 | 17K | |
![[SND]](/icons/sound2.gif) | sloaneish.mp3 | 21-Apr-2007 12:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | sloane.mp3 | 21-Apr-2007 12:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | slo-pitch.mp3 | 21-Apr-2007 12:14 | 11K | |
![[SND]](/icons/sound2.gif) | slo-mo.mp3 | 21-Apr-2007 12:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | slivovitz.mp3 | 21-Apr-2007 12:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | slivering.mp3 | 21-Apr-2007 12:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | sliver.mp3 | 21-Apr-2007 12:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | slitty.mp3 | 21-Apr-2007 12:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | slitter.mp3 | 21-Apr-2007 12:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | slitless.mp3 | 21-Apr-2007 12:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | slithery.mp3 | 21-Apr-2007 12:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | slither.mp3 | 21-Apr-2007 12:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | slit.mp3 | 21-Apr-2007 12:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | slipway.mp3 | 21-Apr-2007 12:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | slipware.mp3 | 21-Apr-2007 12:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | slipup.mp3 | 21-Apr-2007 12:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | slipt.mp3 | 21-Apr-2007 12:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | slipstream.mp3 | 21-Apr-2007 12:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | slipsole.mp3 | 21-Apr-2007 12:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | slipslop.mp3 | 21-Apr-2007 12:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | slipshod.mp3 | 21-Apr-2007 12:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | slippy.mp3 | 21-Apr-2007 12:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | slippery.mp3 | 21-Apr-2007 12:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | slipperwort.mp3 | 21-Apr-2007 12:11 | 17K | |
![[SND]](/icons/sound2.gif) | slipperslopper.mp3 | 21-Apr-2007 12:11 | 17K | |
![[SND]](/icons/sound2.gif) | slipperette.mp3 | 21-Apr-2007 12:11 | 17K | |
![[SND]](/icons/sound2.gif) | slippered.mp3 | 21-Apr-2007 12:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | slipper.mp3 | 21-Apr-2007 12:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | slipped.mp3 | 21-Apr-2007 12:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | slippage.mp3 | 21-Apr-2007 12:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | slipover.mp3 | 21-Apr-2007 12:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | slipknot.mp3 | 21-Apr-2007 12:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | slipform.mp3 | 21-Apr-2007 12:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | slipe.mp3 | 21-Apr-2007 12:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | slipcover.mp3 | 21-Apr-2007 12:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | slipcased.mp3 | 21-Apr-2007 12:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | slipcase.mp3 | 21-Apr-2007 12:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | slip.mp3 | 21-Apr-2007 12:10 | 5.9K | |
![[SND]](/icons/sound2.gif) | slip-sheet.mp3 | 21-Apr-2007 12:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | slip-on.mp3 | 21-Apr-2007 12:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | slinter.mp3 | 21-Apr-2007 12:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | slinky.mp3 | 21-Apr-2007 12:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | slinkiness.mp3 | 21-Apr-2007 12:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | slinkily.mp3 | 21-Apr-2007 12:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | slinked.mp3 | 21-Apr-2007 12:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | slink.mp3 | 21-Apr-2007 12:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | slingshot.mp3 | 21-Apr-2007 12:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | slinging.mp3 | 21-Apr-2007 12:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | slinger.mp3 | 21-Apr-2007 12:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | sling.mp3 | 21-Apr-2007 12:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | slimy.mp3 | 21-Apr-2007 12:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | slimsy.mp3 | 21-Apr-2007 12:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | slimpsy.mp3 | 21-Apr-2007 12:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | slimnastics.mp3 | 21-Apr-2007 12:10 | 11K | |
![[SND]](/icons/sound2.gif) | slimmish.mp3 | 21-Apr-2007 12:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | slimming.mp3 | 21-Apr-2007 12:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | slimmer.mp3 | 21-Apr-2007 12:10 | 6.8K | |
![[SND]](/icons/sound2.gif) | slimjim.mp3 | 21-Apr-2007 12:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | sliminess.mp3 | 21-Apr-2007 12:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | slimily.mp3 | 21-Apr-2007 12:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | slimicide.mp3 | 21-Apr-2007 12:10 | 17K | |
![[SND]](/icons/sound2.gif) | slimeball.mp3 | 21-Apr-2007 12:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | slime.mp3 | 21-Apr-2007 12:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | slim.mp3 | 21-Apr-2007 12:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | slim-jim.mp3 | 21-Apr-2007 12:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | slily.mp3 | 21-Apr-2007 12:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | slightly.mp3 | 21-Apr-2007 12:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | slightingly.mp3 | 21-Apr-2007 12:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | slighting.mp3 | 21-Apr-2007 12:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | slight.mp3 | 21-Apr-2007 12:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | sliest.mp3 | 21-Apr-2007 12:09 | 17K | |
![[SND]](/icons/sound2.gif) | slier.mp3 | 21-Apr-2007 12:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | sliding.mp3 | 21-Apr-2007 12:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | slideway.mp3 | 21-Apr-2007 12:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | slider.mp3 | 21-Apr-2007 12:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | slidemountain.mp3 | 21-Apr-2007 12:09 | 17K | |
![[SND]](/icons/sound2.gif) | slide.mp3 | 21-Apr-2007 12:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | slidden.mp3 | 21-Apr-2007 12:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | slid.mp3 | 21-Apr-2007 12:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | slickum.mp3 | 21-Apr-2007 12:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | slickster.mp3 | 21-Apr-2007 12:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | slickrock.mp3 | 21-Apr-2007 12:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | slicker.mp3 | 21-Apr-2007 12:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | slickenside.mp3 | 21-Apr-2007 12:09 | 10K | |
![[SND]](/icons/sound2.gif) | slickens.mp3 | 21-Apr-2007 12:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | slick.mp3 | 21-Apr-2007 12:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | slick-ear.mp3 | 21-Apr-2007 12:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | slicer.mp3 | 21-Apr-2007 12:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | sliceable.mp3 | 21-Apr-2007 12:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | slice.mp3 | 21-Apr-2007 12:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | slezsko.mp3 | 21-Apr-2007 12:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | sley.mp3 | 21-Apr-2007 12:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | slewed.mp3 | 21-Apr-2007 12:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | slew.mp3 | 21-Apr-2007 12:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | sleuthhound.mp3 | 21-Apr-2007 12:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | sleuth.mp3 | 21-Apr-2007 12:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | sleswick.mp3 | 21-Apr-2007 12:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | slept.mp3 | 21-Apr-2007 12:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | slenter.mp3 | 21-Apr-2007 12:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | slendernessratio.mp3 | 21-Apr-2007 12:08 | 17K | |
![[SND]](/icons/sound2.gif) | slenderize.mp3 | 21-Apr-2007 12:08 | 11K | |
![[SND]](/icons/sound2.gif) | slender.mp3 | 21-Apr-2007 12:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | sleipnir.mp3 | 21-Apr-2007 12:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | sleight.mp3 | 21-Apr-2007 12:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | sleighing.mp3 | 21-Apr-2007 12:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleigh.mp3 | 21-Apr-2007 12:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | sleezy.mp3 | 21-Apr-2007 12:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleez.mp3 | 21-Apr-2007 12:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | sleeving.mp3 | 21-Apr-2007 12:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sleevelet.mp3 | 21-Apr-2007 12:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | sleeveless.mp3 | 21-Apr-2007 12:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | sleeveen.mp3 | 21-Apr-2007 12:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sleeved.mp3 | 21-Apr-2007 12:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | sleeve.mp3 | 21-Apr-2007 12:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sleety.mp3 | 21-Apr-2007 12:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | sleet.mp3 | 21-Apr-2007 12:07 | 6.1K | |
![[SND]](/icons/sound2.gif) | sleestack.mp3 | 21-Apr-2007 12:07 | 17K | |
![[SND]](/icons/sound2.gif) | sleepyhead.mp3 | 21-Apr-2007 12:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | sleepy.mp3 | 21-Apr-2007 12:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | sleepwear.mp3 | 21-Apr-2007 12:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | sleepwalker.mp3 | 21-Apr-2007 12:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | sleepwalk.mp3 | 21-Apr-2007 12:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleepover.mp3 | 21-Apr-2007 12:07 | 10K | |
![[SND]](/icons/sound2.gif) | sleeplike.mp3 | 21-Apr-2007 12:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | sleepless.mp3 | 21-Apr-2007 12:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleeping.mp3 | 21-Apr-2007 12:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | sleepiness.mp3 | 21-Apr-2007 12:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | sleepily.mp3 | 21-Apr-2007 12:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sleepeze.mp3 | 21-Apr-2007 12:07 | 17K | |
![[SND]](/icons/sound2.gif) | sleeperette.mp3 | 21-Apr-2007 12:06 | 17K | |
![[SND]](/icons/sound2.gif) | sleeper.mp3 | 21-Apr-2007 12:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | sleepeezee.mp3 | 21-Apr-2007 12:06 | 17K | |
![[SND]](/icons/sound2.gif) | sleepaway.mp3 | 21-Apr-2007 12:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | sleep.mp3 | 21-Apr-2007 12:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | sleep-in.mp3 | 21-Apr-2007 12:07 | 10K | |
![[SND]](/icons/sound2.gif) | sleeky.mp3 | 21-Apr-2007 12:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | sleekit.mp3 | 21-Apr-2007 12:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | sleekening.mp3 | 21-Apr-2007 12:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleeken.mp3 | 21-Apr-2007 12:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | sleek.mp3 | 21-Apr-2007 12:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | sledgehammer.mp3 | 21-Apr-2007 12:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | sledge.mp3 | 21-Apr-2007 12:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | sledding.mp3 | 21-Apr-2007 12:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sledder.mp3 | 21-Apr-2007 12:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sled.mp3 | 21-Apr-2007 12:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | sleazy.mp3 | 21-Apr-2007 12:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleazoid.mp3 | 21-Apr-2007 12:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleazo.mp3 | 21-Apr-2007 12:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | sleaziness.mp3 | 21-Apr-2007 12:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | sleazily.mp3 | 21-Apr-2007 12:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | sleazeball.mp3 | 21-Apr-2007 12:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | sleazebag.mp3 | 21-Apr-2007 12:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | sleaze.mp3 | 21-Apr-2007 12:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sleave.mp3 | 21-Apr-2007 12:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | slazenger.mp3 | 21-Apr-2007 12:05 | 17K | |
![[SND]](/icons/sound2.gif) | slayton.mp3 | 21-Apr-2007 12:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | slay.mp3 | 21-Apr-2007 12:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | slaw.mp3 | 21-Apr-2007 12:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | slavyansk.mp3 | 21-Apr-2007 12:05 | 17K | |
![[SND]](/icons/sound2.gif) | slavophobe.mp3 | 21-Apr-2007 12:05 | 17K | |
![[SND]](/icons/sound2.gif) | slavocracy.mp3 | 21-Apr-2007 12:05 | 11K | |
![[SND]](/icons/sound2.gif) | slavo.mp3 | 21-Apr-2007 12:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | slavism.mp3 | 21-Apr-2007 12:05 | 17K | |
![[SND]](/icons/sound2.gif) | slavish.mp3 | 21-Apr-2007 12:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | slavicism.mp3 | 21-Apr-2007 12:05 | 17K | |
![[SND]](/icons/sound2.gif) | slavey.mp3 | 21-Apr-2007 12:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | slavery.mp3 | 21-Apr-2007 12:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | slavering.mp3 | 21-Apr-2007 12:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | slaver.mp3 | 21-Apr-2007 12:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | slavenska.mp3 | 21-Apr-2007 12:04 | 17K | |
![[SND]](/icons/sound2.gif) | slaveling.mp3 | 21-Apr-2007 12:04 | 17K | |
![[SND]](/icons/sound2.gif) | slaveholding.mp3 | 21-Apr-2007 12:04 | 10K | |
![[SND]](/icons/sound2.gif) | slaveholder.mp3 | 21-Apr-2007 12:04 | 10K | |
![[SND]](/icons/sound2.gif) | slave.mp3 | 21-Apr-2007 12:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | slave-making ant.mp3 | 21-Apr-2007 12:04 | 14K | |
![[SND]](/icons/sound2.gif) | slava.mp3 | 21-Apr-2007 12:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | slaughterous.mp3 | 21-Apr-2007 12:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | slaughterman.mp3 | 21-Apr-2007 12:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | slaughterhouse.mp3 | 21-Apr-2007 12:04 | 10K | |
![[SND]](/icons/sound2.gif) | slaughterer.mp3 | 21-Apr-2007 12:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | slaughtered.mp3 | 21-Apr-2007 12:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | slaughter.mp3 | 21-Apr-2007 12:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | slaty.mp3 | 21-Apr-2007 12:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | slatting.mp3 | 21-Apr-2007 12:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | slatternly.mp3 | 21-Apr-2007 12:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | slattern.mp3 | 21-Apr-2007 12:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | slatted.mp3 | 21-Apr-2007 12:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | slating.mp3 | 21-Apr-2007 12:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | slathering.mp3 | 21-Apr-2007 12:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | slather.mp3 | 21-Apr-2007 12:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | slatey.mp3 | 21-Apr-2007 12:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | slater.mp3 | 21-Apr-2007 12:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | slatelike.mp3 | 21-Apr-2007 12:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | slate.mp3 | 21-Apr-2007 12:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | slatch.mp3 | 21-Apr-2007 12:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | slat.mp3 | 21-Apr-2007 12:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | slashing.mp3 | 21-Apr-2007 12:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | slasher.mp3 | 21-Apr-2007 12:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | slashed.mp3 | 21-Apr-2007 12:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | slash.mp3 | 21-Apr-2007 12:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | slapsticky.mp3 | 21-Apr-2007 12:03 | 10K | |
![[SND]](/icons/sound2.gif) | slapstick.mp3 | 21-Apr-2007 12:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | slapper.mp3 | 21-Apr-2007 12:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | slapp.mp3 | 21-Apr-2007 12:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | slapjack.mp3 | 21-Apr-2007 12:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | slaphappy.mp3 | 21-Apr-2007 12:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | slapdash.mp3 | 21-Apr-2007 12:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | slap.mp3 | 21-Apr-2007 12:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | slap-up.mp3 | 21-Apr-2007 12:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | slanty.mp3 | 21-Apr-2007 12:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | slantwise.mp3 | 21-Apr-2007 12:03 | 11K | |
![[SND]](/icons/sound2.gif) | slantways.mp3 | 21-Apr-2007 12:03 | 10K | |
![[SND]](/icons/sound2.gif) | slantingly.mp3 | 21-Apr-2007 12:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | slantindicular.mp3 | 21-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | slanter.mp3 | 21-Apr-2007 12:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | slant.mp3 | 21-Apr-2007 12:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | slank.mp3 | 21-Apr-2007 12:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | slangy.mp3 | 21-Apr-2007 12:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | slanguage.mp3 | 21-Apr-2007 12:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | slangkop.mp3 | 21-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | slangingmatch.mp3 | 21-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | slanginess.mp3 | 21-Apr-2007 12:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | slangily.mp3 | 21-Apr-2007 12:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | slanger.mp3 | 21-Apr-2007 12:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | slang.mp3 | 21-Apr-2007 12:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | slanderous.mp3 | 21-Apr-2007 12:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | slandering.mp3 | 21-Apr-2007 12:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | slanderer.mp3 | 21-Apr-2007 12:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | slander.mp3 | 21-Apr-2007 12:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | slammer.mp3 | 21-Apr-2007 12:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | slammed.mp3 | 21-Apr-2007 12:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | slambamthankymam.mp3 | 21-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | slambam.mp3 | 21-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | slam.mp3 | 21-Apr-2007 12:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | slam-bang.mp3 | 21-Apr-2007 12:02 | 11K | |
![[SND]](/icons/sound2.gif) | slalom.mp3 | 21-Apr-2007 12:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | slaker.mp3 | 21-Apr-2007 12:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | slake.mp3 | 21-Apr-2007 12:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | slaister.mp3 | 21-Apr-2007 12:01 | 17K | |
![[SND]](/icons/sound2.gif) | slainte.mp3 | 21-Apr-2007 12:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | slain.mp3 | 21-Apr-2007 12:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | slaggy.mp3 | 21-Apr-2007 12:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | slag.mp3 | 21-Apr-2007 12:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | sladeschoolofart.mp3 | 21-Apr-2007 12:01 | 17K | |
![[SND]](/icons/sound2.gif) | slacks.mp3 | 21-Apr-2007 12:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | slacker.mp3 | 21-Apr-2007 12:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | slackening.mp3 | 21-Apr-2007 12:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | slacken.mp3 | 21-Apr-2007 12:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | slack.mp3 | 21-Apr-2007 12:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | slablike.mp3 | 21-Apr-2007 12:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | slabbery.mp3 | 21-Apr-2007 12:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | slabber.mp3 | 21-Apr-2007 12:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | slab.mp3 | 21-Apr-2007 12:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | slab-sided.mp3 | 21-Apr-2007 12:01 | 11K | |
![[SND]](/icons/sound2.gif) | skywrote.mp3 | 21-Apr-2007 12:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | skywritten.mp3 | 21-Apr-2007 12:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | skywriting.mp3 | 21-Apr-2007 12:01 | 10K | |
![[SND]](/icons/sound2.gif) | skywrite.mp3 | 21-Apr-2007 12:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | skyway.mp3 | 21-Apr-2007 12:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | skyward.mp3 | 21-Apr-2007 12:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | skywalk.mp3 | 21-Apr-2007 12:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | skyte.mp3 | 21-Apr-2007 12:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | skysurfing.mp3 | 21-Apr-2007 12:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | skysurfer.mp3 | 21-Apr-2007 12:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | skyscraping.mp3 | 21-Apr-2007 12:00 | 11K | |
![[SND]](/icons/sound2.gif) | skyscraper.mp3 | 21-Apr-2007 12:00 | 10K | |
![[SND]](/icons/sound2.gif) | skyscape.mp3 | 21-Apr-2007 12:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | skysail.mp3 | 21-Apr-2007 12:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | skyrocket.mp3 | 21-Apr-2007 12:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | skyphos.mp3 | 21-Apr-2007 12:00 | 17K | |
![[SND]](/icons/sound2.gif) | skyman.mp3 | 21-Apr-2007 12:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | skylit.mp3 | 21-Apr-2007 12:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | skyline.mp3 | 21-Apr-2007 12:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | skylighted.mp3 | 21-Apr-2007 12:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | skylight.mp3 | 21-Apr-2007 12:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | skyless.mp3 | 21-Apr-2007 12:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | skylark.mp3 | 21-Apr-2007 12:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | skylab.mp3 | 21-Apr-2007 12:00 | 17K | |
![[SND]](/icons/sound2.gif) | skyjacking.mp3 | 21-Apr-2007 12:00 | 11K | |
![[SND]](/icons/sound2.gif) | skyjacker.mp3 | 21-Apr-2007 12:00 | 10K | |
![[SND]](/icons/sound2.gif) | skyjack.mp3 | 21-Apr-2007 12:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | skyhook.mp3 | 21-Apr-2007 12:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | skygodlin.mp3 | 21-Apr-2007 11:59 | 17K | |
![[SND]](/icons/sound2.gif) | skyey.mp3 | 21-Apr-2007 11:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | skyer.mp3 | 21-Apr-2007 11:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | skydiving.mp3 | 21-Apr-2007 11:59 | 10K | |
![[SND]](/icons/sound2.gif) | skydive.mp3 | 21-Apr-2007 11:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | skycap.mp3 | 21-Apr-2007 11:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | skybox.mp3 | 21-Apr-2007 11:59 | 10K | |
![[SND]](/icons/sound2.gif) | skyborne.mp3 | 21-Apr-2007 11:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | sky.mp3 | 21-Apr-2007 11:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | sky-high.mp3 | 21-Apr-2007 12:00 | 11K | |
![[SND]](/icons/sound2.gif) | skutterudite.mp3 | 21-Apr-2007 11:59 | 17K | |
![[SND]](/icons/sound2.gif) | skutt.mp3 | 21-Apr-2007 11:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | skurfing.mp3 | 21-Apr-2007 11:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | skurf.mp3 | 21-Apr-2007 11:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | skunky.mp3 | 21-Apr-2007 11:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | skunkweed.mp3 | 21-Apr-2007 11:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | skunked.mp3 | 21-Apr-2007 11:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | skunkbrush.mp3 | 21-Apr-2007 11:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | skunk.mp3 | 21-Apr-2007 11:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | skuller.mp3 | 21-Apr-2007 11:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | skulled.mp3 | 21-Apr-2007 11:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | skullduggery.mp3 | 21-Apr-2007 11:59 | 10K | |
![[SND]](/icons/sound2.gif) | skullcap.mp3 | 21-Apr-2007 11:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | skull and crossbones.mp3 | 21-Apr-2007 11:58 | 15K | |
![[SND]](/icons/sound2.gif) | skull.mp3 | 21-Apr-2007 11:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | skulk.mp3 | 21-Apr-2007 11:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | skulduggery.mp3 | 21-Apr-2007 11:58 | 10K | |
![[SND]](/icons/sound2.gif) | skuld.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skuffle.mp3 | 21-Apr-2007 11:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | skua.mp3 | 21-Apr-2007 11:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | skrymir.mp3 | 21-Apr-2007 11:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | skrungy.mp3 | 21-Apr-2007 11:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | skronk.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skrik.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skreek.mp3 | 21-Apr-2007 11:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | skreegh.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skrag.mp3 | 21-Apr-2007 11:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | skouth.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skouras.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skotey.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skosh.mp3 | 21-Apr-2007 11:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | skort.mp3 | 21-Apr-2007 11:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | skoplje.mp3 | 21-Apr-2007 11:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | skookum.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | skoofer.mp3 | 21-Apr-2007 11:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | skolly.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skol.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skokiaan.mp3 | 21-Apr-2007 11:57 | 17K | |
![[SND]](/icons/sound2.gif) | skobelev.mp3 | 21-Apr-2007 11:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | skoal.mp3 | 21-Apr-2007 11:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | sklent.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skizzard.mp3 | 21-Apr-2007 11:57 | 17K | |
![[SND]](/icons/sound2.gif) | skiwear.mp3 | 21-Apr-2007 11:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | skivvy.mp3 | 21-Apr-2007 11:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | skiver.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skive.mp3 | 21-Apr-2007 11:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | skittle.mp3 | 21-Apr-2007 11:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | skittish.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skittery.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skitter.mp3 | 21-Apr-2007 11:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | skite.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skitch.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skit.mp3 | 21-Apr-2007 11:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | skirting.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skirter.mp3 | 21-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | skirted.mp3 | 21-Apr-2007 11:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | skirt.mp3 | 21-Apr-2007 11:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | skirret.mp3 | 21-Apr-2007 11:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | skirr.mp3 | 21-Apr-2007 11:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | skirnir.mp3 | 21-Apr-2007 11:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | skirmish.mp3 | 21-Apr-2007 11:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | skirl.mp3 | 21-Apr-2007 11:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | skipton.mp3 | 21-Apr-2007 11:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | skipread.mp3 | 21-Apr-2007 11:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | skippy.mp3 | 21-Apr-2007 11:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | skippingly.mp3 | 21-Apr-2007 11:56 | 17K | |
![[SND]](/icons/sound2.gif) | skipping.mp3 | 21-Apr-2007 11:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | skippie.mp3 | 21-Apr-2007 11:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | skippet.mp3 | 21-Apr-2007 11:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | skippering.mp3 | 21-Apr-2007 11:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | skipper.mp3 | 21-Apr-2007 11:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | skippable.mp3 | 21-Apr-2007 11:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | skipjack.mp3 | 21-Apr-2007 11:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | skip.mp3 | 21-Apr-2007 11:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | skioring.mp3 | 21-Apr-2007 11:56 | 17K | |
![[SND]](/icons/sound2.gif) | skintight.mp3 | 21-Apr-2007 11:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | skint.mp3 | 21-Apr-2007 11:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | skinny.mp3 | 21-Apr-2007 11:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | skinny-dipper.mp3 | 21-Apr-2007 11:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | skinny-dip.mp3 | 21-Apr-2007 11:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | skinnery.mp3 | 21-Apr-2007 11:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | skinner.mp3 | 21-Apr-2007 11:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | skinned.mp3 | 21-Apr-2007 11:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | skinmag.mp3 | 21-Apr-2007 11:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | skinless.mp3 | 21-Apr-2007 11:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | skinking.mp3 | 21-Apr-2007 11:55 | 17K | |
![[SND]](/icons/sound2.gif) | skinker.mp3 | 21-Apr-2007 11:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | skink.mp3 | 21-Apr-2007 11:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | skinhead.mp3 | 21-Apr-2007 11:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | skinful.mp3 | 21-Apr-2007 11:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | skinflint.mp3 | 21-Apr-2007 11:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | skin.mp3 | 21-Apr-2007 11:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | skin-popper.mp3 | 21-Apr-2007 11:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | skin-pop.mp3 | 21-Apr-2007 11:55 | 10K | |
![[SND]](/icons/sound2.gif) | skin-deep.mp3 | 21-Apr-2007 11:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | skimpy.mp3 | 21-Apr-2007 11:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | skimpole.mp3 | 21-Apr-2007 11:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | skimpiness.mp3 | 21-Apr-2007 11:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | skimpily.mp3 | 21-Apr-2007 11:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | skimp.mp3 | 21-Apr-2007 11:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | skimobile.mp3 | 21-Apr-2007 11:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | skimo.mp3 | 21-Apr-2007 11:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | skimming.mp3 | 21-Apr-2007 11:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | skimmia.mp3 | 21-Apr-2007 11:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | skimmerton.mp3 | 21-Apr-2007 11:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | skimmer.mp3 | 21-Apr-2007 11:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | skimish.mp3 | 21-Apr-2007 11:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | skimblescamble.mp3 | 21-Apr-2007 11:54 | 17K | |
![[SND]](/icons/sound2.gif) | skimble-skamble.mp3 | 21-Apr-2007 11:54 | 11K | |
![[SND]](/icons/sound2.gif) | skim.mp3 | 21-Apr-2007 11:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | skilsaw.mp3 | 21-Apr-2007 11:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | skilly.mp3 | 21-Apr-2007 11:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | skillless.mp3 | 21-Apr-2007 11:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | skillion.mp3 | 21-Apr-2007 11:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | skilling.mp3 | 21-Apr-2007 11:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | skillfully.mp3 | 21-Apr-2007 11:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | skillful.mp3 | 21-Apr-2007 11:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | skillet.mp3 | 21-Apr-2007 11:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | skilless.mp3 | 21-Apr-2007 11:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | skilled.mp3 | 21-Apr-2007 11:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | skillcentre.mp3 | 21-Apr-2007 11:54 | 17K | |
![[SND]](/icons/sound2.gif) | skill.mp3 | 21-Apr-2007 11:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | skilful.mp3 | 21-Apr-2007 11:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | skilfish.mp3 | 21-Apr-2007 11:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | skijoring.mp3 | 21-Apr-2007 11:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | skiing.mp3 | 21-Apr-2007 11:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | skiheil.mp3 | 21-Apr-2007 11:53 | 17K | |
![[SND]](/icons/sound2.gif) | skiffy.mp3 | 21-Apr-2007 11:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | skiffle.mp3 | 21-Apr-2007 11:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | skiff.mp3 | 21-Apr-2007 11:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | skiey.mp3 | 21-Apr-2007 11:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | skies.mp3 | 21-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | skier.mp3 | 21-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | skien.mp3 | 21-Apr-2007 11:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | skied.mp3 | 21-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | skiech.mp3 | 21-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | skidrow.mp3 | 21-Apr-2007 11:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | skid row.mp3 | 21-Apr-2007 11:52 | 10K | |
![[SND]](/icons/sound2.gif) | skidoodle.mp3 | 21-Apr-2007 11:53 | 17K | |
![[SND]](/icons/sound2.gif) | skidoo.mp3 | 21-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | skiddy.mp3 | 21-Apr-2007 11:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | skiddoo.mp3 | 21-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | skidding.mp3 | 21-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | skidder.mp3 | 21-Apr-2007 11:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | skidbladnir.mp3 | 21-Apr-2007 11:53 | 17K | |
![[SND]](/icons/sound2.gif) | skid.mp3 | 21-Apr-2007 11:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | skibob.mp3 | 21-Apr-2007 11:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | skibby.mp3 | 21-Apr-2007 11:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | skiascopy.mp3 | 21-Apr-2007 11:52 | 17K | |
![[SND]](/icons/sound2.gif) | skiascope.mp3 | 21-Apr-2007 11:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | skiamachy.mp3 | 21-Apr-2007 11:52 | 17K | |
![[SND]](/icons/sound2.gif) | skiagraphy.mp3 | 21-Apr-2007 11:52 | 17K | |
![[SND]](/icons/sound2.gif) | skiagraph.mp3 | 21-Apr-2007 11:52 | 17K | |
![[SND]](/icons/sound2.gif) | skiagram.mp3 | 21-Apr-2007 11:52 | 11K | |
![[SND]](/icons/sound2.gif) | skiable.mp3 | 21-Apr-2007 11:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | skia.mp3 | 21-Apr-2007 11:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | ski.mp3 | 21-Apr-2007 11:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | skewwhiff.mp3 | 21-Apr-2007 11:52 | 17K | |
![[SND]](/icons/sound2.gif) | skewness.mp3 | 21-Apr-2007 11:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | skewing.mp3 | 21-Apr-2007 11:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | skewgee.mp3 | 21-Apr-2007 11:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | skewer.mp3 | 21-Apr-2007 11:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | skewbald.mp3 | 21-Apr-2007 11:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | skewback.mp3 | 21-Apr-2007 11:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | skew.mp3 | 21-Apr-2007 11:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | skeuomorph.mp3 | 21-Apr-2007 11:52 | 17K | |
![[SND]](/icons/sound2.gif) | skete.mp3 | 21-Apr-2007 11:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sketchy.mp3 | 21-Apr-2007 11:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | sketchiness.mp3 | 21-Apr-2007 11:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | sketchily.mp3 | 21-Apr-2007 11:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | sketched.mp3 | 21-Apr-2007 11:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | sketchbook.mp3 | 21-Apr-2007 11:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | sketchable.mp3 | 21-Apr-2007 11:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sketch.mp3 | 21-Apr-2007 11:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | sket.mp3 | 21-Apr-2007 11:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | skerry.mp3 | 21-Apr-2007 11:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | skerrick.mp3 | 21-Apr-2007 11:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | skerm.mp3 | 21-Apr-2007 11:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | skepticism.mp3 | 21-Apr-2007 11:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | skeptically.mp3 | 21-Apr-2007 11:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | skeptical.mp3 | 21-Apr-2007 11:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | skeptic.mp3 | 21-Apr-2007 11:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | skepsis.mp3 | 21-Apr-2007 11:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | skepsel.mp3 | 21-Apr-2007 11:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | skepful.mp3 | 21-Apr-2007 11:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | skep.mp3 | 21-Apr-2007 11:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | skenedhu.mp3 | 21-Apr-2007 11:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | skene.mp3 | 21-Apr-2007 11:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | sken.mp3 | 21-Apr-2007 11:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | skeltering.mp3 | 21-Apr-2007 11:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | skelter.mp3 | 21-Apr-2007 11:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | skelp.mp3 | 21-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | skelmersdale.mp3 | 21-Apr-2007 11:50 | 17K | |
![[SND]](/icons/sound2.gif) | skelm.mp3 | 21-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | skelly.mp3 | 21-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | skellum.mp3 | 21-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | skell.mp3 | 21-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | skelicindex.mp3 | 21-Apr-2007 11:50 | 17K | |
![[SND]](/icons/sound2.gif) | skelf.mp3 | 21-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | skeletonizer.mp3 | 21-Apr-2007 11:50 | 11K | |
![[SND]](/icons/sound2.gif) | skeletonize.mp3 | 21-Apr-2007 11:50 | 11K | |
![[SND]](/icons/sound2.gif) | skeletonic.mp3 | 21-Apr-2007 11:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | skeleton.mp3 | 21-Apr-2007 11:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | skeletally.mp3 | 21-Apr-2007 11:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | skeletal.mp3 | 21-Apr-2007 11:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | skein.mp3 | 21-Apr-2007 11:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | skeigh.mp3 | 21-Apr-2007 11:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | skeif.mp3 | 21-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | skegness.mp3 | 21-Apr-2007 11:50 | 17K | |
![[SND]](/icons/sound2.gif) | skeg.mp3 | 21-Apr-2007 11:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | skeezix.mp3 | 21-Apr-2007 11:50 | 17K | |
![[SND]](/icons/sound2.gif) | skeezicks.mp3 | 21-Apr-2007 11:49 | 17K | |
![[SND]](/icons/sound2.gif) | skeezer.mp3 | 21-Apr-2007 11:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | skeevy.mp3 | 21-Apr-2007 11:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | skeeter.mp3 | 21-Apr-2007 11:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | skeet.mp3 | 21-Apr-2007 11:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | skeeching.mp3 | 21-Apr-2007 11:49 | 17K | |
![[SND]](/icons/sound2.gif) | skeech.mp3 | 21-Apr-2007 11:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | skeeball.mp3 | 21-Apr-2007 11:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | skee.mp3 | 21-Apr-2007 11:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | skedaddling.mp3 | 21-Apr-2007 11:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | skedaddler.mp3 | 21-Apr-2007 11:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | skedaddle.mp3 | 21-Apr-2007 11:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | sked.mp3 | 21-Apr-2007 11:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | skeandhu.mp3 | 21-Apr-2007 11:49 | 17K | |
![[SND]](/icons/sound2.gif) | skean.mp3 | 21-Apr-2007 11:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | skaw.mp3 | 21-Apr-2007 11:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | skavler.mp3 | 21-Apr-2007 11:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | skatyeight.mp3 | 21-Apr-2007 11:49 | 17K | |
![[SND]](/icons/sound2.gif) | skatole.mp3 | 21-Apr-2007 11:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | skatol.mp3 | 21-Apr-2007 11:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | skatingrink.mp3 | 21-Apr-2007 11:48 | 17K | |
![[SND]](/icons/sound2.gif) | skating.mp3 | 21-Apr-2007 11:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | skater.mp3 | 21-Apr-2007 11:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | skatemobile.mp3 | 21-Apr-2007 11:48 | 17K | |
![[SND]](/icons/sound2.gif) | skateboarder.mp3 | 21-Apr-2007 11:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | skateboard.mp3 | 21-Apr-2007 11:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | skate.mp3 | 21-Apr-2007 11:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | skat.mp3 | 21-Apr-2007 11:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | skarabrae.mp3 | 21-Apr-2007 11:48 | 17K | |
![[SND]](/icons/sound2.gif) | skanky.mp3 | 21-Apr-2007 11:48 | 14K | |
![[SND]](/icons/sound2.gif) | skanking.mp3 | 21-Apr-2007 11:48 | 17K | |
![[SND]](/icons/sound2.gif) | skank.mp3 | 21-Apr-2007 11:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | skanda.mp3 | 21-Apr-2007 11:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | skammer.mp3 | 21-Apr-2007 11:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | skam.mp3 | 21-Apr-2007 11:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | skaldic.mp3 | 21-Apr-2007 11:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | skald.mp3 | 21-Apr-2007 11:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | skaif.mp3 | 21-Apr-2007 11:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | skagway.mp3 | 21-Apr-2007 11:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | skaggy.mp3 | 21-Apr-2007 11:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | skagen.mp3 | 21-Apr-2007 11:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | skag.mp3 | 21-Apr-2007 11:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | skad.mp3 | 21-Apr-2007 11:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | skaapsteker.mp3 | 21-Apr-2007 11:47 | 17K | |
![[SND]](/icons/sound2.gif) | ska.mp3 | 21-Apr-2007 11:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | sjambok.mp3 | 21-Apr-2007 11:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | sjaelland.mp3 | 21-Apr-2007 11:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | sizzwater.mp3 | 21-Apr-2007 11:47 | 17K | |
![[SND]](/icons/sound2.gif) | sizzling.mp3 | 21-Apr-2007 11:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | sizzler.mp3 | 21-Apr-2007 11:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | sizzled.mp3 | 21-Apr-2007 11:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | sizzle.mp3 | 21-Apr-2007 11:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | sizy.mp3 | 21-Apr-2007 11:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | sizing.mp3 | 21-Apr-2007 11:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | sizewell.mp3 | 21-Apr-2007 11:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | sizer.mp3 | 21-Apr-2007 11:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | sizeism.mp3 | 21-Apr-2007 11:47 | 17K | |
![[SND]](/icons/sound2.gif) | sized.mp3 | 21-Apr-2007 11:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | sizeable.mp3 | 21-Apr-2007 11:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | size.mp3 | 21-Apr-2007 11:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | sizar.mp3 | 21-Apr-2007 11:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | sizably.mp3 | 21-Apr-2007 11:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | sizable.mp3 | 21-Apr-2007 11:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | sixtypenny.mp3 | 21-Apr-2007 11:46 | 17K | |
![[SND]](/icons/sound2.gif) | sixtyish.mp3 | 21-Apr-2007 11:46 | 9.8K | |
![[SND]](/icons/sound2.gif) | sixtyfourmo.mp3 | 21-Apr-2007 11:46 | 17K | |
![[SND]](/icons/sound2.gif) | sixty.mp3 | 21-Apr-2007 11:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | sixty-nine.mp3 | 21-Apr-2007 11:46 | 10K | |
![[SND]](/icons/sound2.gif) | sixty-fourth note.mp3 | 21-Apr-2007 11:46 | 12K | |
![[SND]](/icons/sound2.gif) | sixtusiv.mp3 | 21-Apr-2007 11:46 | 17K | |
![[SND]](/icons/sound2.gif) | sixtieth.mp3 | 21-Apr-2007 11:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | sixths.mp3 | 21-Apr-2007 11:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | sixthly.mp3 | 21-Apr-2007 11:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | sixth.mp3 | 21-Apr-2007 11:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | sixteenth.mp3 | 21-Apr-2007 11:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | sixteenpenny.mp3 | 21-Apr-2007 11:46 | 17K | |
![[SND]](/icons/sound2.gif) | sixteenmo.mp3 | 21-Apr-2007 11:46 | 10K | |
![[SND]](/icons/sound2.gif) | sixteen.mp3 | 21-Apr-2007 11:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | sixte.mp3 | 21-Apr-2007 11:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | sixshooter.mp3 | 21-Apr-2007 11:46 | 17K | |
![[SND]](/icons/sound2.gif) | sixpenny nail.mp3 | 21-Apr-2007 11:46 | 12K | |
![[SND]](/icons/sound2.gif) | sixpenny.mp3 | 21-Apr-2007 11:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | sixpence.mp3 | 21-Apr-2007 11:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | sixoclockswill.mp3 | 21-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | sixmo.mp3 | 21-Apr-2007 11:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sixgill.mp3 | 21-Apr-2007 11:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | sixfold.mp3 | 21-Apr-2007 11:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | sixer.mp3 | 21-Apr-2007 11:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | sixain.mp3 | 21-Apr-2007 11:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | six.mp3 | 21-Apr-2007 11:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | six-shooter.mp3 | 21-Apr-2007 11:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | six-pack.mp3 | 21-Apr-2007 11:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | six-o-six.mp3 | 21-Apr-2007 11:45 | 13K | |
![[SND]](/icons/sound2.gif) | six-gun.mp3 | 21-Apr-2007 11:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | siwalik.mp3 | 21-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | sivispacemparabellum.mp3 | 21-Apr-2007 11:45 | 27K | |
![[SND]](/icons/sound2.gif) | si vis pacem, para bellum.mp3 | 21-Apr-2007 11:04 | 23K | |
![[SND]](/icons/sound2.gif) | sivatherium.mp3 | 21-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | sivapithecus.mp3 | 21-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | sivaji.mp3 | 21-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | sivaite.mp3 | 21-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | sitzmark.mp3 | 21-Apr-2007 11:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | sitzkrieg.mp3 | 21-Apr-2007 11:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | sitzfleish.mp3 | 21-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | sitzbein.mp3 | 21-Apr-2007 11:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | sitzbath.mp3 | 21-Apr-2007 11:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | sitz bath.mp3 | 21-Apr-2007 11:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | situtunga.mp3 | 21-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | situsinversus.mp3 | 21-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | situs.mp3 | 21-Apr-2007 11:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | situla.mp3 | 21-Apr-2007 11:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | situationism.mp3 | 21-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | situational.mp3 | 21-Apr-2007 11:44 | 10K | |
![[SND]](/icons/sound2.gif) | situation.mp3 | 21-Apr-2007 11:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | situated.mp3 | 21-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | situate.mp3 | 21-Apr-2007 11:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | situash.mp3 | 21-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | situ.mp3 | 21-Apr-2007 11:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | sitting.mp3 | 21-Apr-2007 11:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | sitter.mp3 | 21-Apr-2007 11:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | sitten.mp3 | 21-Apr-2007 11:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | sittar.mp3 | 21-Apr-2007 11:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | sitsang.mp3 | 21-Apr-2007 11:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | sitrep.mp3 | 21-Apr-2007 11:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | sitosterol.mp3 | 21-Apr-2007 11:43 | 11K | |
![[SND]](/icons/sound2.gif) | sitophobia.mp3 | 21-Apr-2007 11:43 | 17K | |
![[SND]](/icons/sound2.gif) | sitomania.mp3 | 21-Apr-2007 11:43 | 17K | |
![[SND]](/icons/sound2.gif) | sitology.mp3 | 21-Apr-2007 11:43 | 17K | |
![[SND]](/icons/sound2.gif) | sito.mp3 | 21-Apr-2007 11:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | sitkamer.mp3 | 21-Apr-2007 11:43 | 17K | |
![[SND]](/icons/sound2.gif) | sitka.mp3 | 21-Apr-2007 11:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | siting.mp3 | 21-Apr-2007 11:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | sithole.mp3 | 21-Apr-2007 11:43 | 17K | |
![[SND]](/icons/sound2.gif) | sithens.mp3 | 21-Apr-2007 11:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | sithence.mp3 | 21-Apr-2007 11:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | sith.mp3 | 21-Apr-2007 11:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | sitella.mp3 | 21-Apr-2007 11:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | site.mp3 | 21-Apr-2007 11:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | sit down.mp3 | 21-Apr-2007 11:42 | 9.8K | |
![[SND]](/icons/sound2.gif) | sitcomm.mp3 | 21-Apr-2007 11:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | sitcom.mp3 | 21-Apr-2007 11:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | sitatunga.mp3 | 21-Apr-2007 11:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | sitarist.mp3 | 21-Apr-2007 11:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | sitar.mp3 | 21-Apr-2007 11:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | sita.mp3 | 21-Apr-2007 11:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | sit.mp3 | 21-Apr-2007 11:42 | 5.5K | |
![[SND]](/icons/sound2.gif) | sit-up.mp3 | 21-Apr-2007 11:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | sit-in.mp3 | 21-Apr-2007 11:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | sit-down.mp3 | 21-Apr-2007 11:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | sistrum.mp3 | 21-Apr-2007 11:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | sistroid.mp3 | 21-Apr-2007 11:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | sisteviator.mp3 | 21-Apr-2007 11:42 | 17K | |
![[SND]](/icons/sound2.gif) | siste viator.mp3 | 21-Apr-2007 11:42 | 14K | |
![[SND]](/icons/sound2.gif) | sisters-in-law.mp3 | 21-Apr-2007 11:42 | 10K | |
![[SND]](/icons/sound2.gif) | sisterofloretto.mp3 | 21-Apr-2007 11:42 | 17K | |
![[SND]](/icons/sound2.gif) | sisterly.mp3 | 21-Apr-2007 11:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | sisterhood.mp3 | 21-Apr-2007 11:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | sister.mp3 | 21-Apr-2007 11:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | sister-in-law.mp3 | 21-Apr-2007 11:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | sissy.mp3 | 21-Apr-2007 11:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | sissoo.mp3 | 21-Apr-2007 11:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | sissonne.mp3 | 21-Apr-2007 11:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | sissinghurstcastle.mp3 | 21-Apr-2007 11:41 | 18K | |
![[SND]](/icons/sound2.gif) | sissified.mp3 | 21-Apr-2007 11:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | sisseton.mp3 | 21-Apr-2007 11:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | sisler.mp3 | 21-Apr-2007 11:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | siskin.mp3 | 21-Apr-2007 11:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | sisinnius.mp3 | 21-Apr-2007 11:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | sisera.mp3 | 21-Apr-2007 11:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | siscowet.mp3 | 21-Apr-2007 11:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | sisboombah.mp3 | 21-Apr-2007 11:41 | 17K | |
![[SND]](/icons/sound2.gif) | sisalana.mp3 | 21-Apr-2007 11:41 | 17K | |
![[SND]](/icons/sound2.gif) | sisal.mp3 | 21-Apr-2007 11:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | sis.mp3 | 21-Apr-2007 11:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | sirventes.mp3 | 21-Apr-2007 11:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | sirvente.mp3 | 21-Apr-2007 11:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | sirupy.mp3 | 21-Apr-2007 11:41 | 27K | |
![[SND]](/icons/sound2.gif) | sirup.mp3 | 21-Apr-2007 11:41 | 27K | |
![[SND]](/icons/sound2.gif) | sirtaki.mp3 | 21-Apr-2007 11:41 | 17K | |
![[SND]](/icons/sound2.gif) | sirree.mp3 | 21-Apr-2007 11:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | sirrah.mp3 | 21-Apr-2007 11:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | sirra.mp3 | 21-Apr-2007 11:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | siroset.mp3 | 21-Apr-2007 11:40 | 17K | |
![[SND]](/icons/sound2.gif) | sironize.mp3 | 21-Apr-2007 11:40 | 17K | |
![[SND]](/icons/sound2.gif) | sirocco.mp3 | 21-Apr-2007 11:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | sirloin.mp3 | 21-Apr-2007 11:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | sirkar.mp3 | 21-Apr-2007 11:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | siris.mp3 | 21-Apr-2007 11:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | siricius.mp3 | 21-Apr-2007 11:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | sirica.mp3 | 21-Apr-2007 11:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | siriasis.mp3 | 21-Apr-2007 11:40 | 17K | |
![[SND]](/icons/sound2.gif) | sirian.mp3 | 21-Apr-2007 11:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | sirgang.mp3 | 21-Apr-2007 11:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | sirenic.mp3 | 21-Apr-2007 11:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | sirenian.mp3 | 21-Apr-2007 11:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | sirena.mp3 | 21-Apr-2007 11:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | siren.mp3 | 21-Apr-2007 11:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | siree.mp3 | 21-Apr-2007 11:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | siredon.mp3 | 21-Apr-2007 11:40 | 17K | |
![[SND]](/icons/sound2.gif) | sire.mp3 | 21-Apr-2007 11:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | sirdar.mp3 | 21-Apr-2007 11:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | sircar.mp3 | 21-Apr-2007 11:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | sirajuddaula.mp3 | 21-Apr-2007 11:39 | 17K | |
![[SND]](/icons/sound2.gif) | sir.mp3 | 21-Apr-2007 11:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | siquis.mp3 | 21-Apr-2007 11:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | siquaerispeninsulamamoenamcircumspice.mp3 | 21-Apr-2007 11:39 | 36K | |
![[SND]](/icons/sound2.gif) | si quaeris peninsulam amoenam, circumspice.mp3 | 21-Apr-2007 11:04 | 35K | |
![[SND]](/icons/sound2.gif) | sipunculid.mp3 | 21-Apr-2007 11:39 | 17K | |
![[SND]](/icons/sound2.gif) | sipster.mp3 | 21-Apr-2007 11:39 | 17K | |
![[SND]](/icons/sound2.gif) | sipri.mp3 | 21-Apr-2007 11:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | sippet.mp3 | 21-Apr-2007 11:39 | 5.7K | |
![[SND]](/icons/sound2.gif) | sipper.mp3 | 21-Apr-2007 11:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | siple.mp3 | 21-Apr-2007 11:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sipingjie.mp3 | 21-Apr-2007 11:39 | 17K | |
![[SND]](/icons/sound2.gif) | sipid.mp3 | 21-Apr-2007 11:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | siphuncle.mp3 | 21-Apr-2007 11:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | siphreitorah.mp3 | 21-Apr-2007 11:39 | 17K | |
![[SND]](/icons/sound2.gif) | siphonostele.mp3 | 21-Apr-2007 11:38 | 10K | |
![[SND]](/icons/sound2.gif) | siphonophore.mp3 | 21-Apr-2007 11:38 | 10K | |
![[SND]](/icons/sound2.gif) | siphono.mp3 | 21-Apr-2007 11:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | siphoning.mp3 | 21-Apr-2007 11:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | siphonet.mp3 | 21-Apr-2007 11:38 | 17K | |
![[SND]](/icons/sound2.gif) | siphonapterous.mp3 | 21-Apr-2007 11:38 | 17K | |
![[SND]](/icons/sound2.gif) | siphonage.mp3 | 21-Apr-2007 11:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | siphon.mp3 | 21-Apr-2007 11:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | siphnos.mp3 | 21-Apr-2007 11:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | siph.mp3 | 21-Apr-2007 11:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sipe.mp3 | 21-Apr-2007 11:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sip.mp3 | 21-Apr-2007 11:38 | 5.7K | |
![[SND]](/icons/sound2.gif) | siop.mp3 | 21-Apr-2007 11:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinusvenosus.mp3 | 21-Apr-2007 11:38 | 17K | |
![[SND]](/icons/sound2.gif) | sinus venosus.mp3 | 21-Apr-2007 11:37 | 13K | |
![[SND]](/icons/sound2.gif) | sinusoidally.mp3 | 21-Apr-2007 11:38 | 10K | |
![[SND]](/icons/sound2.gif) | sinusoidal.mp3 | 21-Apr-2007 11:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | sinusoid.mp3 | 21-Apr-2007 11:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | sinusofvalsalva.mp3 | 21-Apr-2007 11:38 | 17K | |
![[SND]](/icons/sound2.gif) | sinusitis.mp3 | 21-Apr-2007 11:38 | 11K | |
![[SND]](/icons/sound2.gif) | sinus.mp3 | 21-Apr-2007 11:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | sinuous.mp3 | 21-Apr-2007 11:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | sinuosity.mp3 | 21-Apr-2007 11:37 | 9.8K | |
![[SND]](/icons/sound2.gif) | sinumbralamp.mp3 | 21-Apr-2007 11:37 | 17K | |
![[SND]](/icons/sound2.gif) | sinuation.mp3 | 21-Apr-2007 11:37 | 17K | |
![[SND]](/icons/sound2.gif) | sinuate.mp3 | 21-Apr-2007 11:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | sintra.mp3 | 21-Apr-2007 11:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | sintmaarten.mp3 | 21-Apr-2007 11:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | sinterability.mp3 | 21-Apr-2007 11:37 | 11K | |
![[SND]](/icons/sound2.gif) | sinter.mp3 | 21-Apr-2007 11:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | sinsyne.mp3 | 21-Apr-2007 11:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | sinsemilla.mp3 | 21-Apr-2007 11:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | sins.mp3 | 21-Apr-2007 11:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | sinowatz.mp3 | 21-Apr-2007 11:37 | 17K | |
![[SND]](/icons/sound2.gif) | sinopoli.mp3 | 21-Apr-2007 11:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | sinopite.mp3 | 21-Apr-2007 11:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | sinopis.mp3 | 21-Apr-2007 11:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | sinopie.mp3 | 21-Apr-2007 11:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | sinopia.mp3 | 21-Apr-2007 11:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | sinophobia.mp3 | 21-Apr-2007 11:36 | 17K | |
![[SND]](/icons/sound2.gif) | sinophile.mp3 | 21-Apr-2007 11:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | sinon.mp3 | 21-Apr-2007 11:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinology.mp3 | 21-Apr-2007 11:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | sinologue.mp3 | 21-Apr-2007 11:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | sinologist.mp3 | 21-Apr-2007 11:36 | 11K | |
![[SND]](/icons/sound2.gif) | sinological.mp3 | 21-Apr-2007 11:36 | 11K | |
![[SND]](/icons/sound2.gif) | sinoatrial.mp3 | 21-Apr-2007 11:36 | 10K | |
![[SND]](/icons/sound2.gif) | sino.mp3 | 21-Apr-2007 11:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinningia.mp3 | 21-Apr-2007 11:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | sinnfein.mp3 | 21-Apr-2007 11:36 | 17K | |
![[SND]](/icons/sound2.gif) | sinnet.mp3 | 21-Apr-2007 11:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinner.mp3 | 21-Apr-2007 11:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | sinless.mp3 | 21-Apr-2007 11:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinkorswim.mp3 | 21-Apr-2007 11:36 | 17K | |
![[SND]](/icons/sound2.gif) | sinkless.mp3 | 21-Apr-2007 11:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | sinking.mp3 | 21-Apr-2007 11:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinkianguighur.mp3 | 21-Apr-2007 11:36 | 17K | |
![[SND]](/icons/sound2.gif) | sinkhole.mp3 | 21-Apr-2007 11:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinker.mp3 | 21-Apr-2007 11:35 | 6.3K | |
![[SND]](/icons/sound2.gif) | sinkage.mp3 | 21-Apr-2007 11:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinkable.mp3 | 21-Apr-2007 11:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | sink.mp3 | 21-Apr-2007 11:35 | 5.2K | |
![[SND]](/icons/sound2.gif) | sinistrous.mp3 | 21-Apr-2007 11:35 | 11K | |
![[SND]](/icons/sound2.gif) | sinistrorse.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinistromanualism.mp3 | 21-Apr-2007 11:35 | 18K | |
![[SND]](/icons/sound2.gif) | sinistrocular.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinistro.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinistration.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinistrality.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinistral.mp3 | 21-Apr-2007 11:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | sinistrad.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinistra.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinistr.mp3 | 21-Apr-2007 11:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | sinister.mp3 | 21-Apr-2007 11:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sining.mp3 | 21-Apr-2007 11:35 | 17K | |
![[SND]](/icons/sound2.gif) | sinigrin.mp3 | 21-Apr-2007 11:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | sinify.mp3 | 21-Apr-2007 11:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | sinicize.mp3 | 21-Apr-2007 11:35 | 11K | |
![[SND]](/icons/sound2.gif) | sinicism.mp3 | 21-Apr-2007 11:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | sinhailien.mp3 | 21-Apr-2007 11:34 | 17K | |
![[SND]](/icons/sound2.gif) | sinh.mp3 | 21-Apr-2007 11:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | singultus.mp3 | 21-Apr-2007 11:34 | 17K | |
![[SND]](/icons/sound2.gif) | singulary.mp3 | 21-Apr-2007 11:34 | 17K | |
![[SND]](/icons/sound2.gif) | singularly.mp3 | 21-Apr-2007 11:34 | 17K | |
![[SND]](/icons/sound2.gif) | singularize.mp3 | 21-Apr-2007 11:34 | 11K | |
![[SND]](/icons/sound2.gif) | singularity.mp3 | 21-Apr-2007 11:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | singular.mp3 | 21-Apr-2007 11:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | singspiel.mp3 | 21-Apr-2007 11:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | singsongy.mp3 | 21-Apr-2007 11:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | singsong.mp3 | 21-Apr-2007 11:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | singsing.mp3 | 21-Apr-2007 11:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | singly.mp3 | 21-Apr-2007 11:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | singlish.mp3 | 21-Apr-2007 11:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | singling.mp3 | 21-Apr-2007 11:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | singletree.mp3 | 21-Apr-2007 11:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | singleton.mp3 | 21-Apr-2007 11:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | singlet.mp3 | 21-Apr-2007 11:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | singlestick.mp3 | 21-Apr-2007 11:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | singleo.mp3 | 21-Apr-2007 11:33 | 17K | |
![[SND]](/icons/sound2.gif) | singleness.mp3 | 21-Apr-2007 11:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | singlehandedly.mp3 | 21-Apr-2007 11:33 | 17K | |
![[SND]](/icons/sound2.gif) | single.mp3 | 21-Apr-2007 11:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | single-valued.mp3 | 21-Apr-2007 11:34 | 11K | |
![[SND]](/icons/sound2.gif) | single-track.mp3 | 21-Apr-2007 11:34 | 10K | |
![[SND]](/icons/sound2.gif) | single-space.mp3 | 21-Apr-2007 11:33 | 10K | |
![[SND]](/icons/sound2.gif) | single-phase.mp3 | 21-Apr-2007 11:33 | 10K | |
![[SND]](/icons/sound2.gif) | single-payer.mp3 | 21-Apr-2007 11:33 | 11K | |
![[SND]](/icons/sound2.gif) | single-minded.mp3 | 21-Apr-2007 11:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | single-lens reflex.mp3 | 21-Apr-2007 11:33 | 15K | |
![[SND]](/icons/sound2.gif) | single-hearted.mp3 | 21-Apr-2007 11:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | single-hander.mp3 | 21-Apr-2007 11:33 | 10K | |
![[SND]](/icons/sound2.gif) | single-handed.mp3 | 21-Apr-2007 11:33 | 9.8K | |
![[SND]](/icons/sound2.gif) | single-foot.mp3 | 21-Apr-2007 11:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | single-breasted.mp3 | 21-Apr-2007 11:33 | 11K | |
![[SND]](/icons/sound2.gif) | single-blind.mp3 | 21-Apr-2007 11:33 | 9.8K | |
![[SND]](/icons/sound2.gif) | single-action.mp3 | 21-Apr-2007 11:33 | 11K | |
![[SND]](/icons/sound2.gif) | singing.mp3 | 21-Apr-2007 11:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | singha.mp3 | 21-Apr-2007 11:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | singersongwriter.mp3 | 21-Apr-2007 11:33 | 17K | |
![[SND]](/icons/sound2.gif) | singer.mp3 | 21-Apr-2007 11:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | singeing.mp3 | 21-Apr-2007 11:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | singed.mp3 | 21-Apr-2007 11:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | singe.mp3 | 21-Apr-2007 11:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | singan.mp3 | 21-Apr-2007 11:32 | 17K | |
![[SND]](/icons/sound2.gif) | singable.mp3 | 21-Apr-2007 11:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | sing.mp3 | 21-Apr-2007 11:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | sing-along.mp3 | 21-Apr-2007 11:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | sinfully.mp3 | 21-Apr-2007 11:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | sinful.mp3 | 21-Apr-2007 11:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinfonietta.mp3 | 21-Apr-2007 11:32 | 10K | |
![[SND]](/icons/sound2.gif) | sinfonie.mp3 | 21-Apr-2007 11:32 | 11K | |
![[SND]](/icons/sound2.gif) | sinfonia concertante.mp3 | 21-Apr-2007 11:32 | 17K | |
![[SND]](/icons/sound2.gif) | sinfonia.mp3 | 21-Apr-2007 11:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | sinfjotli.mp3 | 21-Apr-2007 11:32 | 17K | |
![[SND]](/icons/sound2.gif) | sinewy.mp3 | 21-Apr-2007 11:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | sinew.mp3 | 21-Apr-2007 11:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | sine quibus non.mp3 | 21-Apr-2007 11:32 | 14K | |
![[SND]](/icons/sound2.gif) | sinequanon.mp3 | 21-Apr-2007 11:32 | 17K | |
![[SND]](/icons/sound2.gif) | sine qua non.mp3 | 21-Apr-2007 11:31 | 11K | |
![[SND]](/icons/sound2.gif) | sinemet.mp3 | 21-Apr-2007 11:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | sinedie.mp3 | 21-Apr-2007 11:32 | 17K | |
![[SND]](/icons/sound2.gif) | sine die.mp3 | 21-Apr-2007 11:31 | 10K | |
![[SND]](/icons/sound2.gif) | sinecure.mp3 | 21-Apr-2007 11:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | sine.mp3 | 21-Apr-2007 11:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | sindy.mp3 | 21-Apr-2007 11:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sindonology.mp3 | 21-Apr-2007 11:31 | 17K | |
![[SND]](/icons/sound2.gif) | sindon.mp3 | 21-Apr-2007 11:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sindolor.mp3 | 21-Apr-2007 11:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | sindbis.mp3 | 21-Apr-2007 11:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | sindbadthesailor.mp3 | 21-Apr-2007 11:31 | 17K | |
![[SND]](/icons/sound2.gif) | sind.mp3 | 21-Apr-2007 11:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinciput.mp3 | 21-Apr-2007 11:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | sincipital.mp3 | 21-Apr-2007 11:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | sincipita.mp3 | 21-Apr-2007 11:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | sincerity.mp3 | 21-Apr-2007 11:31 | 10K | |
![[SND]](/icons/sound2.gif) | sincerely.mp3 | 21-Apr-2007 11:31 | 17K | |
![[SND]](/icons/sound2.gif) | sincere.mp3 | 21-Apr-2007 11:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | since.mp3 | 21-Apr-2007 11:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | sinarquista.mp3 | 21-Apr-2007 11:31 | 17K | |
![[SND]](/icons/sound2.gif) | sinarquist.mp3 | 21-Apr-2007 11:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | sinarquism.mp3 | 21-Apr-2007 11:30 | 17K | |
![[SND]](/icons/sound2.gif) | sinarest.mp3 | 21-Apr-2007 11:30 | 17K | |
![[SND]](/icons/sound2.gif) | sinapism.mp3 | 21-Apr-2007 11:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | sinapine.mp3 | 21-Apr-2007 11:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | sinanthropus.mp3 | 21-Apr-2007 11:30 | 17K | |
![[SND]](/icons/sound2.gif) | sinan.mp3 | 21-Apr-2007 11:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sinalbin.mp3 | 21-Apr-2007 11:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | sinal.mp3 | 21-Apr-2007 11:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sina.mp3 | 21-Apr-2007 11:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sin.mp3 | 21-Apr-2007 11:30 | 6.3K | |
![[SND]](/icons/sound2.gif) | simvastatin.mp3 | 21-Apr-2007 11:30 | 11K | |
![[SND]](/icons/sound2.gif) | simurgh.mp3 | 21-Apr-2007 11:30 | 17K | |
![[SND]](/icons/sound2.gif) | simultaneously.mp3 | 21-Apr-2007 11:30 | 12K | |
![[SND]](/icons/sound2.gif) | simultaneous.mp3 | 21-Apr-2007 11:30 | 11K | |
![[SND]](/icons/sound2.gif) | simultaneity.mp3 | 21-Apr-2007 11:30 | 12K | |
![[SND]](/icons/sound2.gif) | simuliumfly.mp3 | 21-Apr-2007 11:30 | 17K | |
![[SND]](/icons/sound2.gif) | simulcast.mp3 | 21-Apr-2007 11:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | simulator.mp3 | 21-Apr-2007 11:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | simulative.mp3 | 21-Apr-2007 11:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | simulation.mp3 | 21-Apr-2007 11:30 | 10K | |
![[SND]](/icons/sound2.gif) | simulated.mp3 | 21-Apr-2007 11:29 | 17K | |
![[SND]](/icons/sound2.gif) | simulate.mp3 | 21-Apr-2007 11:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | simular.mp3 | 21-Apr-2007 11:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | simulant.mp3 | 21-Apr-2007 11:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | simulacrum.mp3 | 21-Apr-2007 11:29 | 10K | |
![[SND]](/icons/sound2.gif) | simulacre.mp3 | 21-Apr-2007 11:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | simulacra.mp3 | 21-Apr-2007 11:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | simul.mp3 | 21-Apr-2007 11:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | simsim.mp3 | 21-Apr-2007 11:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | simpy.mp3 | 21-Apr-2007 11:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | simpulum.mp3 | 21-Apr-2007 11:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | simpsons.mp3 | 21-Apr-2007 11:29 | 17K | |
![[SND]](/icons/sound2.gif) | simply.mp3 | 21-Apr-2007 11:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | simplon.mp3 | 21-Apr-2007 11:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | simplistically.mp3 | 21-Apr-2007 11:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | simplistic.mp3 | 21-Apr-2007 11:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | simpliste.mp3 | 21-Apr-2007 11:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | simplism.mp3 | 21-Apr-2007 11:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | simplify.mp3 | 21-Apr-2007 11:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | simplifier.mp3 | 21-Apr-2007 11:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | simplification.mp3 | 21-Apr-2007 11:28 | 11K | |
![[SND]](/icons/sound2.gif) | simplicius.mp3 | 21-Apr-2007 11:28 | 17K | |
![[SND]](/icons/sound2.gif) | simplicity.mp3 | 21-Apr-2007 11:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | simpliciter.mp3 | 21-Apr-2007 11:28 | 17K | |
![[SND]](/icons/sound2.gif) | simplicidentate.mp3 | 21-Apr-2007 11:28 | 17K | |
![[SND]](/icons/sound2.gif) | simplicially.mp3 | 21-Apr-2007 11:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | simplicial.mp3 | 21-Apr-2007 11:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | simplicia.mp3 | 21-Apr-2007 11:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | simplices.mp3 | 21-Apr-2007 11:28 | 9.8K | |
![[SND]](/icons/sound2.gif) | simplex.mp3 | 21-Apr-2007 11:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | simpleton.mp3 | 21-Apr-2007 11:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | simplest.mp3 | 21-Apr-2007 11:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | simpler.mp3 | 21-Apr-2007 11:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | simpleness.mp3 | 21-Apr-2007 11:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | simpleminded.mp3 | 21-Apr-2007 11:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | simple.mp3 | 21-Apr-2007 11:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | simpering.mp3 | 21-Apr-2007 11:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | simperer.mp3 | 21-Apr-2007 11:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | simper.mp3 | 21-Apr-2007 11:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | simpatico.mp3 | 21-Apr-2007 11:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | simpai.mp3 | 21-Apr-2007 11:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | simp.mp3 | 21-Apr-2007 11:28 | 5.0K | |
![[SND]](/icons/sound2.gif) | simoon.mp3 | 21-Apr-2007 11:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | simoom.mp3 | 21-Apr-2007 11:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | simony.mp3 | 21-Apr-2007 11:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | si monumentum requiris, circumspice.mp3 | 21-Apr-2007 11:04 | 32K | |
![[SND]](/icons/sound2.gif) | simonpure.mp3 | 21-Apr-2007 11:27 | 17K | |
![[SND]](/icons/sound2.gif) | simonov.mp3 | 21-Apr-2007 11:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | simonlegree.mp3 | 21-Apr-2007 11:27 | 17K | |
![[SND]](/icons/sound2.gif) | simonize.mp3 | 21-Apr-2007 11:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | simonist.mp3 | 21-Apr-2007 11:27 | 17K | |
![[SND]](/icons/sound2.gif) | simonism.mp3 | 21-Apr-2007 11:27 | 17K | |
![[SND]](/icons/sound2.gif) | simoniacally.mp3 | 21-Apr-2007 11:27 | 10K | |
![[SND]](/icons/sound2.gif) | simoniacal.mp3 | 21-Apr-2007 11:27 | 11K | |
![[SND]](/icons/sound2.gif) | simoniac.mp3 | 21-Apr-2007 11:27 | 10K | |
![[SND]](/icons/sound2.gif) | simon-pure.mp3 | 21-Apr-2007 11:27 | 10K | |
![[SND]](/icons/sound2.gif) | simoleon.mp3 | 21-Apr-2007 11:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | simnelcake.mp3 | 21-Apr-2007 11:27 | 17K | |
![[SND]](/icons/sound2.gif) | simnel.mp3 | 21-Apr-2007 11:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | simmons.mp3 | 21-Apr-2007 11:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | simmon.mp3 | 21-Apr-2007 11:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | simmering.mp3 | 21-Apr-2007 11:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | simmerdim.mp3 | 21-Apr-2007 11:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | simmer.mp3 | 21-Apr-2007 11:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | simmel.mp3 | 21-Apr-2007 11:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | simm.mp3 | 21-Apr-2007 11:26 | 17K | |
![[SND]](/icons/sound2.gif) | simivalley.mp3 | 21-Apr-2007 11:26 | 17K | |
![[SND]](/icons/sound2.gif) | simitar.mp3 | 21-Apr-2007 11:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | simious.mp3 | 21-Apr-2007 11:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | simionato.mp3 | 21-Apr-2007 11:26 | 17K | |
![[SND]](/icons/sound2.gif) | similize.mp3 | 21-Apr-2007 11:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | similitude.mp3 | 21-Apr-2007 11:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | similiter.mp3 | 21-Apr-2007 11:26 | 17K | |
![[SND]](/icons/sound2.gif) | similis simili gaudet.mp3 | 21-Apr-2007 11:26 | 19K | |
![[SND]](/icons/sound2.gif) | similiasimilibuscurantur.mp3 | 21-Apr-2007 11:26 | 27K | |
![[SND]](/icons/sound2.gif) | similia similibus curantur.mp3 | 21-Apr-2007 11:26 | 22K | |
![[SND]](/icons/sound2.gif) | simile.mp3 | 21-Apr-2007 11:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | similarity.mp3 | 21-Apr-2007 11:26 | 10K | |
![[SND]](/icons/sound2.gif) | similar.mp3 | 21-Apr-2007 11:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | simianshelf.mp3 | 21-Apr-2007 11:26 | 17K | |
![[SND]](/icons/sound2.gif) | simian.mp3 | 21-Apr-2007 11:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | simhathtorah.mp3 | 21-Apr-2007 11:25 | 17K | |
![[SND]](/icons/sound2.gif) | simethicone.mp3 | 21-Apr-2007 11:25 | 17K | |
![[SND]](/icons/sound2.gif) | simeonstylites.mp3 | 21-Apr-2007 11:25 | 17K | |
![[SND]](/icons/sound2.gif) | simeonite.mp3 | 21-Apr-2007 11:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | simeonbenyohai.mp3 | 21-Apr-2007 11:25 | 17K | |
![[SND]](/icons/sound2.gif) | simcoe.mp3 | 21-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | simchathtorah.mp3 | 21-Apr-2007 11:25 | 17K | |
![[SND]](/icons/sound2.gif) | simca.mp3 | 21-Apr-2007 11:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | simba.mp3 | 21-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | simazine.mp3 | 21-Apr-2007 11:25 | 9.6K | |
![[SND]](/icons/sound2.gif) | simaroubaceous.mp3 | 21-Apr-2007 11:25 | 17K | |
![[SND]](/icons/sound2.gif) | simarouba.mp3 | 21-Apr-2007 11:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | simar.mp3 | 21-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | simaqian.mp3 | 21-Apr-2007 11:25 | 17K | |
![[SND]](/icons/sound2.gif) | sima.mp3 | 21-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | sim.mp3 | 21-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | sily.mp3 | 21-Apr-2007 11:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | silvousplait.mp3 | 21-Apr-2007 11:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | silviculturist.mp3 | 21-Apr-2007 11:24 | 11K | |
![[SND]](/icons/sound2.gif) | silviculture.mp3 | 21-Apr-2007 11:24 | 10K | |
![[SND]](/icons/sound2.gif) | silviculturally.mp3 | 21-Apr-2007 11:24 | 12K | |
![[SND]](/icons/sound2.gif) | silvicultural.mp3 | 21-Apr-2007 11:24 | 11K | |
![[SND]](/icons/sound2.gif) | silvics.mp3 | 21-Apr-2007 11:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | silvicolous.mp3 | 21-Apr-2007 11:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | silvichemical.mp3 | 21-Apr-2007 11:24 | 17K | |
![[SND]](/icons/sound2.gif) | silvical.mp3 | 21-Apr-2007 11:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | silvia.mp3 | 21-Apr-2007 11:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | silvex.mp3 | 21-Apr-2007 11:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | silvester.mp3 | 21-Apr-2007 11:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | silvery.mp3 | 21-Apr-2007 11:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | silverweed.mp3 | 21-Apr-2007 11:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | silverware.mp3 | 21-Apr-2007 11:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | silversword.mp3 | 21-Apr-2007 11:24 | 10K | |
![[SND]](/icons/sound2.gif) | silverstone.mp3 | 21-Apr-2007 11:24 | 17K | |
![[SND]](/icons/sound2.gif) | silversmith.mp3 | 21-Apr-2007 11:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | silversides.mp3 | 21-Apr-2007 11:24 | 10K | |
![[SND]](/icons/sound2.gif) | silverside.mp3 | 21-Apr-2007 11:24 | 10K | |
![[SND]](/icons/sound2.gif) | silverpoint.mp3 | 21-Apr-2007 11:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | silvern.mp3 | 21-Apr-2007 11:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | silverly.mp3 | 21-Apr-2007 11:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | silverize.mp3 | 21-Apr-2007 11:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | silverius.mp3 | 21-Apr-2007 11:23 | 17K | |
![[SND]](/icons/sound2.gif) | silvering.mp3 | 21-Apr-2007 11:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | silverfish.mp3 | 21-Apr-2007 11:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | silverer.mp3 | 21-Apr-2007 11:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | silvered.mp3 | 21-Apr-2007 11:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | silverberry.mp3 | 21-Apr-2007 11:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | silverbass.mp3 | 21-Apr-2007 11:23 | 17K | |
![[SND]](/icons/sound2.gif) | silverback.mp3 | 21-Apr-2007 11:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | silver.mp3 | 21-Apr-2007 11:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | silver-tongued.mp3 | 21-Apr-2007 11:24 | 9.6K | |
![[SND]](/icons/sound2.gif) | silvanus.mp3 | 21-Apr-2007 11:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | silvana.mp3 | 21-Apr-2007 11:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | silvan.mp3 | 21-Apr-2007 11:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | silvadine.mp3 | 21-Apr-2007 11:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | silva.mp3 | 21-Apr-2007 11:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | siluroid.mp3 | 21-Apr-2007 11:23 | 17K | |
![[SND]](/icons/sound2.gif) | silurid.mp3 | 21-Apr-2007 11:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | siltyclay.mp3 | 21-Apr-2007 11:23 | 17K | |
![[SND]](/icons/sound2.gif) | silty.mp3 | 21-Apr-2007 11:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | siltstone.mp3 | 21-Apr-2007 11:22 | 10K | |
![[SND]](/icons/sound2.gif) | siltation.mp3 | 21-Apr-2007 11:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | silt.mp3 | 21-Apr-2007 11:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | silphid.mp3 | 21-Apr-2007 11:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | siloxane.mp3 | 21-Apr-2007 11:22 | 10K | |
![[SND]](/icons/sound2.gif) | siloam.mp3 | 21-Apr-2007 11:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | silo.mp3 | 21-Apr-2007 11:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | sillyweed.mp3 | 21-Apr-2007 11:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | silly.mp3 | 21-Apr-2007 11:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | sills.mp3 | 21-Apr-2007 11:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | sillitoe.mp3 | 21-Apr-2007 11:22 | 17K | |
![[SND]](/icons/sound2.gif) | silliness.mp3 | 21-Apr-2007 11:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | sillimanite.mp3 | 21-Apr-2007 11:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | sillily.mp3 | 21-Apr-2007 11:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | siller.mp3 | 21-Apr-2007 11:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | sillanpaa.mp3 | 21-Apr-2007 11:22 | 17K | |
![[SND]](/icons/sound2.gif) | sillakingdom.mp3 | 21-Apr-2007 11:22 | 17K | |
![[SND]](/icons/sound2.gif) | sillabub.mp3 | 21-Apr-2007 11:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | sill.mp3 | 21-Apr-2007 11:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | silky.mp3 | 21-Apr-2007 11:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | silkworm.mp3 | 21-Apr-2007 11:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | silkweed.mp3 | 21-Apr-2007 11:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | silklike.mp3 | 21-Apr-2007 11:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | silkiness.mp3 | 21-Apr-2007 11:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | silkily.mp3 | 21-Apr-2007 11:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | silkie.mp3 | 21-Apr-2007 11:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | silken.mp3 | 21-Apr-2007 11:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | silkaline.mp3 | 21-Apr-2007 11:21 | 17K | |
![[SND]](/icons/sound2.gif) | silk.mp3 | 21-Apr-2007 11:21 | 5.5K | |
![[SND]](/icons/sound2.gif) | silk-stocking.mp3 | 21-Apr-2007 11:21 | 11K | |
![[SND]](/icons/sound2.gif) | siliquose.mp3 | 21-Apr-2007 11:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | silique.mp3 | 21-Apr-2007 11:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | siliqua.mp3 | 21-Apr-2007 11:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | siliculose.mp3 | 21-Apr-2007 11:21 | 17K | |
![[SND]](/icons/sound2.gif) | silicula.mp3 | 21-Apr-2007 11:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | silicotic.mp3 | 21-Apr-2007 11:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | silicosis.mp3 | 21-Apr-2007 11:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | siliconized.mp3 | 21-Apr-2007 11:21 | 9.8K | |
![[SND]](/icons/sound2.gif) | silicone.mp3 | 21-Apr-2007 11:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | silicon.mp3 | 21-Apr-2007 11:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | silico.mp3 | 21-Apr-2007 11:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | silicle.mp3 | 21-Apr-2007 11:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | silicium.mp3 | 21-Apr-2007 11:21 | 17K | |
![[SND]](/icons/sound2.gif) | silicious.mp3 | 21-Apr-2007 11:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | silicify.mp3 | 21-Apr-2007 11:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | silicifiedwood.mp3 | 21-Apr-2007 11:21 | 17K | |
![[SND]](/icons/sound2.gif) | silicification.mp3 | 21-Apr-2007 11:20 | 12K | |
![[SND]](/icons/sound2.gif) | siliciferous.mp3 | 21-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | silicide.mp3 | 21-Apr-2007 11:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | silicicolous.mp3 | 21-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | silicic.mp3 | 21-Apr-2007 11:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | siliceous.mp3 | 21-Apr-2007 11:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | silicated.mp3 | 21-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | silicate.mp3 | 21-Apr-2007 11:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | silicane.mp3 | 21-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | silica.mp3 | 21-Apr-2007 11:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | silic.mp3 | 21-Apr-2007 11:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | silhouettist.mp3 | 21-Apr-2007 11:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | silhouette.mp3 | 21-Apr-2007 11:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | silex.mp3 | 21-Apr-2007 11:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | silenus.mp3 | 21-Apr-2007 11:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | silentlegesinterarma.mp3 | 21-Apr-2007 11:20 | 36K | |
![[SND]](/icons/sound2.gif) | silent leges inter arma.mp3 | 21-Apr-2007 11:20 | 21K | |
![[SND]](/icons/sound2.gif) | silent.mp3 | 21-Apr-2007 11:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | silenos.mp3 | 21-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | sileni.mp3 | 21-Apr-2007 11:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | silene.mp3 | 21-Apr-2007 11:19 | 17K | |
![[SND]](/icons/sound2.gif) | silencer.mp3 | 21-Apr-2007 11:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | silenced.mp3 | 21-Apr-2007 11:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | silence.mp3 | 21-Apr-2007 11:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | sile.mp3 | 21-Apr-2007 11:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | sildenafil.mp3 | 21-Apr-2007 11:19 | 11K | |
![[SND]](/icons/sound2.gif) | sild.mp3 | 21-Apr-2007 11:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | silburyhill.mp3 | 21-Apr-2007 11:19 | 17K | |
![[SND]](/icons/sound2.gif) | silas.mp3 | 21-Apr-2007 11:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | silane.mp3 | 21-Apr-2007 11:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | silage.mp3 | 21-Apr-2007 11:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | sikuri.mp3 | 21-Apr-2007 11:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | sikra.mp3 | 21-Apr-2007 11:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | siking.mp3 | 21-Apr-2007 11:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | sikiang.mp3 | 21-Apr-2007 11:19 | 17K | |
![[SND]](/icons/sound2.gif) | sikhara.mp3 | 21-Apr-2007 11:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | sikeston.mp3 | 21-Apr-2007 11:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | sikes.mp3 | 21-Apr-2007 11:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | siker.mp3 | 21-Apr-2007 11:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | sike.mp3 | 21-Apr-2007 11:18 | 5.5K | |
![[SND]](/icons/sound2.gif) | sikandarabad.mp3 | 21-Apr-2007 11:18 | 17K | |
![[SND]](/icons/sound2.gif) | sika.mp3 | 21-Apr-2007 11:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | sik.mp3 | 21-Apr-2007 11:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | sijeunessesavaitsivieillessepouvait.mp3 | 21-Apr-2007 11:18 | 36K | |
![[SND]](/icons/sound2.gif) | si jeunesse savait, si vieillesse pouvait!.mp3 | 21-Apr-2007 11:04 | 26K | |
![[SND]](/icons/sound2.gif) | siirt.mp3 | 21-Apr-2007 11:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | sihanouk.mp3 | 21-Apr-2007 11:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | sigyn.mp3 | 21-Apr-2007 11:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | sigsbee.mp3 | 21-Apr-2007 11:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | sigrid.mp3 | 21-Apr-2007 11:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | sigrdrifa.mp3 | 21-Apr-2007 11:18 | 17K | |
![[SND]](/icons/sound2.gif) | sigoggling.mp3 | 21-Apr-2007 11:18 | 17K | |
![[SND]](/icons/sound2.gif) | signy.mp3 | 21-Apr-2007 11:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | signpost.mp3 | 21-Apr-2007 11:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | signory.mp3 | 21-Apr-2007 11:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | signorino.mp3 | 21-Apr-2007 11:17 | 17K | |
![[SND]](/icons/sound2.gif) | signorine.mp3 | 21-Apr-2007 11:17 | 11K | |
![[SND]](/icons/sound2.gif) | signorina.mp3 | 21-Apr-2007 11:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | signori.mp3 | 21-Apr-2007 11:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | signoret.mp3 | 21-Apr-2007 11:17 | 17K | |
![[SND]](/icons/sound2.gif) | signorelli.mp3 | 21-Apr-2007 11:17 | 17K | |
![[SND]](/icons/sound2.gif) | signore.mp3 | 21-Apr-2007 11:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | signora.mp3 | 21-Apr-2007 11:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | signor.mp3 | 21-Apr-2007 11:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | signiory.mp3 | 21-Apr-2007 11:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | signior.mp3 | 21-Apr-2007 11:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | signing.mp3 | 21-Apr-2007 11:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | signifying.mp3 | 21-Apr-2007 11:17 | 17K | |
![[SND]](/icons/sound2.gif) | signify.mp3 | 21-Apr-2007 11:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | signifier.mp3 | 21-Apr-2007 11:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | signified.mp3 | 21-Apr-2007 11:17 | 17K | |
![[SND]](/icons/sound2.gif) | signifie.mp3 | 21-Apr-2007 11:17 | 17K | |
![[SND]](/icons/sound2.gif) | significs.mp3 | 21-Apr-2007 11:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | significatum.mp3 | 21-Apr-2007 11:17 | 17K | |
![[SND]](/icons/sound2.gif) | significative.mp3 | 21-Apr-2007 11:17 | 10K | |
![[SND]](/icons/sound2.gif) | signification.mp3 | 21-Apr-2007 11:16 | 11K | |
![[SND]](/icons/sound2.gif) | significantly.mp3 | 21-Apr-2007 11:16 | 10K | |
![[SND]](/icons/sound2.gif) | significant.mp3 | 21-Apr-2007 11:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | significancy.mp3 | 21-Apr-2007 11:16 | 11K | |
![[SND]](/icons/sound2.gif) | significance.mp3 | 21-Apr-2007 11:16 | 11K | |
![[SND]](/icons/sound2.gif) | signifiant.mp3 | 21-Apr-2007 11:16 | 17K | |
![[SND]](/icons/sound2.gif) | signet.mp3 | 21-Apr-2007 11:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | signer.mp3 | 21-Apr-2007 11:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | signee.mp3 | 21-Apr-2007 11:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | signed.mp3 | 21-Apr-2007 11:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | signboard.mp3 | 21-Apr-2007 11:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | signature.mp3 | 21-Apr-2007 11:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | signatory.mp3 | 21-Apr-2007 11:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | signary.mp3 | 21-Apr-2007 11:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | signalment.mp3 | 21-Apr-2007 11:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | signalman.mp3 | 21-Apr-2007 11:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | signally.mp3 | 21-Apr-2007 11:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | signalling.mp3 | 21-Apr-2007 11:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | signalize.mp3 | 21-Apr-2007 11:16 | 10K | |
![[SND]](/icons/sound2.gif) | signalization.mp3 | 21-Apr-2007 11:16 | 12K | |
![[SND]](/icons/sound2.gif) | signalise.mp3 | 21-Apr-2007 11:16 | 17K | |
![[SND]](/icons/sound2.gif) | signaler.mp3 | 21-Apr-2007 11:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | signal.mp3 | 21-Apr-2007 11:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | signage.mp3 | 21-Apr-2007 11:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | signac.mp3 | 21-Apr-2007 11:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | signable.mp3 | 21-Apr-2007 11:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | signa.mp3 | 21-Apr-2007 11:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | sign.mp3 | 21-Apr-2007 11:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | sign-up.mp3 | 21-Apr-2007 11:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | sign-out.mp3 | 21-Apr-2007 11:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | sign-on.mp3 | 21-Apr-2007 11:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | sign-off.mp3 | 21-Apr-2007 11:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | sigmund.mp3 | 21-Apr-2007 11:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | sigmoidoscopy.mp3 | 21-Apr-2007 11:15 | 12K | |
![[SND]](/icons/sound2.gif) | sigmoidoscopic.mp3 | 21-Apr-2007 11:15 | 11K | |
![[SND]](/icons/sound2.gif) | sigmoidoscope.mp3 | 21-Apr-2007 11:15 | 10K | |
![[SND]](/icons/sound2.gif) | sigmoidally.mp3 | 21-Apr-2007 11:15 | 10K | |
![[SND]](/icons/sound2.gif) | sigmoidal.mp3 | 21-Apr-2007 11:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | sigmoid.mp3 | 21-Apr-2007 11:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | sigmatism.mp3 | 21-Apr-2007 11:15 | 17K | |
![[SND]](/icons/sound2.gif) | sigmate.mp3 | 21-Apr-2007 11:15 | 17K | |
![[SND]](/icons/sound2.gif) | sigma.mp3 | 21-Apr-2007 11:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | siglum.mp3 | 21-Apr-2007 11:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | siglos.mp3 | 21-Apr-2007 11:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | sigillography.mp3 | 21-Apr-2007 11:15 | 17K | |
![[SND]](/icons/sound2.gif) | sigillate.mp3 | 21-Apr-2007 11:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | sigil.mp3 | 21-Apr-2007 11:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | sightseer.mp3 | 21-Apr-2007 11:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | sightseeing.mp3 | 21-Apr-2007 11:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | sightsee.mp3 | 21-Apr-2007 11:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | sightread.mp3 | 21-Apr-2007 11:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | sightly.mp3 | 21-Apr-2007 11:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | sightless.mp3 | 21-Apr-2007 11:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | sighting.mp3 | 21-Apr-2007 11:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | sighter.mp3 | 21-Apr-2007 11:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | sighted.mp3 | 21-Apr-2007 11:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | sight.mp3 | 21-Apr-2007 11:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | sight-seeing.mp3 | 21-Apr-2007 11:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | sight-reading.mp3 | 21-Apr-2007 11:14 | 9.5K | |
![[SND]](/icons/sound2.gif) | sight-read.mp3 | 21-Apr-2007 11:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | sighful.mp3 | 21-Apr-2007 11:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | sigher.mp3 | 21-Apr-2007 11:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | sigh.mp3 | 21-Apr-2007 11:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | siggeir.mp3 | 21-Apr-2007 11:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | sigatoka.mp3 | 21-Apr-2007 11:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | siganid.mp3 | 21-Apr-2007 11:14 | 17K | |
![[SND]](/icons/sound2.gif) | sifting.mp3 | 21-Apr-2007 11:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | sifter.mp3 | 21-Apr-2007 11:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | sift.mp3 | 21-Apr-2007 11:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | sifreitorah.mp3 | 21-Apr-2007 11:14 | 17K | |
![[SND]](/icons/sound2.gif) | sifnos.mp3 | 21-Apr-2007 11:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | siffleur.mp3 | 21-Apr-2007 11:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | siff.mp3 | 21-Apr-2007 11:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | sifaka.mp3 | 21-Apr-2007 11:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | sievert.mp3 | 21-Apr-2007 11:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | sievers.mp3 | 21-Apr-2007 11:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | sieve of Eratosthenes.mp3 | 21-Apr-2007 11:13 | 19K | |
![[SND]](/icons/sound2.gif) | sieve.mp3 | 21-Apr-2007 11:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | sievabean.mp3 | 21-Apr-2007 11:13 | 17K | |
![[SND]](/icons/sound2.gif) | sieva bean.mp3 | 21-Apr-2007 11:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | siesta.mp3 | 21-Apr-2007 11:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | sierranevada.mp3 | 21-Apr-2007 11:13 | 17K | |
![[SND]](/icons/sound2.gif) | sierran.mp3 | 21-Apr-2007 11:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | sierramorena.mp3 | 21-Apr-2007 11:13 | 17K | |
![[SND]](/icons/sound2.gif) | sierramadre.mp3 | 21-Apr-2007 11:13 | 17K | |
![[SND]](/icons/sound2.gif) | sierraleone.mp3 | 21-Apr-2007 11:13 | 17K | |
![[SND]](/icons/sound2.gif) | sierra.mp3 | 21-Apr-2007 11:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | sierozem.mp3 | 21-Apr-2007 11:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | siepi.mp3 | 21-Apr-2007 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | sienna.mp3 | 21-Apr-2007 11:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | sienese.mp3 | 21-Apr-2007 11:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | siena.mp3 | 21-Apr-2007 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | siemreap.mp3 | 21-Apr-2007 11:12 | 17K | |
![[SND]](/icons/sound2.gif) | siemens.mp3 | 21-Apr-2007 11:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | sieglinde.mp3 | 21-Apr-2007 11:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | siegheil.mp3 | 21-Apr-2007 11:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | siege.mp3 | 21-Apr-2007 11:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | siecledor.mp3 | 21-Apr-2007 11:12 | 17K | |
![[SND]](/icons/sound2.gif) | siebold.mp3 | 21-Apr-2007 11:12 | 17K | |
![[SND]](/icons/sound2.gif) | sidy.mp3 | 21-Apr-2007 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidrah.mp3 | 21-Apr-2007 11:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidra.mp3 | 21-Apr-2007 11:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidotti.mp3 | 21-Apr-2007 11:11 | 17K | |
![[SND]](/icons/sound2.gif) | sidmouth.mp3 | 21-Apr-2007 11:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidling.mp3 | 21-Apr-2007 11:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | sidle.mp3 | 21-Apr-2007 11:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | siding.mp3 | 21-Apr-2007 11:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | sidiifni.mp3 | 21-Apr-2007 11:11 | 17K | |
![[SND]](/icons/sound2.gif) | sidibelabbes.mp3 | 21-Apr-2007 11:11 | 17K | |
![[SND]](/icons/sound2.gif) | sidh.mp3 | 21-Apr-2007 11:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidey.mp3 | 21-Apr-2007 11:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidewise.mp3 | 21-Apr-2007 11:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | sidewinder.mp3 | 21-Apr-2007 11:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | sidewind.mp3 | 21-Apr-2007 11:11 | 17K | |
![[SND]](/icons/sound2.gif) | sideways.mp3 | 21-Apr-2007 11:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | sideway.mp3 | 21-Apr-2007 11:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | sidewards.mp3 | 21-Apr-2007 11:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | sideward.mp3 | 21-Apr-2007 11:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | sidewall.mp3 | 21-Apr-2007 11:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | sidewalkcafe.mp3 | 21-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | sidewalk.mp3 | 21-Apr-2007 11:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | sidetrack.mp3 | 21-Apr-2007 11:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sideswipe.mp3 | 21-Apr-2007 11:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | sidestroke.mp3 | 21-Apr-2007 11:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | sidestream.mp3 | 21-Apr-2007 11:10 | 10K | |
![[SND]](/icons/sound2.gif) | sidestep.mp3 | 21-Apr-2007 11:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | sidesplitting.mp3 | 21-Apr-2007 11:10 | 10K | |
![[SND]](/icons/sound2.gif) | sidespin.mp3 | 21-Apr-2007 11:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | sidesman.mp3 | 21-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | sideslip.mp3 | 21-Apr-2007 11:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | sideshow.mp3 | 21-Apr-2007 11:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | sidesaddle.mp3 | 21-Apr-2007 11:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | siderostat.mp3 | 21-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | siderosis.mp3 | 21-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | sideroscope.mp3 | 21-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | siderophilin.mp3 | 21-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | siderophile.mp3 | 21-Apr-2007 11:09 | 17K | |
![[SND]](/icons/sound2.gif) | sideronatrite.mp3 | 21-Apr-2007 11:09 | 17K | |
![[SND]](/icons/sound2.gif) | siderolite.mp3 | 21-Apr-2007 11:09 | 9.8K | |
![[SND]](/icons/sound2.gif) | siderography.mp3 | 21-Apr-2007 11:09 | 17K | |
![[SND]](/icons/sound2.gif) | siderocyte.mp3 | 21-Apr-2007 11:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | siderochrome.mp3 | 21-Apr-2007 11:09 | 17K | |
![[SND]](/icons/sound2.gif) | sidero.mp3 | 21-Apr-2007 11:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | siderite.mp3 | 21-Apr-2007 11:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | sidereal.mp3 | 21-Apr-2007 11:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | sider.mp3 | 21-Apr-2007 11:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidepiece.mp3 | 21-Apr-2007 11:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | sideman.mp3 | 21-Apr-2007 11:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | sidelong.mp3 | 21-Apr-2007 11:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | sideling.mp3 | 21-Apr-2007 11:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | sideliner.mp3 | 21-Apr-2007 11:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | sideline.mp3 | 21-Apr-2007 11:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | sidelight.mp3 | 21-Apr-2007 11:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidekick.mp3 | 21-Apr-2007 11:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | sidehill.mp3 | 21-Apr-2007 11:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | sided.mp3 | 21-Apr-2007 11:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | sidecar.mp3 | 21-Apr-2007 11:08 | 9.3K | |
![[SND]](/icons/sound2.gif) | sideburns.mp3 | 21-Apr-2007 11:08 | 10K | |
![[SND]](/icons/sound2.gif) | sideburned.mp3 | 21-Apr-2007 11:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | sideboard.mp3 | 21-Apr-2007 11:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | sidebar.mp3 | 21-Apr-2007 11:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | sideband.mp3 | 21-Apr-2007 11:08 | 9.3K | |
![[SND]](/icons/sound2.gif) | sidearm.mp3 | 21-Apr-2007 11:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | side.mp3 | 21-Apr-2007 11:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | side-whiskers.mp3 | 21-Apr-2007 11:11 | 11K | |
![[SND]](/icons/sound2.gif) | side-whiskered.mp3 | 21-Apr-2007 11:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | side-wheeler.mp3 | 21-Apr-2007 11:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | side-wheel.mp3 | 21-Apr-2007 11:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | side-scan sonar.mp3 | 21-Apr-2007 11:10 | 14K | |
![[SND]](/icons/sound2.gif) | side-out.mp3 | 21-Apr-2007 11:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | side-glance.mp3 | 21-Apr-2007 11:09 | 10K | |
![[SND]](/icons/sound2.gif) | side-dressing.mp3 | 21-Apr-2007 11:09 | 11K | |
![[SND]](/icons/sound2.gif) | side-dress.mp3 | 21-Apr-2007 11:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | siddurim.mp3 | 21-Apr-2007 11:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | siddur.mp3 | 21-Apr-2007 11:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | siddown.mp3 | 21-Apr-2007 11:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | siddhi.mp3 | 21-Apr-2007 11:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | siddhartha.mp3 | 21-Apr-2007 11:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | siddham.mp3 | 21-Apr-2007 11:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sidamo.mp3 | 21-Apr-2007 11:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sid.mp3 | 21-Apr-2007 11:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sicutpatribussitdeusnobis.mp3 | 21-Apr-2007 11:08 | 27K | |
![[SND]](/icons/sound2.gif) | sicut patribus sit Deus nobis.mp3 | 21-Apr-2007 11:08 | 28K | |
![[SND]](/icons/sound2.gif) | sicutante.mp3 | 21-Apr-2007 11:08 | 17K | |
![[SND]](/icons/sound2.gif) | sicu.mp3 | 21-Apr-2007 11:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | sictransitgloriamundi.mp3 | 21-Apr-2007 11:07 | 27K | |
![[SND]](/icons/sound2.gif) | sic transit gloria mundi.mp3 | 21-Apr-2007 11:06 | 21K | |
![[SND]](/icons/sound2.gif) | sicsempertyrannis.mp3 | 21-Apr-2007 11:07 | 18K | |
![[SND]](/icons/sound2.gif) | sic semper tyrannis.mp3 | 21-Apr-2007 11:06 | 16K | |
![[SND]](/icons/sound2.gif) | sicpassim.mp3 | 21-Apr-2007 11:07 | 17K | |
![[SND]](/icons/sound2.gif) | sic passim.mp3 | 21-Apr-2007 11:06 | 10K | |
![[SND]](/icons/sound2.gif) | sicky.mp3 | 21-Apr-2007 11:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | sickroom.mp3 | 21-Apr-2007 11:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sicko.mp3 | 21-Apr-2007 11:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | sicknick.mp3 | 21-Apr-2007 11:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | sickness.mp3 | 21-Apr-2007 11:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | sickly.mp3 | 21-Apr-2007 11:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | sickling.mp3 | 21-Apr-2007 11:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sicklemia.mp3 | 21-Apr-2007 11:07 | 9.6K | |
![[SND]](/icons/sound2.gif) | sickle.mp3 | 21-Apr-2007 11:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | sickish.mp3 | 21-Apr-2007 11:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | sickie.mp3 | 21-Apr-2007 11:07 | 6.4K | |
![[SND]](/icons/sound2.gif) | sickert.mp3 | 21-Apr-2007 11:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sicker.mp3 | 21-Apr-2007 11:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | sickeningly.mp3 | 21-Apr-2007 11:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | sickening.mp3 | 21-Apr-2007 11:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | sickener.mp3 | 21-Apr-2007 11:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | sicken.mp3 | 21-Apr-2007 11:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | sicked.mp3 | 21-Apr-2007 11:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | sickbed.mp3 | 21-Apr-2007 11:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | sick.mp3 | 21-Apr-2007 11:06 | 5.2K | |
![[SND]](/icons/sound2.gif) | sick-out.mp3 | 21-Apr-2007 11:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | sic itur ad astra.mp3 | 21-Apr-2007 11:06 | 16K | |
![[SND]](/icons/sound2.gif) | siciliestwo.mp3 | 21-Apr-2007 11:06 | 17K | |
![[SND]](/icons/sound2.gif) | siciliano.mp3 | 21-Apr-2007 11:06 | 17K | |
![[SND]](/icons/sound2.gif) | sicht.mp3 | 21-Apr-2007 11:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | sice.mp3 | 21-Apr-2007 11:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | siccative.mp3 | 21-Apr-2007 11:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | siccar.mp3 | 21-Apr-2007 11:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | sicanian.mp3 | 21-Apr-2007 11:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | sica.mp3 | 21-Apr-2007 11:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sic.mp3 | 21-Apr-2007 11:06 | 5.2K | |
![[SND]](/icons/sound2.gif) | sibylline.mp3 | 21-Apr-2007 11:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | sibyllic.mp3 | 21-Apr-2007 11:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | sibylla.mp3 | 21-Apr-2007 11:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sibyl.mp3 | 21-Apr-2007 11:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | sibling.mp3 | 21-Apr-2007 11:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | sibir.mp3 | 21-Apr-2007 11:05 | 17K | |
![[SND]](/icons/sound2.gif) | sibilation.mp3 | 21-Apr-2007 11:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | sibilate.mp3 | 21-Apr-2007 11:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | sibilant.mp3 | 21-Apr-2007 11:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | sibilance.mp3 | 21-Apr-2007 11:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | siberite.mp3 | 21-Apr-2007 11:05 | 17K | |
![[SND]](/icons/sound2.gif) | sibbaldsrorqual.mp3 | 21-Apr-2007 11:05 | 17K | |
![[SND]](/icons/sound2.gif) | sib.mp3 | 21-Apr-2007 11:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | siauliai.mp3 | 21-Apr-2007 11:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | siangchiang.mp3 | 21-Apr-2007 11:05 | 17K | |
![[SND]](/icons/sound2.gif) | siamang.mp3 | 21-Apr-2007 11:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | sialorrhea.mp3 | 21-Apr-2007 11:05 | 17K | |
![[SND]](/icons/sound2.gif) | sialoid.mp3 | 21-Apr-2007 11:05 | 17K | |
![[SND]](/icons/sound2.gif) | sialid.mp3 | 21-Apr-2007 11:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sialicacid.mp3 | 21-Apr-2007 11:04 | 17K | |
![[SND]](/icons/sound2.gif) | sialic.mp3 | 21-Apr-2007 11:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sialagogue.mp3 | 21-Apr-2007 11:04 | 11K | |
![[SND]](/icons/sound2.gif) | sialagogic.mp3 | 21-Apr-2007 11:04 | 17K | |
![[SND]](/icons/sound2.gif) | sialadenitis.mp3 | 21-Apr-2007 11:04 | 17K | |
![[SND]](/icons/sound2.gif) | sial.mp3 | 21-Apr-2007 11:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | siabon.mp3 | 21-Apr-2007 11:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | si.mp3 | 21-Apr-2007 11:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | shyster.mp3 | 21-Apr-2007 11:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | shypoo.mp3 | 21-Apr-2007 11:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | shylock.mp3 | 21-Apr-2007 11:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | shyest.mp3 | 21-Apr-2007 11:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | shyer.mp3 | 21-Apr-2007 11:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | shydragersyndrome.mp3 | 21-Apr-2007 11:04 | 17K | |
![[SND]](/icons/sound2.gif) | shy.mp3 | 21-Apr-2007 11:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | shwench.mp3 | 21-Apr-2007 11:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | shwa.mp3 | 21-Apr-2007 11:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | shvindle.mp3 | 21-Apr-2007 11:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | shvartze.mp3 | 21-Apr-2007 11:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | shvantz.mp3 | 21-Apr-2007 11:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | shuzit.mp3 | 21-Apr-2007 11:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | shuttling.mp3 | 21-Apr-2007 11:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | shuttlecock.mp3 | 21-Apr-2007 11:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | shuttle.mp3 | 21-Apr-2007 11:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | shutterless.mp3 | 21-Apr-2007 11:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | shuttering.mp3 | 21-Apr-2007 11:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | shutterbug.mp3 | 21-Apr-2007 11:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | shutter.mp3 | 21-Apr-2007 11:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | shutout.mp3 | 21-Apr-2007 11:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | shutoff.mp3 | 21-Apr-2007 11:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | shutdown.mp3 | 21-Apr-2007 11:03 | 9.8K | |
![[SND]](/icons/sound2.gif) | shut.mp3 | 21-Apr-2007 11:03 | 5.4K | |
![[SND]](/icons/sound2.gif) | shut-in.mp3 | 21-Apr-2007 11:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | shut-eye.mp3 | 21-Apr-2007 11:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | shush.mp3 | 21-Apr-2007 11:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | shuper.mp3 | 21-Apr-2007 11:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | shuntwound.mp3 | 21-Apr-2007 11:03 | 17K | |
![[SND]](/icons/sound2.gif) | shuntingengine.mp3 | 21-Apr-2007 11:02 | 17K | |
![[SND]](/icons/sound2.gif) | shunter.mp3 | 21-Apr-2007 11:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | shunt.mp3 | 21-Apr-2007 11:02 | 5.5K | |
![[SND]](/icons/sound2.gif) | shunpiking.mp3 | 21-Apr-2007 11:02 | 10K | |
![[SND]](/icons/sound2.gif) | shunpiker.mp3 | 21-Apr-2007 11:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | shunpike.mp3 | 21-Apr-2007 11:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | shun.mp3 | 21-Apr-2007 11:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | shumanprocess.mp3 | 21-Apr-2007 11:02 | 17K | |
![[SND]](/icons/sound2.gif) | shulwar.mp3 | 21-Apr-2007 11:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | shulhanarukh.mp3 | 21-Apr-2007 11:02 | 17K | |
![[SND]](/icons/sound2.gif) | shulamite.mp3 | 21-Apr-2007 11:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | shul.mp3 | 21-Apr-2007 11:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | shuhan.mp3 | 21-Apr-2007 11:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | shuggy.mp3 | 21-Apr-2007 11:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | shufu.mp3 | 21-Apr-2007 11:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | shufty.mp3 | 21-Apr-2007 11:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | shuffling.mp3 | 21-Apr-2007 11:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | shuffler.mp3 | 21-Apr-2007 11:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | shuffleboard.mp3 | 21-Apr-2007 11:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | shuffle.mp3 | 21-Apr-2007 11:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | shudra.mp3 | 21-Apr-2007 11:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | shuddery.mp3 | 21-Apr-2007 11:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | shuddering.mp3 | 21-Apr-2007 11:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | shudder.mp3 | 21-Apr-2007 11:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | shucks.mp3 | 21-Apr-2007 11:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | shucking.mp3 | 21-Apr-2007 11:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | shuck.mp3 | 21-Apr-2007 11:01 | 5.2K | |
![[SND]](/icons/sound2.gif) | shubertalley.mp3 | 21-Apr-2007 11:01 | 17K | |
![[SND]](/icons/sound2.gif) | shu.mp3 | 21-Apr-2007 11:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | shtup.mp3 | 21-Apr-2007 11:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | shtum.mp3 | 21-Apr-2007 11:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | shtoonk.mp3 | 21-Apr-2007 11:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | shtoon.mp3 | 21-Apr-2007 11:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | shtook.mp3 | 21-Apr-2007 11:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | shticky.mp3 | 21-Apr-2007 11:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | shtick.mp3 | 21-Apr-2007 11:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | shtetlach.mp3 | 21-Apr-2007 11:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | shtetl.mp3 | 21-Apr-2007 11:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | shtetel.mp3 | 21-Apr-2007 11:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | shtarker.mp3 | 21-Apr-2007 11:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | shrunken.mp3 | 21-Apr-2007 11:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | shrunk.mp3 | 21-Apr-2007 11:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | shrug.mp3 | 21-Apr-2007 11:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | shrubland.mp3 | 21-Apr-2007 11:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | shrubby.mp3 | 21-Apr-2007 11:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | shrubbery.mp3 | 21-Apr-2007 11:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | shrub.mp3 | 21-Apr-2007 11:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | shrove.mp3 | 21-Apr-2007 11:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | shroud.mp3 | 21-Apr-2007 11:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | shroom.mp3 | 21-Apr-2007 11:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | shroff.mp3 | 21-Apr-2007 11:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | shriven.mp3 | 21-Apr-2007 11:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | shrivelling.mp3 | 21-Apr-2007 11:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | shrivel.mp3 | 21-Apr-2007 11:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | shrive.mp3 | 21-Apr-2007 11:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | shrinker.mp3 | 21-Apr-2007 11:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | shrinkage.mp3 | 21-Apr-2007 11:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | shrinkable.mp3 | 21-Apr-2007 11:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | shrink.mp3 | 21-Apr-2007 11:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | shrink-wrap.mp3 | 21-Apr-2007 11:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | shrine.mp3 | 21-Apr-2007 11:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | shrimpy.mp3 | 21-Apr-2007 11:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | shrimplike.mp3 | 21-Apr-2007 11:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | shrimping.mp3 | 21-Apr-2007 10:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | shrimper.mp3 | 21-Apr-2007 10:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | shrimp.mp3 | 21-Apr-2007 10:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | shrilly.mp3 | 21-Apr-2007 10:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | shrill.mp3 | 21-Apr-2007 10:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | shrike.mp3 | 21-Apr-2007 10:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | shrift.mp3 | 21-Apr-2007 10:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | shrieve.mp3 | 21-Apr-2007 10:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | shrievalty.mp3 | 21-Apr-2007 10:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | shrieval.mp3 | 21-Apr-2007 10:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | shriek.mp3 | 21-Apr-2007 10:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | shri.mp3 | 21-Apr-2007 10:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | shrewlike.mp3 | 21-Apr-2007 10:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | shrewish.mp3 | 21-Apr-2007 10:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | shrewdie.mp3 | 21-Apr-2007 10:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | shrewd.mp3 | 21-Apr-2007 10:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | shrew.mp3 | 21-Apr-2007 10:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | shredding.mp3 | 21-Apr-2007 10:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | shreddies.mp3 | 21-Apr-2007 10:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | shredder.mp3 | 21-Apr-2007 10:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | shredded.mp3 | 21-Apr-2007 10:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | shred.mp3 | 21-Apr-2007 10:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | shreadhead.mp3 | 21-Apr-2007 10:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | shrapnel.mp3 | 21-Apr-2007 10:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | shrank.mp3 | 21-Apr-2007 10:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | shraddha.mp3 | 21-Apr-2007 10:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | shpritz.mp3 | 21-Apr-2007 10:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | shpos.mp3 | 21-Apr-2007 10:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | shpleef.mp3 | 21-Apr-2007 10:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | shpilkes.mp3 | 21-Apr-2007 10:58 | 17K | |
![[SND]](/icons/sound2.gif) | shoyu.mp3 | 21-Apr-2007 10:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | showy.mp3 | 21-Apr-2007 10:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | showtime.mp3 | 21-Apr-2007 10:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | showstopping.mp3 | 21-Apr-2007 10:58 | 10K | |
![[SND]](/icons/sound2.gif) | showstopper.mp3 | 21-Apr-2007 10:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | showroom.mp3 | 21-Apr-2007 10:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | showplace.mp3 | 21-Apr-2007 10:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | showpiece.mp3 | 21-Apr-2007 10:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | shown.mp3 | 21-Apr-2007 10:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | showmanship.mp3 | 21-Apr-2007 10:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | showman.mp3 | 21-Apr-2007 10:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | showing.mp3 | 21-Apr-2007 10:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | showiness.mp3 | 21-Apr-2007 10:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | showily.mp3 | 21-Apr-2007 10:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | showgirl.mp3 | 21-Apr-2007 10:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | showery.mp3 | 21-Apr-2007 10:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | showertea.mp3 | 21-Apr-2007 10:57 | 17K | |
![[SND]](/icons/sound2.gif) | showerstall.mp3 | 21-Apr-2007 10:57 | 17K | |
![[SND]](/icons/sound2.gif) | showerproof.mp3 | 21-Apr-2007 10:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | showerless.mp3 | 21-Apr-2007 10:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | showerhead.mp3 | 21-Apr-2007 10:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | showerer.mp3 | 21-Apr-2007 10:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | shower.mp3 | 21-Apr-2007 10:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | showed.mp3 | 21-Apr-2007 10:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | showdown.mp3 | 21-Apr-2007 10:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | showd.mp3 | 21-Apr-2007 10:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | showcase.mp3 | 21-Apr-2007 10:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | showboat.mp3 | 21-Apr-2007 10:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | showbizzy.mp3 | 21-Apr-2007 10:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | showbiz.mp3 | 21-Apr-2007 10:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | showable.mp3 | 21-Apr-2007 10:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | show.mp3 | 21-Apr-2007 10:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | show-offy.mp3 | 21-Apr-2007 10:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | show-off.mp3 | 21-Apr-2007 10:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | show-me.mp3 | 21-Apr-2007 10:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | show-and-tell.mp3 | 21-Apr-2007 10:57 | 10K | |
![[SND]](/icons/sound2.gif) | shover.mp3 | 21-Apr-2007 10:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | shovelsful.mp3 | 21-Apr-2007 10:57 | 10K | |
![[SND]](/icons/sound2.gif) | shovelnose.mp3 | 21-Apr-2007 10:56 | 11K | |
![[SND]](/icons/sound2.gif) | shovelman.mp3 | 21-Apr-2007 10:56 | 17K | |
![[SND]](/icons/sound2.gif) | shovelling.mp3 | 21-Apr-2007 10:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | shoveller.mp3 | 21-Apr-2007 10:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | shovelfuls.mp3 | 21-Apr-2007 10:56 | 11K | |
![[SND]](/icons/sound2.gif) | shovelful.mp3 | 21-Apr-2007 10:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | shoveler.mp3 | 21-Apr-2007 10:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | shovel.mp3 | 21-Apr-2007 10:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | shovel-nosed.mp3 | 21-Apr-2007 10:57 | 10K | |
![[SND]](/icons/sound2.gif) | shovehapenny.mp3 | 21-Apr-2007 10:56 | 17K | |
![[SND]](/icons/sound2.gif) | shove.mp3 | 21-Apr-2007 10:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | shouting.mp3 | 21-Apr-2007 10:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | shout.mp3 | 21-Apr-2007 10:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | shout-out.mp3 | 21-Apr-2007 10:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | shouse.mp3 | 21-Apr-2007 10:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | shoup.mp3 | 21-Apr-2007 10:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | shouldst.mp3 | 21-Apr-2007 10:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | shouldnt.mp3 | 21-Apr-2007 10:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | shouldna.mp3 | 21-Apr-2007 10:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | shouldn't.mp3 | 21-Apr-2007 10:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | shouldest.mp3 | 21-Apr-2007 10:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | shouldering.mp3 | 21-Apr-2007 10:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | shouldered.mp3 | 21-Apr-2007 10:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoulder.mp3 | 21-Apr-2007 10:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | should.mp3 | 21-Apr-2007 10:55 | 5.9K | |
![[SND]](/icons/sound2.gif) | shotting.mp3 | 21-Apr-2007 10:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | shotten.mp3 | 21-Apr-2007 10:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | shott.mp3 | 21-Apr-2007 10:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | shotgunner.mp3 | 21-Apr-2007 10:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | shotgun.mp3 | 21-Apr-2007 10:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | shote.mp3 | 21-Apr-2007 10:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | shot.mp3 | 21-Apr-2007 10:55 | 6.1K | |
![[SND]](/icons/sound2.gif) | shot-putter.mp3 | 21-Apr-2007 10:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | shoshonean.mp3 | 21-Apr-2007 10:55 | 17K | |
![[SND]](/icons/sound2.gif) | shorty.mp3 | 21-Apr-2007 10:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | shortwinded.mp3 | 21-Apr-2007 10:55 | 17K | |
![[SND]](/icons/sound2.gif) | short weight.mp3 | 21-Apr-2007 10:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | shortwave.mp3 | 21-Apr-2007 10:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | shortstop.mp3 | 21-Apr-2007 10:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | shortsighted.mp3 | 21-Apr-2007 10:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | shortness.mp3 | 21-Apr-2007 10:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | shortly.mp3 | 21-Apr-2007 10:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | shortlived.mp3 | 21-Apr-2007 10:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | shortleaf pine.mp3 | 21-Apr-2007 10:54 | 12K | |
![[SND]](/icons/sound2.gif) | shortish.mp3 | 21-Apr-2007 10:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | shortie.mp3 | 21-Apr-2007 10:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | shortia.mp3 | 21-Apr-2007 10:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | shorthorn.mp3 | 21-Apr-2007 10:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | shorthanded.mp3 | 21-Apr-2007 10:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | shorthand.mp3 | 21-Apr-2007 10:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | shorthair.mp3 | 21-Apr-2007 10:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | shortfall.mp3 | 21-Apr-2007 10:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | shortercatechism.mp3 | 21-Apr-2007 10:54 | 17K | |
![[SND]](/icons/sound2.gif) | shorter.mp3 | 21-Apr-2007 10:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | shortening.mp3 | 21-Apr-2007 10:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | shortener.mp3 | 21-Apr-2007 10:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | shorten.mp3 | 21-Apr-2007 10:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | shortcut.mp3 | 21-Apr-2007 10:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | shortcoming.mp3 | 21-Apr-2007 10:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | shortchange.mp3 | 21-Apr-2007 10:53 | 11K | |
![[SND]](/icons/sound2.gif) | shortcake.mp3 | 21-Apr-2007 10:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | shortbread.mp3 | 21-Apr-2007 10:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | shortage.mp3 | 21-Apr-2007 10:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | short.mp3 | 21-Apr-2007 10:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | short-winded.mp3 | 21-Apr-2007 10:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | short-weight.mp3 | 21-Apr-2007 10:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | short-term.mp3 | 21-Apr-2007 10:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | short-tempered.mp3 | 21-Apr-2007 10:55 | 10K | |
![[SND]](/icons/sound2.gif) | short-stop.mp3 | 21-Apr-2007 10:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | short-spoken.mp3 | 21-Apr-2007 10:55 | 11K | |
![[SND]](/icons/sound2.gif) | short-range.mp3 | 21-Apr-2007 10:54 | 10K | |
![[SND]](/icons/sound2.gif) | short-order.mp3 | 21-Apr-2007 10:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | short-nosed cattle louse.mp3 | 21-Apr-2007 10:54 | 15K | |
![[SND]](/icons/sound2.gif) | short-lived.mp3 | 21-Apr-2007 10:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | short-horned grasshopper.mp3 | 21-Apr-2007 10:54 | 14K | |
![[SND]](/icons/sound2.gif) | short-haul.mp3 | 21-Apr-2007 10:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | short-grass prairie.mp3 | 21-Apr-2007 10:54 | 12K | |
![[SND]](/icons/sound2.gif) | short-eared owl.mp3 | 21-Apr-2007 10:53 | 11K | |
![[SND]](/icons/sound2.gif) | short-day.mp3 | 21-Apr-2007 10:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | shorn.mp3 | 21-Apr-2007 10:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | shoring.mp3 | 21-Apr-2007 10:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | shoreweed.mp3 | 21-Apr-2007 10:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | shorewards.mp3 | 21-Apr-2007 10:53 | 10K | |
![[SND]](/icons/sound2.gif) | shoreward.mp3 | 21-Apr-2007 10:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | shoreside.mp3 | 21-Apr-2007 10:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | shoreline.mp3 | 21-Apr-2007 10:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | shoreless.mp3 | 21-Apr-2007 10:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | shorefront.mp3 | 21-Apr-2007 10:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | shorebird.mp3 | 21-Apr-2007 10:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | shore.mp3 | 21-Apr-2007 10:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | shoran.mp3 | 21-Apr-2007 10:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | shopworn.mp3 | 21-Apr-2007 10:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | shopwindow.mp3 | 21-Apr-2007 10:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | shoptalk.mp3 | 21-Apr-2007 10:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | shoppy.mp3 | 21-Apr-2007 10:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | shopping.mp3 | 21-Apr-2007 10:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | shoppie.mp3 | 21-Apr-2007 10:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | shopper.mp3 | 21-Apr-2007 10:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | shoppe.mp3 | 21-Apr-2007 10:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | shopman.mp3 | 21-Apr-2007 10:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | shoplifter.mp3 | 21-Apr-2007 10:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | shoplift.mp3 | 21-Apr-2007 10:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | shopkeeper.mp3 | 21-Apr-2007 10:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | shophar.mp3 | 21-Apr-2007 10:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | shopgirl.mp3 | 21-Apr-2007 10:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | shopful.mp3 | 21-Apr-2007 10:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | shopevirus.mp3 | 21-Apr-2007 10:52 | 17K | |
![[SND]](/icons/sound2.gif) | shopaholic.mp3 | 21-Apr-2007 10:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | shop.mp3 | 21-Apr-2007 10:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | shop-soiled.mp3 | 21-Apr-2007 10:52 | 10K | |
![[SND]](/icons/sound2.gif) | shootist.mp3 | 21-Apr-2007 10:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | shooting.mp3 | 21-Apr-2007 10:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | shooter.mp3 | 21-Apr-2007 10:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | shootemup.mp3 | 21-Apr-2007 10:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | shoot.mp3 | 21-Apr-2007 10:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | shoot-up.mp3 | 21-Apr-2007 10:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | shoot-the-chutes.mp3 | 21-Apr-2007 10:52 | 11K | |
![[SND]](/icons/sound2.gif) | shoot-out.mp3 | 21-Apr-2007 10:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | shoot-'em-up.mp3 | 21-Apr-2007 10:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoon.mp3 | 21-Apr-2007 10:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | shoomers.mp3 | 21-Apr-2007 10:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | shool.mp3 | 21-Apr-2007 10:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | shook.mp3 | 21-Apr-2007 10:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | shook-up.mp3 | 21-Apr-2007 10:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | shoogle.mp3 | 21-Apr-2007 10:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoofly.mp3 | 21-Apr-2007 10:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | shoobies.mp3 | 21-Apr-2007 10:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | shoo.mp3 | 21-Apr-2007 10:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | shoo-in.mp3 | 21-Apr-2007 10:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | shonky.mp3 | 21-Apr-2007 10:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | shonkie.mp3 | 21-Apr-2007 10:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | shonk.mp3 | 21-Apr-2007 10:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | shonicker.mp3 | 21-Apr-2007 10:51 | 17K | |
![[SND]](/icons/sound2.gif) | shoneen.mp3 | 21-Apr-2007 10:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | shone.mp3 | 21-Apr-2007 10:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | shon.mp3 | 21-Apr-2007 10:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | shommus.mp3 | 21-Apr-2007 10:50 | 17K | |
![[SND]](/icons/sound2.gif) | sholom.mp3 | 21-Apr-2007 10:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sholes.mp3 | 21-Apr-2007 10:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sholemaleichem.mp3 | 21-Apr-2007 10:50 | 17K | |
![[SND]](/icons/sound2.gif) | shoji.mp3 | 21-Apr-2007 10:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | shohet.mp3 | 21-Apr-2007 10:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | shogunate.mp3 | 21-Apr-2007 10:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | shogunal.mp3 | 21-Apr-2007 10:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | shogun.mp3 | 21-Apr-2007 10:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | shog.mp3 | 21-Apr-2007 10:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | shofroth.mp3 | 21-Apr-2007 10:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | shofar.mp3 | 21-Apr-2007 10:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoey.mp3 | 21-Apr-2007 10:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | shoestring.mp3 | 21-Apr-2007 10:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | shoer.mp3 | 21-Apr-2007 10:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoepack.mp3 | 21-Apr-2007 10:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | shoepac.mp3 | 21-Apr-2007 10:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | shoemaker.mp3 | 21-Apr-2007 10:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | shoelace.mp3 | 21-Apr-2007 10:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | shoeing.mp3 | 21-Apr-2007 10:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | shoehorn.mp3 | 21-Apr-2007 10:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | shoed.mp3 | 21-Apr-2007 10:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | shoeblack.mp3 | 21-Apr-2007 10:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | shoebill.mp3 | 21-Apr-2007 10:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | shoe.mp3 | 21-Apr-2007 10:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | shoe-leather.mp3 | 21-Apr-2007 10:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | shoddy.mp3 | 21-Apr-2007 10:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | shoddiness.mp3 | 21-Apr-2007 10:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | shoddily.mp3 | 21-Apr-2007 10:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | shodden.mp3 | 21-Apr-2007 10:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | shod.mp3 | 21-Apr-2007 10:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | shockproof.mp3 | 21-Apr-2007 10:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | shockingly.mp3 | 21-Apr-2007 10:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | shocking.mp3 | 21-Apr-2007 10:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | shocker.mp3 | 21-Apr-2007 10:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | shockable.mp3 | 21-Apr-2007 10:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | shock.mp3 | 21-Apr-2007 10:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | shochet.mp3 | 21-Apr-2007 10:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoat.mp3 | 21-Apr-2007 10:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | shoaly.mp3 | 21-Apr-2007 10:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoal.mp3 | 21-Apr-2007 10:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | shoad.mp3 | 21-Apr-2007 10:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | shoa.mp3 | 21-Apr-2007 10:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | shnoz.mp3 | 21-Apr-2007 10:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | shnorrer.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shnook.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shnockered.mp3 | 21-Apr-2007 10:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | shnide.mp3 | 21-Apr-2007 10:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | shnazzy.mp3 | 21-Apr-2007 10:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | shnazz.mp3 | 21-Apr-2007 10:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | shnaps.mp3 | 21-Apr-2007 10:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | shmutz.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shmuck.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shmooze.mp3 | 21-Apr-2007 10:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | shmo.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shmendrick.mp3 | 21-Apr-2007 10:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | shmen.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shmegeggy.mp3 | 21-Apr-2007 10:48 | 17K | |
![[SND]](/icons/sound2.gif) | shmee.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shmeck.mp3 | 21-Apr-2007 10:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | shmear.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shmatte.mp3 | 21-Apr-2007 10:48 | 17K | |
![[SND]](/icons/sound2.gif) | shmarmy.mp3 | 21-Apr-2007 10:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | shmaltzy.mp3 | 21-Apr-2007 10:48 | 17K | |
![[SND]](/icons/sound2.gif) | shmaltz.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shmack.mp3 | 21-Apr-2007 10:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | shm.mp3 | 21-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | shlump.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shluh.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shlub.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shloshim.mp3 | 21-Apr-2007 10:47 | 17K | |
![[SND]](/icons/sound2.gif) | shlook.mp3 | 21-Apr-2007 10:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | shlong.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shlocky.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shlock.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shlimazel.mp3 | 21-Apr-2007 10:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | shlepper.mp3 | 21-Apr-2007 10:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | shlep.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shlemiel.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shkotzim.mp3 | 21-Apr-2007 10:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | shivoo.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shivewheel.mp3 | 21-Apr-2007 10:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | shivery.mp3 | 21-Apr-2007 10:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | shiveringowl.mp3 | 21-Apr-2007 10:47 | 17K | |
![[SND]](/icons/sound2.gif) | shivering.mp3 | 21-Apr-2007 10:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | shiver.mp3 | 21-Apr-2007 10:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | shively.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shivee.mp3 | 21-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | shive.mp3 | 21-Apr-2007 10:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | shivaree.mp3 | 21-Apr-2007 10:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | shivaji.mp3 | 21-Apr-2007 10:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | shivahasarbetammuz.mp3 | 21-Apr-2007 10:46 | 18K | |
![[SND]](/icons/sound2.gif) | shivah.mp3 | 21-Apr-2007 10:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | shiv.mp3 | 21-Apr-2007 10:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | shiur.mp3 | 21-Apr-2007 10:46 | 17K | |
![[SND]](/icons/sound2.gif) | shitty.mp3 | 21-Apr-2007 10:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | shitting.mp3 | 21-Apr-2007 10:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | shittimwood.mp3 | 21-Apr-2007 10:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | shittim.mp3 | 21-Apr-2007 10:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | shitter.mp3 | 21-Apr-2007 10:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | shittah.mp3 | 21-Apr-2007 10:46 | 5.5K | |
![[SND]](/icons/sound2.gif) | shitsure.mp3 | 21-Apr-2007 10:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | shitsky.mp3 | 21-Apr-2007 10:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | shitload.mp3 | 21-Apr-2007 10:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | shitless.mp3 | 21-Apr-2007 10:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | shite.mp3 | 21-Apr-2007 10:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | shit.mp3 | 21-Apr-2007 10:46 | 5.2K | |
![[SND]](/icons/sound2.gif) | shishya.mp3 | 21-Apr-2007 10:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | shishkebab.mp3 | 21-Apr-2007 10:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | shish kebab.mp3 | 21-Apr-2007 10:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | shishi.mp3 | 21-Apr-2007 10:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | shirty.mp3 | 21-Apr-2007 10:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | shirtwaist.mp3 | 21-Apr-2007 10:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | shirttail.mp3 | 21-Apr-2007 10:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | shirtsleeves.mp3 | 21-Apr-2007 10:45 | 10K | |
![[SND]](/icons/sound2.gif) | shirtsleeved.mp3 | 21-Apr-2007 10:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | shirtsleeve.mp3 | 21-Apr-2007 10:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | shirtmaker.mp3 | 21-Apr-2007 10:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | shirtless.mp3 | 21-Apr-2007 10:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | shirting.mp3 | 21-Apr-2007 10:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | shirtfront.mp3 | 21-Apr-2007 10:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | shirtdress.mp3 | 21-Apr-2007 10:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | shirt.mp3 | 21-Apr-2007 10:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | shirring.mp3 | 21-Apr-2007 10:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | shirr.mp3 | 21-Apr-2007 10:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | shirleen.mp3 | 21-Apr-2007 10:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | shirker.mp3 | 21-Apr-2007 10:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | shirk.mp3 | 21-Apr-2007 10:45 | 5.9K | |
![[SND]](/icons/sound2.gif) | shirehighlands.mp3 | 21-Apr-2007 10:45 | 17K | |
![[SND]](/icons/sound2.gif) | shire.mp3 | 21-Apr-2007 10:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | shiralee.mp3 | 21-Apr-2007 10:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | shipyard.mp3 | 21-Apr-2007 10:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | shipwright.mp3 | 21-Apr-2007 10:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | shipwreck.mp3 | 21-Apr-2007 10:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | shipworm.mp3 | 21-Apr-2007 10:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | shipway.mp3 | 21-Apr-2007 10:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | shipton.mp3 | 21-Apr-2007 10:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | shipside.mp3 | 21-Apr-2007 10:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | shipshape.mp3 | 21-Apr-2007 10:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | shippon.mp3 | 21-Apr-2007 10:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | shipping.mp3 | 21-Apr-2007 10:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | shipper.mp3 | 21-Apr-2007 10:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | shippen.mp3 | 21-Apr-2007 10:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | shippable.mp3 | 21-Apr-2007 10:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | shipowner.mp3 | 21-Apr-2007 10:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | shipment.mp3 | 21-Apr-2007 10:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | shipmate.mp3 | 21-Apr-2007 10:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | shipmaster.mp3 | 21-Apr-2007 10:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | shipman.mp3 | 21-Apr-2007 10:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | shipload.mp3 | 21-Apr-2007 10:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | shiplap.mp3 | 21-Apr-2007 10:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | shipkapass.mp3 | 21-Apr-2007 10:44 | 17K | |
![[SND]](/icons/sound2.gif) | shipfitter.mp3 | 21-Apr-2007 10:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | shipentine.mp3 | 21-Apr-2007 10:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | shipbuilding.mp3 | 21-Apr-2007 10:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | shipbuilder.mp3 | 21-Apr-2007 10:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | shipborne.mp3 | 21-Apr-2007 10:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | shipboard.mp3 | 21-Apr-2007 10:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | ship.mp3 | 21-Apr-2007 10:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | shiny.mp3 | 21-Apr-2007 10:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | shinty.mp3 | 21-Apr-2007 10:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | shinplaster.mp3 | 21-Apr-2007 10:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | shinola.mp3 | 21-Apr-2007 10:43 | 17K | |
![[SND]](/icons/sound2.gif) | shinny.mp3 | 21-Apr-2007 10:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | shinney.mp3 | 21-Apr-2007 10:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | shinnery.mp3 | 21-Apr-2007 10:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | shinleaf.mp3 | 21-Apr-2007 10:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | shinkin.mp3 | 21-Apr-2007 10:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | shining.mp3 | 21-Apr-2007 10:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | shingly.mp3 | 21-Apr-2007 10:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | shingling.mp3 | 21-Apr-2007 10:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | shingles.mp3 | 21-Apr-2007 10:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | shingler.mp3 | 21-Apr-2007 10:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | shingle.mp3 | 21-Apr-2007 10:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | shiner.mp3 | 21-Apr-2007 10:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | shined.mp3 | 21-Apr-2007 10:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | shine.mp3 | 21-Apr-2007 10:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | shindy.mp3 | 21-Apr-2007 10:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | shindig.mp3 | 21-Apr-2007 10:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | shinbone.mp3 | 21-Apr-2007 10:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | shin.mp3 | 21-Apr-2007 10:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | shimmy.mp3 | 21-Apr-2007 10:42 | 6.3K | |
![[SND]](/icons/sound2.gif) | shimmery.mp3 | 21-Apr-2007 10:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | shimmering.mp3 | 21-Apr-2007 10:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | shimmer.mp3 | 21-Apr-2007 10:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | shimiaan.mp3 | 21-Apr-2007 10:42 | 17K | |
![[SND]](/icons/sound2.gif) | shim.mp3 | 21-Apr-2007 10:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | shily.mp3 | 21-Apr-2007 10:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | shilpit.mp3 | 21-Apr-2007 10:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | shillyshally.mp3 | 21-Apr-2007 10:41 | 17K | |
![[SND]](/icons/sound2.gif) | shilly-shally.mp3 | 21-Apr-2007 10:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | shilling.mp3 | 21-Apr-2007 10:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | shillelagh.mp3 | 21-Apr-2007 10:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | shillalah.mp3 | 21-Apr-2007 10:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | shillaber.mp3 | 21-Apr-2007 10:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | shill.mp3 | 21-Apr-2007 10:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | shilingi.mp3 | 21-Apr-2007 10:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | shilha.mp3 | 21-Apr-2007 10:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | shilh.mp3 | 21-Apr-2007 10:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | shikse.mp3 | 21-Apr-2007 10:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | shiksa.mp3 | 21-Apr-2007 10:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | shikker.mp3 | 21-Apr-2007 10:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | shikari.mp3 | 21-Apr-2007 10:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | shikar.mp3 | 21-Apr-2007 10:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | shijiazhuang.mp3 | 21-Apr-2007 10:41 | 17K | |
![[SND]](/icons/sound2.gif) | shiitake.mp3 | 21-Apr-2007 10:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | shihuangdi.mp3 | 21-Apr-2007 10:40 | 17K | |
![[SND]](/icons/sound2.gif) | shihtzu.mp3 | 21-Apr-2007 10:40 | 17K | |
![[SND]](/icons/sound2.gif) | shih tzu.mp3 | 21-Apr-2007 10:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | shihan.mp3 | 21-Apr-2007 10:40 | 17K | |
![[SND]](/icons/sound2.gif) | shigellosis.mp3 | 21-Apr-2007 10:40 | 11K | |
![[SND]](/icons/sound2.gif) | shigelloses.mp3 | 21-Apr-2007 10:40 | 11K | |
![[SND]](/icons/sound2.gif) | shigellae.mp3 | 21-Apr-2007 10:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | shigella.mp3 | 21-Apr-2007 10:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | shifty.mp3 | 21-Apr-2007 10:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | shiftless.mp3 | 21-Apr-2007 10:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | shiftingboard.mp3 | 21-Apr-2007 10:40 | 17K | |
![[SND]](/icons/sound2.gif) | shiftiness.mp3 | 21-Apr-2007 10:40 | 9.5K | |
![[SND]](/icons/sound2.gif) | shiftily.mp3 | 21-Apr-2007 10:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | shiftie.mp3 | 21-Apr-2007 10:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | shifter.mp3 | 21-Apr-2007 10:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | shiftable.mp3 | 21-Apr-2007 10:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | shift.mp3 | 21-Apr-2007 10:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | shiever.mp3 | 21-Apr-2007 10:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | shiest.mp3 | 21-Apr-2007 10:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | shier.mp3 | 21-Apr-2007 10:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | shieling.mp3 | 21-Apr-2007 10:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | shields.mp3 | 21-Apr-2007 10:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | shielding.mp3 | 21-Apr-2007 10:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | shield.mp3 | 21-Apr-2007 10:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | shiel.mp3 | 21-Apr-2007 10:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | shidduch.mp3 | 21-Apr-2007 10:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | shickered.mp3 | 21-Apr-2007 10:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | shicker.mp3 | 21-Apr-2007 10:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | shicer.mp3 | 21-Apr-2007 10:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | shibboleth.mp3 | 21-Apr-2007 10:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | shibahasarbetammuz.mp3 | 21-Apr-2007 10:39 | 27K | |
![[SND]](/icons/sound2.gif) | shibah.mp3 | 21-Apr-2007 10:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | shiatzu.mp3 | 21-Apr-2007 10:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | shiatsu.mp3 | 21-Apr-2007 10:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | shiah.mp3 | 21-Apr-2007 10:39 | 17K | |
![[SND]](/icons/sound2.gif) | shh.mp3 | 21-Apr-2007 10:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | shewbread.mp3 | 21-Apr-2007 10:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | shew.mp3 | 21-Apr-2007 10:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | shevuoth.mp3 | 21-Apr-2007 10:39 | 17K | |
![[SND]](/icons/sound2.gif) | sheveret.mp3 | 21-Apr-2007 10:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | shevat.mp3 | 21-Apr-2007 10:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | shevabrachoth.mp3 | 21-Apr-2007 10:38 | 17K | |
![[SND]](/icons/sound2.gif) | sheva.mp3 | 21-Apr-2007 10:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | sheugh.mp3 | 21-Apr-2007 10:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | sheshe.mp3 | 21-Apr-2007 10:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | shes.mp3 | 21-Apr-2007 10:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheryl.mp3 | 21-Apr-2007 10:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sherwani.mp3 | 21-Apr-2007 10:38 | 17K | |
![[SND]](/icons/sound2.gif) | shertogenbosch.mp3 | 21-Apr-2007 10:38 | 17K | |
![[SND]](/icons/sound2.gif) | sherry.mp3 | 21-Apr-2007 10:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | sherris.mp3 | 21-Apr-2007 10:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | sherrill.mp3 | 21-Apr-2007 10:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | shermed.mp3 | 21-Apr-2007 10:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | sherlockian.mp3 | 21-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | sherlockholmes.mp3 | 21-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | sherlock.mp3 | 21-Apr-2007 10:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | sheriffwick.mp3 | 21-Apr-2007 10:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | sheriffdom.mp3 | 21-Apr-2007 10:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheriffalty.mp3 | 21-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | sheriff.mp3 | 21-Apr-2007 10:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | sherif.mp3 | 21-Apr-2007 10:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheria.mp3 | 21-Apr-2007 10:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | shergottite.mp3 | 21-Apr-2007 10:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | sherd.mp3 | 21-Apr-2007 10:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | sherbet.mp3 | 21-Apr-2007 10:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | sherbert.mp3 | 21-Apr-2007 10:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | sherardize.mp3 | 21-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | sheqel.mp3 | 21-Apr-2007 10:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheqalim.mp3 | 21-Apr-2007 10:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | sheppey.mp3 | 21-Apr-2007 10:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | shepperton.mp3 | 21-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | sheppardscorrection.mp3 | 21-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | sheppard.mp3 | 21-Apr-2007 10:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheplers.mp3 | 21-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | shepherdess.mp3 | 21-Apr-2007 10:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | shepherd.mp3 | 21-Apr-2007 10:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | shent.mp3 | 21-Apr-2007 10:36 | 5.5K | |
![[SND]](/icons/sound2.gif) | sheng.mp3 | 21-Apr-2007 10:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | shend.mp3 | 21-Apr-2007 10:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | shencongwen.mp3 | 21-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | shenannicking.mp3 | 21-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | shenanigan.mp3 | 21-Apr-2007 10:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | shemozzle.mp3 | 21-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | shemonehesreh.mp3 | 21-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | sheminiatzereth.mp3 | 21-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | shembe.mp3 | 21-Apr-2007 10:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | shemale.mp3 | 21-Apr-2007 10:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | shelving.mp3 | 21-Apr-2007 10:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | shelves.mp3 | 21-Apr-2007 10:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | shelve.mp3 | 21-Apr-2007 10:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | shelty.mp3 | 21-Apr-2007 10:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | sheltie.mp3 | 21-Apr-2007 10:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | sheltery.mp3 | 21-Apr-2007 10:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | shelterless.mp3 | 21-Apr-2007 10:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | shelteringtrust.mp3 | 21-Apr-2007 10:35 | 17K | |
![[SND]](/icons/sound2.gif) | sheltering.mp3 | 21-Apr-2007 10:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | shelterer.mp3 | 21-Apr-2007 10:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheltered.mp3 | 21-Apr-2007 10:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | shelterbelt.mp3 | 21-Apr-2007 10:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | shelter.mp3 | 21-Apr-2007 10:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | shelta.mp3 | 21-Apr-2007 10:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | shelly.mp3 | 21-Apr-2007 10:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | shellwork.mp3 | 21-Apr-2007 10:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | shellproof.mp3 | 21-Apr-2007 10:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | shelling.mp3 | 21-Apr-2007 10:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | shellfishery.mp3 | 21-Apr-2007 10:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | shellfish.mp3 | 21-Apr-2007 10:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | sheller.mp3 | 21-Apr-2007 10:34 | 6.3K | |
![[SND]](/icons/sound2.gif) | shelled.mp3 | 21-Apr-2007 10:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | shellcracker.mp3 | 21-Apr-2007 10:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | shellback.mp3 | 21-Apr-2007 10:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | shellacking.mp3 | 21-Apr-2007 10:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | shellacked.mp3 | 21-Apr-2007 10:34 | 17K | |
![[SND]](/icons/sound2.gif) | shellac.mp3 | 21-Apr-2007 10:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | shell.mp3 | 21-Apr-2007 10:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | shelflike.mp3 | 21-Apr-2007 10:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | shelfful.mp3 | 21-Apr-2007 10:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | shelf.mp3 | 21-Apr-2007 10:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | shelduck.mp3 | 21-Apr-2007 10:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | sheldrake.mp3 | 21-Apr-2007 10:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sheldoniantheatre.mp3 | 21-Apr-2007 10:34 | 17K | |
![[SND]](/icons/sound2.gif) | shelby.mp3 | 21-Apr-2007 10:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | shelburne.mp3 | 21-Apr-2007 10:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | shekhinah.mp3 | 21-Apr-2007 10:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | shekel.mp3 | 21-Apr-2007 10:33 | 6.3K | |
![[SND]](/icons/sound2.gif) | sheitel.mp3 | 21-Apr-2007 10:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheitan.mp3 | 21-Apr-2007 10:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheila.mp3 | 21-Apr-2007 10:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | sheikhdom.mp3 | 21-Apr-2007 10:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | sheikh.mp3 | 21-Apr-2007 10:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | sheikdom.mp3 | 21-Apr-2007 10:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | sheika.mp3 | 21-Apr-2007 10:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheik.mp3 | 21-Apr-2007 10:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | shehitah.mp3 | 21-Apr-2007 10:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheherazade.mp3 | 21-Apr-2007 10:33 | 17K | |
![[SND]](/icons/sound2.gif) | shehe.mp3 | 21-Apr-2007 10:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | shegetz.mp3 | 21-Apr-2007 10:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | sheffersstroke.mp3 | 21-Apr-2007 10:33 | 17K | |
![[SND]](/icons/sound2.gif) | sheetlike.mp3 | 21-Apr-2007 10:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | sheeting.mp3 | 21-Apr-2007 10:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | sheetfed.mp3 | 21-Apr-2007 10:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheet.mp3 | 21-Apr-2007 10:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | sheesh.mp3 | 21-Apr-2007 10:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | sheers.mp3 | 21-Apr-2007 10:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheerness.mp3 | 21-Apr-2007 10:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheerlegs.mp3 | 21-Apr-2007 10:33 | 9.5K | |
![[SND]](/icons/sound2.gif) | sheer.mp3 | 21-Apr-2007 10:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | sheepweed.mp3 | 21-Apr-2007 10:32 | 17K | |
![[SND]](/icons/sound2.gif) | sheepskin.mp3 | 21-Apr-2007 10:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | sheepshearing.mp3 | 21-Apr-2007 10:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | sheepshearer.mp3 | 21-Apr-2007 10:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | sheepshead.mp3 | 21-Apr-2007 10:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | sheepshank.mp3 | 21-Apr-2007 10:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheepshagger.mp3 | 21-Apr-2007 10:32 | 17K | |
![[SND]](/icons/sound2.gif) | sheepo.mp3 | 21-Apr-2007 10:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheepman.mp3 | 21-Apr-2007 10:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheep ked.mp3 | 21-Apr-2007 10:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | sheepish.mp3 | 21-Apr-2007 10:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | sheepherding.mp3 | 21-Apr-2007 10:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | sheepherder.mp3 | 21-Apr-2007 10:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | sheepfold.mp3 | 21-Apr-2007 10:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | sheepdog.mp3 | 21-Apr-2007 10:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | sheepcote.mp3 | 21-Apr-2007 10:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheepberry.mp3 | 21-Apr-2007 10:32 | 17K | |
![[SND]](/icons/sound2.gif) | sheep.mp3 | 21-Apr-2007 10:32 | 5.4K | |
![[SND]](/icons/sound2.gif) | sheeny.mp3 | 21-Apr-2007 10:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | sheeney.mp3 | 21-Apr-2007 10:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheene.mp3 | 21-Apr-2007 10:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | sheena.mp3 | 21-Apr-2007 10:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheen.mp3 | 21-Apr-2007 10:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | sheelah.mp3 | 21-Apr-2007 10:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheeit.mp3 | 21-Apr-2007 10:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | sheehan.mp3 | 21-Apr-2007 10:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | sheefish.mp3 | 21-Apr-2007 10:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | shee.mp3 | 21-Apr-2007 10:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | shedlike.mp3 | 21-Apr-2007 10:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | shedevil.mp3 | 21-Apr-2007 10:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | shedding.mp3 | 21-Apr-2007 10:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | shedder.mp3 | 21-Apr-2007 10:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | shed.mp3 | 21-Apr-2007 10:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | shechitah.mp3 | 21-Apr-2007 10:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | shechi.mp3 | 21-Apr-2007 10:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | shebeen.mp3 | 21-Apr-2007 10:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | shebang.mp3 | 21-Apr-2007 10:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | sheaves.mp3 | 21-Apr-2007 10:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | sheave.mp3 | 21-Apr-2007 10:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | shea tree.mp3 | 21-Apr-2007 10:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | sheaths.mp3 | 21-Apr-2007 10:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | sheathing.mp3 | 21-Apr-2007 10:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | sheather.mp3 | 21-Apr-2007 10:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | sheathe.mp3 | 21-Apr-2007 10:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | sheathbill.mp3 | 21-Apr-2007 10:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheath.mp3 | 21-Apr-2007 10:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | sheatfish.mp3 | 21-Apr-2007 10:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | shearwater.mp3 | 21-Apr-2007 10:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | shearling.mp3 | 21-Apr-2007 10:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | shearing.mp3 | 21-Apr-2007 10:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | shearhog.mp3 | 21-Apr-2007 10:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | shearer.mp3 | 21-Apr-2007 10:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheared.mp3 | 21-Apr-2007 10:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | shear.mp3 | 21-Apr-2007 10:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | shealing.mp3 | 21-Apr-2007 10:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sheaflike.mp3 | 21-Apr-2007 10:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | sheaffer.mp3 | 21-Apr-2007 10:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | sheaf.mp3 | 21-Apr-2007 10:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | sheading.mp3 | 21-Apr-2007 10:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | shea butter.mp3 | 21-Apr-2007 10:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | shea.mp3 | 21-Apr-2007 10:30 | 27K | |
![[SND]](/icons/sound2.gif) | she.mp3 | 21-Apr-2007 10:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | she-oak.mp3 | 21-Apr-2007 10:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | she-crab.mp3 | 21-Apr-2007 10:31 | 10K | |
![[SND]](/icons/sound2.gif) | she's.mp3 | 21-Apr-2007 10:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | she'll.mp3 | 21-Apr-2007 10:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | she'd.mp3 | 21-Apr-2007 10:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | shchi.mp3 | 21-Apr-2007 10:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | shcheglovsk.mp3 | 21-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | shcharansky.mp3 | 21-Apr-2007 10:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | shazam.mp3 | 21-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | shaytan.mp3 | 21-Apr-2007 10:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | shaykh.mp3 | 21-Apr-2007 10:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | shay.mp3 | 21-Apr-2007 10:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | shawm.mp3 | 21-Apr-2007 10:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | shawlie.mp3 | 21-Apr-2007 10:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | shawl.mp3 | 21-Apr-2007 10:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | shawabti.mp3 | 21-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | shaw.mp3 | 21-Apr-2007 10:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | shavuoth.mp3 | 21-Apr-2007 10:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | shaving.mp3 | 21-Apr-2007 10:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | shavie.mp3 | 21-Apr-2007 10:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | shaviana.mp3 | 21-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | shavetail.mp3 | 21-Apr-2007 10:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | shaves.mp3 | 21-Apr-2007 10:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | shaver.mp3 | 21-Apr-2007 10:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | shaven.mp3 | 21-Apr-2007 10:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | shaveling.mp3 | 21-Apr-2007 10:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | shaved.mp3 | 21-Apr-2007 10:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | shave.mp3 | 21-Apr-2007 10:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | shaun.mp3 | 21-Apr-2007 10:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | shatterproof.mp3 | 21-Apr-2007 10:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | shatteringly.mp3 | 21-Apr-2007 10:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | shatter.mp3 | 21-Apr-2007 10:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | shattalarab.mp3 | 21-Apr-2007 10:28 | 17K | |
![[SND]](/icons/sound2.gif) | shat.mp3 | 21-Apr-2007 10:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | shastracara.mp3 | 21-Apr-2007 10:28 | 17K | |
![[SND]](/icons/sound2.gif) | shastra.mp3 | 21-Apr-2007 10:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | shasta.mp3 | 21-Apr-2007 10:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | shaslik.mp3 | 21-Apr-2007 10:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | shashlik.mp3 | 21-Apr-2007 10:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | sharrie.mp3 | 21-Apr-2007 10:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | sharra.mp3 | 21-Apr-2007 10:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | sharpy.mp3 | 21-Apr-2007 10:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | sharpshooting.mp3 | 21-Apr-2007 10:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | sharpshooter.mp3 | 21-Apr-2007 10:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | sharpsburg.mp3 | 21-Apr-2007 10:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | sharps.mp3 | 21-Apr-2007 10:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | sharply.mp3 | 21-Apr-2007 10:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | sharpish.mp3 | 21-Apr-2007 10:27 | 17K | |
![[SND]](/icons/sound2.gif) | sharpie.mp3 | 21-Apr-2007 10:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | sharpeville.mp3 | 21-Apr-2007 10:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | sharpesgrysbok.mp3 | 21-Apr-2007 10:27 | 17K | |
![[SND]](/icons/sound2.gif) | sharper.mp3 | 21-Apr-2007 10:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | sharpening.mp3 | 21-Apr-2007 10:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | sharpener.mp3 | 21-Apr-2007 10:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | sharpen.mp3 | 21-Apr-2007 10:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | sharpei.mp3 | 21-Apr-2007 10:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | sharp.mp3 | 21-Apr-2007 10:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | sharp-witted.mp3 | 21-Apr-2007 10:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | sharp-tongued.mp3 | 21-Apr-2007 10:27 | 10K | |
![[SND]](/icons/sound2.gif) | sharp-sighted.mp3 | 21-Apr-2007 10:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | sharp-shinned hawk.mp3 | 21-Apr-2007 10:27 | 13K | |
![[SND]](/icons/sound2.gif) | sharp-set.mp3 | 21-Apr-2007 10:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | sharp-nosed.mp3 | 21-Apr-2007 10:27 | 11K | |
![[SND]](/icons/sound2.gif) | sharp-eyed.mp3 | 21-Apr-2007 10:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | sharonfruit.mp3 | 21-Apr-2007 10:26 | 17K | |
![[SND]](/icons/sound2.gif) | sharmalsheikh.mp3 | 21-Apr-2007 10:26 | 17K | |
![[SND]](/icons/sound2.gif) | sharleen.mp3 | 21-Apr-2007 10:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | sharkskin.mp3 | 21-Apr-2007 10:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | sharklike.mp3 | 21-Apr-2007 10:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | shark.mp3 | 21-Apr-2007 10:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | sharifian.mp3 | 21-Apr-2007 10:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | sharif.mp3 | 21-Apr-2007 10:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | shariah.mp3 | 21-Apr-2007 10:26 | 17K | |
![[SND]](/icons/sound2.gif) | sharia.mp3 | 21-Apr-2007 10:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | shareware.mp3 | 21-Apr-2007 10:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | sharer.mp3 | 21-Apr-2007 10:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | shareholding.mp3 | 21-Apr-2007 10:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | shareholder.mp3 | 21-Apr-2007 10:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | sharecropper.mp3 | 21-Apr-2007 10:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | sharecrop.mp3 | 21-Apr-2007 10:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | shareable.mp3 | 21-Apr-2007 10:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | shareability.mp3 | 21-Apr-2007 10:25 | 10K | |
![[SND]](/icons/sound2.gif) | share.mp3 | 21-Apr-2007 10:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | shardana.mp3 | 21-Apr-2007 10:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | shard.mp3 | 21-Apr-2007 10:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | sharav.mp3 | 21-Apr-2007 10:25 | 17K | |
![[SND]](/icons/sound2.gif) | sharable.mp3 | 21-Apr-2007 10:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | shara.mp3 | 21-Apr-2007 10:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | shar-pei.mp3 | 21-Apr-2007 10:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | shapo.mp3 | 21-Apr-2007 10:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | shapley.mp3 | 21-Apr-2007 10:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | shapka.mp3 | 21-Apr-2007 10:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | shaper.mp3 | 21-Apr-2007 10:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | shapen.mp3 | 21-Apr-2007 10:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | shapely.mp3 | 21-Apr-2007 10:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | shapeless.mp3 | 21-Apr-2007 10:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | shaped.mp3 | 21-Apr-2007 10:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | shapeable.mp3 | 21-Apr-2007 10:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | shape.mp3 | 21-Apr-2007 10:25 | 5.2K | |
![[SND]](/icons/sound2.gif) | shape-up.mp3 | 21-Apr-2007 10:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | shape-shifter.mp3 | 21-Apr-2007 10:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | shape-shift.mp3 | 21-Apr-2007 10:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | shapable.mp3 | 21-Apr-2007 10:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | shaoxing.mp3 | 21-Apr-2007 10:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | shaolin.mp3 | 21-Apr-2007 10:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | shantytown.mp3 | 21-Apr-2007 10:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | shantyman.mp3 | 21-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | shanty.mp3 | 21-Apr-2007 10:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | shantung.mp3 | 21-Apr-2007 10:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | shanti.mp3 | 21-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | shantey.mp3 | 21-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | shant.mp3 | 21-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | shanstates.mp3 | 21-Apr-2007 10:24 | 17K | |
![[SND]](/icons/sound2.gif) | shanny.mp3 | 21-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | shanna.mp3 | 21-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | shankpiece.mp3 | 21-Apr-2007 10:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | shankly.mp3 | 21-Apr-2007 10:24 | 17K | |
![[SND]](/icons/sound2.gif) | shanked.mp3 | 21-Apr-2007 10:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | shankara.mp3 | 21-Apr-2007 10:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | shankar.mp3 | 21-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | shank.mp3 | 21-Apr-2007 10:23 | 5.7K | |
![[SND]](/icons/sound2.gif) | shanhaiguan.mp3 | 21-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | shangti.mp3 | 21-Apr-2007 10:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | shangrila.mp3 | 21-Apr-2007 10:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | shangqiu.mp3 | 21-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | shango.mp3 | 21-Apr-2007 10:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | shanghaier.mp3 | 21-Apr-2007 10:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | shanghai.mp3 | 21-Apr-2007 10:23 | 12K | |
![[SND]](/icons/sound2.gif) | shange.mp3 | 21-Apr-2007 10:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | shangaan.mp3 | 21-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | shane.mp3 | 21-Apr-2007 10:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | shandygaff.mp3 | 21-Apr-2007 10:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | shandy.mp3 | 21-Apr-2007 10:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | shandrydan.mp3 | 21-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | shan't.mp3 | 21-Apr-2007 10:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | shamus.mp3 | 21-Apr-2007 10:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | shamshir.mp3 | 21-Apr-2007 10:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | shamrock.mp3 | 21-Apr-2007 10:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | shampoo.mp3 | 21-Apr-2007 10:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | shampers.mp3 | 21-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | shamoy.mp3 | 21-Apr-2007 10:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | shamo.mp3 | 21-Apr-2007 10:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | shammy.mp3 | 21-Apr-2007 10:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | shammus.mp3 | 21-Apr-2007 10:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | shammosim.mp3 | 21-Apr-2007 10:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | shammes.mp3 | 21-Apr-2007 10:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | shammer.mp3 | 21-Apr-2007 10:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | shammash.mp3 | 21-Apr-2007 10:22 | 17K | |
![[SND]](/icons/sound2.gif) | shammai.mp3 | 21-Apr-2007 10:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | shames.mp3 | 21-Apr-2007 10:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | shameless.mp3 | 21-Apr-2007 10:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | shamefully.mp3 | 21-Apr-2007 10:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | shameful.mp3 | 21-Apr-2007 10:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | shamefast.mp3 | 21-Apr-2007 10:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | shamefacedness.mp3 | 21-Apr-2007 10:22 | 12K | |
![[SND]](/icons/sound2.gif) | shamefacedly.mp3 | 21-Apr-2007 10:22 | 11K | |
![[SND]](/icons/sound2.gif) | shamefaced.mp3 | 21-Apr-2007 10:22 | 9.3K | |
![[SND]](/icons/sound2.gif) | shame.mp3 | 21-Apr-2007 10:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | shambro.mp3 | 21-Apr-2007 10:22 | 17K | |
![[SND]](/icons/sound2.gif) | shambolic.mp3 | 21-Apr-2007 10:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | shambling.mp3 | 21-Apr-2007 10:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | shambles.mp3 | 21-Apr-2007 10:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | shamble.mp3 | 21-Apr-2007 10:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | shamba.mp3 | 21-Apr-2007 10:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | shamateur.mp3 | 21-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | shamash.mp3 | 21-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | shamas.mp3 | 21-Apr-2007 10:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | shamanistic.mp3 | 21-Apr-2007 10:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | shamanist.mp3 | 21-Apr-2007 10:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | shamanism.mp3 | 21-Apr-2007 10:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | shamanic.mp3 | 21-Apr-2007 10:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | shaman.mp3 | 21-Apr-2007 10:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | shamamillet.mp3 | 21-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | shamal.mp3 | 21-Apr-2007 10:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | shama.mp3 | 21-Apr-2007 10:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | sham.mp3 | 21-Apr-2007 10:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | shalwar.mp3 | 21-Apr-2007 10:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | shalt.mp3 | 21-Apr-2007 10:21 | 6.1K | |
![[SND]](/icons/sound2.gif) | shaloshseudoth.mp3 | 21-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | shalomaleichem.mp3 | 21-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | shalom aleichem.mp3 | 21-Apr-2007 10:21 | 11K | |
![[SND]](/icons/sound2.gif) | shalom.mp3 | 21-Apr-2007 10:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | shalmaneseriii.mp3 | 21-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | shallowly.mp3 | 21-Apr-2007 10:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | shallow.mp3 | 21-Apr-2007 10:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | shallot.mp3 | 21-Apr-2007 10:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | shallop.mp3 | 21-Apr-2007 10:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | shalloon.mp3 | 21-Apr-2007 10:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | shall.mp3 | 21-Apr-2007 10:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | shalimar.mp3 | 21-Apr-2007 10:20 | 17K | |
![[SND]](/icons/sound2.gif) | shaliapin.mp3 | 21-Apr-2007 10:20 | 17K | |
![[SND]](/icons/sound2.gif) | shaley.mp3 | 21-Apr-2007 10:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | shale.mp3 | 21-Apr-2007 10:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | shalachmanoth.mp3 | 21-Apr-2007 10:20 | 17K | |
![[SND]](/icons/sound2.gif) | shakyamuni.mp3 | 21-Apr-2007 10:20 | 17K | |
![[SND]](/icons/sound2.gif) | shaky.mp3 | 21-Apr-2007 10:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | shakspere.mp3 | 21-Apr-2007 10:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | shako.mp3 | 21-Apr-2007 10:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | shaking.mp3 | 21-Apr-2007 10:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | shakiness.mp3 | 21-Apr-2007 10:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | shakily.mp3 | 21-Apr-2007 10:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | shakers.mp3 | 21-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | shakerheights.mp3 | 21-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | shaker.mp3 | 21-Apr-2007 10:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | shakeout.mp3 | 21-Apr-2007 10:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | shaken.mp3 | 21-Apr-2007 10:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | shakedown.mp3 | 21-Apr-2007 10:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | shakeable.mp3 | 21-Apr-2007 10:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | shake.mp3 | 21-Apr-2007 10:19 | 5.5K | |
![[SND]](/icons/sound2.gif) | shake-up.mp3 | 21-Apr-2007 10:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | shaka.mp3 | 21-Apr-2007 10:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | shaiva.mp3 | 21-Apr-2007 10:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | shaitan.mp3 | 21-Apr-2007 10:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | shair.mp3 | 21-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | shaikhism.mp3 | 21-Apr-2007 10:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | shaikhi.mp3 | 21-Apr-2007 10:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | shaikh.mp3 | 21-Apr-2007 10:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | shahjahanpur.mp3 | 21-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | shahjahan.mp3 | 21-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | shahdom.mp3 | 21-Apr-2007 10:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | shaharith.mp3 | 21-Apr-2007 10:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | shahaptian.mp3 | 21-Apr-2007 10:18 | 17K | |
![[SND]](/icons/sound2.gif) | shahanshah.mp3 | 21-Apr-2007 10:18 | 17K | |
![[SND]](/icons/sound2.gif) | shahalam.mp3 | 21-Apr-2007 10:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | shahada.mp3 | 21-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | shah.mp3 | 21-Apr-2007 10:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | shagroon.mp3 | 21-Apr-2007 10:18 | 17K | |
![[SND]](/icons/sound2.gif) | shagreen.mp3 | 21-Apr-2007 10:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | shaggymane.mp3 | 21-Apr-2007 10:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | shaggy.mp3 | 21-Apr-2007 10:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | shaggy-dog.mp3 | 21-Apr-2007 10:18 | 10K | |
![[SND]](/icons/sound2.gif) | shagginess.mp3 | 21-Apr-2007 10:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | shaggily.mp3 | 21-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | shagger.mp3 | 21-Apr-2007 10:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | shagged.mp3 | 21-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | shagbark.mp3 | 21-Apr-2007 10:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | shaganappi.mp3 | 21-Apr-2007 10:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | shag.mp3 | 21-Apr-2007 10:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | shafts.mp3 | 21-Apr-2007 10:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | shafting.mp3 | 21-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | shaft.mp3 | 21-Apr-2007 10:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | shafii.mp3 | 21-Apr-2007 10:17 | 17K | |
![[SND]](/icons/sound2.gif) | shaffer.mp3 | 21-Apr-2007 10:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | shaef.mp3 | 21-Apr-2007 10:17 | 17K | |
![[SND]](/icons/sound2.gif) | shady.mp3 | 21-Apr-2007 10:17 | 6.4K | |
![[SND]](/icons/sound2.gif) | shaduf.mp3 | 21-Apr-2007 10:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | shadrach.mp3 | 21-Apr-2007 10:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | shadowy.mp3 | 21-Apr-2007 10:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | shadowlike.mp3 | 21-Apr-2007 10:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | shadowless.mp3 | 21-Apr-2007 10:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | shadowing.mp3 | 21-Apr-2007 10:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | shadowiness.mp3 | 21-Apr-2007 10:17 | 10K | |
![[SND]](/icons/sound2.gif) | shadowily.mp3 | 21-Apr-2007 10:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | shadowgraphy.mp3 | 21-Apr-2007 10:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | shadowgraph.mp3 | 21-Apr-2007 10:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | shadower.mp3 | 21-Apr-2007 10:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | shadowed.mp3 | 21-Apr-2007 10:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | shadowbox.mp3 | 21-Apr-2007 10:17 | 10K | |
![[SND]](/icons/sound2.gif) | shadow.mp3 | 21-Apr-2007 10:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | shadoof.mp3 | 21-Apr-2007 10:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | shadkhan.mp3 | 21-Apr-2007 10:17 | 17K | |
![[SND]](/icons/sound2.gif) | shading.mp3 | 21-Apr-2007 10:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | shadiness.mp3 | 21-Apr-2007 10:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | shadily.mp3 | 21-Apr-2007 10:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | shadeless.mp3 | 21-Apr-2007 10:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | shaded.mp3 | 21-Apr-2007 10:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | shade.mp3 | 21-Apr-2007 10:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | shade-grown.mp3 | 21-Apr-2007 10:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | shaddock.mp3 | 21-Apr-2007 10:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | shaddai.mp3 | 21-Apr-2007 10:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | shadchan.mp3 | 21-Apr-2007 10:16 | 17K | |
![[SND]](/icons/sound2.gif) | shadbush.mp3 | 21-Apr-2007 10:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | shadbolt.mp3 | 21-Apr-2007 10:16 | 17K | |
![[SND]](/icons/sound2.gif) | shadblow.mp3 | 21-Apr-2007 10:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | shadberry.mp3 | 21-Apr-2007 10:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | shad.mp3 | 21-Apr-2007 10:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | shacky.mp3 | 21-Apr-2007 10:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | shacks.mp3 | 21-Apr-2007 10:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | shacko.mp3 | 21-Apr-2007 10:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | shackling.mp3 | 21-Apr-2007 10:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | shackler.mp3 | 21-Apr-2007 10:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | shacklebone.mp3 | 21-Apr-2007 10:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | shackle.mp3 | 21-Apr-2007 10:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | shacket.mp3 | 21-Apr-2007 10:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | shackerette.mp3 | 21-Apr-2007 10:16 | 17K | |
![[SND]](/icons/sound2.gif) | shack.mp3 | 21-Apr-2007 10:16 | 5.7K | |
![[SND]](/icons/sound2.gif) | shache.mp3 | 21-Apr-2007 10:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | shacharith.mp3 | 21-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | shabu-shabu.mp3 | 21-Apr-2007 10:15 | 11K | |
![[SND]](/icons/sound2.gif) | shabrack.mp3 | 21-Apr-2007 10:15 | 17K | |
![[SND]](/icons/sound2.gif) | shabby.mp3 | 21-Apr-2007 10:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | shabbiness.mp3 | 21-Apr-2007 10:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | shabbily.mp3 | 21-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | shabbasgoy.mp3 | 21-Apr-2007 10:15 | 17K | |
![[SND]](/icons/sound2.gif) | shabbas.mp3 | 21-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | sh.mp3 | 21-Apr-2007 10:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | sgravenhage.mp3 | 21-Apr-2007 10:15 | 17K | |
![[SND]](/icons/sound2.gif) | sgraffito.mp3 | 21-Apr-2007 10:15 | 10K | |
![[SND]](/icons/sound2.gif) | sgraffiti.mp3 | 21-Apr-2007 10:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | sgiandhu.mp3 | 21-Apr-2007 10:15 | 17K | |
![[SND]](/icons/sound2.gif) | sgabello.mp3 | 21-Apr-2007 10:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | sfumato.mp3 | 21-Apr-2007 10:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | sforzandopiano.mp3 | 21-Apr-2007 10:15 | 27K | |
![[SND]](/icons/sound2.gif) | sforzando.mp3 | 21-Apr-2007 10:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | sforzandi.mp3 | 21-Apr-2007 10:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | sforza.mp3 | 21-Apr-2007 10:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | sferics.mp3 | 21-Apr-2007 10:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | sez.mp3 | 21-Apr-2007 10:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | seyfertgalaxy.mp3 | 21-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | sexy.mp3 | 21-Apr-2007 10:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | sexvalent.mp3 | 21-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | sexuallytransmitteddisease.mp3 | 21-Apr-2007 10:14 | 27K | |
![[SND]](/icons/sound2.gif) | sexually.mp3 | 21-Apr-2007 10:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | sexualize.mp3 | 21-Apr-2007 10:14 | 11K | |
![[SND]](/icons/sound2.gif) | sexuality.mp3 | 21-Apr-2007 10:14 | 11K | |
![[SND]](/icons/sound2.gif) | sexual.mp3 | 21-Apr-2007 10:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | sextus.mp3 | 21-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | sextupling.mp3 | 21-Apr-2007 10:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | sextuplicate.mp3 | 21-Apr-2007 10:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | sextuplex.mp3 | 21-Apr-2007 10:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | sextuplet.mp3 | 21-Apr-2007 10:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | sextuple.mp3 | 21-Apr-2007 10:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | sexton.mp3 | 21-Apr-2007 10:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | sextodecimo.mp3 | 21-Apr-2007 10:13 | 11K | |
![[SND]](/icons/sound2.gif) | sexto.mp3 | 21-Apr-2007 10:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sextillion.mp3 | 21-Apr-2007 10:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | sextile.mp3 | 21-Apr-2007 10:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | sextic.mp3 | 21-Apr-2007 10:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | sextet.mp3 | 21-Apr-2007 10:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | sextern.mp3 | 21-Apr-2007 10:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | sextant.mp3 | 21-Apr-2007 10:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | sextan.mp3 | 21-Apr-2007 10:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | sextain.mp3 | 21-Apr-2007 10:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | sext.mp3 | 21-Apr-2007 10:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | sexpot.mp3 | 21-Apr-2007 10:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | sexploiter.mp3 | 21-Apr-2007 10:13 | 17K | |
![[SND]](/icons/sound2.gif) | sexploitation.mp3 | 21-Apr-2007 10:13 | 11K | |
![[SND]](/icons/sound2.gif) | sexpert.mp3 | 21-Apr-2007 10:13 | 17K | |
![[SND]](/icons/sound2.gif) | sexpartite.mp3 | 21-Apr-2007 10:13 | 17K | |
![[SND]](/icons/sound2.gif) | sexology.mp3 | 21-Apr-2007 10:13 | 10K | |
![[SND]](/icons/sound2.gif) | sexologist.mp3 | 21-Apr-2007 10:13 | 11K | |
![[SND]](/icons/sound2.gif) | sexo.mp3 | 21-Apr-2007 10:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | sexless.mp3 | 21-Apr-2007 10:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | sexivalent.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexist.mp3 | 21-Apr-2007 10:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | sexism.mp3 | 21-Apr-2007 10:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | sexiness.mp3 | 21-Apr-2007 10:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | sexily.mp3 | 21-Apr-2007 10:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | sexillion.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexi.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexfoil.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexennial.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexenary.mp3 | 21-Apr-2007 10:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | sexed.mp3 | 21-Apr-2007 10:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | sexdigitate.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexdecillion.mp3 | 21-Apr-2007 10:12 | 11K | |
![[SND]](/icons/sound2.gif) | sexcapade.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexavalent.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexagesimal.mp3 | 21-Apr-2007 10:12 | 11K | |
![[SND]](/icons/sound2.gif) | sexagesima.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexagenary.mp3 | 21-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | sexagenarian.mp3 | 21-Apr-2007 10:12 | 12K | |
![[SND]](/icons/sound2.gif) | sex.mp3 | 21-Apr-2007 10:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | sex-linked.mp3 | 21-Apr-2007 10:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | sex-linkage.mp3 | 21-Apr-2007 10:12 | 11K | |
![[SND]](/icons/sound2.gif) | sex-limited.mp3 | 21-Apr-2007 10:12 | 11K | |
![[SND]](/icons/sound2.gif) | sewn.mp3 | 21-Apr-2007 10:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | sewing.mp3 | 21-Apr-2007 10:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | sewin.mp3 | 21-Apr-2007 10:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | sewerrat.mp3 | 21-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | sewerpill.mp3 | 21-Apr-2007 10:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | sewerhog.mp3 | 21-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | sewergas.mp3 | 21-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | sewerage.mp3 | 21-Apr-2007 10:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | sewer.mp3 | 21-Apr-2007 10:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | sewen.mp3 | 21-Apr-2007 10:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | sewellel.mp3 | 21-Apr-2007 10:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | sewardpeninsula.mp3 | 21-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | sewan.mp3 | 21-Apr-2007 10:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sewall.mp3 | 21-Apr-2007 10:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | sewage.mp3 | 21-Apr-2007 10:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | sewable.mp3 | 21-Apr-2007 10:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | sewability.mp3 | 21-Apr-2007 10:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | sew.mp3 | 21-Apr-2007 10:11 | 6.3K | |
![[SND]](/icons/sound2.gif) | sevruga.mp3 | 21-Apr-2007 10:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | sevin.mp3 | 21-Apr-2007 10:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | seviche.mp3 | 21-Apr-2007 10:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | seveso.mp3 | 21-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | severy.mp3 | 21-Apr-2007 10:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | severodvinsk.mp3 | 21-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | severodonetsk.mp3 | 21-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | severnayazemlya.mp3 | 21-Apr-2007 10:10 | 27K | |
![[SND]](/icons/sound2.gif) | severn.mp3 | 21-Apr-2007 10:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | severity.mp3 | 21-Apr-2007 10:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | severini.mp3 | 21-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | severing.mp3 | 21-Apr-2007 10:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | severely.mp3 | 21-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | severe.mp3 | 21-Apr-2007 10:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | severance.mp3 | 21-Apr-2007 10:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | severalty.mp3 | 21-Apr-2007 10:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | severally.mp3 | 21-Apr-2007 10:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | severalfold.mp3 | 21-Apr-2007 10:09 | 12K | |
![[SND]](/icons/sound2.gif) | several.mp3 | 21-Apr-2007 10:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | severable.mp3 | 21-Apr-2007 10:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | severability.mp3 | 21-Apr-2007 10:09 | 11K | |
![[SND]](/icons/sound2.gif) | sever.mp3 | 21-Apr-2007 10:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | seventyleven.mp3 | 21-Apr-2007 10:09 | 17K | |
![[SND]](/icons/sound2.gif) | seventy.mp3 | 21-Apr-2007 10:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | seventy-eight.mp3 | 21-Apr-2007 10:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | seventieth.mp3 | 21-Apr-2007 10:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | sevenths.mp3 | 21-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | seventh.mp3 | 21-Apr-2007 10:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | seventeenthamendment.mp3 | 21-Apr-2007 10:09 | 17K | |
![[SND]](/icons/sound2.gif) | seventeenth.mp3 | 21-Apr-2007 10:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | seventeener.mp3 | 21-Apr-2007 10:09 | 17K | |
![[SND]](/icons/sound2.gif) | seventeen.mp3 | 21-Apr-2007 10:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | sevenpenny.mp3 | 21-Apr-2007 10:09 | 17K | |
![[SND]](/icons/sound2.gif) | sevenfold.mp3 | 21-Apr-2007 10:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | sevener.mp3 | 21-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | seven.mp3 | 21-Apr-2007 10:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | seven-up.mp3 | 21-Apr-2007 10:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | seve.mp3 | 21-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | seuss.mp3 | 21-Apr-2007 10:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | setwall.mp3 | 21-Apr-2007 10:08 | 17K | |
![[SND]](/icons/sound2.gif) | setup.mp3 | 21-Apr-2007 10:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | setulose.mp3 | 21-Apr-2007 10:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | setula.mp3 | 21-Apr-2007 10:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | settlor.mp3 | 21-Apr-2007 10:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | settling.mp3 | 21-Apr-2007 10:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | settler.mp3 | 21-Apr-2007 10:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | settlement.mp3 | 21-Apr-2007 10:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | settled.mp3 | 21-Apr-2007 10:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | settleable.mp3 | 21-Apr-2007 10:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | settle.mp3 | 21-Apr-2007 10:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | setting.mp3 | 21-Apr-2007 10:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | setter.mp3 | 21-Apr-2007 10:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | settee.mp3 | 21-Apr-2007 10:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | settecento.mp3 | 21-Apr-2007 10:08 | 17K | |
![[SND]](/icons/sound2.gif) | settecentesque.mp3 | 21-Apr-2007 10:08 | 17K | |
![[SND]](/icons/sound2.gif) | sett.mp3 | 21-Apr-2007 10:08 | 5.4K | |
![[SND]](/icons/sound2.gif) | setswana.mp3 | 21-Apr-2007 10:08 | 17K | |
![[SND]](/icons/sound2.gif) | setscrew.mp3 | 21-Apr-2007 10:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | sets.mp3 | 21-Apr-2007 10:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | setout.mp3 | 21-Apr-2007 10:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | setose.mp3 | 21-Apr-2007 10:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | setoff.mp3 | 21-Apr-2007 10:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | setline.mp3 | 21-Apr-2007 10:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | setireme.mp3 | 21-Apr-2007 10:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | setigerous.mp3 | 21-Apr-2007 10:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | setiform.mp3 | 21-Apr-2007 10:07 | 17K | |
![[SND]](/icons/sound2.gif) | seti.mp3 | 21-Apr-2007 10:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | setenant.mp3 | 21-Apr-2007 10:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | se tenant.mp3 | 20-Apr-2007 17:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | setback.mp3 | 21-Apr-2007 10:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | setaria.mp3 | 21-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | setal.mp3 | 21-Apr-2007 10:07 | 6.4K | |
![[SND]](/icons/sound2.gif) | setae.mp3 | 21-Apr-2007 10:07 | 6.4K | |
![[SND]](/icons/sound2.gif) | setaceous.mp3 | 21-Apr-2007 10:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | seta.mp3 | 21-Apr-2007 10:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | set.mp3 | 21-Apr-2007 10:06 | 5.0K | |
![[SND]](/icons/sound2.gif) | set-to.mp3 | 21-Apr-2007 10:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | set-in.mp3 | 21-Apr-2007 10:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | set-aside.mp3 | 21-Apr-2007 10:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | sestina.mp3 | 21-Apr-2007 10:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | sestet.mp3 | 21-Apr-2007 10:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | sestertius.mp3 | 21-Apr-2007 10:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | sestertium.mp3 | 21-Apr-2007 10:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | sestertia.mp3 | 21-Apr-2007 10:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | sesterce.mp3 | 21-Apr-2007 10:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sessionalindemnity.mp3 | 21-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | sessional.mp3 | 21-Apr-2007 10:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | session.mp3 | 21-Apr-2007 10:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | sessile.mp3 | 21-Apr-2007 10:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | sess.mp3 | 21-Apr-2007 10:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | sesquiterpene.mp3 | 21-Apr-2007 10:06 | 10K | |
![[SND]](/icons/sound2.gif) | sesquipedalian.mp3 | 21-Apr-2007 10:06 | 11K | |
![[SND]](/icons/sound2.gif) | sesquicentennial.mp3 | 21-Apr-2007 10:06 | 12K | |
![[SND]](/icons/sound2.gif) | sesquicentenary.mp3 | 21-Apr-2007 10:06 | 12K | |
![[SND]](/icons/sound2.gif) | sesquicarbonate.mp3 | 21-Apr-2007 10:06 | 11K | |
![[SND]](/icons/sound2.gif) | sesquialteral.mp3 | 21-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | sesquialtera.mp3 | 21-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | sesqui.mp3 | 21-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | sesostris.mp3 | 21-Apr-2007 10:05 | 17K | |
![[SND]](/icons/sound2.gif) | sesky.mp3 | 21-Apr-2007 10:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | sesh.mp3 | 21-Apr-2007 10:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | sesamoid.mp3 | 21-Apr-2007 10:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | sesame.mp3 | 21-Apr-2007 10:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | ses.mp3 | 21-Apr-2007 10:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | servomotor.mp3 | 21-Apr-2007 10:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | servomechanism.mp3 | 21-Apr-2007 10:05 | 11K | |
![[SND]](/icons/sound2.gif) | servo.mp3 | 21-Apr-2007 10:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | serviustullius.mp3 | 21-Apr-2007 10:05 | 17K | |
![[SND]](/icons/sound2.gif) | servitude.mp3 | 21-Apr-2007 10:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | servitor.mp3 | 21-Apr-2007 10:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | servingman.mp3 | 21-Apr-2007 10:05 | 17K | |
![[SND]](/icons/sound2.gif) | serving.mp3 | 21-Apr-2007 10:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | servility.mp3 | 21-Apr-2007 10:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | servileness.mp3 | 21-Apr-2007 10:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | servilely.mp3 | 21-Apr-2007 10:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | servile.mp3 | 21-Apr-2007 10:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | serviette.mp3 | 21-Apr-2007 10:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | servienttenement.mp3 | 21-Apr-2007 10:05 | 17K | |
![[SND]](/icons/sound2.gif) | servicewoman.mp3 | 21-Apr-2007 10:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | serviceman.mp3 | 21-Apr-2007 10:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | serviceberry.mp3 | 21-Apr-2007 10:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | serviceably.mp3 | 21-Apr-2007 10:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | serviceableness.mp3 | 21-Apr-2007 10:04 | 11K | |
![[SND]](/icons/sound2.gif) | serviceable.mp3 | 21-Apr-2007 10:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | serviceability.mp3 | 21-Apr-2007 10:04 | 11K | |
![[SND]](/icons/sound2.gif) | service.mp3 | 21-Apr-2007 10:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | servery.mp3 | 21-Apr-2007 10:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | server.mp3 | 21-Apr-2007 10:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | serve.mp3 | 21-Apr-2007 10:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | servanthood.mp3 | 21-Apr-2007 10:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | servant.mp3 | 21-Apr-2007 10:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | serval.mp3 | 21-Apr-2007 10:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | serv.mp3 | 21-Apr-2007 10:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | serum.mp3 | 21-Apr-2007 10:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | sertularian.mp3 | 21-Apr-2007 10:04 | 17K | |
![[SND]](/icons/sound2.gif) | sertraline.mp3 | 21-Apr-2007 10:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | sertomaclub.mp3 | 21-Apr-2007 10:04 | 17K | |
![[SND]](/icons/sound2.gif) | sertolicell.mp3 | 21-Apr-2007 10:04 | 17K | |
![[SND]](/icons/sound2.gif) | serry.mp3 | 21-Apr-2007 10:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | serrurerie.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serrulation.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serrulate.mp3 | 21-Apr-2007 10:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | serriform.mp3 | 21-Apr-2007 10:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | serried.mp3 | 21-Apr-2007 10:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | serricorn.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serrepapier.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serrefine.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serration.mp3 | 21-Apr-2007 10:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | serratia.mp3 | 21-Apr-2007 10:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | serrated.mp3 | 21-Apr-2007 10:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | serrate.mp3 | 21-Apr-2007 10:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | serranoid.mp3 | 21-Apr-2007 10:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | serrano.mp3 | 21-Apr-2007 10:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | serranid.mp3 | 21-Apr-2007 10:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | serrajunipero.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serradomar.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serradilla.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serradamantiqueira.mp3 | 21-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | serra.mp3 | 21-Apr-2007 10:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | serpulid.mp3 | 21-Apr-2007 10:02 | 17K | |
![[SND]](/icons/sound2.gif) | serpula.mp3 | 21-Apr-2007 10:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | serpukhov.mp3 | 21-Apr-2007 10:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | serps.mp3 | 21-Apr-2007 10:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | serpigo.mp3 | 21-Apr-2007 10:02 | 17K | |
![[SND]](/icons/sound2.gif) | serpiginous.mp3 | 21-Apr-2007 10:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | serpico.mp3 | 21-Apr-2007 10:02 | 17K | |
![[SND]](/icons/sound2.gif) | serpentis.mp3 | 21-Apr-2007 10:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | serpentinous.mp3 | 21-Apr-2007 10:02 | 17K | |
![[SND]](/icons/sound2.gif) | serpentinize.mp3 | 21-Apr-2007 10:02 | 17K | |
![[SND]](/icons/sound2.gif) | serpentine.mp3 | 21-Apr-2007 10:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | serpentiform.mp3 | 21-Apr-2007 10:02 | 17K | |
![[SND]](/icons/sound2.gif) | serpentarium.mp3 | 21-Apr-2007 10:02 | 17K | |
![[SND]](/icons/sound2.gif) | serpent.mp3 | 21-Apr-2007 10:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | serpens.mp3 | 21-Apr-2007 10:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | serpasil.mp3 | 21-Apr-2007 10:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | serow.mp3 | 21-Apr-2007 10:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | serous.mp3 | 21-Apr-2007 10:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | serotype.mp3 | 21-Apr-2007 10:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | serotoninergic.mp3 | 21-Apr-2007 10:01 | 12K | |
![[SND]](/icons/sound2.gif) | serotonin.mp3 | 21-Apr-2007 10:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | serotonergic.mp3 | 21-Apr-2007 10:01 | 11K | |
![[SND]](/icons/sound2.gif) | serotiny.mp3 | 21-Apr-2007 10:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | serotinous.mp3 | 21-Apr-2007 10:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | serotine.mp3 | 21-Apr-2007 10:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | serotinal.mp3 | 21-Apr-2007 10:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | serositis.mp3 | 21-Apr-2007 10:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | serosal.mp3 | 21-Apr-2007 10:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | serosa.mp3 | 21-Apr-2007 10:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | seropurulent.mp3 | 21-Apr-2007 10:01 | 10K | |
![[SND]](/icons/sound2.gif) | seroprevalence.mp3 | 21-Apr-2007 10:01 | 12K | |
![[SND]](/icons/sound2.gif) | seropositivity.mp3 | 21-Apr-2007 10:01 | 13K | |
![[SND]](/icons/sound2.gif) | seropositive.mp3 | 21-Apr-2007 10:01 | 12K | |
![[SND]](/icons/sound2.gif) | seronegativity.mp3 | 21-Apr-2007 10:01 | 12K | |
![[SND]](/icons/sound2.gif) | seronegative.mp3 | 21-Apr-2007 10:01 | 11K | |
![[SND]](/icons/sound2.gif) | seroma.mp3 | 21-Apr-2007 10:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | serology.mp3 | 21-Apr-2007 10:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | serologist.mp3 | 21-Apr-2007 10:01 | 10K | |
![[SND]](/icons/sound2.gif) | serologically.mp3 | 21-Apr-2007 10:01 | 10K | |
![[SND]](/icons/sound2.gif) | serological.mp3 | 21-Apr-2007 10:01 | 11K | |
![[SND]](/icons/sound2.gif) | serologic.mp3 | 21-Apr-2007 10:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | seroconvert.mp3 | 21-Apr-2007 10:01 | 10K | |
![[SND]](/icons/sound2.gif) | seroconversion.mp3 | 21-Apr-2007 10:00 | 13K | |
![[SND]](/icons/sound2.gif) | sero.mp3 | 21-Apr-2007 10:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sermonize.mp3 | 21-Apr-2007 10:00 | 10K | |
![[SND]](/icons/sound2.gif) | sermonic.mp3 | 21-Apr-2007 10:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sermonette.mp3 | 21-Apr-2007 10:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sermon.mp3 | 21-Apr-2007 10:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | serlio.mp3 | 21-Apr-2007 10:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | serjeanty.mp3 | 21-Apr-2007 10:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | serjeant.mp3 | 21-Apr-2007 10:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | serjeant-at-law.mp3 | 21-Apr-2007 10:00 | 12K | |
![[SND]](/icons/sound2.gif) | seriplane.mp3 | 21-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | seriph.mp3 | 21-Apr-2007 10:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | seriousness.mp3 | 21-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | seriously.mp3 | 21-Apr-2007 10:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | serious.mp3 | 21-Apr-2007 10:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | serious-minded.mp3 | 21-Apr-2007 10:00 | 11K | |
![[SND]](/icons/sound2.gif) | seriocomics.mp3 | 21-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | seriocomically.mp3 | 21-Apr-2007 10:00 | 12K | |
![[SND]](/icons/sound2.gif) | seriocomic.mp3 | 21-Apr-2007 10:00 | 11K | |
![[SND]](/icons/sound2.gif) | seriocomedy.mp3 | 21-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | seringa.mp3 | 21-Apr-2007 10:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | serinette.mp3 | 21-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | serine.mp3 | 21-Apr-2007 09:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | serin.mp3 | 21-Apr-2007 09:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | serigraphy.mp3 | 21-Apr-2007 09:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | serigrapher.mp3 | 21-Apr-2007 09:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | serigraph.mp3 | 21-Apr-2007 09:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | seriffed.mp3 | 21-Apr-2007 09:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | serif.mp3 | 21-Apr-2007 09:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | serieswound.mp3 | 21-Apr-2007 09:59 | 17K | |
![[SND]](/icons/sound2.gif) | serieswinding.mp3 | 21-Apr-2007 09:59 | 17K | |
![[SND]](/icons/sound2.gif) | series.mp3 | 21-Apr-2007 09:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | seriema.mp3 | 21-Apr-2007 09:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | sericulturist.mp3 | 21-Apr-2007 09:59 | 11K | |
![[SND]](/icons/sound2.gif) | sericulture.mp3 | 21-Apr-2007 09:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | sericultural.mp3 | 21-Apr-2007 09:59 | 10K | |
![[SND]](/icons/sound2.gif) | serictery.mp3 | 21-Apr-2007 09:59 | 17K | |
![[SND]](/icons/sound2.gif) | sericite.mp3 | 21-Apr-2007 09:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | sericin.mp3 | 21-Apr-2007 09:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | sericeous.mp3 | 21-Apr-2007 09:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | sericate.mp3 | 21-Apr-2007 09:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | seric.mp3 | 21-Apr-2007 09:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | seriation.mp3 | 21-Apr-2007 09:59 | 17K | |
![[SND]](/icons/sound2.gif) | seriatim.mp3 | 21-Apr-2007 09:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | seriate.mp3 | 21-Apr-2007 09:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | serially.mp3 | 21-Apr-2007 09:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | serialize.mp3 | 21-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | serialization.mp3 | 21-Apr-2007 09:58 | 13K | |
![[SND]](/icons/sound2.gif) | seriality.mp3 | 21-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | serialist.mp3 | 21-Apr-2007 09:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | serialism.mp3 | 21-Apr-2007 09:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | serial.mp3 | 21-Apr-2007 09:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | seri.mp3 | 21-Apr-2007 09:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | sergiusi.mp3 | 21-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | serging.mp3 | 21-Apr-2007 09:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | sergiev.mp3 | 21-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | sergeanty.mp3 | 21-Apr-2007 09:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | sergeantbilko.mp3 | 21-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | sergeant.mp3 | 21-Apr-2007 09:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | sergeancy.mp3 | 21-Apr-2007 09:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | serge.mp3 | 21-Apr-2007 09:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | serfdom.mp3 | 21-Apr-2007 09:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | serfage.mp3 | 21-Apr-2007 09:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | serf.mp3 | 21-Apr-2007 09:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | sereth.mp3 | 21-Apr-2007 09:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | sereno.mp3 | 21-Apr-2007 09:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | serenity.mp3 | 21-Apr-2007 09:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | serengeti.mp3 | 21-Apr-2007 09:57 | 17K | |
![[SND]](/icons/sound2.gif) | sereneness.mp3 | 21-Apr-2007 09:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | serene.mp3 | 21-Apr-2007 09:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | serendipper.mp3 | 21-Apr-2007 09:57 | 17K | |
![[SND]](/icons/sound2.gif) | serendipity.mp3 | 21-Apr-2007 09:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | serendipitous.mp3 | 21-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | serendip.mp3 | 21-Apr-2007 09:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | serenata.mp3 | 21-Apr-2007 09:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | serenade.mp3 | 21-Apr-2007 09:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | serena.mp3 | 21-Apr-2007 09:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | seremban.mp3 | 21-Apr-2007 09:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | serein.mp3 | 21-Apr-2007 09:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | sere.mp3 | 21-Apr-2007 09:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | serdab.mp3 | 21-Apr-2007 09:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | sercq.mp3 | 21-Apr-2007 09:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | serbonian.mp3 | 21-Apr-2007 09:57 | 17K | |
![[SND]](/icons/sound2.gif) | serbo.mp3 | 21-Apr-2007 09:57 | 17K | |
![[SND]](/icons/sound2.gif) | seraskier.mp3 | 21-Apr-2007 09:56 | 17K | |
![[SND]](/icons/sound2.gif) | seraphine.mp3 | 21-Apr-2007 09:56 | 17K | |
![[SND]](/icons/sound2.gif) | seraphim.mp3 | 21-Apr-2007 09:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | seraphically.mp3 | 21-Apr-2007 09:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | seraphic.mp3 | 21-Apr-2007 09:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | seraph.mp3 | 21-Apr-2007 09:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | serapeum.mp3 | 21-Apr-2007 09:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | serape.mp3 | 21-Apr-2007 09:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | serang.mp3 | 21-Apr-2007 09:56 | 17K | |
![[SND]](/icons/sound2.gif) | seral.mp3 | 21-Apr-2007 09:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | serajevo.mp3 | 21-Apr-2007 09:56 | 17K | |
![[SND]](/icons/sound2.gif) | serai.mp3 | 21-Apr-2007 09:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | seraglio.mp3 | 21-Apr-2007 09:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | serac.mp3 | 21-Apr-2007 09:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | sera.mp3 | 21-Apr-2007 09:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | ser.mp3 | 21-Apr-2007 09:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | sequoya.mp3 | 21-Apr-2007 09:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | sequoia.mp3 | 21-Apr-2007 09:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | sequitur.mp3 | 21-Apr-2007 09:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | sequinned.mp3 | 21-Apr-2007 09:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | sequined.mp3 | 21-Apr-2007 09:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | sequin.mp3 | 21-Apr-2007 09:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | sequestrum.mp3 | 21-Apr-2007 09:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | sequestrectomy.mp3 | 21-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | sequestrator.mp3 | 21-Apr-2007 09:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | sequestration.mp3 | 21-Apr-2007 09:55 | 10K | |
![[SND]](/icons/sound2.gif) | sequestrate.mp3 | 21-Apr-2007 09:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | sequestrant.mp3 | 21-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | sequestra.mp3 | 21-Apr-2007 09:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | sequestering.mp3 | 21-Apr-2007 09:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | sequestered.mp3 | 21-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | sequester.mp3 | 21-Apr-2007 09:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | sequentially.mp3 | 21-Apr-2007 09:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | sequential.mp3 | 21-Apr-2007 09:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | sequentes.mp3 | 21-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | sequent.mp3 | 21-Apr-2007 09:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | sequency.mp3 | 21-Apr-2007 09:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | sequencing.mp3 | 21-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | sequencer.mp3 | 21-Apr-2007 09:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | sequence.mp3 | 21-Apr-2007 09:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | sequenator.mp3 | 21-Apr-2007 09:54 | 17K | |
![[SND]](/icons/sound2.gif) | sequelae.mp3 | 21-Apr-2007 09:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | sequela.mp3 | 21-Apr-2007 09:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | sequel.mp3 | 21-Apr-2007 09:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | sequacity.mp3 | 21-Apr-2007 09:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | sequacious.mp3 | 21-Apr-2007 09:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | sepulture.mp3 | 21-Apr-2007 09:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | sepulchre.mp3 | 21-Apr-2007 09:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | sepulchrally.mp3 | 21-Apr-2007 09:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | sepulchral.mp3 | 21-Apr-2007 09:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | sepulchering.mp3 | 21-Apr-2007 09:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | sepulcher.mp3 | 21-Apr-2007 09:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | septuplicate.mp3 | 21-Apr-2007 09:54 | 36K | |
![[SND]](/icons/sound2.gif) | septuplet.mp3 | 21-Apr-2007 09:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | septuple.mp3 | 21-Apr-2007 09:54 | 17K | |
![[SND]](/icons/sound2.gif) | septuor.mp3 | 21-Apr-2007 09:54 | 17K | |
![[SND]](/icons/sound2.gif) | septum.mp3 | 21-Apr-2007 09:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | septuagenary.mp3 | 21-Apr-2007 09:53 | 17K | |
![[SND]](/icons/sound2.gif) | septuagenarian.mp3 | 21-Apr-2007 09:53 | 14K | |
![[SND]](/icons/sound2.gif) | septolet.mp3 | 21-Apr-2007 09:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | septivalent.mp3 | 21-Apr-2007 09:53 | 17K | |
![[SND]](/icons/sound2.gif) | septingenary.mp3 | 21-Apr-2007 09:53 | 17K | |
![[SND]](/icons/sound2.gif) | septimus.mp3 | 21-Apr-2007 09:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | septime.mp3 | 21-Apr-2007 09:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | septimana.mp3 | 21-Apr-2007 09:53 | 17K | |
![[SND]](/icons/sound2.gif) | septimal.mp3 | 21-Apr-2007 09:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | septillion.mp3 | 21-Apr-2007 09:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | septiles.mp3 | 21-Apr-2007 09:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | septifragal.mp3 | 21-Apr-2007 09:53 | 17K | |
![[SND]](/icons/sound2.gif) | septicidal.mp3 | 21-Apr-2007 09:53 | 10K | |
![[SND]](/icons/sound2.gif) | septicemic.mp3 | 21-Apr-2007 09:53 | 10K | |
![[SND]](/icons/sound2.gif) | septicemia.mp3 | 21-Apr-2007 09:53 | 10K | |
![[SND]](/icons/sound2.gif) | septic.mp3 | 21-Apr-2007 09:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | septi.mp3 | 21-Apr-2007 09:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | septfoil.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septet.mp3 | 21-Apr-2007 09:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | septentrional.mp3 | 21-Apr-2007 09:52 | 11K | |
![[SND]](/icons/sound2.gif) | septentrion.mp3 | 21-Apr-2007 09:52 | 11K | |
![[SND]](/icons/sound2.gif) | septennium.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septennially.mp3 | 21-Apr-2007 09:52 | 9.8K | |
![[SND]](/icons/sound2.gif) | septennial.mp3 | 21-Apr-2007 09:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | septennate.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septendecillion.mp3 | 21-Apr-2007 09:52 | 12K | |
![[SND]](/icons/sound2.gif) | septenate.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septenary.mp3 | 21-Apr-2007 09:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | septenarius.mp3 | 21-Apr-2007 09:52 | 11K | |
![[SND]](/icons/sound2.gif) | septenarii.mp3 | 21-Apr-2007 09:52 | 11K | |
![[SND]](/icons/sound2.gif) | septemvirate.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septemviral.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septemvir.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septempartite.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septembrist.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septectomy.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septavalent.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septate.mp3 | 21-Apr-2007 09:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | septarium.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septangular.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septangle.mp3 | 21-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | septan.mp3 | 21-Apr-2007 09:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | septal.mp3 | 21-Apr-2007 09:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | septage.mp3 | 21-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | septa.mp3 | 21-Apr-2007 09:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | sept.mp3 | 21-Apr-2007 09:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | sepsis.mp3 | 21-Apr-2007 09:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | sepsine.mp3 | 21-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | sepses.mp3 | 21-Apr-2007 09:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | seps.mp3 | 21-Apr-2007 09:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | seppuku.mp3 | 21-Apr-2007 09:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sepoy.mp3 | 21-Apr-2007 09:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | sepiolite.mp3 | 21-Apr-2007 09:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | sepia.mp3 | 21-Apr-2007 09:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | sephora.mp3 | 21-Apr-2007 09:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sephertorah.mp3 | 21-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | sepharvites.mp3 | 21-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | separatrix.mp3 | 21-Apr-2007 09:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | separatory.mp3 | 21-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | separator.mp3 | 21-Apr-2007 09:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | separative.mp3 | 21-Apr-2007 09:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | separatistic.mp3 | 21-Apr-2007 09:50 | 10K | |
![[SND]](/icons/sound2.gif) | separatist.mp3 | 21-Apr-2007 09:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | separatism.mp3 | 21-Apr-2007 09:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | separationist.mp3 | 21-Apr-2007 09:50 | 11K | |
![[SND]](/icons/sound2.gif) | separation.mp3 | 21-Apr-2007 09:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | separateness.mp3 | 21-Apr-2007 09:50 | 10K | |
![[SND]](/icons/sound2.gif) | separately.mp3 | 21-Apr-2007 09:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | separate.mp3 | 21-Apr-2007 09:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | separable.mp3 | 21-Apr-2007 09:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | separability.mp3 | 21-Apr-2007 09:50 | 10K | |
![[SND]](/icons/sound2.gif) | sepalous.mp3 | 21-Apr-2007 09:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sepaloid.mp3 | 21-Apr-2007 09:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | sepal.mp3 | 21-Apr-2007 09:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | senza.mp3 | 21-Apr-2007 09:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | senwood.mp3 | 21-Apr-2007 09:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | senusi.mp3 | 21-Apr-2007 09:50 | 17K | |
![[SND]](/icons/sound2.gif) | senufo.mp3 | 21-Apr-2007 09:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | sentry.mp3 | 21-Apr-2007 09:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | sentinel.mp3 | 21-Apr-2007 09:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | sentimo.mp3 | 21-Apr-2007 09:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | sentimentalize.mp3 | 21-Apr-2007 09:50 | 12K | |
![[SND]](/icons/sound2.gif) | sentimentalization.mp3 | 21-Apr-2007 09:50 | 14K | |
![[SND]](/icons/sound2.gif) | sentimentality.mp3 | 21-Apr-2007 09:49 | 12K | |
![[SND]](/icons/sound2.gif) | sentimentalist.mp3 | 21-Apr-2007 09:49 | 11K | |
![[SND]](/icons/sound2.gif) | sentimentalism.mp3 | 21-Apr-2007 09:49 | 11K | |
![[SND]](/icons/sound2.gif) | sentimental.mp3 | 21-Apr-2007 09:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | sentiment.mp3 | 21-Apr-2007 09:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | sentient.mp3 | 21-Apr-2007 09:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | sentience.mp3 | 21-Apr-2007 09:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | senti.mp3 | 21-Apr-2007 09:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | sententious.mp3 | 21-Apr-2007 09:49 | 10K | |
![[SND]](/icons/sound2.gif) | sentential.mp3 | 21-Apr-2007 09:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | sententiae.mp3 | 21-Apr-2007 09:49 | 10K | |
![[SND]](/icons/sound2.gif) | sententia.mp3 | 21-Apr-2007 09:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | sentence.mp3 | 21-Apr-2007 09:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | sente.mp3 | 21-Apr-2007 09:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | sent.mp3 | 21-Apr-2007 09:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | sensustricto.mp3 | 21-Apr-2007 09:49 | 17K | |
![[SND]](/icons/sound2.gif) | sensu stricto.mp3 | 21-Apr-2007 09:48 | 12K | |
![[SND]](/icons/sound2.gif) | sensurround.mp3 | 21-Apr-2007 09:49 | 17K | |
![[SND]](/icons/sound2.gif) | sensuously.mp3 | 21-Apr-2007 09:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | sensuous.mp3 | 21-Apr-2007 09:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | sensuosity.mp3 | 21-Apr-2007 09:49 | 10K | |
![[SND]](/icons/sound2.gif) | sensum.mp3 | 21-Apr-2007 09:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sensulato.mp3 | 21-Apr-2007 09:49 | 17K | |
![[SND]](/icons/sound2.gif) | sensuism.mp3 | 21-Apr-2007 09:49 | 17K | |
![[SND]](/icons/sound2.gif) | sensually.mp3 | 21-Apr-2007 09:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | sensualize.mp3 | 21-Apr-2007 09:49 | 11K | |
![[SND]](/icons/sound2.gif) | sensualization.mp3 | 21-Apr-2007 09:49 | 12K | |
![[SND]](/icons/sound2.gif) | sensuality.mp3 | 21-Apr-2007 09:49 | 10K | |
![[SND]](/icons/sound2.gif) | sensualistic.mp3 | 21-Apr-2007 09:48 | 11K | |
![[SND]](/icons/sound2.gif) | sensualist.mp3 | 21-Apr-2007 09:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | sensualism.mp3 | 21-Apr-2007 09:48 | 10K | |
![[SND]](/icons/sound2.gif) | sensual.mp3 | 21-Apr-2007 09:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | sensu.mp3 | 21-Apr-2007 09:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | sensory.mp3 | 21-Apr-2007 09:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | sensorium.mp3 | 21-Apr-2007 09:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | sensorineural.mp3 | 21-Apr-2007 09:48 | 11K | |
![[SND]](/icons/sound2.gif) | sensorimotor.mp3 | 21-Apr-2007 09:48 | 11K | |
![[SND]](/icons/sound2.gif) | sensorially.mp3 | 21-Apr-2007 09:48 | 11K | |
![[SND]](/icons/sound2.gif) | sensorial.mp3 | 21-Apr-2007 09:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | sensoria.mp3 | 21-Apr-2007 09:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | sensor.mp3 | 21-Apr-2007 09:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | sensodyne.mp3 | 21-Apr-2007 09:48 | 17K | |
![[SND]](/icons/sound2.gif) | sensitometry.mp3 | 21-Apr-2007 09:48 | 11K | |
![[SND]](/icons/sound2.gif) | sensitometric.mp3 | 21-Apr-2007 09:48 | 10K | |
![[SND]](/icons/sound2.gif) | sensitometer.mp3 | 21-Apr-2007 09:48 | 10K | |
![[SND]](/icons/sound2.gif) | sensitize.mp3 | 21-Apr-2007 09:48 | 10K | |
![[SND]](/icons/sound2.gif) | sensitization.mp3 | 21-Apr-2007 09:48 | 11K | |
![[SND]](/icons/sound2.gif) | sensitivity.mp3 | 21-Apr-2007 09:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | sensitiveness.mp3 | 21-Apr-2007 09:48 | 17K | |
![[SND]](/icons/sound2.gif) | sensitive.mp3 | 21-Apr-2007 09:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | sensillum.mp3 | 21-Apr-2007 09:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | sensillae.mp3 | 21-Apr-2007 09:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | sensilla.mp3 | 21-Apr-2007 09:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | sensibly.mp3 | 21-Apr-2007 09:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | sensible.mp3 | 21-Apr-2007 09:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | sensibility.mp3 | 21-Apr-2007 09:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | sensibilia.mp3 | 21-Apr-2007 09:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | senseless.mp3 | 21-Apr-2007 09:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | sensei.mp3 | 21-Apr-2007 09:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | senseful.mp3 | 21-Apr-2007 09:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | sense.mp3 | 21-Apr-2007 09:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | sensaysh.mp3 | 21-Apr-2007 09:47 | 17K | |
![[SND]](/icons/sound2.gif) | sensationism.mp3 | 21-Apr-2007 09:47 | 17K | |
![[SND]](/icons/sound2.gif) | sensationalize.mp3 | 21-Apr-2007 09:47 | 13K | |
![[SND]](/icons/sound2.gif) | sensationalistic.mp3 | 21-Apr-2007 09:47 | 13K | |
![[SND]](/icons/sound2.gif) | sensationalist.mp3 | 21-Apr-2007 09:47 | 13K | |
![[SND]](/icons/sound2.gif) | sensationalism.mp3 | 21-Apr-2007 09:47 | 12K | |
![[SND]](/icons/sound2.gif) | sensational.mp3 | 21-Apr-2007 09:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | sensation.mp3 | 21-Apr-2007 09:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | sensate.mp3 | 21-Apr-2007 09:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | sensa.mp3 | 21-Apr-2007 09:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | senryu.mp3 | 21-Apr-2007 09:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | senoussi.mp3 | 21-Apr-2007 09:47 | 17K | |
![[SND]](/icons/sound2.gif) | senorita.mp3 | 21-Apr-2007 09:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | senores.mp3 | 21-Apr-2007 09:47 | 10K | |
![[SND]](/icons/sound2.gif) | senora.mp3 | 21-Apr-2007 09:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | senor.mp3 | 21-Apr-2007 09:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | senoneveroebentrovato.mp3 | 21-Apr-2007 09:47 | 36K | |
![[SND]](/icons/sound2.gif) | se non e vero, e ben trovato.mp3 | 20-Apr-2007 17:39 | 23K | |
![[SND]](/icons/sound2.gif) | sennit.mp3 | 21-Apr-2007 09:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | sennight.mp3 | 21-Apr-2007 09:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | sennett.mp3 | 21-Apr-2007 09:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | sennet.mp3 | 21-Apr-2007 09:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | sennar.mp3 | 21-Apr-2007 09:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | sennaknot.mp3 | 21-Apr-2007 09:46 | 17K | |
![[SND]](/icons/sound2.gif) | sennackerib.mp3 | 21-Apr-2007 09:46 | 17K | |
![[SND]](/icons/sound2.gif) | senna.mp3 | 21-Apr-2007 09:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | seniti.mp3 | 21-Apr-2007 09:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | seniority.mp3 | 21-Apr-2007 09:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | senioritis.mp3 | 21-Apr-2007 09:46 | 17K | |
![[SND]](/icons/sound2.gif) | seniorespriores.mp3 | 21-Apr-2007 09:46 | 27K | |
![[SND]](/icons/sound2.gif) | senior.mp3 | 21-Apr-2007 09:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | senility.mp3 | 21-Apr-2007 09:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | senilely.mp3 | 21-Apr-2007 09:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | senile.mp3 | 21-Apr-2007 09:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | senhouseslip.mp3 | 21-Apr-2007 09:46 | 17K | |
![[SND]](/icons/sound2.gif) | senhorita.mp3 | 21-Apr-2007 09:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | senhores.mp3 | 21-Apr-2007 09:46 | 9.8K | |
![[SND]](/icons/sound2.gif) | senhora.mp3 | 21-Apr-2007 09:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | senhor.mp3 | 21-Apr-2007 09:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | sengreen.mp3 | 21-Apr-2007 09:46 | 17K | |
![[SND]](/icons/sound2.gif) | sengi.mp3 | 21-Apr-2007 09:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | seneschal.mp3 | 21-Apr-2007 09:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | senescent.mp3 | 21-Apr-2007 09:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | senescence.mp3 | 21-Apr-2007 09:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | senesce.mp3 | 21-Apr-2007 09:45 | 17K | |
![[SND]](/icons/sound2.gif) | senegal.mp3 | 21-Apr-2007 09:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | senega.mp3 | 21-Apr-2007 09:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | senefelder.mp3 | 21-Apr-2007 09:45 | 17K | |
![[SND]](/icons/sound2.gif) | senectitude.mp3 | 21-Apr-2007 09:45 | 10K | |
![[SND]](/icons/sound2.gif) | senecio.mp3 | 21-Apr-2007 09:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | sene.mp3 | 21-Apr-2007 09:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | senderoluminoso.mp3 | 21-Apr-2007 09:45 | 17K | |
![[SND]](/icons/sound2.gif) | senderista.mp3 | 21-Apr-2007 09:45 | 17K | |
![[SND]](/icons/sound2.gif) | sender.mp3 | 21-Apr-2007 09:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sendee.mp3 | 21-Apr-2007 09:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | sendal.mp3 | 21-Apr-2007 09:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | sendaivirus.mp3 | 21-Apr-2007 09:45 | 17K | |
![[SND]](/icons/sound2.gif) | send.mp3 | 21-Apr-2007 09:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | send-up.mp3 | 21-Apr-2007 09:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | send-off.mp3 | 21-Apr-2007 09:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | senatusconsultum.mp3 | 21-Apr-2007 09:44 | 27K | |
![[SND]](/icons/sound2.gif) | senatus consultum.mp3 | 21-Apr-2007 09:44 | 13K | |
![[SND]](/icons/sound2.gif) | senatus consulta.mp3 | 21-Apr-2007 09:44 | 13K | |
![[SND]](/icons/sound2.gif) | senatusacademicus.mp3 | 21-Apr-2007 09:44 | 27K | |
![[SND]](/icons/sound2.gif) | senatus.mp3 | 21-Apr-2007 09:44 | 17K | |
![[SND]](/icons/sound2.gif) | senatorship.mp3 | 21-Apr-2007 09:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | senatorian.mp3 | 21-Apr-2007 09:44 | 10K | |
![[SND]](/icons/sound2.gif) | senatorial.mp3 | 21-Apr-2007 09:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | senator.mp3 | 21-Apr-2007 09:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | senate.mp3 | 21-Apr-2007 09:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | senary.mp3 | 21-Apr-2007 09:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | senarmontite.mp3 | 21-Apr-2007 09:44 | 17K | |
![[SND]](/icons/sound2.gif) | senarius.mp3 | 21-Apr-2007 09:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | senarii.mp3 | 21-Apr-2007 09:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | sena.mp3 | 21-Apr-2007 09:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | sen.mp3 | 21-Apr-2007 09:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | semtex.mp3 | 21-Apr-2007 09:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | sempstress.mp3 | 21-Apr-2007 09:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | sempre.mp3 | 21-Apr-2007 09:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | semplice.mp3 | 21-Apr-2007 09:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | semple.mp3 | 21-Apr-2007 09:44 | 5.7K | |
![[SND]](/icons/sound2.gif) | sempiternity.mp3 | 21-Apr-2007 09:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | sempiternal.mp3 | 21-Apr-2007 09:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | sempervivum.mp3 | 21-Apr-2007 09:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | sempervirent.mp3 | 21-Apr-2007 09:44 | 17K | |
![[SND]](/icons/sound2.gif) | semperparatus.mp3 | 21-Apr-2007 09:44 | 17K | |
![[SND]](/icons/sound2.gif) | semper paratus.mp3 | 21-Apr-2007 09:43 | 12K | |
![[SND]](/icons/sound2.gif) | semperidem.mp3 | 21-Apr-2007 09:43 | 17K | |
![[SND]](/icons/sound2.gif) | semper idem.mp3 | 21-Apr-2007 09:43 | 12K | |
![[SND]](/icons/sound2.gif) | semperfidelis.mp3 | 21-Apr-2007 09:43 | 17K | |
![[SND]](/icons/sound2.gif) | semper fidelis.mp3 | 21-Apr-2007 09:43 | 12K | |
![[SND]](/icons/sound2.gif) | semperfi.mp3 | 21-Apr-2007 09:43 | 17K | |
![[SND]](/icons/sound2.gif) | sempereadem.mp3 | 21-Apr-2007 09:43 | 17K | |
![[SND]](/icons/sound2.gif) | semper eadem.mp3 | 21-Apr-2007 09:43 | 14K | |
![[SND]](/icons/sound2.gif) | semper.mp3 | 21-Apr-2007 09:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | sempe.mp3 | 21-Apr-2007 09:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | sempach.mp3 | 21-Apr-2007 09:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | semolina.mp3 | 21-Apr-2007 09:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | semolia.mp3 | 21-Apr-2007 09:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | semmit.mp3 | 21-Apr-2007 09:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | semmelweis.mp3 | 21-Apr-2007 09:43 | 17K | |
![[SND]](/icons/sound2.gif) | semiyearly.mp3 | 21-Apr-2007 09:43 | 10K | |
![[SND]](/icons/sound2.gif) | semiworks.mp3 | 21-Apr-2007 09:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | semiweekly.mp3 | 21-Apr-2007 09:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | semivowel.mp3 | 21-Apr-2007 09:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | semitruck.mp3 | 21-Apr-2007 09:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | semitropics.mp3 | 21-Apr-2007 09:43 | 11K | |
![[SND]](/icons/sound2.gif) | semitropical.mp3 | 21-Apr-2007 09:43 | 10K | |
![[SND]](/icons/sound2.gif) | semitropic.mp3 | 21-Apr-2007 09:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | semitransparent.mp3 | 21-Apr-2007 09:43 | 12K | |
![[SND]](/icons/sound2.gif) | semitranslucent.mp3 | 21-Apr-2007 09:43 | 12K | |
![[SND]](/icons/sound2.gif) | semitrailer.mp3 | 21-Apr-2007 09:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | semitonically.mp3 | 21-Apr-2007 09:42 | 10K | |
![[SND]](/icons/sound2.gif) | semitonic.mp3 | 21-Apr-2007 09:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | semitone.mp3 | 21-Apr-2007 09:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | semitonal.mp3 | 21-Apr-2007 09:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | semitohamitic.mp3 | 21-Apr-2007 09:42 | 17K | |
![[SND]](/icons/sound2.gif) | semitize.mp3 | 21-Apr-2007 09:42 | 17K | |
![[SND]](/icons/sound2.gif) | semiterrestrial.mp3 | 21-Apr-2007 07:58 | 11K | |
![[SND]](/icons/sound2.gif) | semisynthetic.mp3 | 21-Apr-2007 07:58 | 10K | |
![[SND]](/icons/sound2.gif) | semisweet.mp3 | 21-Apr-2007 07:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | semisubmersible.mp3 | 21-Apr-2007 07:58 | 12K | |
![[SND]](/icons/sound2.gif) | semisolid.mp3 | 21-Apr-2007 07:58 | 9.8K | |
![[SND]](/icons/sound2.gif) | semisoft.mp3 | 21-Apr-2007 07:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | semiskilled.mp3 | 21-Apr-2007 07:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | semishrubby.mp3 | 21-Apr-2007 07:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | semisedentary.mp3 | 21-Apr-2007 07:58 | 12K | |
![[SND]](/icons/sound2.gif) | semisecret.mp3 | 21-Apr-2007 07:58 | 10K | |
![[SND]](/icons/sound2.gif) | semisacred.mp3 | 21-Apr-2007 07:58 | 9.5K | |
![[SND]](/icons/sound2.gif) | semis.mp3 | 21-Apr-2007 07:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | semirural.mp3 | 21-Apr-2007 07:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | semirigid.mp3 | 21-Apr-2007 07:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | semiretirement.mp3 | 21-Apr-2007 07:58 | 11K | |
![[SND]](/icons/sound2.gif) | semiretired.mp3 | 21-Apr-2007 07:58 | 11K | |
![[SND]](/icons/sound2.gif) | semireligious.mp3 | 21-Apr-2007 07:58 | 11K | |
![[SND]](/icons/sound2.gif) | semiramis.mp3 | 21-Apr-2007 07:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | semiquaver.mp3 | 21-Apr-2007 07:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | semiquantitative.mp3 | 21-Apr-2007 07:58 | 12K | |
![[SND]](/icons/sound2.gif) | semipublic.mp3 | 21-Apr-2007 07:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | semiprofessional.mp3 | 21-Apr-2007 07:58 | 11K | |
![[SND]](/icons/sound2.gif) | semipro.mp3 | 21-Apr-2007 07:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | semiprivate.mp3 | 21-Apr-2007 07:57 | 10K | |
![[SND]](/icons/sound2.gif) | semiprecious.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semipostal.mp3 | 21-Apr-2007 07:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | semipornography.mp3 | 21-Apr-2007 07:57 | 13K | |
![[SND]](/icons/sound2.gif) | semipornographic.mp3 | 21-Apr-2007 07:57 | 12K | |
![[SND]](/icons/sound2.gif) | semiporcelain.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semipopular.mp3 | 21-Apr-2007 07:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | semipolitical.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semipermeable.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semipermeability.mp3 | 21-Apr-2007 07:57 | 13K | |
![[SND]](/icons/sound2.gif) | semipermanent.mp3 | 21-Apr-2007 07:57 | 10K | |
![[SND]](/icons/sound2.gif) | semiparasitic.mp3 | 21-Apr-2007 07:57 | 12K | |
![[SND]](/icons/sound2.gif) | semiparasite.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semipalmated.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semiotics.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semioticist.mp3 | 21-Apr-2007 07:57 | 11K | |
![[SND]](/icons/sound2.gif) | semiotician.mp3 | 21-Apr-2007 07:57 | 10K | |
![[SND]](/icons/sound2.gif) | semiotic.mp3 | 21-Apr-2007 07:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | semiosis.mp3 | 21-Apr-2007 07:57 | 10K | |
![[SND]](/icons/sound2.gif) | semiopaque.mp3 | 21-Apr-2007 07:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | semiology.mp3 | 21-Apr-2007 07:57 | 10K | |
![[SND]](/icons/sound2.gif) | semiologist.mp3 | 21-Apr-2007 07:57 | 12K | |
![[SND]](/icons/sound2.gif) | semiologically.mp3 | 21-Apr-2007 07:56 | 12K | |
![[SND]](/icons/sound2.gif) | semiological.mp3 | 21-Apr-2007 07:56 | 11K | |
![[SND]](/icons/sound2.gif) | semiofficially.mp3 | 21-Apr-2007 07:56 | 11K | |
![[SND]](/icons/sound2.gif) | semiofficial.mp3 | 21-Apr-2007 07:56 | 10K | |
![[SND]](/icons/sound2.gif) | semiochemical.mp3 | 21-Apr-2007 07:56 | 17K | |
![[SND]](/icons/sound2.gif) | seminudity.mp3 | 21-Apr-2007 07:56 | 10K | |
![[SND]](/icons/sound2.gif) | seminude.mp3 | 21-Apr-2007 07:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | seminomadic.mp3 | 21-Apr-2007 07:56 | 10K | |
![[SND]](/icons/sound2.gif) | seminomad.mp3 | 21-Apr-2007 07:56 | 10K | |
![[SND]](/icons/sound2.gif) | seminivorous.mp3 | 21-Apr-2007 07:56 | 17K | |
![[SND]](/icons/sound2.gif) | seminiferous.mp3 | 21-Apr-2007 07:56 | 11K | |
![[SND]](/icons/sound2.gif) | seminatural.mp3 | 21-Apr-2007 07:56 | 10K | |
![[SND]](/icons/sound2.gif) | semination.mp3 | 21-Apr-2007 07:56 | 17K | |
![[SND]](/icons/sound2.gif) | seminate.mp3 | 21-Apr-2007 07:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | seminary.mp3 | 21-Apr-2007 07:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | seminarist.mp3 | 21-Apr-2007 07:56 | 9.3K | |
![[SND]](/icons/sound2.gif) | seminarian.mp3 | 21-Apr-2007 07:56 | 10K | |
![[SND]](/icons/sound2.gif) | seminar.mp3 | 21-Apr-2007 07:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | seminally.mp3 | 21-Apr-2007 07:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | seminal.mp3 | 21-Apr-2007 07:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | semina.mp3 | 21-Apr-2007 07:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | semimystical.mp3 | 21-Apr-2007 07:55 | 11K | |
![[SND]](/icons/sound2.gif) | semimonthly.mp3 | 21-Apr-2007 07:55 | 10K | |
![[SND]](/icons/sound2.gif) | semimonastic.mp3 | 21-Apr-2007 07:55 | 12K | |
![[SND]](/icons/sound2.gif) | semimoist.mp3 | 21-Apr-2007 07:55 | 10K | |
![[SND]](/icons/sound2.gif) | semiminor axis.mp3 | 21-Apr-2007 07:55 | 14K | |
![[SND]](/icons/sound2.gif) | semimicro.mp3 | 21-Apr-2007 07:55 | 10K | |
![[SND]](/icons/sound2.gif) | semimetallic.mp3 | 21-Apr-2007 07:55 | 10K | |
![[SND]](/icons/sound2.gif) | semimetal.mp3 | 21-Apr-2007 07:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | semimat.mp3 | 21-Apr-2007 07:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | semimajor axis.mp3 | 21-Apr-2007 07:55 | 15K | |
![[SND]](/icons/sound2.gif) | semilustrous.mp3 | 21-Apr-2007 07:55 | 11K | |
![[SND]](/icons/sound2.gif) | semilunar.mp3 | 21-Apr-2007 07:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | semilogarithmic.mp3 | 21-Apr-2007 07:55 | 11K | |
![[SND]](/icons/sound2.gif) | semilog.mp3 | 21-Apr-2007 07:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | semillon.mp3 | 21-Apr-2007 07:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | semiliterate.mp3 | 21-Apr-2007 07:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | semiliquid.mp3 | 21-Apr-2007 07:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | semilethal.mp3 | 21-Apr-2007 07:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | semilegendary.mp3 | 21-Apr-2007 07:55 | 12K | |
![[SND]](/icons/sound2.gif) | semigroup.mp3 | 21-Apr-2007 07:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | semigovernmental.mp3 | 21-Apr-2007 07:55 | 11K | |
![[SND]](/icons/sound2.gif) | semigloss.mp3 | 21-Apr-2007 07:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | semiformal.mp3 | 21-Apr-2007 07:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | semifluid.mp3 | 21-Apr-2007 07:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | semiflexible.mp3 | 21-Apr-2007 07:54 | 11K | |
![[SND]](/icons/sound2.gif) | semifitted.mp3 | 21-Apr-2007 07:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | semifinished.mp3 | 21-Apr-2007 07:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | semifinalist.mp3 | 21-Apr-2007 07:54 | 11K | |
![[SND]](/icons/sound2.gif) | semifinal.mp3 | 21-Apr-2007 07:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | semifeudal.mp3 | 21-Apr-2007 07:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | semievergreen.mp3 | 21-Apr-2007 07:54 | 11K | |
![[SND]](/icons/sound2.gif) | semierect.mp3 | 21-Apr-2007 07:54 | 10K | |
![[SND]](/icons/sound2.gif) | semiempirical.mp3 | 21-Apr-2007 07:54 | 11K | |
![[SND]](/icons/sound2.gif) | semidwarf.mp3 | 21-Apr-2007 07:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | semidrying.mp3 | 21-Apr-2007 07:54 | 11K | |
![[SND]](/icons/sound2.gif) | semidry.mp3 | 21-Apr-2007 07:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | semidominant.mp3 | 21-Apr-2007 07:54 | 10K | |
![[SND]](/icons/sound2.gif) | semidomestication.mp3 | 21-Apr-2007 07:54 | 13K | |
![[SND]](/icons/sound2.gif) | semidomesticated.mp3 | 21-Apr-2007 07:54 | 13K | |
![[SND]](/icons/sound2.gif) | semidomed.mp3 | 21-Apr-2007 07:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | semidome.mp3 | 21-Apr-2007 07:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | semidocumentary.mp3 | 21-Apr-2007 07:54 | 13K | |
![[SND]](/icons/sound2.gif) | semidivine.mp3 | 21-Apr-2007 07:54 | 10K | |
![[SND]](/icons/sound2.gif) | semidiurnal.mp3 | 21-Apr-2007 07:54 | 10K | |
![[SND]](/icons/sound2.gif) | semidiameter.mp3 | 21-Apr-2007 07:54 | 11K | |
![[SND]](/icons/sound2.gif) | semidetached.mp3 | 21-Apr-2007 07:54 | 10K | |
![[SND]](/icons/sound2.gif) | semidesert.mp3 | 21-Apr-2007 07:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | semideify.mp3 | 21-Apr-2007 07:53 | 12K | |
![[SND]](/icons/sound2.gif) | semidarkness.mp3 | 21-Apr-2007 07:53 | 11K | |
![[SND]](/icons/sound2.gif) | semicylindrical.mp3 | 21-Apr-2007 07:53 | 12K | |
![[SND]](/icons/sound2.gif) | semicrystalline.mp3 | 21-Apr-2007 07:53 | 10K | |
![[SND]](/icons/sound2.gif) | semiconservative.mp3 | 21-Apr-2007 07:53 | 12K | |
![[SND]](/icons/sound2.gif) | semiconscious.mp3 | 21-Apr-2007 07:53 | 11K | |
![[SND]](/icons/sound2.gif) | semiconductor.mp3 | 21-Apr-2007 07:53 | 11K | |
![[SND]](/icons/sound2.gif) | semiconducting.mp3 | 21-Apr-2007 07:53 | 11K | |
![[SND]](/icons/sound2.gif) | semicommercial.mp3 | 21-Apr-2007 07:53 | 10K | |
![[SND]](/icons/sound2.gif) | semicolony.mp3 | 21-Apr-2007 07:53 | 10K | |
![[SND]](/icons/sound2.gif) | semicolonialism.mp3 | 21-Apr-2007 07:53 | 13K | |
![[SND]](/icons/sound2.gif) | semicolonial.mp3 | 21-Apr-2007 07:53 | 10K | |
![[SND]](/icons/sound2.gif) | semicolon.mp3 | 21-Apr-2007 07:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | semiclassical.mp3 | 21-Apr-2007 07:53 | 11K | |
![[SND]](/icons/sound2.gif) | semiclassic.mp3 | 21-Apr-2007 07:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | semicivilized.mp3 | 21-Apr-2007 07:53 | 13K | |
![[SND]](/icons/sound2.gif) | semicircular.mp3 | 21-Apr-2007 07:53 | 10K | |
![[SND]](/icons/sound2.gif) | semicircle.mp3 | 21-Apr-2007 07:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | semicentennial.mp3 | 21-Apr-2007 07:53 | 12K | |
![[SND]](/icons/sound2.gif) | semibreve.mp3 | 21-Apr-2007 07:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | semiautonomous.mp3 | 21-Apr-2007 07:53 | 13K | |
![[SND]](/icons/sound2.gif) | semiautomatically.mp3 | 21-Apr-2007 07:53 | 13K | |
![[SND]](/icons/sound2.gif) | semiautomatic.mp3 | 21-Apr-2007 07:53 | 12K | |
![[SND]](/icons/sound2.gif) | semiautobiographical.mp3 | 21-Apr-2007 07:53 | 16K | |
![[SND]](/icons/sound2.gif) | semiaridity.mp3 | 21-Apr-2007 07:52 | 11K | |
![[SND]](/icons/sound2.gif) | semiarid.mp3 | 21-Apr-2007 07:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | semiarboreal.mp3 | 21-Apr-2007 07:52 | 12K | |
![[SND]](/icons/sound2.gif) | semiaquatic.mp3 | 21-Apr-2007 07:52 | 10K | |
![[SND]](/icons/sound2.gif) | semiannual.mp3 | 21-Apr-2007 07:52 | 11K | |
![[SND]](/icons/sound2.gif) | semiabstraction.mp3 | 21-Apr-2007 07:52 | 12K | |
![[SND]](/icons/sound2.gif) | semiabstract.mp3 | 21-Apr-2007 07:52 | 11K | |
![[SND]](/icons/sound2.gif) | semi.mp3 | 21-Apr-2007 07:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | semi-independent.mp3 | 21-Apr-2007 07:55 | 12K | |
![[SND]](/icons/sound2.gif) | semi-antique.mp3 | 21-Apr-2007 07:52 | 11K | |
![[SND]](/icons/sound2.gif) | semestrial.mp3 | 21-Apr-2007 07:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | semestral.mp3 | 21-Apr-2007 07:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | semester.mp3 | 21-Apr-2007 07:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | semeru.mp3 | 21-Apr-2007 07:52 | 17K | |
![[SND]](/icons/sound2.gif) | semen.mp3 | 21-Apr-2007 07:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | sememic.mp3 | 21-Apr-2007 07:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | sememe.mp3 | 21-Apr-2007 07:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | semelparous.mp3 | 21-Apr-2007 07:52 | 10K | |
![[SND]](/icons/sound2.gif) | semelincident.mp3 | 21-Apr-2007 07:52 | 17K | |
![[SND]](/icons/sound2.gif) | semeiotics.mp3 | 21-Apr-2007 07:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | semeiotic.mp3 | 21-Apr-2007 07:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | semeiology.mp3 | 21-Apr-2007 07:52 | 17K | |
![[SND]](/icons/sound2.gif) | semeiography.mp3 | 21-Apr-2007 07:52 | 17K | |
![[SND]](/icons/sound2.gif) | seme.mp3 | 21-Apr-2007 07:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | semblant.mp3 | 21-Apr-2007 07:51 | 17K | |
![[SND]](/icons/sound2.gif) | semblance.mp3 | 21-Apr-2007 07:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | semblably.mp3 | 21-Apr-2007 07:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | semblable.mp3 | 21-Apr-2007 07:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | sematology.mp3 | 21-Apr-2007 07:51 | 17K | |
![[SND]](/icons/sound2.gif) | sematic.mp3 | 21-Apr-2007 07:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | semasiology.mp3 | 21-Apr-2007 07:51 | 12K | |
![[SND]](/icons/sound2.gif) | semasiological.mp3 | 21-Apr-2007 07:51 | 13K | |
![[SND]](/icons/sound2.gif) | semaphore.mp3 | 21-Apr-2007 07:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | semantics.mp3 | 21-Apr-2007 07:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | semanticist.mp3 | 21-Apr-2007 07:51 | 11K | |
![[SND]](/icons/sound2.gif) | semantically.mp3 | 21-Apr-2007 07:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | semantical.mp3 | 21-Apr-2007 07:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | semantic.mp3 | 21-Apr-2007 07:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | semanteme.mp3 | 21-Apr-2007 07:51 | 17K | |
![[SND]](/icons/sound2.gif) | semang.mp3 | 21-Apr-2007 07:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | semaise.mp3 | 21-Apr-2007 07:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | semainier.mp3 | 21-Apr-2007 07:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sem.mp3 | 21-Apr-2007 07:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | selves.mp3 | 21-Apr-2007 07:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | selvedged.mp3 | 21-Apr-2007 07:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | selvedge.mp3 | 21-Apr-2007 07:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | selvagee.mp3 | 21-Apr-2007 07:50 | 17K | |
![[SND]](/icons/sound2.gif) | selvage.mp3 | 21-Apr-2007 07:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | selva.mp3 | 21-Apr-2007 07:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | seltzer.mp3 | 21-Apr-2007 07:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | selsyn.mp3 | 21-Apr-2007 07:50 | 17K | |
![[SND]](/icons/sound2.gif) | sellout.mp3 | 21-Apr-2007 07:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | sellotape.mp3 | 21-Apr-2007 07:50 | 17K | |
![[SND]](/icons/sound2.gif) | selling.mp3 | 21-Apr-2007 07:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | selling-plater.mp3 | 21-Apr-2007 07:50 | 9.8K | |
![[SND]](/icons/sound2.gif) | seller.mp3 | 21-Apr-2007 07:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | selle.mp3 | 21-Apr-2007 07:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | sellafield.mp3 | 21-Apr-2007 07:50 | 17K | |
![[SND]](/icons/sound2.gif) | sellable.mp3 | 21-Apr-2007 07:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | sella.mp3 | 21-Apr-2007 07:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sell.mp3 | 21-Apr-2007 07:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | sell-off.mp3 | 21-Apr-2007 07:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | selkie.mp3 | 21-Apr-2007 07:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | selina.mp3 | 21-Apr-2007 07:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | selihoth.mp3 | 21-Apr-2007 07:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | selfwinding.mp3 | 21-Apr-2007 07:49 | 17K | |
![[SND]](/icons/sound2.gif) | selfward.mp3 | 21-Apr-2007 07:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | selfsow.mp3 | 21-Apr-2007 07:48 | 17K | |
![[SND]](/icons/sound2.gif) | selfsameness.mp3 | 21-Apr-2007 07:48 | 10K | |
![[SND]](/icons/sound2.gif) | selfsame.mp3 | 21-Apr-2007 07:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | selfridges.mp3 | 21-Apr-2007 07:47 | 17K | |
![[SND]](/icons/sound2.gif) | selfridge.mp3 | 21-Apr-2007 07:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | selfness.mp3 | 21-Apr-2007 07:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | selfless.mp3 | 21-Apr-2007 07:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | selfish.mp3 | 21-Apr-2007 07:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | selfing.mp3 | 21-Apr-2007 07:44 | 17K | |
![[SND]](/icons/sound2.gif) | selfidentification.mp3 | 21-Apr-2007 07:43 | 17K | |
![[SND]](/icons/sound2.gif) | selfhood.mp3 | 21-Apr-2007 07:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | selffed.mp3 | 21-Apr-2007 07:42 | 10K | |
![[SND]](/icons/sound2.gif) | selfdom.mp3 | 21-Apr-2007 07:41 | 17K | |
![[SND]](/icons/sound2.gif) | self.mp3 | 20-Apr-2007 18:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | self-worth.mp3 | 21-Apr-2007 07:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-winding.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-willedness.mp3 | 21-Apr-2007 07:49 | 12K | |
![[SND]](/icons/sound2.gif) | self-willedly.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-willed.mp3 | 21-Apr-2007 07:49 | 10K | |
![[SND]](/icons/sound2.gif) | self-will.mp3 | 21-Apr-2007 07:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | self-trust.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-treatment.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-tolerance.mp3 | 21-Apr-2007 07:49 | 12K | |
![[SND]](/icons/sound2.gif) | self-taught.mp3 | 21-Apr-2007 07:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | self-tanner.mp3 | 21-Apr-2007 07:49 | 12K | |
![[SND]](/icons/sound2.gif) | self-sustaining.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-supporting.mp3 | 21-Apr-2007 07:49 | 10K | |
![[SND]](/icons/sound2.gif) | self-support.mp3 | 21-Apr-2007 07:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-suggestion.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-sufficing.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-sufficient.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-sufficiency.mp3 | 21-Apr-2007 07:49 | 12K | |
![[SND]](/icons/sound2.gif) | self-subsisting.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-subsistent.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-subsistence.mp3 | 21-Apr-2007 07:49 | 13K | |
![[SND]](/icons/sound2.gif) | self-styled.mp3 | 21-Apr-2007 07:49 | 11K | |
![[SND]](/icons/sound2.gif) | self-study.mp3 | 21-Apr-2007 07:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | self-stimulatory.mp3 | 21-Apr-2007 07:49 | 13K | |
![[SND]](/icons/sound2.gif) | self-stimulation.mp3 | 21-Apr-2007 07:48 | 12K | |
![[SND]](/icons/sound2.gif) | self-stick.mp3 | 21-Apr-2007 07:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | self-sterility.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-sterile.mp3 | 21-Apr-2007 07:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | self-starting.mp3 | 21-Apr-2007 07:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | self-starter.mp3 | 21-Apr-2007 07:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | self-sown.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-sowed.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-sow.mp3 | 21-Apr-2007 07:48 | 10K | |
![[SND]](/icons/sound2.gif) | self-slaughtered.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-slaughter.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-similarity.mp3 | 21-Apr-2007 07:48 | 12K | |
![[SND]](/icons/sound2.gif) | self-similar.mp3 | 21-Apr-2007 07:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-serving.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-service.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-serve.mp3 | 21-Apr-2007 07:48 | 10K | |
![[SND]](/icons/sound2.gif) | self-seeking.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-seeker.mp3 | 21-Apr-2007 07:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-searching.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-sealing.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-scrutiny.mp3 | 21-Apr-2007 07:48 | 11K | |
![[SND]](/icons/sound2.gif) | self-satisfied.mp3 | 21-Apr-2007 07:48 | 12K | |
![[SND]](/icons/sound2.gif) | self-satisfaction.mp3 | 21-Apr-2007 07:48 | 13K | |
![[SND]](/icons/sound2.gif) | self-sacrificing.mp3 | 21-Apr-2007 07:47 | 14K | |
![[SND]](/icons/sound2.gif) | self-sacrifice.mp3 | 21-Apr-2007 07:47 | 14K | |
![[SND]](/icons/sound2.gif) | self-ruling.mp3 | 21-Apr-2007 07:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | self-rule.mp3 | 21-Apr-2007 07:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | self-rising flour.mp3 | 21-Apr-2007 07:47 | 15K | |
![[SND]](/icons/sound2.gif) | self-righteous.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-rewarding.mp3 | 21-Apr-2007 07:47 | 10K | |
![[SND]](/icons/sound2.gif) | self-revelation.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-revealing.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-respecting.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-respect.mp3 | 21-Apr-2007 07:47 | 10K | |
![[SND]](/icons/sound2.gif) | self-reported.mp3 | 21-Apr-2007 07:47 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-report.mp3 | 21-Apr-2007 07:47 | 10K | |
![[SND]](/icons/sound2.gif) | self-replication.mp3 | 21-Apr-2007 07:47 | 12K | |
![[SND]](/icons/sound2.gif) | self-replicating.mp3 | 21-Apr-2007 07:47 | 12K | |
![[SND]](/icons/sound2.gif) | self-reliant.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-reliance.mp3 | 21-Apr-2007 07:47 | 12K | |
![[SND]](/icons/sound2.gif) | self-regulating.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-regarding.mp3 | 21-Apr-2007 07:47 | 10K | |
![[SND]](/icons/sound2.gif) | self-regard.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-reflexivity.mp3 | 21-Apr-2007 07:47 | 13K | |
![[SND]](/icons/sound2.gif) | self-reflexive.mp3 | 21-Apr-2007 07:47 | 11K | |
![[SND]](/icons/sound2.gif) | self-reflective.mp3 | 21-Apr-2007 07:47 | 12K | |
![[SND]](/icons/sound2.gif) | self-reflection.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-recording.mp3 | 21-Apr-2007 07:46 | 10K | |
![[SND]](/icons/sound2.gif) | self-recognition.mp3 | 21-Apr-2007 07:46 | 12K | |
![[SND]](/icons/sound2.gif) | self-realization.mp3 | 21-Apr-2007 07:46 | 13K | |
![[SND]](/icons/sound2.gif) | self-rating.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-questioning.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-question.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-purification.mp3 | 21-Apr-2007 07:46 | 13K | |
![[SND]](/icons/sound2.gif) | self-publish.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-propulsion.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-propelling.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-propelled.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-professed.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-proclaimed.mp3 | 21-Apr-2007 07:46 | 12K | |
![[SND]](/icons/sound2.gif) | self-pride.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-preservation.mp3 | 21-Apr-2007 07:46 | 13K | |
![[SND]](/icons/sound2.gif) | self-possession.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-possessedly.mp3 | 21-Apr-2007 07:46 | 12K | |
![[SND]](/icons/sound2.gif) | self-possessed.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-portrait.mp3 | 21-Apr-2007 07:46 | 10K | |
![[SND]](/icons/sound2.gif) | self-pollination.mp3 | 21-Apr-2007 07:46 | 12K | |
![[SND]](/icons/sound2.gif) | self-pollinate.mp3 | 21-Apr-2007 07:46 | 12K | |
![[SND]](/icons/sound2.gif) | self-poised.mp3 | 21-Apr-2007 07:46 | 12K | |
![[SND]](/icons/sound2.gif) | self-poise.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-pleased.mp3 | 21-Apr-2007 07:46 | 11K | |
![[SND]](/icons/sound2.gif) | self-pityingly.mp3 | 21-Apr-2007 07:46 | 12K | |
![[SND]](/icons/sound2.gif) | self-pitying.mp3 | 21-Apr-2007 07:45 | 12K | |
![[SND]](/icons/sound2.gif) | self-pity.mp3 | 21-Apr-2007 07:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | self-perception.mp3 | 21-Apr-2007 07:45 | 11K | |
![[SND]](/icons/sound2.gif) | self-partiality.mp3 | 21-Apr-2007 07:45 | 12K | |
![[SND]](/icons/sound2.gif) | self-paced.mp3 | 21-Apr-2007 07:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-organization.mp3 | 21-Apr-2007 07:45 | 13K | |
![[SND]](/icons/sound2.gif) | self-opinionated.mp3 | 21-Apr-2007 07:45 | 12K | |
![[SND]](/icons/sound2.gif) | self-opinion.mp3 | 21-Apr-2007 07:45 | 10K | |
![[SND]](/icons/sound2.gif) | self-observation.mp3 | 21-Apr-2007 07:45 | 12K | |
![[SND]](/icons/sound2.gif) | self-murder.mp3 | 21-Apr-2007 07:45 | 10K | |
![[SND]](/icons/sound2.gif) | self-moved.mp3 | 21-Apr-2007 07:45 | 11K | |
![[SND]](/icons/sound2.gif) | self-mailing.mp3 | 21-Apr-2007 07:45 | 11K | |
![[SND]](/icons/sound2.gif) | self-mailer.mp3 | 21-Apr-2007 07:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-made.mp3 | 21-Apr-2007 07:45 | 11K | |
![[SND]](/icons/sound2.gif) | self-loving.mp3 | 21-Apr-2007 07:45 | 10K | |
![[SND]](/icons/sound2.gif) | self-love.mp3 | 21-Apr-2007 07:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-loading.mp3 | 21-Apr-2007 07:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | self-loader.mp3 | 21-Apr-2007 07:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | self-liquidating.mp3 | 21-Apr-2007 07:45 | 12K | |
![[SND]](/icons/sound2.gif) | self-limiting.mp3 | 21-Apr-2007 07:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-limited.mp3 | 21-Apr-2007 07:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-knowledge.mp3 | 21-Apr-2007 07:45 | 11K | |
![[SND]](/icons/sound2.gif) | self-knowing.mp3 | 21-Apr-2007 07:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | self-justifying.mp3 | 21-Apr-2007 07:44 | 13K | |
![[SND]](/icons/sound2.gif) | self-justification.mp3 | 21-Apr-2007 07:44 | 13K | |
![[SND]](/icons/sound2.gif) | self-involved.mp3 | 21-Apr-2007 07:44 | 11K | |
![[SND]](/icons/sound2.gif) | self-interest.mp3 | 21-Apr-2007 07:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-insurer.mp3 | 21-Apr-2007 07:44 | 10K | |
![[SND]](/icons/sound2.gif) | self-insure.mp3 | 21-Apr-2007 07:44 | 10K | |
![[SND]](/icons/sound2.gif) | self-insurance.mp3 | 21-Apr-2007 07:44 | 11K | |
![[SND]](/icons/sound2.gif) | self-indulgent.mp3 | 21-Apr-2007 07:44 | 11K | |
![[SND]](/icons/sound2.gif) | self-indulgence.mp3 | 21-Apr-2007 07:44 | 12K | |
![[SND]](/icons/sound2.gif) | self-induction.mp3 | 21-Apr-2007 07:44 | 10K | |
![[SND]](/icons/sound2.gif) | self-inductance.mp3 | 21-Apr-2007 07:44 | 12K | |
![[SND]](/icons/sound2.gif) | self-incrimination.mp3 | 21-Apr-2007 07:44 | 12K | |
![[SND]](/icons/sound2.gif) | self-incriminating.mp3 | 21-Apr-2007 07:44 | 12K | |
![[SND]](/icons/sound2.gif) | self-incompatible.mp3 | 21-Apr-2007 07:44 | 12K | |
![[SND]](/icons/sound2.gif) | self-incompatibility.mp3 | 21-Apr-2007 07:44 | 14K | |
![[SND]](/icons/sound2.gif) | self-inclusive.mp3 | 21-Apr-2007 07:44 | 11K | |
![[SND]](/icons/sound2.gif) | self-important.mp3 | 21-Apr-2007 07:44 | 10K | |
![[SND]](/icons/sound2.gif) | self-importance.mp3 | 21-Apr-2007 07:44 | 12K | |
![[SND]](/icons/sound2.gif) | self-immolation.mp3 | 21-Apr-2007 07:44 | 12K | |
![[SND]](/icons/sound2.gif) | self-immolate.mp3 | 21-Apr-2007 07:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | self-image.mp3 | 21-Apr-2007 07:44 | 11K | |
![[SND]](/icons/sound2.gif) | self-ignition.mp3 | 21-Apr-2007 07:44 | 10K | |
![[SND]](/icons/sound2.gif) | self-ignite.mp3 | 21-Apr-2007 07:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-identity.mp3 | 21-Apr-2007 07:44 | 11K | |
![[SND]](/icons/sound2.gif) | self-identification.mp3 | 21-Apr-2007 07:43 | 14K | |
![[SND]](/icons/sound2.gif) | self-identical.mp3 | 21-Apr-2007 07:43 | 11K | |
![[SND]](/icons/sound2.gif) | self-help.mp3 | 21-Apr-2007 07:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | self-heal.mp3 | 21-Apr-2007 07:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | self-gratulatory.mp3 | 21-Apr-2007 07:43 | 13K | |
![[SND]](/icons/sound2.gif) | self-gratulation.mp3 | 21-Apr-2007 07:43 | 12K | |
![[SND]](/icons/sound2.gif) | self-gratification.mp3 | 21-Apr-2007 07:43 | 13K | |
![[SND]](/icons/sound2.gif) | self-government.mp3 | 21-Apr-2007 07:43 | 11K | |
![[SND]](/icons/sound2.gif) | self-governing.mp3 | 21-Apr-2007 07:43 | 10K | |
![[SND]](/icons/sound2.gif) | self-governed.mp3 | 21-Apr-2007 07:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | self-governance.mp3 | 21-Apr-2007 07:43 | 11K | |
![[SND]](/icons/sound2.gif) | self-glory.mp3 | 21-Apr-2007 07:43 | 10K | |
![[SND]](/icons/sound2.gif) | self-glorifying.mp3 | 21-Apr-2007 07:43 | 13K | |
![[SND]](/icons/sound2.gif) | self-glorification.mp3 | 21-Apr-2007 07:43 | 14K | |
![[SND]](/icons/sound2.gif) | self-given.mp3 | 21-Apr-2007 07:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | self-fulfillment.mp3 | 21-Apr-2007 07:43 | 12K | |
![[SND]](/icons/sound2.gif) | self-fulfilling.mp3 | 21-Apr-2007 07:43 | 12K | |
![[SND]](/icons/sound2.gif) | self-fruitful.mp3 | 21-Apr-2007 07:43 | 11K | |
![[SND]](/icons/sound2.gif) | self-forgettingly.mp3 | 21-Apr-2007 07:43 | 12K | |
![[SND]](/icons/sound2.gif) | self-forgetting.mp3 | 21-Apr-2007 07:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-forgetfully.mp3 | 21-Apr-2007 07:43 | 12K | |
![[SND]](/icons/sound2.gif) | self-forgetful.mp3 | 21-Apr-2007 07:43 | 10K | |
![[SND]](/icons/sound2.gif) | self-flattery.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-flattering.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-flagellation.mp3 | 21-Apr-2007 07:42 | 12K | |
![[SND]](/icons/sound2.gif) | self-flagellate.mp3 | 21-Apr-2007 07:42 | 13K | |
![[SND]](/icons/sound2.gif) | self-fertilize.mp3 | 21-Apr-2007 07:42 | 13K | |
![[SND]](/icons/sound2.gif) | self-fertilization.mp3 | 21-Apr-2007 07:42 | 14K | |
![[SND]](/icons/sound2.gif) | self-fertility.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-fertile.mp3 | 21-Apr-2007 07:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | self-feeling.mp3 | 21-Apr-2007 07:42 | 10K | |
![[SND]](/icons/sound2.gif) | self-feeder.mp3 | 21-Apr-2007 07:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-feed.mp3 | 21-Apr-2007 07:42 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-expressive.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-expression.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-exploration.mp3 | 21-Apr-2007 07:42 | 12K | |
![[SND]](/icons/sound2.gif) | self-explanatory.mp3 | 21-Apr-2007 07:42 | 13K | |
![[SND]](/icons/sound2.gif) | self-exiled.mp3 | 21-Apr-2007 07:42 | 10K | |
![[SND]](/icons/sound2.gif) | self-executing.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-excited.mp3 | 21-Apr-2007 07:42 | 10K | |
![[SND]](/icons/sound2.gif) | self-examination.mp3 | 21-Apr-2007 07:42 | 13K | |
![[SND]](/icons/sound2.gif) | self-evident.mp3 | 21-Apr-2007 07:42 | 10K | |
![[SND]](/icons/sound2.gif) | self-evidence.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-esteem.mp3 | 21-Apr-2007 07:42 | 10K | |
![[SND]](/icons/sound2.gif) | self-enrichment.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-enforcing.mp3 | 21-Apr-2007 07:42 | 11K | |
![[SND]](/icons/sound2.gif) | self-energizing.mp3 | 21-Apr-2007 07:42 | 12K | |
![[SND]](/icons/sound2.gif) | self-employment.mp3 | 21-Apr-2007 07:41 | 10K | |
![[SND]](/icons/sound2.gif) | self-employed.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-elected.mp3 | 21-Apr-2007 07:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | self-drive.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-dramatizing.mp3 | 21-Apr-2007 07:41 | 12K | |
![[SND]](/icons/sound2.gif) | self-dramatizer.mp3 | 21-Apr-2007 07:41 | 13K | |
![[SND]](/icons/sound2.gif) | self-dramatization.mp3 | 21-Apr-2007 07:41 | 14K | |
![[SND]](/icons/sound2.gif) | self-distrustful.mp3 | 21-Apr-2007 07:41 | 13K | |
![[SND]](/icons/sound2.gif) | self-distrust.mp3 | 21-Apr-2007 07:41 | 12K | |
![[SND]](/icons/sound2.gif) | self-discovery.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-disciplined.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-discipline.mp3 | 21-Apr-2007 07:41 | 10K | |
![[SND]](/icons/sound2.gif) | self-devoted.mp3 | 21-Apr-2007 07:41 | 10K | |
![[SND]](/icons/sound2.gif) | self-determinism.mp3 | 21-Apr-2007 07:41 | 12K | |
![[SND]](/icons/sound2.gif) | self-determining.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-determined.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-determination.mp3 | 21-Apr-2007 07:41 | 13K | |
![[SND]](/icons/sound2.gif) | self-destructive.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-destruction.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-destruct.mp3 | 21-Apr-2007 07:41 | 10K | |
![[SND]](/icons/sound2.gif) | self-destroying.mp3 | 21-Apr-2007 07:41 | 12K | |
![[SND]](/icons/sound2.gif) | self-despair.mp3 | 21-Apr-2007 07:41 | 11K | |
![[SND]](/icons/sound2.gif) | self-designation.mp3 | 21-Apr-2007 07:41 | 13K | |
![[SND]](/icons/sound2.gif) | self-denyingly.mp3 | 21-Apr-2007 07:40 | 12K | |
![[SND]](/icons/sound2.gif) | self-denying.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-denial.mp3 | 21-Apr-2007 07:40 | 10K | |
![[SND]](/icons/sound2.gif) | self-definition.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-defensive.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-defense.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-dealing.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-corrective.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-correcting.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-controlled.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-control.mp3 | 21-Apr-2007 07:40 | 10K | |
![[SND]](/icons/sound2.gif) | self-contradictory.mp3 | 21-Apr-2007 07:40 | 13K | |
![[SND]](/icons/sound2.gif) | self-contradiction.mp3 | 21-Apr-2007 07:40 | 12K | |
![[SND]](/icons/sound2.gif) | self-contentment.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-contented.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-content.mp3 | 21-Apr-2007 07:40 | 10K | |
![[SND]](/icons/sound2.gif) | self-contamination.mp3 | 21-Apr-2007 07:40 | 13K | |
![[SND]](/icons/sound2.gif) | self-containment.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-containedness.mp3 | 21-Apr-2007 07:40 | 13K | |
![[SND]](/icons/sound2.gif) | self-containedly.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-contained.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-consistent.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-consistency.mp3 | 21-Apr-2007 07:40 | 12K | |
![[SND]](/icons/sound2.gif) | self-consequence.mp3 | 21-Apr-2007 07:40 | 12K | |
![[SND]](/icons/sound2.gif) | self-conscious.mp3 | 21-Apr-2007 07:40 | 11K | |
![[SND]](/icons/sound2.gif) | self-congratulatory.mp3 | 21-Apr-2007 07:39 | 14K | |
![[SND]](/icons/sound2.gif) | self-congratulation.mp3 | 21-Apr-2007 07:39 | 14K | |
![[SND]](/icons/sound2.gif) | self-confrontation.mp3 | 21-Apr-2007 07:39 | 13K | |
![[SND]](/icons/sound2.gif) | self-confident.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-confidence.mp3 | 21-Apr-2007 07:39 | 12K | |
![[SND]](/icons/sound2.gif) | self-confession.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-confessedly.mp3 | 21-Apr-2007 07:39 | 12K | |
![[SND]](/icons/sound2.gif) | self-confessed.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-concerned.mp3 | 21-Apr-2007 07:39 | 12K | |
![[SND]](/icons/sound2.gif) | self-concern.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-conception.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-concept.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-conceited.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-conceit.mp3 | 21-Apr-2007 07:39 | 10K | |
![[SND]](/icons/sound2.gif) | self-composedness.mp3 | 21-Apr-2007 07:39 | 13K | |
![[SND]](/icons/sound2.gif) | self-composedly.mp3 | 21-Apr-2007 07:39 | 12K | |
![[SND]](/icons/sound2.gif) | self-composed.mp3 | 21-Apr-2007 07:39 | 12K | |
![[SND]](/icons/sound2.gif) | self-compatible.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-compatibility.mp3 | 21-Apr-2007 07:39 | 12K | |
![[SND]](/icons/sound2.gif) | self-colored.mp3 | 21-Apr-2007 07:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | self-collected.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-cocking.mp3 | 21-Apr-2007 07:39 | 10K | |
![[SND]](/icons/sound2.gif) | self-closing.mp3 | 21-Apr-2007 07:39 | 10K | |
![[SND]](/icons/sound2.gif) | self-centered.mp3 | 21-Apr-2007 07:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | self-catering.mp3 | 21-Apr-2007 07:39 | 11K | |
![[SND]](/icons/sound2.gif) | self-born.mp3 | 21-Apr-2007 07:39 | 10K | |
![[SND]](/icons/sound2.gif) | self-betrayal.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-belted.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-belt.mp3 | 21-Apr-2007 07:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | self-aware.mp3 | 21-Apr-2007 07:38 | 10K | |
![[SND]](/icons/sound2.gif) | self-assuredness.mp3 | 21-Apr-2007 07:38 | 13K | |
![[SND]](/icons/sound2.gif) | self-assuredly.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-assured.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-assurance.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-assumption.mp3 | 21-Apr-2007 07:38 | 10K | |
![[SND]](/icons/sound2.gif) | self-assertive.mp3 | 21-Apr-2007 07:38 | 10K | |
![[SND]](/icons/sound2.gif) | self-assertion.mp3 | 21-Apr-2007 07:38 | 10K | |
![[SND]](/icons/sound2.gif) | self-assertingly.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-asserting.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-assembly.mp3 | 21-Apr-2007 07:38 | 10K | |
![[SND]](/icons/sound2.gif) | self-assemble.mp3 | 21-Apr-2007 07:38 | 10K | |
![[SND]](/icons/sound2.gif) | self-appointed.mp3 | 21-Apr-2007 07:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | self-applause.mp3 | 21-Apr-2007 07:38 | 11K | |
![[SND]](/icons/sound2.gif) | self-applauding.mp3 | 21-Apr-2007 07:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | self-annihilation.mp3 | 21-Apr-2007 07:37 | 12K | |
![[SND]](/icons/sound2.gif) | self-analytical.mp3 | 21-Apr-2007 07:37 | 11K | |
![[SND]](/icons/sound2.gif) | self-analysis.mp3 | 21-Apr-2007 07:37 | 12K | |
![[SND]](/icons/sound2.gif) | self-affected.mp3 | 21-Apr-2007 07:37 | 10K | |
![[SND]](/icons/sound2.gif) | self-admiration.mp3 | 21-Apr-2007 07:37 | 12K | |
![[SND]](/icons/sound2.gif) | self-adjustment.mp3 | 21-Apr-2007 07:37 | 10K | |
![[SND]](/icons/sound2.gif) | self-adhesive.mp3 | 21-Apr-2007 07:37 | 10K | |
![[SND]](/icons/sound2.gif) | self-addressed.mp3 | 21-Apr-2007 07:37 | 10K | |
![[SND]](/icons/sound2.gif) | self-actualize.mp3 | 21-Apr-2007 07:37 | 13K | |
![[SND]](/icons/sound2.gif) | self-actualization.mp3 | 21-Apr-2007 07:37 | 14K | |
![[SND]](/icons/sound2.gif) | self-activity.mp3 | 21-Apr-2007 07:37 | 11K | |
![[SND]](/icons/sound2.gif) | self-acting.mp3 | 21-Apr-2007 07:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | self-abuse.mp3 | 21-Apr-2007 07:37 | 11K | |
![[SND]](/icons/sound2.gif) | self-absorption.mp3 | 21-Apr-2007 07:37 | 11K | |
![[SND]](/icons/sound2.gif) | self-absorbed.mp3 | 21-Apr-2007 07:37 | 11K | |
![[SND]](/icons/sound2.gif) | self-abandonment.mp3 | 21-Apr-2007 07:37 | 12K | |
![[SND]](/icons/sound2.gif) | self-abandoned.mp3 | 21-Apr-2007 07:37 | 11K | |
![[SND]](/icons/sound2.gif) | seleucusi.mp3 | 20-Apr-2007 18:01 | 17K | |
![[SND]](/icons/sound2.gif) | seleucidan.mp3 | 20-Apr-2007 18:01 | 17K | |
![[SND]](/icons/sound2.gif) | seles.mp3 | 20-Apr-2007 18:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | seler.mp3 | 20-Apr-2007 18:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | selenous.mp3 | 20-Apr-2007 18:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | selenotropism.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | selenosis.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | selenology.mp3 | 20-Apr-2007 18:00 | 11K | |
![[SND]](/icons/sound2.gif) | selenologist.mp3 | 20-Apr-2007 18:00 | 12K | |
![[SND]](/icons/sound2.gif) | selenological.mp3 | 20-Apr-2007 18:00 | 12K | |
![[SND]](/icons/sound2.gif) | selenography.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | selenodont.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | selenodesy.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | selenocentric.mp3 | 20-Apr-2007 18:00 | 11K | |
![[SND]](/icons/sound2.gif) | seleno.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | selenium.mp3 | 20-Apr-2007 18:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | selenite.mp3 | 20-Apr-2007 18:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | selenious.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | seleniferous.mp3 | 20-Apr-2007 18:00 | 11K | |
![[SND]](/icons/sound2.gif) | selenide.mp3 | 20-Apr-2007 18:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | selenic.mp3 | 20-Apr-2007 18:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | seleni.mp3 | 20-Apr-2007 18:00 | 17K | |
![[SND]](/icons/sound2.gif) | selenate.mp3 | 20-Apr-2007 17:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | selen.mp3 | 20-Apr-2007 17:59 | 17K | |
![[SND]](/icons/sound2.gif) | selectron.mp3 | 20-Apr-2007 17:59 | 17K | |
![[SND]](/icons/sound2.gif) | selector.mp3 | 20-Apr-2007 17:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | selectness.mp3 | 20-Apr-2007 17:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | selectman.mp3 | 20-Apr-2007 17:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | selectivity.mp3 | 20-Apr-2007 17:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | selective.mp3 | 20-Apr-2007 17:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | selectionist.mp3 | 20-Apr-2007 17:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | selection.mp3 | 20-Apr-2007 17:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | selectee.mp3 | 20-Apr-2007 17:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | selected.mp3 | 20-Apr-2007 17:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | selectance.mp3 | 20-Apr-2007 17:59 | 17K | |
![[SND]](/icons/sound2.gif) | selectable.mp3 | 20-Apr-2007 17:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | select.mp3 | 20-Apr-2007 17:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | seldom.mp3 | 20-Apr-2007 17:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | selcouth.mp3 | 20-Apr-2007 17:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | selby.mp3 | 20-Apr-2007 17:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | selborne.mp3 | 20-Apr-2007 17:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | selamlik.mp3 | 20-Apr-2007 17:59 | 17K | |
![[SND]](/icons/sound2.gif) | selah.mp3 | 20-Apr-2007 17:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | selaginella.mp3 | 20-Apr-2007 17:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | seladang.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | selachoid.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | selachian.mp3 | 20-Apr-2007 17:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | sel.mp3 | 20-Apr-2007 17:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | sekt.mp3 | 20-Apr-2007 17:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | sekos.mp3 | 20-Apr-2007 17:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | sekonditakoradi.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | sekhmet.mp3 | 20-Apr-2007 17:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | sejour.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | sejm.mp3 | 20-Apr-2007 17:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | sejant.mp3 | 20-Apr-2007 17:58 | 6.8K | |
![[SND]](/icons/sound2.gif) | seizure.mp3 | 20-Apr-2007 17:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | seizor.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | seizing.mp3 | 20-Apr-2007 17:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | seizin.mp3 | 20-Apr-2007 17:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | seizequartiers.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | seize.mp3 | 20-Apr-2007 17:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | seiwhale.mp3 | 20-Apr-2007 17:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | sei whale.mp3 | 20-Apr-2007 17:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | seistan.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | seismoscope.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | seismosaur.mp3 | 20-Apr-2007 17:58 | 17K | |
![[SND]](/icons/sound2.gif) | seismometry.mp3 | 20-Apr-2007 17:58 | 10K | |
![[SND]](/icons/sound2.gif) | seismometric.mp3 | 20-Apr-2007 17:57 | 11K | |
![[SND]](/icons/sound2.gif) | seismometer.mp3 | 20-Apr-2007 17:57 | 10K | |
![[SND]](/icons/sound2.gif) | seismology.mp3 | 20-Apr-2007 17:57 | 10K | |
![[SND]](/icons/sound2.gif) | seismologist.mp3 | 20-Apr-2007 17:57 | 11K | |
![[SND]](/icons/sound2.gif) | seismological.mp3 | 20-Apr-2007 17:57 | 11K | |
![[SND]](/icons/sound2.gif) | seismologic.mp3 | 20-Apr-2007 17:57 | 10K | |
![[SND]](/icons/sound2.gif) | seismography.mp3 | 20-Apr-2007 17:57 | 11K | |
![[SND]](/icons/sound2.gif) | seismographic.mp3 | 20-Apr-2007 17:57 | 11K | |
![[SND]](/icons/sound2.gif) | seismographer.mp3 | 20-Apr-2007 17:57 | 11K | |
![[SND]](/icons/sound2.gif) | seismograph.mp3 | 20-Apr-2007 17:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | seismogram.mp3 | 20-Apr-2007 17:57 | 11K | |
![[SND]](/icons/sound2.gif) | seismo.mp3 | 20-Apr-2007 17:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | seismism.mp3 | 20-Apr-2007 17:57 | 17K | |
![[SND]](/icons/sound2.gif) | seismicity.mp3 | 20-Apr-2007 17:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | seismically.mp3 | 20-Apr-2007 17:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | seismic.mp3 | 20-Apr-2007 17:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | seism.mp3 | 20-Apr-2007 17:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | seising.mp3 | 20-Apr-2007 17:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | seisin.mp3 | 20-Apr-2007 17:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | seise.mp3 | 20-Apr-2007 17:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | seis.mp3 | 20-Apr-2007 17:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | seirios.mp3 | 20-Apr-2007 17:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | seiren.mp3 | 20-Apr-2007 17:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | seinesaintdenis.mp3 | 20-Apr-2007 17:57 | 17K | |
![[SND]](/icons/sound2.gif) | seiner.mp3 | 20-Apr-2007 17:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | seinemaritime.mp3 | 20-Apr-2007 17:56 | 17K | |
![[SND]](/icons/sound2.gif) | seineetmarne.mp3 | 20-Apr-2007 17:56 | 17K | |
![[SND]](/icons/sound2.gif) | seine.mp3 | 20-Apr-2007 17:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | seilenos.mp3 | 20-Apr-2007 17:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | seik.mp3 | 20-Apr-2007 17:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | seignory.mp3 | 20-Apr-2007 17:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | seignorial.mp3 | 20-Apr-2007 17:56 | 9.3K | |
![[SND]](/icons/sound2.gif) | seignorage.mp3 | 20-Apr-2007 17:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | seigniory.mp3 | 20-Apr-2007 17:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | seigniorage.mp3 | 20-Apr-2007 17:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | seignior.mp3 | 20-Apr-2007 17:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | seigneury.mp3 | 20-Apr-2007 17:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | seigneurial.mp3 | 20-Apr-2007 17:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | seigneurage.mp3 | 20-Apr-2007 17:56 | 17K | |
![[SND]](/icons/sound2.gif) | seigneur.mp3 | 20-Apr-2007 17:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | seif.mp3 | 20-Apr-2007 17:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | seidlitzpowders.mp3 | 20-Apr-2007 17:56 | 17K | |
![[SND]](/icons/sound2.gif) | seidensticker.mp3 | 20-Apr-2007 17:56 | 17K | |
![[SND]](/icons/sound2.gif) | seidel.mp3 | 20-Apr-2007 17:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | seichometer.mp3 | 20-Apr-2007 17:55 | 17K | |
![[SND]](/icons/sound2.gif) | seiche.mp3 | 20-Apr-2007 17:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | seicento.mp3 | 20-Apr-2007 17:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | sei.mp3 | 20-Apr-2007 17:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sehnsucht.mp3 | 20-Apr-2007 17:55 | 17K | |
![[SND]](/icons/sound2.gif) | sehnaknot.mp3 | 20-Apr-2007 17:55 | 17K | |
![[SND]](/icons/sound2.gif) | sehablaespanol.mp3 | 20-Apr-2007 17:55 | 27K | |
![[SND]](/icons/sound2.gif) | se habla espanol.mp3 | 20-Apr-2007 17:39 | 14K | |
![[SND]](/icons/sound2.gif) | seguidilla.mp3 | 20-Apr-2007 17:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | segue.mp3 | 20-Apr-2007 17:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | segregator.mp3 | 20-Apr-2007 17:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | segregative.mp3 | 20-Apr-2007 17:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | segregationist.mp3 | 20-Apr-2007 17:55 | 12K | |
![[SND]](/icons/sound2.gif) | segregation.mp3 | 20-Apr-2007 17:55 | 10K | |
![[SND]](/icons/sound2.gif) | segregated.mp3 | 20-Apr-2007 17:55 | 17K | |
![[SND]](/icons/sound2.gif) | segregate.mp3 | 20-Apr-2007 17:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | segregant.mp3 | 20-Apr-2007 17:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | segreant.mp3 | 20-Apr-2007 17:55 | 17K | |
![[SND]](/icons/sound2.gif) | segre.mp3 | 20-Apr-2007 17:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | segor.mp3 | 20-Apr-2007 17:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | sego lily.mp3 | 20-Apr-2007 17:55 | 11K | |
![[SND]](/icons/sound2.gif) | sego.mp3 | 20-Apr-2007 17:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | segno.mp3 | 20-Apr-2007 17:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | segmentize.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | segmented.mp3 | 20-Apr-2007 17:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | segmentation.mp3 | 20-Apr-2007 17:54 | 11K | |
![[SND]](/icons/sound2.gif) | segmentary.mp3 | 20-Apr-2007 17:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | segmentally.mp3 | 20-Apr-2007 17:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | segmentalized.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | segmentalize.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | segmentalization.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | segmental.mp3 | 20-Apr-2007 17:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | segment.mp3 | 20-Apr-2007 17:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | seghers.mp3 | 20-Apr-2007 17:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | seggie.mp3 | 20-Apr-2007 17:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | seggar.mp3 | 20-Apr-2007 17:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | segetal.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | segercone.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | segar.mp3 | 20-Apr-2007 17:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | sega.mp3 | 20-Apr-2007 17:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | seg.mp3 | 20-Apr-2007 17:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | sefertorah.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | seferis.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | seeyabye.mp3 | 20-Apr-2007 17:54 | 17K | |
![[SND]](/icons/sound2.gif) | seething.mp3 | 20-Apr-2007 17:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | seethe.mp3 | 20-Apr-2007 17:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | seesaw.mp3 | 20-Apr-2007 17:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | sees.mp3 | 20-Apr-2007 17:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | seersucker.mp3 | 20-Apr-2007 17:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | seeress.mp3 | 20-Apr-2007 17:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | seer.mp3 | 20-Apr-2007 17:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | seepy.mp3 | 20-Apr-2007 17:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | seepage.mp3 | 20-Apr-2007 17:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | seep.mp3 | 20-Apr-2007 17:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | seen.mp3 | 20-Apr-2007 17:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | seemly.mp3 | 20-Apr-2007 17:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | seemingly.mp3 | 20-Apr-2007 17:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | seeming.mp3 | 20-Apr-2007 17:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | seemer.mp3 | 20-Apr-2007 17:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | seem.mp3 | 20-Apr-2007 17:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | seely.mp3 | 20-Apr-2007 17:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | seeland.mp3 | 20-Apr-2007 17:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | seel.mp3 | 20-Apr-2007 17:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | seeker.mp3 | 20-Apr-2007 17:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | seek.mp3 | 20-Apr-2007 17:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | seeing.mp3 | 20-Apr-2007 17:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | seegar.mp3 | 20-Apr-2007 17:53 | 17K | |
![[SND]](/icons/sound2.gif) | seedy.mp3 | 20-Apr-2007 17:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | seedtime.mp3 | 20-Apr-2007 17:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | seedsman.mp3 | 20-Apr-2007 17:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | seedpod.mp3 | 20-Apr-2007 17:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | seedman.mp3 | 20-Apr-2007 17:52 | 17K | |
![[SND]](/icons/sound2.gif) | seedlip.mp3 | 20-Apr-2007 17:52 | 17K | |
![[SND]](/icons/sound2.gif) | seedling.mp3 | 20-Apr-2007 17:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | seedlike.mp3 | 20-Apr-2007 17:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | seedless.mp3 | 20-Apr-2007 17:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | seediness.mp3 | 20-Apr-2007 17:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | seedily.mp3 | 20-Apr-2007 17:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | seeder.mp3 | 20-Apr-2007 17:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | seeded.mp3 | 20-Apr-2007 17:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | seedeater.mp3 | 20-Apr-2007 17:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | seedcake.mp3 | 20-Apr-2007 17:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | seedbed.mp3 | 20-Apr-2007 17:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | seed.mp3 | 20-Apr-2007 17:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | seecatch.mp3 | 20-Apr-2007 17:52 | 17K | |
![[SND]](/icons/sound2.gif) | seebee.mp3 | 20-Apr-2007 17:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | seebeckeffect.mp3 | 20-Apr-2007 17:52 | 17K | |
![[SND]](/icons/sound2.gif) | seebeck.mp3 | 20-Apr-2007 17:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | seeable.mp3 | 20-Apr-2007 17:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | see.mp3 | 20-Apr-2007 17:52 | 5.7K | |
![[SND]](/icons/sound2.gif) | see-through.mp3 | 20-Apr-2007 17:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | sedum.mp3 | 20-Apr-2007 17:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | sedulous.mp3 | 20-Apr-2007 17:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | sedulity.mp3 | 20-Apr-2007 17:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | seduisant.mp3 | 20-Apr-2007 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | seductress.mp3 | 20-Apr-2007 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | seductive.mp3 | 20-Apr-2007 17:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | seduction.mp3 | 20-Apr-2007 17:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | seducement.mp3 | 20-Apr-2007 17:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | seduce.mp3 | 20-Apr-2007 17:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sedrah.mp3 | 20-Apr-2007 17:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sedormid.mp3 | 20-Apr-2007 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | seditious.mp3 | 20-Apr-2007 17:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | seditionist.mp3 | 20-Apr-2007 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | seditionary.mp3 | 20-Apr-2007 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | sedition.mp3 | 20-Apr-2007 17:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | sedimentology.mp3 | 20-Apr-2007 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | sedimentologist.mp3 | 20-Apr-2007 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | sedimentologically.mp3 | 20-Apr-2007 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | sedimentological.mp3 | 20-Apr-2007 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | sedimentologic.mp3 | 20-Apr-2007 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | sedimentation.mp3 | 20-Apr-2007 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | sedimentary.mp3 | 20-Apr-2007 17:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | sedimentable.mp3 | 20-Apr-2007 17:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | sediment.mp3 | 20-Apr-2007 17:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | sedilia.mp3 | 20-Apr-2007 17:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | sedile.mp3 | 20-Apr-2007 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | sedgy.mp3 | 20-Apr-2007 17:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | sedged.mp3 | 20-Apr-2007 17:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | sedge.mp3 | 20-Apr-2007 17:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | sedfestival.mp3 | 20-Apr-2007 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | sedevacante.mp3 | 20-Apr-2007 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | sederunt.mp3 | 20-Apr-2007 17:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | seder.mp3 | 20-Apr-2007 17:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | sedentary.mp3 | 20-Apr-2007 17:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | sedefendendo.mp3 | 20-Apr-2007 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | se defendendo.mp3 | 20-Apr-2007 17:39 | 14K | |
![[SND]](/icons/sound2.gif) | sedecias.mp3 | 20-Apr-2007 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | seddon.mp3 | 20-Apr-2007 17:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | seddity.mp3 | 20-Apr-2007 17:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sedative.mp3 | 20-Apr-2007 17:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | sedation.mp3 | 20-Apr-2007 17:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | sedate.mp3 | 20-Apr-2007 17:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | sedarim.mp3 | 20-Apr-2007 17:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | sedalia.mp3 | 20-Apr-2007 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | sedaka.mp3 | 20-Apr-2007 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | security.mp3 | 20-Apr-2007 17:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | securitize.mp3 | 20-Apr-2007 17:50 | 12K | |
![[SND]](/icons/sound2.gif) | securitization.mp3 | 20-Apr-2007 17:50 | 13K | |
![[SND]](/icons/sound2.gif) | securitiesandexchangecommission.mp3 | 20-Apr-2007 17:49 | 27K | |
![[SND]](/icons/sound2.gif) | securitate.mp3 | 20-Apr-2007 17:49 | 17K | |
![[SND]](/icons/sound2.gif) | securiform.mp3 | 20-Apr-2007 17:49 | 17K | |
![[SND]](/icons/sound2.gif) | securicor.mp3 | 20-Apr-2007 17:49 | 17K | |
![[SND]](/icons/sound2.gif) | securement.mp3 | 20-Apr-2007 17:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | secure.mp3 | 20-Apr-2007 17:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | secundus.mp3 | 20-Apr-2007 17:49 | 17K | |
![[SND]](/icons/sound2.gif) | secundum naturam.mp3 | 20-Apr-2007 17:49 | 15K | |
![[SND]](/icons/sound2.gif) | secundum artem.mp3 | 20-Apr-2007 17:49 | 13K | |
![[SND]](/icons/sound2.gif) | secundum.mp3 | 20-Apr-2007 17:49 | 17K | |
![[SND]](/icons/sound2.gif) | secundines.mp3 | 20-Apr-2007 17:49 | 17K | |
![[SND]](/icons/sound2.gif) | secundine.mp3 | 20-Apr-2007 17:49 | 17K | |
![[SND]](/icons/sound2.gif) | secund.mp3 | 20-Apr-2007 17:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | secularly.mp3 | 20-Apr-2007 17:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | secularize.mp3 | 20-Apr-2007 17:49 | 12K | |
![[SND]](/icons/sound2.gif) | secularization.mp3 | 20-Apr-2007 17:49 | 13K | |
![[SND]](/icons/sound2.gif) | secularity.mp3 | 20-Apr-2007 17:49 | 10K | |
![[SND]](/icons/sound2.gif) | secularistic.mp3 | 20-Apr-2007 17:49 | 11K | |
![[SND]](/icons/sound2.gif) | secularist.mp3 | 20-Apr-2007 17:49 | 10K | |
![[SND]](/icons/sound2.gif) | secularism.mp3 | 20-Apr-2007 17:49 | 11K | |
![[SND]](/icons/sound2.gif) | secular.mp3 | 20-Apr-2007 17:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sectoring.mp3 | 20-Apr-2007 17:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | sectorial.mp3 | 20-Apr-2007 17:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | sector.mp3 | 20-Apr-2007 17:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | sectioning.mp3 | 20-Apr-2007 17:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | sectiondor.mp3 | 20-Apr-2007 17:48 | 17K | |
![[SND]](/icons/sound2.gif) | sectionalize.mp3 | 20-Apr-2007 17:48 | 17K | |
![[SND]](/icons/sound2.gif) | sectionalism.mp3 | 20-Apr-2007 17:48 | 11K | |
![[SND]](/icons/sound2.gif) | sectional.mp3 | 20-Apr-2007 17:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | section.mp3 | 20-Apr-2007 17:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | sectility.mp3 | 20-Apr-2007 17:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | sectile.mp3 | 20-Apr-2007 17:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | sectary.mp3 | 20-Apr-2007 17:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | sectarianize.mp3 | 20-Apr-2007 17:48 | 13K | |
![[SND]](/icons/sound2.gif) | sectarianism.mp3 | 20-Apr-2007 17:48 | 12K | |
![[SND]](/icons/sound2.gif) | sectarian.mp3 | 20-Apr-2007 17:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | sect.mp3 | 20-Apr-2007 17:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | secretory.mp3 | 20-Apr-2007 17:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | secretor.mp3 | 20-Apr-2007 17:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | secretive.mp3 | 20-Apr-2007 17:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | secretionary.mp3 | 20-Apr-2007 17:48 | 10K | |
![[SND]](/icons/sound2.gif) | secretion.mp3 | 20-Apr-2007 17:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | secretin.mp3 | 20-Apr-2007 17:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | secrete.mp3 | 20-Apr-2007 17:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | secretaryship.mp3 | 20-Apr-2007 17:48 | 12K | |
![[SND]](/icons/sound2.gif) | secretarydom.mp3 | 20-Apr-2007 17:48 | 17K | |
![[SND]](/icons/sound2.gif) | secretary.mp3 | 20-Apr-2007 17:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | secretariat.mp3 | 20-Apr-2007 17:48 | 10K | |
![[SND]](/icons/sound2.gif) | secretarial.mp3 | 20-Apr-2007 17:47 | 10K | |
![[SND]](/icons/sound2.gif) | secretaire.mp3 | 20-Apr-2007 17:47 | 17K | |
![[SND]](/icons/sound2.gif) | secretagogue.mp3 | 20-Apr-2007 17:47 | 10K | |
![[SND]](/icons/sound2.gif) | secretagog.mp3 | 20-Apr-2007 17:47 | 17K | |
![[SND]](/icons/sound2.gif) | secreta.mp3 | 20-Apr-2007 17:47 | 17K | |
![[SND]](/icons/sound2.gif) | secret.mp3 | 20-Apr-2007 17:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | secrecy.mp3 | 20-Apr-2007 17:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | secos.mp3 | 20-Apr-2007 17:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | secondwind.mp3 | 20-Apr-2007 17:47 | 17K | |
![[SND]](/icons/sound2.gif) | secondo.mp3 | 20-Apr-2007 17:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | secondment.mp3 | 20-Apr-2007 17:47 | 17K | |
![[SND]](/icons/sound2.gif) | secondly.mp3 | 20-Apr-2007 17:47 | 17K | |
![[SND]](/icons/sound2.gif) | secondi.mp3 | 20-Apr-2007 17:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | secondhand.mp3 | 20-Apr-2007 17:47 | 11K | |
![[SND]](/icons/sound2.gif) | second hand.mp3 | 20-Apr-2007 17:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | seconder.mp3 | 20-Apr-2007 17:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | seconde.mp3 | 20-Apr-2007 17:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | secondary.mp3 | 20-Apr-2007 17:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | secondariness.mp3 | 20-Apr-2007 17:47 | 12K | |
![[SND]](/icons/sound2.gif) | secondarily.mp3 | 20-Apr-2007 17:46 | 10K | |
![[SND]](/icons/sound2.gif) | second.mp3 | 20-Apr-2007 17:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | second-string.mp3 | 20-Apr-2007 17:47 | 10K | |
![[SND]](/icons/sound2.gif) | second-rater.mp3 | 20-Apr-2007 17:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | second-rate.mp3 | 20-Apr-2007 17:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | second-line.mp3 | 20-Apr-2007 17:47 | 9.8K | |
![[SND]](/icons/sound2.gif) | second-guess.mp3 | 20-Apr-2007 17:47 | 10K | |
![[SND]](/icons/sound2.gif) | second-best.mp3 | 20-Apr-2007 17:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | secobarbital.mp3 | 20-Apr-2007 17:46 | 12K | |
![[SND]](/icons/sound2.gif) | seclusive.mp3 | 20-Apr-2007 17:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | seclusion.mp3 | 20-Apr-2007 17:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | secluded.mp3 | 20-Apr-2007 17:46 | 17K | |
![[SND]](/icons/sound2.gif) | seclude.mp3 | 20-Apr-2007 17:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | secko.mp3 | 20-Apr-2007 17:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | secessionist.mp3 | 20-Apr-2007 17:46 | 10K | |
![[SND]](/icons/sound2.gif) | secessionism.mp3 | 20-Apr-2007 17:46 | 11K | |
![[SND]](/icons/sound2.gif) | secession.mp3 | 20-Apr-2007 17:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | secesh.mp3 | 20-Apr-2007 17:46 | 17K | |
![[SND]](/icons/sound2.gif) | secern.mp3 | 20-Apr-2007 17:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | seceder.mp3 | 20-Apr-2007 17:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | secede.mp3 | 20-Apr-2007 17:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | secdef.mp3 | 20-Apr-2007 17:46 | 17K | |
![[SND]](/icons/sound2.gif) | seccy.mp3 | 20-Apr-2007 17:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | seccotine.mp3 | 20-Apr-2007 17:46 | 17K | |
![[SND]](/icons/sound2.gif) | secco.mp3 | 20-Apr-2007 17:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | secchi.mp3 | 20-Apr-2007 17:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | secateurs.mp3 | 20-Apr-2007 17:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | secateur.mp3 | 20-Apr-2007 17:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | secant.mp3 | 20-Apr-2007 17:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | secam.mp3 | 20-Apr-2007 17:45 | 17K | |
![[SND]](/icons/sound2.gif) | sec.mp3 | 20-Apr-2007 17:45 | 5.5K | |
![[SND]](/icons/sound2.gif) | sebum.mp3 | 20-Apr-2007 17:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | seborrheic.mp3 | 20-Apr-2007 17:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | seborrhea.mp3 | 20-Apr-2007 17:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | seboim.mp3 | 20-Apr-2007 17:45 | 17K | |
![[SND]](/icons/sound2.gif) | sebo.mp3 | 20-Apr-2007 17:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sebiferous.mp3 | 20-Apr-2007 17:45 | 17K | |
![[SND]](/icons/sound2.gif) | sebesten.mp3 | 20-Apr-2007 17:45 | 17K | |
![[SND]](/icons/sound2.gif) | sebeok.mp3 | 20-Apr-2007 17:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | sebastian.mp3 | 20-Apr-2007 17:45 | 17K | |
![[SND]](/icons/sound2.gif) | sebamed.mp3 | 20-Apr-2007 17:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | sebacic acid.mp3 | 20-Apr-2007 17:45 | 14K | |
![[SND]](/icons/sound2.gif) | sebacic.mp3 | 20-Apr-2007 17:45 | 17K | |
![[SND]](/icons/sound2.gif) | sebaceous.mp3 | 20-Apr-2007 17:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | seb.mp3 | 20-Apr-2007 17:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | seaworthy.mp3 | 20-Apr-2007 17:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | seaworthiness.mp3 | 20-Apr-2007 17:45 | 11K | |
![[SND]](/icons/sound2.gif) | seaweed.mp3 | 20-Apr-2007 17:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | seaway.mp3 | 20-Apr-2007 17:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | seawater.mp3 | 20-Apr-2007 17:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | seaware.mp3 | 20-Apr-2007 17:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | seawards.mp3 | 20-Apr-2007 17:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | seaward.mp3 | 20-Apr-2007 17:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | seawan.mp3 | 20-Apr-2007 17:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | seawall.mp3 | 20-Apr-2007 17:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | seatrain.mp3 | 20-Apr-2007 17:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | seatonvalley.mp3 | 20-Apr-2007 17:44 | 17K | |
![[SND]](/icons/sound2.gif) | seato.mp3 | 20-Apr-2007 17:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | seatmate.mp3 | 20-Apr-2007 17:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | seatman.mp3 | 20-Apr-2007 17:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | seating.mp3 | 20-Apr-2007 17:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | seater.mp3 | 20-Apr-2007 17:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | seated.mp3 | 20-Apr-2007 17:44 | 17K | |
![[SND]](/icons/sound2.gif) | seat.mp3 | 20-Apr-2007 17:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | seastrand.mp3 | 20-Apr-2007 17:44 | 10K | |
![[SND]](/icons/sound2.gif) | seasonless.mp3 | 20-Apr-2007 17:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | seasoning.mp3 | 20-Apr-2007 17:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | seasoner.mp3 | 20-Apr-2007 17:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | seasoned.mp3 | 20-Apr-2007 17:43 | 17K | |
![[SND]](/icons/sound2.gif) | seasonally.mp3 | 20-Apr-2007 17:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | seasonality.mp3 | 20-Apr-2007 17:43 | 10K | |
![[SND]](/icons/sound2.gif) | seasonal.mp3 | 20-Apr-2007 17:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | seasonably.mp3 | 20-Apr-2007 17:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | seasonable.mp3 | 20-Apr-2007 17:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | season.mp3 | 20-Apr-2007 17:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | seaside.mp3 | 20-Apr-2007 17:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | seasickness.mp3 | 20-Apr-2007 17:43 | 11K | |
![[SND]](/icons/sound2.gif) | seasick.mp3 | 20-Apr-2007 17:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | seashoretest.mp3 | 20-Apr-2007 17:43 | 17K | |
![[SND]](/icons/sound2.gif) | seashore.mp3 | 20-Apr-2007 17:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | seashell.mp3 | 20-Apr-2007 17:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | seascape.mp3 | 20-Apr-2007 17:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | seasat.mp3 | 20-Apr-2007 17:43 | 17K | |
![[SND]](/icons/sound2.gif) | searsroebuckandco.mp3 | 20-Apr-2007 17:43 | 17K | |
![[SND]](/icons/sound2.gif) | searle.mp3 | 20-Apr-2007 17:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | searingly.mp3 | 20-Apr-2007 17:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | searingiron.mp3 | 20-Apr-2007 17:42 | 17K | |
![[SND]](/icons/sound2.gif) | searing.mp3 | 20-Apr-2007 17:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | searchlight.mp3 | 20-Apr-2007 17:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | searchless.mp3 | 20-Apr-2007 17:42 | 17K | |
![[SND]](/icons/sound2.gif) | searchingly.mp3 | 20-Apr-2007 17:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | searching.mp3 | 20-Apr-2007 17:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | searchable.mp3 | 20-Apr-2007 17:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | search.mp3 | 20-Apr-2007 17:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | sear.mp3 | 20-Apr-2007 17:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | seaquarium.mp3 | 20-Apr-2007 17:42 | 17K | |
![[SND]](/icons/sound2.gif) | seaquake.mp3 | 20-Apr-2007 17:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | seapuss.mp3 | 20-Apr-2007 17:42 | 17K | |
![[SND]](/icons/sound2.gif) | sea puss.mp3 | 20-Apr-2007 17:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | seaport.mp3 | 20-Apr-2007 17:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | seaplane.mp3 | 20-Apr-2007 17:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | seapiece.mp3 | 20-Apr-2007 17:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | seance.mp3 | 20-Apr-2007 17:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | seanadeireann.mp3 | 20-Apr-2007 17:42 | 17K | |
![[SND]](/icons/sound2.gif) | sean.mp3 | 20-Apr-2007 17:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | seamy.mp3 | 20-Apr-2007 17:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | seamwelding.mp3 | 20-Apr-2007 17:41 | 17K | |
![[SND]](/icons/sound2.gif) | seamstress.mp3 | 20-Apr-2007 17:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | seamster.mp3 | 20-Apr-2007 17:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | seamount.mp3 | 20-Apr-2007 17:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | seamlike.mp3 | 20-Apr-2007 17:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | seamlessness.mp3 | 20-Apr-2007 17:41 | 11K | |
![[SND]](/icons/sound2.gif) | seamlessly.mp3 | 20-Apr-2007 17:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | seamless.mp3 | 20-Apr-2007 17:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | seaming.mp3 | 20-Apr-2007 17:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | seamer.mp3 | 20-Apr-2007 17:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | seamark.mp3 | 20-Apr-2007 17:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | seamanship.mp3 | 20-Apr-2007 17:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | seamanly.mp3 | 20-Apr-2007 17:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | seamanlike.mp3 | 20-Apr-2007 17:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | seaman.mp3 | 20-Apr-2007 17:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | seam.mp3 | 20-Apr-2007 17:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | sealyhamterrier.mp3 | 20-Apr-2007 17:41 | 17K | |
![[SND]](/icons/sound2.gif) | sealskin.mp3 | 20-Apr-2007 17:41 | 9.6K | |
![[SND]](/icons/sound2.gif) | seals.mp3 | 20-Apr-2007 17:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | sealingwax.mp3 | 20-Apr-2007 17:41 | 17K | |
![[SND]](/icons/sound2.gif) | sealift.mp3 | 20-Apr-2007 17:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | sealery.mp3 | 20-Apr-2007 17:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | sealer.mp3 | 20-Apr-2007 17:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | sealed.mp3 | 20-Apr-2007 17:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | sealed-beam.mp3 | 20-Apr-2007 17:40 | 11K | |
![[SND]](/icons/sound2.gif) | sealant.mp3 | 20-Apr-2007 17:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | sealab.mp3 | 20-Apr-2007 17:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | seal.mp3 | 20-Apr-2007 17:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | seajack.mp3 | 20-Apr-2007 17:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | seahawk.mp3 | 20-Apr-2007 17:40 | 17K | |
![[SND]](/icons/sound2.gif) | seagull.mp3 | 20-Apr-2007 17:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | seagram.mp3 | 20-Apr-2007 17:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | seagoing.mp3 | 20-Apr-2007 17:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | seagirt.mp3 | 20-Apr-2007 17:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | seafront.mp3 | 20-Apr-2007 17:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | seafowl.mp3 | 20-Apr-2007 17:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | seafood.mp3 | 20-Apr-2007 17:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | seafloor.mp3 | 20-Apr-2007 17:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | seafaring.mp3 | 20-Apr-2007 17:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | seafarer.mp3 | 20-Apr-2007 17:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | seadrome.mp3 | 20-Apr-2007 17:40 | 17K | |
![[SND]](/icons/sound2.gif) | seacraft.mp3 | 20-Apr-2007 17:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | seacopter.mp3 | 20-Apr-2007 17:40 | 17K | |
![[SND]](/icons/sound2.gif) | seacoast.mp3 | 20-Apr-2007 17:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | seabow.mp3 | 20-Apr-2007 17:39 | 17K | |
![[SND]](/icons/sound2.gif) | seaborne.mp3 | 20-Apr-2007 17:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | seaborgium.mp3 | 20-Apr-2007 17:39 | 10K | |
![[SND]](/icons/sound2.gif) | seaboot.mp3 | 20-Apr-2007 17:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | seaboard.mp3 | 20-Apr-2007 17:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | seablite.mp3 | 20-Apr-2007 17:39 | 17K | |
![[SND]](/icons/sound2.gif) | seabird.mp3 | 20-Apr-2007 17:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | seabed.mp3 | 20-Apr-2007 17:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | seabass.mp3 | 20-Apr-2007 17:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | seabased.mp3 | 20-Apr-2007 17:39 | 17K | |
![[SND]](/icons/sound2.gif) | seabag.mp3 | 20-Apr-2007 17:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | sea.mp3 | 20-Apr-2007 17:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | sea-run.mp3 | 20-Apr-2007 17:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | sea-maiden.mp3 | 20-Apr-2007 17:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | sea-maid.mp3 | 20-Apr-2007 17:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | sea-lane.mp3 | 20-Apr-2007 17:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | se.mp3 | 20-Apr-2007 17:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | se'nnight.mp3 | 21-Apr-2007 09:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | sdeath.mp3 | 20-Apr-2007 17:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | scythe.mp3 | 20-Apr-2007 17:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | scyros.mp3 | 20-Apr-2007 17:38 | 17K | |
![[SND]](/icons/sound2.gif) | scyphus.mp3 | 20-Apr-2007 17:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | scyphula.mp3 | 20-Apr-2007 17:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | scyphozoan.mp3 | 20-Apr-2007 17:38 | 10K | |
![[SND]](/icons/sound2.gif) | scyphius.mp3 | 20-Apr-2007 17:38 | 17K | |
![[SND]](/icons/sound2.gif) | scyphistomae.mp3 | 20-Apr-2007 17:38 | 10K | |
![[SND]](/icons/sound2.gif) | scyphistoma.mp3 | 20-Apr-2007 17:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | scyphiform.mp3 | 20-Apr-2007 17:38 | 17K | |
![[SND]](/icons/sound2.gif) | scyphi.mp3 | 20-Apr-2007 17:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | scyphate.mp3 | 20-Apr-2007 17:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | scyelite.mp3 | 20-Apr-2007 17:38 | 17K | |
![[SND]](/icons/sound2.gif) | scuzzy.mp3 | 20-Apr-2007 17:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | scuzzo.mp3 | 20-Apr-2007 17:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | scuzzball.mp3 | 20-Apr-2007 17:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | scuzz.mp3 | 20-Apr-2007 17:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | scut work.mp3 | 20-Apr-2007 17:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | scutum.mp3 | 20-Apr-2007 17:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | scuttling.mp3 | 20-Apr-2007 17:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | scuttlebutt.mp3 | 20-Apr-2007 17:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | scuttle.mp3 | 20-Apr-2007 17:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | scutter.mp3 | 20-Apr-2007 17:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | scuto bonae voluntatis tuae coronasti nos.mp3 | 20-Apr-2007 17:38 | 41K | |
![[SND]](/icons/sound2.gif) | scutiform.mp3 | 20-Apr-2007 17:38 | 17K | |
![[SND]](/icons/sound2.gif) | scutellum.mp3 | 20-Apr-2007 17:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | scutellation.mp3 | 20-Apr-2007 17:37 | 17K | |
![[SND]](/icons/sound2.gif) | scutellated.mp3 | 20-Apr-2007 17:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | scutellate.mp3 | 20-Apr-2007 17:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | scutellar.mp3 | 20-Apr-2007 17:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | scutella.mp3 | 20-Apr-2007 17:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | scute.mp3 | 20-Apr-2007 17:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | scutcher.mp3 | 20-Apr-2007 17:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | scutcheon.mp3 | 20-Apr-2007 17:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | scutch.mp3 | 20-Apr-2007 17:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | scutate.mp3 | 20-Apr-2007 17:37 | 17K | |
![[SND]](/icons/sound2.gif) | scutari.mp3 | 20-Apr-2007 17:37 | 27K | |
![[SND]](/icons/sound2.gif) | scutal.mp3 | 20-Apr-2007 17:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | scutage.mp3 | 20-Apr-2007 17:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | scuta.mp3 | 20-Apr-2007 17:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | scut.mp3 | 20-Apr-2007 17:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | scurvy.mp3 | 20-Apr-2007 17:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | scurviness.mp3 | 20-Apr-2007 17:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | scurvily.mp3 | 20-Apr-2007 17:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | scurry.mp3 | 20-Apr-2007 17:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | scurrilous.mp3 | 20-Apr-2007 17:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | scurrility.mp3 | 20-Apr-2007 17:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | scurrile.mp3 | 20-Apr-2007 17:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | scurril.mp3 | 20-Apr-2007 17:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | scurfy.mp3 | 20-Apr-2007 17:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | scurf.mp3 | 20-Apr-2007 17:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | scurb.mp3 | 20-Apr-2007 17:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | scuppernong.mp3 | 20-Apr-2007 17:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | scupper.mp3 | 20-Apr-2007 17:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | scup.mp3 | 20-Apr-2007 17:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | scunnion.mp3 | 20-Apr-2007 17:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | scunner.mp3 | 20-Apr-2007 17:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | scungy.mp3 | 20-Apr-2007 17:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | scungilli.mp3 | 20-Apr-2007 17:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | scunge.mp3 | 20-Apr-2007 17:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | scuncheon.mp3 | 20-Apr-2007 17:36 | 17K | |
![[SND]](/icons/sound2.gif) | scummy.mp3 | 20-Apr-2007 17:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | scumbling.mp3 | 20-Apr-2007 17:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | scumble.mp3 | 20-Apr-2007 17:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | scumbag.mp3 | 20-Apr-2007 17:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | scum.mp3 | 20-Apr-2007 17:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | sculpturing.mp3 | 20-Apr-2007 17:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | sculpturesque.mp3 | 20-Apr-2007 17:36 | 10K | |
![[SND]](/icons/sound2.gif) | sculpture.mp3 | 20-Apr-2007 17:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | sculptural.mp3 | 20-Apr-2007 17:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | sculptress.mp3 | 20-Apr-2007 17:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | sculptor.mp3 | 20-Apr-2007 17:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | sculpted.mp3 | 20-Apr-2007 17:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | sculpt.mp3 | 20-Apr-2007 17:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | sculpsit.mp3 | 20-Apr-2007 17:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | sculpserunt.mp3 | 20-Apr-2007 17:35 | 17K | |
![[SND]](/icons/sound2.gif) | sculping.mp3 | 20-Apr-2007 17:35 | 17K | |
![[SND]](/icons/sound2.gif) | sculpin.mp3 | 20-Apr-2007 17:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | sculp.mp3 | 20-Apr-2007 17:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | scully.mp3 | 20-Apr-2007 17:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | scullion.mp3 | 20-Apr-2007 17:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | scullin.mp3 | 20-Apr-2007 17:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | scullery.mp3 | 20-Apr-2007 17:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | scull.mp3 | 20-Apr-2007 17:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | sculk.mp3 | 20-Apr-2007 17:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | sculduggery.mp3 | 20-Apr-2007 17:35 | 17K | |
![[SND]](/icons/sound2.gif) | sculduddery.mp3 | 20-Apr-2007 17:35 | 17K | |
![[SND]](/icons/sound2.gif) | sculch.mp3 | 20-Apr-2007 17:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | scug.mp3 | 20-Apr-2007 17:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | scuffling.mp3 | 20-Apr-2007 17:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | scuffle.mp3 | 20-Apr-2007 17:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | scuffer.mp3 | 20-Apr-2007 17:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | scuff.mp3 | 20-Apr-2007 17:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | scudo.mp3 | 20-Apr-2007 17:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | scudi.mp3 | 20-Apr-2007 17:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | scudamore.mp3 | 20-Apr-2007 17:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | scud.mp3 | 20-Apr-2007 17:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | scuba.mp3 | 20-Apr-2007 17:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | scsi.mp3 | 20-Apr-2007 17:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | scry.mp3 | 20-Apr-2007 17:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | scrutoire.mp3 | 20-Apr-2007 17:34 | 17K | |
![[SND]](/icons/sound2.gif) | scrutiny.mp3 | 20-Apr-2007 17:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | scrutinize.mp3 | 20-Apr-2007 17:34 | 11K | |
![[SND]](/icons/sound2.gif) | scrutineer.mp3 | 20-Apr-2007 17:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | scrutator.mp3 | 20-Apr-2007 17:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrutable.mp3 | 20-Apr-2007 17:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | scrupulous.mp3 | 20-Apr-2007 17:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | scrupulosity.mp3 | 20-Apr-2007 17:34 | 12K | |
![[SND]](/icons/sound2.gif) | scrupling.mp3 | 20-Apr-2007 17:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | scruple.mp3 | 20-Apr-2007 17:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | scrungy.mp3 | 20-Apr-2007 17:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | scrunge.mp3 | 20-Apr-2007 17:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | scrunchy.mp3 | 20-Apr-2007 17:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | scrunch.mp3 | 20-Apr-2007 17:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | scrumpy.mp3 | 20-Apr-2007 17:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | scrumptious.mp3 | 20-Apr-2007 17:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | scrumple.mp3 | 20-Apr-2007 17:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | scrump.mp3 | 20-Apr-2007 17:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | scrummy.mp3 | 20-Apr-2007 17:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | scrummage.mp3 | 20-Apr-2007 17:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | scrum.mp3 | 20-Apr-2007 17:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | scruffy.mp3 | 20-Apr-2007 17:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | scruffiness.mp3 | 20-Apr-2007 17:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | scruffily.mp3 | 20-Apr-2007 17:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | scruff.mp3 | 20-Apr-2007 17:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | scrud.mp3 | 20-Apr-2007 17:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrubwoman.mp3 | 20-Apr-2007 17:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | scrubland.mp3 | 20-Apr-2007 17:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | scrubby.mp3 | 20-Apr-2007 17:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | scrubber.mp3 | 20-Apr-2007 17:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | scrubbed.mp3 | 20-Apr-2007 17:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | scrubbable.mp3 | 20-Apr-2007 17:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | scrub.mp3 | 20-Apr-2007 17:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | scrow.mp3 | 20-Apr-2007 17:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | scrovegnichapel.mp3 | 20-Apr-2007 17:33 | 17K | |
![[SND]](/icons/sound2.gif) | scroungy.mp3 | 20-Apr-2007 17:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrounge.mp3 | 20-Apr-2007 17:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | scrouge.mp3 | 20-Apr-2007 17:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrotum.mp3 | 20-Apr-2007 17:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | scrotitis.mp3 | 20-Apr-2007 17:33 | 17K | |
![[SND]](/icons/sound2.gif) | scrotal.mp3 | 20-Apr-2007 17:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | scrota.mp3 | 20-Apr-2007 17:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | scrophulariaceous.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scroop.mp3 | 20-Apr-2007 17:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | scroogie.mp3 | 20-Apr-2007 17:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | scrooge.mp3 | 20-Apr-2007 17:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | scrooched.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scrooch.mp3 | 20-Apr-2007 17:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | scronched.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scrollwork.mp3 | 20-Apr-2007 17:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | scrollery.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scrolled.mp3 | 20-Apr-2007 17:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | scroll.mp3 | 20-Apr-2007 17:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | scroggin.mp3 | 20-Apr-2007 17:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrog.mp3 | 20-Apr-2007 17:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | scrofulous.mp3 | 20-Apr-2007 17:32 | 10K | |
![[SND]](/icons/sound2.gif) | scrofula.mp3 | 20-Apr-2007 17:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | scrod.mp3 | 20-Apr-2007 17:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | scrobiculate.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scrivener.mp3 | 20-Apr-2007 17:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | scrivello.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scriveboard.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scriptwriter.mp3 | 20-Apr-2007 17:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | scripture.mp3 | 20-Apr-2007 17:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | scripturalist.mp3 | 20-Apr-2007 17:32 | 17K | |
![[SND]](/icons/sound2.gif) | scripturalism.mp3 | 20-Apr-2007 17:31 | 17K | |
![[SND]](/icons/sound2.gif) | scriptural.mp3 | 20-Apr-2007 17:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | scriptorium.mp3 | 20-Apr-2007 17:31 | 10K | |
![[SND]](/icons/sound2.gif) | scriptoria.mp3 | 20-Apr-2007 17:31 | 9.8K | |
![[SND]](/icons/sound2.gif) | scripter.mp3 | 20-Apr-2007 17:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | script.mp3 | 20-Apr-2007 17:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | scripsit.mp3 | 20-Apr-2007 17:31 | 17K | |
![[SND]](/icons/sound2.gif) | scripps.mp3 | 20-Apr-2007 17:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | scripophily.mp3 | 20-Apr-2007 17:31 | 17K | |
![[SND]](/icons/sound2.gif) | scripophile.mp3 | 20-Apr-2007 17:31 | 17K | |
![[SND]](/icons/sound2.gif) | scrip.mp3 | 20-Apr-2007 17:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | scrinium.mp3 | 20-Apr-2007 17:31 | 17K | |
![[SND]](/icons/sound2.gif) | scrimshaw.mp3 | 20-Apr-2007 17:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | scrimshank.mp3 | 20-Apr-2007 17:31 | 17K | |
![[SND]](/icons/sound2.gif) | scrimshander.mp3 | 20-Apr-2007 17:31 | 10K | |
![[SND]](/icons/sound2.gif) | scrimpy.mp3 | 20-Apr-2007 17:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | scrimp.mp3 | 20-Apr-2007 17:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | scrimmage.mp3 | 20-Apr-2007 17:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | scrim.mp3 | 20-Apr-2007 17:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | scrieve.mp3 | 20-Apr-2007 17:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | scriber.mp3 | 20-Apr-2007 17:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | scribe.mp3 | 20-Apr-2007 17:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | scribbling.mp3 | 20-Apr-2007 17:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | scribbler.mp3 | 20-Apr-2007 17:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | scribble.mp3 | 20-Apr-2007 17:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | scribanne.mp3 | 20-Apr-2007 17:30 | 17K | |
![[SND]](/icons/sound2.gif) | scribal.mp3 | 20-Apr-2007 17:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | scriabin.mp3 | 20-Apr-2007 17:30 | 17K | |
![[SND]](/icons/sound2.gif) | screwy.mp3 | 20-Apr-2007 17:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | screwworm.mp3 | 20-Apr-2007 17:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | screwup.mp3 | 20-Apr-2007 17:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | screwlike.mp3 | 20-Apr-2007 17:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | screwee.mp3 | 20-Apr-2007 17:30 | 17K | |
![[SND]](/icons/sound2.gif) | screwed.mp3 | 20-Apr-2007 17:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | screwdriver.mp3 | 20-Apr-2007 17:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | screwbean.mp3 | 20-Apr-2007 17:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | screwball.mp3 | 20-Apr-2007 17:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | screw.mp3 | 20-Apr-2007 17:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | screigh.mp3 | 20-Apr-2007 17:30 | 17K | |
![[SND]](/icons/sound2.gif) | screever.mp3 | 20-Apr-2007 17:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | screeve.mp3 | 20-Apr-2007 17:30 | 17K | |
![[SND]](/icons/sound2.gif) | screenwriter.mp3 | 20-Apr-2007 17:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | screenplay.mp3 | 20-Apr-2007 17:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | screeno.mp3 | 20-Apr-2007 17:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | screenland.mp3 | 20-Apr-2007 17:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | screening.mp3 | 20-Apr-2007 17:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | screenful.mp3 | 20-Apr-2007 17:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | screenable.mp3 | 20-Apr-2007 17:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | screen.mp3 | 20-Apr-2007 17:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | screek.mp3 | 20-Apr-2007 17:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | screed.mp3 | 20-Apr-2007 17:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | screechy.mp3 | 20-Apr-2007 17:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | screeching.mp3 | 20-Apr-2007 17:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | screech.mp3 | 20-Apr-2007 17:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | scree.mp3 | 20-Apr-2007 17:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | screamy.mp3 | 20-Apr-2007 17:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | screamingmeemies.mp3 | 20-Apr-2007 17:29 | 17K | |
![[SND]](/icons/sound2.gif) | screaming meemies.mp3 | 20-Apr-2007 17:29 | 13K | |
![[SND]](/icons/sound2.gif) | screaming.mp3 | 20-Apr-2007 17:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | screamer.mp3 | 20-Apr-2007 17:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | scream.mp3 | 20-Apr-2007 17:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | screaky.mp3 | 20-Apr-2007 17:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | screak.mp3 | 20-Apr-2007 17:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | scray.mp3 | 20-Apr-2007 17:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | scrawny.mp3 | 20-Apr-2007 17:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | scrawly.mp3 | 20-Apr-2007 17:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | scrawler.mp3 | 20-Apr-2007 17:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrawl.mp3 | 20-Apr-2007 17:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | scraunched.mp3 | 20-Apr-2007 17:29 | 17K | |
![[SND]](/icons/sound2.gif) | scraunch.mp3 | 20-Apr-2007 17:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | scratchy.mp3 | 20-Apr-2007 17:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | scratching.mp3 | 20-Apr-2007 17:29 | 17K | |
![[SND]](/icons/sound2.gif) | scratchiness.mp3 | 20-Apr-2007 17:29 | 9.8K | |
![[SND]](/icons/sound2.gif) | scratchily.mp3 | 20-Apr-2007 17:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | scratchies.mp3 | 20-Apr-2007 17:28 | 17K | |
![[SND]](/icons/sound2.gif) | scratches.mp3 | 20-Apr-2007 17:28 | 17K | |
![[SND]](/icons/sound2.gif) | scratcher.mp3 | 20-Apr-2007 17:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | scratchboard.mp3 | 20-Apr-2007 17:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | scratch.mp3 | 20-Apr-2007 17:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | scraps.mp3 | 20-Apr-2007 17:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | scrappy.mp3 | 20-Apr-2007 17:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | scrapple.mp3 | 20-Apr-2007 17:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | scrappiness.mp3 | 20-Apr-2007 17:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | scrappily.mp3 | 20-Apr-2007 17:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrapper.mp3 | 20-Apr-2007 17:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | scrappage.mp3 | 20-Apr-2007 17:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | scraping.mp3 | 20-Apr-2007 17:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrapie.mp3 | 20-Apr-2007 17:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | scraper.mp3 | 20-Apr-2007 17:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrape.mp3 | 20-Apr-2007 17:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | scrapbook.mp3 | 20-Apr-2007 17:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | scrap.mp3 | 20-Apr-2007 17:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | scranny.mp3 | 20-Apr-2007 17:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrannel.mp3 | 20-Apr-2007 17:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | scran.mp3 | 20-Apr-2007 17:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | scramjet.mp3 | 20-Apr-2007 17:28 | 17K | |
![[SND]](/icons/sound2.gif) | scrambling.mp3 | 20-Apr-2007 17:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | scrambler.mp3 | 20-Apr-2007 17:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | scramble.mp3 | 20-Apr-2007 17:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | scramb.mp3 | 20-Apr-2007 17:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | scramasax.mp3 | 20-Apr-2007 17:27 | 17K | |
![[SND]](/icons/sound2.gif) | scram.mp3 | 20-Apr-2007 17:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | scraggy.mp3 | 20-Apr-2007 17:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | scraggly.mp3 | 20-Apr-2007 17:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | scrag.mp3 | 20-Apr-2007 17:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | scrabbly.mp3 | 20-Apr-2007 17:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | scrabbling.mp3 | 20-Apr-2007 17:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | scrabbler.mp3 | 20-Apr-2007 17:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | scrabble.mp3 | 20-Apr-2007 17:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | scowlingly.mp3 | 20-Apr-2007 17:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | scowl.mp3 | 20-Apr-2007 17:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | scow.mp3 | 20-Apr-2007 17:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | scoutmaster.mp3 | 20-Apr-2007 17:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | scouting.mp3 | 20-Apr-2007 17:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | scouth.mp3 | 20-Apr-2007 17:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | scouter.mp3 | 20-Apr-2007 17:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | scoutcraft.mp3 | 20-Apr-2007 17:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | scout.mp3 | 20-Apr-2007 17:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | scouse.mp3 | 20-Apr-2007 17:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | scouring.mp3 | 20-Apr-2007 17:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | scourge.mp3 | 20-Apr-2007 17:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | scourer.mp3 | 20-Apr-2007 17:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | scour.mp3 | 20-Apr-2007 17:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | scoundrelly.mp3 | 20-Apr-2007 17:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | scoundrel.mp3 | 20-Apr-2007 17:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | scotus.mp3 | 20-Apr-2007 17:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | scotty.mp3 | 20-Apr-2007 17:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | scottsborotrials.mp3 | 20-Apr-2007 17:26 | 17K | |
![[SND]](/icons/sound2.gif) | scottsbluff.mp3 | 20-Apr-2007 17:26 | 17K | |
![[SND]](/icons/sound2.gif) | scotto.mp3 | 20-Apr-2007 17:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | scotticize.mp3 | 20-Apr-2007 17:26 | 17K | |
![[SND]](/icons/sound2.gif) | scottice.mp3 | 20-Apr-2007 17:26 | 17K | |
![[SND]](/icons/sound2.gif) | scotti.mp3 | 20-Apr-2007 17:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | scotopic.mp3 | 20-Apr-2007 17:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | scotopia.mp3 | 20-Apr-2007 17:26 | 17K | |
![[SND]](/icons/sound2.gif) | scotophobin.mp3 | 20-Apr-2007 17:25 | 17K | |
![[SND]](/icons/sound2.gif) | scotophilic.mp3 | 20-Apr-2007 17:25 | 17K | |
![[SND]](/icons/sound2.gif) | scotomata.mp3 | 20-Apr-2007 17:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | scotoma.mp3 | 20-Apr-2007 17:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | scotograph.mp3 | 20-Apr-2007 17:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | scotodinia.mp3 | 20-Apr-2007 17:25 | 17K | |
![[SND]](/icons/sound2.gif) | scoto.mp3 | 20-Apr-2007 17:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | scoticism.mp3 | 20-Apr-2007 17:25 | 17K | |
![[SND]](/icons/sound2.gif) | scoter.mp3 | 20-Apr-2007 17:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | scotchgard.mp3 | 20-Apr-2007 17:25 | 17K | |
![[SND]](/icons/sound2.gif) | scot-free.mp3 | 20-Apr-2007 17:25 | 11K | |
![[SND]](/icons/sound2.gif) | scorzonera.mp3 | 20-Apr-2007 17:25 | 17K | |
![[SND]](/icons/sound2.gif) | scorpion.mp3 | 20-Apr-2007 17:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | scorpioid.mp3 | 20-Apr-2007 17:24 | 17K | |
![[SND]](/icons/sound2.gif) | scorper.mp3 | 20-Apr-2007 17:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | scorpaenoid.mp3 | 20-Apr-2007 17:24 | 17K | |
![[SND]](/icons/sound2.gif) | scorpaenid.mp3 | 20-Apr-2007 17:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | scornfully.mp3 | 20-Apr-2007 17:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | scornful.mp3 | 20-Apr-2007 17:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | scorn.mp3 | 20-Apr-2007 17:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | scoring.mp3 | 20-Apr-2007 17:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | scorify.mp3 | 20-Apr-2007 17:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | scorifier.mp3 | 20-Apr-2007 17:24 | 17K | |
![[SND]](/icons/sound2.gif) | scorification.mp3 | 20-Apr-2007 17:24 | 17K | |
![[SND]](/icons/sound2.gif) | scoriae.mp3 | 20-Apr-2007 17:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | scoriaceous.mp3 | 20-Apr-2007 17:24 | 11K | |
![[SND]](/icons/sound2.gif) | scoria.mp3 | 20-Apr-2007 17:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | scorf.mp3 | 20-Apr-2007 17:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | scorer.mp3 | 20-Apr-2007 17:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | scoreless.mp3 | 20-Apr-2007 17:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | scorekeeper.mp3 | 20-Apr-2007 17:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | scorecard.mp3 | 20-Apr-2007 17:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | scoreboard.mp3 | 20-Apr-2007 17:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | score.mp3 | 20-Apr-2007 17:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | scordatura.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scorchingly.mp3 | 20-Apr-2007 17:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | scorching.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scorcher.mp3 | 20-Apr-2007 17:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | scorched.mp3 | 20-Apr-2007 17:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | scorched-earth.mp3 | 20-Apr-2007 17:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | scorch.mp3 | 20-Apr-2007 17:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | scorbutic.mp3 | 20-Apr-2007 17:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | scopy.mp3 | 20-Apr-2007 17:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | scopus.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scopulate.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scopula.mp3 | 20-Apr-2007 17:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | scopsowl.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scopophilia.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scopoline.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scopolamine.mp3 | 20-Apr-2007 17:23 | 11K | |
![[SND]](/icons/sound2.gif) | scoping.mp3 | 20-Apr-2007 17:23 | 17K | |
![[SND]](/icons/sound2.gif) | scopic.mp3 | 20-Apr-2007 17:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | scope.mp3 | 20-Apr-2007 17:23 | 6.1K | |
![[SND]](/icons/sound2.gif) | scopas.mp3 | 20-Apr-2007 17:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | scopa.mp3 | 20-Apr-2007 17:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | scop.mp3 | 20-Apr-2007 17:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | scootie.mp3 | 20-Apr-2007 17:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | scooters.mp3 | 20-Apr-2007 17:22 | 17K | |
![[SND]](/icons/sound2.gif) | scooter.mp3 | 20-Apr-2007 17:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | scoot.mp3 | 20-Apr-2007 17:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | scoosh.mp3 | 20-Apr-2007 17:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | scoopful.mp3 | 20-Apr-2007 17:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | scooper.mp3 | 20-Apr-2007 17:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | scoopable.mp3 | 20-Apr-2007 17:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | scoop.mp3 | 20-Apr-2007 17:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | scooch.mp3 | 20-Apr-2007 17:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | scoobs.mp3 | 20-Apr-2007 17:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | scone.mp3 | 20-Apr-2007 17:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | sconcheon.mp3 | 20-Apr-2007 17:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | sconce.mp3 | 20-Apr-2007 17:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | scombroid.mp3 | 20-Apr-2007 17:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | scombrid.mp3 | 20-Apr-2007 17:22 | 17K | |
![[SND]](/icons/sound2.gif) | scomber.mp3 | 20-Apr-2007 17:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | scolophore.mp3 | 20-Apr-2007 17:22 | 17K | |
![[SND]](/icons/sound2.gif) | scolopendrium.mp3 | 20-Apr-2007 17:22 | 17K | |
![[SND]](/icons/sound2.gif) | scolopendrid.mp3 | 20-Apr-2007 17:22 | 17K | |
![[SND]](/icons/sound2.gif) | scolopendra.mp3 | 20-Apr-2007 17:22 | 10K | |
![[SND]](/icons/sound2.gif) | scolopaceous.mp3 | 20-Apr-2007 17:22 | 17K | |
![[SND]](/icons/sound2.gif) | scollop.mp3 | 20-Apr-2007 17:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | scoliotic.mp3 | 20-Apr-2007 17:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | scoliosis.mp3 | 20-Apr-2007 17:21 | 11K | |
![[SND]](/icons/sound2.gif) | scolioses.mp3 | 20-Apr-2007 17:21 | 12K | |
![[SND]](/icons/sound2.gif) | scolion.mp3 | 20-Apr-2007 17:21 | 17K | |
![[SND]](/icons/sound2.gif) | scolices.mp3 | 20-Apr-2007 17:21 | 11K | |
![[SND]](/icons/sound2.gif) | scolex.mp3 | 20-Apr-2007 17:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | scolecite.mp3 | 20-Apr-2007 17:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | scoleces.mp3 | 20-Apr-2007 17:21 | 11K | |
![[SND]](/icons/sound2.gif) | scolding.mp3 | 20-Apr-2007 17:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | scold.mp3 | 20-Apr-2007 17:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | scoke.mp3 | 20-Apr-2007 17:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | scoinsonarch.mp3 | 20-Apr-2007 17:21 | 17K | |
![[SND]](/icons/sound2.gif) | scofield.mp3 | 20-Apr-2007 17:21 | 17K | |
![[SND]](/icons/sound2.gif) | scofflaw.mp3 | 20-Apr-2007 17:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | scoffings.mp3 | 20-Apr-2007 17:21 | 17K | |
![[SND]](/icons/sound2.gif) | scoff.mp3 | 20-Apr-2007 17:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | scobe.mp3 | 20-Apr-2007 17:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | scob.mp3 | 20-Apr-2007 17:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | sclerous.mp3 | 20-Apr-2007 17:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | sclerotomy.mp3 | 20-Apr-2007 17:21 | 17K | |
![[SND]](/icons/sound2.gif) | sclerotome.mp3 | 20-Apr-2007 17:21 | 17K | |
![[SND]](/icons/sound2.gif) | sclerotized.mp3 | 20-Apr-2007 17:21 | 11K | |
![[SND]](/icons/sound2.gif) | sclerotization.mp3 | 20-Apr-2007 17:21 | 12K | |
![[SND]](/icons/sound2.gif) | sclerotium.mp3 | 20-Apr-2007 17:21 | 10K | |
![[SND]](/icons/sound2.gif) | sclerotitis.mp3 | 20-Apr-2007 17:21 | 17K | |
![[SND]](/icons/sound2.gif) | sclerotinia.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | sclerotin.mp3 | 20-Apr-2007 17:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | sclerotic.mp3 | 20-Apr-2007 17:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | sclerotial.mp3 | 20-Apr-2007 17:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | sclerotia.mp3 | 20-Apr-2007 17:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | sclerotherapy.mp3 | 20-Apr-2007 17:20 | 12K | |
![[SND]](/icons/sound2.gif) | sclerosis.mp3 | 20-Apr-2007 17:20 | 11K | |
![[SND]](/icons/sound2.gif) | sclerosing.mp3 | 20-Apr-2007 17:20 | 10K | |
![[SND]](/icons/sound2.gif) | sclerosed.mp3 | 20-Apr-2007 17:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | sclerose.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | scleroscope.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | scleroprotein.mp3 | 20-Apr-2007 17:20 | 13K | |
![[SND]](/icons/sound2.gif) | sclerophyte.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | sclerophylly.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | sclerophyll.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | sclerometer.mp3 | 20-Apr-2007 17:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | scleroma.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | scleroid.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | sclerogenous.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | sclerodermatous.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | scleroderma.mp3 | 20-Apr-2007 17:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | sclerocauly.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | scleroblast.mp3 | 20-Apr-2007 17:20 | 17K | |
![[SND]](/icons/sound2.gif) | sclero.mp3 | 20-Apr-2007 17:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | scleritis.mp3 | 20-Apr-2007 17:19 | 17K | |
![[SND]](/icons/sound2.gif) | sclerite.mp3 | 20-Apr-2007 17:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | sclerenchymatous.mp3 | 20-Apr-2007 17:19 | 12K | |
![[SND]](/icons/sound2.gif) | sclerenchyma.mp3 | 20-Apr-2007 17:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | sclerema.mp3 | 20-Apr-2007 17:19 | 17K | |
![[SND]](/icons/sound2.gif) | sclereid.mp3 | 20-Apr-2007 17:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | sclerectomy.mp3 | 20-Apr-2007 17:19 | 17K | |
![[SND]](/icons/sound2.gif) | scleral.mp3 | 20-Apr-2007 17:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | sclera.mp3 | 20-Apr-2007 17:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | scler.mp3 | 20-Apr-2007 17:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | sclent.mp3 | 20-Apr-2007 17:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | sclaff.mp3 | 20-Apr-2007 17:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | scivvy.mp3 | 20-Apr-2007 17:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | sciuroid.mp3 | 20-Apr-2007 17:19 | 17K | |
![[SND]](/icons/sound2.gif) | sciurine.mp3 | 20-Apr-2007 17:19 | 17K | |
![[SND]](/icons/sound2.gif) | scituate.mp3 | 20-Apr-2007 17:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | scitech.mp3 | 20-Apr-2007 17:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | scissure.mp3 | 20-Apr-2007 17:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | scissors.mp3 | 20-Apr-2007 17:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | scissoring.mp3 | 20-Apr-2007 17:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | scissor.mp3 | 20-Apr-2007 17:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | scissor-tailed flycatcher.mp3 | 20-Apr-2007 17:19 | 17K | |
![[SND]](/icons/sound2.gif) | scission.mp3 | 20-Apr-2007 17:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | scissile.mp3 | 20-Apr-2007 17:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | scissel.mp3 | 20-Apr-2007 17:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | scisearch.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | scirrhus.mp3 | 20-Apr-2007 17:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | scirrhous.mp3 | 20-Apr-2007 17:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | scirrhoid.mp3 | 20-Apr-2007 17:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | sciron.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | scirocco.mp3 | 20-Apr-2007 17:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | scirefacias.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | scire facias.mp3 | 20-Apr-2007 17:18 | 12K | |
![[SND]](/icons/sound2.gif) | sciosophy.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | sciophyte.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | sciophilous.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | scion.mp3 | 20-Apr-2007 17:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | sciomancy.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | sciomachy.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | sciolto.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | sciolistic.mp3 | 20-Apr-2007 17:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | sciolist.mp3 | 20-Apr-2007 17:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | sciolism.mp3 | 20-Apr-2007 17:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | scintiscanning.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | scintiscanner.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | scintiscan.mp3 | 20-Apr-2007 17:18 | 17K | |
![[SND]](/icons/sound2.gif) | scintillometer.mp3 | 20-Apr-2007 17:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | scintillator.mp3 | 20-Apr-2007 17:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | scintillation.mp3 | 20-Apr-2007 17:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | scintillating.mp3 | 20-Apr-2007 17:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | scintillate.mp3 | 20-Apr-2007 17:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | scintillant.mp3 | 20-Apr-2007 17:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | scintilla.mp3 | 20-Apr-2007 17:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | scintigraphy.mp3 | 20-Apr-2007 17:17 | 10K | |
![[SND]](/icons/sound2.gif) | scintigraphic.mp3 | 20-Apr-2007 17:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | scintigram.mp3 | 20-Apr-2007 17:17 | 17K | |
![[SND]](/icons/sound2.gif) | scincoid.mp3 | 20-Apr-2007 17:17 | 17K | |
![[SND]](/icons/sound2.gif) | scimitar.mp3 | 20-Apr-2007 17:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | scillyisles.mp3 | 20-Apr-2007 17:17 | 17K | |
![[SND]](/icons/sound2.gif) | scillism.mp3 | 20-Apr-2007 17:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | scilla.mp3 | 20-Apr-2007 17:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | scilicet.mp3 | 20-Apr-2007 17:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | scifi.mp3 | 20-Apr-2007 17:17 | 17K | |
![[SND]](/icons/sound2.gif) | scientology.mp3 | 20-Apr-2007 17:17 | 17K | |
![[SND]](/icons/sound2.gif) | scientize.mp3 | 20-Apr-2007 17:17 | 11K | |
![[SND]](/icons/sound2.gif) | scientistic.mp3 | 20-Apr-2007 17:17 | 10K | |
![[SND]](/icons/sound2.gif) | scientist.mp3 | 20-Apr-2007 17:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | scientism.mp3 | 20-Apr-2007 17:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | scientifically.mp3 | 20-Apr-2007 17:17 | 11K | |
![[SND]](/icons/sound2.gif) | scientific.mp3 | 20-Apr-2007 17:16 | 10K | |
![[SND]](/icons/sound2.gif) | sciential.mp3 | 20-Apr-2007 17:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | scientiaestpotentia.mp3 | 20-Apr-2007 17:16 | 27K | |
![[SND]](/icons/sound2.gif) | scienter.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | science.mp3 | 20-Apr-2007 17:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | science-fictional.mp3 | 20-Apr-2007 17:16 | 12K | |
![[SND]](/icons/sound2.gif) | sciatica.mp3 | 20-Apr-2007 17:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | sciatic.mp3 | 20-Apr-2007 17:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | sciamachy.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | sciagraphy.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | sciaenoid.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | scia.mp3 | 20-Apr-2007 17:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | sci.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | sci-fi.mp3 | 20-Apr-2007 17:17 | 10K | |
![[SND]](/icons/sound2.gif) | schwyzertutsch.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | schwitters.mp3 | 20-Apr-2007 17:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | schwing.mp3 | 20-Apr-2007 17:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | schwenkfelder.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | schweizerdeutsch.mp3 | 20-Apr-2007 17:16 | 17K | |
![[SND]](/icons/sound2.gif) | schweiz.mp3 | 20-Apr-2007 17:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | schweik.mp3 | 20-Apr-2007 17:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | schwedlersmaple.mp3 | 20-Apr-2007 17:15 | 17K | |
![[SND]](/icons/sound2.gif) | schwarzschildradius.mp3 | 20-Apr-2007 17:15 | 17K | |
![[SND]](/icons/sound2.gif) | schwarzenegger.mp3 | 20-Apr-2007 17:15 | 17K | |
![[SND]](/icons/sound2.gif) | schwarz.mp3 | 20-Apr-2007 17:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | schwartze.mp3 | 20-Apr-2007 17:15 | 17K | |
![[SND]](/icons/sound2.gif) | schwarmerei.mp3 | 20-Apr-2007 17:15 | 11K | |
![[SND]](/icons/sound2.gif) | schwann.mp3 | 20-Apr-2007 17:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | schwab.mp3 | 20-Apr-2007 17:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | schwa.mp3 | 20-Apr-2007 17:15 | 5.9K | |
![[SND]](/icons/sound2.gif) | schvug.mp3 | 20-Apr-2007 17:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | schvartzer.mp3 | 20-Apr-2007 17:15 | 17K | |
![[SND]](/icons/sound2.gif) | schvartze.mp3 | 20-Apr-2007 17:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | schuylerville.mp3 | 20-Apr-2007 17:15 | 17K | |
![[SND]](/icons/sound2.gif) | schutzstaffel.mp3 | 20-Apr-2007 17:15 | 17K | |
![[SND]](/icons/sound2.gif) | schutz.mp3 | 20-Apr-2007 17:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | schussboomer.mp3 | 20-Apr-2007 17:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | schussboom.mp3 | 20-Apr-2007 17:14 | 17K | |
![[SND]](/icons/sound2.gif) | schuss.mp3 | 20-Apr-2007 17:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | schurman.mp3 | 20-Apr-2007 17:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | schumpeter.mp3 | 20-Apr-2007 17:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | schumannheink.mp3 | 20-Apr-2007 17:14 | 17K | |
![[SND]](/icons/sound2.gif) | schumacher.mp3 | 20-Apr-2007 17:14 | 17K | |
![[SND]](/icons/sound2.gif) | schuller.mp3 | 20-Apr-2007 17:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | schul.mp3 | 20-Apr-2007 17:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | schuit.mp3 | 20-Apr-2007 17:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | schtup.mp3 | 20-Apr-2007 17:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | schtum.mp3 | 20-Apr-2007 17:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | schtoonk.mp3 | 20-Apr-2007 17:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | schtick.mp3 | 20-Apr-2007 17:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | schtarker.mp3 | 20-Apr-2007 17:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | schryari.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schroeder.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schrodingerequation.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schroderbernsteintheorem.mp3 | 20-Apr-2007 17:13 | 27K | |
![[SND]](/icons/sound2.gif) | schrod.mp3 | 20-Apr-2007 17:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | schreinerize.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schreinerfinish.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schreiner.mp3 | 20-Apr-2007 17:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | schreibersite.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schrecklichkeit.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schrank.mp3 | 20-Apr-2007 17:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | schpritz.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schoutenislands.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schottkydefect.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schottische.mp3 | 20-Apr-2007 17:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | schorl.mp3 | 20-Apr-2007 17:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | schopenhauerism.mp3 | 20-Apr-2007 17:13 | 17K | |
![[SND]](/icons/sound2.gif) | schooner.mp3 | 20-Apr-2007 17:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | schooner-rigged.mp3 | 20-Apr-2007 17:12 | 11K | |
![[SND]](/icons/sound2.gif) | schoolwork.mp3 | 20-Apr-2007 17:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | schooltime.mp3 | 20-Apr-2007 17:12 | 10K | |
![[SND]](/icons/sound2.gif) | schoolteacherish.mp3 | 20-Apr-2007 17:12 | 17K | |
![[SND]](/icons/sound2.gif) | schoolteacher.mp3 | 20-Apr-2007 17:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | schoolroom.mp3 | 20-Apr-2007 17:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | schoolphobia.mp3 | 20-Apr-2007 17:12 | 17K | |
![[SND]](/icons/sound2.gif) | schoolmistressy.mp3 | 20-Apr-2007 17:12 | 11K | |
![[SND]](/icons/sound2.gif) | schoolmistress.mp3 | 20-Apr-2007 17:12 | 12K | |
![[SND]](/icons/sound2.gif) | schoolmate.mp3 | 20-Apr-2007 17:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | schoolmasterish.mp3 | 20-Apr-2007 17:12 | 13K | |
![[SND]](/icons/sound2.gif) | schoolmaster.mp3 | 20-Apr-2007 17:12 | 11K | |
![[SND]](/icons/sound2.gif) | schoolmarmish.mp3 | 20-Apr-2007 17:12 | 12K | |
![[SND]](/icons/sound2.gif) | schoolmarm.mp3 | 20-Apr-2007 17:12 | 10K | |
![[SND]](/icons/sound2.gif) | schoolman.mp3 | 20-Apr-2007 17:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | schoolmaam.mp3 | 20-Apr-2007 17:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | schoolma'am.mp3 | 20-Apr-2007 17:12 | 10K | |
![[SND]](/icons/sound2.gif) | schoolkid.mp3 | 20-Apr-2007 17:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | schooling.mp3 | 20-Apr-2007 17:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | schoolie.mp3 | 20-Apr-2007 17:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | schoolhouse.mp3 | 20-Apr-2007 17:11 | 10K | |
![[SND]](/icons/sound2.gif) | schoolgirl.mp3 | 20-Apr-2007 17:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | schoolfellow.mp3 | 20-Apr-2007 17:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | schooler.mp3 | 20-Apr-2007 17:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | schoolcraft.mp3 | 20-Apr-2007 17:11 | 17K | |
![[SND]](/icons/sound2.gif) | schoolchild.mp3 | 20-Apr-2007 17:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | schoolboyish.mp3 | 20-Apr-2007 17:11 | 11K | |
![[SND]](/icons/sound2.gif) | schoolboy.mp3 | 20-Apr-2007 17:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | schoolbook.mp3 | 20-Apr-2007 17:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | schoolbag.mp3 | 20-Apr-2007 17:11 | 10K | |
![[SND]](/icons/sound2.gif) | school.mp3 | 20-Apr-2007 17:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | school-leaver.mp3 | 20-Apr-2007 17:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | schongauer.mp3 | 20-Apr-2007 17:11 | 17K | |
![[SND]](/icons/sound2.gif) | schonberg.mp3 | 20-Apr-2007 17:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | schonbein.mp3 | 20-Apr-2007 17:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | schon.mp3 | 20-Apr-2007 17:11 | 17K | |
![[SND]](/icons/sound2.gif) | scholium.mp3 | 20-Apr-2007 17:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | scholiastic.mp3 | 20-Apr-2007 17:11 | 10K | |
![[SND]](/icons/sound2.gif) | scholiast.mp3 | 20-Apr-2007 17:11 | 10K | |
![[SND]](/icons/sound2.gif) | scholia.mp3 | 20-Apr-2007 17:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | scholasticism.mp3 | 20-Apr-2007 17:11 | 12K | |
![[SND]](/icons/sound2.gif) | scholasticate.mp3 | 20-Apr-2007 17:11 | 11K | |
![[SND]](/icons/sound2.gif) | scholastically.mp3 | 20-Apr-2007 17:11 | 11K | |
![[SND]](/icons/sound2.gif) | scholastic.mp3 | 20-Apr-2007 17:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | scholarship.mp3 | 20-Apr-2007 17:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | scholarly.mp3 | 20-Apr-2007 17:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | scholarch.mp3 | 20-Apr-2007 17:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | scholar.mp3 | 20-Apr-2007 17:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | scholae cantorum.mp3 | 20-Apr-2007 17:10 | 13K | |
![[SND]](/icons/sound2.gif) | scholacantorum.mp3 | 20-Apr-2007 17:10 | 17K | |
![[SND]](/icons/sound2.gif) | schola cantorum.mp3 | 20-Apr-2007 17:10 | 14K | |
![[SND]](/icons/sound2.gif) | schol.mp3 | 20-Apr-2007 17:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | schnozzler.mp3 | 20-Apr-2007 17:10 | 17K | |
![[SND]](/icons/sound2.gif) | schnozzled.mp3 | 20-Apr-2007 17:10 | 17K | |
![[SND]](/icons/sound2.gif) | schnozzle.mp3 | 20-Apr-2007 17:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | schnoz.mp3 | 20-Apr-2007 17:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | schnorrer.mp3 | 20-Apr-2007 17:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | schnorkle.mp3 | 20-Apr-2007 17:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | schnook.mp3 | 20-Apr-2007 17:10 | 5.7K | |
![[SND]](/icons/sound2.gif) | schnockered.mp3 | 20-Apr-2007 17:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | schnitzel.mp3 | 20-Apr-2007 17:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | schnittke.mp3 | 20-Apr-2007 17:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | schneidertrophy.mp3 | 20-Apr-2007 17:10 | 17K | |
![[SND]](/icons/sound2.gif) | schneiderhan.mp3 | 20-Apr-2007 17:09 | 17K | |
![[SND]](/icons/sound2.gif) | schneider.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schnecken.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schnauzer.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schnapps.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schnapple.mp3 | 20-Apr-2007 17:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | schnapper.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schmutzy.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schmutz.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schmutter.mp3 | 20-Apr-2007 17:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | schmucker.mp3 | 20-Apr-2007 17:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | schmuck.mp3 | 20-Apr-2007 17:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | schmotte.mp3 | 20-Apr-2007 17:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | schmoozy.mp3 | 20-Apr-2007 17:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | schmoozer.mp3 | 20-Apr-2007 17:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | schmooze.mp3 | 20-Apr-2007 17:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | schmoo.mp3 | 20-Apr-2007 17:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | schmoe.mp3 | 20-Apr-2007 17:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | schmock.mp3 | 20-Apr-2007 17:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | schmo.mp3 | 20-Apr-2007 17:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | schmitttrigger.mp3 | 20-Apr-2007 17:09 | 17K | |
![[SND]](/icons/sound2.gif) | schmierkase.mp3 | 20-Apr-2007 17:09 | 17K | |
![[SND]](/icons/sound2.gif) | schmendrick.mp3 | 20-Apr-2007 17:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | schmegeggy.mp3 | 20-Apr-2007 17:08 | 17K | |
![[SND]](/icons/sound2.gif) | schmeer.mp3 | 20-Apr-2007 17:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | schmee.mp3 | 20-Apr-2007 17:08 | 17K | |
![[SND]](/icons/sound2.gif) | schmedlap.mp3 | 20-Apr-2007 17:08 | 17K | |
![[SND]](/icons/sound2.gif) | schmeckel.mp3 | 20-Apr-2007 17:08 | 17K | |
![[SND]](/icons/sound2.gif) | schmeck.mp3 | 20-Apr-2007 17:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | schmear.mp3 | 20-Apr-2007 17:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | schmatte.mp3 | 20-Apr-2007 17:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | schmalz.mp3 | 20-Apr-2007 17:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | schmaltzy.mp3 | 20-Apr-2007 17:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | schmaltz.mp3 | 20-Apr-2007 17:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | schmalkalden.mp3 | 20-Apr-2007 17:08 | 17K | |
![[SND]](/icons/sound2.gif) | schmack.mp3 | 20-Apr-2007 17:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | schlump.mp3 | 20-Apr-2007 17:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | schlubette.mp3 | 20-Apr-2007 17:08 | 17K | |
![[SND]](/icons/sound2.gif) | schlub.mp3 | 20-Apr-2007 17:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | schloss.mp3 | 20-Apr-2007 17:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | schloomp.mp3 | 20-Apr-2007 17:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | schlontz.mp3 | 20-Apr-2007 17:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | schlong.mp3 | 20-Apr-2007 17:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | schlocky.mp3 | 20-Apr-2007 17:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | schlockmeister.mp3 | 20-Apr-2007 17:07 | 17K | |
![[SND]](/icons/sound2.gif) | schlock.mp3 | 20-Apr-2007 17:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | schlob.mp3 | 20-Apr-2007 17:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | schlimazel.mp3 | 20-Apr-2007 17:07 | 17K | |
![[SND]](/icons/sound2.gif) | schlieric.mp3 | 20-Apr-2007 17:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | schlieren.mp3 | 20-Apr-2007 17:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | schlieffen.mp3 | 20-Apr-2007 17:07 | 17K | |
![[SND]](/icons/sound2.gif) | schlick.mp3 | 20-Apr-2007 17:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | schley.mp3 | 20-Apr-2007 17:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | schlesien.mp3 | 20-Apr-2007 17:07 | 17K | |
![[SND]](/icons/sound2.gif) | schleppy.mp3 | 20-Apr-2007 17:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | schlepper.mp3 | 20-Apr-2007 17:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | schlepp.mp3 | 20-Apr-2007 17:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | schlep.mp3 | 20-Apr-2007 17:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | schlenter.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schlemiel.mp3 | 20-Apr-2007 17:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | schlemazel.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schleiden.mp3 | 20-Apr-2007 17:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | schlechts.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schlang.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schlag.mp3 | 20-Apr-2007 17:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | schlack.mp3 | 20-Apr-2007 17:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | schizzy.mp3 | 20-Apr-2007 17:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | schizzedout.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schizy.mp3 | 20-Apr-2007 17:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | schizotypalpersonality.mp3 | 20-Apr-2007 17:06 | 27K | |
![[SND]](/icons/sound2.gif) | schizothymia.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schizopod.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schizophyte.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schizophyceous.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schizophrenogenic.mp3 | 20-Apr-2007 17:06 | 17K | |
![[SND]](/icons/sound2.gif) | schizophrenically.mp3 | 20-Apr-2007 17:06 | 11K | |
![[SND]](/icons/sound2.gif) | schizophrenic.mp3 | 20-Apr-2007 17:06 | 10K | |
![[SND]](/icons/sound2.gif) | schizophrenia.mp3 | 20-Apr-2007 17:05 | 11K | |
![[SND]](/icons/sound2.gif) | schizophrene.mp3 | 20-Apr-2007 17:05 | 10K | |
![[SND]](/icons/sound2.gif) | schizont.mp3 | 20-Apr-2007 17:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | schizomycosis.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schizomycete.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schizoid.mp3 | 20-Apr-2007 17:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | schizogony.mp3 | 20-Apr-2007 17:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | schizogonous.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schizogonic.mp3 | 20-Apr-2007 17:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | schizogenous.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schizogenetic.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schizogenesis.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schizogamy.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schizocarp.mp3 | 20-Apr-2007 17:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | schizoaffectivedisorder.mp3 | 20-Apr-2007 17:05 | 18K | |
![[SND]](/icons/sound2.gif) | schizo.mp3 | 20-Apr-2007 17:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | schizanthus.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schiz.mp3 | 20-Apr-2007 17:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | schitzo.mp3 | 20-Apr-2007 17:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | schitizi.mp3 | 20-Apr-2007 17:05 | 17K | |
![[SND]](/icons/sound2.gif) | schistosomiasis.mp3 | 20-Apr-2007 17:05 | 14K | |
![[SND]](/icons/sound2.gif) | schistosomiases.mp3 | 20-Apr-2007 17:05 | 15K | |
![[SND]](/icons/sound2.gif) | schistosome.mp3 | 20-Apr-2007 17:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | schistosomal.mp3 | 20-Apr-2007 17:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | schistosity.mp3 | 20-Apr-2007 17:04 | 11K | |
![[SND]](/icons/sound2.gif) | schistosis.mp3 | 20-Apr-2007 17:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | schistose.mp3 | 20-Apr-2007 17:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | schist.mp3 | 20-Apr-2007 17:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | schismatize.mp3 | 20-Apr-2007 17:04 | 11K | |
![[SND]](/icons/sound2.gif) | schismatically.mp3 | 20-Apr-2007 17:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | schismatical.mp3 | 20-Apr-2007 17:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | schismatic.mp3 | 20-Apr-2007 17:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | schism.mp3 | 20-Apr-2007 17:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | schisgal.mp3 | 20-Apr-2007 17:04 | 17K | |
![[SND]](/icons/sound2.gif) | schippers.mp3 | 20-Apr-2007 17:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | schipperke.mp3 | 20-Apr-2007 17:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | schipa.mp3 | 20-Apr-2007 17:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | schilling.mp3 | 20-Apr-2007 17:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | schillerize.mp3 | 20-Apr-2007 17:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | schiller.mp3 | 20-Apr-2007 17:04 | 5.7K | |
![[SND]](/icons/sound2.gif) | schiffreagent.mp3 | 20-Apr-2007 17:04 | 17K | |
![[SND]](/icons/sound2.gif) | schiffli.mp3 | 20-Apr-2007 17:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | schiff.mp3 | 20-Apr-2007 17:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | schiele.mp3 | 20-Apr-2007 17:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | schicker.mp3 | 20-Apr-2007 17:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | scherzo.mp3 | 20-Apr-2007 17:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | scherzi.mp3 | 20-Apr-2007 17:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | scherzando.mp3 | 20-Apr-2007 17:03 | 11K | |
![[SND]](/icons/sound2.gif) | scherm.mp3 | 20-Apr-2007 17:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | scheria.mp3 | 20-Apr-2007 17:03 | 17K | |
![[SND]](/icons/sound2.gif) | schemozzle.mp3 | 20-Apr-2007 17:03 | 17K | |
![[SND]](/icons/sound2.gif) | scheming.mp3 | 20-Apr-2007 17:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | scheme.mp3 | 20-Apr-2007 17:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | schematize.mp3 | 20-Apr-2007 17:03 | 11K | |
![[SND]](/icons/sound2.gif) | schematization.mp3 | 20-Apr-2007 17:03 | 12K | |
![[SND]](/icons/sound2.gif) | schematism.mp3 | 20-Apr-2007 17:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | schematically.mp3 | 20-Apr-2007 17:03 | 9.8K | |
![[SND]](/icons/sound2.gif) | schematic.mp3 | 20-Apr-2007 17:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | schemata.mp3 | 20-Apr-2007 17:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | schema.mp3 | 20-Apr-2007 17:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | schelly.mp3 | 20-Apr-2007 17:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | scheize.mp3 | 20-Apr-2007 17:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | schefflera.mp3 | 20-Apr-2007 17:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | schefferite.mp3 | 20-Apr-2007 17:02 | 17K | |
![[SND]](/icons/sound2.gif) | scheelite.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | scheele.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | scheel.mp3 | 20-Apr-2007 17:02 | 17K | |
![[SND]](/icons/sound2.gif) | scheduledterritories.mp3 | 20-Apr-2007 17:02 | 17K | |
![[SND]](/icons/sound2.gif) | schedule.mp3 | 20-Apr-2007 17:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | schechter.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | schav.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | schaumburglippe.mp3 | 20-Apr-2007 17:02 | 17K | |
![[SND]](/icons/sound2.gif) | schaudinn.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | schatzi.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | schatchen.mp3 | 20-Apr-2007 17:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | scharwenka.mp3 | 20-Apr-2007 17:02 | 17K | |
![[SND]](/icons/sound2.gif) | schappe.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | schanzi.mp3 | 20-Apr-2007 17:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | schandband.mp3 | 20-Apr-2007 17:02 | 17K | |
![[SND]](/icons/sound2.gif) | schafskopf.mp3 | 20-Apr-2007 17:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | schaff.mp3 | 20-Apr-2007 17:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | schafermethod.mp3 | 20-Apr-2007 17:01 | 17K | |
![[SND]](/icons/sound2.gif) | schaerbeek.mp3 | 20-Apr-2007 17:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | schadenfreude.mp3 | 20-Apr-2007 17:01 | 9.8K | |
![[SND]](/icons/sound2.gif) | schaapsteker.mp3 | 20-Apr-2007 17:01 | 17K | |
![[SND]](/icons/sound2.gif) | sceptre.mp3 | 20-Apr-2007 17:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | scepticism.mp3 | 20-Apr-2007 17:01 | 17K | |
![[SND]](/icons/sound2.gif) | sceptical.mp3 | 20-Apr-2007 17:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | sceptic.mp3 | 20-Apr-2007 17:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | sceptering.mp3 | 20-Apr-2007 17:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | sceptered.mp3 | 20-Apr-2007 17:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | scepter.mp3 | 20-Apr-2007 17:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | scepsis.mp3 | 20-Apr-2007 17:01 | 17K | |
![[SND]](/icons/sound2.gif) | scentometer.mp3 | 20-Apr-2007 17:01 | 17K | |
![[SND]](/icons/sound2.gif) | scentless.mp3 | 20-Apr-2007 17:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | scentism.mp3 | 20-Apr-2007 17:01 | 17K | |
![[SND]](/icons/sound2.gif) | scented.mp3 | 20-Apr-2007 17:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | scent.mp3 | 20-Apr-2007 17:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | scenography.mp3 | 20-Apr-2007 17:01 | 10K | |
![[SND]](/icons/sound2.gif) | scenographic.mp3 | 20-Apr-2007 17:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | scenographer.mp3 | 20-Apr-2007 17:00 | 11K | |
![[SND]](/icons/sound2.gif) | scenograph.mp3 | 20-Apr-2007 17:00 | 17K | |
![[SND]](/icons/sound2.gif) | scenically.mp3 | 20-Apr-2007 17:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | scenical.mp3 | 20-Apr-2007 17:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | scenic.mp3 | 20-Apr-2007 17:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | sceneshifter.mp3 | 20-Apr-2007 17:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | scenery.mp3 | 20-Apr-2007 17:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | sceneman.mp3 | 20-Apr-2007 17:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | scene a faire.mp3 | 20-Apr-2007 17:00 | 10K | |
![[SND]](/icons/sound2.gif) | scene.mp3 | 20-Apr-2007 17:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | scene-stealer.mp3 | 20-Apr-2007 17:00 | 10K | |
![[SND]](/icons/sound2.gif) | scend.mp3 | 20-Apr-2007 17:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | scenarist.mp3 | 20-Apr-2007 17:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | scenario.mp3 | 20-Apr-2007 17:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | scena.mp3 | 20-Apr-2007 17:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | scelp.mp3 | 20-Apr-2007 17:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | sceat.mp3 | 20-Apr-2007 17:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | scazon.mp3 | 20-Apr-2007 17:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | scawtite.mp3 | 20-Apr-2007 17:00 | 17K | |
![[SND]](/icons/sound2.gif) | scavenger.mp3 | 20-Apr-2007 17:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | scavenge.mp3 | 20-Apr-2007 17:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | scaur.mp3 | 20-Apr-2007 17:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | scauper.mp3 | 20-Apr-2007 17:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | scaup.mp3 | 20-Apr-2007 16:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | scaud.mp3 | 20-Apr-2007 16:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | scaturient.mp3 | 20-Apr-2007 16:59 | 17K | |
![[SND]](/icons/sound2.gif) | scatty.mp3 | 20-Apr-2007 16:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | scattershot.mp3 | 20-Apr-2007 16:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | scatterometer.mp3 | 20-Apr-2007 16:59 | 17K | |
![[SND]](/icons/sound2.gif) | scatteringly.mp3 | 20-Apr-2007 16:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | scattering.mp3 | 20-Apr-2007 16:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | scattergun.mp3 | 20-Apr-2007 16:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | scattergram.mp3 | 20-Apr-2007 16:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | scattergood.mp3 | 20-Apr-2007 16:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | scatterer.mp3 | 20-Apr-2007 16:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | scattered.mp3 | 20-Apr-2007 16:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | scatterbrained.mp3 | 20-Apr-2007 16:59 | 10K | |
![[SND]](/icons/sound2.gif) | scatterbrain.mp3 | 20-Apr-2007 16:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | scatteration.mp3 | 20-Apr-2007 16:59 | 10K | |
![[SND]](/icons/sound2.gif) | scatter.mp3 | 20-Apr-2007 16:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | scatt.mp3 | 20-Apr-2007 16:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | scatoscopy.mp3 | 20-Apr-2007 16:59 | 17K | |
![[SND]](/icons/sound2.gif) | scatophagous.mp3 | 20-Apr-2007 16:59 | 17K | |
![[SND]](/icons/sound2.gif) | scatoma.mp3 | 20-Apr-2007 16:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | scatology.mp3 | 20-Apr-2007 16:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | scatological.mp3 | 20-Apr-2007 16:59 | 11K | |
![[SND]](/icons/sound2.gif) | scato.mp3 | 20-Apr-2007 16:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | scathing.mp3 | 20-Apr-2007 16:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | scatheless.mp3 | 20-Apr-2007 16:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | scathe.mp3 | 20-Apr-2007 16:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | scatback.mp3 | 20-Apr-2007 16:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | scat.mp3 | 20-Apr-2007 16:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | scary.mp3 | 20-Apr-2007 16:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | scarves.mp3 | 20-Apr-2007 16:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | scarus.mp3 | 20-Apr-2007 16:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | scart.mp3 | 20-Apr-2007 16:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | scarsdale.mp3 | 20-Apr-2007 16:15 | 17K | |
![[SND]](/icons/sound2.gif) | scarry.mp3 | 20-Apr-2007 16:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | scarph.mp3 | 20-Apr-2007 16:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | scarper.mp3 | 20-Apr-2007 16:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | scarpe.mp3 | 20-Apr-2007 16:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | scarp.mp3 | 20-Apr-2007 16:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | scarne.mp3 | 20-Apr-2007 16:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | scarlettohara.mp3 | 20-Apr-2007 16:14 | 17K | |
![[SND]](/icons/sound2.gif) | scarlet.mp3 | 20-Apr-2007 16:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | scarless.mp3 | 20-Apr-2007 16:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | scarlatinoid.mp3 | 20-Apr-2007 16:14 | 17K | |
![[SND]](/icons/sound2.gif) | scarlatinal.mp3 | 20-Apr-2007 16:14 | 10K | |
![[SND]](/icons/sound2.gif) | scarlatina.mp3 | 20-Apr-2007 16:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | scarious.mp3 | 20-Apr-2007 16:14 | 10K | |
![[SND]](/icons/sound2.gif) | scarily.mp3 | 20-Apr-2007 16:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | scarifyingly.mp3 | 20-Apr-2007 16:14 | 12K | |
![[SND]](/icons/sound2.gif) | scarify.mp3 | 20-Apr-2007 16:14 | 9.3K | |
![[SND]](/icons/sound2.gif) | scarifier.mp3 | 20-Apr-2007 16:14 | 10K | |
![[SND]](/icons/sound2.gif) | scarificator.mp3 | 20-Apr-2007 16:14 | 17K | |
![[SND]](/icons/sound2.gif) | scarification.mp3 | 20-Apr-2007 16:14 | 12K | |
![[SND]](/icons/sound2.gif) | scargill.mp3 | 20-Apr-2007 16:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | scarfskin.mp3 | 20-Apr-2007 16:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | scarfpin.mp3 | 20-Apr-2007 16:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | scarfe.mp3 | 20-Apr-2007 16:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | scarf.mp3 | 20-Apr-2007 16:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | scarey.mp3 | 20-Apr-2007 16:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | scaremongering.mp3 | 20-Apr-2007 16:13 | 11K | |
![[SND]](/icons/sound2.gif) | scaremonger.mp3 | 20-Apr-2007 16:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | scarehead.mp3 | 20-Apr-2007 16:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | scaredycat.mp3 | 20-Apr-2007 16:13 | 17K | |
![[SND]](/icons/sound2.gif) | scaredy-cat.mp3 | 20-Apr-2007 16:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | scared.mp3 | 20-Apr-2007 16:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | scarecrow.mp3 | 20-Apr-2007 16:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | scare.mp3 | 20-Apr-2007 16:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | scarcity.mp3 | 20-Apr-2007 16:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | scarcement.mp3 | 20-Apr-2007 16:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | scarcely.mp3 | 20-Apr-2007 16:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | scarce.mp3 | 20-Apr-2007 16:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | scaramouche.mp3 | 20-Apr-2007 16:13 | 9.6K | |
![[SND]](/icons/sound2.gif) | scaramouch.mp3 | 20-Apr-2007 16:13 | 9.6K | |
![[SND]](/icons/sound2.gif) | scaraboid.mp3 | 20-Apr-2007 16:13 | 17K | |
![[SND]](/icons/sound2.gif) | scarabaeus.mp3 | 20-Apr-2007 16:13 | 11K | |
![[SND]](/icons/sound2.gif) | scarabaeoid.mp3 | 20-Apr-2007 16:13 | 17K | |
![[SND]](/icons/sound2.gif) | scarabaeid.mp3 | 20-Apr-2007 16:13 | 17K | |
![[SND]](/icons/sound2.gif) | scarab.mp3 | 20-Apr-2007 16:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | scar.mp3 | 20-Apr-2007 16:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | scapulo.mp3 | 20-Apr-2007 16:13 | 17K | |
![[SND]](/icons/sound2.gif) | scapulimancy.mp3 | 20-Apr-2007 16:12 | 17K | |
![[SND]](/icons/sound2.gif) | scapulary.mp3 | 20-Apr-2007 16:12 | 17K | |
![[SND]](/icons/sound2.gif) | scapular.mp3 | 20-Apr-2007 16:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | scapulae.mp3 | 20-Apr-2007 16:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | scapula.mp3 | 20-Apr-2007 16:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | scapul.mp3 | 20-Apr-2007 16:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | scapose.mp3 | 20-Apr-2007 16:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | scapolite.mp3 | 20-Apr-2007 16:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | scapin.mp3 | 20-Apr-2007 16:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | scapiform.mp3 | 20-Apr-2007 16:12 | 17K | |
![[SND]](/icons/sound2.gif) | scaphopod.mp3 | 20-Apr-2007 16:12 | 17K | |
![[SND]](/icons/sound2.gif) | scaphoid.mp3 | 20-Apr-2007 16:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | scaphocephaly.mp3 | 20-Apr-2007 16:12 | 17K | |
![[SND]](/icons/sound2.gif) | scapho.mp3 | 20-Apr-2007 16:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | scapegrace.mp3 | 20-Apr-2007 16:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | scapegoatism.mp3 | 20-Apr-2007 16:12 | 10K | |
![[SND]](/icons/sound2.gif) | scapegoat.mp3 | 20-Apr-2007 16:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | scape.mp3 | 20-Apr-2007 16:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | scapaflow.mp3 | 20-Apr-2007 16:12 | 17K | |
![[SND]](/icons/sound2.gif) | scapa.mp3 | 20-Apr-2007 16:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | scap.mp3 | 20-Apr-2007 16:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | scanty.mp3 | 20-Apr-2007 16:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | scantling.mp3 | 20-Apr-2007 16:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | scantle.mp3 | 20-Apr-2007 16:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | scantiness.mp3 | 20-Apr-2007 16:11 | 10K | |
![[SND]](/icons/sound2.gif) | scantily.mp3 | 20-Apr-2007 16:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | scanties.mp3 | 20-Apr-2007 16:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | scant.mp3 | 20-Apr-2007 16:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | scansorial.mp3 | 20-Apr-2007 16:11 | 17K | |
![[SND]](/icons/sound2.gif) | scansion.mp3 | 20-Apr-2007 16:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | scanning.mp3 | 20-Apr-2007 16:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | scanner.mp3 | 20-Apr-2007 16:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | scannable.mp3 | 20-Apr-2007 16:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | scank.mp3 | 20-Apr-2007 16:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | scania.mp3 | 20-Apr-2007 16:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | scandium.mp3 | 20-Apr-2007 16:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | scandinoovian.mp3 | 20-Apr-2007 16:11 | 17K | |
![[SND]](/icons/sound2.gif) | scandihoovian.mp3 | 20-Apr-2007 16:11 | 17K | |
![[SND]](/icons/sound2.gif) | scandic.mp3 | 20-Apr-2007 16:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | scandia.mp3 | 20-Apr-2007 16:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | scandent.mp3 | 20-Apr-2007 16:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | scandaroon.mp3 | 20-Apr-2007 16:11 | 17K | |
![[SND]](/icons/sound2.gif) | scandalummagnatum.mp3 | 20-Apr-2007 16:11 | 18K | |
![[SND]](/icons/sound2.gif) | scandalous.mp3 | 20-Apr-2007 16:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | scandalmongering.mp3 | 20-Apr-2007 16:10 | 12K | |
![[SND]](/icons/sound2.gif) | scandalmonger.mp3 | 20-Apr-2007 16:10 | 11K | |
![[SND]](/icons/sound2.gif) | scandalize.mp3 | 20-Apr-2007 16:10 | 11K | |
![[SND]](/icons/sound2.gif) | scandal.mp3 | 20-Apr-2007 16:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | scandahoovian.mp3 | 20-Apr-2007 16:10 | 17K | |
![[SND]](/icons/sound2.gif) | scan.mp3 | 20-Apr-2007 16:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | scamster.mp3 | 20-Apr-2007 16:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | scampish.mp3 | 20-Apr-2007 16:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | scampi.mp3 | 20-Apr-2007 16:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | scampering.mp3 | 20-Apr-2007 16:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | scamper.mp3 | 20-Apr-2007 16:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | scamp.mp3 | 20-Apr-2007 16:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | scammony.mp3 | 20-Apr-2007 16:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | scammered.mp3 | 20-Apr-2007 16:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | scammer.mp3 | 20-Apr-2007 16:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | scamillus.mp3 | 20-Apr-2007 16:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | scamandrius.mp3 | 20-Apr-2007 16:10 | 27K | |
![[SND]](/icons/sound2.gif) | scam.mp3 | 20-Apr-2007 16:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | scaly.mp3 | 20-Apr-2007 16:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | scalpriform.mp3 | 20-Apr-2007 16:10 | 17K | |
![[SND]](/icons/sound2.gif) | scalping.mp3 | 20-Apr-2007 16:10 | 17K | |
![[SND]](/icons/sound2.gif) | scalper.mp3 | 20-Apr-2007 16:10 | 17K | |
![[SND]](/icons/sound2.gif) | scalpel.mp3 | 20-Apr-2007 16:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | scalp.mp3 | 20-Apr-2007 16:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | scaloppine.mp3 | 20-Apr-2007 16:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | scalogram.mp3 | 20-Apr-2007 16:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | scallywag.mp3 | 20-Apr-2007 16:09 | 17K | |
![[SND]](/icons/sound2.gif) | scally.mp3 | 20-Apr-2007 16:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | scallopini.mp3 | 20-Apr-2007 16:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | scalloping.mp3 | 20-Apr-2007 16:09 | 17K | |
![[SND]](/icons/sound2.gif) | scalloper.mp3 | 20-Apr-2007 16:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | scallop.mp3 | 20-Apr-2007 16:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | scallion.mp3 | 20-Apr-2007 16:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | scalled.mp3 | 20-Apr-2007 16:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | scallawag.mp3 | 20-Apr-2007 16:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | scall.mp3 | 20-Apr-2007 16:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | scaling.mp3 | 20-Apr-2007 16:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | scaler.mp3 | 20-Apr-2007 16:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | scalenus.mp3 | 20-Apr-2007 16:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | scalenohedron.mp3 | 20-Apr-2007 16:09 | 17K | |
![[SND]](/icons/sound2.gif) | scalene.mp3 | 20-Apr-2007 16:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | scalelike.mp3 | 20-Apr-2007 16:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | scaleless.mp3 | 20-Apr-2007 16:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | scaled.mp3 | 20-Apr-2007 16:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | scale.mp3 | 20-Apr-2007 16:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | scale-up.mp3 | 20-Apr-2007 16:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | scale-down.mp3 | 20-Apr-2007 16:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | scalding.mp3 | 20-Apr-2007 16:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | scaldfish.mp3 | 20-Apr-2007 16:08 | 17K | |
![[SND]](/icons/sound2.gif) | scalder.mp3 | 20-Apr-2007 16:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | scald.mp3 | 20-Apr-2007 16:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | scalawag.mp3 | 20-Apr-2007 16:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | scalation.mp3 | 20-Apr-2007 16:08 | 17K | |
![[SND]](/icons/sound2.gif) | scalariform.mp3 | 20-Apr-2007 16:08 | 11K | |
![[SND]](/icons/sound2.gif) | scalare.mp3 | 20-Apr-2007 16:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | scalar.mp3 | 20-Apr-2007 16:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | scalage.mp3 | 20-Apr-2007 16:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | scalado.mp3 | 20-Apr-2007 16:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | scalade.mp3 | 20-Apr-2007 16:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | scalacordonata.mp3 | 20-Apr-2007 16:08 | 17K | |
![[SND]](/icons/sound2.gif) | scalable.mp3 | 20-Apr-2007 16:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | scalability.mp3 | 20-Apr-2007 16:08 | 11K | |
![[SND]](/icons/sound2.gif) | scala.mp3 | 20-Apr-2007 16:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | scairdycat.mp3 | 20-Apr-2007 16:08 | 17K | |
![[SND]](/icons/sound2.gif) | scagliola.mp3 | 20-Apr-2007 16:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | scag.mp3 | 20-Apr-2007 16:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | scaffolding.mp3 | 20-Apr-2007 16:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | scaffoldage.mp3 | 20-Apr-2007 16:08 | 17K | |
![[SND]](/icons/sound2.gif) | scaffold.mp3 | 20-Apr-2007 16:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | scaffle.mp3 | 20-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | scafellpike.mp3 | 20-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | scaf.mp3 | 20-Apr-2007 16:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | scaevola.mp3 | 20-Apr-2007 16:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | scad.mp3 | 20-Apr-2007 16:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | scabrous.mp3 | 20-Apr-2007 16:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | scabrid.mp3 | 20-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | scabland.mp3 | 20-Apr-2007 16:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | scabious.mp3 | 20-Apr-2007 16:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | scabiosa.mp3 | 20-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | scabietic.mp3 | 20-Apr-2007 16:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | scabies.mp3 | 20-Apr-2007 16:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | scabicide.mp3 | 20-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | scabby.mp3 | 20-Apr-2007 16:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | scabble.mp3 | 20-Apr-2007 16:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | scabbed.mp3 | 20-Apr-2007 16:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | scabbard.mp3 | 20-Apr-2007 16:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | scab.mp3 | 20-Apr-2007 16:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | sbrinz.mp3 | 20-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | sblood.mp3 | 20-Apr-2007 16:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | sbarro.mp3 | 20-Apr-2007 16:07 | 17K | |
![[SND]](/icons/sound2.gif) | sazerac.mp3 | 20-Apr-2007 16:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | sayyid.mp3 | 20-Apr-2007 16:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | sayslaw.mp3 | 20-Apr-2007 16:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | says.mp3 | 20-Apr-2007 16:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | sayonara.mp3 | 20-Apr-2007 16:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | saying.mp3 | 20-Apr-2007 16:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | sayest.mp3 | 20-Apr-2007 16:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | sayer.mp3 | 20-Apr-2007 16:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | sayem.mp3 | 20-Apr-2007 16:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sayee.mp3 | 20-Apr-2007 16:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sayboltuniversalseconds.mp3 | 20-Apr-2007 16:06 | 27K | |
![[SND]](/icons/sound2.gif) | sayao.mp3 | 20-Apr-2007 16:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | sayanmountains.mp3 | 20-Apr-2007 16:06 | 17K | |
![[SND]](/icons/sound2.gif) | sayable.mp3 | 20-Apr-2007 16:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | say.mp3 | 20-Apr-2007 16:06 | 6.6K | |
![[SND]](/icons/sound2.gif) | say-so.mp3 | 20-Apr-2007 16:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | saxtuba.mp3 | 20-Apr-2007 16:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | saxophonist.mp3 | 20-Apr-2007 16:06 | 11K | |
![[SND]](/icons/sound2.gif) | saxophonic.mp3 | 20-Apr-2007 16:06 | 10K | |
![[SND]](/icons/sound2.gif) | saxophone.mp3 | 20-Apr-2007 16:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | saxonyanhalt.mp3 | 20-Apr-2007 16:05 | 18K | |
![[SND]](/icons/sound2.gif) | saxonize.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxonist.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxonism.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxogrammaticus.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxitoxin.mp3 | 20-Apr-2007 16:05 | 11K | |
![[SND]](/icons/sound2.gif) | saxist.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxifrax.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxifrage.mp3 | 20-Apr-2007 16:05 | 11K | |
![[SND]](/icons/sound2.gif) | saxifragaceous.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxicolous.mp3 | 20-Apr-2007 16:05 | 11K | |
![[SND]](/icons/sound2.gif) | saxicoline.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxhorn.mp3 | 20-Apr-2007 16:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | saxeweimareisenach.mp3 | 20-Apr-2007 16:05 | 27K | |
![[SND]](/icons/sound2.gif) | saxemeiningen.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxecoburggotha.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxealtenburg.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | saxatile.mp3 | 20-Apr-2007 16:05 | 17K | |
![[SND]](/icons/sound2.gif) | sax.mp3 | 20-Apr-2007 16:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | sawyer.mp3 | 20-Apr-2007 16:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | sawtooth.mp3 | 20-Apr-2007 16:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | sawtimber.mp3 | 20-Apr-2007 16:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | sawney.mp3 | 20-Apr-2007 16:04 | 17K | |
![[SND]](/icons/sound2.gif) | sawn.mp3 | 20-Apr-2007 16:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | sawmill.mp3 | 20-Apr-2007 16:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | sawm.mp3 | 20-Apr-2007 16:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | sawlog.mp3 | 20-Apr-2007 16:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | sawlike.mp3 | 20-Apr-2007 16:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | sawing.mp3 | 20-Apr-2007 16:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | sawhorse.mp3 | 20-Apr-2007 16:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | sawfly.mp3 | 20-Apr-2007 16:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | sawfish.mp3 | 20-Apr-2007 16:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | sawer.mp3 | 20-Apr-2007 16:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | sawed.mp3 | 20-Apr-2007 16:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | sawed-off.mp3 | 20-Apr-2007 16:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | sawdust.mp3 | 20-Apr-2007 16:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | sawder.mp3 | 20-Apr-2007 16:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | sawbuck.mp3 | 20-Apr-2007 16:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | sawbones.mp3 | 20-Apr-2007 16:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | sawatch.mp3 | 20-Apr-2007 16:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | sawan.mp3 | 20-Apr-2007 16:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | sawallisch.mp3 | 20-Apr-2007 16:03 | 17K | |
![[SND]](/icons/sound2.gif) | saw.mp3 | 20-Apr-2007 16:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | saw-whet owl.mp3 | 20-Apr-2007 16:04 | 12K | |
![[SND]](/icons/sound2.gif) | saw-toothed.mp3 | 20-Apr-2007 16:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | savvy.mp3 | 20-Apr-2007 16:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | savoy cabbage.mp3 | 20-Apr-2007 16:03 | 13K | |
![[SND]](/icons/sound2.gif) | savoury.mp3 | 20-Apr-2007 16:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | savour.mp3 | 20-Apr-2007 16:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | savory.mp3 | 20-Apr-2007 16:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | savorous.mp3 | 20-Apr-2007 16:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | savorless.mp3 | 20-Apr-2007 16:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | savoring.mp3 | 20-Apr-2007 16:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | savoriness.mp3 | 20-Apr-2007 16:03 | 11K | |
![[SND]](/icons/sound2.gif) | savorily.mp3 | 20-Apr-2007 16:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | savorer.mp3 | 20-Apr-2007 16:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | savor.mp3 | 20-Apr-2007 16:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | savoirvivre.mp3 | 20-Apr-2007 16:03 | 17K | |
![[SND]](/icons/sound2.gif) | savoirfaire.mp3 | 20-Apr-2007 16:03 | 17K | |
![[SND]](/icons/sound2.gif) | savoir faire.mp3 | 20-Apr-2007 16:03 | 12K | |
![[SND]](/icons/sound2.gif) | savitskaya.mp3 | 20-Apr-2007 16:02 | 17K | |
![[SND]](/icons/sound2.gif) | saviour.mp3 | 20-Apr-2007 16:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | savior.mp3 | 20-Apr-2007 16:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | saving.mp3 | 20-Apr-2007 16:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | savin.mp3 | 20-Apr-2007 16:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | savilerow.mp3 | 20-Apr-2007 16:02 | 17K | |
![[SND]](/icons/sound2.gif) | savile.mp3 | 20-Apr-2007 16:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | savigny.mp3 | 20-Apr-2007 16:02 | 17K | |
![[SND]](/icons/sound2.gif) | savery.mp3 | 20-Apr-2007 16:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | saveloy.mp3 | 20-Apr-2007 16:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | saveable.mp3 | 20-Apr-2007 16:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | save.mp3 | 20-Apr-2007 16:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | save-all.mp3 | 20-Apr-2007 16:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | savate.mp3 | 20-Apr-2007 16:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | savarin.mp3 | 20-Apr-2007 16:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | savant.mp3 | 20-Apr-2007 16:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | savannah.mp3 | 20-Apr-2007 16:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | savanna.mp3 | 20-Apr-2007 16:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | savama.mp3 | 20-Apr-2007 16:02 | 17K | |
![[SND]](/icons/sound2.gif) | savalas.mp3 | 20-Apr-2007 16:02 | 17K | |
![[SND]](/icons/sound2.gif) | savak.mp3 | 20-Apr-2007 16:02 | 17K | |
![[SND]](/icons/sound2.gif) | savagism.mp3 | 20-Apr-2007 16:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | savagery.mp3 | 20-Apr-2007 16:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | savagedom.mp3 | 20-Apr-2007 16:01 | 17K | |
![[SND]](/icons/sound2.gif) | savage.mp3 | 20-Apr-2007 16:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | sav.mp3 | 20-Apr-2007 16:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | sauza.mp3 | 20-Apr-2007 16:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | sauvignonblanc.mp3 | 20-Apr-2007 16:01 | 17K | |
![[SND]](/icons/sound2.gif) | sauvignon blanc.mp3 | 20-Apr-2007 16:01 | 13K | |
![[SND]](/icons/sound2.gif) | sauvignon.mp3 | 20-Apr-2007 16:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | sauvequipeut.mp3 | 20-Apr-2007 16:01 | 17K | |
![[SND]](/icons/sound2.gif) | sautoir.mp3 | 20-Apr-2007 16:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | sautille.mp3 | 20-Apr-2007 16:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | sauternes.mp3 | 20-Apr-2007 16:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | sauterne.mp3 | 20-Apr-2007 16:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | saute.mp3 | 20-Apr-2007 16:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | sautdebasque.mp3 | 20-Apr-2007 16:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | saut.mp3 | 20-Apr-2007 16:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | saussurite.mp3 | 20-Apr-2007 16:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | saussurean.mp3 | 20-Apr-2007 16:01 | 17K | |
![[SND]](/icons/sound2.gif) | sausalito.mp3 | 20-Apr-2007 16:01 | 17K | |
![[SND]](/icons/sound2.gif) | sausage.mp3 | 20-Apr-2007 16:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | saury.mp3 | 20-Apr-2007 16:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | saurus.mp3 | 20-Apr-2007 16:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | saururaceous.mp3 | 20-Apr-2007 16:00 | 17K | |
![[SND]](/icons/sound2.gif) | sauropod.mp3 | 20-Apr-2007 16:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | sauro.mp3 | 20-Apr-2007 16:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | saurischian.mp3 | 20-Apr-2007 16:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | saurian.mp3 | 20-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | saurel.mp3 | 20-Apr-2007 16:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | saur.mp3 | 20-Apr-2007 16:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | saunterer.mp3 | 20-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | saunter.mp3 | 20-Apr-2007 16:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | saundra.mp3 | 20-Apr-2007 16:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sauncy.mp3 | 20-Apr-2007 16:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sauna.mp3 | 20-Apr-2007 16:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | saumon.mp3 | 20-Apr-2007 16:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | saum.mp3 | 20-Apr-2007 16:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | saultstemarie.mp3 | 20-Apr-2007 16:00 | 17K | |
![[SND]](/icons/sound2.gif) | saulteaux.mp3 | 20-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | sault.mp3 | 20-Apr-2007 16:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | saugh.mp3 | 20-Apr-2007 15:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | sauger.mp3 | 20-Apr-2007 15:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | sauerkraut.mp3 | 20-Apr-2007 15:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | sauerbraten.mp3 | 20-Apr-2007 15:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | saudia.mp3 | 20-Apr-2007 15:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | saudi.mp3 | 20-Apr-2007 15:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | saucy.mp3 | 20-Apr-2007 15:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | saucisson.mp3 | 20-Apr-2007 15:59 | 17K | |
![[SND]](/icons/sound2.gif) | sauciness.mp3 | 20-Apr-2007 15:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | saucily.mp3 | 20-Apr-2007 15:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | saucier.mp3 | 20-Apr-2007 15:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | sauch.mp3 | 20-Apr-2007 15:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | saucesupreme.mp3 | 20-Apr-2007 15:59 | 17K | |
![[SND]](/icons/sound2.gif) | saucerman.mp3 | 20-Apr-2007 15:59 | 17K | |
![[SND]](/icons/sound2.gif) | saucerlike.mp3 | 20-Apr-2007 15:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | saucerful.mp3 | 20-Apr-2007 15:59 | 17K | |
![[SND]](/icons/sound2.gif) | saucer.mp3 | 20-Apr-2007 15:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | saucepan.mp3 | 20-Apr-2007 15:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | sauceespagnole.mp3 | 20-Apr-2007 15:59 | 17K | |
![[SND]](/icons/sound2.gif) | sauced.mp3 | 20-Apr-2007 15:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | saucebox.mp3 | 20-Apr-2007 15:59 | 10K | |
![[SND]](/icons/sound2.gif) | sauceboat.mp3 | 20-Apr-2007 15:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | saucebercy.mp3 | 20-Apr-2007 15:58 | 17K | |
![[SND]](/icons/sound2.gif) | sauceamericaine.mp3 | 20-Apr-2007 15:58 | 17K | |
![[SND]](/icons/sound2.gif) | sauce.mp3 | 20-Apr-2007 15:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | sau.mp3 | 20-Apr-2007 15:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | satyromaniac.mp3 | 20-Apr-2007 15:58 | 17K | |
![[SND]](/icons/sound2.gif) | satyrid.mp3 | 20-Apr-2007 15:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | satyricon.mp3 | 20-Apr-2007 15:58 | 17K | |
![[SND]](/icons/sound2.gif) | satyric.mp3 | 20-Apr-2007 15:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | satyriasis.mp3 | 20-Apr-2007 15:58 | 12K | |
![[SND]](/icons/sound2.gif) | satyr.mp3 | 20-Apr-2007 15:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | satyayuga.mp3 | 20-Apr-2007 15:58 | 17K | |
![[SND]](/icons/sound2.gif) | satyaloka.mp3 | 20-Apr-2007 15:58 | 17K | |
![[SND]](/icons/sound2.gif) | satyagraha.mp3 | 20-Apr-2007 15:58 | 10K | |
![[SND]](/icons/sound2.gif) | saturnism.mp3 | 20-Apr-2007 15:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | saturnine.mp3 | 20-Apr-2007 15:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | saturniid.mp3 | 20-Apr-2007 15:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | saturnic.mp3 | 20-Apr-2007 15:58 | 17K | |
![[SND]](/icons/sound2.gif) | saturnalian.mp3 | 20-Apr-2007 15:58 | 10K | |
![[SND]](/icons/sound2.gif) | saturnalia.mp3 | 20-Apr-2007 15:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | saturator.mp3 | 20-Apr-2007 15:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | saturation.mp3 | 20-Apr-2007 15:57 | 10K | |
![[SND]](/icons/sound2.gif) | saturater.mp3 | 20-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | saturated.mp3 | 20-Apr-2007 15:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | saturate.mp3 | 20-Apr-2007 15:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | saturant.mp3 | 20-Apr-2007 15:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | saturable.mp3 | 20-Apr-2007 15:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | satumare.mp3 | 20-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | sattvic.mp3 | 20-Apr-2007 15:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | sattva.mp3 | 20-Apr-2007 15:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | sattar.mp3 | 20-Apr-2007 15:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | satsuma.mp3 | 20-Apr-2007 15:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | satsang.mp3 | 20-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | satrapy.mp3 | 20-Apr-2007 15:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | satrap.mp3 | 20-Apr-2007 15:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | satrangi.mp3 | 20-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | satpurarange.mp3 | 20-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | satow.mp3 | 20-Apr-2007 15:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | satori.mp3 | 20-Apr-2007 15:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | satnav.mp3 | 20-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | sativa.mp3 | 20-Apr-2007 15:57 | 17K | |
![[SND]](/icons/sound2.gif) | satisfyingly.mp3 | 20-Apr-2007 15:57 | 11K | |
![[SND]](/icons/sound2.gif) | satisfying.mp3 | 20-Apr-2007 15:56 | 17K | |
![[SND]](/icons/sound2.gif) | satisfy.mp3 | 20-Apr-2007 15:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | satisfied.mp3 | 20-Apr-2007 15:56 | 17K | |
![[SND]](/icons/sound2.gif) | satisfice.mp3 | 20-Apr-2007 15:56 | 17K | |
![[SND]](/icons/sound2.gif) | satisfiable.mp3 | 20-Apr-2007 15:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | satisfactory.mp3 | 20-Apr-2007 15:56 | 11K | |
![[SND]](/icons/sound2.gif) | satisfactorily.mp3 | 20-Apr-2007 15:56 | 12K | |
![[SND]](/icons/sound2.gif) | satisfaction.mp3 | 20-Apr-2007 15:56 | 11K | |
![[SND]](/icons/sound2.gif) | satirize.mp3 | 20-Apr-2007 15:56 | 9.8K | |
![[SND]](/icons/sound2.gif) | satirizable.mp3 | 20-Apr-2007 15:56 | 10K | |
![[SND]](/icons/sound2.gif) | satirist.mp3 | 20-Apr-2007 15:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | satirically.mp3 | 20-Apr-2007 15:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | satirical.mp3 | 20-Apr-2007 15:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | satiric.mp3 | 20-Apr-2007 15:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | satire.mp3 | 20-Apr-2007 15:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | satiny.mp3 | 20-Apr-2007 15:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | satinwood.mp3 | 20-Apr-2007 15:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | satinet.mp3 | 20-Apr-2007 15:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | satin.mp3 | 20-Apr-2007 15:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | satiety.mp3 | 20-Apr-2007 15:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | saticon.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | satiation.mp3 | 20-Apr-2007 15:55 | 10K | |
![[SND]](/icons/sound2.gif) | satiated.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | satiate.mp3 | 20-Apr-2007 15:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | satiable.mp3 | 20-Apr-2007 15:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | sati.mp3 | 20-Apr-2007 15:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | satem.mp3 | 20-Apr-2007 15:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | satelloid.mp3 | 20-Apr-2007 15:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | satellization.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | satellitium.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | satellite.mp3 | 20-Apr-2007 15:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | sateless.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | sateen.mp3 | 20-Apr-2007 15:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | sate.mp3 | 20-Apr-2007 15:55 | 5.5K | |
![[SND]](/icons/sound2.gif) | satcom.mp3 | 20-Apr-2007 15:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | satcitananda.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | satchmo.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | satchelful.mp3 | 20-Apr-2007 15:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | satchel.mp3 | 20-Apr-2007 15:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | satch.mp3 | 20-Apr-2007 15:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | satay.mp3 | 20-Apr-2007 15:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | satanology.mp3 | 20-Apr-2007 15:55 | 17K | |
![[SND]](/icons/sound2.gif) | satanist.mp3 | 20-Apr-2007 15:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | satanism.mp3 | 20-Apr-2007 15:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | satanically.mp3 | 20-Apr-2007 15:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | satanic.mp3 | 20-Apr-2007 15:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | satang.mp3 | 20-Apr-2007 15:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | satai.mp3 | 20-Apr-2007 15:54 | 17K | |
![[SND]](/icons/sound2.gif) | sat.mp3 | 20-Apr-2007 15:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | sastrugi.mp3 | 20-Apr-2007 15:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | sastruga.mp3 | 20-Apr-2007 15:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | sastra.mp3 | 20-Apr-2007 15:54 | 17K | |
![[SND]](/icons/sound2.gif) | sassy.mp3 | 20-Apr-2007 15:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | sassetta.mp3 | 20-Apr-2007 15:54 | 17K | |
![[SND]](/icons/sound2.gif) | sassenach.mp3 | 20-Apr-2007 15:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | sassatie.mp3 | 20-Apr-2007 15:54 | 17K | |
![[SND]](/icons/sound2.gif) | sassafras.mp3 | 20-Apr-2007 15:54 | 10K | |
![[SND]](/icons/sound2.gif) | sassaby.mp3 | 20-Apr-2007 15:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | sass.mp3 | 20-Apr-2007 15:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | saskatoon.mp3 | 20-Apr-2007 15:54 | 11K | |
![[SND]](/icons/sound2.gif) | sasine.mp3 | 20-Apr-2007 15:53 | 17K | |
![[SND]](/icons/sound2.gif) | sasin.mp3 | 20-Apr-2007 15:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | sashimi.mp3 | 20-Apr-2007 15:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | sashed.mp3 | 20-Apr-2007 15:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | sashay.mp3 | 20-Apr-2007 15:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | sasha.mp3 | 20-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | sash.mp3 | 20-Apr-2007 15:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | sas.mp3 | 20-Apr-2007 15:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarvodaya.mp3 | 20-Apr-2007 15:53 | 17K | |
![[SND]](/icons/sound2.gif) | saruscrane.mp3 | 20-Apr-2007 15:53 | 17K | |
![[SND]](/icons/sound2.gif) | saruk.mp3 | 20-Apr-2007 15:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | sartorius.mp3 | 20-Apr-2007 15:53 | 11K | |
![[SND]](/icons/sound2.gif) | sartorii.mp3 | 20-Apr-2007 15:53 | 10K | |
![[SND]](/icons/sound2.gif) | sartorially.mp3 | 20-Apr-2007 15:53 | 10K | |
![[SND]](/icons/sound2.gif) | sartorial.mp3 | 20-Apr-2007 15:53 | 10K | |
![[SND]](/icons/sound2.gif) | sartor.mp3 | 20-Apr-2007 15:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | sarton.mp3 | 20-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sarto.mp3 | 20-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sarsenet.mp3 | 20-Apr-2007 15:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | sarsen.mp3 | 20-Apr-2007 15:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | sarsat.mp3 | 20-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | sarsaparilla.mp3 | 20-Apr-2007 15:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | sarrusophone.mp3 | 20-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | sarrazin.mp3 | 20-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | sarraute.mp3 | 20-Apr-2007 15:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | sarraceniaceous.mp3 | 20-Apr-2007 15:52 | 18K | |
![[SND]](/icons/sound2.gif) | sarracenia.mp3 | 20-Apr-2007 15:52 | 11K | |
![[SND]](/icons/sound2.gif) | sarplar.mp3 | 20-Apr-2007 15:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | sarpi.mp3 | 20-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | sarpanch.mp3 | 20-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | sarouk.mp3 | 20-Apr-2007 15:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | saros.mp3 | 20-Apr-2007 15:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | saronicgulf.mp3 | 20-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | sarong.mp3 | 20-Apr-2007 15:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | saron.mp3 | 20-Apr-2007 15:52 | 17K | |
![[SND]](/icons/sound2.gif) | sarodist.mp3 | 20-Apr-2007 15:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | sarode.mp3 | 20-Apr-2007 15:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarod.mp3 | 20-Apr-2007 15:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarnie.mp3 | 20-Apr-2007 15:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sarnen.mp3 | 20-Apr-2007 15:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sarnath.mp3 | 20-Apr-2007 15:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | sarmiento.mp3 | 20-Apr-2007 15:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | sarmentum.mp3 | 20-Apr-2007 15:51 | 17K | |
![[SND]](/icons/sound2.gif) | sarmentose.mp3 | 20-Apr-2007 15:51 | 17K | |
![[SND]](/icons/sound2.gif) | sarky.mp3 | 20-Apr-2007 15:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarking.mp3 | 20-Apr-2007 15:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarka.mp3 | 20-Apr-2007 15:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sark.mp3 | 20-Apr-2007 15:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | saritthanarat.mp3 | 20-Apr-2007 15:51 | 17K | |
![[SND]](/icons/sound2.gif) | saris.mp3 | 20-Apr-2007 15:51 | 17K | |
![[SND]](/icons/sound2.gif) | sarin.mp3 | 20-Apr-2007 15:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | sari.mp3 | 20-Apr-2007 15:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | sargon.mp3 | 20-Apr-2007 15:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | sargodha.mp3 | 20-Apr-2007 15:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | sargo.mp3 | 20-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | sargeson.mp3 | 20-Apr-2007 15:50 | 17K | |
![[SND]](/icons/sound2.gif) | sarge.mp3 | 20-Apr-2007 15:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | sargassum.mp3 | 20-Apr-2007 15:50 | 9.8K | |
![[SND]](/icons/sound2.gif) | sargasso.mp3 | 20-Apr-2007 15:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | sarg.mp3 | 20-Apr-2007 15:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sarerabay.mp3 | 20-Apr-2007 15:50 | 17K | |
![[SND]](/icons/sound2.gif) | saree.mp3 | 20-Apr-2007 15:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | sardonyx.mp3 | 20-Apr-2007 15:50 | 10K | |
![[SND]](/icons/sound2.gif) | sardonicism.mp3 | 20-Apr-2007 15:50 | 11K | |
![[SND]](/icons/sound2.gif) | sardonically.mp3 | 20-Apr-2007 15:50 | 10K | |
![[SND]](/icons/sound2.gif) | sardonic.mp3 | 20-Apr-2007 15:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | sardius.mp3 | 20-Apr-2007 15:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sardine.mp3 | 20-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | sardelle.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sardar.mp3 | 20-Apr-2007 15:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sardanapalus.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sardanapalian.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sardana.mp3 | 20-Apr-2007 15:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | sard.mp3 | 20-Apr-2007 15:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | sarcous.mp3 | 20-Apr-2007 15:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | sarcosome.mp3 | 20-Apr-2007 15:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | sarcosomal.mp3 | 20-Apr-2007 15:49 | 10K | |
![[SND]](/icons/sound2.gif) | sarcosine.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sarcopticmange.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sarcoptic mange.mp3 | 20-Apr-2007 15:49 | 14K | |
![[SND]](/icons/sound2.gif) | sarcoplasmic.mp3 | 20-Apr-2007 15:49 | 11K | |
![[SND]](/icons/sound2.gif) | sarcoplasma.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sarcoplasm.mp3 | 20-Apr-2007 15:49 | 10K | |
![[SND]](/icons/sound2.gif) | sarcophile.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sarcophagus.mp3 | 20-Apr-2007 15:49 | 11K | |
![[SND]](/icons/sound2.gif) | sarcophagous.mp3 | 20-Apr-2007 15:49 | 17K | |
![[SND]](/icons/sound2.gif) | sarcophagi.mp3 | 20-Apr-2007 15:49 | 10K | |
![[SND]](/icons/sound2.gif) | sarcomere.mp3 | 20-Apr-2007 15:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | sarcomatous.mp3 | 20-Apr-2007 15:49 | 10K | |
![[SND]](/icons/sound2.gif) | sarcomatosis.mp3 | 20-Apr-2007 15:49 | 13K | |
![[SND]](/icons/sound2.gif) | sarcomatoses.mp3 | 20-Apr-2007 15:48 | 13K | |
![[SND]](/icons/sound2.gif) | sarcomata.mp3 | 20-Apr-2007 15:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | sarcoma.mp3 | 20-Apr-2007 15:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | sarcology.mp3 | 20-Apr-2007 15:48 | 17K | |
![[SND]](/icons/sound2.gif) | sarcolemmal.mp3 | 20-Apr-2007 15:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | sarcolemma.mp3 | 20-Apr-2007 15:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | sarcolacticacid.mp3 | 20-Apr-2007 15:48 | 18K | |
![[SND]](/icons/sound2.gif) | sarcoidosis.mp3 | 20-Apr-2007 15:48 | 12K | |
![[SND]](/icons/sound2.gif) | sarcoidoses.mp3 | 20-Apr-2007 15:48 | 13K | |
![[SND]](/icons/sound2.gif) | sarcoid.mp3 | 20-Apr-2007 15:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarcodinian.mp3 | 20-Apr-2007 15:48 | 17K | |
![[SND]](/icons/sound2.gif) | sarcode.mp3 | 20-Apr-2007 15:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | sarcocarp.mp3 | 20-Apr-2007 15:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | sarco.mp3 | 20-Apr-2007 15:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | sarcina.mp3 | 20-Apr-2007 15:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarcenet.mp3 | 20-Apr-2007 15:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | sarcelle.mp3 | 20-Apr-2007 15:48 | 17K | |
![[SND]](/icons/sound2.gif) | sarcastically.mp3 | 20-Apr-2007 15:48 | 11K | |
![[SND]](/icons/sound2.gif) | sarcastic.mp3 | 20-Apr-2007 15:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | sarcasm.mp3 | 20-Apr-2007 15:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | sarc.mp3 | 20-Apr-2007 15:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | sarazen.mp3 | 20-Apr-2007 15:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | sarasvati.mp3 | 20-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | sarapul.mp3 | 20-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | sarapis.mp3 | 20-Apr-2007 15:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | sarape.mp3 | 20-Apr-2007 15:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | sarangi.mp3 | 20-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | saran.mp3 | 20-Apr-2007 15:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | saramaccan.mp3 | 20-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | sarai.mp3 | 20-Apr-2007 15:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | sarah.mp3 | 20-Apr-2007 15:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | saragat.mp3 | 20-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | sarafan.mp3 | 20-Apr-2007 15:47 | 17K | |
![[SND]](/icons/sound2.gif) | sarabande.mp3 | 20-Apr-2007 15:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | saraband.mp3 | 20-Apr-2007 15:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | sara.mp3 | 20-Apr-2007 15:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | sar.mp3 | 20-Apr-2007 15:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | saquinavir.mp3 | 20-Apr-2007 15:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | saqqara.mp3 | 20-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | sapwood.mp3 | 20-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | sapucaia.mp3 | 20-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | sapsucker.mp3 | 20-Apr-2007 15:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | sapsago.mp3 | 20-Apr-2007 15:46 | 9.6K | |
![[SND]](/icons/sound2.gif) | saprozoic.mp3 | 20-Apr-2007 15:46 | 10K | |
![[SND]](/icons/sound2.gif) | saprophytically.mp3 | 20-Apr-2007 15:46 | 11K | |
![[SND]](/icons/sound2.gif) | saprophytic.mp3 | 20-Apr-2007 15:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | saprophyte.mp3 | 20-Apr-2007 15:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | saprophile.mp3 | 20-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | saprophagous.mp3 | 20-Apr-2007 15:46 | 11K | |
![[SND]](/icons/sound2.gif) | sapropel.mp3 | 20-Apr-2007 15:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | saprolite.mp3 | 20-Apr-2007 15:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | saprolegnia.mp3 | 20-Apr-2007 15:46 | 17K | |
![[SND]](/icons/sound2.gif) | saprogenicity.mp3 | 20-Apr-2007 15:46 | 12K | |
![[SND]](/icons/sound2.gif) | saprogenic.mp3 | 20-Apr-2007 15:46 | 10K | |
![[SND]](/icons/sound2.gif) | saprogen.mp3 | 20-Apr-2007 15:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | saprobe.mp3 | 20-Apr-2007 15:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | sapro.mp3 | 20-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | sapremia.mp3 | 20-Apr-2007 15:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | sappy.mp3 | 20-Apr-2007 15:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | sappiness.mp3 | 20-Apr-2007 15:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | sappho.mp3 | 20-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sapphism.mp3 | 20-Apr-2007 15:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | sapphirine.mp3 | 20-Apr-2007 15:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | sapphire.mp3 | 20-Apr-2007 15:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | sapphira.mp3 | 20-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sapphic.mp3 | 20-Apr-2007 15:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | sapperoo.mp3 | 20-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | sapper.mp3 | 20-Apr-2007 15:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | sappanwood.mp3 | 20-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | sapote.mp3 | 20-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | sapotaceous.mp3 | 20-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | sapota.mp3 | 20-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | saporous.mp3 | 20-Apr-2007 15:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | saporific.mp3 | 20-Apr-2007 15:45 | 17K | |
![[SND]](/icons/sound2.gif) | sapor.mp3 | 20-Apr-2007 15:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | saponite.mp3 | 20-Apr-2007 15:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | saponin.mp3 | 20-Apr-2007 15:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | saponify.mp3 | 20-Apr-2007 15:45 | 10K | |
![[SND]](/icons/sound2.gif) | saponifier.mp3 | 20-Apr-2007 15:45 | 11K | |
![[SND]](/icons/sound2.gif) | saponification.mp3 | 20-Apr-2007 15:45 | 13K | |
![[SND]](/icons/sound2.gif) | saponifiable.mp3 | 20-Apr-2007 15:45 | 12K | |
![[SND]](/icons/sound2.gif) | saponaceous.mp3 | 20-Apr-2007 15:45 | 12K | |
![[SND]](/icons/sound2.gif) | sapogenin.mp3 | 20-Apr-2007 15:45 | 10K | |
![[SND]](/icons/sound2.gif) | sapodilla.mp3 | 20-Apr-2007 15:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | sapling.mp3 | 20-Apr-2007 15:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | saplessness.mp3 | 20-Apr-2007 15:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | sapless.mp3 | 20-Apr-2007 15:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | sapindaceous.mp3 | 20-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | sapiential.mp3 | 20-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | sapient.mp3 | 20-Apr-2007 15:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | sapiens.mp3 | 20-Apr-2007 15:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | sapience.mp3 | 20-Apr-2007 15:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | sapidity.mp3 | 20-Apr-2007 15:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | sapid.mp3 | 20-Apr-2007 15:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | saphenous.mp3 | 20-Apr-2007 15:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | saphena.mp3 | 20-Apr-2007 15:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | sapheaded.mp3 | 20-Apr-2007 15:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | saphead.mp3 | 20-Apr-2007 15:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | saphar.mp3 | 20-Apr-2007 15:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | sapfu.mp3 | 20-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | sapele.mp3 | 20-Apr-2007 15:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | sapanwood.mp3 | 20-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | sapajou.mp3 | 20-Apr-2007 15:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | saovicente.mp3 | 20-Apr-2007 15:44 | 17K | |
![[SND]](/icons/sound2.gif) | saotomeandprincipe.mp3 | 20-Apr-2007 15:44 | 27K | |
![[SND]](/icons/sound2.gif) | saotome.mp3 | 20-Apr-2007 15:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | saotiago.mp3 | 20-Apr-2007 15:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | saoshyant.mp3 | 20-Apr-2007 15:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | saosalvador.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saorstateireann.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saopedrodoriograndedosul.mp3 | 20-Apr-2007 15:43 | 27K | |
![[SND]](/icons/sound2.gif) | saopaulodeluanda.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saopaulo.mp3 | 20-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | saoneetloire.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saona.mp3 | 20-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | saomiguel.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saoluis.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saojosedoscampos.mp3 | 20-Apr-2007 15:43 | 27K | |
![[SND]](/icons/sound2.gif) | saojosedoriopreto.mp3 | 20-Apr-2007 15:43 | 27K | |
![[SND]](/icons/sound2.gif) | saojoaodemeriti.mp3 | 20-Apr-2007 15:43 | 18K | |
![[SND]](/icons/sound2.gif) | saogoncalo.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saofrancisco.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saocaetanodosul.mp3 | 20-Apr-2007 15:43 | 17K | |
![[SND]](/icons/sound2.gif) | saobernardodocampo.mp3 | 20-Apr-2007 15:43 | 18K | |
![[SND]](/icons/sound2.gif) | sao.mp3 | 20-Apr-2007 15:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | sanza.mp3 | 20-Apr-2007 15:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | sanyasi.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | sanusi.mp3 | 20-Apr-2007 15:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanukite.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | santour.mp3 | 20-Apr-2007 15:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | santotomedeguayana.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | santosdumont.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | santos.mp3 | 20-Apr-2007 15:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | santorin.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | santonin.mp3 | 20-Apr-2007 15:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | santonica.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | santon.mp3 | 20-Apr-2007 15:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | santolina.mp3 | 20-Apr-2007 15:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | santol.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | santodomingo.mp3 | 20-Apr-2007 15:42 | 17K | |
![[SND]](/icons/sound2.gif) | santoandre.mp3 | 20-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | santo.mp3 | 20-Apr-2007 15:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | santir.mp3 | 20-Apr-2007 15:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | santimu.mp3 | 20-Apr-2007 15:41 | 9.6K | |
![[SND]](/icons/sound2.gif) | santims.mp3 | 20-Apr-2007 15:41 | 11K | |
![[SND]](/icons/sound2.gif) | santimi.mp3 | 20-Apr-2007 15:41 | 9.8K | |
![[SND]](/icons/sound2.gif) | santiagodeloscaballeros.mp3 | 20-Apr-2007 15:41 | 27K | |
![[SND]](/icons/sound2.gif) | santiagodelestero.mp3 | 20-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | santiagodecuba.mp3 | 20-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | santiagodecompostela.mp3 | 20-Apr-2007 15:41 | 27K | |
![[SND]](/icons/sound2.gif) | santero.mp3 | 20-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | santatecla.mp3 | 20-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | santarosadecopan.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santarosa.mp3 | 20-Apr-2007 15:40 | 36K | |
![[SND]](/icons/sound2.gif) | santapaula.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santana.mp3 | 20-Apr-2007 15:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | santamonica.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santamaura.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santamarta.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santamaria.mp3 | 20-Apr-2007 15:40 | 36K | |
![[SND]](/icons/sound2.gif) | santalucia.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santalol.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santali.mp3 | 20-Apr-2007 15:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | santalaceous.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santal.mp3 | 20-Apr-2007 15:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | santaisabel.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santagertrudis.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santafe.mp3 | 20-Apr-2007 15:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | santacruzdetenerife.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santacolomadegramanet.mp3 | 20-Apr-2007 15:40 | 18K | |
![[SND]](/icons/sound2.gif) | santaclara.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santacatarina.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santacatalina.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santabarbara.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santaanna.mp3 | 20-Apr-2007 15:40 | 17K | |
![[SND]](/icons/sound2.gif) | santaana.mp3 | 20-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | santa.mp3 | 20-Apr-2007 15:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | sanstefano.mp3 | 20-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sanssouci.mp3 | 20-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sans souci.mp3 | 20-Apr-2007 15:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | sansserif.mp3 | 20-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sans serif.mp3 | 20-Apr-2007 15:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | sansphrase.mp3 | 20-Apr-2007 15:39 | 17K | |
![[SND]](/icons/sound2.gif) | sanspeuretsansreproche.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sans peur et sans reproche.mp3 | 20-Apr-2007 15:37 | 19K | |
![[SND]](/icons/sound2.gif) | sanspeine.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sanspareil.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansovino.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansonflamsteedprojection.mp3 | 20-Apr-2007 15:38 | 27K | |
![[SND]](/icons/sound2.gif) | sansom.mp3 | 20-Apr-2007 15:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | sansgene.mp3 | 20-Apr-2007 15:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | sans gene.mp3 | 20-Apr-2007 15:37 | 9.6K | |
![[SND]](/icons/sound2.gif) | sansfacon.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansevieria.mp3 | 20-Apr-2007 15:38 | 11K | |
![[SND]](/icons/sound2.gif) | sanserif.mp3 | 20-Apr-2007 15:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | sansei.mp3 | 20-Apr-2007 15:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | sansebastian.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansdoute.mp3 | 20-Apr-2007 15:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | sans doute.mp3 | 20-Apr-2007 15:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | sansculottism.mp3 | 20-Apr-2007 15:38 | 12K | |
![[SND]](/icons/sound2.gif) | sansculottish.mp3 | 20-Apr-2007 15:38 | 12K | |
![[SND]](/icons/sound2.gif) | sansculottide.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansculottic.mp3 | 20-Apr-2007 15:38 | 11K | |
![[SND]](/icons/sound2.gif) | sansculotte.mp3 | 20-Apr-2007 15:38 | 11K | |
![[SND]](/icons/sound2.gif) | sanscrit.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansceremonie.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansappel.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansan.mp3 | 20-Apr-2007 15:38 | 17K | |
![[SND]](/icons/sound2.gif) | sansalvador.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sansa.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sans.mp3 | 20-Apr-2007 15:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanroc.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sanremo.mp3 | 20-Apr-2007 15:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanrafael.mp3 | 20-Apr-2007 15:37 | 36K | |
![[SND]](/icons/sound2.gif) | sanquentin.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sanpro.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sanpedrosula.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sanpablo.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sannyasin.mp3 | 20-Apr-2007 15:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | sannyasi.mp3 | 20-Apr-2007 15:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | sannup.mp3 | 20-Apr-2007 15:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | sannhemp.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sann hemp.mp3 | 20-Apr-2007 15:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | sanmigueldetucuman.mp3 | 20-Apr-2007 15:37 | 27K | |
![[SND]](/icons/sound2.gif) | sanmiguel.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sanmicheli.mp3 | 20-Apr-2007 15:37 | 17K | |
![[SND]](/icons/sound2.gif) | sanmateo.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanmartin.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanmarino.mp3 | 20-Apr-2007 15:36 | 36K | |
![[SND]](/icons/sound2.gif) | sanmarcos.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanman.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanluispotosi.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanluisobispo.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanleandro.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanktpolten.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanktmoritz.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanktgallen.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sankt.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sankey.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sankara.mp3 | 20-Apr-2007 15:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanka.mp3 | 20-Apr-2007 15:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | sank.mp3 | 20-Apr-2007 15:36 | 5.5K | |
![[SND]](/icons/sound2.gif) | sanjuanito.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanjuandelacruz.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanjuancapistrano.mp3 | 20-Apr-2007 15:36 | 17K | |
![[SND]](/icons/sound2.gif) | sanjuanbautista.mp3 | 20-Apr-2007 15:36 | 18K | |
![[SND]](/icons/sound2.gif) | sanjuan.mp3 | 20-Apr-2007 15:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanjosescale.mp3 | 20-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sanjose.mp3 | 20-Apr-2007 15:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanjoaquin.mp3 | 20-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sanjak.mp3 | 20-Apr-2007 15:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | sanjacinto.mp3 | 20-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sanity.mp3 | 20-Apr-2007 15:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | sanitorium.mp3 | 20-Apr-2007 15:35 | 11K | |
![[SND]](/icons/sound2.gif) | sanitoria.mp3 | 20-Apr-2007 15:35 | 10K | |
![[SND]](/icons/sound2.gif) | sanitizer.mp3 | 20-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sanitize.mp3 | 20-Apr-2007 15:35 | 10K | |
![[SND]](/icons/sound2.gif) | sanitization.mp3 | 20-Apr-2007 15:35 | 12K | |
![[SND]](/icons/sound2.gif) | sanitationman.mp3 | 20-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sanitationist.mp3 | 20-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sanitation.mp3 | 20-Apr-2007 15:35 | 10K | |
![[SND]](/icons/sound2.gif) | sanitate.mp3 | 20-Apr-2007 15:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | sanitary.mp3 | 20-Apr-2007 15:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | sanitarium.mp3 | 20-Apr-2007 15:35 | 11K | |
![[SND]](/icons/sound2.gif) | sanitarily.mp3 | 20-Apr-2007 15:35 | 10K | |
![[SND]](/icons/sound2.gif) | sanitarian.mp3 | 20-Apr-2007 15:35 | 10K | |
![[SND]](/icons/sound2.gif) | sanitaria.mp3 | 20-Apr-2007 15:35 | 10K | |
![[SND]](/icons/sound2.gif) | sanious.mp3 | 20-Apr-2007 15:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | sanin.mp3 | 20-Apr-2007 15:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | sanildefonso.mp3 | 20-Apr-2007 15:35 | 17K | |
![[SND]](/icons/sound2.gif) | sanify.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanies.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanidine.mp3 | 20-Apr-2007 15:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | sanicle.mp3 | 20-Apr-2007 15:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | sanibelisland.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanguivorous.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanguinopurulent.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanguinolent.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanguinity.mp3 | 20-Apr-2007 15:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | sanguineous.mp3 | 20-Apr-2007 15:34 | 11K | |
![[SND]](/icons/sound2.gif) | sanguineness.mp3 | 20-Apr-2007 15:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | sanguine.mp3 | 20-Apr-2007 15:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | sanguinary.mp3 | 20-Apr-2007 15:34 | 10K | |
![[SND]](/icons/sound2.gif) | sanguinarine.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanguinarily.mp3 | 20-Apr-2007 15:34 | 11K | |
![[SND]](/icons/sound2.gif) | sanguinaria.mp3 | 20-Apr-2007 15:34 | 11K | |
![[SND]](/icons/sound2.gif) | sanguification.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanguiferous.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sanguicolous.mp3 | 20-Apr-2007 15:34 | 17K | |
![[SND]](/icons/sound2.gif) | sangui.mp3 | 20-Apr-2007 15:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | sangria.mp3 | 20-Apr-2007 15:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | sangredecristo.mp3 | 20-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sangraal.mp3 | 20-Apr-2007 15:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | sangoma.mp3 | 20-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sango.mp3 | 20-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sanglier.mp3 | 20-Apr-2007 15:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | sangli.mp3 | 20-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sangiorgio.mp3 | 20-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sangha.mp3 | 20-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sangh.mp3 | 20-Apr-2007 15:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | sangfroid.mp3 | 20-Apr-2007 15:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | sangerman.mp3 | 20-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sangdeboeuf.mp3 | 20-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sangaree.mp3 | 20-Apr-2007 15:33 | 9.3K | |
![[SND]](/icons/sound2.gif) | sangar.mp3 | 20-Apr-2007 15:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | sangallensis.mp3 | 20-Apr-2007 15:33 | 17K | |
![[SND]](/icons/sound2.gif) | sangabriel.mp3 | 20-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sang.mp3 | 20-Apr-2007 15:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | sanfranciscodemacoris.mp3 | 20-Apr-2007 15:32 | 27K | |
![[SND]](/icons/sound2.gif) | sanfrancisco.mp3 | 20-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sanfran.mp3 | 20-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sanfernando.mp3 | 20-Apr-2007 15:32 | 36K | |
![[SND]](/icons/sound2.gif) | sanfelipe.mp3 | 20-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | saneness.mp3 | 20-Apr-2007 15:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | sane.mp3 | 20-Apr-2007 15:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | sandymacnab.mp3 | 20-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sandy.mp3 | 20-Apr-2007 15:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | sandwort.mp3 | 20-Apr-2007 15:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sandworm.mp3 | 20-Apr-2007 15:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | sandwicheria.mp3 | 20-Apr-2007 15:32 | 17K | |
![[SND]](/icons/sound2.gif) | sandwich.mp3 | 20-Apr-2007 15:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | sandstorm.mp3 | 20-Apr-2007 15:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | sandstone.mp3 | 20-Apr-2007 15:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | sandspur.mp3 | 20-Apr-2007 15:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | sandsoap.mp3 | 20-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | sandshoe.mp3 | 20-Apr-2007 15:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | sands.mp3 | 20-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sandron.mp3 | 20-Apr-2007 15:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sandroller.mp3 | 20-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sandrocottus.mp3 | 20-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sandro.mp3 | 20-Apr-2007 15:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | sandra.mp3 | 20-Apr-2007 15:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sandpit.mp3 | 20-Apr-2007 15:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | sandpiper.mp3 | 20-Apr-2007 15:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | sandpile.mp3 | 20-Apr-2007 15:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | sandpapery.mp3 | 20-Apr-2007 15:31 | 10K | |
![[SND]](/icons/sound2.gif) | sandpaper.mp3 | 20-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | sandpainting.mp3 | 20-Apr-2007 15:31 | 9.6K | |
![[SND]](/icons/sound2.gif) | sandoz.mp3 | 20-Apr-2007 15:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | sandownpark.mp3 | 20-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sandor.mp3 | 20-Apr-2007 15:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | sandomingo.mp3 | 20-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sandman.mp3 | 20-Apr-2007 15:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | sandlotter.mp3 | 20-Apr-2007 15:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | sandlot.mp3 | 20-Apr-2007 15:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | sandling.mp3 | 20-Apr-2007 15:31 | 17K | |
![[SND]](/icons/sound2.gif) | sandiver.mp3 | 20-Apr-2007 15:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | sandino.mp3 | 20-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | sandimas.mp3 | 20-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | sandiego.mp3 | 20-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | sandie.mp3 | 20-Apr-2007 15:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sandhya.mp3 | 20-Apr-2007 15:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | sandhog.mp3 | 20-Apr-2007 15:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | sandhillcrane.mp3 | 20-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | sandhill crane.mp3 | 20-Apr-2007 15:30 | 13K | |
![[SND]](/icons/sound2.gif) | sandhi.mp3 | 20-Apr-2007 15:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | sandgrouse.mp3 | 20-Apr-2007 15:30 | 10K | |
![[SND]](/icons/sound2.gif) | sandglass.mp3 | 20-Apr-2007 15:30 | 10K | |
![[SND]](/icons/sound2.gif) | sandfly fever.mp3 | 20-Apr-2007 15:30 | 13K | |
![[SND]](/icons/sound2.gif) | sandever.mp3 | 20-Apr-2007 15:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanders.mp3 | 20-Apr-2007 15:30 | 17K | |
![[SND]](/icons/sound2.gif) | sanderling.mp3 | 20-Apr-2007 15:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | sander.mp3 | 20-Apr-2007 15:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | sandeman.mp3 | 20-Apr-2007 15:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | sandek.mp3 | 20-Apr-2007 15:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | sanded.mp3 | 20-Apr-2007 15:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | sandbur.mp3 | 20-Apr-2007 15:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | sandbox.mp3 | 20-Apr-2007 15:30 | 11K | |
![[SND]](/icons/sound2.gif) | sandblast.mp3 | 20-Apr-2007 15:29 | 10K | |
![[SND]](/icons/sound2.gif) | sandbar.mp3 | 20-Apr-2007 15:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | sandbank.mp3 | 20-Apr-2007 15:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | sandbag.mp3 | 20-Apr-2007 15:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | sandarac.mp3 | 20-Apr-2007 15:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | sandalwood.mp3 | 20-Apr-2007 15:29 | 10K | |
![[SND]](/icons/sound2.gif) | sandaled.mp3 | 20-Apr-2007 15:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | sandal.mp3 | 20-Apr-2007 15:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | sandage.mp3 | 20-Apr-2007 15:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | sand.mp3 | 20-Apr-2007 15:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | sand-cast.mp3 | 20-Apr-2007 15:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | sand-blind.mp3 | 20-Apr-2007 15:29 | 11K | |
![[SND]](/icons/sound2.gif) | sanctumsanctorum.mp3 | 20-Apr-2007 15:29 | 17K | |
![[SND]](/icons/sound2.gif) | sanctum sanctorum.mp3 | 20-Apr-2007 15:29 | 15K | |
![[SND]](/icons/sound2.gif) | sanctum.mp3 | 20-Apr-2007 15:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | sanctuary.mp3 | 20-Apr-2007 15:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | sanctity.mp3 | 20-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanctitude.mp3 | 20-Apr-2007 15:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | sanctioning.mp3 | 20-Apr-2007 15:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanctionable.mp3 | 20-Apr-2007 15:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | sanction.mp3 | 20-Apr-2007 15:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | sanctimony.mp3 | 20-Apr-2007 15:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | sanctimonious.mp3 | 20-Apr-2007 15:29 | 12K | |
![[SND]](/icons/sound2.gif) | sanctify.mp3 | 20-Apr-2007 15:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | sanctifier.mp3 | 20-Apr-2007 15:28 | 9.8K | |
![[SND]](/icons/sound2.gif) | sanctified.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sanctification.mp3 | 20-Apr-2007 15:28 | 11K | |
![[SND]](/icons/sound2.gif) | sancta simplicitas.mp3 | 20-Apr-2007 15:28 | 19K | |
![[SND]](/icons/sound2.gif) | sancta.mp3 | 20-Apr-2007 15:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | sancristobal.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sanchopanza.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sancarlos.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sanbuenaventura.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sanbruno.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sanborn.mp3 | 20-Apr-2007 15:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | sanblas.mp3 | 20-Apr-2007 15:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | sanbernardo.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sanbernardino.mp3 | 20-Apr-2007 15:28 | 17K | |
![[SND]](/icons/sound2.gif) | sanbenito.mp3 | 20-Apr-2007 15:28 | 9.8K | |
![[SND]](/icons/sound2.gif) | sanatory.mp3 | 20-Apr-2007 15:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | sanatorium.mp3 | 20-Apr-2007 15:28 | 11K | |
![[SND]](/icons/sound2.gif) | sanatoria.mp3 | 20-Apr-2007 15:27 | 10K | |
![[SND]](/icons/sound2.gif) | sanatogen.mp3 | 20-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sanative.mp3 | 20-Apr-2007 15:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | sanantonio.mp3 | 20-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sanangelo.mp3 | 20-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | sanandreasfault.mp3 | 20-Apr-2007 15:27 | 17K | |
![[SND]](/icons/sound2.gif) | samurai.mp3 | 20-Apr-2007 15:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | samsonite.mp3 | 20-Apr-2007 15:25 | 17K | |
![[SND]](/icons/sound2.gif) | samsoe.mp3 | 20-Apr-2007 15:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | samskara.mp3 | 20-Apr-2007 15:24 | 17K | |
![[SND]](/icons/sound2.gif) | samshu.mp3 | 20-Apr-2007 15:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | samsara.mp3 | 20-Apr-2007 15:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | sampy.mp3 | 20-Apr-2007 15:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | sampson.mp3 | 20-Apr-2007 15:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | sampo.mp3 | 20-Apr-2007 15:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | sampling.mp3 | 20-Apr-2007 15:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | sampler.mp3 | 20-Apr-2007 15:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | sample.mp3 | 20-Apr-2007 15:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | samphire.mp3 | 20-Apr-2007 15:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | sampan.mp3 | 20-Apr-2007 15:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | sampaguita.mp3 | 20-Apr-2007 15:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | samp.mp3 | 20-Apr-2007 15:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | samovar.mp3 | 20-Apr-2007 15:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | samoset.mp3 | 20-Apr-2007 15:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | samosa.mp3 | 20-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | samogon.mp3 | 20-Apr-2007 15:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | samo.mp3 | 20-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | sammy.mp3 | 20-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | sammartini.mp3 | 20-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | samlet.mp3 | 20-Apr-2007 15:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | samkhya.mp3 | 20-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | samizdatchik.mp3 | 20-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | samizdat.mp3 | 20-Apr-2007 15:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | samiti.mp3 | 20-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | samite.mp3 | 20-Apr-2007 15:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | samisen.mp3 | 20-Apr-2007 15:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | samink.mp3 | 20-Apr-2007 15:23 | 17K | |
![[SND]](/icons/sound2.gif) | samiel.mp3 | 20-Apr-2007 15:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | samhita.mp3 | 20-Apr-2007 15:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | samhain.mp3 | 20-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | samgha.mp3 | 20-Apr-2007 15:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | samfu.mp3 | 20-Apr-2007 15:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | samey.mp3 | 20-Apr-2007 15:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | sameness.mp3 | 20-Apr-2007 15:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | samel.mp3 | 20-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | samekh.mp3 | 20-Apr-2007 15:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | same.mp3 | 20-Apr-2007 15:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | sambur.mp3 | 20-Apr-2007 15:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | sambuke.mp3 | 20-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | sambuk.mp3 | 20-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | sambuca.mp3 | 20-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | sambrownebelt.mp3 | 20-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | sambre.mp3 | 20-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | sambo.mp3 | 20-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | sambar.mp3 | 20-Apr-2007 15:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | sambal.mp3 | 20-Apr-2007 15:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | samba.mp3 | 20-Apr-2007 15:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | samaveda.mp3 | 20-Apr-2007 15:22 | 17K | |
![[SND]](/icons/sound2.gif) | samarskite.mp3 | 20-Apr-2007 15:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | samarra.mp3 | 20-Apr-2007 15:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | samarium.mp3 | 20-Apr-2007 15:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | samariform.mp3 | 20-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | samarang.mp3 | 20-Apr-2007 15:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | samaranch.mp3 | 20-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | samara.mp3 | 20-Apr-2007 15:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | samantha.mp3 | 20-Apr-2007 15:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | samanid.mp3 | 20-Apr-2007 15:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | samanacay.mp3 | 20-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | saman.mp3 | 20-Apr-2007 15:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | samaj.mp3 | 20-Apr-2007 15:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | samain.mp3 | 20-Apr-2007 15:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | samadhi.mp3 | 20-Apr-2007 15:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | sama.mp3 | 20-Apr-2007 15:21 | 17K | |
![[SND]](/icons/sound2.gif) | salyut.mp3 | 20-Apr-2007 15:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | salvor.mp3 | 20-Apr-2007 15:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | salvolatile.mp3 | 20-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | sal volatile.mp3 | 20-Apr-2007 15:10 | 11K | |
![[SND]](/icons/sound2.gif) | salvo.mp3 | 20-Apr-2007 15:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | salvific.mp3 | 20-Apr-2007 15:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | salvia.mp3 | 20-Apr-2007 15:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | salverform.mp3 | 20-Apr-2007 15:20 | 11K | |
![[SND]](/icons/sound2.gif) | salveregina.mp3 | 20-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | salver.mp3 | 20-Apr-2007 15:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | salvemini.mp3 | 20-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | salve.mp3 | 20-Apr-2007 15:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | salvaveritatei.mp3 | 20-Apr-2007 15:20 | 17K | |
![[SND]](/icons/sound2.gif) | salvatore.mp3 | 20-Apr-2007 15:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | salvationism.mp3 | 20-Apr-2007 15:20 | 11K | |
![[SND]](/icons/sound2.gif) | salvational.mp3 | 20-Apr-2007 15:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | salvation.mp3 | 20-Apr-2007 15:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | salvarsan.mp3 | 20-Apr-2007 15:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | salvageable.mp3 | 20-Apr-2007 15:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | salvageability.mp3 | 20-Apr-2007 15:20 | 11K | |
![[SND]](/icons/sound2.gif) | salvage.mp3 | 20-Apr-2007 15:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | salvable.mp3 | 20-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | salutiferous.mp3 | 20-Apr-2007 15:19 | 11K | |
![[SND]](/icons/sound2.gif) | salute.mp3 | 20-Apr-2007 15:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | salutatory.mp3 | 20-Apr-2007 15:19 | 10K | |
![[SND]](/icons/sound2.gif) | salutatorium.mp3 | 20-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | salutatorian.mp3 | 20-Apr-2007 15:19 | 12K | |
![[SND]](/icons/sound2.gif) | salutational.mp3 | 20-Apr-2007 15:19 | 11K | |
![[SND]](/icons/sound2.gif) | salutation.mp3 | 20-Apr-2007 15:19 | 10K | |
![[SND]](/icons/sound2.gif) | salutary.mp3 | 20-Apr-2007 15:19 | 9.6K | |
![[SND]](/icons/sound2.gif) | salutariness.mp3 | 20-Apr-2007 15:19 | 12K | |
![[SND]](/icons/sound2.gif) | salutarily.mp3 | 20-Apr-2007 15:19 | 11K | |
![[SND]](/icons/sound2.gif) | saluspopulisupremalexesto.mp3 | 20-Apr-2007 15:19 | 27K | |
![[SND]](/icons/sound2.gif) | salus populi suprema lex esto.mp3 | 20-Apr-2007 15:19 | 28K | |
![[SND]](/icons/sound2.gif) | salus.mp3 | 20-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | saluretic.mp3 | 20-Apr-2007 15:19 | 17K | |
![[SND]](/icons/sound2.gif) | saluki.mp3 | 20-Apr-2007 15:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | salugi.mp3 | 20-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | salud.mp3 | 20-Apr-2007 15:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | salubrity.mp3 | 20-Apr-2007 15:19 | 9.6K | |
![[SND]](/icons/sound2.gif) | salubrious.mp3 | 20-Apr-2007 15:19 | 10K | |
![[SND]](/icons/sound2.gif) | salty.mp3 | 20-Apr-2007 15:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | saltwort.mp3 | 20-Apr-2007 15:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | saltworks.mp3 | 20-Apr-2007 15:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | saltwater.mp3 | 20-Apr-2007 15:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | saltus.mp3 | 20-Apr-2007 15:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | saltshaker.mp3 | 20-Apr-2007 15:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | saltpeter.mp3 | 20-Apr-2007 15:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | saltonsea.mp3 | 20-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | salto mortale.mp3 | 20-Apr-2007 15:18 | 14K | |
![[SND]](/icons/sound2.gif) | saltness.mp3 | 20-Apr-2007 15:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | saltlike.mp3 | 20-Apr-2007 15:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | saltless.mp3 | 20-Apr-2007 15:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | saltish.mp3 | 20-Apr-2007 15:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | saltire.mp3 | 20-Apr-2007 15:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | salting.mp3 | 20-Apr-2007 15:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | saltiness.mp3 | 20-Apr-2007 15:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | saltine.mp3 | 20-Apr-2007 15:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | saltimbocca.mp3 | 20-Apr-2007 15:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | saltimbanco.mp3 | 20-Apr-2007 15:18 | 17K | |
![[SND]](/icons/sound2.gif) | saltily.mp3 | 20-Apr-2007 15:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | saltigrade.mp3 | 20-Apr-2007 15:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | saltier.mp3 | 20-Apr-2007 15:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | saltie.mp3 | 20-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | saltery.mp3 | 20-Apr-2007 15:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | saltern.mp3 | 20-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | salter.mp3 | 20-Apr-2007 15:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | salten.mp3 | 20-Apr-2007 15:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | salted.mp3 | 20-Apr-2007 15:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | saltcellar.mp3 | 20-Apr-2007 15:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | saltbush.mp3 | 20-Apr-2007 15:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | saltbox.mp3 | 20-Apr-2007 15:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | saltatory.mp3 | 20-Apr-2007 15:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | saltatorial.mp3 | 20-Apr-2007 15:17 | 10K | |
![[SND]](/icons/sound2.gif) | saltator.mp3 | 20-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | saltato.mp3 | 20-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | saltationism.mp3 | 20-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | saltation.mp3 | 20-Apr-2007 15:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | saltarello.mp3 | 20-Apr-2007 15:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | saltant.mp3 | 20-Apr-2007 15:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | saltandpepper.mp3 | 20-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | saltando.mp3 | 20-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | salt.mp3 | 20-Apr-2007 15:17 | 5.9K | |
![[SND]](/icons/sound2.gif) | salsuginous.mp3 | 20-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | salsoda.mp3 | 20-Apr-2007 15:17 | 17K | |
![[SND]](/icons/sound2.gif) | salsilla.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salsify.mp3 | 20-Apr-2007 15:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | salse.mp3 | 20-Apr-2007 15:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | salsa.mp3 | 20-Apr-2007 15:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | salpinx.mp3 | 20-Apr-2007 15:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | salpingotomy.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salpingostomy.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salpingo.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salpingitis.mp3 | 20-Apr-2007 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | salpingian.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salpingectomy.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salping.mp3 | 20-Apr-2007 15:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | salpiglossis.mp3 | 20-Apr-2007 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | salpicon.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salpa.mp3 | 20-Apr-2007 15:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | salp.mp3 | 20-Apr-2007 15:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | salopette.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | saloop.mp3 | 20-Apr-2007 15:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | saloon.mp3 | 20-Apr-2007 15:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | salonnard.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salonist.mp3 | 20-Apr-2007 15:16 | 17K | |
![[SND]](/icons/sound2.gif) | salon des refuses.mp3 | 20-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | salon.mp3 | 20-Apr-2007 15:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | salometer.mp3 | 20-Apr-2007 15:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | salol.mp3 | 20-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | salmonoid.mp3 | 20-Apr-2007 15:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | salmonid.mp3 | 20-Apr-2007 15:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | salmonellosis.mp3 | 20-Apr-2007 15:15 | 13K | |
![[SND]](/icons/sound2.gif) | salmonelloses.mp3 | 20-Apr-2007 15:15 | 13K | |
![[SND]](/icons/sound2.gif) | salmonellae.mp3 | 20-Apr-2007 15:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | salmonella.mp3 | 20-Apr-2007 15:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | salmonberry.mp3 | 20-Apr-2007 15:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | salmon.mp3 | 20-Apr-2007 15:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | salmis.mp3 | 20-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | salmi.mp3 | 20-Apr-2007 15:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | salmanazar.mp3 | 20-Apr-2007 15:15 | 17K | |
![[SND]](/icons/sound2.gif) | salmagundi.mp3 | 20-Apr-2007 15:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | sallylunn.mp3 | 20-Apr-2007 15:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | sally.mp3 | 20-Apr-2007 15:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | sallowy.mp3 | 20-Apr-2007 15:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | sallowness.mp3 | 20-Apr-2007 15:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | sallowish.mp3 | 20-Apr-2007 15:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | sallow.mp3 | 20-Apr-2007 15:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | sallet.mp3 | 20-Apr-2007 15:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | salledattente.mp3 | 20-Apr-2007 15:14 | 17K | |
![[SND]](/icons/sound2.gif) | salleamanger.mp3 | 20-Apr-2007 15:14 | 17K | |
![[SND]](/icons/sound2.gif) | salle a manger.mp3 | 20-Apr-2007 15:14 | 13K | |
![[SND]](/icons/sound2.gif) | salle.mp3 | 20-Apr-2007 15:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | salkvaccine.mp3 | 20-Apr-2007 15:14 | 17K | |
![[SND]](/icons/sound2.gif) | salix.mp3 | 20-Apr-2007 15:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | salivator.mp3 | 20-Apr-2007 15:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | salivation.mp3 | 20-Apr-2007 15:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | salivate.mp3 | 20-Apr-2007 15:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | salivary.mp3 | 20-Apr-2007 15:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | saliva.mp3 | 20-Apr-2007 15:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | salisbury.mp3 | 20-Apr-2007 15:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | salinometer.mp3 | 20-Apr-2007 15:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | salinize.mp3 | 20-Apr-2007 15:14 | 10K | |
![[SND]](/icons/sound2.gif) | salinization.mp3 | 20-Apr-2007 15:14 | 11K | |
![[SND]](/icons/sound2.gif) | salinity.mp3 | 20-Apr-2007 15:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | saline.mp3 | 20-Apr-2007 15:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | salimeter.mp3 | 20-Apr-2007 15:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | salii.mp3 | 20-Apr-2007 15:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | salify.mp3 | 20-Apr-2007 15:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | salifkeita.mp3 | 20-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | saliferous.mp3 | 20-Apr-2007 15:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | salientian.mp3 | 20-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | salient.mp3 | 20-Apr-2007 15:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | saliency.mp3 | 20-Apr-2007 15:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | salience.mp3 | 20-Apr-2007 15:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | salicylic acid.mp3 | 20-Apr-2007 15:13 | 14K | |
![[SND]](/icons/sound2.gif) | salicylic.mp3 | 20-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | salicylate.mp3 | 20-Apr-2007 15:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | salicional.mp3 | 20-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | salicin.mp3 | 20-Apr-2007 15:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | salicet.mp3 | 20-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | salicaceous.mp3 | 20-Apr-2007 15:13 | 17K | |
![[SND]](/icons/sound2.gif) | salic.mp3 | 20-Apr-2007 15:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | salian.mp3 | 20-Apr-2007 15:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | salet.mp3 | 20-Apr-2007 15:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | saleswoman.mp3 | 20-Apr-2007 15:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | salesroom.mp3 | 20-Apr-2007 15:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | salesperson.mp3 | 20-Apr-2007 15:12 | 10K | |
![[SND]](/icons/sound2.gif) | salespeople.mp3 | 20-Apr-2007 15:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | salesmanship.mp3 | 20-Apr-2007 15:12 | 10K | |
![[SND]](/icons/sound2.gif) | salesman.mp3 | 20-Apr-2007 15:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | saleslady.mp3 | 20-Apr-2007 15:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | salesgirl.mp3 | 20-Apr-2007 15:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | salesclerk.mp3 | 20-Apr-2007 15:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | sales.mp3 | 20-Apr-2007 15:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | saleroom.mp3 | 20-Apr-2007 15:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | saleratus.mp3 | 20-Apr-2007 15:12 | 10K | |
![[SND]](/icons/sound2.gif) | salep.mp3 | 20-Apr-2007 15:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | saleable.mp3 | 20-Apr-2007 15:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | sale.mp3 | 20-Apr-2007 15:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | salduba.mp3 | 20-Apr-2007 15:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | salchow.mp3 | 20-Apr-2007 15:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | salbutamol.mp3 | 20-Apr-2007 15:12 | 17K | |
![[SND]](/icons/sound2.gif) | salavat.mp3 | 20-Apr-2007 15:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | salatticum.mp3 | 20-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | salat.mp3 | 20-Apr-2007 15:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | salaryman.mp3 | 20-Apr-2007 15:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | salary.mp3 | 20-Apr-2007 15:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | salaried.mp3 | 20-Apr-2007 15:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | salariat.mp3 | 20-Apr-2007 15:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | salar.mp3 | 20-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | salangane.mp3 | 20-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | salamweinbergtheory.mp3 | 20-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | salammbo.mp3 | 20-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | salami.mp3 | 20-Apr-2007 15:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | salamandroid.mp3 | 20-Apr-2007 15:11 | 17K | |
![[SND]](/icons/sound2.gif) | salamandrine.mp3 | 20-Apr-2007 15:11 | 11K | |
![[SND]](/icons/sound2.gif) | salamander.mp3 | 20-Apr-2007 15:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | salal.mp3 | 20-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | salah.mp3 | 20-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | saladenicoise.mp3 | 20-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | salade.mp3 | 20-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | salad.mp3 | 20-Apr-2007 15:10 | 6.8K | |
![[SND]](/icons/sound2.gif) | salacrou.mp3 | 20-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | salacious.mp3 | 20-Apr-2007 15:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | salable.mp3 | 20-Apr-2007 15:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | salability.mp3 | 20-Apr-2007 15:10 | 11K | |
![[SND]](/icons/sound2.gif) | salaam alaikum.mp3 | 20-Apr-2007 15:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | salaam.mp3 | 20-Apr-2007 15:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | sala.mp3 | 20-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | sal Atticum.mp3 | 20-Apr-2007 15:10 | 11K | |
![[SND]](/icons/sound2.gif) | sal.mp3 | 20-Apr-2007 15:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | sakyamuni.mp3 | 20-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | sakuntala.mp3 | 20-Apr-2007 15:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | saktism.mp3 | 20-Apr-2007 15:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | sakta.mp3 | 20-Apr-2007 15:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | saksfifthavenue.mp3 | 20-Apr-2007 15:10 | 17K | |
![[SND]](/icons/sound2.gif) | sakon.mp3 | 20-Apr-2007 15:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | sakkos.mp3 | 20-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | saki.mp3 | 20-Apr-2007 15:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | saker.mp3 | 20-Apr-2007 15:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | sakel.mp3 | 20-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | sake.mp3 | 20-Apr-2007 15:09 | 6.1K | |
![[SND]](/icons/sound2.gif) | sakau.mp3 | 20-Apr-2007 15:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | sakajawea.mp3 | 20-Apr-2007 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | saithe.mp3 | 20-Apr-2007 15:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | saith.mp3 | 20-Apr-2007 15:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | saite.mp3 | 20-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | saisonnier.mp3 | 20-Apr-2007 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | sair.mp3 | 20-Apr-2007 15:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | saiqa.mp3 | 20-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | saintvitussdance.mp3 | 20-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | sainttropez.mp3 | 20-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | saintsimonian.mp3 | 20-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | saintsimon.mp3 | 20-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | saintship.mp3 | 20-Apr-2007 15:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | saintsaens.mp3 | 20-Apr-2007 15:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | saintpaulia.mp3 | 20-Apr-2007 15:08 | 17K | |
![[SND]](/icons/sound2.gif) | saintmaurdesfosses.mp3 | 20-Apr-2007 15:07 | 18K | |
![[SND]](/icons/sound2.gif) | saintly.mp3 | 20-Apr-2007 15:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | saintlouis.mp3 | 20-Apr-2007 15:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | saintlike.mp3 | 20-Apr-2007 15:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | saintkilda.mp3 | 20-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | saintjust.mp3 | 20-Apr-2007 15:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | sainthood.mp3 | 20-Apr-2007 15:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | saintfoin.mp3 | 20-Apr-2007 15:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | saintexupery.mp3 | 20-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | sainted.mp3 | 20-Apr-2007 15:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | saintebeuve.mp3 | 20-Apr-2007 15:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | saintdom.mp3 | 20-Apr-2007 15:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | saintaustell.mp3 | 20-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | saintagnesseve.mp3 | 20-Apr-2007 15:06 | 17K | |
![[SND]](/icons/sound2.gif) | saint.mp3 | 20-Apr-2007 15:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | sainsburys.mp3 | 20-Apr-2007 15:03 | 17K | |
![[SND]](/icons/sound2.gif) | sainfoin.mp3 | 20-Apr-2007 15:03 | 10K | |
![[SND]](/icons/sound2.gif) | sain.mp3 | 20-Apr-2007 15:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | saimin.mp3 | 20-Apr-2007 15:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | sailplane.mp3 | 20-Apr-2007 15:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | sailorman.mp3 | 20-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | sailorly.mp3 | 20-Apr-2007 15:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | sailoring.mp3 | 20-Apr-2007 15:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | sailor.mp3 | 20-Apr-2007 15:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | sailor's-choice.mp3 | 20-Apr-2007 15:03 | 11K | |
![[SND]](/icons/sound2.gif) | sailmaker.mp3 | 20-Apr-2007 15:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | sailless.mp3 | 20-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | sailing.mp3 | 20-Apr-2007 15:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | sailfish.mp3 | 20-Apr-2007 15:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | sailer.mp3 | 20-Apr-2007 15:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | sailed.mp3 | 20-Apr-2007 15:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | sailcloth.mp3 | 20-Apr-2007 15:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | sailboater.mp3 | 20-Apr-2007 15:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | sailboat.mp3 | 20-Apr-2007 15:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | sailboarding.mp3 | 20-Apr-2007 15:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | sailboarder.mp3 | 20-Apr-2007 15:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | sailboard.mp3 | 20-Apr-2007 15:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | sailable.mp3 | 20-Apr-2007 15:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | sail.mp3 | 20-Apr-2007 15:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | saiga.mp3 | 20-Apr-2007 15:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | said.mp3 | 20-Apr-2007 15:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | saice.mp3 | 20-Apr-2007 15:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | saibling.mp3 | 20-Apr-2007 15:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | sahuaro.mp3 | 20-Apr-2007 15:02 | 17K | |
![[SND]](/icons/sound2.gif) | sahrawi.mp3 | 20-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | sahiwal.mp3 | 20-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | sahityaakademi.mp3 | 20-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | sahib.mp3 | 20-Apr-2007 15:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | saheb.mp3 | 20-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | sagy.mp3 | 20-Apr-2007 15:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | saguiaelhamra.mp3 | 20-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | saguaro.mp3 | 20-Apr-2007 15:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | saguache.mp3 | 20-Apr-2007 15:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | sagradafamilia.mp3 | 20-Apr-2007 15:01 | 17K | |
![[SND]](/icons/sound2.gif) | sago.mp3 | 20-Apr-2007 15:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | sagittate.mp3 | 20-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sagittary.mp3 | 20-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sagittally.mp3 | 20-Apr-2007 15:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | sagittal.mp3 | 20-Apr-2007 15:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | sagitta.mp3 | 20-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | saggy.mp3 | 20-Apr-2007 15:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | sagger.mp3 | 20-Apr-2007 15:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | saggar.mp3 | 20-Apr-2007 15:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | sagenite.mp3 | 20-Apr-2007 15:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | sagebrush.mp3 | 20-Apr-2007 15:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | sage.mp3 | 20-Apr-2007 15:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | sagbut.mp3 | 20-Apr-2007 15:00 | 17K | |
![[SND]](/icons/sound2.gif) | sagamore.mp3 | 20-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | sagacity.mp3 | 20-Apr-2007 15:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | sagacious.mp3 | 20-Apr-2007 15:00 | 10K | |
![[SND]](/icons/sound2.gif) | saga.mp3 | 20-Apr-2007 15:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | sag.mp3 | 20-Apr-2007 15:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | saft.mp3 | 20-Apr-2007 14:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | safrole.mp3 | 20-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | safranine.mp3 | 20-Apr-2007 14:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | safranin.mp3 | 20-Apr-2007 14:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | safire.mp3 | 20-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | safing.mp3 | 20-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | safidrud.mp3 | 20-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | saffron.mp3 | 20-Apr-2007 14:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | safflower.mp3 | 20-Apr-2007 14:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | safflorite.mp3 | 20-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | saffian.mp3 | 20-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | safeway.mp3 | 20-Apr-2007 14:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | safetyman.mp3 | 20-Apr-2007 14:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | safety.mp3 | 20-Apr-2007 14:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | safen.mp3 | 20-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | safely.mp3 | 20-Apr-2007 14:59 | 17K | |
![[SND]](/icons/sound2.gif) | safelight.mp3 | 20-Apr-2007 14:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | safekeeping.mp3 | 20-Apr-2007 14:59 | 10K | |
![[SND]](/icons/sound2.gif) | safeguard.mp3 | 20-Apr-2007 14:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | safecracking.mp3 | 20-Apr-2007 14:58 | 10K | |
![[SND]](/icons/sound2.gif) | safecracker.mp3 | 20-Apr-2007 14:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | safe.mp3 | 20-Apr-2007 14:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | safe-conduct.mp3 | 20-Apr-2007 14:58 | 11K | |
![[SND]](/icons/sound2.gif) | safavid.mp3 | 20-Apr-2007 14:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | safari.mp3 | 20-Apr-2007 14:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | safaandmarwa.mp3 | 20-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | saeva indignatio.mp3 | 20-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | saeter.mp3 | 20-Apr-2007 14:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | saehrimnir.mp3 | 20-Apr-2007 14:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | saef.mp3 | 20-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | sae.mp3 | 20-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | sadowa.mp3 | 20-Apr-2007 14:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | sadomasochistic.mp3 | 20-Apr-2007 14:58 | 13K | |
![[SND]](/icons/sound2.gif) | sadomasochist.mp3 | 20-Apr-2007 14:58 | 12K | |
![[SND]](/icons/sound2.gif) | sadomasochism.mp3 | 20-Apr-2007 14:58 | 13K | |
![[SND]](/icons/sound2.gif) | sadomaso.mp3 | 20-Apr-2007 14:58 | 17K | |
![[SND]](/icons/sound2.gif) | sadoc.mp3 | 20-Apr-2007 14:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | sado.mp3 | 20-Apr-2007 14:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | sadness.mp3 | 20-Apr-2007 14:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | sadly.mp3 | 20-Apr-2007 14:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | sadlerswells.mp3 | 20-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | sadistically.mp3 | 20-Apr-2007 14:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | sadistic.mp3 | 20-Apr-2007 14:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | sadist.mp3 | 20-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sadism.mp3 | 20-Apr-2007 14:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | sadiron.mp3 | 20-Apr-2007 14:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | sadiemaisie.mp3 | 20-Apr-2007 14:57 | 17K | |
![[SND]](/icons/sound2.gif) | sadie.mp3 | 20-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sadi.mp3 | 20-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sadhu.mp3 | 20-Apr-2007 14:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | sadhika.mp3 | 20-Apr-2007 14:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | sadhe.mp3 | 20-Apr-2007 14:57 | 5.9K | |
![[SND]](/icons/sound2.gif) | sadhaka.mp3 | 20-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | sade.mp3 | 20-Apr-2007 14:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | saddling.mp3 | 20-Apr-2007 14:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | saddletree.mp3 | 20-Apr-2007 14:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | saddlery.mp3 | 20-Apr-2007 14:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | saddler.mp3 | 20-Apr-2007 14:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | saddleless.mp3 | 20-Apr-2007 14:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | saddlecloth.mp3 | 20-Apr-2007 14:56 | 11K | |
![[SND]](/icons/sound2.gif) | saddlebred.mp3 | 20-Apr-2007 14:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | saddlebow.mp3 | 20-Apr-2007 14:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | saddlebag.mp3 | 20-Apr-2007 14:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | saddle.mp3 | 20-Apr-2007 14:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | saddish.mp3 | 20-Apr-2007 14:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | saddhu.mp3 | 20-Apr-2007 14:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | saddharmapundarika.mp3 | 20-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | saddening.mp3 | 20-Apr-2007 14:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | sadden.mp3 | 20-Apr-2007 14:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | sadd.mp3 | 20-Apr-2007 14:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | sadat.mp3 | 20-Apr-2007 14:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | sadaqat.mp3 | 20-Apr-2007 14:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | sad.mp3 | 20-Apr-2007 14:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | sacrum.mp3 | 20-Apr-2007 14:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | sacrosciatic.mp3 | 20-Apr-2007 14:56 | 17K | |
![[SND]](/icons/sound2.gif) | sacrosanctity.mp3 | 20-Apr-2007 14:56 | 12K | |
![[SND]](/icons/sound2.gif) | sacrosanct.mp3 | 20-Apr-2007 14:56 | 10K | |
![[SND]](/icons/sound2.gif) | sacroiliac.mp3 | 20-Apr-2007 14:56 | 11K | |
![[SND]](/icons/sound2.gif) | sacro.mp3 | 20-Apr-2007 14:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | sacristy.mp3 | 20-Apr-2007 14:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | sacristan.mp3 | 20-Apr-2007 14:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | sacrist.mp3 | 20-Apr-2007 14:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | sacring.mp3 | 20-Apr-2007 14:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | sacrilegious.mp3 | 20-Apr-2007 14:55 | 11K | |
![[SND]](/icons/sound2.gif) | sacrilege.mp3 | 20-Apr-2007 14:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | sacrificially.mp3 | 20-Apr-2007 14:55 | 11K | |
![[SND]](/icons/sound2.gif) | sacrificial.mp3 | 20-Apr-2007 14:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | sacrifice.mp3 | 20-Apr-2007 14:55 | 11K | |
![[SND]](/icons/sound2.gif) | sacred.mp3 | 20-Apr-2007 14:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | sacrecoeur.mp3 | 20-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | sacrebleu.mp3 | 20-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | sacre bleu.mp3 | 20-Apr-2007 14:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | sacre.mp3 | 20-Apr-2007 14:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | sacraromanarota.mp3 | 20-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | sacrarium.mp3 | 20-Apr-2007 14:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | sacraria.mp3 | 20-Apr-2007 14:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | sacramentary.mp3 | 20-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | sacramentarian.mp3 | 20-Apr-2007 14:55 | 17K | |
![[SND]](/icons/sound2.gif) | sacramentally.mp3 | 20-Apr-2007 14:55 | 11K | |
![[SND]](/icons/sound2.gif) | sacramentalist.mp3 | 20-Apr-2007 14:55 | 12K | |
![[SND]](/icons/sound2.gif) | sacramentalism.mp3 | 20-Apr-2007 14:55 | 12K | |
![[SND]](/icons/sound2.gif) | sacramental.mp3 | 20-Apr-2007 14:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | sacrament.mp3 | 20-Apr-2007 14:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | sacralize.mp3 | 20-Apr-2007 14:54 | 12K | |
![[SND]](/icons/sound2.gif) | sacralization.mp3 | 20-Apr-2007 14:54 | 11K | |
![[SND]](/icons/sound2.gif) | sacral.mp3 | 20-Apr-2007 14:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | sacra.mp3 | 20-Apr-2007 14:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | sacr.mp3 | 20-Apr-2007 14:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | sacque.mp3 | 20-Apr-2007 14:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | saclike.mp3 | 20-Apr-2007 14:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | sackvillewest.mp3 | 20-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | sackless.mp3 | 20-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | sacking.mp3 | 20-Apr-2007 14:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | sackful.mp3 | 20-Apr-2007 14:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | sacker.mp3 | 20-Apr-2007 14:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | sackcloth.mp3 | 20-Apr-2007 14:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | sackbut.mp3 | 20-Apr-2007 14:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | sack.mp3 | 20-Apr-2007 14:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | sachsenanhalt.mp3 | 20-Apr-2007 14:54 | 17K | |
![[SND]](/icons/sound2.gif) | sacheted.mp3 | 20-Apr-2007 14:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | sachet.mp3 | 20-Apr-2007 14:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | sachertorte.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | sachermasoch.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | sachemic.mp3 | 20-Apr-2007 14:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | sachem.mp3 | 20-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | sacerdotally.mp3 | 20-Apr-2007 14:53 | 11K | |
![[SND]](/icons/sound2.gif) | sacerdotalize.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | sacerdotalist.mp3 | 20-Apr-2007 14:53 | 12K | |
![[SND]](/icons/sound2.gif) | sacerdotalism.mp3 | 20-Apr-2007 14:53 | 13K | |
![[SND]](/icons/sound2.gif) | sacerdotal.mp3 | 20-Apr-2007 14:53 | 9.8K | |
![[SND]](/icons/sound2.gif) | sacerdotage.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | sacerdocy.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | sacellum.mp3 | 20-Apr-2007 14:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | sacculus.mp3 | 20-Apr-2007 14:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | sacculi.mp3 | 20-Apr-2007 14:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | saccule.mp3 | 20-Apr-2007 14:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | sacculation.mp3 | 20-Apr-2007 14:53 | 10K | |
![[SND]](/icons/sound2.gif) | sacculated.mp3 | 20-Apr-2007 14:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | sacculate.mp3 | 20-Apr-2007 14:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | saccular.mp3 | 20-Apr-2007 14:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | sacciform.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | saccidananda.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | saccharose.mp3 | 20-Apr-2007 14:53 | 17K | |
![[SND]](/icons/sound2.gif) | saccharomyces.mp3 | 20-Apr-2007 14:52 | 14K | |
![[SND]](/icons/sound2.gif) | saccharometer.mp3 | 20-Apr-2007 14:52 | 11K | |
![[SND]](/icons/sound2.gif) | saccharolytic.mp3 | 20-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | saccharoidal.mp3 | 20-Apr-2007 14:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | saccharoid.mp3 | 20-Apr-2007 14:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | saccharo.mp3 | 20-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | saccharize.mp3 | 20-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | saccharinize.mp3 | 20-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | saccharinity.mp3 | 20-Apr-2007 14:52 | 10K | |
![[SND]](/icons/sound2.gif) | saccharine.mp3 | 20-Apr-2007 14:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | saccharin.mp3 | 20-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | saccharimetry.mp3 | 20-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | saccharimeter.mp3 | 20-Apr-2007 14:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | saccharify.mp3 | 20-Apr-2007 14:52 | 10K | |
![[SND]](/icons/sound2.gif) | saccharification.mp3 | 20-Apr-2007 14:52 | 13K | |
![[SND]](/icons/sound2.gif) | sacchariferous.mp3 | 20-Apr-2007 14:52 | 17K | |
![[SND]](/icons/sound2.gif) | saccharide.mp3 | 20-Apr-2007 14:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | saccharic.mp3 | 20-Apr-2007 14:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | saccharate.mp3 | 20-Apr-2007 14:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | saccharase.mp3 | 20-Apr-2007 14:52 | 9.8K | |
![[SND]](/icons/sound2.gif) | sacchar.mp3 | 20-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | saccate.mp3 | 20-Apr-2007 14:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | saccadic.mp3 | 20-Apr-2007 14:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | saccade.mp3 | 20-Apr-2007 14:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | sacbut.mp3 | 20-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | sacaton.mp3 | 20-Apr-2007 14:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | sacalait.mp3 | 20-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sacahuiste.mp3 | 20-Apr-2007 14:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | sacahuista.mp3 | 20-Apr-2007 14:51 | 10K | |
![[SND]](/icons/sound2.gif) | sac.mp3 | 20-Apr-2007 14:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | saburra.mp3 | 20-Apr-2007 14:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | sabulous.mp3 | 20-Apr-2007 14:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | sabring.mp3 | 20-Apr-2007 14:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | sabrina.mp3 | 20-Apr-2007 14:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | sabreur.mp3 | 20-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | sabretache.mp3 | 20-Apr-2007 14:51 | 17K | |
![[SND]](/icons/sound2.gif) | sabre.mp3 | 20-Apr-2007 14:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | sabra.mp3 | 20-Apr-2007 14:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | saboteur.mp3 | 20-Apr-2007 14:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | saboted.mp3 | 20-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sabotage.mp3 | 20-Apr-2007 14:51 | 11K | |
![[SND]](/icons/sound2.gif) | sabot.mp3 | 20-Apr-2007 14:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | sabora.mp3 | 20-Apr-2007 14:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | sablefish.mp3 | 20-Apr-2007 14:51 | 10K | |
![[SND]](/icons/sound2.gif) | sabled.mp3 | 20-Apr-2007 14:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | sable.mp3 | 20-Apr-2007 14:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | sabkha.mp3 | 20-Apr-2007 14:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | sabir.mp3 | 20-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabinesgull.mp3 | 20-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | sabinelake.mp3 | 20-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | sabina.mp3 | 20-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabin.mp3 | 20-Apr-2007 14:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | sabian.mp3 | 20-Apr-2007 14:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | sabermetrics.mp3 | 20-Apr-2007 14:50 | 12K | |
![[SND]](/icons/sound2.gif) | sabermetrician.mp3 | 20-Apr-2007 14:50 | 11K | |
![[SND]](/icons/sound2.gif) | saber.mp3 | 20-Apr-2007 14:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | saber-toothed.mp3 | 20-Apr-2007 14:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | sabenabelgianworldairlines.mp3 | 20-Apr-2007 14:50 | 27K | |
![[SND]](/icons/sound2.gif) | sabellianism.mp3 | 20-Apr-2007 14:50 | 17K | |
![[SND]](/icons/sound2.gif) | sabean.mp3 | 20-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabe.mp3 | 20-Apr-2007 14:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabbatize.mp3 | 20-Apr-2007 14:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | sabbatical.mp3 | 20-Apr-2007 14:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | sabbatic.mp3 | 20-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabbat.mp3 | 20-Apr-2007 14:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | sabayon.mp3 | 20-Apr-2007 14:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | sabattiereffect.mp3 | 20-Apr-2007 14:49 | 17K | |
![[SND]](/icons/sound2.gif) | sabaton.mp3 | 20-Apr-2007 14:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | sabata.mp3 | 20-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabaoth.mp3 | 20-Apr-2007 14:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | sabalo.mp3 | 20-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabaism.mp3 | 20-Apr-2007 14:49 | 17K | |
![[SND]](/icons/sound2.gif) | sabaean.mp3 | 20-Apr-2007 14:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | sabadilla.mp3 | 20-Apr-2007 14:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | sab.mp3 | 20-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | saavedralamas.mp3 | 20-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | saatchiandsaatchi.mp3 | 20-Apr-2007 14:48 | 17K | |
![[SND]](/icons/sound2.gif) | saadi.mp3 | 20-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | saab.mp3 | 20-Apr-2007 14:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | s.mp3 | 20-Apr-2007 14:48 | 5.5K | |
![[SND]](/icons/sound2.gif) | s'more.mp3 | 21-Apr-2007 12:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | s'il vous plait.mp3 | 21-Apr-2007 11:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | Szymborska.mp3 | 21-Apr-2007 21:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | Szombathely.mp3 | 21-Apr-2007 21:11 | 11K | |
![[SND]](/icons/sound2.gif) | Szolnok.mp3 | 21-Apr-2007 21:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | Szold.mp3 | 21-Apr-2007 21:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | Szilard.mp3 | 21-Apr-2007 21:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | Szepingkai.mp3 | 21-Apr-2007 21:11 | 11K | |
![[SND]](/icons/sound2.gif) | Szent-Gyorgyi.mp3 | 21-Apr-2007 21:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | Szell.mp3 | 21-Apr-2007 21:11 | 6.3K | |
![[SND]](/icons/sound2.gif) | Szekesfehervar.mp3 | 21-Apr-2007 21:11 | 15K | |
![[SND]](/icons/sound2.gif) | Szeged.mp3 | 21-Apr-2007 21:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | Szechuan.mp3 | 21-Apr-2007 21:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Szczecin.mp3 | 21-Apr-2007 21:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | Szamos.mp3 | 21-Apr-2007 21:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Syrtis Major.mp3 | 21-Apr-2007 21:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | Syros.mp3 | 21-Apr-2007 21:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | Syrian hamster.mp3 | 21-Apr-2007 21:09 | 12K | |
![[SND]](/icons/sound2.gif) | Syrian.mp3 | 21-Apr-2007 21:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | Syriac.mp3 | 21-Apr-2007 21:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | Syria.mp3 | 21-Apr-2007 21:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | Syrah.mp3 | 21-Apr-2007 21:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | Syracuse.mp3 | 21-Apr-2007 21:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | Syracusan.mp3 | 21-Apr-2007 21:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | Syracusae.mp3 | 21-Apr-2007 21:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | Syr Dar'ya.mp3 | 21-Apr-2007 21:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | Syene.mp3 | 21-Apr-2007 20:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sydney.mp3 | 21-Apr-2007 20:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | Sybarite.mp3 | 21-Apr-2007 20:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | Switzerland.mp3 | 21-Apr-2007 20:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | Swiss.mp3 | 21-Apr-2007 20:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | Swedish.mp3 | 21-Apr-2007 20:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sweden.mp3 | 21-Apr-2007 20:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | Swede.mp3 | 21-Apr-2007 20:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | Swazi.mp3 | 21-Apr-2007 20:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | Swatow.mp3 | 21-Apr-2007 20:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | Swainson's hawk.mp3 | 21-Apr-2007 20:47 | 11K | |
![[SND]](/icons/sound2.gif) | Swabian.mp3 | 21-Apr-2007 20:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | Swabia.mp3 | 21-Apr-2007 20:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | Svizzera.mp3 | 21-Apr-2007 20:46 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sverdlovsk.mp3 | 21-Apr-2007 20:46 | 9.5K | |
![[SND]](/icons/sound2.gif) | Suzhou.mp3 | 21-Apr-2007 20:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | Susiana.mp3 | 21-Apr-2007 20:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | Susan B. Anthony Day.mp3 | 21-Apr-2007 20:41 | 16K | |
![[SND]](/icons/sound2.gif) | Susa.mp3 | 21-Apr-2007 20:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | Suruga Bay.mp3 | 21-Apr-2007 20:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | Surinamese.mp3 | 21-Apr-2007 15:50 | 11K | |
![[SND]](/icons/sound2.gif) | Surinamer.mp3 | 21-Apr-2007 15:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | Suriname.mp3 | 21-Apr-2007 15:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | Suribachi, Mount.mp3 | 21-Apr-2007 15:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sur, Point.mp3 | 21-Apr-2007 15:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | Suomi.mp3 | 21-Apr-2007 15:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sunni.mp3 | 21-Apr-2007 15:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sunday.mp3 | 21-Apr-2007 15:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sunday-go-to-meeting.mp3 | 21-Apr-2007 15:38 | 12K | |
![[SND]](/icons/sound2.gif) | Sun Yat-sen.mp3 | 21-Apr-2007 15:38 | 11K | |
![[SND]](/icons/sound2.gif) | Sumter.mp3 | 21-Apr-2007 15:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sumatran.mp3 | 21-Apr-2007 15:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sumatra.mp3 | 21-Apr-2007 15:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sulu Archipelago.mp3 | 21-Apr-2007 15:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sullivan.mp3 | 21-Apr-2007 15:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sulawesi.mp3 | 21-Apr-2007 15:31 | 9.6K | |
![[SND]](/icons/sound2.gif) | Sukarnapura.mp3 | 21-Apr-2007 15:31 | 11K | |
![[SND]](/icons/sound2.gif) | Suisun Bay.mp3 | 21-Apr-2007 15:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | Suisse.mp3 | 21-Apr-2007 15:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | Suffolk.mp3 | 21-Apr-2007 15:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | Suez.mp3 | 21-Apr-2007 15:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sudirman Range.mp3 | 21-Apr-2007 15:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sudan grass.mp3 | 21-Apr-2007 15:26 | 13K | |
![[SND]](/icons/sound2.gif) | Sudan.mp3 | 21-Apr-2007 15:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | Suchow.mp3 | 21-Apr-2007 15:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | Suarez Gonzalez.mp3 | 21-Apr-2007 15:14 | 15K | |
![[SND]](/icons/sound2.gif) | Stuart.mp3 | 21-Apr-2007 15:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | Strymonic Gulf.mp3 | 21-Apr-2007 15:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | Stromlo, Mount.mp3 | 21-Apr-2007 15:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | Strimonikos Kolpos.mp3 | 21-Apr-2007 15:02 | 16K | |
![[SND]](/icons/sound2.gif) | Strimon, Gulf of.mp3 | 21-Apr-2007 15:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | Stratford-upon-Avon.mp3 | 21-Apr-2007 14:56 | 15K | |
![[SND]](/icons/sound2.gif) | Straits dollar.mp3 | 21-Apr-2007 14:54 | 11K | |
![[SND]](/icons/sound2.gif) | Stour.mp3 | 21-Apr-2007 14:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | Stonehenge.mp3 | 21-Apr-2007 14:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | Stokes' aster.mp3 | 21-Apr-2007 14:45 | 12K | |
![[SND]](/icons/sound2.gif) | Stoke Newington.mp3 | 21-Apr-2007 14:45 | 12K | |
![[SND]](/icons/sound2.gif) | Stoke-on-Trent.mp3 | 21-Apr-2007 14:45 | 11K | |
![[SND]](/icons/sound2.gif) | Stoicism.mp3 | 21-Apr-2007 14:45 | 10K | |
![[SND]](/icons/sound2.gif) | Stockholm.mp3 | 21-Apr-2007 14:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | Stirling engine.mp3 | 21-Apr-2007 14:41 | 12K | |
![[SND]](/icons/sound2.gif) | Stirling's formula.mp3 | 21-Apr-2007 14:41 | 13K | |
![[SND]](/icons/sound2.gif) | Stieglitz.mp3 | 21-Apr-2007 14:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | Stewart.mp3 | 21-Apr-2007 14:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | Stevenson.mp3 | 21-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | Stevens Point.mp3 | 21-Apr-2007 14:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | Stettin.mp3 | 21-Apr-2007 14:34 | 9.5K | |
![[SND]](/icons/sound2.gif) | Stephen.mp3 | 21-Apr-2007 14:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | Steller's jay.mp3 | 21-Apr-2007 14:27 | 11K | |
![[SND]](/icons/sound2.gif) | Steinbeck.mp3 | 21-Apr-2007 14:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | Steens Mountain.mp3 | 21-Apr-2007 14:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | Steele.mp3 | 21-Apr-2007 14:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | Stebark.mp3 | 21-Apr-2007 14:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | Stavropol'.mp3 | 21-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | Statia.mp3 | 21-Apr-2007 14:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | Staten Island.mp3 | 21-Apr-2007 14:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | Starr.mp3 | 21-Apr-2007 14:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | Star of David.mp3 | 21-Apr-2007 14:15 | 12K | |
![[SND]](/icons/sound2.gif) | Stanton.mp3 | 21-Apr-2007 14:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | Stanleyville.mp3 | 21-Apr-2007 14:14 | 9.3K | |
![[SND]](/icons/sound2.gif) | Stanley.mp3 | 21-Apr-2007 14:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | Stanislaw I.mp3 | 21-Apr-2007 14:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | Stanislavski method.mp3 | 21-Apr-2007 14:13 | 13K | |
![[SND]](/icons/sound2.gif) | Stanislav.mp3 | 21-Apr-2007 14:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | Stanford-Binet test.mp3 | 21-Apr-2007 14:13 | 16K | |
![[SND]](/icons/sound2.gif) | Stalinsk.mp3 | 21-Apr-2007 14:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | Stalino.mp3 | 21-Apr-2007 14:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | Stalingrad.mp3 | 21-Apr-2007 14:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | Stalinabad.mp3 | 21-Apr-2007 14:10 | 10K | |
![[SND]](/icons/sound2.gif) | Stalin.mp3 | 21-Apr-2007 14:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | Stakhanov.mp3 | 21-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | Staked Plain.mp3 | 21-Apr-2007 14:09 | 11K | |
![[SND]](/icons/sound2.gif) | Staffordshire bull terrier.mp3 | 21-Apr-2007 14:07 | 18K | |
![[SND]](/icons/sound2.gif) | Stabat Mater.mp3 | 21-Apr-2007 14:05 | 13K | |
![[SND]](/icons/sound2.gif) | Ssu-p'ing.mp3 | 21-Apr-2007 14:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sri Lankan.mp3 | 21-Apr-2007 14:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sri Lanka.mp3 | 21-Apr-2007 14:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sri Jayawardenepura Kotte.mp3 | 21-Apr-2007 14:04 | 27K | |
![[SND]](/icons/sound2.gif) | Sri.mp3 | 21-Apr-2007 14:05 | 5.7K | |
![[SND]](/icons/sound2.gif) | Springfield rifle.mp3 | 21-Apr-2007 13:54 | 14K | |
![[SND]](/icons/sound2.gif) | Springfield.mp3 | 21-Apr-2007 13:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | Spock.mp3 | 21-Apr-2007 13:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | Spencer Gulf.mp3 | 21-Apr-2007 13:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sparta.mp3 | 21-Apr-2007 13:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | Sparks.mp3 | 21-Apr-2007 13:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | Spanish Main.mp3 | 21-Apr-2007 13:21 | 6.1K | |
![[SND]](/icons/sound2.gif) | Spanish.mp3 | 21-Apr-2007 13:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | Spaniard.mp3 | 21-Apr-2007 13:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | Spanglish.mp3 | 21-Apr-2007 13:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | Spam.mp3 | 21-Apr-2007 13:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | Spain.mp3 | 21-Apr-2007 13:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sovetsk.mp3 | 21-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | Southend-on-Sea.mp3 | 21-Apr-2007 13:15 | 13K | |
![[SND]](/icons/sound2.gif) | South Yemeni.mp3 | 21-Apr-2007 13:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | South Ossetia.mp3 | 21-Apr-2007 13:14 | 11K | |
![[SND]](/icons/sound2.gif) | South Moresby National Park.mp3 | 21-Apr-2007 13:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | South Kingstown.mp3 | 21-Apr-2007 13:14 | 10K | |
![[SND]](/icons/sound2.gif) | South Gate.mp3 | 21-Apr-2007 13:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | South Devon.mp3 | 21-Apr-2007 13:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | South Dakotan.mp3 | 21-Apr-2007 13:14 | 11K | |
![[SND]](/icons/sound2.gif) | South Dakota.mp3 | 21-Apr-2007 13:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | South Carolinian.mp3 | 21-Apr-2007 13:14 | 12K | |
![[SND]](/icons/sound2.gif) | South Carolina.mp3 | 21-Apr-2007 13:14 | 12K | |
![[SND]](/icons/sound2.gif) | South Bend.mp3 | 21-Apr-2007 13:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sousse.mp3 | 21-Apr-2007 13:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | Soto, de.mp3 | 21-Apr-2007 13:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sorel-Tracy.mp3 | 21-Apr-2007 13:08 | 13K | |
![[SND]](/icons/sound2.gif) | Sorbiodunum.mp3 | 21-Apr-2007 13:07 | 10K | |
![[SND]](/icons/sound2.gif) | Sorata.mp3 | 21-Apr-2007 13:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | Soong Mei-ling.mp3 | 21-Apr-2007 13:04 | 12K | |
![[SND]](/icons/sound2.gif) | Soong Ch'ing-ling.mp3 | 21-Apr-2007 13:04 | 11K | |
![[SND]](/icons/sound2.gif) | Soong Ai-ling.mp3 | 21-Apr-2007 13:04 | 11K | |
![[SND]](/icons/sound2.gif) | Soochow.mp3 | 21-Apr-2007 13:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | Soo Canals.mp3 | 21-Apr-2007 13:04 | 5.0K | |
![[SND]](/icons/sound2.gif) | Songnam.mp3 | 21-Apr-2007 13:02 | 11K | |
![[SND]](/icons/sound2.gif) | Sondheim.mp3 | 21-Apr-2007 13:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | Somes.mp3 | 21-Apr-2007 12:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | Somalia.mp3 | 21-Apr-2007 12:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | Solway Firth.mp3 | 21-Apr-2007 12:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | Solvay process.mp3 | 21-Apr-2007 12:57 | 12K | |
![[SND]](/icons/sound2.gif) | Solomon.mp3 | 21-Apr-2007 12:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | Soliman.mp3 | 21-Apr-2007 12:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Solent, The.mp3 | 21-Apr-2007 12:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | Solapur.mp3 | 21-Apr-2007 12:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sol.mp3 | 21-Apr-2007 12:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sogne Fjord.mp3 | 21-Apr-2007 12:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sofiya.mp3 | 21-Apr-2007 12:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sofia.mp3 | 21-Apr-2007 12:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sodoma.mp3 | 21-Apr-2007 12:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sodom.mp3 | 21-Apr-2007 12:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | Sodertalje.mp3 | 21-Apr-2007 12:46 | 10K | |
![[SND]](/icons/sound2.gif) | Soddy.mp3 | 21-Apr-2007 12:46 | 6.1K | |
![[SND]](/icons/sound2.gif) | Socratically.mp3 | 21-Apr-2007 12:46 | 9.5K | |
![[SND]](/icons/sound2.gif) | Socratic.mp3 | 21-Apr-2007 12:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Socrates.mp3 | 21-Apr-2007 12:46 | 9.6K | |
![[SND]](/icons/sound2.gif) | Socotra.mp3 | 21-Apr-2007 12:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | Socorro.mp3 | 21-Apr-2007 12:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | Socinus.mp3 | 21-Apr-2007 12:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | Socinianism.mp3 | 21-Apr-2007 12:43 | 11K | |
![[SND]](/icons/sound2.gif) | Socinian.mp3 | 21-Apr-2007 12:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | Society Islands.mp3 | 21-Apr-2007 12:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sochi.mp3 | 21-Apr-2007 12:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | Soca.mp3 | 21-Apr-2007 12:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sobat.mp3 | 21-Apr-2007 12:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | Soave.mp3 | 21-Apr-2007 12:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | Soares.mp3 | 21-Apr-2007 12:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | Snyders.mp3 | 21-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | Snowdonia.mp3 | 21-Apr-2007 12:37 | 9.6K | |
![[SND]](/icons/sound2.gif) | Snowdon.mp3 | 21-Apr-2007 12:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | Snowden.mp3 | 21-Apr-2007 12:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | Snow Mountains.mp3 | 21-Apr-2007 12:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | Snorri Sturluson.mp3 | 21-Apr-2007 12:36 | 13K | |
![[SND]](/icons/sound2.gif) | Snoqualmie Falls.mp3 | 21-Apr-2007 12:36 | 9.3K | |
![[SND]](/icons/sound2.gif) | Snead.mp3 | 21-Apr-2007 12:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | Smyth.mp3 | 21-Apr-2007 12:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | Smyrna.mp3 | 21-Apr-2007 12:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | Smuts.mp3 | 21-Apr-2007 12:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | Smollett.mp3 | 21-Apr-2007 12:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | Smolensk.mp3 | 21-Apr-2007 12:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | Smithson.mp3 | 21-Apr-2007 12:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | Smithfield ham.mp3 | 21-Apr-2007 12:24 | 14K | |
![[SND]](/icons/sound2.gif) | Smetana.mp3 | 21-Apr-2007 12:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | Smalley.mp3 | 21-Apr-2007 12:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | Slovensko.mp3 | 21-Apr-2007 12:15 | 11K | |
![[SND]](/icons/sound2.gif) | Slovenian.mp3 | 21-Apr-2007 12:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | Slovenia.mp3 | 21-Apr-2007 12:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | Slovene.mp3 | 21-Apr-2007 12:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | Slovakian.mp3 | 21-Apr-2007 12:15 | 10K | |
![[SND]](/icons/sound2.gif) | Slovakia.mp3 | 21-Apr-2007 12:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | Slovak.mp3 | 21-Apr-2007 12:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | Slocum.mp3 | 21-Apr-2007 12:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sloan.mp3 | 21-Apr-2007 12:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sligo.mp3 | 21-Apr-2007 12:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | Slidell.mp3 | 21-Apr-2007 12:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | Slide Mountain.mp3 | 21-Apr-2007 12:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | Slesvig.mp3 | 21-Apr-2007 12:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sleaford.mp3 | 21-Apr-2007 12:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | Slavophilism.mp3 | 21-Apr-2007 12:05 | 11K | |
![[SND]](/icons/sound2.gif) | Slavophile.mp3 | 21-Apr-2007 12:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | Slavophil.mp3 | 21-Apr-2007 12:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | Slavonic.mp3 | 21-Apr-2007 12:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Slavonian.mp3 | 21-Apr-2007 12:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | Slavonia.mp3 | 21-Apr-2007 12:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | Slavkov.mp3 | 21-Apr-2007 12:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | Slavist.mp3 | 21-Apr-2007 12:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | Slavicist.mp3 | 21-Apr-2007 12:05 | 10K | |
![[SND]](/icons/sound2.gif) | Slavic.mp3 | 21-Apr-2007 12:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | Slav.mp3 | 21-Apr-2007 12:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | Skyros.mp3 | 21-Apr-2007 12:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | Skye terrier.mp3 | 21-Apr-2007 11:59 | 11K | |
![[SND]](/icons/sound2.gif) | Skye.mp3 | 21-Apr-2007 11:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | Skryabin.mp3 | 21-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Skou.mp3 | 21-Apr-2007 11:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | Skopje.mp3 | 21-Apr-2007 11:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | Skokie.mp3 | 21-Apr-2007 11:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | Skoda.mp3 | 21-Apr-2007 11:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | Skivvies.mp3 | 21-Apr-2007 11:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | Skiros.mp3 | 21-Apr-2007 11:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | Skinnerian.mp3 | 21-Apr-2007 11:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | Skinner box.mp3 | 21-Apr-2007 11:55 | 10K | |
![[SND]](/icons/sound2.gif) | Skikda.mp3 | 21-Apr-2007 11:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | Skiddaw.mp3 | 21-Apr-2007 11:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | Skeltonics.mp3 | 21-Apr-2007 11:51 | 11K | |
![[SND]](/icons/sound2.gif) | Skeltonic.mp3 | 21-Apr-2007 11:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | Skelton.mp3 | 21-Apr-2007 11:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | Skeena.mp3 | 21-Apr-2007 11:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | Skeat.mp3 | 21-Apr-2007 11:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | Skaw, The.mp3 | 21-Apr-2007 11:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | Skaneateles Lake.mp3 | 21-Apr-2007 11:48 | 11K | |
![[SND]](/icons/sound2.gif) | Skagit.mp3 | 21-Apr-2007 11:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | Skagerrak.mp3 | 21-Apr-2007 11:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | Skagens Odde.mp3 | 21-Apr-2007 11:47 | 10K | |
![[SND]](/icons/sound2.gif) | Sjalland.mp3 | 21-Apr-2007 11:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sixtine.mp3 | 21-Apr-2007 11:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | Siwash.mp3 | 21-Apr-2007 11:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | Siwalik Range.mp3 | 21-Apr-2007 11:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | Siwa.mp3 | 21-Apr-2007 11:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | Sivas.mp3 | 21-Apr-2007 11:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sivan.mp3 | 21-Apr-2007 11:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | Siva.mp3 | 21-Apr-2007 11:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sitwell.mp3 | 21-Apr-2007 11:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sittwe.mp3 | 21-Apr-2007 11:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sitting Bull.mp3 | 21-Apr-2007 11:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sittang.mp3 | 21-Apr-2007 11:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sitka spruce.mp3 | 21-Apr-2007 11:43 | 12K | |
![[SND]](/icons/sound2.gif) | Sisyphus.mp3 | 21-Apr-2007 11:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sisyphian.mp3 | 21-Apr-2007 11:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sisyphean.mp3 | 21-Apr-2007 11:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | Siswati.mp3 | 21-Apr-2007 11:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sistine.mp3 | 21-Apr-2007 11:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sismondi.mp3 | 21-Apr-2007 11:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sisley.mp3 | 21-Apr-2007 11:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | Siskiyou Mountains.mp3 | 21-Apr-2007 11:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | Siros.mp3 | 21-Apr-2007 11:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sirmilik National Park.mp3 | 21-Apr-2007 11:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sirius.mp3 | 21-Apr-2007 11:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | Siret.mp3 | 21-Apr-2007 11:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | Siraj-ud-Dawlah.mp3 | 21-Apr-2007 11:39 | 11K | |
![[SND]](/icons/sound2.gif) | Siracusa.mp3 | 21-Apr-2007 11:39 | 11K | |
![[SND]](/icons/sound2.gif) | Sirach.mp3 | 21-Apr-2007 11:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sir Roger de Coverley.mp3 | 21-Apr-2007 11:39 | 14K | |
![[SND]](/icons/sound2.gif) | Siqueiros.mp3 | 21-Apr-2007 11:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sippar.mp3 | 21-Apr-2007 11:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | Siping.mp3 | 21-Apr-2007 11:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sioux City.mp3 | 21-Apr-2007 11:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | Sioux.mp3 | 21-Apr-2007 11:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | Siouan.mp3 | 21-Apr-2007 11:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sion.mp3 | 21-Apr-2007 11:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sinuiju.mp3 | 21-Apr-2007 11:37 | 11K | |
![[SND]](/icons/sound2.gif) | Sint Maarten.mp3 | 21-Apr-2007 11:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sint-Niklaas.mp3 | 21-Apr-2007 11:37 | 15K | |
![[SND]](/icons/sound2.gif) | Sinsiang.mp3 | 21-Apr-2007 11:37 | 10K | |
![[SND]](/icons/sound2.gif) | Sinope.mp3 | 21-Apr-2007 11:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sinop.mp3 | 21-Apr-2007 11:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sino-Tibetan.mp3 | 21-Apr-2007 11:37 | 10K | |
![[SND]](/icons/sound2.gif) | Sino-.mp3 | 21-Apr-2007 11:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sinkiang Uighur.mp3 | 21-Apr-2007 11:36 | 12K | |
![[SND]](/icons/sound2.gif) | Sinitic.mp3 | 21-Apr-2007 11:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sinhalese.mp3 | 21-Apr-2007 11:34 | 11K | |
![[SND]](/icons/sound2.gif) | Sinhala.mp3 | 21-Apr-2007 11:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | Singhalese.mp3 | 21-Apr-2007 11:33 | 11K | |
![[SND]](/icons/sound2.gif) | Singh.mp3 | 21-Apr-2007 11:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | Singaporean.mp3 | 21-Apr-2007 11:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | Singapore.mp3 | 21-Apr-2007 11:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sindhi.mp3 | 21-Apr-2007 11:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sindh.mp3 | 21-Apr-2007 11:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sindbad.mp3 | 21-Apr-2007 11:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sinclair.mp3 | 21-Apr-2007 11:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sinbad.mp3 | 21-Apr-2007 11:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sinatra.mp3 | 21-Apr-2007 11:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sinaloa.mp3 | 21-Apr-2007 11:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sinaitic.mp3 | 21-Apr-2007 11:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sinai.mp3 | 21-Apr-2007 11:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | Simsbury.mp3 | 21-Apr-2007 11:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sims.mp3 | 21-Apr-2007 11:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | Simpson.mp3 | 21-Apr-2007 11:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | Simpson's rule.mp3 | 21-Apr-2007 11:29 | 10K | |
![[SND]](/icons/sound2.gif) | Simplon Pass.mp3 | 21-Apr-2007 11:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | Simonstown.mp3 | 21-Apr-2007 11:27 | 11K | |
![[SND]](/icons/sound2.gif) | Simonides.mp3 | 21-Apr-2007 11:27 | 11K | |
![[SND]](/icons/sound2.gif) | Simon Magus.mp3 | 21-Apr-2007 11:27 | 11K | |
![[SND]](/icons/sound2.gif) | Simon Legree.mp3 | 21-Apr-2007 11:27 | 11K | |
![[SND]](/icons/sound2.gif) | Simon.mp3 | 21-Apr-2007 11:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | Simmenthal.mp3 | 21-Apr-2007 11:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | Simmental.mp3 | 21-Apr-2007 11:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | Simla.mp3 | 21-Apr-2007 11:26 | 6.1K | |
![[SND]](/icons/sound2.gif) | Simi Valley.mp3 | 21-Apr-2007 11:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | Simferopol.mp3 | 21-Apr-2007 11:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | Simeon Stylites.mp3 | 21-Apr-2007 11:25 | 14K | |
![[SND]](/icons/sound2.gif) | Simeon.mp3 | 21-Apr-2007 11:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | Simenon.mp3 | 21-Apr-2007 11:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | Simcoe, Lake.mp3 | 21-Apr-2007 11:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | Simchas Torah.mp3 | 21-Apr-2007 11:25 | 10K | |
![[SND]](/icons/sound2.gif) | Simbirsk.mp3 | 21-Apr-2007 11:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | Silva, da.mp3 | 21-Apr-2007 11:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | Silurian.mp3 | 21-Apr-2007 11:23 | 10K | |
![[SND]](/icons/sound2.gif) | Silures.mp3 | 21-Apr-2007 11:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | Silone.mp3 | 21-Apr-2007 11:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | Silesian.mp3 | 21-Apr-2007 11:20 | 10K | |
![[SND]](/icons/sound2.gif) | Silesia.mp3 | 21-Apr-2007 11:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | Silastic.mp3 | 21-Apr-2007 11:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sikyon.mp3 | 21-Apr-2007 11:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sikorsky.mp3 | 21-Apr-2007 11:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sikorski.mp3 | 21-Apr-2007 11:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sikkimese.mp3 | 21-Apr-2007 11:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sikkim.mp3 | 21-Apr-2007 11:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sikhote-Alin'.mp3 | 21-Apr-2007 11:19 | 12K | |
![[SND]](/icons/sound2.gif) | Sikhism.mp3 | 21-Apr-2007 11:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sikh.mp3 | 21-Apr-2007 11:18 | 4.8K | |
![[SND]](/icons/sound2.gif) | Sikang.mp3 | 21-Apr-2007 11:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sigurdsson.mp3 | 21-Apr-2007 11:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sigurd.mp3 | 21-Apr-2007 11:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sigismund.mp3 | 21-Apr-2007 11:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sieyes.mp3 | 21-Apr-2007 11:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sierra de Guadarrama.mp3 | 21-Apr-2007 11:12 | 15K | |
![[SND]](/icons/sound2.gif) | Sierra de Gredos.mp3 | 21-Apr-2007 11:12 | 14K | |
![[SND]](/icons/sound2.gif) | Sierra Vista.mp3 | 21-Apr-2007 11:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sierra Nevada de Santa Marta.mp3 | 21-Apr-2007 11:13 | 21K | |
![[SND]](/icons/sound2.gif) | Sierra Nevada de Merida.mp3 | 21-Apr-2007 11:13 | 19K | |
![[SND]](/icons/sound2.gif) | Sierra Nevada.mp3 | 21-Apr-2007 11:13 | 11K | |
![[SND]](/icons/sound2.gif) | Sierra Morena.mp3 | 21-Apr-2007 11:13 | 13K | |
![[SND]](/icons/sound2.gif) | Sierra Madre del Sur.mp3 | 21-Apr-2007 11:13 | 17K | |
![[SND]](/icons/sound2.gif) | Sierra Madre Oriental.mp3 | 21-Apr-2007 11:13 | 19K | |
![[SND]](/icons/sound2.gif) | Sierra Madre Occidental.mp3 | 21-Apr-2007 11:13 | 21K | |
![[SND]](/icons/sound2.gif) | Sierra Leonean.mp3 | 21-Apr-2007 11:12 | 13K | |
![[SND]](/icons/sound2.gif) | Sierra Leone.mp3 | 21-Apr-2007 11:12 | 12K | |
![[SND]](/icons/sound2.gif) | Sierra Blanca Peak.mp3 | 21-Apr-2007 11:12 | 11K | |
![[SND]](/icons/sound2.gif) | Siennese.mp3 | 21-Apr-2007 11:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sienkiewicz.mp3 | 21-Apr-2007 11:12 | 10K | |
![[SND]](/icons/sound2.gif) | Siegfried.mp3 | 21-Apr-2007 11:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | Siegbahn.mp3 | 21-Apr-2007 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Siebengebirge.mp3 | 21-Apr-2007 11:12 | 11K | |
![[SND]](/icons/sound2.gif) | Sidra, Gulf of.mp3 | 21-Apr-2007 11:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sidonian.mp3 | 21-Apr-2007 11:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sidon.mp3 | 21-Apr-2007 11:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sidney.mp3 | 21-Apr-2007 11:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | Sidi Bel Abbes.mp3 | 21-Apr-2007 11:11 | 12K | |
![[SND]](/icons/sound2.gif) | Sidi Barrani.mp3 | 21-Apr-2007 11:11 | 10K | |
![[SND]](/icons/sound2.gif) | Siddons.mp3 | 21-Apr-2007 11:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | Siddhartha Gautama.mp3 | 21-Apr-2007 11:08 | 13K | |
![[SND]](/icons/sound2.gif) | Sicyon.mp3 | 21-Apr-2007 11:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sickles.mp3 | 21-Apr-2007 11:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sicily.mp3 | 21-Apr-2007 11:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sicilian.mp3 | 21-Apr-2007 11:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sicilia.mp3 | 21-Apr-2007 11:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sichuan.mp3 | 21-Apr-2007 11:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sibuyan Sea.mp3 | 21-Apr-2007 11:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sibiu.mp3 | 21-Apr-2007 11:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | Siberian husky.mp3 | 21-Apr-2007 11:05 | 13K | |
![[SND]](/icons/sound2.gif) | Siberian.mp3 | 21-Apr-2007 11:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | Siberia.mp3 | 21-Apr-2007 11:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sibelius.mp3 | 21-Apr-2007 11:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Siangtan.mp3 | 21-Apr-2007 11:05 | 10K | |
![[SND]](/icons/sound2.gif) | Sian.mp3 | 21-Apr-2007 11:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | Siamese.mp3 | 21-Apr-2007 11:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Siam.mp3 | 21-Apr-2007 11:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sialkot.mp3 | 21-Apr-2007 11:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | Shymkent.mp3 | 21-Apr-2007 11:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shvernik.mp3 | 21-Apr-2007 11:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shute.mp3 | 21-Apr-2007 11:03 | 5.2K | |
![[SND]](/icons/sound2.gif) | Shushan.mp3 | 21-Apr-2007 11:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shumagin.mp3 | 21-Apr-2007 11:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shultz.mp3 | 21-Apr-2007 11:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shull.mp3 | 21-Apr-2007 11:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shuangliao.mp3 | 21-Apr-2007 11:01 | 9.8K | |
![[SND]](/icons/sound2.gif) | Shrovetide.mp3 | 21-Apr-2007 11:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | Shrove Tuesday.mp3 | 21-Apr-2007 11:00 | 12K | |
![[SND]](/icons/sound2.gif) | Shropshire.mp3 | 21-Apr-2007 11:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | Shriner.mp3 | 21-Apr-2007 11:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | Shrewsbury.mp3 | 21-Apr-2007 10:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | Shreveport.mp3 | 21-Apr-2007 10:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | Shostakovich.mp3 | 21-Apr-2007 10:55 | 11K | |
![[SND]](/icons/sound2.gif) | Shoshoni.mp3 | 21-Apr-2007 10:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | Shoshone.mp3 | 21-Apr-2007 10:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | Shortland Islands.mp3 | 21-Apr-2007 10:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shoreview.mp3 | 21-Apr-2007 10:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | Shoreditch.mp3 | 21-Apr-2007 10:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | Shona.mp3 | 21-Apr-2007 10:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sholokhov.mp3 | 21-Apr-2007 10:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sholapur.mp3 | 21-Apr-2007 10:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | Shockley.mp3 | 21-Apr-2007 10:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | Shoah.mp3 | 21-Apr-2007 10:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shkoder.mp3 | 21-Apr-2007 10:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shizuoka.mp3 | 21-Apr-2007 10:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | Shiva.mp3 | 21-Apr-2007 10:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | Shishaldin.mp3 | 21-Apr-2007 10:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | Shirley poppy.mp3 | 21-Apr-2007 10:45 | 12K | |
![[SND]](/icons/sound2.gif) | Shirley.mp3 | 21-Apr-2007 10:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shirer.mp3 | 21-Apr-2007 10:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shiraz.mp3 | 21-Apr-2007 10:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shirakawa.mp3 | 21-Apr-2007 10:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | Shipley.mp3 | 21-Apr-2007 10:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | Shintoistic.mp3 | 21-Apr-2007 10:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | Shintoist.mp3 | 21-Apr-2007 10:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | Shintoism.mp3 | 21-Apr-2007 10:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | Shinto.mp3 | 21-Apr-2007 10:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shingon.mp3 | 21-Apr-2007 10:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | Shinar.mp3 | 21-Apr-2007 10:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | Shina.mp3 | 21-Apr-2007 10:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | Shimonoseki.mp3 | 21-Apr-2007 10:42 | 11K | |
![[SND]](/icons/sound2.gif) | Shimoda.mp3 | 21-Apr-2007 10:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Shimla.mp3 | 21-Apr-2007 10:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | Shimizu.mp3 | 21-Apr-2007 10:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Shiloh.mp3 | 21-Apr-2007 10:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shilluk.mp3 | 21-Apr-2007 10:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shillong.mp3 | 21-Apr-2007 10:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shilka.mp3 | 21-Apr-2007 10:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shikoku.mp3 | 21-Apr-2007 10:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | Shikarpur.mp3 | 21-Apr-2007 10:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | Shiite.mp3 | 21-Apr-2007 10:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | Shiism.mp3 | 21-Apr-2007 10:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | Shih-chia-chuang.mp3 | 21-Apr-2007 10:40 | 13K | |
![[SND]](/icons/sound2.gif) | Shigemitsu.mp3 | 21-Apr-2007 10:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | Shigatse.mp3 | 21-Apr-2007 10:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | Shidehara.mp3 | 21-Apr-2007 10:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | Shiban al-Kawm.mp3 | 21-Apr-2007 10:39 | 12K | |
![[SND]](/icons/sound2.gif) | Shiba Inu.mp3 | 21-Apr-2007 10:39 | 11K | |
![[SND]](/icons/sound2.gif) | Shia.mp3 | 21-Apr-2007 10:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shi'i.mp3 | 21-Apr-2007 10:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sheyenne.mp3 | 21-Apr-2007 10:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | Shevardnadze.mp3 | 21-Apr-2007 10:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | Shetlander.mp3 | 21-Apr-2007 10:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | Shetland.mp3 | 21-Apr-2007 10:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sherwood Forest.mp3 | 21-Apr-2007 10:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sherwood.mp3 | 21-Apr-2007 10:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sherrington.mp3 | 21-Apr-2007 10:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sherriff.mp3 | 21-Apr-2007 10:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | Sherpa.mp3 | 21-Apr-2007 10:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | Shermanesque.mp3 | 21-Apr-2007 10:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sherman.mp3 | 21-Apr-2007 10:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sheridan.mp3 | 21-Apr-2007 10:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sherbrooke.mp3 | 21-Apr-2007 10:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sheraton.mp3 | 21-Apr-2007 10:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shepard.mp3 | 21-Apr-2007 10:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sheol.mp3 | 21-Apr-2007 10:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shenyang.mp3 | 21-Apr-2007 10:36 | 9.3K | |
![[SND]](/icons/sound2.gif) | Shenstone.mp3 | 21-Apr-2007 10:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | Shensi.mp3 | 21-Apr-2007 10:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | Shenandoah.mp3 | 21-Apr-2007 10:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | Shemitish.mp3 | 21-Apr-2007 10:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | Shemitic.mp3 | 21-Apr-2007 10:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | Shemite.mp3 | 21-Apr-2007 10:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shemini Atzereth.mp3 | 21-Apr-2007 10:35 | 13K | |
![[SND]](/icons/sound2.gif) | Shema.mp3 | 21-Apr-2007 10:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shem.mp3 | 21-Apr-2007 10:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shelton.mp3 | 21-Apr-2007 10:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | Shelleyesque.mp3 | 21-Apr-2007 10:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | Shelleyan.mp3 | 21-Apr-2007 10:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | Shelley.mp3 | 21-Apr-2007 10:34 | 6.3K | |
![[SND]](/icons/sound2.gif) | Shelikof.mp3 | 21-Apr-2007 10:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sheldon.mp3 | 21-Apr-2007 10:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sheffield.mp3 | 21-Apr-2007 10:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sheetrock.mp3 | 21-Apr-2007 10:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sheeler.mp3 | 21-Apr-2007 10:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | Shechinah.mp3 | 21-Apr-2007 10:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shechem.mp3 | 21-Apr-2007 10:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | Sheboygan.mp3 | 21-Apr-2007 10:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | Shebat.mp3 | 21-Apr-2007 10:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sheba.mp3 | 21-Apr-2007 10:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | Shcherbakov.mp3 | 21-Apr-2007 10:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | Shays.mp3 | 21-Apr-2007 10:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Shawwal.mp3 | 21-Apr-2007 10:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Shawnee.mp3 | 21-Apr-2007 10:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | Shawn.mp3 | 21-Apr-2007 10:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shawangunk Mountains.mp3 | 21-Apr-2007 10:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shavian.mp3 | 21-Apr-2007 10:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | Shatt al Arab.mp3 | 21-Apr-2007 10:28 | 10K | |
![[SND]](/icons/sound2.gif) | Shastri.mp3 | 21-Apr-2007 10:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | Shasta daisy.mp3 | 21-Apr-2007 10:28 | 11K | |
![[SND]](/icons/sound2.gif) | Shasta, Mount.mp3 | 21-Apr-2007 10:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shashi.mp3 | 21-Apr-2007 10:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sharpless.mp3 | 21-Apr-2007 10:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sharpe.mp3 | 21-Apr-2007 10:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | Sharon.mp3 | 21-Apr-2007 10:26 | 13K | |
![[SND]](/icons/sound2.gif) | Sharon, Plain of.mp3 | 21-Apr-2007 10:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sharjah.mp3 | 21-Apr-2007 10:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shari.mp3 | 21-Apr-2007 10:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shapiro.mp3 | 21-Apr-2007 10:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | Shaoyang.mp3 | 21-Apr-2007 10:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | Shao-hsing.mp3 | 21-Apr-2007 10:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | Shanxi.mp3 | 21-Apr-2007 10:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | Shantou.mp3 | 21-Apr-2007 10:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | Shansi.mp3 | 21-Apr-2007 10:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | Shannon.mp3 | 21-Apr-2007 10:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | Shangri-la.mp3 | 21-Apr-2007 10:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | Shang.mp3 | 21-Apr-2007 10:23 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shang-ch'iu.mp3 | 21-Apr-2007 10:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | Shandong.mp3 | 21-Apr-2007 10:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | Shan.mp3 | 21-Apr-2007 10:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | Shan-tung.mp3 | 21-Apr-2007 10:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | Shamir.mp3 | 21-Apr-2007 10:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | Shaktism.mp3 | 21-Apr-2007 10:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | Shakti.mp3 | 21-Apr-2007 10:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | Shakta.mp3 | 21-Apr-2007 10:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | Shaksperian.mp3 | 21-Apr-2007 10:20 | 11K | |
![[SND]](/icons/sound2.gif) | Shaksperean.mp3 | 21-Apr-2007 10:20 | 11K | |
![[SND]](/icons/sound2.gif) | Shakhty.mp3 | 21-Apr-2007 10:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shakespeariana.mp3 | 21-Apr-2007 10:20 | 11K | |
![[SND]](/icons/sound2.gif) | Shakespearian.mp3 | 21-Apr-2007 10:19 | 11K | |
![[SND]](/icons/sound2.gif) | Shakespeareana.mp3 | 21-Apr-2007 10:19 | 11K | |
![[SND]](/icons/sound2.gif) | Shakespearean.mp3 | 21-Apr-2007 10:19 | 11K | |
![[SND]](/icons/sound2.gif) | Shakespeare.mp3 | 21-Apr-2007 10:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | Shakerism.mp3 | 21-Apr-2007 10:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | Shaker Heights.mp3 | 21-Apr-2007 10:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | Shahn.mp3 | 21-Apr-2007 10:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | Shah Ja.han.mp3 | 21-Apr-2007 10:18 | 11K | |
![[SND]](/icons/sound2.gif) | Shaftesbury.mp3 | 21-Apr-2007 10:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | Shadwell.mp3 | 21-Apr-2007 10:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | Shackleton.mp3 | 21-Apr-2007 10:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shabuoth.mp3 | 21-Apr-2007 10:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | Shabbat.mp3 | 21-Apr-2007 10:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | Shaban.mp3 | 21-Apr-2007 10:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | Shaba.mp3 | 21-Apr-2007 10:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | Shaanxi.mp3 | 21-Apr-2007 10:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sha-shih.mp3 | 21-Apr-2007 10:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sfax.mp3 | 21-Apr-2007 10:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | Seyss-Inquart.mp3 | 21-Apr-2007 10:14 | 10K | |
![[SND]](/icons/sound2.gif) | Seymour.mp3 | 21-Apr-2007 10:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | Seyhan.mp3 | 21-Apr-2007 10:14 | 10K | |
![[SND]](/icons/sound2.gif) | Seyfert galaxy.mp3 | 21-Apr-2007 10:14 | 12K | |
![[SND]](/icons/sound2.gif) | Seychellois.mp3 | 21-Apr-2007 10:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | Seychelles.mp3 | 21-Apr-2007 10:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sextans.mp3 | 21-Apr-2007 10:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sewell.mp3 | 21-Apr-2007 10:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | Seward Peninsula.mp3 | 21-Apr-2007 10:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | Seward.mp3 | 21-Apr-2007 10:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sevres.mp3 | 21-Apr-2007 10:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | Seville.mp3 | 21-Apr-2007 10:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sevilla.mp3 | 21-Apr-2007 10:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | Sevigne.mp3 | 21-Apr-2007 10:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sevier.mp3 | 21-Apr-2007 10:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | Severus.mp3 | 21-Apr-2007 10:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | Severnaya Zemlya.mp3 | 21-Apr-2007 10:10 | 15K | |
![[SND]](/icons/sound2.gif) | Severn River.mp3 | 21-Apr-2007 10:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sevcenko.mp3 | 21-Apr-2007 10:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sevastopol.mp3 | 21-Apr-2007 10:08 | 10K | |
![[SND]](/icons/sound2.gif) | Sevan.mp3 | 21-Apr-2007 10:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | Seurat.mp3 | 21-Apr-2007 10:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | Setubal.mp3 | 21-Apr-2007 10:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | Seton.mp3 | 21-Apr-2007 10:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | Setif.mp3 | 21-Apr-2007 10:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | Seth.mp3 | 21-Apr-2007 10:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sete Quedas.mp3 | 21-Apr-2007 10:07 | 11K | |
![[SND]](/icons/sound2.gif) | Sete.mp3 | 21-Apr-2007 10:07 | 5.4K | |
![[SND]](/icons/sound2.gif) | Sestos.mp3 | 21-Apr-2007 10:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sesto San Giovanni.mp3 | 21-Apr-2007 10:06 | 16K | |
![[SND]](/icons/sound2.gif) | Sessions.mp3 | 21-Apr-2007 10:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sesotho.mp3 | 21-Apr-2007 10:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | Servite.mp3 | 21-Apr-2007 10:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | Servia.mp3 | 21-Apr-2007 10:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | Servetus.mp3 | 21-Apr-2007 10:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sertorius.mp3 | 21-Apr-2007 10:04 | 10K | |
![[SND]](/icons/sound2.gif) | Sertoman.mp3 | 21-Apr-2007 10:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sertoli cell.mp3 | 21-Apr-2007 10:03 | 11K | |
![[SND]](/icons/sound2.gif) | Serrai.mp3 | 21-Apr-2007 10:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | Serra do Mar.mp3 | 21-Apr-2007 10:02 | 10K | |
![[SND]](/icons/sound2.gif) | Serra da Estrela.mp3 | 21-Apr-2007 10:02 | 14K | |
![[SND]](/icons/sound2.gif) | Serra Tumucumaque.mp3 | 21-Apr-2007 10:03 | 14K | |
![[SND]](/icons/sound2.gif) | Serra Parima.mp3 | 21-Apr-2007 10:02 | 10K | |
![[SND]](/icons/sound2.gif) | Serowe.mp3 | 21-Apr-2007 10:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | Serkin.mp3 | 21-Apr-2007 10:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | Seringapatam.mp3 | 21-Apr-2007 10:00 | 12K | |
![[SND]](/icons/sound2.gif) | Sergipe.mp3 | 21-Apr-2007 09:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | Serengeti Plain.mp3 | 21-Apr-2007 09:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | Serendib.mp3 | 21-Apr-2007 09:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | Serekunda.mp3 | 21-Apr-2007 09:57 | 10K | |
![[SND]](/icons/sound2.gif) | Serdica.mp3 | 21-Apr-2007 09:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | Serbo-Croatian.mp3 | 21-Apr-2007 09:57 | 12K | |
![[SND]](/icons/sound2.gif) | Serbian.mp3 | 21-Apr-2007 09:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | Serbia.mp3 | 21-Apr-2007 09:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | Serb.mp3 | 21-Apr-2007 09:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | Serapis.mp3 | 21-Apr-2007 09:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | Seram.mp3 | 21-Apr-2007 09:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sequoyah.mp3 | 21-Apr-2007 09:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sequoia National Park.mp3 | 21-Apr-2007 09:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | Septuagintal.mp3 | 21-Apr-2007 09:54 | 10K | |
![[SND]](/icons/sound2.gif) | Septuagint.mp3 | 21-Apr-2007 09:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | Septuagesima.mp3 | 21-Apr-2007 09:53 | 12K | |
![[SND]](/icons/sound2.gif) | September.mp3 | 21-Apr-2007 09:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sept-iles.mp3 | 21-Apr-2007 09:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sepik.mp3 | 21-Apr-2007 09:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sephardim.mp3 | 21-Apr-2007 09:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sephardic.mp3 | 21-Apr-2007 09:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sephardi.mp3 | 21-Apr-2007 09:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | Seoul.mp3 | 21-Apr-2007 09:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | Sens.mp3 | 21-Apr-2007 09:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sennacherib.mp3 | 21-Apr-2007 09:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sennaar.mp3 | 21-Apr-2007 09:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | Senlis.mp3 | 21-Apr-2007 09:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | Senlac.mp3 | 21-Apr-2007 09:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Senghor.mp3 | 21-Apr-2007 09:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | Senegambian.mp3 | 21-Apr-2007 09:45 | 10K | |
![[SND]](/icons/sound2.gif) | Senegambia.mp3 | 21-Apr-2007 09:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | Senegalese.mp3 | 21-Apr-2007 09:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | Senecan.mp3 | 21-Apr-2007 09:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | Seneca Lake.mp3 | 21-Apr-2007 09:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | Seneca.mp3 | 21-Apr-2007 09:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sendak.mp3 | 21-Apr-2007 09:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sendai.mp3 | 21-Apr-2007 09:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | Semmes.mp3 | 21-Apr-2007 09:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | Semitist.mp3 | 21-Apr-2007 07:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | Semitism.mp3 | 21-Apr-2007 07:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | Semitics.mp3 | 21-Apr-2007 07:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | Semiticist.mp3 | 21-Apr-2007 07:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | Semitic.mp3 | 21-Apr-2007 07:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | Semite.mp3 | 21-Apr-2007 07:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | Semipalatinsk.mp3 | 21-Apr-2007 07:57 | 12K | |
![[SND]](/icons/sound2.gif) | Seminole.mp3 | 21-Apr-2007 07:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | Seminole, Lake.mp3 | 21-Apr-2007 07:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | Semey.mp3 | 21-Apr-2007 07:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | Semenov.mp3 | 21-Apr-2007 07:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | Semele.mp3 | 21-Apr-2007 07:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | Semarang.mp3 | 21-Apr-2007 07:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | Selznick.mp3 | 21-Apr-2007 07:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Selten.mp3 | 21-Apr-2007 07:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | Selma.mp3 | 21-Apr-2007 07:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | Selkirkshire.mp3 | 21-Apr-2007 07:50 | 10K | |
![[SND]](/icons/sound2.gif) | Selkirk.mp3 | 21-Apr-2007 07:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | Seljukian.mp3 | 21-Apr-2007 07:50 | 9.8K | |
![[SND]](/icons/sound2.gif) | Seljuk.mp3 | 21-Apr-2007 07:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | Seleucus I Nicator.mp3 | 20-Apr-2007 18:01 | 13K | |
![[SND]](/icons/sound2.gif) | Seleucid.mp3 | 20-Apr-2007 18:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | Seleucia Tracheotis.mp3 | 20-Apr-2007 18:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | Seleucia Pieria.mp3 | 20-Apr-2007 18:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | Seleucia.mp3 | 20-Apr-2007 18:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | Selenga.mp3 | 20-Apr-2007 17:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | Selene.mp3 | 20-Apr-2007 17:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | Selden.mp3 | 20-Apr-2007 17:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | Selangor.mp3 | 20-Apr-2007 17:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sejanus.mp3 | 20-Apr-2007 17:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | Seim.mp3 | 20-Apr-2007 17:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | Seihun.mp3 | 20-Apr-2007 17:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | Seifert.mp3 | 20-Apr-2007 17:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | Seidlitz powders.mp3 | 20-Apr-2007 17:56 | 14K | |
![[SND]](/icons/sound2.gif) | Segovia.mp3 | 20-Apr-2007 17:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | Segal.mp3 | 20-Apr-2007 17:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | Seferiades.mp3 | 20-Apr-2007 17:54 | 11K | |
![[SND]](/icons/sound2.gif) | Seeger.mp3 | 20-Apr-2007 17:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | Seeckt.mp3 | 20-Apr-2007 17:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | Sedgemoor.mp3 | 20-Apr-2007 17:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sedan.mp3 | 20-Apr-2007 17:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | Secunderabad.mp3 | 20-Apr-2007 17:49 | 11K | |
![[SND]](/icons/sound2.gif) | Seconal.mp3 | 20-Apr-2007 17:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Seckel.mp3 | 20-Apr-2007 17:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sebastopol.mp3 | 20-Apr-2007 17:45 | 10K | |
![[SND]](/icons/sound2.gif) | Sebastia.mp3 | 20-Apr-2007 17:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sebago Lake.mp3 | 20-Apr-2007 17:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | Seattleite.mp3 | 20-Apr-2007 17:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | Seattle.mp3 | 20-Apr-2007 17:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sears.mp3 | 20-Apr-2007 17:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sea of Chinnereth.mp3 | 20-Apr-2007 17:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sea of Candia.mp3 | 20-Apr-2007 17:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | Sealyham terrier.mp3 | 20-Apr-2007 17:41 | 14K | |
![[SND]](/icons/sound2.gif) | Seaborg.mp3 | 20-Apr-2007 17:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | Seabee.mp3 | 20-Apr-2007 17:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sea Tac.mp3 | 20-Apr-2007 17:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | Scythian.mp3 | 20-Apr-2007 17:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | Scythia.mp3 | 20-Apr-2007 17:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | Scylla.mp3 | 20-Apr-2007 17:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | Scutari, Lake.mp3 | 20-Apr-2007 17:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | Scunthorpe.mp3 | 20-Apr-2007 17:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | Scudery.mp3 | 20-Apr-2007 17:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | Scranton.mp3 | 20-Apr-2007 17:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | Scouser.mp3 | 20-Apr-2007 17:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | Scottsdale.mp3 | 20-Apr-2007 17:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | Scotts Bluff National Monument.mp3 | 20-Apr-2007 17:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | Scottishness.mp3 | 20-Apr-2007 17:26 | 10K | |
![[SND]](/icons/sound2.gif) | Scottish Borders.mp3 | 20-Apr-2007 17:26 | 16K | |
![[SND]](/icons/sound2.gif) | Scottish.mp3 | 20-Apr-2007 17:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | Scottie.mp3 | 20-Apr-2007 17:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | Scotticism.mp3 | 20-Apr-2007 17:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | Scott.mp3 | 20-Apr-2007 17:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | Scotswoman.mp3 | 20-Apr-2007 17:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | Scotsman.mp3 | 20-Apr-2007 17:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | Scots.mp3 | 20-Apr-2007 17:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | Scotland Yard.mp3 | 20-Apr-2007 17:25 | 12K | |
![[SND]](/icons/sound2.gif) | Scotland.mp3 | 20-Apr-2007 17:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | Scotist.mp3 | 20-Apr-2007 17:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | Scotism.mp3 | 20-Apr-2007 17:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | Scotic.mp3 | 20-Apr-2007 17:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | Scotia Sea.mp3 | 20-Apr-2007 17:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | Scotia.mp3 | 20-Apr-2007 17:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | Scotchwoman.mp3 | 20-Apr-2007 17:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | Scotchman.mp3 | 20-Apr-2007 17:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | Scotch.mp3 | 20-Apr-2007 17:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | Scot.mp3 | 20-Apr-2007 17:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | Scorsese.mp3 | 20-Apr-2007 17:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | Scorpius.mp3 | 20-Apr-2007 17:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | Scorpio.mp3 | 20-Apr-2007 17:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | Scoresby Sound.mp3 | 20-Apr-2007 17:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | Scopus, Mount.mp3 | 20-Apr-2007 17:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | Scopes.mp3 | 20-Apr-2007 17:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | Scipio.mp3 | 20-Apr-2007 17:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | Scioto.mp3 | 20-Apr-2007 17:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | Scilly, Isles of.mp3 | 20-Apr-2007 17:17 | 5.7K | |
![[SND]](/icons/sound2.gif) | Scillonian.mp3 | 20-Apr-2007 17:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | Schwyz.mp3 | 20-Apr-2007 17:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | Schwinger.mp3 | 20-Apr-2007 17:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | Schwerin.mp3 | 20-Apr-2007 17:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | Schweitzer.mp3 | 20-Apr-2007 17:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | Schweinfurt.mp3 | 20-Apr-2007 17:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | Schwarzwald.mp3 | 20-Apr-2007 17:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | Schwarzkopf.mp3 | 20-Apr-2007 17:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | Schwartz.mp3 | 20-Apr-2007 17:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | Schwann cell.mp3 | 20-Apr-2007 17:15 | 11K | |
![[SND]](/icons/sound2.gif) | Schwaben.mp3 | 20-Apr-2007 17:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | Schuylkill.mp3 | 20-Apr-2007 17:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | Schuyler.mp3 | 20-Apr-2007 17:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | Schuschnigg.mp3 | 20-Apr-2007 17:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | Schurz.mp3 | 20-Apr-2007 17:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | Schumann.mp3 | 20-Apr-2007 17:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | Schumann-Heink.mp3 | 20-Apr-2007 17:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | Schuman.mp3 | 20-Apr-2007 17:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | Schulz.mp3 | 20-Apr-2007 17:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | Schultz.mp3 | 20-Apr-2007 17:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | Schubertian.mp3 | 20-Apr-2007 17:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | Schubert.mp3 | 20-Apr-2007 17:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | Schrodinger equation.mp3 | 20-Apr-2007 17:13 | 14K | |
![[SND]](/icons/sound2.gif) | Schrodinger.mp3 | 20-Apr-2007 17:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | Schroder.mp3 | 20-Apr-2007 17:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | Schrieffer.mp3 | 20-Apr-2007 17:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | Schouten Islands.mp3 | 20-Apr-2007 17:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | Schopenhauerian.mp3 | 20-Apr-2007 17:13 | 11K | |
![[SND]](/icons/sound2.gif) | Schopenhauer.mp3 | 20-Apr-2007 17:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | Scholes.mp3 | 20-Apr-2007 17:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | Schofield.mp3 | 20-Apr-2007 17:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Schoenbergian.mp3 | 20-Apr-2007 17:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | Schoenberg.mp3 | 20-Apr-2007 17:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | Schnitzler.mp3 | 20-Apr-2007 17:10 | 6.8K | |
![[SND]](/icons/sound2.gif) | Schnabel.mp3 | 20-Apr-2007 17:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | Schmidt camera.mp3 | 20-Apr-2007 17:08 | 11K | |
![[SND]](/icons/sound2.gif) | Schmidt.mp3 | 20-Apr-2007 17:09 | 5.2K | |
![[SND]](/icons/sound2.gif) | Schliemann.mp3 | 20-Apr-2007 17:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | Schleswig.mp3 | 20-Apr-2007 17:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | Schleswig-Holstein.mp3 | 20-Apr-2007 17:07 | 14K | |
![[SND]](/icons/sound2.gif) | Schlesinger.mp3 | 20-Apr-2007 17:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | Schleiermacher.mp3 | 20-Apr-2007 17:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | Schleicher.mp3 | 20-Apr-2007 17:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | Schlegel.mp3 | 20-Apr-2007 17:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | Schirach.mp3 | 20-Apr-2007 17:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | Schindler.mp3 | 20-Apr-2007 17:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | Schiff's reagent.mp3 | 20-Apr-2007 17:04 | 11K | |
![[SND]](/icons/sound2.gif) | Schiedam.mp3 | 20-Apr-2007 17:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | Schick test.mp3 | 20-Apr-2007 17:03 | 10K | |
![[SND]](/icons/sound2.gif) | Schick.mp3 | 20-Apr-2007 17:03 | 4.8K | |
![[SND]](/icons/sound2.gif) | Schiaparelli.mp3 | 20-Apr-2007 17:03 | 10K | |
![[SND]](/icons/sound2.gif) | Scheveningen.mp3 | 20-Apr-2007 17:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | Schererville.mp3 | 20-Apr-2007 17:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | Schenectady.mp3 | 20-Apr-2007 17:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | Schellingian.mp3 | 20-Apr-2007 17:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | Schelling.mp3 | 20-Apr-2007 17:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | Scheldt.mp3 | 20-Apr-2007 17:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | Schelde.mp3 | 20-Apr-2007 17:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | Scheidemann.mp3 | 20-Apr-2007 17:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | Scheherazade.mp3 | 20-Apr-2007 17:02 | 11K | |
![[SND]](/icons/sound2.gif) | Schawlow.mp3 | 20-Apr-2007 17:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | Schaumburg.mp3 | 20-Apr-2007 17:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | Schaumburg-Lippe.mp3 | 20-Apr-2007 17:02 | 11K | |
![[SND]](/icons/sound2.gif) | Scharnhorst.mp3 | 20-Apr-2007 17:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | Schally.mp3 | 20-Apr-2007 17:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | Schaffhausen.mp3 | 20-Apr-2007 17:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | Schacht.mp3 | 20-Apr-2007 17:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | Schaarbeek.mp3 | 20-Apr-2007 17:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | Scarron.mp3 | 20-Apr-2007 16:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | Scarlatti.mp3 | 20-Apr-2007 16:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | Scarborough.mp3 | 20-Apr-2007 16:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | Scapa Flow.mp3 | 20-Apr-2007 16:12 | 10K | |
![[SND]](/icons/sound2.gif) | Scandinavian.mp3 | 20-Apr-2007 16:11 | 11K | |
![[SND]](/icons/sound2.gif) | Scandinavia.mp3 | 20-Apr-2007 16:11 | 11K | |
![[SND]](/icons/sound2.gif) | Scandian.mp3 | 20-Apr-2007 16:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | Scanderbeg.mp3 | 20-Apr-2007 16:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | Scamander.mp3 | 20-Apr-2007 16:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | Scaliger.mp3 | 20-Apr-2007 16:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | Scalia.mp3 | 20-Apr-2007 16:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | Scafell Pike.mp3 | 20-Apr-2007 16:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sca Fell.mp3 | 20-Apr-2007 16:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sazan.mp3 | 20-Apr-2007 16:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sayreville.mp3 | 20-Apr-2007 16:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sayers.mp3 | 20-Apr-2007 16:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sayan Mountains.mp3 | 20-Apr-2007 16:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | Saxony.mp3 | 20-Apr-2007 16:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | Saxony-Anhalt.mp3 | 20-Apr-2007 16:06 | 14K | |
![[SND]](/icons/sound2.gif) | Saxon.mp3 | 20-Apr-2007 16:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | Saxo Grammaticus.mp3 | 20-Apr-2007 16:05 | 14K | |
![[SND]](/icons/sound2.gif) | Saxe.mp3 | 20-Apr-2007 16:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sawatch Range.mp3 | 20-Apr-2007 16:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Savoyard.mp3 | 20-Apr-2007 16:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | Savoy.mp3 | 20-Apr-2007 16:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | Savonarola.mp3 | 20-Apr-2007 16:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | Savona.mp3 | 20-Apr-2007 16:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | Savoie.mp3 | 20-Apr-2007 16:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | Savoia.mp3 | 20-Apr-2007 16:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | Savo.mp3 | 20-Apr-2007 16:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | Savimbi.mp3 | 20-Apr-2007 16:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | Savaii.mp3 | 20-Apr-2007 16:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sava.mp3 | 20-Apr-2007 16:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | Saussurian.mp3 | 20-Apr-2007 16:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saussure.mp3 | 20-Apr-2007 16:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | Saurashtra.mp3 | 20-Apr-2007 16:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | Saumur.mp3 | 20-Apr-2007 16:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sault Sainte Marie.mp3 | 20-Apr-2007 16:00 | 12K | |
![[SND]](/icons/sound2.gif) | Saul.mp3 | 20-Apr-2007 16:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sauk.mp3 | 20-Apr-2007 16:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | Saugus.mp3 | 20-Apr-2007 16:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | Saudi Arabia.mp3 | 20-Apr-2007 15:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | Saud.mp3 | 20-Apr-2007 15:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | Saturnian.mp3 | 20-Apr-2007 15:58 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saturn.mp3 | 20-Apr-2007 15:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | Saturdays.mp3 | 20-Apr-2007 15:58 | 10K | |
![[SND]](/icons/sound2.gif) | Saturday.mp3 | 20-Apr-2007 15:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | Satu-Mare.mp3 | 20-Apr-2007 15:57 | 11K | |
![[SND]](/icons/sound2.gif) | Satpura Range.mp3 | 20-Apr-2007 15:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | Satilla.mp3 | 20-Apr-2007 15:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | Satie.mp3 | 20-Apr-2007 15:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | Satcher.mp3 | 20-Apr-2007 15:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Satan.mp3 | 20-Apr-2007 15:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sassoon.mp3 | 20-Apr-2007 15:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sassari.mp3 | 20-Apr-2007 15:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sassanid.mp3 | 20-Apr-2007 15:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sassanian.mp3 | 20-Apr-2007 15:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sasquatch.mp3 | 20-Apr-2007 15:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saskatchewanian.mp3 | 20-Apr-2007 15:53 | 12K | |
![[SND]](/icons/sound2.gif) | Saskatchewan.mp3 | 20-Apr-2007 15:53 | 10K | |
![[SND]](/icons/sound2.gif) | Saseno.mp3 | 20-Apr-2007 15:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sasebo.mp3 | 20-Apr-2007 15:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sasanid.mp3 | 20-Apr-2007 15:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sasanian.mp3 | 20-Apr-2007 15:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sarum.mp3 | 20-Apr-2007 15:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sartrian.mp3 | 20-Apr-2007 15:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sartre.mp3 | 20-Apr-2007 15:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sarthe.mp3 | 20-Apr-2007 15:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | Sarre.mp3 | 20-Apr-2007 15:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | Sarpedon.mp3 | 20-Apr-2007 15:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | Saroyan.mp3 | 20-Apr-2007 15:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | Saros Gulf.mp3 | 20-Apr-2007 15:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | Saronic Gulf.mp3 | 20-Apr-2007 15:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sarnoff.mp3 | 20-Apr-2007 15:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sarnia.mp3 | 20-Apr-2007 15:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sarmatian.mp3 | 20-Apr-2007 15:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sarmatia.mp3 | 20-Apr-2007 15:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sarkese.mp3 | 20-Apr-2007 15:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sargon II.mp3 | 20-Apr-2007 15:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sargent.mp3 | 20-Apr-2007 15:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sargasso Sea.mp3 | 20-Apr-2007 15:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sarera Bay.mp3 | 20-Apr-2007 15:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sardou.mp3 | 20-Apr-2007 15:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sardis.mp3 | 20-Apr-2007 15:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sardinian.mp3 | 20-Apr-2007 15:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sardinia.mp3 | 20-Apr-2007 15:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sardica.mp3 | 20-Apr-2007 15:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sardian.mp3 | 20-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sardes.mp3 | 20-Apr-2007 15:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sardegna.mp3 | 20-Apr-2007 15:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sardanapallus.mp3 | 20-Apr-2007 15:49 | 11K | |
![[SND]](/icons/sound2.gif) | Sarawak.mp3 | 20-Apr-2007 15:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | Saratov.mp3 | 20-Apr-2007 15:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | Saratoga trunk.mp3 | 20-Apr-2007 15:47 | 13K | |
![[SND]](/icons/sound2.gif) | Saratoga.mp3 | 20-Apr-2007 15:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sarasota.mp3 | 20-Apr-2007 15:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saransk.mp3 | 20-Apr-2007 15:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Saranac.mp3 | 20-Apr-2007 15:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | Saramago.mp3 | 20-Apr-2007 15:47 | 11K | |
![[SND]](/icons/sound2.gif) | Sarajevo.mp3 | 20-Apr-2007 15:47 | 10K | |
![[SND]](/icons/sound2.gif) | Sarajevan.mp3 | 20-Apr-2007 15:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saragossa.mp3 | 20-Apr-2007 15:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saracenic.mp3 | 20-Apr-2007 15:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saracen.mp3 | 20-Apr-2007 15:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sarabat.mp3 | 20-Apr-2007 15:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sapporo.mp3 | 20-Apr-2007 15:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sapir.mp3 | 20-Apr-2007 15:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | Saone.mp3 | 20-Apr-2007 15:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sao Tome.mp3 | 20-Apr-2007 15:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sao Tiago.mp3 | 20-Apr-2007 15:43 | 11K | |
![[SND]](/icons/sound2.gif) | Sao Salvador.mp3 | 20-Apr-2007 15:43 | 12K | |
![[SND]](/icons/sound2.gif) | Sao Roque, Cape.mp3 | 20-Apr-2007 15:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sao Paulo.mp3 | 20-Apr-2007 15:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sao Miguel.mp3 | 20-Apr-2007 15:42 | 11K | |
![[SND]](/icons/sound2.gif) | Sao Manuel.mp3 | 20-Apr-2007 15:42 | 11K | |
![[SND]](/icons/sound2.gif) | Sao Luis.mp3 | 20-Apr-2007 15:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sao Francisco.mp3 | 20-Apr-2007 15:42 | 12K | |
![[SND]](/icons/sound2.gif) | Santurce.mp3 | 20-Apr-2007 15:42 | 10K | |
![[SND]](/icons/sound2.gif) | Santos-Dumont.mp3 | 20-Apr-2007 15:42 | 11K | |
![[SND]](/icons/sound2.gif) | Santorini.mp3 | 20-Apr-2007 15:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | Santo Domingo.mp3 | 20-Apr-2007 15:41 | 10K | |
![[SND]](/icons/sound2.gif) | Santo Domingan.mp3 | 20-Apr-2007 15:41 | 10K | |
![[SND]](/icons/sound2.gif) | Santo Andre.mp3 | 20-Apr-2007 15:41 | 15K | |
![[SND]](/icons/sound2.gif) | Santiago de los Caballeros.mp3 | 20-Apr-2007 15:41 | 24K | |
![[SND]](/icons/sound2.gif) | Santiago del Estero.mp3 | 20-Apr-2007 15:41 | 17K | |
![[SND]](/icons/sound2.gif) | Santiago de Cuba.mp3 | 20-Apr-2007 15:41 | 14K | |
![[SND]](/icons/sound2.gif) | Santiago de Compostela.mp3 | 20-Apr-2007 15:41 | 10K | |
![[SND]](/icons/sound2.gif) | Santiago.mp3 | 20-Apr-2007 15:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | Santiagan.mp3 | 20-Apr-2007 15:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | Santeria.mp3 | 20-Apr-2007 15:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | Santee.mp3 | 20-Apr-2007 15:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | Santayana.mp3 | 20-Apr-2007 15:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | Santarem.mp3 | 20-Apr-2007 15:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | Santander.mp3 | 20-Apr-2007 15:40 | 10K | |
![[SND]](/icons/sound2.gif) | Santa Rosa.mp3 | 20-Apr-2007 15:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | Santa Paula.mp3 | 20-Apr-2007 15:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | Santa Monica.mp3 | 20-Apr-2007 15:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | Santa Marta.mp3 | 20-Apr-2007 15:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | Santa Maria.mp3 | 20-Apr-2007 15:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | Santa Isabel.mp3 | 20-Apr-2007 15:39 | 10K | |
![[SND]](/icons/sound2.gif) | Santa Gertrudis.mp3 | 20-Apr-2007 15:39 | 13K | |
![[SND]](/icons/sound2.gif) | Santa Fean.mp3 | 20-Apr-2007 15:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | Santa Fe.mp3 | 20-Apr-2007 15:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | Santa Cruz de Tenerife.mp3 | 20-Apr-2007 15:39 | 18K | |
![[SND]](/icons/sound2.gif) | Santa Cruz.mp3 | 20-Apr-2007 15:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | Santa Claus.mp3 | 20-Apr-2007 15:39 | 10K | |
![[SND]](/icons/sound2.gif) | Santa Clarita.mp3 | 20-Apr-2007 15:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | Santa Clara.mp3 | 20-Apr-2007 15:39 | 5.2K | |
![[SND]](/icons/sound2.gif) | Santa Catarina.mp3 | 20-Apr-2007 15:39 | 11K | |
![[SND]](/icons/sound2.gif) | Santa Catalina.mp3 | 20-Apr-2007 15:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | Santa Barbara.mp3 | 20-Apr-2007 15:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | Santa Anna.mp3 | 20-Apr-2007 15:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | Santa Ana.mp3 | 20-Apr-2007 15:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sanskritist.mp3 | 20-Apr-2007 15:38 | 10K | |
![[SND]](/icons/sound2.gif) | Sanskritic.mp3 | 20-Apr-2007 15:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sanskrit.mp3 | 20-Apr-2007 15:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sankt Moritz.mp3 | 20-Apr-2007 15:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sankt Gallen.mp3 | 20-Apr-2007 15:36 | 10K | |
![[SND]](/icons/sound2.gif) | Sankt Anton am Arlberg.mp3 | 20-Apr-2007 15:36 | 18K | |
![[SND]](/icons/sound2.gif) | Sankhya.mp3 | 20-Apr-2007 15:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sanibel Island.mp3 | 20-Apr-2007 15:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sanhedrin.mp3 | 20-Apr-2007 15:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sangre de Cristo Mountains.mp3 | 20-Apr-2007 15:33 | 12K | |
![[SND]](/icons/sound2.gif) | Sangreal.mp3 | 20-Apr-2007 15:33 | 11K | |
![[SND]](/icons/sound2.gif) | Sangihe Islands.mp3 | 20-Apr-2007 15:33 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sangi Islands.mp3 | 20-Apr-2007 15:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sanger.mp3 | 20-Apr-2007 15:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sangay.mp3 | 20-Apr-2007 15:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sangamon.mp3 | 20-Apr-2007 15:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sangallo.mp3 | 20-Apr-2007 15:33 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sanforized.mp3 | 20-Apr-2007 15:32 | 11K | |
![[SND]](/icons/sound2.gif) | Sanford.mp3 | 20-Apr-2007 15:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sandwich Islands.mp3 | 20-Apr-2007 15:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sandusky.mp3 | 20-Apr-2007 15:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sandringham.mp3 | 20-Apr-2007 15:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sandinista.mp3 | 20-Apr-2007 15:30 | 10K | |
![[SND]](/icons/sound2.gif) | Sandia Mountains.mp3 | 20-Apr-2007 15:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sandhurst.mp3 | 20-Apr-2007 15:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | Sandburg.mp3 | 20-Apr-2007 15:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sandakan.mp3 | 20-Apr-2007 15:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sancy, Puy de.mp3 | 20-Apr-2007 15:29 | 11K | |
![[SND]](/icons/sound2.gif) | Sanctus.mp3 | 20-Apr-2007 15:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sancti Spiritus.mp3 | 20-Apr-2007 15:28 | 15K | |
![[SND]](/icons/sound2.gif) | Sancho Panza.mp3 | 20-Apr-2007 15:28 | 11K | |
![[SND]](/icons/sound2.gif) | Sancerre.mp3 | 20-Apr-2007 15:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sanandaj.mp3 | 20-Apr-2007 15:27 | 10K | |
![[SND]](/icons/sound2.gif) | Sana.mp3 | 20-Apr-2007 15:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | San Stefano.mp3 | 20-Apr-2007 15:27 | 9.6K | |
![[SND]](/icons/sound2.gif) | San Sebastian.mp3 | 20-Apr-2007 15:27 | 13K | |
![[SND]](/icons/sound2.gif) | San Salvador.mp3 | 20-Apr-2007 15:27 | 12K | |
![[SND]](/icons/sound2.gif) | San Remo.mp3 | 20-Apr-2007 15:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | San Ramon.mp3 | 20-Apr-2007 15:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | San Rafael.mp3 | 20-Apr-2007 15:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | San Pedro Sula.mp3 | 20-Apr-2007 15:27 | 14K | |
![[SND]](/icons/sound2.gif) | San Pedro Channel.mp3 | 20-Apr-2007 15:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | San Pablo.mp3 | 20-Apr-2007 15:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | San Miguel de Tucuman.mp3 | 20-Apr-2007 15:27 | 18K | |
![[SND]](/icons/sound2.gif) | San Mateo.mp3 | 20-Apr-2007 15:27 | 10K | |
![[SND]](/icons/sound2.gif) | San Martin.mp3 | 20-Apr-2007 15:27 | 10K | |
![[SND]](/icons/sound2.gif) | San Marino.mp3 | 20-Apr-2007 15:27 | 10K | |
![[SND]](/icons/sound2.gif) | San Marinese.mp3 | 20-Apr-2007 15:27 | 11K | |
![[SND]](/icons/sound2.gif) | San Marcos.mp3 | 20-Apr-2007 15:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | San Luis Potosi.mp3 | 20-Apr-2007 15:26 | 15K | |
![[SND]](/icons/sound2.gif) | San Luis Obispo.mp3 | 20-Apr-2007 15:26 | 13K | |
![[SND]](/icons/sound2.gif) | San Luis.mp3 | 20-Apr-2007 15:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | San Lucas, Cape.mp3 | 20-Apr-2007 15:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | San Lorenzo.mp3 | 20-Apr-2007 15:26 | 11K | |
![[SND]](/icons/sound2.gif) | San Leandro.mp3 | 20-Apr-2007 15:26 | 11K | |
![[SND]](/icons/sound2.gif) | San Juanero.mp3 | 20-Apr-2007 15:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | San Juan.mp3 | 20-Apr-2007 15:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | San Jose scale.mp3 | 20-Apr-2007 15:26 | 14K | |
![[SND]](/icons/sound2.gif) | San Jose.mp3 | 20-Apr-2007 15:26 | 10K | |
![[SND]](/icons/sound2.gif) | San Joaquin.mp3 | 20-Apr-2007 15:26 | 11K | |
![[SND]](/icons/sound2.gif) | San Jacinto Day.mp3 | 20-Apr-2007 15:26 | 14K | |
![[SND]](/icons/sound2.gif) | San Jacinto.mp3 | 20-Apr-2007 15:26 | 11K | |
![[SND]](/icons/sound2.gif) | San Isidro.mp3 | 20-Apr-2007 15:26 | 10K | |
![[SND]](/icons/sound2.gif) | San Ildefonso.mp3 | 20-Apr-2007 15:26 | 13K | |
![[SND]](/icons/sound2.gif) | San Gimignano.mp3 | 20-Apr-2007 15:26 | 14K | |
![[SND]](/icons/sound2.gif) | San German.mp3 | 20-Apr-2007 15:26 | 11K | |
![[SND]](/icons/sound2.gif) | San Gabriel.mp3 | 20-Apr-2007 15:26 | 10K | |
![[SND]](/icons/sound2.gif) | San Francisco.mp3 | 20-Apr-2007 15:26 | 12K | |
![[SND]](/icons/sound2.gif) | San Franciscan.mp3 | 20-Apr-2007 15:26 | 11K | |
![[SND]](/icons/sound2.gif) | San Fernando.mp3 | 20-Apr-2007 15:26 | 11K | |
![[SND]](/icons/sound2.gif) | San Domingo.mp3 | 20-Apr-2007 15:26 | 10K | |
![[SND]](/icons/sound2.gif) | San Dimas.mp3 | 20-Apr-2007 15:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | San Diego.mp3 | 20-Apr-2007 15:25 | 10K | |
![[SND]](/icons/sound2.gif) | San Diegan.mp3 | 20-Apr-2007 15:25 | 9.8K | |
![[SND]](/icons/sound2.gif) | San Cristobal.mp3 | 20-Apr-2007 15:25 | 10K | |
![[SND]](/icons/sound2.gif) | San Clemente.mp3 | 20-Apr-2007 15:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | San Carlos de Bariloche.mp3 | 20-Apr-2007 15:25 | 21K | |
![[SND]](/icons/sound2.gif) | San Carlos.mp3 | 20-Apr-2007 15:25 | 11K | |
![[SND]](/icons/sound2.gif) | San Buenaventura.mp3 | 20-Apr-2007 15:25 | 13K | |
![[SND]](/icons/sound2.gif) | San Bruno.mp3 | 20-Apr-2007 15:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | San Bernardino Mountains.mp3 | 20-Apr-2007 15:25 | 13K | |
![[SND]](/icons/sound2.gif) | San Bernardino.mp3 | 20-Apr-2007 15:25 | 11K | |
![[SND]](/icons/sound2.gif) | San Benito.mp3 | 20-Apr-2007 15:25 | 9.8K | |
![[SND]](/icons/sound2.gif) | San Antonio.mp3 | 20-Apr-2007 15:25 | 11K | |
![[SND]](/icons/sound2.gif) | San Antonian.mp3 | 20-Apr-2007 15:25 | 11K | |
![[SND]](/icons/sound2.gif) | San Angelo.mp3 | 20-Apr-2007 15:25 | 9.8K | |
![[SND]](/icons/sound2.gif) | San Andreas Fault.mp3 | 20-Apr-2007 15:25 | 11K | |
![[SND]](/icons/sound2.gif) | San.mp3 | 20-Apr-2007 15:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | Samuelsson.mp3 | 20-Apr-2007 15:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | Samuelson.mp3 | 20-Apr-2007 15:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | Samuel.mp3 | 20-Apr-2007 15:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | Samsun.mp3 | 20-Apr-2007 15:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | Samsonian.mp3 | 20-Apr-2007 15:24 | 10K | |
![[SND]](/icons/sound2.gif) | Samson.mp3 | 20-Apr-2007 15:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | Samper Pizano.mp3 | 20-Apr-2007 15:24 | 13K | |
![[SND]](/icons/sound2.gif) | Samoyedic.mp3 | 20-Apr-2007 15:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | Samoyede.mp3 | 20-Apr-2007 15:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | Samoyed.mp3 | 20-Apr-2007 15:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | Samothraki.mp3 | 20-Apr-2007 15:24 | 10K | |
![[SND]](/icons/sound2.gif) | Samothracian.mp3 | 20-Apr-2007 15:24 | 10K | |
![[SND]](/icons/sound2.gif) | Samothrace.mp3 | 20-Apr-2007 15:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | Samos.mp3 | 20-Apr-2007 15:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | Samoan.mp3 | 20-Apr-2007 15:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | Samoa.mp3 | 20-Apr-2007 15:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | Samnium.mp3 | 20-Apr-2007 15:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | Samnite.mp3 | 20-Apr-2007 15:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sammarinesi.mp3 | 20-Apr-2007 15:23 | 12K | |
![[SND]](/icons/sound2.gif) | Sammarinese.mp3 | 20-Apr-2007 15:23 | 13K | |
![[SND]](/icons/sound2.gif) | Sammamish.mp3 | 20-Apr-2007 15:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | Samian.mp3 | 20-Apr-2007 15:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sami.mp3 | 20-Apr-2007 15:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | Samarkand.mp3 | 20-Apr-2007 15:22 | 9.5K | |
![[SND]](/icons/sound2.gif) | Samaritan.mp3 | 20-Apr-2007 15:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | Samarinda.mp3 | 20-Apr-2007 15:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | Samaria.mp3 | 20-Apr-2007 15:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | Samar.mp3 | 20-Apr-2007 15:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | Samanala.mp3 | 20-Apr-2007 15:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sam Browne belt.mp3 | 20-Apr-2007 15:21 | 14K | |
![[SND]](/icons/sound2.gif) | Sam.mp3 | 20-Apr-2007 15:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | Salzkammergut.mp3 | 20-Apr-2007 15:21 | 13K | |
![[SND]](/icons/sound2.gif) | Salzgitter.mp3 | 20-Apr-2007 15:21 | 9.8K | |
![[SND]](/icons/sound2.gif) | Salzburg.mp3 | 20-Apr-2007 15:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | Salween.mp3 | 20-Apr-2007 15:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | Salvationist.mp3 | 20-Apr-2007 15:20 | 10K | |
![[SND]](/icons/sound2.gif) | Salvadorian.mp3 | 20-Apr-2007 15:20 | 11K | |
![[SND]](/icons/sound2.gif) | Salvadoran.mp3 | 20-Apr-2007 15:20 | 10K | |
![[SND]](/icons/sound2.gif) | Salvador.mp3 | 20-Apr-2007 15:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Saluda.mp3 | 20-Apr-2007 15:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | Salton Sea.mp3 | 20-Apr-2007 15:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | Salto.mp3 | 20-Apr-2007 15:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Saltillo.mp3 | 20-Apr-2007 15:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | Salta.mp3 | 20-Apr-2007 15:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | Salopian.mp3 | 20-Apr-2007 15:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | Salop.mp3 | 20-Apr-2007 15:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | Salonika.mp3 | 20-Apr-2007 15:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | Salonika, Gulf of.mp3 | 20-Apr-2007 15:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | Salomon.mp3 | 20-Apr-2007 15:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | Salome.mp3 | 20-Apr-2007 15:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sally Lunn.mp3 | 20-Apr-2007 15:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | Sallustian.mp3 | 20-Apr-2007 15:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sallust.mp3 | 20-Apr-2007 15:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sallee.mp3 | 20-Apr-2007 15:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | Salk vaccine.mp3 | 20-Apr-2007 15:14 | 11K | |
![[SND]](/icons/sound2.gif) | Salk.mp3 | 20-Apr-2007 15:14 | 5.7K | |
![[SND]](/icons/sound2.gif) | Salishan.mp3 | 20-Apr-2007 15:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | Salish.mp3 | 20-Apr-2007 15:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | Salisbury steak.mp3 | 20-Apr-2007 15:14 | 12K | |
![[SND]](/icons/sound2.gif) | Salique.mp3 | 20-Apr-2007 15:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | Salinger.mp3 | 20-Apr-2007 15:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | Salinas de Gortari.mp3 | 20-Apr-2007 15:13 | 15K | |
![[SND]](/icons/sound2.gif) | Salinas.mp3 | 20-Apr-2007 15:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | Salina.mp3 | 20-Apr-2007 15:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | Salieri.mp3 | 20-Apr-2007 15:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | Salford.mp3 | 20-Apr-2007 15:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | Salesian.mp3 | 20-Apr-2007 15:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | Salerno.mp3 | 20-Apr-2007 15:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | Salernitan.mp3 | 20-Apr-2007 15:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | Salem.mp3 | 20-Apr-2007 15:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | Saldanha Bay.mp3 | 20-Apr-2007 15:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | Salazar.mp3 | 20-Apr-2007 15:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | Salamis.mp3 | 20-Apr-2007 15:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Salambria.mp3 | 20-Apr-2007 15:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | Salamaua.mp3 | 20-Apr-2007 15:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | Salamanca.mp3 | 20-Apr-2007 15:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | Salam.mp3 | 20-Apr-2007 15:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | Salado.mp3 | 20-Apr-2007 15:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | Saladin.mp3 | 20-Apr-2007 15:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | Salaberry-de-Valleyfield.mp3 | 20-Apr-2007 15:10 | 16K | |
![[SND]](/icons/sound2.gif) | Sakti.mp3 | 20-Apr-2007 15:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | Sakonnet River.mp3 | 20-Apr-2007 15:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sakmann.mp3 | 20-Apr-2007 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sakkara.mp3 | 20-Apr-2007 15:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sakishima Islands.mp3 | 20-Apr-2007 15:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sakharov.mp3 | 20-Apr-2007 15:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sakhalin.mp3 | 20-Apr-2007 15:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | Sakha.mp3 | 20-Apr-2007 15:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | Sakarya.mp3 | 20-Apr-2007 15:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sakakawea, Lake.mp3 | 20-Apr-2007 15:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | Sakai.mp3 | 20-Apr-2007 15:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sajama.mp3 | 20-Apr-2007 15:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | Saivism.mp3 | 20-Apr-2007 15:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | Saiva.mp3 | 20-Apr-2007 15:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sais.mp3 | 20-Apr-2007 15:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | Saipanese.mp3 | 20-Apr-2007 15:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saipan.mp3 | 20-Apr-2007 15:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | Saionji.mp3 | 20-Apr-2007 15:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | Saintsbury.mp3 | 20-Apr-2007 15:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | Saintonge.mp3 | 20-Apr-2007 15:08 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sainte-Therese.mp3 | 20-Apr-2007 15:06 | 11K | |
![[SND]](/icons/sound2.gif) | Sainte-Julie.mp3 | 20-Apr-2007 15:06 | 13K | |
![[SND]](/icons/sound2.gif) | Sainte-Foy.mp3 | 20-Apr-2007 15:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sainte-Beuve.mp3 | 20-Apr-2007 15:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saint Vitus' dance.mp3 | 20-Apr-2007 15:06 | 14K | |
![[SND]](/icons/sound2.gif) | Saint Vincent.mp3 | 20-Apr-2007 15:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saint Thomas.mp3 | 20-Apr-2007 15:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | Saint Simons Island.mp3 | 20-Apr-2007 15:05 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Petersburg.mp3 | 20-Apr-2007 15:05 | 12K | |
![[SND]](/icons/sound2.gif) | Saint Peters.mp3 | 20-Apr-2007 15:05 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Peter, Lake.mp3 | 20-Apr-2007 15:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Saint Paulite.mp3 | 20-Apr-2007 15:05 | 10K | |
![[SND]](/icons/sound2.gif) | Saint Paul.mp3 | 20-Apr-2007 15:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saint Patrick's Day.mp3 | 20-Apr-2007 15:05 | 14K | |
![[SND]](/icons/sound2.gif) | Saint Pancras.mp3 | 20-Apr-2007 15:05 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Moritz.mp3 | 20-Apr-2007 15:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | Saint Maurice.mp3 | 20-Apr-2007 15:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saint Marys.mp3 | 20-Apr-2007 15:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saint Martin.mp3 | 20-Apr-2007 15:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saint Martin's summer.mp3 | 20-Apr-2007 15:05 | 14K | |
![[SND]](/icons/sound2.gif) | Saint Lucian.mp3 | 20-Apr-2007 15:05 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Lucia.mp3 | 20-Apr-2007 15:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saint Louisian.mp3 | 20-Apr-2007 15:05 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Louis encephalitis.mp3 | 20-Apr-2007 15:04 | 19K | |
![[SND]](/icons/sound2.gif) | Saint Louisan.mp3 | 20-Apr-2007 15:05 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Louis Park.mp3 | 20-Apr-2007 15:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | Saint Louis.mp3 | 20-Apr-2007 15:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | Saint Louis, Lake.mp3 | 20-Apr-2007 15:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | Saint Lawrence.mp3 | 20-Apr-2007 15:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saint Laurent.mp3 | 20-Apr-2007 15:04 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Kitts.mp3 | 20-Apr-2007 15:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saint Joseph.mp3 | 20-Apr-2007 15:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saint Johns.mp3 | 20-Apr-2007 15:04 | 10K | |
![[SND]](/icons/sound2.gif) | Saint John.mp3 | 20-Apr-2007 15:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saint John's bread.mp3 | 20-Apr-2007 15:04 | 12K | |
![[SND]](/icons/sound2.gif) | Saint John's.mp3 | 20-Apr-2007 15:04 | 10K | |
![[SND]](/icons/sound2.gif) | Saint Helier.mp3 | 20-Apr-2007 15:04 | 9.8K | |
![[SND]](/icons/sound2.gif) | Saint Helens.mp3 | 20-Apr-2007 15:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saint Helena.mp3 | 20-Apr-2007 15:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saint Gotthard.mp3 | 20-Apr-2007 15:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saint George.mp3 | 20-Apr-2007 15:04 | 11K | |
![[SND]](/icons/sound2.gif) | Saint George's.mp3 | 20-Apr-2007 15:04 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Gall.mp3 | 20-Apr-2007 15:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | Saint Francis.mp3 | 20-Apr-2007 15:04 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Eustatius.mp3 | 20-Apr-2007 15:04 | 12K | |
![[SND]](/icons/sound2.gif) | Saint Emilion.mp3 | 20-Apr-2007 15:04 | 12K | |
![[SND]](/icons/sound2.gif) | Saint Elmo's fire.mp3 | 20-Apr-2007 15:04 | 16K | |
![[SND]](/icons/sound2.gif) | Saint Elias, Mount.mp3 | 20-Apr-2007 15:04 | 10K | |
![[SND]](/icons/sound2.gif) | Saint Denis.mp3 | 20-Apr-2007 15:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saint Croix.mp3 | 20-Apr-2007 15:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | Saint Cloud.mp3 | 20-Apr-2007 15:03 | 10K | |
![[SND]](/icons/sound2.gif) | Saint Clair, Lake.mp3 | 20-Apr-2007 15:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saint Christopher.mp3 | 20-Apr-2007 15:03 | 10K | |
![[SND]](/icons/sound2.gif) | Saint Charles.mp3 | 20-Apr-2007 15:03 | 10K | |
![[SND]](/icons/sound2.gif) | Saint Catharines.mp3 | 20-Apr-2007 15:03 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Bernard.mp3 | 20-Apr-2007 15:03 | 11K | |
![[SND]](/icons/sound2.gif) | Saint Barthelemy.mp3 | 20-Apr-2007 15:03 | 13K | |
![[SND]](/icons/sound2.gif) | Saint Augustine grass.mp3 | 20-Apr-2007 15:03 | 18K | |
![[SND]](/icons/sound2.gif) | Saint Anthony's cross.mp3 | 20-Apr-2007 15:03 | 16K | |
![[SND]](/icons/sound2.gif) | Saint Andrew's cross.mp3 | 20-Apr-2007 15:03 | 15K | |
![[SND]](/icons/sound2.gif) | Saint Albert.mp3 | 20-Apr-2007 15:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | Saint Albans.mp3 | 20-Apr-2007 15:03 | 10K | |
![[SND]](/icons/sound2.gif) | Saint Agnes' Eve.mp3 | 20-Apr-2007 15:03 | 15K | |
![[SND]](/icons/sound2.gif) | Saint-etienne.mp3 | 20-Apr-2007 15:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saint-Tropez.mp3 | 20-Apr-2007 15:08 | 10K | |
![[SND]](/icons/sound2.gif) | Saint-Simon.mp3 | 20-Apr-2007 15:08 | 10K | |
![[SND]](/icons/sound2.gif) | Saint-Saens.mp3 | 20-Apr-2007 15:08 | 11K | |
![[SND]](/icons/sound2.gif) | Saint-Quentin.mp3 | 20-Apr-2007 15:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saint-Pierre and Miquelon.mp3 | 20-Apr-2007 15:08 | 16K | |
![[SND]](/icons/sound2.gif) | Saint-Ouen.mp3 | 20-Apr-2007 15:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | Saint-Nicolas.mp3 | 20-Apr-2007 15:08 | 12K | |
![[SND]](/icons/sound2.gif) | Saint-Nazaire.mp3 | 20-Apr-2007 15:07 | 10K | |
![[SND]](/icons/sound2.gif) | Saint-Mihiel.mp3 | 20-Apr-2007 15:07 | 10K | |
![[SND]](/icons/sound2.gif) | Saint-Maur-des-Fosses.mp3 | 20-Apr-2007 15:07 | 15K | |
![[SND]](/icons/sound2.gif) | Saint-Malo.mp3 | 20-Apr-2007 15:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | Saint-Louis.mp3 | 20-Apr-2007 15:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | Saint-Lo.mp3 | 20-Apr-2007 15:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | Saint-Leonard.mp3 | 20-Apr-2007 15:07 | 10K | |
![[SND]](/icons/sound2.gif) | Saint-Laurent.mp3 | 20-Apr-2007 15:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saint-Just.mp3 | 20-Apr-2007 15:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | Saint-John's-wort.mp3 | 20-Apr-2007 15:07 | 12K | |
![[SND]](/icons/sound2.gif) | Saint-Jerome.mp3 | 20-Apr-2007 15:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | Saint-Jean-sur-Richelieu.mp3 | 20-Apr-2007 15:07 | 17K | |
![[SND]](/icons/sound2.gif) | Saint-Jean-de-Luz.mp3 | 20-Apr-2007 15:07 | 13K | |
![[SND]](/icons/sound2.gif) | Saint-Hyacinthe.mp3 | 20-Apr-2007 15:07 | 11K | |
![[SND]](/icons/sound2.gif) | Saint-Hubert.mp3 | 20-Apr-2007 15:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saint-Germain.mp3 | 20-Apr-2007 15:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | Saint-Germain-en-Laye.mp3 | 20-Apr-2007 15:07 | 15K | |
![[SND]](/icons/sound2.gif) | Saint-Gaudens.mp3 | 20-Apr-2007 15:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | Saint-Francois.mp3 | 20-Apr-2007 15:06 | 12K | |
![[SND]](/icons/sound2.gif) | Saint-Eustache.mp3 | 20-Apr-2007 15:06 | 11K | |
![[SND]](/icons/sound2.gif) | Saint-Denis.mp3 | 20-Apr-2007 15:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | Saint-Cyr-l'ecole.mp3 | 20-Apr-2007 15:06 | 14K | |
![[SND]](/icons/sound2.gif) | Saint-Constant.mp3 | 20-Apr-2007 15:06 | 10K | |
![[SND]](/icons/sound2.gif) | Saint-Cloud.mp3 | 20-Apr-2007 15:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | Saint-Bruno-de-Montarville.mp3 | 20-Apr-2007 15:06 | 16K | |
![[SND]](/icons/sound2.gif) | Saimaa.mp3 | 20-Apr-2007 15:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | Saigonese.mp3 | 20-Apr-2007 15:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | Saigon.mp3 | 20-Apr-2007 15:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | Saida.mp3 | 20-Apr-2007 15:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sahelian.mp3 | 20-Apr-2007 15:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sahel.mp3 | 20-Apr-2007 15:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | Saharanpur.mp3 | 20-Apr-2007 15:01 | 11K | |
![[SND]](/icons/sound2.gif) | Saharan.mp3 | 20-Apr-2007 15:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | Sahara.mp3 | 20-Apr-2007 15:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | Sahaptin.mp3 | 20-Apr-2007 15:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sagunto.mp3 | 20-Apr-2007 15:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | Saguia el Hamra.mp3 | 20-Apr-2007 15:01 | 13K | |
![[SND]](/icons/sound2.gif) | Saguenay.mp3 | 20-Apr-2007 15:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saguaro National Park.mp3 | 20-Apr-2007 15:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sagres.mp3 | 20-Apr-2007 15:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | Sagittarius.mp3 | 20-Apr-2007 15:00 | 11K | |
![[SND]](/icons/sound2.gif) | Sagittarian.mp3 | 20-Apr-2007 15:00 | 11K | |
![[SND]](/icons/sound2.gif) | Saginaw.mp3 | 20-Apr-2007 15:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saghalien.mp3 | 20-Apr-2007 15:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sagan.mp3 | 20-Apr-2007 15:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sagamihara.mp3 | 20-Apr-2007 15:00 | 11K | |
![[SND]](/icons/sound2.gif) | Sagami Sea.mp3 | 20-Apr-2007 15:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | Safi.mp3 | 20-Apr-2007 14:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | Safed Koh.mp3 | 20-Apr-2007 14:59 | 11K | |
![[SND]](/icons/sound2.gif) | Safar.mp3 | 20-Apr-2007 14:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sade, de.mp3 | 20-Apr-2007 14:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | Sadduceeism.mp3 | 20-Apr-2007 14:57 | 11K | |
![[SND]](/icons/sound2.gif) | Sadducee.mp3 | 20-Apr-2007 14:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | Sadducean.mp3 | 20-Apr-2007 14:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | Sacramento.mp3 | 20-Apr-2007 14:55 | 10K | |
![[SND]](/icons/sound2.gif) | Saco.mp3 | 20-Apr-2007 14:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sackville.mp3 | 20-Apr-2007 14:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | Sackville-West.mp3 | 20-Apr-2007 14:54 | 11K | |
![[SND]](/icons/sound2.gif) | Sachsen.mp3 | 20-Apr-2007 14:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Sachs.mp3 | 20-Apr-2007 14:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sacher torte.mp3 | 20-Apr-2007 14:53 | 11K | |
![[SND]](/icons/sound2.gif) | Sacco.mp3 | 20-Apr-2007 14:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sacajawea.mp3 | 20-Apr-2007 14:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sabratha.mp3 | 20-Apr-2007 14:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | Sabrata.mp3 | 20-Apr-2007 14:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Sable, Cape.mp3 | 20-Apr-2007 14:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sabine.mp3 | 20-Apr-2007 14:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sabi.mp3 | 20-Apr-2007 14:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sabellian.mp3 | 20-Apr-2007 14:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | Sabbath.mp3 | 20-Apr-2007 14:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | Sabbatarianism.mp3 | 20-Apr-2007 14:49 | 13K | |
![[SND]](/icons/sound2.gif) | Sabbatarian.mp3 | 20-Apr-2007 14:49 | 11K | |
![[SND]](/icons/sound2.gif) | Sabatini.mp3 | 20-Apr-2007 14:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | Sabatier.mp3 | 20-Apr-2007 14:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | Sabarmati.mp3 | 20-Apr-2007 14:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | Sabana Grande.mp3 | 20-Apr-2007 14:49 | 12K | |
![[SND]](/icons/sound2.gif) | Sabah.mp3 | 20-Apr-2007 14:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | Sabadell.mp3 | 20-Apr-2007 14:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | Saba.mp3 | 20-Apr-2007 14:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | Saarland.mp3 | 20-Apr-2007 14:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | Saarinen.mp3 | 20-Apr-2007 14:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | Saaremaa.mp3 | 20-Apr-2007 14:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | Saarbrucken.mp3 | 20-Apr-2007 14:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | Saar.mp3 | 20-Apr-2007 14:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | Saanich.mp3 | 20-Apr-2007 14:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | Saanen.mp3 | 20-Apr-2007 14:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | Saale.mp3 | 20-Apr-2007 14:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | Sa.dat.mp3 | 20-Apr-2007 14:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | SSRI.mp3 | 21-Apr-2007 14:05 | 10K | |
![[SND]](/icons/sound2.gif) | SNP.mp3 | 21-Apr-2007 12:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | SIV.mp3 | 21-Apr-2007 11:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | SIGINT.mp3 | 21-Apr-2007 11:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | SGML.mp3 | 21-Apr-2007 10:15 | 10K | |
![[SND]](/icons/sound2.gif) | SAP.mp3 | 20-Apr-2007 15:44 | 6.1K | |
|