![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | p..mp3 | 19-Apr-2007 23:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | p.mp3 | 19-Apr-2007 23:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | p53.mp3 | 19-Apr-2007 23:19 | 11K | |
![[SND]](/icons/sound2.gif) | PA system.mp3 | 19-Apr-2007 23:19 | 10K | |
![[SND]](/icons/sound2.gif) | Pa.nini.mp3 | 19-Apr-2007 23:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | pa.mp3 | 19-Apr-2007 23:19 | 4.8K | |
![[SND]](/icons/sound2.gif) | Paaic.mp3 | 19-Apr-2007 23:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | paal.mp3 | 19-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | paanga.mp3 | 19-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | pa'anga.mp3 | 19-Apr-2007 23:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | Paasikivi.mp3 | 19-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | PABA.mp3 | 19-Apr-2007 23:19 | 5.7K | |
![[SND]](/icons/sound2.gif) | pablo.mp3 | 19-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | pablum.mp3 | 19-Apr-2007 23:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | pabst.mp3 | 19-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | pabstblueribbon.mp3 | 19-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | pabulum.mp3 | 19-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | pac.mp3 | 19-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | paca.mp3 | 19-Apr-2007 23:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pacaraima Mountains.mp3 | 19-Apr-2007 23:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | pacaraimamountains.mp3 | 19-Apr-2007 23:20 | 17K | |
![[SND]](/icons/sound2.gif) | pacceka.mp3 | 19-Apr-2007 23:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | paccha.mp3 | 19-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | pace.mp3 | 19-Apr-2007 23:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | paced.mp3 | 19-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | pacemaker.mp3 | 19-Apr-2007 23:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | pacemaking.mp3 | 19-Apr-2007 23:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | pacer.mp3 | 19-Apr-2007 23:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | pacesetter.mp3 | 19-Apr-2007 23:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | pacesetting.mp3 | 19-Apr-2007 23:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | pacetua.mp3 | 19-Apr-2007 23:20 | 17K | |
![[SND]](/icons/sound2.gif) | pacey.mp3 | 19-Apr-2007 23:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | pacha.mp3 | 19-Apr-2007 23:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | pachalic.mp3 | 19-Apr-2007 23:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pachelbel.mp3 | 19-Apr-2007 23:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | pachin.mp3 | 19-Apr-2007 23:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | pachinko.mp3 | 19-Apr-2007 23:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | pachisi.mp3 | 19-Apr-2007 23:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | pachmann.mp3 | 19-Apr-2007 23:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | pachomius.mp3 | 19-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | pachouli.mp3 | 19-Apr-2007 23:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pachuca.mp3 | 19-Apr-2007 23:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | pachuco.mp3 | 19-Apr-2007 23:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | pachy.mp3 | 19-Apr-2007 23:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | pachycephaosaur.mp3 | 19-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | pachyderm.mp3 | 19-Apr-2007 23:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | pachydermatous.mp3 | 19-Apr-2007 23:22 | 11K | |
![[SND]](/icons/sound2.gif) | pachydermous.mp3 | 19-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | pachymeter.mp3 | 19-Apr-2007 23:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | pachyosteomorph.mp3 | 19-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | pachysandra.mp3 | 19-Apr-2007 23:22 | 9.3K | |
![[SND]](/icons/sound2.gif) | pachytene.mp3 | 19-Apr-2007 23:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | pacifarin.mp3 | 19-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | pacifiable.mp3 | 19-Apr-2007 23:22 | 11K | |
![[SND]](/icons/sound2.gif) | Pacific Islands, Trust Territory of the.mp3 | 19-Apr-2007 23:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | Pacific time.mp3 | 19-Apr-2007 23:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | pacific.mp3 | 19-Apr-2007 23:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | Pacifica.mp3 | 19-Apr-2007 23:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | pacifical.mp3 | 19-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | pacifically.mp3 | 19-Apr-2007 23:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | pacificate.mp3 | 19-Apr-2007 23:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | pacification.mp3 | 19-Apr-2007 23:23 | 11K | |
![[SND]](/icons/sound2.gif) | pacificator.mp3 | 19-Apr-2007 23:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | pacificism.mp3 | 19-Apr-2007 23:23 | 10K | |
![[SND]](/icons/sound2.gif) | pacificist.mp3 | 19-Apr-2007 23:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | pacifico.mp3 | 19-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | pacifier.mp3 | 19-Apr-2007 23:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | pacifism.mp3 | 19-Apr-2007 23:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | pacifist.mp3 | 19-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | pacifistic.mp3 | 19-Apr-2007 23:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | pacifistically.mp3 | 19-Apr-2007 23:23 | 10K | |
![[SND]](/icons/sound2.gif) | pacify.mp3 | 19-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pacinian corpuscle.mp3 | 19-Apr-2007 23:24 | 15K | |
![[SND]](/icons/sound2.gif) | paciniancorpuscle.mp3 | 19-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | pacino.mp3 | 19-Apr-2007 23:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | pack.mp3 | 19-Apr-2007 23:24 | 4.8K | |
![[SND]](/icons/sound2.gif) | packability.mp3 | 19-Apr-2007 23:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | packable.mp3 | 19-Apr-2007 23:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | package.mp3 | 19-Apr-2007 23:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | packaged.mp3 | 19-Apr-2007 23:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | packager.mp3 | 19-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | packaging.mp3 | 19-Apr-2007 23:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | packard.mp3 | 19-Apr-2007 23:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | packboard.mp3 | 19-Apr-2007 23:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | packed.mp3 | 19-Apr-2007 23:24 | 5.9K | |
![[SND]](/icons/sound2.gif) | packer.mp3 | 19-Apr-2007 23:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | packet.mp3 | 19-Apr-2007 23:25 | 5.0K | |
![[SND]](/icons/sound2.gif) | packhorse.mp3 | 19-Apr-2007 23:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | packie.mp3 | 19-Apr-2007 23:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | packing.mp3 | 19-Apr-2007 23:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | packinghouse.mp3 | 19-Apr-2007 23:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | packman.mp3 | 19-Apr-2007 23:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | packsack.mp3 | 19-Apr-2007 23:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | packsaddle.mp3 | 19-Apr-2007 23:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | packthread.mp3 | 19-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | packwood.mp3 | 19-Apr-2007 23:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | paclitaxel.mp3 | 19-Apr-2007 23:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | pacman.mp3 | 19-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | pacorabanne.mp3 | 19-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | pact.mp3 | 19-Apr-2007 23:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | pactel.mp3 | 19-Apr-2007 23:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | paction.mp3 | 19-Apr-2007 23:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pactolus.mp3 | 19-Apr-2007 23:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | pacy.mp3 | 19-Apr-2007 23:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | pad thai.mp3 | 19-Apr-2007 23:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | pad.mp3 | 19-Apr-2007 23:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | Padang.mp3 | 19-Apr-2007 23:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | padauk.mp3 | 19-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | padded.mp3 | 19-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | padding.mp3 | 19-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | Paddington.mp3 | 19-Apr-2007 23:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | paddle.mp3 | 19-Apr-2007 23:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | paddleball.mp3 | 19-Apr-2007 23:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | paddleboard.mp3 | 19-Apr-2007 23:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | paddleboat.mp3 | 19-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | paddlefish.mp3 | 19-Apr-2007 23:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | paddler.mp3 | 19-Apr-2007 23:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | paddling.mp3 | 19-Apr-2007 23:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | paddock.mp3 | 19-Apr-2007 23:26 | 5.2K | |
![[SND]](/icons/sound2.gif) | paddy wagon.mp3 | 19-Apr-2007 23:26 | 10K | |
![[SND]](/icons/sound2.gif) | paddy.mp3 | 19-Apr-2007 23:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | paddymelon.mp3 | 19-Apr-2007 23:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | paddywack.mp3 | 19-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | paddywhack.mp3 | 19-Apr-2007 23:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | pademelon.mp3 | 19-Apr-2007 23:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | paderborn.mp3 | 19-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | Paderewski.mp3 | 19-Apr-2007 23:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | padi.mp3 | 19-Apr-2007 23:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | padiddle.mp3 | 19-Apr-2007 23:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | padishah.mp3 | 19-Apr-2007 23:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | padlock.mp3 | 19-Apr-2007 23:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | padmashri.mp3 | 19-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | padnag.mp3 | 19-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | padouk.mp3 | 19-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | Padova.mp3 | 19-Apr-2007 23:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | padparadschahsapphire.mp3 | 19-Apr-2007 23:27 | 17K | |
![[SND]](/icons/sound2.gif) | Padre Island.mp3 | 19-Apr-2007 23:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | padre.mp3 | 19-Apr-2007 23:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | padrino.mp3 | 19-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | padrone.mp3 | 19-Apr-2007 23:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | padroni.mp3 | 19-Apr-2007 23:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | Padua.mp3 | 19-Apr-2007 23:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | Paduan.mp3 | 19-Apr-2007 23:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | paduasoy.mp3 | 19-Apr-2007 23:27 | 10K | |
![[SND]](/icons/sound2.gif) | Paducah.mp3 | 19-Apr-2007 23:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | Padus.mp3 | 19-Apr-2007 23:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | paean.mp3 | 19-Apr-2007 23:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | paedo.mp3 | 19-Apr-2007 23:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | paedogenesis.mp3 | 19-Apr-2007 23:27 | 10K | |
![[SND]](/icons/sound2.gif) | paedogenetic.mp3 | 19-Apr-2007 23:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | paedogenetically.mp3 | 19-Apr-2007 23:27 | 11K | |
![[SND]](/icons/sound2.gif) | paedogenic.mp3 | 19-Apr-2007 23:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | paedomorphic.mp3 | 19-Apr-2007 23:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | paedomorphism.mp3 | 19-Apr-2007 23:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | paedomorphosis.mp3 | 19-Apr-2007 23:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | paekche.mp3 | 19-Apr-2007 23:27 | 17K | |
![[SND]](/icons/sound2.gif) | paella.mp3 | 19-Apr-2007 23:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | paenula.mp3 | 19-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | paeon.mp3 | 19-Apr-2007 23:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | paeony.mp3 | 19-Apr-2007 23:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | paesan.mp3 | 19-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | paesano.mp3 | 19-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | paesiello.mp3 | 19-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | Paestum.mp3 | 19-Apr-2007 23:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | paez.mp3 | 19-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | pafisticated.mp3 | 19-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | pagan.mp3 | 19-Apr-2007 23:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | pagandom.mp3 | 19-Apr-2007 23:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | Paganini.mp3 | 19-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | paganish.mp3 | 19-Apr-2007 23:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | paganism.mp3 | 19-Apr-2007 23:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | paganize.mp3 | 19-Apr-2007 23:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | page.mp3 | 19-Apr-2007 23:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | pageant.mp3 | 19-Apr-2007 23:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | pageantry.mp3 | 19-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | pager.mp3 | 19-Apr-2007 23:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | Paget.mp3 | 19-Apr-2007 23:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | Paget's disease.mp3 | 19-Apr-2007 23:28 | 12K | |
![[SND]](/icons/sound2.gif) | pagettmp.mp3 | 19-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | page-turner.mp3 | 19-Apr-2007 23:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | paginal.mp3 | 19-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | paginate.mp3 | 19-Apr-2007 23:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | pagination.mp3 | 19-Apr-2007 23:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | paging.mp3 | 19-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | pagne.mp3 | 19-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | pagnol.mp3 | 19-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pago Pago.mp3 | 19-Apr-2007 23:29 | 10K | |
![[SND]](/icons/sound2.gif) | pagod.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pagoda.mp3 | 19-Apr-2007 23:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | pagodite.mp3 | 19-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | pagopago.mp3 | 19-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | pagri.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pagurian.mp3 | 19-Apr-2007 23:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | pagurid.mp3 | 19-Apr-2007 23:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | pagus.mp3 | 19-Apr-2007 23:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | pah.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pahang.mp3 | 19-Apr-2007 23:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | pahari.mp3 | 19-Apr-2007 23:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pahlavi.mp3 | 19-Apr-2007 23:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | pahmi.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | paho.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pahoehoe.mp3 | 19-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | pahouin.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pahsien.mp3 | 19-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | paid.mp3 | 19-Apr-2007 23:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | paideia.mp3 | 19-Apr-2007 23:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Paige.mp3 | 19-Apr-2007 23:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | paigle.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | paignton.mp3 | 19-Apr-2007 23:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | paik.mp3 | 19-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pail.mp3 | 19-Apr-2007 23:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | pailful.mp3 | 19-Apr-2007 23:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | paillard.mp3 | 19-Apr-2007 23:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | paillasse.mp3 | 19-Apr-2007 23:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | paillette.mp3 | 19-Apr-2007 23:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | paillon.mp3 | 19-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | pailoo.mp3 | 19-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | paimiochair.mp3 | 19-Apr-2007 23:30 | 17K | |
![[SND]](/icons/sound2.gif) | pain.mp3 | 19-Apr-2007 23:30 | 6.3K | |
![[SND]](/icons/sound2.gif) | Paine.mp3 | 19-Apr-2007 23:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | pained.mp3 | 19-Apr-2007 23:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | painesville.mp3 | 19-Apr-2007 23:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | painful.mp3 | 19-Apr-2007 23:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | painfuller.mp3 | 19-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | painfully.mp3 | 19-Apr-2007 23:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | painfulness.mp3 | 19-Apr-2007 23:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | painkiller.mp3 | 19-Apr-2007 23:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | painkilling.mp3 | 19-Apr-2007 23:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | painless.mp3 | 19-Apr-2007 23:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | Painleve.mp3 | 19-Apr-2007 23:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | painstaking.mp3 | 19-Apr-2007 23:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | painstakingly.mp3 | 19-Apr-2007 23:30 | 11K | |
![[SND]](/icons/sound2.gif) | paint.mp3 | 19-Apr-2007 23:30 | 5.4K | |
![[SND]](/icons/sound2.gif) | paintball.mp3 | 19-Apr-2007 23:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | paintbrush.mp3 | 19-Apr-2007 23:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | painted.mp3 | 19-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | painter.mp3 | 19-Apr-2007 23:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | painterliness.mp3 | 19-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | painterly.mp3 | 19-Apr-2007 23:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | painting.mp3 | 19-Apr-2007 23:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | paintwork.mp3 | 19-Apr-2007 23:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | painty.mp3 | 19-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | pair.mp3 | 19-Apr-2007 23:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | pair-bond.mp3 | 19-Apr-2007 23:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | pairing.mp3 | 19-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | pairle.mp3 | 19-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | paisa.mp3 | 19-Apr-2007 23:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | paisano.mp3 | 19-Apr-2007 23:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | paise.mp3 | 19-Apr-2007 23:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | paisiello.mp3 | 19-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | paisley.mp3 | 19-Apr-2007 23:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | paisleyism.mp3 | 19-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | paisleyite.mp3 | 19-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | paitrick.mp3 | 19-Apr-2007 23:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | Paiute.mp3 | 19-Apr-2007 23:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | pajama.mp3 | 19-Apr-2007 23:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | pajamaed.mp3 | 19-Apr-2007 23:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | pajamas.mp3 | 19-Apr-2007 23:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | pak choi.mp3 | 19-Apr-2007 23:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | pak.mp3 | 19-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | pakahi.mp3 | 19-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | pakalolo.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | Pakanbaru.mp3 | 19-Apr-2007 23:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | pakapoo.mp3 | 19-Apr-2007 23:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | pakapotti.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | pakaraimamountains.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | pakche.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | pakchoi.mp3 | 19-Apr-2007 23:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | pakeha.mp3 | 19-Apr-2007 23:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | pakhtun.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | Paki.mp3 | 19-Apr-2007 23:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | pakirikiri.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | Pakistan.mp3 | 19-Apr-2007 23:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | Pakistani.mp3 | 19-Apr-2007 23:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | pakki.mp3 | 19-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | pakokku.mp3 | 19-Apr-2007 23:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | pakora.mp3 | 19-Apr-2007 23:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | pakse.mp3 | 19-Apr-2007 23:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | pal.mp3 | 19-Apr-2007 23:32 | 5.9K | |
![[SND]](/icons/sound2.gif) | pala.mp3 | 19-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | palabra.mp3 | 19-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | palace.mp3 | 19-Apr-2007 23:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | palacecoup.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | palaciovaldes.mp3 | 19-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | palade.mp3 | 19-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | paladic.mp3 | 19-Apr-2007 23:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | paladin.mp3 | 19-Apr-2007 23:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | palae.mp3 | 19-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | palaeo.mp3 | 19-Apr-2007 23:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | palaeologus.mp3 | 19-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | Palaestina.mp3 | 19-Apr-2007 23:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | palaestra.mp3 | 19-Apr-2007 23:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | palaestrae.mp3 | 19-Apr-2007 23:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | palafitte.mp3 | 19-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | palagi.mp3 | 19-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | palais.mp3 | 19-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | palaisdedanse.mp3 | 19-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | palamedes.mp3 | 19-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | palampore.mp3 | 19-Apr-2007 23:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | palanquin.mp3 | 19-Apr-2007 23:33 | 9.3K | |
![[SND]](/icons/sound2.gif) | palapa.mp3 | 19-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | palari.mp3 | 19-Apr-2007 23:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | palatability.mp3 | 19-Apr-2007 23:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | palatable.mp3 | 19-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | palatably.mp3 | 19-Apr-2007 23:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | palatal.mp3 | 19-Apr-2007 23:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | palatalization.mp3 | 19-Apr-2007 23:33 | 11K | |
![[SND]](/icons/sound2.gif) | palatalize.mp3 | 19-Apr-2007 23:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | palatalized.mp3 | 19-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | palatally.mp3 | 19-Apr-2007 23:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | palate.mp3 | 19-Apr-2007 23:33 | 5.2K | |
![[SND]](/icons/sound2.gif) | palatial.mp3 | 19-Apr-2007 23:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | palatially.mp3 | 19-Apr-2007 23:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | palatic.mp3 | 19-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | palatinate.mp3 | 19-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | palatine.mp3 | 19-Apr-2007 23:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | palatium.mp3 | 19-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | palatka.mp3 | 19-Apr-2007 23:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | palato.mp3 | 19-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | palatogram.mp3 | 19-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | palatography.mp3 | 19-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | Palau.mp3 | 19-Apr-2007 23:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | Palauan.mp3 | 19-Apr-2007 23:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | palauislands.mp3 | 19-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | palaver.mp3 | 19-Apr-2007 23:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | palavering.mp3 | 19-Apr-2007 23:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | Palawan.mp3 | 19-Apr-2007 23:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | palazzi.mp3 | 19-Apr-2007 23:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | palazzo.mp3 | 19-Apr-2007 23:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | pale.mp3 | 19-Apr-2007 23:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | palea.mp3 | 19-Apr-2007 23:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | paleaceous.mp3 | 19-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | paleae.mp3 | 19-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | paleal.mp3 | 19-Apr-2007 23:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | Palearctic.mp3 | 19-Apr-2007 23:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | paleate.mp3 | 19-Apr-2007 23:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | paled.mp3 | 19-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | paleface.mp3 | 19-Apr-2007 23:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | palely.mp3 | 19-Apr-2007 23:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | Palembang.mp3 | 19-Apr-2007 23:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | Palencia.mp3 | 19-Apr-2007 23:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | paleness.mp3 | 19-Apr-2007 23:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | Palenque.mp3 | 19-Apr-2007 23:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | paleo.mp3 | 19-Apr-2007 23:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | paleoanthropological.mp3 | 19-Apr-2007 23:35 | 18K | |
![[SND]](/icons/sound2.gif) | paleoanthropologist.mp3 | 19-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | paleoanthropology.mp3 | 19-Apr-2007 23:35 | 16K | |
![[SND]](/icons/sound2.gif) | paleobiologic.mp3 | 19-Apr-2007 23:35 | 13K | |
![[SND]](/icons/sound2.gif) | paleobiological.mp3 | 19-Apr-2007 23:35 | 14K | |
![[SND]](/icons/sound2.gif) | paleobiologist.mp3 | 19-Apr-2007 23:35 | 14K | |
![[SND]](/icons/sound2.gif) | paleobiology.mp3 | 19-Apr-2007 23:35 | 12K | |
![[SND]](/icons/sound2.gif) | paleobotanic.mp3 | 19-Apr-2007 23:35 | 11K | |
![[SND]](/icons/sound2.gif) | paleobotanical.mp3 | 19-Apr-2007 23:35 | 12K | |
![[SND]](/icons/sound2.gif) | paleobotanically.mp3 | 19-Apr-2007 23:35 | 13K | |
![[SND]](/icons/sound2.gif) | paleobotanist.mp3 | 19-Apr-2007 23:35 | 12K | |
![[SND]](/icons/sound2.gif) | paleobotany.mp3 | 19-Apr-2007 23:35 | 11K | |
![[SND]](/icons/sound2.gif) | Paleocene.mp3 | 19-Apr-2007 23:35 | 10K | |
![[SND]](/icons/sound2.gif) | paleoclimatic.mp3 | 19-Apr-2007 23:35 | 13K | |
![[SND]](/icons/sound2.gif) | paleoclimatologist.mp3 | 19-Apr-2007 23:35 | 15K | |
![[SND]](/icons/sound2.gif) | paleoclimatology.mp3 | 19-Apr-2007 23:35 | 16K | |
![[SND]](/icons/sound2.gif) | paleoconservative.mp3 | 19-Apr-2007 23:36 | 14K | |
![[SND]](/icons/sound2.gif) | paleoecologic.mp3 | 19-Apr-2007 23:36 | 13K | |
![[SND]](/icons/sound2.gif) | paleoecological.mp3 | 19-Apr-2007 23:36 | 14K | |
![[SND]](/icons/sound2.gif) | paleoecologist.mp3 | 19-Apr-2007 23:36 | 13K | |
![[SND]](/icons/sound2.gif) | paleoecology.mp3 | 19-Apr-2007 23:36 | 13K | |
![[SND]](/icons/sound2.gif) | Paleogene.mp3 | 19-Apr-2007 23:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | paleogeographic.mp3 | 19-Apr-2007 23:36 | 13K | |
![[SND]](/icons/sound2.gif) | paleogeographical.mp3 | 19-Apr-2007 23:36 | 14K | |
![[SND]](/icons/sound2.gif) | paleogeographically.mp3 | 19-Apr-2007 23:36 | 15K | |
![[SND]](/icons/sound2.gif) | paleogeography.mp3 | 19-Apr-2007 23:36 | 14K | |
![[SND]](/icons/sound2.gif) | paleographer.mp3 | 19-Apr-2007 23:36 | 11K | |
![[SND]](/icons/sound2.gif) | paleographic.mp3 | 19-Apr-2007 23:36 | 10K | |
![[SND]](/icons/sound2.gif) | paleographical.mp3 | 19-Apr-2007 23:36 | 10K | |
![[SND]](/icons/sound2.gif) | paleographically.mp3 | 19-Apr-2007 23:36 | 13K | |
![[SND]](/icons/sound2.gif) | paleography.mp3 | 19-Apr-2007 23:36 | 10K | |
![[SND]](/icons/sound2.gif) | Paleo-Indian.mp3 | 19-Apr-2007 23:36 | 11K | |
![[SND]](/icons/sound2.gif) | paleolith.mp3 | 19-Apr-2007 23:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | paleolithic.mp3 | 19-Apr-2007 23:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | paleology.mp3 | 19-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | paleomagnetic.mp3 | 19-Apr-2007 23:36 | 12K | |
![[SND]](/icons/sound2.gif) | paleomagnetically.mp3 | 19-Apr-2007 23:36 | 14K | |
![[SND]](/icons/sound2.gif) | paleomagnetism.mp3 | 19-Apr-2007 23:36 | 14K | |
![[SND]](/icons/sound2.gif) | paleomagnetist.mp3 | 19-Apr-2007 23:36 | 13K | |
![[SND]](/icons/sound2.gif) | paleontography.mp3 | 19-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | paleontologic.mp3 | 19-Apr-2007 23:37 | 12K | |
![[SND]](/icons/sound2.gif) | paleontological.mp3 | 19-Apr-2007 23:37 | 13K | |
![[SND]](/icons/sound2.gif) | paleontologist.mp3 | 19-Apr-2007 23:37 | 13K | |
![[SND]](/icons/sound2.gif) | paleontology.mp3 | 19-Apr-2007 23:37 | 12K | |
![[SND]](/icons/sound2.gif) | paleopathological.mp3 | 19-Apr-2007 23:37 | 15K | |
![[SND]](/icons/sound2.gif) | paleopathologist.mp3 | 19-Apr-2007 23:37 | 14K | |
![[SND]](/icons/sound2.gif) | paleopathology.mp3 | 19-Apr-2007 23:37 | 13K | |
![[SND]](/icons/sound2.gif) | Paleozoic.mp3 | 19-Apr-2007 23:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | paleozoological.mp3 | 19-Apr-2007 23:37 | 13K | |
![[SND]](/icons/sound2.gif) | paleozoologist.mp3 | 19-Apr-2007 23:37 | 13K | |
![[SND]](/icons/sound2.gif) | paleozoology.mp3 | 19-Apr-2007 23:37 | 11K | |
![[SND]](/icons/sound2.gif) | Palermitan.mp3 | 19-Apr-2007 23:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | Palermo.mp3 | 19-Apr-2007 23:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | Palestine.mp3 | 19-Apr-2007 23:37 | 9.8K | |
![[SND]](/icons/sound2.gif) | Palestinian.mp3 | 19-Apr-2007 23:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | palestra.mp3 | 19-Apr-2007 23:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | Palestrina.mp3 | 19-Apr-2007 23:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | palet.mp3 | 19-Apr-2007 23:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | paletot.mp3 | 19-Apr-2007 23:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | palette.mp3 | 19-Apr-2007 23:37 | 5.2K | |
![[SND]](/icons/sound2.gif) | Paley.mp3 | 19-Apr-2007 23:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | palfrey.mp3 | 19-Apr-2007 23:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | Palgrave.mp3 | 19-Apr-2007 23:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | Pali.mp3 | 19-Apr-2007 23:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | palikar.mp3 | 19-Apr-2007 23:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | palila.mp3 | 19-Apr-2007 23:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | palilalia.mp3 | 19-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | palilogy.mp3 | 19-Apr-2007 23:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | palimony.mp3 | 19-Apr-2007 23:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | palimpsest.mp3 | 19-Apr-2007 23:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | palimscope.mp3 | 19-Apr-2007 23:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | palindrome.mp3 | 19-Apr-2007 23:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | palindromic.mp3 | 19-Apr-2007 23:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | palindromist.mp3 | 19-Apr-2007 23:38 | 10K | |
![[SND]](/icons/sound2.gif) | paling.mp3 | 19-Apr-2007 23:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | palingenesis.mp3 | 19-Apr-2007 23:38 | 11K | |
![[SND]](/icons/sound2.gif) | palingenesist.mp3 | 19-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | palingenetic.mp3 | 19-Apr-2007 23:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | palinode.mp3 | 19-Apr-2007 23:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | palinopsia.mp3 | 19-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | paliphrasia.mp3 | 19-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | palisade.mp3 | 19-Apr-2007 23:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | Palisades.mp3 | 19-Apr-2007 23:38 | 10K | |
![[SND]](/icons/sound2.gif) | palisado.mp3 | 19-Apr-2007 23:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | palisander.mp3 | 19-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | palish.mp3 | 19-Apr-2007 23:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | palissy.mp3 | 19-Apr-2007 23:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | Palk Strait.mp3 | 19-Apr-2007 23:38 | 5.2K | |
![[SND]](/icons/sound2.gif) | palki.mp3 | 19-Apr-2007 23:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | palkstrait.mp3 | 19-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | pall.mp3 | 19-Apr-2007 23:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | palla.mp3 | 19-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | palladia.mp3 | 19-Apr-2007 23:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | Palladian.mp3 | 19-Apr-2007 23:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | Palladianism.mp3 | 19-Apr-2007 23:39 | 10K | |
![[SND]](/icons/sound2.gif) | palladic.mp3 | 19-Apr-2007 23:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | palladinize.mp3 | 19-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | Palladio.mp3 | 19-Apr-2007 23:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | palladium.mp3 | 19-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | palladize.mp3 | 19-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | palladous.mp3 | 19-Apr-2007 23:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | pallah.mp3 | 19-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pallas.mp3 | 19-Apr-2007 23:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | pallasite.mp3 | 19-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | pallbearer.mp3 | 19-Apr-2007 23:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | pallescent.mp3 | 19-Apr-2007 23:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | pallet.mp3 | 19-Apr-2007 23:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | palleted.mp3 | 19-Apr-2007 23:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | palletization.mp3 | 19-Apr-2007 23:39 | 11K | |
![[SND]](/icons/sound2.gif) | palletize.mp3 | 19-Apr-2007 23:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | palletizer.mp3 | 19-Apr-2007 23:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | pallette.mp3 | 19-Apr-2007 23:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | pallia.mp3 | 19-Apr-2007 23:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | pallial.mp3 | 19-Apr-2007 23:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | palliasse.mp3 | 19-Apr-2007 23:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | palliate.mp3 | 19-Apr-2007 23:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | palliation.mp3 | 19-Apr-2007 23:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | palliative.mp3 | 19-Apr-2007 23:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | palliator.mp3 | 19-Apr-2007 23:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | pallid.mp3 | 19-Apr-2007 23:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | pallida Mors.mp3 | 19-Apr-2007 23:40 | 11K | |
![[SND]](/icons/sound2.gif) | pallidamors.mp3 | 19-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | pallidotomy.mp3 | 19-Apr-2007 23:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | palliser.mp3 | 19-Apr-2007 23:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | pallium.mp3 | 19-Apr-2007 23:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | pallmall.mp3 | 19-Apr-2007 23:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | pall-mall.mp3 | 19-Apr-2007 23:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | pallor.mp3 | 19-Apr-2007 23:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | pally.mp3 | 19-Apr-2007 23:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | palm.mp3 | 19-Apr-2007 23:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | Palma de Mallorca.mp3 | 19-Apr-2007 23:40 | 13K | |
![[SND]](/icons/sound2.gif) | Palma.mp3 | 19-Apr-2007 23:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | palmaceous.mp3 | 19-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | palmachristi.mp3 | 19-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | palmademallorca.mp3 | 19-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | palmar.mp3 | 19-Apr-2007 23:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | palmary.mp3 | 19-Apr-2007 23:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | Palmas, Cape.mp3 | 19-Apr-2007 23:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | palmas.mp3 | 19-Apr-2007 23:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | palmate.mp3 | 19-Apr-2007 23:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | palmated.mp3 | 19-Apr-2007 23:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | palmatifid.mp3 | 19-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | palmation.mp3 | 19-Apr-2007 23:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | palmbay.mp3 | 19-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | Palmdale.mp3 | 19-Apr-2007 23:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | palme.mp3 | 19-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | palmed.mp3 | 19-Apr-2007 23:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | Palmer Archipelago.mp3 | 19-Apr-2007 23:41 | 5.2K | |
![[SND]](/icons/sound2.gif) | palmer.mp3 | 19-Apr-2007 23:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | palmerarchipelago.mp3 | 19-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | Palmerston.mp3 | 19-Apr-2007 23:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | Palmerstonian.mp3 | 19-Apr-2007 23:41 | 9.8K | |
![[SND]](/icons/sound2.gif) | palmerworm.mp3 | 19-Apr-2007 23:41 | 10K | |
![[SND]](/icons/sound2.gif) | palmette.mp3 | 19-Apr-2007 23:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | palmetto.mp3 | 19-Apr-2007 23:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | palmful.mp3 | 19-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | Palmgren.mp3 | 19-Apr-2007 23:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | palmiet.mp3 | 19-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | palmiped.mp3 | 19-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | palmira.mp3 | 19-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | palmist.mp3 | 19-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | palmistry.mp3 | 19-Apr-2007 23:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | palmitate.mp3 | 19-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | palmitic acid.mp3 | 19-Apr-2007 23:41 | 13K | |
![[SND]](/icons/sound2.gif) | palmitic.mp3 | 19-Apr-2007 23:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | palmitin.mp3 | 19-Apr-2007 23:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | palmitoleicacid.mp3 | 19-Apr-2007 23:42 | 27K | |
![[SND]](/icons/sound2.gif) | palmlike.mp3 | 19-Apr-2007 23:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | palmolive.mp3 | 19-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | palmsprings.mp3 | 19-Apr-2007 23:42 | 17K | |
![[SND]](/icons/sound2.gif) | palmtop.mp3 | 19-Apr-2007 23:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | palmy.mp3 | 19-Apr-2007 23:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Palmyra.mp3 | 19-Apr-2007 23:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | Palmyrene.mp3 | 19-Apr-2007 23:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Palo Alto.mp3 | 19-Apr-2007 23:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | paloalto.mp3 | 19-Apr-2007 23:42 | 36K | |
![[SND]](/icons/sound2.gif) | palolo.mp3 | 19-Apr-2007 23:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | paloma.mp3 | 19-Apr-2007 23:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | Palomar Mountain.mp3 | 19-Apr-2007 23:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | palomar.mp3 | 19-Apr-2007 23:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | palometa.mp3 | 19-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | palomino.mp3 | 19-Apr-2007 23:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | palone.mp3 | 19-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | palooka.mp3 | 19-Apr-2007 23:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | palookaville.mp3 | 19-Apr-2007 23:42 | 17K | |
![[SND]](/icons/sound2.gif) | Palos de la Frontera.mp3 | 19-Apr-2007 23:42 | 15K | |
![[SND]](/icons/sound2.gif) | Palos.mp3 | 19-Apr-2007 23:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | palosanto.mp3 | 19-Apr-2007 23:42 | 17K | |
![[SND]](/icons/sound2.gif) | paloshills.mp3 | 19-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | Palouse.mp3 | 19-Apr-2007 23:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | paloverde.mp3 | 19-Apr-2007 23:43 | 10K | |
![[SND]](/icons/sound2.gif) | palp.mp3 | 19-Apr-2007 23:43 | 5.4K | |
![[SND]](/icons/sound2.gif) | palpability.mp3 | 19-Apr-2007 23:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | palpable.mp3 | 19-Apr-2007 23:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | palpably.mp3 | 19-Apr-2007 23:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | palpal.mp3 | 19-Apr-2007 23:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | palpate.mp3 | 19-Apr-2007 23:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | palpation.mp3 | 19-Apr-2007 23:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | palpebra.mp3 | 19-Apr-2007 23:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | palpebral.mp3 | 19-Apr-2007 23:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | palpebrate.mp3 | 19-Apr-2007 23:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | palpi.mp3 | 19-Apr-2007 23:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | palpitant.mp3 | 19-Apr-2007 23:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | palpitate.mp3 | 19-Apr-2007 23:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | palpitation.mp3 | 19-Apr-2007 23:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | palpus.mp3 | 19-Apr-2007 23:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | palsa.mp3 | 19-Apr-2007 23:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | palseywalsey.mp3 | 19-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | palsgrave.mp3 | 19-Apr-2007 23:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | palsgravine.mp3 | 19-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | palship.mp3 | 19-Apr-2007 23:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | palsie.mp3 | 19-Apr-2007 23:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | palsied.mp3 | 19-Apr-2007 23:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | palstave.mp3 | 19-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | palsy.mp3 | 19-Apr-2007 23:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | palsywalsy.mp3 | 19-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | palsy-walsy.mp3 | 19-Apr-2007 23:44 | 12K | |
![[SND]](/icons/sound2.gif) | palter.mp3 | 19-Apr-2007 23:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | palterer.mp3 | 19-Apr-2007 23:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | paltering.mp3 | 19-Apr-2007 23:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | paltry.mp3 | 19-Apr-2007 23:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | paludal.mp3 | 19-Apr-2007 23:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | paludamentum.mp3 | 19-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | paludism.mp3 | 19-Apr-2007 23:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | paludrine.mp3 | 19-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | paluka.mp3 | 19-Apr-2007 23:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | paly.mp3 | 19-Apr-2007 23:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | palynologic.mp3 | 19-Apr-2007 23:44 | 11K | |
![[SND]](/icons/sound2.gif) | palynological.mp3 | 19-Apr-2007 23:44 | 11K | |
![[SND]](/icons/sound2.gif) | palynologically.mp3 | 19-Apr-2007 23:44 | 12K | |
![[SND]](/icons/sound2.gif) | palynologist.mp3 | 19-Apr-2007 23:44 | 11K | |
![[SND]](/icons/sound2.gif) | palynology.mp3 | 19-Apr-2007 23:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | palytoxin.mp3 | 19-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | pam.mp3 | 19-Apr-2007 23:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | pamanyungan.mp3 | 19-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | pamaquine.mp3 | 19-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | pamela.mp3 | 19-Apr-2007 23:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | pameton.mp3 | 19-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pamir.mp3 | 19-Apr-2007 23:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | pamiri.mp3 | 19-Apr-2007 23:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pamirs.mp3 | 19-Apr-2007 23:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | Pamlico.mp3 | 19-Apr-2007 23:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | pamlicosound.mp3 | 19-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | pampa.mp3 | 19-Apr-2007 23:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | pampas grass.mp3 | 19-Apr-2007 23:45 | 11K | |
![[SND]](/icons/sound2.gif) | pampas.mp3 | 19-Apr-2007 23:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | pampean.mp3 | 19-Apr-2007 23:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pampeluna.mp3 | 19-Apr-2007 23:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | pamper.mp3 | 19-Apr-2007 23:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | pamperer.mp3 | 19-Apr-2007 23:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | pampering.mp3 | 19-Apr-2007 23:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | pampero.mp3 | 19-Apr-2007 23:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | pampers.mp3 | 19-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | pamphlet.mp3 | 19-Apr-2007 23:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | pamphleteer.mp3 | 19-Apr-2007 23:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | pamphletize.mp3 | 19-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | pamphrey.mp3 | 19-Apr-2007 23:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pamphylia.mp3 | 19-Apr-2007 23:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pamphylian.mp3 | 19-Apr-2007 23:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | Pamplona.mp3 | 19-Apr-2007 23:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | pampootie.mp3 | 19-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | pamprodactylous.mp3 | 19-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | pan.mp3 | 19-Apr-2007 23:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | panacea.mp3 | 19-Apr-2007 23:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | panacean.mp3 | 19-Apr-2007 23:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | panache.mp3 | 19-Apr-2007 23:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | panada.mp3 | 19-Apr-2007 23:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | Pan-African.mp3 | 19-Apr-2007 23:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | Pan-Africanism.mp3 | 19-Apr-2007 23:46 | 11K | |
![[SND]](/icons/sound2.gif) | Pan-Africanist.mp3 | 19-Apr-2007 23:46 | 11K | |
![[SND]](/icons/sound2.gif) | panagia.mp3 | 19-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | Panaji.mp3 | 19-Apr-2007 23:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | panam.mp3 | 19-Apr-2007 23:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | Panama.mp3 | 19-Apr-2007 23:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | Panamanian.mp3 | 19-Apr-2007 23:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | Pan-American.mp3 | 19-Apr-2007 23:46 | 9.8K | |
![[SND]](/icons/sound2.gif) | Pan-Americanism.mp3 | 19-Apr-2007 23:46 | 12K | |
![[SND]](/icons/sound2.gif) | panamiga.mp3 | 19-Apr-2007 23:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Panamint Mountains.mp3 | 19-Apr-2007 23:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | panamintmountains.mp3 | 19-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | pan-Arab.mp3 | 19-Apr-2007 23:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pan-Arabism.mp3 | 19-Apr-2007 23:46 | 11K | |
![[SND]](/icons/sound2.gif) | pan-Arabist.mp3 | 19-Apr-2007 23:46 | 11K | |
![[SND]](/icons/sound2.gif) | panaritium.mp3 | 19-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | panasonic.mp3 | 19-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | panatela.mp3 | 19-Apr-2007 23:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | panatella.mp3 | 19-Apr-2007 23:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | panathenaea.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | panathenaic.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | panavision.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | Panay.mp3 | 19-Apr-2007 23:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | pancake.mp3 | 19-Apr-2007 23:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pan-Cake.mp3 | 19-Apr-2007 23:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | pancetta.mp3 | 19-Apr-2007 23:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | panchaia.mp3 | 19-Apr-2007 23:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | panchasila.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | panchatantra.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | panchax.mp3 | 19-Apr-2007 23:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | panchayat.mp3 | 19-Apr-2007 23:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | Panchen Lama.mp3 | 19-Apr-2007 23:47 | 10K | |
![[SND]](/icons/sound2.gif) | panchenlama.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | panchetto.mp3 | 19-Apr-2007 23:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | panchovilla.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | panchreston.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | panchromatic.mp3 | 19-Apr-2007 23:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | pancratiast.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | pancratic.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | pancratium.mp3 | 19-Apr-2007 23:47 | 9.8K | |
![[SND]](/icons/sound2.gif) | pancreas.mp3 | 19-Apr-2007 23:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | pancreat.mp3 | 19-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | pancreatectomized.mp3 | 19-Apr-2007 23:47 | 14K | |
![[SND]](/icons/sound2.gif) | pancreatectomy.mp3 | 19-Apr-2007 23:48 | 13K | |
![[SND]](/icons/sound2.gif) | pancreatic.mp3 | 19-Apr-2007 23:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | pancreaticfibrosis.mp3 | 19-Apr-2007 23:48 | 17K | |
![[SND]](/icons/sound2.gif) | pancreatin.mp3 | 19-Apr-2007 23:48 | 10K | |
![[SND]](/icons/sound2.gif) | pancreatitides.mp3 | 19-Apr-2007 23:48 | 13K | |
![[SND]](/icons/sound2.gif) | pancreatitis.mp3 | 19-Apr-2007 23:48 | 12K | |
![[SND]](/icons/sound2.gif) | pancreato.mp3 | 19-Apr-2007 23:48 | 17K | |
![[SND]](/icons/sound2.gif) | pancreatotomy.mp3 | 19-Apr-2007 23:48 | 17K | |
![[SND]](/icons/sound2.gif) | pancreozymin.mp3 | 19-Apr-2007 23:48 | 12K | |
![[SND]](/icons/sound2.gif) | pancuroniumbromide.mp3 | 19-Apr-2007 23:48 | 17K | |
![[SND]](/icons/sound2.gif) | pancytopenia.mp3 | 19-Apr-2007 23:48 | 12K | |
![[SND]](/icons/sound2.gif) | panda.mp3 | 19-Apr-2007 23:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | pandal.mp3 | 19-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pandanaceous.mp3 | 19-Apr-2007 23:48 | 17K | |
![[SND]](/icons/sound2.gif) | pandani.mp3 | 19-Apr-2007 23:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | pandanus.mp3 | 19-Apr-2007 23:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | Pandarus.mp3 | 19-Apr-2007 23:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | pandavas.mp3 | 19-Apr-2007 23:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pandean.mp3 | 19-Apr-2007 23:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | pandect.mp3 | 19-Apr-2007 23:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | pandemic.mp3 | 19-Apr-2007 23:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | pandemonium.mp3 | 19-Apr-2007 23:48 | 10K | |
![[SND]](/icons/sound2.gif) | pander.mp3 | 19-Apr-2007 23:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | panderer.mp3 | 19-Apr-2007 23:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | pandering.mp3 | 19-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pandiculation.mp3 | 19-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | pandit.mp3 | 19-Apr-2007 23:49 | 5.5K | |
![[SND]](/icons/sound2.gif) | pandoor.mp3 | 19-Apr-2007 23:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | pandora.mp3 | 19-Apr-2007 23:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | pandoraefretum.mp3 | 19-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | Pandora's box.mp3 | 19-Apr-2007 23:49 | 13K | |
![[SND]](/icons/sound2.gif) | pandore.mp3 | 19-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | pandour.mp3 | 19-Apr-2007 23:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | pandoura.mp3 | 19-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | pandowdy.mp3 | 19-Apr-2007 23:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | pandurate.mp3 | 19-Apr-2007 23:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | pandure.mp3 | 19-Apr-2007 23:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | panduriform.mp3 | 19-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | pandy.mp3 | 19-Apr-2007 23:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | pane.mp3 | 19-Apr-2007 23:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | paned.mp3 | 19-Apr-2007 23:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | paneer.mp3 | 19-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | panegyric.mp3 | 19-Apr-2007 23:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | panegyrical.mp3 | 19-Apr-2007 23:49 | 10K | |
![[SND]](/icons/sound2.gif) | panegyrically.mp3 | 19-Apr-2007 23:49 | 10K | |
![[SND]](/icons/sound2.gif) | panegyrist.mp3 | 19-Apr-2007 23:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | panegyrize.mp3 | 19-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | panel.mp3 | 19-Apr-2007 23:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | panela.mp3 | 19-Apr-2007 23:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | paneless.mp3 | 19-Apr-2007 23:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | paneling.mp3 | 19-Apr-2007 23:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | panelist.mp3 | 19-Apr-2007 23:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | panelized.mp3 | 19-Apr-2007 23:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | panelology.mp3 | 19-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | panem et circenses.mp3 | 19-Apr-2007 23:50 | 18K | |
![[SND]](/icons/sound2.gif) | panemetcircenses.mp3 | 19-Apr-2007 23:50 | 27K | |
![[SND]](/icons/sound2.gif) | panencephalitis.mp3 | 19-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | panentheism.mp3 | 19-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | panetella.mp3 | 19-Apr-2007 23:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | panetiere.mp3 | 19-Apr-2007 23:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | panettone.mp3 | 19-Apr-2007 23:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | panfish.mp3 | 19-Apr-2007 23:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | panfry.mp3 | 19-Apr-2007 23:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | panful.mp3 | 19-Apr-2007 23:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | pang.mp3 | 19-Apr-2007 23:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | panga.mp3 | 19-Apr-2007 23:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | Pangaea.mp3 | 19-Apr-2007 23:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | pangenesis.mp3 | 19-Apr-2007 23:50 | 10K | |
![[SND]](/icons/sound2.gif) | pangenetic.mp3 | 19-Apr-2007 23:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | pangfou.mp3 | 19-Apr-2007 23:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | pangim.mp3 | 19-Apr-2007 23:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | Panglossian.mp3 | 19-Apr-2007 23:50 | 9.8K | |
![[SND]](/icons/sound2.gif) | pangola grass.mp3 | 19-Apr-2007 23:50 | 13K | |
![[SND]](/icons/sound2.gif) | pangolagrass.mp3 | 19-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | pangolin.mp3 | 19-Apr-2007 23:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | pangopango.mp3 | 19-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | pangram.mp3 | 19-Apr-2007 23:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | pangu.mp3 | 19-Apr-2007 23:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | panguingue.mp3 | 19-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | pangwe.mp3 | 19-Apr-2007 23:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | panhandle.mp3 | 19-Apr-2007 23:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | panhandler.mp3 | 19-Apr-2007 23:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | panhandling.mp3 | 19-Apr-2007 23:51 | 11K | |
![[SND]](/icons/sound2.gif) | Panhellenic.mp3 | 19-Apr-2007 23:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | Panhormus.mp3 | 19-Apr-2007 23:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | panhoss.mp3 | 19-Apr-2007 23:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | panhuman.mp3 | 19-Apr-2007 23:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | panic grass.mp3 | 19-Apr-2007 23:51 | 11K | |
![[SND]](/icons/sound2.gif) | panic.mp3 | 19-Apr-2007 23:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | panicked.mp3 | 19-Apr-2007 23:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | panicky.mp3 | 19-Apr-2007 23:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | panicle.mp3 | 19-Apr-2007 23:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | panicled.mp3 | 19-Apr-2007 23:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | panic-stricken.mp3 | 19-Apr-2007 23:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | paniculate.mp3 | 19-Apr-2007 23:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | panicum.mp3 | 19-Apr-2007 23:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | panier.mp3 | 19-Apr-2007 23:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | Panini.mp3 | 19-Apr-2007 23:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | paniolo.mp3 | 19-Apr-2007 23:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Panipat.mp3 | 19-Apr-2007 23:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | panivorous.mp3 | 19-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | Panjab.mp3 | 19-Apr-2007 23:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | Panjabi.mp3 | 19-Apr-2007 23:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | panjandra.mp3 | 19-Apr-2007 23:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | panjandrum.mp3 | 19-Apr-2007 23:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | panjim.mp3 | 19-Apr-2007 23:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | Panjnad.mp3 | 19-Apr-2007 23:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pankhurst.mp3 | 19-Apr-2007 23:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pankow.mp3 | 19-Apr-2007 23:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | panku.mp3 | 19-Apr-2007 23:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | panlectalgrid.mp3 | 19-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | panleukopenia.mp3 | 19-Apr-2007 23:52 | 12K | |
![[SND]](/icons/sound2.gif) | panlogism.mp3 | 19-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | panman.mp3 | 19-Apr-2007 23:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | panmictic.mp3 | 19-Apr-2007 23:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | panmixia.mp3 | 19-Apr-2007 23:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | Panmunjom.mp3 | 19-Apr-2007 23:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | pannage.mp3 | 19-Apr-2007 23:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | panne.mp3 | 19-Apr-2007 23:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | pannhas.mp3 | 19-Apr-2007 23:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | panniculus.mp3 | 19-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | pannier.mp3 | 19-Apr-2007 23:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | pannikin.mp3 | 19-Apr-2007 23:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | panning.mp3 | 19-Apr-2007 23:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pannini.mp3 | 19-Apr-2007 23:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pannonia.mp3 | 19-Apr-2007 23:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | pannose.mp3 | 19-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | pannus.mp3 | 19-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | panoan.mp3 | 19-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | panocha.mp3 | 19-Apr-2007 23:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | Panofsky.mp3 | 19-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | panoplied.mp3 | 19-Apr-2007 23:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | panoply.mp3 | 19-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | panoptic.mp3 | 19-Apr-2007 23:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | panopticon.mp3 | 19-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | panorama.mp3 | 19-Apr-2007 23:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | panoramic.mp3 | 19-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | panoramically.mp3 | 19-Apr-2007 23:53 | 10K | |
![[SND]](/icons/sound2.gif) | Panormus.mp3 | 19-Apr-2007 23:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | panpipe.mp3 | 19-Apr-2007 23:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | panplegia.mp3 | 19-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | panpsychism.mp3 | 19-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | pansexual.mp3 | 19-Apr-2007 23:53 | 10K | |
![[SND]](/icons/sound2.gif) | pansexuality.mp3 | 19-Apr-2007 23:53 | 12K | |
![[SND]](/icons/sound2.gif) | pansified.mp3 | 19-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | pansil.mp3 | 19-Apr-2007 23:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pan-Slavic.mp3 | 19-Apr-2007 23:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | Pan-Slavism.mp3 | 19-Apr-2007 23:53 | 10K | |
![[SND]](/icons/sound2.gif) | Pan-Slavist.mp3 | 19-Apr-2007 23:53 | 10K | |
![[SND]](/icons/sound2.gif) | pansophism.mp3 | 19-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | pansophy.mp3 | 19-Apr-2007 23:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | panspermia.mp3 | 19-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | pansy.mp3 | 19-Apr-2007 23:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | pant.mp3 | 19-Apr-2007 23:54 | 5.4K | |
![[SND]](/icons/sound2.gif) | panta rhei.mp3 | 19-Apr-2007 23:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | pantagraph.mp3 | 19-Apr-2007 23:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pantagruel.mp3 | 19-Apr-2007 23:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | Pantagruelian.mp3 | 19-Apr-2007 23:54 | 11K | |
![[SND]](/icons/sound2.gif) | pantalets.mp3 | 19-Apr-2007 23:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | pantalettes.mp3 | 19-Apr-2007 23:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | pantalone.mp3 | 19-Apr-2007 23:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | pantaloon.mp3 | 19-Apr-2007 23:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | pantarhei.mp3 | 19-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | pantechnicon.mp3 | 19-Apr-2007 23:54 | 10K | |
![[SND]](/icons/sound2.gif) | Pantelleria.mp3 | 19-Apr-2007 23:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | pantene.mp3 | 19-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | pantheism.mp3 | 19-Apr-2007 23:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | pantheist.mp3 | 19-Apr-2007 23:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | pantheistic.mp3 | 19-Apr-2007 23:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | pantheistical.mp3 | 19-Apr-2007 23:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | pantheistically.mp3 | 19-Apr-2007 23:54 | 11K | |
![[SND]](/icons/sound2.gif) | Pantheon.mp3 | 19-Apr-2007 23:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | pantheonize.mp3 | 19-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | panther.mp3 | 19-Apr-2007 23:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | panthera.mp3 | 19-Apr-2007 23:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pantherine.mp3 | 19-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | pantherism.mp3 | 19-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | panti.mp3 | 19-Apr-2007 23:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | pantie.mp3 | 19-Apr-2007 23:55 | 5.9K | |
![[SND]](/icons/sound2.gif) | panties.mp3 | 19-Apr-2007 23:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | pantihose.mp3 | 19-Apr-2007 23:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | pantile.mp3 | 19-Apr-2007 23:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | pantiled.mp3 | 19-Apr-2007 23:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | pantislip.mp3 | 19-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | pantisocracy.mp3 | 19-Apr-2007 23:55 | 11K | |
![[SND]](/icons/sound2.gif) | pantisocratic.mp3 | 19-Apr-2007 23:55 | 11K | |
![[SND]](/icons/sound2.gif) | pantisocratical.mp3 | 19-Apr-2007 23:55 | 12K | |
![[SND]](/icons/sound2.gif) | pantisocratist.mp3 | 19-Apr-2007 23:55 | 11K | |
![[SND]](/icons/sound2.gif) | panto.mp3 | 19-Apr-2007 23:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | pantofle.mp3 | 19-Apr-2007 23:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | pantograph.mp3 | 19-Apr-2007 23:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | pantographic.mp3 | 19-Apr-2007 23:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | pantography.mp3 | 19-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | pantology.mp3 | 19-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | pantomime.mp3 | 19-Apr-2007 23:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pantomimic.mp3 | 19-Apr-2007 23:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | pantomimist.mp3 | 19-Apr-2007 23:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | pantomorphic.mp3 | 19-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | pantonal.mp3 | 19-Apr-2007 23:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | pantonality.mp3 | 19-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | pantoscopic.mp3 | 19-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | pantothenate.mp3 | 19-Apr-2007 23:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | pantothenic acid.mp3 | 19-Apr-2007 23:56 | 14K | |
![[SND]](/icons/sound2.gif) | pantothenicacid.mp3 | 19-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | pantothere.mp3 | 19-Apr-2007 23:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | pantoufle.mp3 | 19-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | pantoum.mp3 | 19-Apr-2007 23:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | pantropic.mp3 | 19-Apr-2007 23:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | pantropical.mp3 | 19-Apr-2007 23:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | pantry.mp3 | 19-Apr-2007 23:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | pantryman.mp3 | 19-Apr-2007 23:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | pants.mp3 | 19-Apr-2007 23:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pantsuit.mp3 | 19-Apr-2007 23:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pantun.mp3 | 19-Apr-2007 23:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | panty.mp3 | 19-Apr-2007 23:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | pantyhose.mp3 | 19-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | pantywaist.mp3 | 19-Apr-2007 23:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | Panuco.mp3 | 19-Apr-2007 23:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | panurge.mp3 | 19-Apr-2007 23:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | panza.mp3 | 19-Apr-2007 23:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | panzer.mp3 | 19-Apr-2007 23:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | Pao de Acucar.mp3 | 19-Apr-2007 23:56 | 11K | |
![[SND]](/icons/sound2.gif) | Pao-chi.mp3 | 19-Apr-2007 23:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | paodeacucar.mp3 | 19-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | Paoking.mp3 | 19-Apr-2007 23:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | Paoli.mp3 | 19-Apr-2007 23:57 | 5.7K | |
![[SND]](/icons/sound2.gif) | paolozzi.mp3 | 19-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | Pao-ting.mp3 | 19-Apr-2007 23:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | Pao-t'ou.mp3 | 19-Apr-2007 23:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | paotow.mp3 | 19-Apr-2007 23:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pap smear.mp3 | 19-Apr-2007 23:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | pap.mp3 | 19-Apr-2007 23:57 | 5.2K | |
![[SND]](/icons/sound2.gif) | papa.mp3 | 19-Apr-2007 23:57 | 5.2K | |
![[SND]](/icons/sound2.gif) | papabile.mp3 | 19-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | papable.mp3 | 19-Apr-2007 23:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | papacy.mp3 | 19-Apr-2007 23:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | papadopoulos.mp3 | 19-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | papagayo.mp3 | 19-Apr-2007 23:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | Papago.mp3 | 19-Apr-2007 23:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | papain.mp3 | 19-Apr-2007 23:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | papal.mp3 | 19-Apr-2007 23:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | papalism.mp3 | 19-Apr-2007 23:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | papalize.mp3 | 19-Apr-2007 23:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | papally.mp3 | 19-Apr-2007 23:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | Papandreou.mp3 | 19-Apr-2007 23:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | Papanicolaou smear.mp3 | 19-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | papanicolaoutest.mp3 | 19-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | paparazzi.mp3 | 19-Apr-2007 23:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | paparazzo.mp3 | 19-Apr-2007 23:57 | 10K | |
![[SND]](/icons/sound2.gif) | papaveraceous.mp3 | 19-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | papaverine.mp3 | 19-Apr-2007 23:58 | 10K | |
![[SND]](/icons/sound2.gif) | papaverous.mp3 | 19-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | papaw.mp3 | 19-Apr-2007 23:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | papawemba.mp3 | 19-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | papaya.mp3 | 19-Apr-2007 23:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | pape.mp3 | 19-Apr-2007 23:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Papeete.mp3 | 19-Apr-2007 23:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | papelera.mp3 | 19-Apr-2007 23:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | Papen.mp3 | 19-Apr-2007 23:58 | 5.7K | |
![[SND]](/icons/sound2.gif) | paper.mp3 | 19-Apr-2007 23:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | paperandlead.mp3 | 19-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | paperback.mp3 | 19-Apr-2007 23:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | paperbacked.mp3 | 19-Apr-2007 23:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | paperbark.mp3 | 19-Apr-2007 23:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | paperboard.mp3 | 19-Apr-2007 23:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | paperbound.mp3 | 19-Apr-2007 23:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | paperboy.mp3 | 19-Apr-2007 23:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | paperer.mp3 | 19-Apr-2007 23:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | paperhanger.mp3 | 19-Apr-2007 23:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | paperhanging.mp3 | 19-Apr-2007 23:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | papering.mp3 | 19-Apr-2007 23:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | paperless.mp3 | 19-Apr-2007 23:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | papermache.mp3 | 19-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | papermaker.mp3 | 19-Apr-2007 23:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | papermaking.mp3 | 19-Apr-2007 23:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | paper-thin.mp3 | 19-Apr-2007 23:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | paper-train.mp3 | 19-Apr-2007 23:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | paperweight.mp3 | 19-Apr-2007 23:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | paperwhite.mp3 | 19-Apr-2007 23:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | paperwork.mp3 | 19-Apr-2007 23:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | papery.mp3 | 19-Apr-2007 23:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | papeterie.mp3 | 19-Apr-2007 23:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | Paphian.mp3 | 19-Apr-2007 23:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | Paphlagonia.mp3 | 19-Apr-2007 23:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | Paphlagonian.mp3 | 19-Apr-2007 23:59 | 10K | |
![[SND]](/icons/sound2.gif) | Paphos.mp3 | 19-Apr-2007 23:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | Papiamento.mp3 | 19-Apr-2007 23:59 | 10K | |
![[SND]](/icons/sound2.gif) | Papiamentu.mp3 | 19-Apr-2007 23:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | papier colle.mp3 | 19-Apr-2007 23:59 | 11K | |
![[SND]](/icons/sound2.gif) | papiercolle.mp3 | 19-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | papiermache.mp3 | 19-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | papier-mache.mp3 | 19-Apr-2007 23:59 | 11K | |
![[SND]](/icons/sound2.gif) | papiers colles.mp3 | 19-Apr-2007 23:59 | 11K | |
![[SND]](/icons/sound2.gif) | papilionaceous.mp3 | 19-Apr-2007 23:59 | 12K | |
![[SND]](/icons/sound2.gif) | papilla.mp3 | 19-Apr-2007 23:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | papillae.mp3 | 19-Apr-2007 23:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | papillary.mp3 | 19-Apr-2007 23:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | papillate.mp3 | 19-Apr-2007 23:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | papilliform.mp3 | 19-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | papilloma.mp3 | 20-Apr-2007 00:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | papillomata.mp3 | 20-Apr-2007 00:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | papillomatous.mp3 | 20-Apr-2007 00:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | papillomavirus.mp3 | 20-Apr-2007 00:00 | 12K | |
![[SND]](/icons/sound2.gif) | papillon.mp3 | 20-Apr-2007 00:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | papillose.mp3 | 20-Apr-2007 00:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | papillote.mp3 | 20-Apr-2007 00:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | Papineau.mp3 | 20-Apr-2007 00:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | papinian.mp3 | 20-Apr-2007 00:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | papism.mp3 | 20-Apr-2007 00:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | papist.mp3 | 20-Apr-2007 00:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | papistical.mp3 | 20-Apr-2007 00:00 | 17K | |
![[SND]](/icons/sound2.gif) | papistry.mp3 | 20-Apr-2007 00:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | papoose.mp3 | 20-Apr-2007 00:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | papovavirus.mp3 | 20-Apr-2007 00:00 | 12K | |
![[SND]](/icons/sound2.gif) | papp.mp3 | 20-Apr-2007 00:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pappenheim.mp3 | 20-Apr-2007 00:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | pappenheimer.mp3 | 20-Apr-2007 00:00 | 17K | |
![[SND]](/icons/sound2.gif) | pappi.mp3 | 20-Apr-2007 00:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | pappie.mp3 | 20-Apr-2007 00:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | pappose.mp3 | 20-Apr-2007 00:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | pappus.mp3 | 20-Apr-2007 00:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | pappusofalexandria.mp3 | 20-Apr-2007 00:00 | 18K | |
![[SND]](/icons/sound2.gif) | pappy.mp3 | 20-Apr-2007 00:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | papreg.mp3 | 20-Apr-2007 00:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | paprika.mp3 | 20-Apr-2007 00:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | paptest.mp3 | 20-Apr-2007 00:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | Papua.mp3 | 20-Apr-2007 00:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | Papuan.mp3 | 20-Apr-2007 00:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | papula.mp3 | 20-Apr-2007 00:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | papular.mp3 | 20-Apr-2007 00:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | papule.mp3 | 20-Apr-2007 00:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | papworthhospital.mp3 | 20-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | papyraceous.mp3 | 20-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | papyri.mp3 | 20-Apr-2007 00:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | papyrograph.mp3 | 20-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | papyrologist.mp3 | 20-Apr-2007 00:01 | 11K | |
![[SND]](/icons/sound2.gif) | papyrology.mp3 | 20-Apr-2007 00:01 | 10K | |
![[SND]](/icons/sound2.gif) | papyrus.mp3 | 20-Apr-2007 00:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | par avance.mp3 | 20-Apr-2007 00:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | par avion.mp3 | 20-Apr-2007 00:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | par excellence.mp3 | 20-Apr-2007 00:01 | 10K | |
![[SND]](/icons/sound2.gif) | par exemple.mp3 | 20-Apr-2007 00:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | par.mp3 | 20-Apr-2007 00:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | Para rubber.mp3 | 20-Apr-2007 00:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | Para.mp3 | 20-Apr-2007 00:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | para-aminobenzoic acid.mp3 | 20-Apr-2007 00:01 | 21K | |
![[SND]](/icons/sound2.gif) | para-aminosalicylic acid.mp3 | 20-Apr-2007 00:01 | 21K | |
![[SND]](/icons/sound2.gif) | parabasis.mp3 | 20-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | parabellum.mp3 | 20-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | parabiosis.mp3 | 20-Apr-2007 00:02 | 11K | |
![[SND]](/icons/sound2.gif) | parabiotic.mp3 | 20-Apr-2007 00:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | parabiotically.mp3 | 20-Apr-2007 00:02 | 11K | |
![[SND]](/icons/sound2.gif) | parablast.mp3 | 20-Apr-2007 00:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | parable.mp3 | 20-Apr-2007 00:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | parabola.mp3 | 20-Apr-2007 00:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | parabolic.mp3 | 20-Apr-2007 00:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | parabolically.mp3 | 20-Apr-2007 00:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | parabolize.mp3 | 20-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | paraboloid.mp3 | 20-Apr-2007 00:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | paraboloidal.mp3 | 20-Apr-2007 00:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | paracasein.mp3 | 20-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | paracelislands.mp3 | 20-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | Paracelsus.mp3 | 20-Apr-2007 00:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | paracentesis.mp3 | 20-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | paracetamol.mp3 | 20-Apr-2007 00:02 | 11K | |
![[SND]](/icons/sound2.gif) | parachronism.mp3 | 20-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | parachute.mp3 | 20-Apr-2007 00:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | parachutic.mp3 | 20-Apr-2007 00:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | parachutist.mp3 | 20-Apr-2007 00:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | Paraclete.mp3 | 20-Apr-2007 00:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | paracrine.mp3 | 20-Apr-2007 00:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | paracusis.mp3 | 20-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | parade.mp3 | 20-Apr-2007 00:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | paradichlorobenzene.mp3 | 20-Apr-2007 00:03 | 16K | |
![[SND]](/icons/sound2.gif) | paradiddle.mp3 | 20-Apr-2007 00:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | paradigm.mp3 | 20-Apr-2007 00:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | paradigmatic.mp3 | 20-Apr-2007 00:03 | 9.8K | |
![[SND]](/icons/sound2.gif) | paradigmatically.mp3 | 20-Apr-2007 00:03 | 12K | |
![[SND]](/icons/sound2.gif) | paradisaic.mp3 | 20-Apr-2007 00:03 | 9.8K | |
![[SND]](/icons/sound2.gif) | paradisaical.mp3 | 20-Apr-2007 00:03 | 11K | |
![[SND]](/icons/sound2.gif) | paradisaically.mp3 | 20-Apr-2007 00:03 | 12K | |
![[SND]](/icons/sound2.gif) | paradisal.mp3 | 20-Apr-2007 00:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | paradise.mp3 | 20-Apr-2007 00:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | paradisean.mp3 | 20-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | paradisiac.mp3 | 20-Apr-2007 00:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | paradisiacal.mp3 | 20-Apr-2007 00:03 | 11K | |
![[SND]](/icons/sound2.gif) | paradisiacally.mp3 | 20-Apr-2007 00:03 | 12K | |
![[SND]](/icons/sound2.gif) | paradisial.mp3 | 20-Apr-2007 00:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | paradisical.mp3 | 20-Apr-2007 00:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | parador.mp3 | 20-Apr-2007 00:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | paradores.mp3 | 20-Apr-2007 00:03 | 10K | |
![[SND]](/icons/sound2.gif) | parados.mp3 | 20-Apr-2007 00:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | paradox.mp3 | 20-Apr-2007 00:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | paradoxical.mp3 | 20-Apr-2007 00:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | paradoxicality.mp3 | 20-Apr-2007 00:03 | 12K | |
![[SND]](/icons/sound2.gif) | paradoxically.mp3 | 20-Apr-2007 00:03 | 10K | |
![[SND]](/icons/sound2.gif) | paradoxicalness.mp3 | 20-Apr-2007 00:03 | 13K | |
![[SND]](/icons/sound2.gif) | paradoxist.mp3 | 20-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | paradoxure.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paradoxy.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paraesthesia.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paraffin.mp3 | 20-Apr-2007 00:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | paraffine.mp3 | 20-Apr-2007 00:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | paraffinic.mp3 | 20-Apr-2007 00:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | paraffinize.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paraffinoid.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paraformaldehyde.mp3 | 20-Apr-2007 00:04 | 13K | |
![[SND]](/icons/sound2.gif) | paragenesis.mp3 | 20-Apr-2007 00:04 | 10K | |
![[SND]](/icons/sound2.gif) | paragenetic.mp3 | 20-Apr-2007 00:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | paragenetically.mp3 | 20-Apr-2007 00:04 | 11K | |
![[SND]](/icons/sound2.gif) | parageusia.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paraglide.mp3 | 20-Apr-2007 00:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | paraglider.mp3 | 20-Apr-2007 00:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | paragliding.mp3 | 20-Apr-2007 00:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | paraglossa.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paraglyphprinting.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paragoge.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paragon.mp3 | 20-Apr-2007 00:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | paragonite.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paragraph.mp3 | 20-Apr-2007 00:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | paragrapher.mp3 | 20-Apr-2007 00:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | paragraphia.mp3 | 20-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | paragraphic.mp3 | 20-Apr-2007 00:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | paragraphist.mp3 | 20-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | Paraguay.mp3 | 20-Apr-2007 00:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | Paraguayan.mp3 | 20-Apr-2007 00:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | Paraiba do Norte.mp3 | 20-Apr-2007 00:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | Paraiba do Sul.mp3 | 20-Apr-2007 00:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | Paraiba.mp3 | 20-Apr-2007 00:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | parainfluenza virus.mp3 | 20-Apr-2007 00:05 | 19K | |
![[SND]](/icons/sound2.gif) | paraison.mp3 | 20-Apr-2007 00:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | parajournalism.mp3 | 20-Apr-2007 00:05 | 11K | |
![[SND]](/icons/sound2.gif) | parakeet.mp3 | 20-Apr-2007 00:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | parakou.mp3 | 20-Apr-2007 00:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | paralalia.mp3 | 20-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | paralanguage.mp3 | 20-Apr-2007 00:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | paraldehyde.mp3 | 20-Apr-2007 00:05 | 11K | |
![[SND]](/icons/sound2.gif) | paralegal.mp3 | 20-Apr-2007 00:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | paraleipsis.mp3 | 20-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | paralepsis.mp3 | 20-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | paralexia.mp3 | 20-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | paralimnion.mp3 | 20-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | paralinguistic.mp3 | 20-Apr-2007 00:05 | 11K | |
![[SND]](/icons/sound2.gif) | paralinguistics.mp3 | 20-Apr-2007 00:05 | 12K | |
![[SND]](/icons/sound2.gif) | paralipomena.mp3 | 20-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | Paralipomenon.mp3 | 20-Apr-2007 00:05 | 13K | |
![[SND]](/icons/sound2.gif) | paralipsis.mp3 | 20-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | parallactic.mp3 | 20-Apr-2007 00:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | parallacticellipse.mp3 | 20-Apr-2007 00:06 | 18K | |
![[SND]](/icons/sound2.gif) | parallax.mp3 | 20-Apr-2007 00:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | parallel.mp3 | 20-Apr-2007 00:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | parallelepiped.mp3 | 20-Apr-2007 00:06 | 12K | |
![[SND]](/icons/sound2.gif) | parallelism.mp3 | 20-Apr-2007 00:06 | 11K | |
![[SND]](/icons/sound2.gif) | parallelist.mp3 | 20-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | parallelistic.mp3 | 20-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | parallelize.mp3 | 20-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | parallelogram.mp3 | 20-Apr-2007 00:06 | 11K | |
![[SND]](/icons/sound2.gif) | parallel-veined.mp3 | 20-Apr-2007 00:06 | 12K | |
![[SND]](/icons/sound2.gif) | paralogism.mp3 | 20-Apr-2007 00:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | paralogize.mp3 | 20-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | Paralympian.mp3 | 20-Apr-2007 00:06 | 10K | |
![[SND]](/icons/sound2.gif) | Paralympic.mp3 | 20-Apr-2007 00:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | Paralympics.mp3 | 20-Apr-2007 00:06 | 10K | |
![[SND]](/icons/sound2.gif) | paralyses.mp3 | 20-Apr-2007 00:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | paralysis agitans.mp3 | 20-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | paralysis.mp3 | 20-Apr-2007 00:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | paralysisagitans.mp3 | 20-Apr-2007 00:06 | 18K | |
![[SND]](/icons/sound2.gif) | paralytic.mp3 | 20-Apr-2007 00:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | paralytically.mp3 | 20-Apr-2007 00:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | paralyzation.mp3 | 20-Apr-2007 00:06 | 11K | |
![[SND]](/icons/sound2.gif) | paralyze.mp3 | 20-Apr-2007 00:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | paralyzed.mp3 | 20-Apr-2007 00:07 | 17K | |
![[SND]](/icons/sound2.gif) | paralyzer.mp3 | 20-Apr-2007 00:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | paralyzingly.mp3 | 20-Apr-2007 00:07 | 11K | |
![[SND]](/icons/sound2.gif) | paramagnet.mp3 | 20-Apr-2007 00:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | paramagnetic.mp3 | 20-Apr-2007 00:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | paramagnetically.mp3 | 20-Apr-2007 00:07 | 12K | |
![[SND]](/icons/sound2.gif) | paramagnetism.mp3 | 20-Apr-2007 00:07 | 12K | |
![[SND]](/icons/sound2.gif) | Paramaribo.mp3 | 20-Apr-2007 00:07 | 9.6K | |
![[SND]](/icons/sound2.gif) | paramatman.mp3 | 20-Apr-2007 00:07 | 17K | |
![[SND]](/icons/sound2.gif) | paramatta.mp3 | 20-Apr-2007 00:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | paramecia.mp3 | 20-Apr-2007 00:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | paramecium.mp3 | 20-Apr-2007 00:07 | 10K | |
![[SND]](/icons/sound2.gif) | paramedic.mp3 | 20-Apr-2007 00:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | paramedical.mp3 | 20-Apr-2007 00:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | parament.mp3 | 20-Apr-2007 00:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | parameter.mp3 | 20-Apr-2007 00:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | parameterization.mp3 | 20-Apr-2007 00:07 | 14K | |
![[SND]](/icons/sound2.gif) | parameterize.mp3 | 20-Apr-2007 00:07 | 12K | |
![[SND]](/icons/sound2.gif) | parametrial.mp3 | 20-Apr-2007 00:07 | 17K | |
![[SND]](/icons/sound2.gif) | parametric.mp3 | 20-Apr-2007 00:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | parametrically.mp3 | 20-Apr-2007 00:07 | 10K | |
![[SND]](/icons/sound2.gif) | parametricamplifier.mp3 | 20-Apr-2007 00:07 | 27K | |
![[SND]](/icons/sound2.gif) | parametrization.mp3 | 20-Apr-2007 00:07 | 13K | |
![[SND]](/icons/sound2.gif) | parametrize.mp3 | 20-Apr-2007 00:07 | 11K | |
![[SND]](/icons/sound2.gif) | parametron.mp3 | 20-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | paramilitary.mp3 | 20-Apr-2007 00:08 | 11K | |
![[SND]](/icons/sound2.gif) | paramita.mp3 | 20-Apr-2007 00:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | paramnesia.mp3 | 20-Apr-2007 00:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | paramo.mp3 | 20-Apr-2007 00:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | paramoecium.mp3 | 20-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | paramorph.mp3 | 20-Apr-2007 00:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | paramorphism.mp3 | 20-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | paramount.mp3 | 20-Apr-2007 00:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | paramountcy.mp3 | 20-Apr-2007 00:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | paramountly.mp3 | 20-Apr-2007 00:08 | 9.3K | |
![[SND]](/icons/sound2.gif) | paramour.mp3 | 20-Apr-2007 00:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | Paramus.mp3 | 20-Apr-2007 00:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | paramylum.mp3 | 20-Apr-2007 00:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | paramyxovirus.mp3 | 20-Apr-2007 00:08 | 14K | |
![[SND]](/icons/sound2.gif) | Parana.mp3 | 20-Apr-2007 00:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | paranagua.mp3 | 20-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | Paranahiba.mp3 | 20-Apr-2007 00:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | paranapine.mp3 | 20-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | paranephros.mp3 | 20-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | parang.mp3 | 20-Apr-2007 00:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | paranoia.mp3 | 20-Apr-2007 00:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | paranoiac.mp3 | 20-Apr-2007 00:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | paranoic.mp3 | 20-Apr-2007 00:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | paranoically.mp3 | 20-Apr-2007 00:08 | 10K | |
![[SND]](/icons/sound2.gif) | paranoid.mp3 | 20-Apr-2007 00:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | paranoidal.mp3 | 20-Apr-2007 00:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | paranormal.mp3 | 20-Apr-2007 00:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | paranormality.mp3 | 20-Apr-2007 00:09 | 11K | |
![[SND]](/icons/sound2.gif) | paranormally.mp3 | 20-Apr-2007 00:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | paranthropus.mp3 | 20-Apr-2007 00:09 | 17K | |
![[SND]](/icons/sound2.gif) | paranymph.mp3 | 20-Apr-2007 00:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | parapente.mp3 | 20-Apr-2007 00:09 | 17K | |
![[SND]](/icons/sound2.gif) | parapet.mp3 | 20-Apr-2007 00:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | parapeted.mp3 | 20-Apr-2007 00:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | paraph.mp3 | 20-Apr-2007 00:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | paraphaseamplifier.mp3 | 20-Apr-2007 00:09 | 17K | |
![[SND]](/icons/sound2.gif) | paraphasia.mp3 | 20-Apr-2007 00:09 | 17K | |
![[SND]](/icons/sound2.gif) | paraphernalia.mp3 | 20-Apr-2007 00:09 | 10K | |
![[SND]](/icons/sound2.gif) | paraphilia.mp3 | 20-Apr-2007 00:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | paraphiliac.mp3 | 20-Apr-2007 00:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | paraphilic.mp3 | 20-Apr-2007 00:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | paraphrasable.mp3 | 20-Apr-2007 00:09 | 9.8K | |
![[SND]](/icons/sound2.gif) | paraphrase.mp3 | 20-Apr-2007 00:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | paraphrasis.mp3 | 20-Apr-2007 00:09 | 17K | |
![[SND]](/icons/sound2.gif) | paraphrast.mp3 | 20-Apr-2007 00:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | paraphrastic.mp3 | 20-Apr-2007 00:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | paraphrastically.mp3 | 20-Apr-2007 00:09 | 11K | |
![[SND]](/icons/sound2.gif) | paraphyses.mp3 | 20-Apr-2007 00:09 | 10K | |
![[SND]](/icons/sound2.gif) | paraphysis.mp3 | 20-Apr-2007 00:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | paraplane.mp3 | 20-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | paraplanner.mp3 | 20-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | paraplegia.mp3 | 20-Apr-2007 00:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | paraplegic.mp3 | 20-Apr-2007 00:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | parapodia.mp3 | 20-Apr-2007 00:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | parapodial.mp3 | 20-Apr-2007 00:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | parapodium.mp3 | 20-Apr-2007 00:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | parapraxis.mp3 | 20-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | paraprofessional.mp3 | 20-Apr-2007 00:10 | 11K | |
![[SND]](/icons/sound2.gif) | paraproteinemia.mp3 | 20-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | parapsychological.mp3 | 20-Apr-2007 00:10 | 12K | |
![[SND]](/icons/sound2.gif) | parapsychologist.mp3 | 20-Apr-2007 00:10 | 12K | |
![[SND]](/icons/sound2.gif) | parapsychology.mp3 | 20-Apr-2007 00:10 | 11K | |
![[SND]](/icons/sound2.gif) | paraquat.mp3 | 20-Apr-2007 00:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | paraquet.mp3 | 20-Apr-2007 00:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | pararescue.mp3 | 20-Apr-2007 00:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | pararescueman.mp3 | 20-Apr-2007 00:10 | 12K | |
![[SND]](/icons/sound2.gif) | pararescuer.mp3 | 20-Apr-2007 00:10 | 11K | |
![[SND]](/icons/sound2.gif) | pararhatany.mp3 | 20-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | pararosaniline.mp3 | 20-Apr-2007 00:10 | 12K | |
![[SND]](/icons/sound2.gif) | pararubber.mp3 | 20-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | paras.mp3 | 20-Apr-2007 00:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | parasailing.mp3 | 20-Apr-2007 00:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | parasang.mp3 | 20-Apr-2007 00:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | parascending.mp3 | 20-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | parascenium.mp3 | 20-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | paraselene.mp3 | 20-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | parasexual.mp3 | 20-Apr-2007 00:11 | 10K | |
![[SND]](/icons/sound2.gif) | parasexuality.mp3 | 20-Apr-2007 00:11 | 12K | |
![[SND]](/icons/sound2.gif) | parashah.mp3 | 20-Apr-2007 00:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | parashurama.mp3 | 20-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | parasite.mp3 | 20-Apr-2007 00:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | parasitic.mp3 | 20-Apr-2007 00:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | parasitical.mp3 | 20-Apr-2007 00:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | parasitically.mp3 | 20-Apr-2007 00:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | parasiticidal.mp3 | 20-Apr-2007 00:11 | 12K | |
![[SND]](/icons/sound2.gif) | parasiticide.mp3 | 20-Apr-2007 00:11 | 11K | |
![[SND]](/icons/sound2.gif) | parasitism.mp3 | 20-Apr-2007 00:11 | 10K | |
![[SND]](/icons/sound2.gif) | parasitization.mp3 | 20-Apr-2007 00:11 | 13K | |
![[SND]](/icons/sound2.gif) | parasitize.mp3 | 20-Apr-2007 00:11 | 11K | |
![[SND]](/icons/sound2.gif) | parasitoid.mp3 | 20-Apr-2007 00:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | parasitoidism.mp3 | 20-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | parasitologic.mp3 | 20-Apr-2007 00:11 | 12K | |
![[SND]](/icons/sound2.gif) | parasitological.mp3 | 20-Apr-2007 00:11 | 13K | |
![[SND]](/icons/sound2.gif) | parasitologically.mp3 | 20-Apr-2007 00:11 | 14K | |
![[SND]](/icons/sound2.gif) | parasitologist.mp3 | 20-Apr-2007 00:11 | 12K | |
![[SND]](/icons/sound2.gif) | parasitology.mp3 | 20-Apr-2007 00:11 | 12K | |
![[SND]](/icons/sound2.gif) | parasitoses.mp3 | 20-Apr-2007 00:11 | 12K | |
![[SND]](/icons/sound2.gif) | parasitosis.mp3 | 20-Apr-2007 00:11 | 11K | |
![[SND]](/icons/sound2.gif) | paraskiing.mp3 | 20-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | parasol.mp3 | 20-Apr-2007 00:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | parastatal.mp3 | 20-Apr-2007 00:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | parastichy.mp3 | 20-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | parasuicide.mp3 | 20-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | parasymbiosis.mp3 | 20-Apr-2007 00:12 | 27K | |
![[SND]](/icons/sound2.gif) | parasympathetic.mp3 | 20-Apr-2007 00:12 | 11K | |
![[SND]](/icons/sound2.gif) | parasympathomimetic.mp3 | 20-Apr-2007 00:12 | 16K | |
![[SND]](/icons/sound2.gif) | parasynthesis.mp3 | 20-Apr-2007 00:12 | 11K | |
![[SND]](/icons/sound2.gif) | parasynthetic.mp3 | 20-Apr-2007 00:12 | 10K | |
![[SND]](/icons/sound2.gif) | parasyntheton.mp3 | 20-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | paratactic.mp3 | 20-Apr-2007 00:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | paratactical.mp3 | 20-Apr-2007 00:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | paratactically.mp3 | 20-Apr-2007 00:12 | 11K | |
![[SND]](/icons/sound2.gif) | parataxic.mp3 | 20-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | parataxis.mp3 | 20-Apr-2007 00:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | parathion.mp3 | 20-Apr-2007 00:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | parathormone.mp3 | 20-Apr-2007 00:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | parathyroid.mp3 | 20-Apr-2007 00:12 | 10K | |
![[SND]](/icons/sound2.gif) | parathyroidectomized.mp3 | 20-Apr-2007 00:12 | 16K | |
![[SND]](/icons/sound2.gif) | parathyroidectomy.mp3 | 20-Apr-2007 00:12 | 15K | |
![[SND]](/icons/sound2.gif) | paratonic.mp3 | 20-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | paratransit.mp3 | 20-Apr-2007 00:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | paratroop.mp3 | 20-Apr-2007 00:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | paratrooper.mp3 | 20-Apr-2007 00:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | paratroops.mp3 | 20-Apr-2007 00:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | paratrophic.mp3 | 20-Apr-2007 00:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | paratyphoid.mp3 | 20-Apr-2007 00:13 | 10K | |
![[SND]](/icons/sound2.gif) | paravail.mp3 | 20-Apr-2007 00:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | paravance.mp3 | 20-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | paravane.mp3 | 20-Apr-2007 00:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | paravent.mp3 | 20-Apr-2007 00:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | paravidya.mp3 | 20-Apr-2007 00:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | paravion.mp3 | 20-Apr-2007 00:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | paraxial.mp3 | 20-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | parazoan.mp3 | 20-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | parboil.mp3 | 20-Apr-2007 00:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | parboiled.mp3 | 20-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | parbuckle.mp3 | 20-Apr-2007 00:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | parc.mp3 | 20-Apr-2007 00:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | parca.mp3 | 20-Apr-2007 00:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | Parcae.mp3 | 20-Apr-2007 00:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | parcel.mp3 | 20-Apr-2007 00:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | parceling.mp3 | 20-Apr-2007 00:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | parcelling.mp3 | 20-Apr-2007 00:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | parcenary.mp3 | 20-Apr-2007 00:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | parcener.mp3 | 20-Apr-2007 00:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | parch.mp3 | 20-Apr-2007 00:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | parched.mp3 | 20-Apr-2007 00:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | Parcheesi.mp3 | 20-Apr-2007 00:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | parching.mp3 | 20-Apr-2007 00:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | parchment.mp3 | 20-Apr-2007 00:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | parchmentize.mp3 | 20-Apr-2007 00:14 | 17K | |
![[SND]](/icons/sound2.gif) | parclose.mp3 | 20-Apr-2007 00:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | parcours.mp3 | 20-Apr-2007 00:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | parcourse.mp3 | 20-Apr-2007 00:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | pard.mp3 | 20-Apr-2007 00:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | pardah.mp3 | 20-Apr-2007 00:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pardalote.mp3 | 20-Apr-2007 00:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | pardaxin.mp3 | 20-Apr-2007 00:14 | 17K | |
![[SND]](/icons/sound2.gif) | pardi.mp3 | 20-Apr-2007 00:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | pardie.mp3 | 20-Apr-2007 00:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | pardner.mp3 | 20-Apr-2007 00:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | pardon.mp3 | 20-Apr-2007 00:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | pardonable.mp3 | 20-Apr-2007 00:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | pardonably.mp3 | 20-Apr-2007 00:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | pardoner.mp3 | 20-Apr-2007 00:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | pardoning.mp3 | 20-Apr-2007 00:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pardubice.mp3 | 20-Apr-2007 00:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | pardy.mp3 | 20-Apr-2007 00:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pare.mp3 | 20-Apr-2007 00:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | parecious.mp3 | 20-Apr-2007 00:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | paregmenon.mp3 | 20-Apr-2007 00:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | paregoric.mp3 | 20-Apr-2007 00:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | pareira.mp3 | 20-Apr-2007 00:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pareirabrava.mp3 | 20-Apr-2007 00:15 | 17K | |
![[SND]](/icons/sound2.gif) | parenchyma.mp3 | 20-Apr-2007 00:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | parenchymal.mp3 | 20-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | parenchymatous.mp3 | 20-Apr-2007 00:15 | 11K | |
![[SND]](/icons/sound2.gif) | parens.mp3 | 20-Apr-2007 00:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | parent.mp3 | 20-Apr-2007 00:15 | 5.9K | |
![[SND]](/icons/sound2.gif) | parentage.mp3 | 20-Apr-2007 00:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | parental.mp3 | 20-Apr-2007 00:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | parentalia.mp3 | 20-Apr-2007 00:15 | 17K | |
![[SND]](/icons/sound2.gif) | parentally.mp3 | 20-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | parenteral.mp3 | 20-Apr-2007 00:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | parenterally.mp3 | 20-Apr-2007 00:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | parentheses.mp3 | 20-Apr-2007 00:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | parenthesis.mp3 | 20-Apr-2007 00:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | parenthesize.mp3 | 20-Apr-2007 00:15 | 10K | |
![[SND]](/icons/sound2.gif) | parenthetic.mp3 | 20-Apr-2007 00:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | parenthetical.mp3 | 20-Apr-2007 00:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | parenthetically.mp3 | 20-Apr-2007 00:15 | 10K | |
![[SND]](/icons/sound2.gif) | parenthood.mp3 | 20-Apr-2007 00:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | parenticide.mp3 | 20-Apr-2007 00:15 | 17K | |
![[SND]](/icons/sound2.gif) | parenting.mp3 | 20-Apr-2007 00:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | parentless.mp3 | 20-Apr-2007 00:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | parentline.mp3 | 20-Apr-2007 00:15 | 17K | |
![[SND]](/icons/sound2.gif) | pareo.mp3 | 20-Apr-2007 00:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | parer.mp3 | 20-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | parergon.mp3 | 20-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | pareses.mp3 | 20-Apr-2007 00:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | paresis.mp3 | 20-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | paresthesia.mp3 | 20-Apr-2007 00:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | paresthetic.mp3 | 20-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | paretic.mp3 | 20-Apr-2007 00:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | Pareto.mp3 | 20-Apr-2007 00:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | pareu.mp3 | 20-Apr-2007 00:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | pareve.mp3 | 20-Apr-2007 00:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | parexcellence.mp3 | 20-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | parexemple.mp3 | 20-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | parfait.mp3 | 20-Apr-2007 00:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | parfleche.mp3 | 20-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | parfocal.mp3 | 20-Apr-2007 00:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | parfocality.mp3 | 20-Apr-2007 00:16 | 9.8K | |
![[SND]](/icons/sound2.gif) | parfocalize.mp3 | 20-Apr-2007 00:16 | 11K | |
![[SND]](/icons/sound2.gif) | parfum.mp3 | 20-Apr-2007 00:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | pargana.mp3 | 20-Apr-2007 00:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | pargasite.mp3 | 20-Apr-2007 00:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | parge.mp3 | 20-Apr-2007 00:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | parget.mp3 | 20-Apr-2007 00:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | pargeting.mp3 | 20-Apr-2007 00:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | parging.mp3 | 20-Apr-2007 00:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | pargyline.mp3 | 20-Apr-2007 00:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | parhelia.mp3 | 20-Apr-2007 00:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | parheliacal.mp3 | 20-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | parhelic.mp3 | 20-Apr-2007 00:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | parheliccircle.mp3 | 20-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | parhelion.mp3 | 20-Apr-2007 00:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | pari passu.mp3 | 20-Apr-2007 00:17 | 11K | |
![[SND]](/icons/sound2.gif) | pari.mp3 | 20-Apr-2007 00:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | Paria Peninsula.mp3 | 20-Apr-2007 00:17 | 6.4K | |
![[SND]](/icons/sound2.gif) | Pariah.mp3 | 20-Apr-2007 00:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | parian.mp3 | 20-Apr-2007 00:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | parica.mp3 | 20-Apr-2007 00:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | Paricutin.mp3 | 20-Apr-2007 00:17 | 10K | |
![[SND]](/icons/sound2.gif) | paries.mp3 | 20-Apr-2007 00:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | parietal.mp3 | 20-Apr-2007 00:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | parimutuel.mp3 | 20-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | pari-mutuel.mp3 | 20-Apr-2007 00:17 | 10K | |
![[SND]](/icons/sound2.gif) | paring.mp3 | 20-Apr-2007 00:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | paripassu.mp3 | 20-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | paripinnate.mp3 | 20-Apr-2007 00:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | Paris green.mp3 | 20-Apr-2007 00:17 | 11K | |
![[SND]](/icons/sound2.gif) | Paris.mp3 | 20-Apr-2007 00:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | parish.mp3 | 20-Apr-2007 00:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | parishad.mp3 | 20-Apr-2007 00:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | parishioner.mp3 | 20-Apr-2007 00:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | Parisian.mp3 | 20-Apr-2007 00:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | parisienne.mp3 | 20-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | parison.mp3 | 20-Apr-2007 00:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | parity.mp3 | 20-Apr-2007 00:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | Park Chung Hee.mp3 | 20-Apr-2007 00:18 | 12K | |
![[SND]](/icons/sound2.gif) | park.mp3 | 20-Apr-2007 00:18 | 5.0K | |
![[SND]](/icons/sound2.gif) | parka.mp3 | 20-Apr-2007 00:18 | 5.7K | |
![[SND]](/icons/sound2.gif) | parkade.mp3 | 20-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | parkedavis.mp3 | 20-Apr-2007 00:18 | 17K | |
![[SND]](/icons/sound2.gif) | parker.mp3 | 20-Apr-2007 00:18 | 5.5K | |
![[SND]](/icons/sound2.gif) | Parkersburg.mp3 | 20-Apr-2007 00:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | Parkes.mp3 | 20-Apr-2007 00:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | parkette.mp3 | 20-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | parkha.mp3 | 20-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | parkhurst.mp3 | 20-Apr-2007 00:18 | 17K | |
![[SND]](/icons/sound2.gif) | parkie.mp3 | 20-Apr-2007 00:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | parkin.mp3 | 20-Apr-2007 00:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | parking brake.mp3 | 20-Apr-2007 00:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | parking.mp3 | 20-Apr-2007 00:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | parkinson.mp3 | 20-Apr-2007 00:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | parkinsonian.mp3 | 20-Apr-2007 00:18 | 10K | |
![[SND]](/icons/sound2.gif) | parkinsonism.mp3 | 20-Apr-2007 00:18 | 11K | |
![[SND]](/icons/sound2.gif) | Parkinson's disease.mp3 | 20-Apr-2007 00:18 | 15K | |
![[SND]](/icons/sound2.gif) | parkland.mp3 | 20-Apr-2007 00:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | parklike.mp3 | 20-Apr-2007 00:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | Parkman.mp3 | 20-Apr-2007 00:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | Parks.mp3 | 20-Apr-2007 00:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | parkway.mp3 | 20-Apr-2007 00:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | parky.mp3 | 20-Apr-2007 00:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | parlance.mp3 | 20-Apr-2007 00:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | parlando.mp3 | 20-Apr-2007 00:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | parlante.mp3 | 20-Apr-2007 00:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | parlary.mp3 | 20-Apr-2007 00:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | parlay.mp3 | 20-Apr-2007 00:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | parle.mp3 | 20-Apr-2007 00:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | parlement.mp3 | 20-Apr-2007 00:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | parley.mp3 | 20-Apr-2007 00:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | parleyvoo.mp3 | 20-Apr-2007 00:19 | 17K | |
![[SND]](/icons/sound2.gif) | parliament.mp3 | 20-Apr-2007 00:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | parliamentarian.mp3 | 20-Apr-2007 00:19 | 13K | |
![[SND]](/icons/sound2.gif) | parliamentarianism.mp3 | 20-Apr-2007 00:19 | 17K | |
![[SND]](/icons/sound2.gif) | parliamentary.mp3 | 20-Apr-2007 00:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | parlor.mp3 | 20-Apr-2007 00:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | parlour.mp3 | 20-Apr-2007 00:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | parlous.mp3 | 20-Apr-2007 00:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | parlyaree.mp3 | 20-Apr-2007 00:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | Parma.mp3 | 20-Apr-2007 00:19 | 5.7K | |
![[SND]](/icons/sound2.gif) | parmaheights.mp3 | 20-Apr-2007 00:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Parmenides.mp3 | 20-Apr-2007 00:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | parmentier.mp3 | 20-Apr-2007 00:19 | 17K | |
![[SND]](/icons/sound2.gif) | Parmesan.mp3 | 20-Apr-2007 00:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | parmigiana.mp3 | 20-Apr-2007 00:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | Parmigianino.mp3 | 20-Apr-2007 00:20 | 11K | |
![[SND]](/icons/sound2.gif) | parmigiano.mp3 | 20-Apr-2007 00:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | Parnahyba.mp3 | 20-Apr-2007 00:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | parnaiba.mp3 | 20-Apr-2007 00:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | Parnassian.mp3 | 20-Apr-2007 00:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | Parnassos.mp3 | 20-Apr-2007 00:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | Parnassus.mp3 | 20-Apr-2007 00:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | Parnell.mp3 | 20-Apr-2007 00:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | parnic.mp3 | 20-Apr-2007 00:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | paro.mp3 | 20-Apr-2007 00:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | parocheth.mp3 | 20-Apr-2007 00:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | parochiaid.mp3 | 20-Apr-2007 00:20 | 17K | |
![[SND]](/icons/sound2.gif) | parochial.mp3 | 20-Apr-2007 00:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | parochialism.mp3 | 20-Apr-2007 00:20 | 11K | |
![[SND]](/icons/sound2.gif) | parochialize.mp3 | 20-Apr-2007 00:20 | 17K | |
![[SND]](/icons/sound2.gif) | parochially.mp3 | 20-Apr-2007 00:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | parodic.mp3 | 20-Apr-2007 00:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | parodist.mp3 | 20-Apr-2007 00:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | parodistic.mp3 | 20-Apr-2007 00:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | parodontium.mp3 | 20-Apr-2007 00:20 | 17K | |
![[SND]](/icons/sound2.gif) | parodos.mp3 | 20-Apr-2007 00:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | parody.mp3 | 20-Apr-2007 00:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | paroicous.mp3 | 20-Apr-2007 00:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | parokheth.mp3 | 20-Apr-2007 00:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | parol.mp3 | 20-Apr-2007 00:20 | 5.9K | |
![[SND]](/icons/sound2.gif) | parole.mp3 | 20-Apr-2007 00:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | parolee.mp3 | 20-Apr-2007 00:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | paromomycin.mp3 | 20-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | paronomasia.mp3 | 20-Apr-2007 00:21 | 12K | |
![[SND]](/icons/sound2.gif) | paronomastic.mp3 | 20-Apr-2007 00:21 | 10K | |
![[SND]](/icons/sound2.gif) | paronychia.mp3 | 20-Apr-2007 00:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | paronym.mp3 | 20-Apr-2007 00:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | paronymous.mp3 | 20-Apr-2007 00:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | paroquet.mp3 | 20-Apr-2007 00:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | Paros.mp3 | 20-Apr-2007 00:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | parosmia.mp3 | 20-Apr-2007 00:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | parotic.mp3 | 20-Apr-2007 00:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | parotid.mp3 | 20-Apr-2007 00:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | parotiditis.mp3 | 20-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | parotitic.mp3 | 20-Apr-2007 00:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | parotitis.mp3 | 20-Apr-2007 00:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | parotoid.mp3 | 20-Apr-2007 00:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | parous.mp3 | 20-Apr-2007 00:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | Parousia.mp3 | 20-Apr-2007 00:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | paroxetine.mp3 | 20-Apr-2007 00:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | paroxysm.mp3 | 20-Apr-2007 00:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | paroxysmal.mp3 | 20-Apr-2007 00:21 | 9.8K | |
![[SND]](/icons/sound2.gif) | paroxysmaltachycardia.mp3 | 20-Apr-2007 00:21 | 27K | |
![[SND]](/icons/sound2.gif) | paroxytone.mp3 | 20-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | parpen.mp3 | 20-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | parquet.mp3 | 20-Apr-2007 00:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | parqueted.mp3 | 20-Apr-2007 00:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | parqueting.mp3 | 20-Apr-2007 00:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | parquetry.mp3 | 20-Apr-2007 00:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | parr.mp3 | 20-Apr-2007 00:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | parrakeet.mp3 | 20-Apr-2007 00:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | parral.mp3 | 20-Apr-2007 00:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | Parramatta.mp3 | 20-Apr-2007 00:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | parran.mp3 | 20-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | parrel.mp3 | 20-Apr-2007 00:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | parricidal.mp3 | 20-Apr-2007 00:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | parricide.mp3 | 20-Apr-2007 00:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | Parrington.mp3 | 20-Apr-2007 00:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | Parris Island.mp3 | 20-Apr-2007 00:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | Parrish.mp3 | 20-Apr-2007 00:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | parrisisland.mp3 | 20-Apr-2007 00:22 | 17K | |
![[SND]](/icons/sound2.gif) | parritch.mp3 | 20-Apr-2007 00:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | parro.mp3 | 20-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | parroket.mp3 | 20-Apr-2007 00:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | parrot.mp3 | 20-Apr-2007 00:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | Parry Islands.mp3 | 20-Apr-2007 00:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | parry.mp3 | 20-Apr-2007 00:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | pars pro toto.mp3 | 20-Apr-2007 00:22 | 12K | |
![[SND]](/icons/sound2.gif) | pars.mp3 | 20-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | parse.mp3 | 20-Apr-2007 00:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | parsec.mp3 | 20-Apr-2007 00:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | Parsee.mp3 | 20-Apr-2007 00:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | parseeism.mp3 | 20-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | parser.mp3 | 20-Apr-2007 00:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | parsha.mp3 | 20-Apr-2007 00:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | Parsi.mp3 | 20-Apr-2007 00:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | parsifal.mp3 | 20-Apr-2007 00:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | Parsiism.mp3 | 20-Apr-2007 00:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | parsimonious.mp3 | 20-Apr-2007 00:23 | 10K | |
![[SND]](/icons/sound2.gif) | parsimony.mp3 | 20-Apr-2007 00:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | parsintermedia.mp3 | 20-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | parsley.mp3 | 20-Apr-2007 00:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | parsleyed.mp3 | 20-Apr-2007 00:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | parsleypiert.mp3 | 20-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | parslied.mp3 | 20-Apr-2007 00:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | parsnip.mp3 | 20-Apr-2007 00:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | parson.mp3 | 20-Apr-2007 00:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | parsonage.mp3 | 20-Apr-2007 00:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | parsoness.mp3 | 20-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | Parsons table.mp3 | 20-Apr-2007 00:23 | 12K | |
![[SND]](/icons/sound2.gif) | Parsons.mp3 | 20-Apr-2007 00:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | parsva.mp3 | 20-Apr-2007 00:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | part.mp3 | 20-Apr-2007 00:23 | 5.0K | |
![[SND]](/icons/sound2.gif) | partake.mp3 | 20-Apr-2007 00:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | partaken.mp3 | 20-Apr-2007 00:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | partan.mp3 | 20-Apr-2007 00:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | partch.mp3 | 20-Apr-2007 00:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | parted.mp3 | 20-Apr-2007 00:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | partera.mp3 | 20-Apr-2007 00:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | parterre.mp3 | 20-Apr-2007 00:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | parthenia.mp3 | 20-Apr-2007 00:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | partheno.mp3 | 20-Apr-2007 00:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | parthenocarpic.mp3 | 20-Apr-2007 00:24 | 11K | |
![[SND]](/icons/sound2.gif) | parthenocarpy.mp3 | 20-Apr-2007 00:24 | 11K | |
![[SND]](/icons/sound2.gif) | parthenogenesis.mp3 | 20-Apr-2007 00:24 | 12K | |
![[SND]](/icons/sound2.gif) | parthenogenetic.mp3 | 20-Apr-2007 00:24 | 11K | |
![[SND]](/icons/sound2.gif) | parthenogenetically.mp3 | 20-Apr-2007 00:24 | 13K | |
![[SND]](/icons/sound2.gif) | parthenogenic.mp3 | 20-Apr-2007 00:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | parthenogenone.mp3 | 20-Apr-2007 00:24 | 17K | |
![[SND]](/icons/sound2.gif) | Parthenon.mp3 | 20-Apr-2007 00:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | parthenopaeus.mp3 | 20-Apr-2007 00:24 | 17K | |
![[SND]](/icons/sound2.gif) | parthenope.mp3 | 20-Apr-2007 00:24 | 17K | |
![[SND]](/icons/sound2.gif) | parthenos.mp3 | 20-Apr-2007 00:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | parthenospore.mp3 | 20-Apr-2007 00:24 | 17K | |
![[SND]](/icons/sound2.gif) | Parthia.mp3 | 20-Apr-2007 00:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | Parthian.mp3 | 20-Apr-2007 00:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | parti pris.mp3 | 20-Apr-2007 00:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | parti.mp3 | 20-Apr-2007 00:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | partial.mp3 | 20-Apr-2007 00:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | partiality.mp3 | 20-Apr-2007 00:24 | 9.6K | |
![[SND]](/icons/sound2.gif) | partialize.mp3 | 20-Apr-2007 00:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | partially.mp3 | 20-Apr-2007 00:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | partibility.mp3 | 20-Apr-2007 00:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | partible.mp3 | 20-Apr-2007 00:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | partic.mp3 | 20-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | particepscriminis.mp3 | 20-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | participable.mp3 | 20-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | participaction.mp3 | 20-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | participance.mp3 | 20-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | participant.mp3 | 20-Apr-2007 00:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | participate.mp3 | 20-Apr-2007 00:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | participation.mp3 | 20-Apr-2007 00:25 | 10K | |
![[SND]](/icons/sound2.gif) | participational.mp3 | 20-Apr-2007 00:25 | 10K | |
![[SND]](/icons/sound2.gif) | participative.mp3 | 20-Apr-2007 00:25 | 10K | |
![[SND]](/icons/sound2.gif) | participator.mp3 | 20-Apr-2007 00:25 | 10K | |
![[SND]](/icons/sound2.gif) | participatory.mp3 | 20-Apr-2007 00:25 | 10K | |
![[SND]](/icons/sound2.gif) | participial.mp3 | 20-Apr-2007 00:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | participialize.mp3 | 20-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | participially.mp3 | 20-Apr-2007 00:25 | 10K | |
![[SND]](/icons/sound2.gif) | participle.mp3 | 20-Apr-2007 00:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | particle.mp3 | 20-Apr-2007 00:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | particleboard.mp3 | 20-Apr-2007 00:25 | 9.6K | |
![[SND]](/icons/sound2.gif) | parti-color.mp3 | 20-Apr-2007 00:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | particolored.mp3 | 20-Apr-2007 00:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | parti-colored.mp3 | 20-Apr-2007 00:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | particular.mp3 | 20-Apr-2007 00:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | particularism.mp3 | 20-Apr-2007 00:26 | 11K | |
![[SND]](/icons/sound2.gif) | particularist.mp3 | 20-Apr-2007 00:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | particularistic.mp3 | 20-Apr-2007 00:26 | 10K | |
![[SND]](/icons/sound2.gif) | particularity.mp3 | 20-Apr-2007 00:26 | 11K | |
![[SND]](/icons/sound2.gif) | particularization.mp3 | 20-Apr-2007 00:26 | 12K | |
![[SND]](/icons/sound2.gif) | particularize.mp3 | 20-Apr-2007 00:26 | 11K | |
![[SND]](/icons/sound2.gif) | particularly.mp3 | 20-Apr-2007 00:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | particulate.mp3 | 20-Apr-2007 00:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | partiecarree.mp3 | 20-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | partier.mp3 | 20-Apr-2007 00:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | parting.mp3 | 20-Apr-2007 00:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | partipris.mp3 | 20-Apr-2007 00:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | partiquebecois.mp3 | 20-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | partis pris.mp3 | 20-Apr-2007 00:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | partis.mp3 | 20-Apr-2007 00:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | partisan.mp3 | 20-Apr-2007 00:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | partisanism.mp3 | 20-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | partisanly.mp3 | 20-Apr-2007 00:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | partisanship.mp3 | 20-Apr-2007 00:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | partita.mp3 | 20-Apr-2007 00:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | partite.mp3 | 20-Apr-2007 00:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | partition.mp3 | 20-Apr-2007 00:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | partitioner.mp3 | 20-Apr-2007 00:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | partitionist.mp3 | 20-Apr-2007 00:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | partitive.mp3 | 20-Apr-2007 00:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | partizan.mp3 | 20-Apr-2007 00:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | partlet.mp3 | 20-Apr-2007 00:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | partly.mp3 | 20-Apr-2007 00:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | partner.mp3 | 20-Apr-2007 00:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | partnerless.mp3 | 20-Apr-2007 00:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | partnership.mp3 | 20-Apr-2007 00:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | parton.mp3 | 20-Apr-2007 00:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | partook.mp3 | 20-Apr-2007 00:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | partridge.mp3 | 20-Apr-2007 00:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | partridgeberry.mp3 | 20-Apr-2007 00:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | part-song.mp3 | 20-Apr-2007 00:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | part-time.mp3 | 20-Apr-2007 00:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | part-timer.mp3 | 20-Apr-2007 00:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | parturient.mp3 | 20-Apr-2007 00:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | parturifacient.mp3 | 20-Apr-2007 00:27 | 17K | |
![[SND]](/icons/sound2.gif) | parturition.mp3 | 20-Apr-2007 00:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | parturiunt montes, nascetur ridiculus mus.mp3 | 20-Apr-2007 00:27 | 35K | |
![[SND]](/icons/sound2.gif) | partway.mp3 | 20-Apr-2007 00:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | party pooper.mp3 | 20-Apr-2007 00:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | party.mp3 | 20-Apr-2007 00:27 | 5.4K | |
![[SND]](/icons/sound2.gif) | partyer.mp3 | 20-Apr-2007 00:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | partygoer.mp3 | 20-Apr-2007 00:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | partyism.mp3 | 20-Apr-2007 00:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | party-liner.mp3 | 20-Apr-2007 00:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | partyon.mp3 | 20-Apr-2007 00:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | parula.mp3 | 20-Apr-2007 00:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | parulis.mp3 | 20-Apr-2007 00:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | parure.mp3 | 20-Apr-2007 00:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | parvalbumin.mp3 | 20-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | parvati.mp3 | 20-Apr-2007 00:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | parve.mp3 | 20-Apr-2007 00:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | parvenu.mp3 | 20-Apr-2007 00:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | parvenue.mp3 | 20-Apr-2007 00:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | parvenus.mp3 | 20-Apr-2007 00:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | parvis.mp3 | 20-Apr-2007 00:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | parvise.mp3 | 20-Apr-2007 00:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | parvo.mp3 | 20-Apr-2007 00:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | parvoline.mp3 | 20-Apr-2007 00:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | parvovirus.mp3 | 20-Apr-2007 00:28 | 10K | |
![[SND]](/icons/sound2.gif) | parylene.mp3 | 20-Apr-2007 00:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | parzival.mp3 | 20-Apr-2007 00:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | pas de bourree.mp3 | 20-Apr-2007 00:28 | 9.8K | |
![[SND]](/icons/sound2.gif) | pas de bourrees.mp3 | 20-Apr-2007 00:28 | 11K | |
![[SND]](/icons/sound2.gif) | Pas de Calais.mp3 | 20-Apr-2007 00:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | pas de chat.mp3 | 20-Apr-2007 00:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | pas de deux.mp3 | 20-Apr-2007 00:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | pas de quatre.mp3 | 20-Apr-2007 00:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | pas de trois.mp3 | 20-Apr-2007 00:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | pas seul.mp3 | 20-Apr-2007 00:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | pas.mp3 | 20-Apr-2007 00:29 | 5.0K | |
![[SND]](/icons/sound2.gif) | Pasadena.mp3 | 20-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pasadenan.mp3 | 20-Apr-2007 00:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | pasalle.mp3 | 20-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pasargadae.mp3 | 20-Apr-2007 00:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pasay.mp3 | 20-Apr-2007 00:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pascagoula.mp3 | 20-Apr-2007 00:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | pascal.mp3 | 20-Apr-2007 00:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pascalian.mp3 | 20-Apr-2007 00:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | Pascal's triangle.mp3 | 20-Apr-2007 00:29 | 13K | |
![[SND]](/icons/sound2.gif) | Pasch.mp3 | 20-Apr-2007 00:29 | 5.2K | |
![[SND]](/icons/sound2.gif) | Pascha.mp3 | 20-Apr-2007 00:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | paschal.mp3 | 20-Apr-2007 00:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | paschali.mp3 | 20-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | paschenbackeffect.mp3 | 20-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | paschflower.mp3 | 20-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | pascin.mp3 | 20-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pasco.mp3 | 20-Apr-2007 00:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | pasdaction.mp3 | 20-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasdane.mp3 | 20-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasdebasque.mp3 | 20-Apr-2007 00:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | pasdebourree.mp3 | 20-Apr-2007 00:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | pasdecalais.mp3 | 20-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasdechat.mp3 | 20-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasdecheval.mp3 | 20-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | pasdecote.mp3 | 20-Apr-2007 00:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | pasdedeux.mp3 | 20-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasdequatre.mp3 | 20-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | pasdetrois.mp3 | 20-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasdutout.mp3 | 20-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | pase.mp3 | 20-Apr-2007 00:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | paseo.mp3 | 20-Apr-2007 00:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | pasglisse.mp3 | 20-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | pash.mp3 | 20-Apr-2007 00:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | pasha.mp3 | 20-Apr-2007 00:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | pashalik.mp3 | 20-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | pashm.mp3 | 20-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | pashmina.mp3 | 20-Apr-2007 00:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pashto.mp3 | 20-Apr-2007 00:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pashtun.mp3 | 20-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | pashypetter.mp3 | 20-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | pasic.mp3 | 20-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | Pasig.mp3 | 20-Apr-2007 00:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | pasionaria.mp3 | 20-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | Pasiphae.mp3 | 20-Apr-2007 00:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | pasithea.mp3 | 20-Apr-2007 00:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | paskha.mp3 | 20-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasmarche.mp3 | 20-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | pasmore.mp3 | 20-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | Paso Robles.mp3 | 20-Apr-2007 00:31 | 11K | |
![[SND]](/icons/sound2.gif) | pasodoble.mp3 | 20-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | pasolini.mp3 | 20-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | pasop.mp3 | 20-Apr-2007 00:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | paspy.mp3 | 20-Apr-2007 00:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | pasquale.mp3 | 20-Apr-2007 00:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | pasqueflower.mp3 | 20-Apr-2007 00:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | pasquil.mp3 | 20-Apr-2007 00:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasquinade.mp3 | 20-Apr-2007 00:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | pass.mp3 | 20-Apr-2007 00:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | passable.mp3 | 20-Apr-2007 00:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | passably.mp3 | 20-Apr-2007 00:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | passacaglia.mp3 | 20-Apr-2007 00:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | passade.mp3 | 20-Apr-2007 00:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | passado.mp3 | 20-Apr-2007 00:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | passage.mp3 | 20-Apr-2007 00:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | passageway.mp3 | 20-Apr-2007 00:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | passagework.mp3 | 20-Apr-2007 00:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | Passaic.mp3 | 20-Apr-2007 00:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | Passamaquoddy Bay.mp3 | 20-Apr-2007 00:31 | 10K | |
![[SND]](/icons/sound2.gif) | passamaquoddy.mp3 | 20-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | passament.mp3 | 20-Apr-2007 00:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | passant.mp3 | 20-Apr-2007 00:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | passband.mp3 | 20-Apr-2007 00:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | passbook.mp3 | 20-Apr-2007 00:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | passchendaele.mp3 | 20-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | passe.mp3 | 20-Apr-2007 00:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | passecompose.mp3 | 20-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | passed.mp3 | 20-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | passee.mp3 | 20-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | passeggiata.mp3 | 20-Apr-2007 00:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | passel.mp3 | 20-Apr-2007 00:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | passement.mp3 | 20-Apr-2007 00:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | passementerie.mp3 | 20-Apr-2007 00:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | passenger.mp3 | 20-Apr-2007 00:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | passepartout.mp3 | 20-Apr-2007 00:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | passe-partout.mp3 | 20-Apr-2007 00:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | passepied.mp3 | 20-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | passer.mp3 | 20-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | passerby.mp3 | 20-Apr-2007 00:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | passeriform.mp3 | 20-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | passerine.mp3 | 20-Apr-2007 00:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | Passero, Cape.mp3 | 20-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | passersby.mp3 | 20-Apr-2007 00:32 | 10K | |
![[SND]](/icons/sound2.gif) | passeul.mp3 | 20-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | pass-fail.mp3 | 20-Apr-2007 00:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | Passfield.mp3 | 20-Apr-2007 00:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | passible.mp3 | 20-Apr-2007 00:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | passim.mp3 | 20-Apr-2007 00:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | passin.mp3 | 20-Apr-2007 00:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | passing.mp3 | 20-Apr-2007 00:33 | 6.3K | |
![[SND]](/icons/sound2.gif) | passingly.mp3 | 20-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | passion.mp3 | 20-Apr-2007 00:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | passional.mp3 | 20-Apr-2007 00:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | passionary.mp3 | 20-Apr-2007 00:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | passionate.mp3 | 20-Apr-2007 00:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | passionflower.mp3 | 20-Apr-2007 00:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | Passionist.mp3 | 20-Apr-2007 00:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | passionless.mp3 | 20-Apr-2007 00:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | Passiontide.mp3 | 20-Apr-2007 00:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | passivate.mp3 | 20-Apr-2007 00:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | passivation.mp3 | 20-Apr-2007 00:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | passive.mp3 | 20-Apr-2007 00:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | passive-matrix.mp3 | 20-Apr-2007 00:33 | 12K | |
![[SND]](/icons/sound2.gif) | passivism.mp3 | 20-Apr-2007 00:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | passivist.mp3 | 20-Apr-2007 00:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | passivity.mp3 | 20-Apr-2007 00:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | passivization.mp3 | 20-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | passkey.mp3 | 20-Apr-2007 00:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | passless.mp3 | 20-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | passman.mp3 | 20-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | passofundo.mp3 | 20-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | passometer.mp3 | 20-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | Passover.mp3 | 20-Apr-2007 00:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | passport.mp3 | 20-Apr-2007 00:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | passus.mp3 | 20-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | password.mp3 | 20-Apr-2007 00:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | Passy.mp3 | 20-Apr-2007 00:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | past.mp3 | 20-Apr-2007 00:34 | 5.7K | |
![[SND]](/icons/sound2.gif) | pasta.mp3 | 20-Apr-2007 00:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pastaza.mp3 | 20-Apr-2007 00:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | paste.mp3 | 20-Apr-2007 00:34 | 5.2K | |
![[SND]](/icons/sound2.gif) | pasteboard.mp3 | 20-Apr-2007 00:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | pasted.mp3 | 20-Apr-2007 00:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | pastedown.mp3 | 20-Apr-2007 00:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | pastel.mp3 | 20-Apr-2007 00:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | pastelist.mp3 | 20-Apr-2007 00:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | pastellist.mp3 | 20-Apr-2007 00:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | paster.mp3 | 20-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | pastern.mp3 | 20-Apr-2007 00:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | Pasternak.mp3 | 20-Apr-2007 00:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | pasteup.mp3 | 20-Apr-2007 00:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | Pasteur.mp3 | 20-Apr-2007 00:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | pasteurella.mp3 | 20-Apr-2007 00:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | pasteurellosis.mp3 | 20-Apr-2007 00:34 | 17K | |
![[SND]](/icons/sound2.gif) | Pasteurian.mp3 | 20-Apr-2007 00:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | pasteurism.mp3 | 20-Apr-2007 00:34 | 17K | |
![[SND]](/icons/sound2.gif) | pasteurization.mp3 | 20-Apr-2007 00:34 | 11K | |
![[SND]](/icons/sound2.gif) | pasteurize.mp3 | 20-Apr-2007 00:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | pasteurizer.mp3 | 20-Apr-2007 00:35 | 17K | |
![[SND]](/icons/sound2.gif) | pasticci.mp3 | 20-Apr-2007 00:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | pasticcio.mp3 | 20-Apr-2007 00:35 | 9.6K | |
![[SND]](/icons/sound2.gif) | pastiche.mp3 | 20-Apr-2007 00:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pasticheur.mp3 | 20-Apr-2007 00:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | pasticheuse.mp3 | 20-Apr-2007 00:35 | 17K | |
![[SND]](/icons/sound2.gif) | pasties.mp3 | 20-Apr-2007 00:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | pastiglia.mp3 | 20-Apr-2007 00:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pastil.mp3 | 20-Apr-2007 00:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | pastille.mp3 | 20-Apr-2007 00:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pastime.mp3 | 20-Apr-2007 00:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | pastina.mp3 | 20-Apr-2007 00:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | pastiness.mp3 | 20-Apr-2007 00:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | pasting.mp3 | 20-Apr-2007 00:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | pastis.mp3 | 20-Apr-2007 00:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pastitsio.mp3 | 20-Apr-2007 00:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | pastitso.mp3 | 20-Apr-2007 00:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | pastless.mp3 | 20-Apr-2007 00:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | pastness.mp3 | 20-Apr-2007 00:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | pasto.mp3 | 20-Apr-2007 00:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pastonletters.mp3 | 20-Apr-2007 00:35 | 17K | |
![[SND]](/icons/sound2.gif) | pastor.mp3 | 20-Apr-2007 00:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | pastorage.mp3 | 20-Apr-2007 00:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | pastoral.mp3 | 20-Apr-2007 00:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | pastorale.mp3 | 20-Apr-2007 00:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | pastoralism.mp3 | 20-Apr-2007 00:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | pastoralist.mp3 | 20-Apr-2007 00:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | pastoralize.mp3 | 20-Apr-2007 00:36 | 17K | |
![[SND]](/icons/sound2.gif) | pastorally.mp3 | 20-Apr-2007 00:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | pastoralprayer.mp3 | 20-Apr-2007 00:36 | 17K | |
![[SND]](/icons/sound2.gif) | pastorate.mp3 | 20-Apr-2007 00:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | pastoring.mp3 | 20-Apr-2007 00:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | pastorium.mp3 | 20-Apr-2007 00:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | pastorship.mp3 | 20-Apr-2007 00:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | pastose.mp3 | 20-Apr-2007 00:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | pastrami.mp3 | 20-Apr-2007 00:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | pastromi.mp3 | 20-Apr-2007 00:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | pastry.mp3 | 20-Apr-2007 00:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | pasturable.mp3 | 20-Apr-2007 00:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | pasturage.mp3 | 20-Apr-2007 00:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | pasture.mp3 | 20-Apr-2007 00:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | pastureland.mp3 | 20-Apr-2007 00:36 | 9.3K | |
![[SND]](/icons/sound2.gif) | pasty.mp3 | 20-Apr-2007 00:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | pastyfaced.mp3 | 20-Apr-2007 00:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | pat.mp3 | 20-Apr-2007 00:36 | 4.3K | |
![[SND]](/icons/sound2.gif) | pataca.mp3 | 20-Apr-2007 00:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | patacake.mp3 | 20-Apr-2007 00:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | pat-a-cake.mp3 | 20-Apr-2007 00:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | patagia.mp3 | 20-Apr-2007 00:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | patagium.mp3 | 20-Apr-2007 00:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | Patagonia.mp3 | 20-Apr-2007 00:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | Patagonian.mp3 | 20-Apr-2007 00:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | Patan.mp3 | 20-Apr-2007 00:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | patanjali.mp3 | 20-Apr-2007 00:37 | 17K | |
![[SND]](/icons/sound2.gif) | pataphysics.mp3 | 20-Apr-2007 00:37 | 17K | |
![[SND]](/icons/sound2.gif) | Patapsco.mp3 | 20-Apr-2007 00:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | patavinity.mp3 | 20-Apr-2007 00:37 | 17K | |
![[SND]](/icons/sound2.gif) | patch.mp3 | 20-Apr-2007 00:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | patchboard.mp3 | 20-Apr-2007 00:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | patchen.mp3 | 20-Apr-2007 00:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | patchery.mp3 | 20-Apr-2007 00:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | patchily.mp3 | 20-Apr-2007 00:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | patchiness.mp3 | 20-Apr-2007 00:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | patchogue.mp3 | 20-Apr-2007 00:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | patchouli.mp3 | 20-Apr-2007 00:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | patchouly.mp3 | 20-Apr-2007 00:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | patchwork.mp3 | 20-Apr-2007 00:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | patchy.mp3 | 20-Apr-2007 00:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | pate de foie gras.mp3 | 20-Apr-2007 00:37 | 13K | |
![[SND]](/icons/sound2.gif) | pate.mp3 | 20-Apr-2007 00:37 | 4.3K | |
![[SND]](/icons/sound2.gif) | pateachou.mp3 | 20-Apr-2007 00:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | pated.mp3 | 20-Apr-2007 00:37 | 5.5K | |
![[SND]](/icons/sound2.gif) | patedefoiegras.mp3 | 20-Apr-2007 00:37 | 17K | |
![[SND]](/icons/sound2.gif) | patedeverre.mp3 | 20-Apr-2007 00:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | patedure.mp3 | 20-Apr-2007 00:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | patella.mp3 | 20-Apr-2007 00:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | patellae.mp3 | 20-Apr-2007 00:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | patellar.mp3 | 20-Apr-2007 00:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | patellate.mp3 | 20-Apr-2007 00:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | patelliform.mp3 | 20-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | paten.mp3 | 20-Apr-2007 00:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | patency.mp3 | 20-Apr-2007 00:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | patenier.mp3 | 20-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | patent flour.mp3 | 20-Apr-2007 00:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | patent leather.mp3 | 20-Apr-2007 00:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | patent.mp3 | 20-Apr-2007 00:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | patentability.mp3 | 20-Apr-2007 00:38 | 10K | |
![[SND]](/icons/sound2.gif) | patentable.mp3 | 20-Apr-2007 00:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | patented.mp3 | 20-Apr-2007 00:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | patentee.mp3 | 20-Apr-2007 00:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | patentleather.mp3 | 20-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | patently.mp3 | 20-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | patentor.mp3 | 20-Apr-2007 00:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | pater patriae.mp3 | 20-Apr-2007 00:38 | 13K | |
![[SND]](/icons/sound2.gif) | pater.mp3 | 20-Apr-2007 00:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | patera.mp3 | 20-Apr-2007 00:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pateresque.mp3 | 20-Apr-2007 00:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | paterfamilias.mp3 | 20-Apr-2007 00:38 | 11K | |
![[SND]](/icons/sound2.gif) | Paterian.mp3 | 20-Apr-2007 00:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | paternal.mp3 | 20-Apr-2007 00:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | paternalism.mp3 | 20-Apr-2007 00:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | paternalist.mp3 | 20-Apr-2007 00:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | paternalistic.mp3 | 20-Apr-2007 00:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | paternalistically.mp3 | 20-Apr-2007 00:39 | 11K | |
![[SND]](/icons/sound2.gif) | paternally.mp3 | 20-Apr-2007 00:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | paternity.mp3 | 20-Apr-2007 00:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | paternoster.mp3 | 20-Apr-2007 00:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | paterpatriae.mp3 | 20-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | Paterson.mp3 | 20-Apr-2007 00:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | pates de foie gras.mp3 | 20-Apr-2007 00:39 | 13K | |
![[SND]](/icons/sound2.gif) | patesurpate.mp3 | 20-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | patetendre.mp3 | 20-Apr-2007 00:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | path.mp3 | 20-Apr-2007 00:39 | 4.6K | |
![[SND]](/icons/sound2.gif) | Pathan.mp3 | 20-Apr-2007 00:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | pathbreaking.mp3 | 20-Apr-2007 00:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | pathetic.mp3 | 20-Apr-2007 00:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | pathetical.mp3 | 20-Apr-2007 00:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | pathetically.mp3 | 20-Apr-2007 00:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | pathetics.mp3 | 20-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | pathetlao.mp3 | 20-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | pathfinder.mp3 | 20-Apr-2007 00:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | pathfinding.mp3 | 20-Apr-2007 00:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | pathia.mp3 | 20-Apr-2007 00:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | pathic.mp3 | 20-Apr-2007 00:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | pathless.mp3 | 20-Apr-2007 00:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | patho.mp3 | 20-Apr-2007 00:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | pathobiology.mp3 | 20-Apr-2007 00:40 | 12K | |
![[SND]](/icons/sound2.gif) | pathoformic.mp3 | 20-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | pathogen.mp3 | 20-Apr-2007 00:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | pathogenesis.mp3 | 20-Apr-2007 00:40 | 11K | |
![[SND]](/icons/sound2.gif) | pathogenetic.mp3 | 20-Apr-2007 00:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | pathogenic.mp3 | 20-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | pathogenicity.mp3 | 20-Apr-2007 00:40 | 11K | |
![[SND]](/icons/sound2.gif) | pathognomonic.mp3 | 20-Apr-2007 00:40 | 9.6K | |
![[SND]](/icons/sound2.gif) | pathognomy.mp3 | 20-Apr-2007 00:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | pathography.mp3 | 20-Apr-2007 00:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | pathologic.mp3 | 20-Apr-2007 00:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | pathological.mp3 | 20-Apr-2007 00:40 | 9.5K | |
![[SND]](/icons/sound2.gif) | pathologically.mp3 | 20-Apr-2007 00:40 | 10K | |
![[SND]](/icons/sound2.gif) | pathologist.mp3 | 20-Apr-2007 00:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | pathologize.mp3 | 20-Apr-2007 00:40 | 9.6K | |
![[SND]](/icons/sound2.gif) | pathology.mp3 | 20-Apr-2007 00:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | pathometer.mp3 | 20-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | pathomorphism.mp3 | 20-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | pathophysiologic.mp3 | 20-Apr-2007 00:40 | 13K | |
![[SND]](/icons/sound2.gif) | pathophysiological.mp3 | 20-Apr-2007 00:40 | 14K | |
![[SND]](/icons/sound2.gif) | pathophysiology.mp3 | 20-Apr-2007 00:40 | 12K | |
![[SND]](/icons/sound2.gif) | pathos.mp3 | 20-Apr-2007 00:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | pathosis.mp3 | 20-Apr-2007 00:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | paths.mp3 | 20-Apr-2007 00:40 | 6.1K | |
![[SND]](/icons/sound2.gif) | pathway.mp3 | 20-Apr-2007 00:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | pathy.mp3 | 20-Apr-2007 00:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | Patiala.mp3 | 20-Apr-2007 00:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | patience.mp3 | 20-Apr-2007 00:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | patient.mp3 | 20-Apr-2007 00:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | patiently.mp3 | 20-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | patin.mp3 | 20-Apr-2007 00:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | patina.mp3 | 20-Apr-2007 00:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | patinae.mp3 | 20-Apr-2007 00:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | patinas.mp3 | 20-Apr-2007 00:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | patinate.mp3 | 20-Apr-2007 00:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | patination.mp3 | 20-Apr-2007 00:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | patine.mp3 | 20-Apr-2007 00:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | patinir.mp3 | 20-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | patinize.mp3 | 20-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | patinous.mp3 | 20-Apr-2007 00:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | patio.mp3 | 20-Apr-2007 00:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | patisserie.mp3 | 20-Apr-2007 00:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | patissier.mp3 | 20-Apr-2007 00:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | patlander.mp3 | 20-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | Patmore.mp3 | 20-Apr-2007 00:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | Patmos.mp3 | 20-Apr-2007 00:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | Patna.mp3 | 20-Apr-2007 00:41 | 4.8K | |
![[SND]](/icons/sound2.gif) | pato.mp3 | 20-Apr-2007 00:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | patois.mp3 | 20-Apr-2007 00:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | Paton.mp3 | 20-Apr-2007 00:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | patonce.mp3 | 20-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | patoot.mp3 | 20-Apr-2007 00:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | patootie.mp3 | 20-Apr-2007 00:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | Patos, Lagoa dos.mp3 | 20-Apr-2007 00:42 | 14K | |
![[SND]](/icons/sound2.gif) | patr.mp3 | 20-Apr-2007 00:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | Patrae.mp3 | 20-Apr-2007 00:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | Patrai.mp3 | 20-Apr-2007 00:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | Patraikos Kolpos.mp3 | 20-Apr-2007 00:42 | 15K | |
![[SND]](/icons/sound2.gif) | Patras.mp3 | 20-Apr-2007 00:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | patresconscripti.mp3 | 20-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | patresfamilias.mp3 | 20-Apr-2007 00:42 | 13K | |
![[SND]](/icons/sound2.gif) | patri.mp3 | 20-Apr-2007 00:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | patrial.mp3 | 20-Apr-2007 00:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | patriapotestas.mp3 | 20-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | patriarch.mp3 | 20-Apr-2007 00:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | patriarchal.mp3 | 20-Apr-2007 00:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | patriarchalism.mp3 | 20-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | patriarchate.mp3 | 20-Apr-2007 00:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | patriarchy.mp3 | 20-Apr-2007 00:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | patriate.mp3 | 20-Apr-2007 00:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | patricia.mp3 | 20-Apr-2007 00:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | patrician.mp3 | 20-Apr-2007 00:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | patriciate.mp3 | 20-Apr-2007 00:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | patricidal.mp3 | 20-Apr-2007 00:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | patricide.mp3 | 20-Apr-2007 00:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | Patrick.mp3 | 20-Apr-2007 00:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | patricliny.mp3 | 20-Apr-2007 00:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | patrilineal.mp3 | 20-Apr-2007 00:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | patriliny.mp3 | 20-Apr-2007 00:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | patrimonial.mp3 | 20-Apr-2007 00:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | patrimonialsea.mp3 | 20-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | patrimony.mp3 | 20-Apr-2007 00:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | patriot.mp3 | 20-Apr-2007 00:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | patriotic.mp3 | 20-Apr-2007 00:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | patriotically.mp3 | 20-Apr-2007 00:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | patriotism.mp3 | 20-Apr-2007 00:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | patripassianism.mp3 | 20-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | patripotestal.mp3 | 20-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | patristic.mp3 | 20-Apr-2007 00:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | patristical.mp3 | 20-Apr-2007 00:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | patristics.mp3 | 20-Apr-2007 00:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | patrix.mp3 | 20-Apr-2007 00:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | patro.mp3 | 20-Apr-2007 00:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | patrocliny.mp3 | 20-Apr-2007 00:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | Patroclus.mp3 | 20-Apr-2007 00:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | patrol.mp3 | 20-Apr-2007 00:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | patrolman.mp3 | 20-Apr-2007 00:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | patrologist.mp3 | 20-Apr-2007 00:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | patrology.mp3 | 20-Apr-2007 00:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | patron.mp3 | 20-Apr-2007 00:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | patronage.mp3 | 20-Apr-2007 00:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | patronal.mp3 | 20-Apr-2007 00:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | patroness.mp3 | 20-Apr-2007 00:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | patronization.mp3 | 20-Apr-2007 00:44 | 10K | |
![[SND]](/icons/sound2.gif) | patronize.mp3 | 20-Apr-2007 00:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | patronizing.mp3 | 20-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | patronizingly.mp3 | 20-Apr-2007 00:44 | 10K | |
![[SND]](/icons/sound2.gif) | patronym.mp3 | 20-Apr-2007 00:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | patronymic.mp3 | 20-Apr-2007 00:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | patroon.mp3 | 20-Apr-2007 00:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | patsy.mp3 | 20-Apr-2007 00:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | pattee.mp3 | 20-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | patten.mp3 | 20-Apr-2007 00:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | patter.mp3 | 20-Apr-2007 00:44 | 4.6K | |
![[SND]](/icons/sound2.gif) | patterer.mp3 | 20-Apr-2007 00:44 | 5.9K | |
![[SND]](/icons/sound2.gif) | pattern.mp3 | 20-Apr-2007 00:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | patterned.mp3 | 20-Apr-2007 00:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | patterning.mp3 | 20-Apr-2007 00:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | patternize.mp3 | 20-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | patterson.mp3 | 20-Apr-2007 00:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | Patti.mp3 | 20-Apr-2007 00:44 | 5.0K | |
![[SND]](/icons/sound2.gif) | pattie.mp3 | 20-Apr-2007 00:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | pattle.mp3 | 20-Apr-2007 00:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | Patton.mp3 | 20-Apr-2007 00:44 | 5.9K | |
![[SND]](/icons/sound2.gif) | pattu.mp3 | 20-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | patty.mp3 | 20-Apr-2007 00:45 | 5.5K | |
![[SND]](/icons/sound2.gif) | patty-cake.mp3 | 20-Apr-2007 00:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | pattypan.mp3 | 20-Apr-2007 00:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | pattypansquash.mp3 | 20-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | patu.mp3 | 20-Apr-2007 00:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | patuca.mp3 | 20-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | patulin.mp3 | 20-Apr-2007 00:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | patulous.mp3 | 20-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | Patuxent.mp3 | 20-Apr-2007 00:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | patwin.mp3 | 20-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | paty.mp3 | 20-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | patzer.mp3 | 20-Apr-2007 00:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | Pau.mp3 | 20-Apr-2007 00:45 | 5.0K | |
![[SND]](/icons/sound2.gif) | paua.mp3 | 20-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | pauci.mp3 | 20-Apr-2007 00:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | paucis verbis.mp3 | 20-Apr-2007 00:45 | 12K | |
![[SND]](/icons/sound2.gif) | paucisverbis.mp3 | 20-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | paucity.mp3 | 20-Apr-2007 00:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | Paul Bunyan.mp3 | 20-Apr-2007 00:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | Paul.mp3 | 20-Apr-2007 00:45 | 5.4K | |
![[SND]](/icons/sound2.gif) | paula.mp3 | 20-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | paulboncour.mp3 | 20-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | Paulding.mp3 | 20-Apr-2007 00:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | pauldron.mp3 | 20-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | paulette.mp3 | 20-Apr-2007 00:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pauli exclusion principle.mp3 | 20-Apr-2007 00:46 | 16K | |
![[SND]](/icons/sound2.gif) | Pauli.mp3 | 20-Apr-2007 00:46 | 5.7K | |
![[SND]](/icons/sound2.gif) | Pauline.mp3 | 20-Apr-2007 00:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pauling.mp3 | 20-Apr-2007 00:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | paulinism.mp3 | 20-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | paulinus.mp3 | 20-Apr-2007 00:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | paulinusofnola.mp3 | 20-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | Paulist.mp3 | 20-Apr-2007 00:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | paulista.mp3 | 20-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | paulmasson.mp3 | 20-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | paulownia.mp3 | 20-Apr-2007 00:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | paulpry.mp3 | 20-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | Paulus.mp3 | 20-Apr-2007 00:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | paumgartner.mp3 | 20-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | paumotuarchipelago.mp3 | 20-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | paunch.mp3 | 20-Apr-2007 00:46 | 5.7K | |
![[SND]](/icons/sound2.gif) | paunchy.mp3 | 20-Apr-2007 00:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | pauper.mp3 | 20-Apr-2007 00:46 | 6.1K | |
![[SND]](/icons/sound2.gif) | pauperism.mp3 | 20-Apr-2007 00:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | pauperization.mp3 | 20-Apr-2007 00:46 | 11K | |
![[SND]](/icons/sound2.gif) | pauperize.mp3 | 20-Apr-2007 00:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | paupiette.mp3 | 20-Apr-2007 00:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | pauraque.mp3 | 20-Apr-2007 00:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | paurometabolism.mp3 | 20-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | Pausanias.mp3 | 20-Apr-2007 00:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | pause.mp3 | 20-Apr-2007 00:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | pav.mp3 | 20-Apr-2007 00:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | pavage.mp3 | 20-Apr-2007 00:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | pavan.mp3 | 20-Apr-2007 00:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | pavane.mp3 | 20-Apr-2007 00:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | pavarotti.mp3 | 20-Apr-2007 00:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | pave.mp3 | 20-Apr-2007 00:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | paveed.mp3 | 20-Apr-2007 00:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | pavelpetrovich.mp3 | 20-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | pavement.mp3 | 20-Apr-2007 00:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | pavepaws.mp3 | 20-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | paver.mp3 | 20-Apr-2007 00:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | pavese.mp3 | 20-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | Pavia.mp3 | 20-Apr-2007 00:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | pavid.mp3 | 20-Apr-2007 00:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | pavilion.mp3 | 20-Apr-2007 00:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | pavillon.mp3 | 20-Apr-2007 00:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | pavillonchinois.mp3 | 20-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | pavin.mp3 | 20-Apr-2007 00:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | paving.mp3 | 20-Apr-2007 00:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | pavior.mp3 | 20-Apr-2007 00:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | paviotso.mp3 | 20-Apr-2007 00:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | paviour.mp3 | 20-Apr-2007 00:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | pavis.mp3 | 20-Apr-2007 00:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pavlodar.mp3 | 20-Apr-2007 00:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pavlof.mp3 | 20-Apr-2007 00:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pavlograd.mp3 | 20-Apr-2007 00:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pavlov.mp3 | 20-Apr-2007 00:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | pavlova.mp3 | 20-Apr-2007 00:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pavlovian.mp3 | 20-Apr-2007 00:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | pavo.mp3 | 20-Apr-2007 00:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pavoni.mp3 | 20-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | pavonine.mp3 | 20-Apr-2007 00:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | pavulon.mp3 | 20-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | paw.mp3 | 20-Apr-2007 00:48 | 5.5K | |
![[SND]](/icons/sound2.gif) | pawky.mp3 | 20-Apr-2007 00:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | pawl.mp3 | 20-Apr-2007 00:48 | 5.4K | |
![[SND]](/icons/sound2.gif) | pawn.mp3 | 20-Apr-2007 00:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | pawnage.mp3 | 20-Apr-2007 00:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | pawnbroker.mp3 | 20-Apr-2007 00:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | pawnbroking.mp3 | 20-Apr-2007 00:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | Pawnee.mp3 | 20-Apr-2007 00:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | pawner.mp3 | 20-Apr-2007 00:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | pawnor.mp3 | 20-Apr-2007 00:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | pawnshop.mp3 | 20-Apr-2007 00:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | pawpaw.mp3 | 20-Apr-2007 00:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | Pawtucket.mp3 | 20-Apr-2007 00:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | pax vobiscum.mp3 | 20-Apr-2007 00:48 | 13K | |
![[SND]](/icons/sound2.gif) | pax.mp3 | 20-Apr-2007 00:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | paxbritannica.mp3 | 20-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | paxos.mp3 | 20-Apr-2007 00:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | paxromana.mp3 | 20-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | paxton.mp3 | 20-Apr-2007 00:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | paxvobiscum.mp3 | 20-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | paxwax.mp3 | 20-Apr-2007 00:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | pay.mp3 | 20-Apr-2007 00:49 | 5.4K | |
![[SND]](/icons/sound2.gif) | payable.mp3 | 20-Apr-2007 00:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | payback.mp3 | 20-Apr-2007 00:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | paycheck.mp3 | 20-Apr-2007 00:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | payday.mp3 | 20-Apr-2007 00:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | payee.mp3 | 20-Apr-2007 00:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | payer.mp3 | 20-Apr-2007 00:49 | 5.5K | |
![[SND]](/icons/sound2.gif) | paying.mp3 | 20-Apr-2007 00:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | payload.mp3 | 20-Apr-2007 00:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | paymaster.mp3 | 20-Apr-2007 00:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | payment.mp3 | 20-Apr-2007 00:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | payne.mp3 | 20-Apr-2007 00:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | paynim.mp3 | 20-Apr-2007 00:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | payoff.mp3 | 20-Apr-2007 00:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | payola.mp3 | 20-Apr-2007 00:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | payor.mp3 | 20-Apr-2007 00:49 | 5.5K | |
![[SND]](/icons/sound2.gif) | payout.mp3 | 20-Apr-2007 00:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | payroll.mp3 | 20-Apr-2007 00:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | paysage.mp3 | 20-Apr-2007 00:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | Paysandu.mp3 | 20-Apr-2007 00:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | payton.mp3 | 20-Apr-2007 00:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | Paz.mp3 | 20-Apr-2007 00:50 | 5.7K | |
![[SND]](/icons/sound2.gif) | pazaza.mp3 | 20-Apr-2007 00:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | pazazz.mp3 | 20-Apr-2007 00:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | pazestenssoro.mp3 | 20-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | pazyryk.mp3 | 20-Apr-2007 00:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | pazzaza.mp3 | 20-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | PBB.mp3 | 20-Apr-2007 00:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | PBX.mp3 | 20-Apr-2007 00:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | PC.mp3 | 20-Apr-2007 00:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | PCB.mp3 | 20-Apr-2007 00:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | PCP.mp3 | 20-Apr-2007 00:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | pd.mp3 | 20-Apr-2007 00:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | PDA.mp3 | 20-Apr-2007 00:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | PDQ.mp3 | 20-Apr-2007 00:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | pe.mp3 | 20-Apr-2007 00:50 | 4.8K | |
![[SND]](/icons/sound2.gif) | pea jacket.mp3 | 20-Apr-2007 00:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | pea.mp3 | 20-Apr-2007 00:50 | 4.6K | |
![[SND]](/icons/sound2.gif) | Peabody.mp3 | 20-Apr-2007 00:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | peace.mp3 | 20-Apr-2007 00:50 | 5.0K | |
![[SND]](/icons/sound2.gif) | peaceable.mp3 | 20-Apr-2007 00:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | peaceably.mp3 | 20-Apr-2007 00:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | peacecorps.mp3 | 20-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | peaceful.mp3 | 20-Apr-2007 00:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | peacefully.mp3 | 20-Apr-2007 00:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | peacekeeper.mp3 | 20-Apr-2007 00:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | peacekeeping.mp3 | 20-Apr-2007 00:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | peacemaker.mp3 | 20-Apr-2007 00:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | peacemaking.mp3 | 20-Apr-2007 00:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | peacemonger.mp3 | 20-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | peacenik.mp3 | 20-Apr-2007 00:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | peacetime.mp3 | 20-Apr-2007 00:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | peach.mp3 | 20-Apr-2007 00:51 | 5.2K | |
![[SND]](/icons/sound2.gif) | peachblow.mp3 | 20-Apr-2007 00:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | peacherino.mp3 | 20-Apr-2007 00:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | peachick.mp3 | 20-Apr-2007 00:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | Peachtree City.mp3 | 20-Apr-2007 00:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | peachy.mp3 | 20-Apr-2007 00:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | peacoat.mp3 | 20-Apr-2007 00:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | peacock.mp3 | 20-Apr-2007 00:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | peacockish.mp3 | 20-Apr-2007 00:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | peacocky.mp3 | 20-Apr-2007 00:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | peafowl.mp3 | 20-Apr-2007 00:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | peag.mp3 | 20-Apr-2007 00:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | peahen.mp3 | 20-Apr-2007 00:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | peak.mp3 | 20-Apr-2007 00:51 | 4.3K | |
![[SND]](/icons/sound2.gif) | peake.mp3 | 20-Apr-2007 00:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | peaked.mp3 | 20-Apr-2007 00:51 | 4.6K | |
![[SND]](/icons/sound2.gif) | peakedness.mp3 | 20-Apr-2007 00:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | peaky.mp3 | 20-Apr-2007 00:52 | 5.4K | |
![[SND]](/icons/sound2.gif) | peal.mp3 | 20-Apr-2007 00:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | Peale.mp3 | 20-Apr-2007 00:52 | 5.2K | |
![[SND]](/icons/sound2.gif) | pealike.mp3 | 20-Apr-2007 00:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | pean.mp3 | 20-Apr-2007 00:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | peano.mp3 | 20-Apr-2007 00:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | peanut.mp3 | 20-Apr-2007 00:52 | 5.7K | |
![[SND]](/icons/sound2.gif) | peapod.mp3 | 20-Apr-2007 00:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | pear.mp3 | 20-Apr-2007 00:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | pearl.mp3 | 20-Apr-2007 00:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pearland.mp3 | 20-Apr-2007 00:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | pearled.mp3 | 20-Apr-2007 00:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pearler.mp3 | 20-Apr-2007 00:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | pearlescence.mp3 | 20-Apr-2007 00:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | pearlescent.mp3 | 20-Apr-2007 00:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | pearlite.mp3 | 20-Apr-2007 00:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | pearlitic.mp3 | 20-Apr-2007 00:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | pearlized.mp3 | 20-Apr-2007 00:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | pearlwort.mp3 | 20-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | pearly.mp3 | 20-Apr-2007 00:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | pearmain.mp3 | 20-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | pears.mp3 | 20-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | pearse.mp3 | 20-Apr-2007 00:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | pear-shaped.mp3 | 20-Apr-2007 00:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | Pearson.mp3 | 20-Apr-2007 00:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | peart.mp3 | 20-Apr-2007 00:53 | 4.5K | |
![[SND]](/icons/sound2.gif) | Peary Land.mp3 | 20-Apr-2007 00:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | Peary.mp3 | 20-Apr-2007 00:53 | 5.2K | |
![[SND]](/icons/sound2.gif) | peasant.mp3 | 20-Apr-2007 00:53 | 5.7K | |
![[SND]](/icons/sound2.gif) | peasantry.mp3 | 20-Apr-2007 00:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | peascod.mp3 | 20-Apr-2007 00:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | pease.mp3 | 20-Apr-2007 00:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | peasecod.mp3 | 20-Apr-2007 00:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | peashooter.mp3 | 20-Apr-2007 00:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | peat.mp3 | 20-Apr-2007 00:53 | 3.9K | |
![[SND]](/icons/sound2.gif) | peatery.mp3 | 20-Apr-2007 00:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | peattie.mp3 | 20-Apr-2007 00:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | peaty.mp3 | 20-Apr-2007 00:53 | 5.4K | |
![[SND]](/icons/sound2.gif) | peaudesoie.mp3 | 20-Apr-2007 00:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | peavey.mp3 | 20-Apr-2007 00:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | peavy.mp3 | 20-Apr-2007 00:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | peb.mp3 | 20-Apr-2007 00:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | peba.mp3 | 20-Apr-2007 00:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | pebble.mp3 | 20-Apr-2007 00:53 | 5.2K | |
![[SND]](/icons/sound2.gif) | pebbling.mp3 | 20-Apr-2007 00:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | pebbly.mp3 | 20-Apr-2007 00:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | pebrine.mp3 | 20-Apr-2007 00:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | pec.mp3 | 20-Apr-2007 00:53 | 3.8K | |
![[SND]](/icons/sound2.gif) | pecan.mp3 | 20-Apr-2007 00:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | peccable.mp3 | 20-Apr-2007 00:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | peccadillo.mp3 | 20-Apr-2007 00:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | peccant.mp3 | 20-Apr-2007 00:54 | 5.4K | |
![[SND]](/icons/sound2.gif) | peccary.mp3 | 20-Apr-2007 00:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | peccatophobia.mp3 | 20-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | peccavi.mp3 | 20-Apr-2007 00:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | pech.mp3 | 20-Apr-2007 00:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | pechemelba.mp3 | 20-Apr-2007 00:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pechenga.mp3 | 20-Apr-2007 00:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | pecher.mp3 | 20-Apr-2007 00:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pechora.mp3 | 20-Apr-2007 00:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | peck.mp3 | 20-Apr-2007 00:54 | 3.9K | |
![[SND]](/icons/sound2.gif) | pecker.mp3 | 20-Apr-2007 00:54 | 5.0K | |
![[SND]](/icons/sound2.gif) | peckerwood.mp3 | 20-Apr-2007 00:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | peckhamrye.mp3 | 20-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | pecking.mp3 | 20-Apr-2007 00:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | peckings.mp3 | 20-Apr-2007 00:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | peckinpah.mp3 | 20-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | peckish.mp3 | 20-Apr-2007 00:54 | 6.3K | |
![[SND]](/icons/sound2.gif) | pecks.mp3 | 20-Apr-2007 00:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | pecksniff.mp3 | 20-Apr-2007 00:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pecksniffian.mp3 | 20-Apr-2007 00:54 | 11K | |
![[SND]](/icons/sound2.gif) | pecky.mp3 | 20-Apr-2007 00:54 | 5.2K | |
![[SND]](/icons/sound2.gif) | pecorino.mp3 | 20-Apr-2007 00:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pecos.mp3 | 20-Apr-2007 00:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pecs.mp3 | 20-Apr-2007 00:54 | 5.7K | |
![[SND]](/icons/sound2.gif) | pectase.mp3 | 20-Apr-2007 00:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | pectate.mp3 | 20-Apr-2007 00:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | pecten.mp3 | 20-Apr-2007 00:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | pectic.mp3 | 20-Apr-2007 00:55 | 5.5K | |
![[SND]](/icons/sound2.gif) | pectin.mp3 | 20-Apr-2007 00:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | pectinaceous.mp3 | 20-Apr-2007 00:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | pectinate.mp3 | 20-Apr-2007 00:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | pectination.mp3 | 20-Apr-2007 00:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | pectines.mp3 | 20-Apr-2007 00:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pectinesterase.mp3 | 20-Apr-2007 00:55 | 11K | |
![[SND]](/icons/sound2.gif) | pectinose.mp3 | 20-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | pectize.mp3 | 20-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | pectolite.mp3 | 20-Apr-2007 00:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | pectoral.mp3 | 20-Apr-2007 00:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | pectoralis.mp3 | 20-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | pectose.mp3 | 20-Apr-2007 00:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | pectous.mp3 | 20-Apr-2007 00:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | peculate.mp3 | 20-Apr-2007 00:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | peculation.mp3 | 20-Apr-2007 00:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | peculator.mp3 | 20-Apr-2007 00:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | peculiar.mp3 | 20-Apr-2007 00:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | peculiarity.mp3 | 20-Apr-2007 00:55 | 11K | |
![[SND]](/icons/sound2.gif) | peculiarize.mp3 | 20-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | peculium.mp3 | 20-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | pecuniarily.mp3 | 20-Apr-2007 00:55 | 10K | |
![[SND]](/icons/sound2.gif) | pecuniary.mp3 | 20-Apr-2007 00:56 | 10K | |
![[SND]](/icons/sound2.gif) | ped.mp3 | 20-Apr-2007 00:56 | 4.8K | |
![[SND]](/icons/sound2.gif) | pedagese.mp3 | 20-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | pedagog.mp3 | 20-Apr-2007 00:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | pedagogic.mp3 | 20-Apr-2007 00:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedagogical.mp3 | 20-Apr-2007 00:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedagogically.mp3 | 20-Apr-2007 00:56 | 9.8K | |
![[SND]](/icons/sound2.gif) | pedagogics.mp3 | 20-Apr-2007 00:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | pedagogism.mp3 | 20-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | pedagogue.mp3 | 20-Apr-2007 00:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | pedagogy.mp3 | 20-Apr-2007 00:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pedal.mp3 | 20-Apr-2007 00:56 | 4.8K | |
![[SND]](/icons/sound2.gif) | pedalfer.mp3 | 20-Apr-2007 00:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | pedalling.mp3 | 20-Apr-2007 00:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | pedal-note.mp3 | 20-Apr-2007 00:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | pedalo.mp3 | 20-Apr-2007 00:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | pedant.mp3 | 20-Apr-2007 00:56 | 5.7K | |
![[SND]](/icons/sound2.gif) | pedantic.mp3 | 20-Apr-2007 00:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | pedantically.mp3 | 20-Apr-2007 00:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedanticism.mp3 | 20-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | pedantocracy.mp3 | 20-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | pedantry.mp3 | 20-Apr-2007 00:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | pedate.mp3 | 20-Apr-2007 00:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | pedati.mp3 | 20-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | peddle.mp3 | 20-Apr-2007 00:56 | 5.0K | |
![[SND]](/icons/sound2.gif) | peddler.mp3 | 20-Apr-2007 00:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | peddlery.mp3 | 20-Apr-2007 00:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | peddling.mp3 | 20-Apr-2007 00:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | pede.mp3 | 20-Apr-2007 00:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pederast.mp3 | 20-Apr-2007 00:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | pederastic.mp3 | 20-Apr-2007 00:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | pederasty.mp3 | 20-Apr-2007 00:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pedernales.mp3 | 20-Apr-2007 00:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | Pedersen.mp3 | 20-Apr-2007 00:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | pedes.mp3 | 20-Apr-2007 00:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | pedestal.mp3 | 20-Apr-2007 00:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | pedestrian.mp3 | 20-Apr-2007 00:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | pedestrianism.mp3 | 20-Apr-2007 00:57 | 11K | |
![[SND]](/icons/sound2.gif) | pedestrianize.mp3 | 20-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | pedi.mp3 | 20-Apr-2007 00:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pedia.mp3 | 20-Apr-2007 00:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pediarchy.mp3 | 20-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | pediatric.mp3 | 20-Apr-2007 00:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | pediatrician.mp3 | 20-Apr-2007 00:57 | 10K | |
![[SND]](/icons/sound2.gif) | pediatrics.mp3 | 20-Apr-2007 00:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | pediatrist.mp3 | 20-Apr-2007 00:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedicab.mp3 | 20-Apr-2007 00:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | pedicel.mp3 | 20-Apr-2007 00:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | pedicellaria.mp3 | 20-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | pedicellate.mp3 | 20-Apr-2007 00:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | pedicle.mp3 | 20-Apr-2007 00:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | pedicled.mp3 | 20-Apr-2007 00:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | pedicular.mp3 | 20-Apr-2007 00:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | pediculate.mp3 | 20-Apr-2007 00:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | pediculicide.mp3 | 20-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | pediculoses.mp3 | 20-Apr-2007 00:58 | 11K | |
![[SND]](/icons/sound2.gif) | pediculosis.mp3 | 20-Apr-2007 00:58 | 11K | |
![[SND]](/icons/sound2.gif) | pediculous.mp3 | 20-Apr-2007 00:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedicure.mp3 | 20-Apr-2007 00:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | pedicurist.mp3 | 20-Apr-2007 00:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | pediform.mp3 | 20-Apr-2007 00:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | pedigree.mp3 | 20-Apr-2007 00:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | pedigreed.mp3 | 20-Apr-2007 00:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | pediment.mp3 | 20-Apr-2007 00:58 | 5.7K | |
![[SND]](/icons/sound2.gif) | pedimental.mp3 | 20-Apr-2007 00:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | pedimented.mp3 | 20-Apr-2007 00:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pediococcus.mp3 | 20-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | pedion.mp3 | 20-Apr-2007 00:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pedipalp.mp3 | 20-Apr-2007 00:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | pedlar.mp3 | 20-Apr-2007 00:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | pedlery.mp3 | 20-Apr-2007 00:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | pedo.mp3 | 20-Apr-2007 00:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pedobaptism.mp3 | 20-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | pedobaptist.mp3 | 20-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | pedocal.mp3 | 20-Apr-2007 00:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | pedocalic.mp3 | 20-Apr-2007 00:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | pedochemical.mp3 | 20-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | pedodontics.mp3 | 20-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | pedogenesis.mp3 | 20-Apr-2007 00:59 | 10K | |
![[SND]](/icons/sound2.gif) | pedogenetic.mp3 | 20-Apr-2007 00:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | pedogenic.mp3 | 20-Apr-2007 00:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | pedologic.mp3 | 20-Apr-2007 00:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | pedological.mp3 | 20-Apr-2007 00:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedologist.mp3 | 20-Apr-2007 00:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | pedology.mp3 | 20-Apr-2007 00:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | pedometer.mp3 | 20-Apr-2007 00:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | pedomorphism.mp3 | 20-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | pedophile.mp3 | 20-Apr-2007 00:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | pedophilia.mp3 | 20-Apr-2007 00:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedophiliac.mp3 | 20-Apr-2007 00:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | pedophilic.mp3 | 20-Apr-2007 00:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | pedorthic.mp3 | 20-Apr-2007 00:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | pedorthics.mp3 | 20-Apr-2007 00:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | pedorthist.mp3 | 20-Apr-2007 00:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | pedrail.mp3 | 20-Apr-2007 00:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pedro.mp3 | 20-Apr-2007 00:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | pedroi.mp3 | 20-Apr-2007 00:59 | 27K | |
![[SND]](/icons/sound2.gif) | pedrojuancaballero.mp3 | 20-Apr-2007 00:59 | 36K | |
![[SND]](/icons/sound2.gif) | peds.mp3 | 20-Apr-2007 00:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | peduncle.mp3 | 20-Apr-2007 00:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | peduncled.mp3 | 20-Apr-2007 01:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | peduncular.mp3 | 20-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | pedunculate.mp3 | 20-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | pedunculated.mp3 | 20-Apr-2007 01:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | pedway.mp3 | 20-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pee Dee.mp3 | 20-Apr-2007 01:00 | 5.2K | |
![[SND]](/icons/sound2.gif) | pee.mp3 | 20-Apr-2007 01:00 | 4.6K | |
![[SND]](/icons/sound2.gif) | Peebles.mp3 | 20-Apr-2007 01:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | Peeblesshire.mp3 | 20-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | peed.mp3 | 20-Apr-2007 01:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | peedee.mp3 | 20-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | peegeehydrangea.mp3 | 20-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | peejays.mp3 | 20-Apr-2007 01:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | peek.mp3 | 20-Apr-2007 01:00 | 4.3K | |
![[SND]](/icons/sound2.gif) | peekaboo.mp3 | 20-Apr-2007 01:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | peekapoo.mp3 | 20-Apr-2007 01:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | peekskill.mp3 | 20-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | peel.mp3 | 20-Apr-2007 01:00 | 5.5K | |
![[SND]](/icons/sound2.gif) | peelable.mp3 | 20-Apr-2007 01:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | Peele.mp3 | 20-Apr-2007 01:00 | 4.8K | |
![[SND]](/icons/sound2.gif) | peeler.mp3 | 20-Apr-2007 01:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | peeling.mp3 | 20-Apr-2007 01:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | peelite.mp3 | 20-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | peelywayly.mp3 | 20-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | peen.mp3 | 20-Apr-2007 01:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | Peene.mp3 | 20-Apr-2007 01:00 | 5.4K | |
![[SND]](/icons/sound2.gif) | Peenemunde.mp3 | 20-Apr-2007 01:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | peenie.mp3 | 20-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | peep.mp3 | 20-Apr-2007 01:01 | 4.1K | |
![[SND]](/icons/sound2.gif) | peepbo.mp3 | 20-Apr-2007 01:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | peepee.mp3 | 20-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | peeper.mp3 | 20-Apr-2007 01:01 | 5.4K | |
![[SND]](/icons/sound2.gif) | peephole.mp3 | 20-Apr-2007 01:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | Peeping Tom.mp3 | 20-Apr-2007 01:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | Peeping Tomism.mp3 | 20-Apr-2007 01:01 | 11K | |
![[SND]](/icons/sound2.gif) | peepul.mp3 | 20-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | peer.mp3 | 20-Apr-2007 01:01 | 5.0K | |
![[SND]](/icons/sound2.gif) | peerage.mp3 | 20-Apr-2007 01:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | peeress.mp3 | 20-Apr-2007 01:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | peergynt.mp3 | 20-Apr-2007 01:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | peerie.mp3 | 20-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | peerless.mp3 | 20-Apr-2007 01:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | peet.mp3 | 20-Apr-2007 01:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | peeties.mp3 | 20-Apr-2007 01:01 | 17K | |
![[SND]](/icons/sound2.gif) | peetweet.mp3 | 20-Apr-2007 01:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | peeve.mp3 | 20-Apr-2007 01:01 | 5.4K | |
![[SND]](/icons/sound2.gif) | peeved.mp3 | 20-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | peevers.mp3 | 20-Apr-2007 01:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | peevish.mp3 | 20-Apr-2007 01:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | peewee.mp3 | 20-Apr-2007 01:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | peewit.mp3 | 20-Apr-2007 01:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | peezy.mp3 | 20-Apr-2007 01:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | peg top.mp3 | 20-Apr-2007 01:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | peg.mp3 | 20-Apr-2007 01:02 | 5.2K | |
![[SND]](/icons/sound2.gif) | Pegasus.mp3 | 20-Apr-2007 01:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | Peg-Board.mp3 | 20-Apr-2007 01:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | pegged.mp3 | 20-Apr-2007 01:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | peggotty.mp3 | 20-Apr-2007 01:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | peggy.mp3 | 20-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pegmatite.mp3 | 20-Apr-2007 01:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | pegmatitic.mp3 | 20-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pego.mp3 | 20-Apr-2007 01:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | peg-top.mp3 | 20-Apr-2007 01:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | peg-topped.mp3 | 20-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pegu.mp3 | 20-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | peguy.mp3 | 20-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | peh.mp3 | 20-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pehlevi.mp3 | 20-Apr-2007 01:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | PEI.mp3 | 20-Apr-2007 01:02 | 5.2K | |
![[SND]](/icons/sound2.gif) | peiching.mp3 | 20-Apr-2007 01:02 | 17K | |
![[SND]](/icons/sound2.gif) | peignoir.mp3 | 20-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pein.mp3 | 20-Apr-2007 01:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | peine forte et dure.mp3 | 20-Apr-2007 01:02 | 14K | |
![[SND]](/icons/sound2.gif) | peineforteetdure.mp3 | 20-Apr-2007 01:02 | 27K | |
![[SND]](/icons/sound2.gif) | Peiping.mp3 | 20-Apr-2007 01:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | Peipsi.mp3 | 20-Apr-2007 01:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | Peipus.mp3 | 20-Apr-2007 01:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | peiraeus.mp3 | 20-Apr-2007 01:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | peiraievs.mp3 | 20-Apr-2007 01:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | Peirce.mp3 | 20-Apr-2007 01:03 | 5.2K | |
![[SND]](/icons/sound2.gif) | Peircean.mp3 | 20-Apr-2007 01:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | peise.mp3 | 20-Apr-2007 01:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | peisistratus.mp3 | 20-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | pejorate.mp3 | 20-Apr-2007 01:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | pejoration.mp3 | 20-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | pejorative.mp3 | 20-Apr-2007 01:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | pekan.mp3 | 20-Apr-2007 01:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pekanbaru.mp3 | 20-Apr-2007 01:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | peke.mp3 | 20-Apr-2007 01:03 | 4.1K | |
![[SND]](/icons/sound2.gif) | pekepoo.mp3 | 20-Apr-2007 01:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pekin.mp3 | 20-Apr-2007 01:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | Pekinese.mp3 | 20-Apr-2007 01:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | Peking duck.mp3 | 20-Apr-2007 01:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | Peking.mp3 | 20-Apr-2007 01:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | Pekingese.mp3 | 20-Apr-2007 01:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | pekingology.mp3 | 20-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | pekoe.mp3 | 20-Apr-2007 01:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | pelage.mp3 | 20-Apr-2007 01:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pelagian.mp3 | 20-Apr-2007 01:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pelagianism.mp3 | 20-Apr-2007 01:03 | 11K | |
![[SND]](/icons/sound2.gif) | pelagianize.mp3 | 20-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | pelagic.mp3 | 20-Apr-2007 01:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | Pelagie Islands.mp3 | 20-Apr-2007 01:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pelagius.mp3 | 20-Apr-2007 01:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | pelargonic.mp3 | 20-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | pelargonium.mp3 | 20-Apr-2007 01:04 | 10K | |
![[SND]](/icons/sound2.gif) | pelasgi.mp3 | 20-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | Pelasgian.mp3 | 20-Apr-2007 01:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | pelasgis.mp3 | 20-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | pelasgus.mp3 | 20-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | pele.mp3 | 20-Apr-2007 01:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | pelecypod.mp3 | 20-Apr-2007 01:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | Pelee Island.mp3 | 20-Apr-2007 01:04 | 5.9K | |
![[SND]](/icons/sound2.gif) | Pelee, Mount.mp3 | 20-Apr-2007 01:04 | 5.9K | |
![[SND]](/icons/sound2.gif) | pelee.mp3 | 20-Apr-2007 01:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Peleliu.mp3 | 20-Apr-2007 01:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | pelerine.mp3 | 20-Apr-2007 01:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | peleshair.mp3 | 20-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | pelestears.mp3 | 20-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | Peleus.mp3 | 20-Apr-2007 01:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | pelf.mp3 | 20-Apr-2007 01:04 | 4.6K | |
![[SND]](/icons/sound2.gif) | pelham.mp3 | 20-Apr-2007 01:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | pelhamholles.mp3 | 20-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | pelias.mp3 | 20-Apr-2007 01:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | pelican.mp3 | 20-Apr-2007 01:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | pelides.mp3 | 20-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | pelike.mp3 | 20-Apr-2007 01:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pelion.mp3 | 20-Apr-2007 01:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | pelisse.mp3 | 20-Apr-2007 01:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | pelite.mp3 | 20-Apr-2007 01:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pella.mp3 | 20-Apr-2007 01:05 | 5.0K | |
![[SND]](/icons/sound2.gif) | pellagra.mp3 | 20-Apr-2007 01:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | pellagrin.mp3 | 20-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | pellagrous.mp3 | 20-Apr-2007 01:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | pelleasandmelisande.mp3 | 20-Apr-2007 01:05 | 36K | |
![[SND]](/icons/sound2.gif) | pellekar.mp3 | 20-Apr-2007 01:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | pellet.mp3 | 20-Apr-2007 01:05 | 4.8K | |
![[SND]](/icons/sound2.gif) | pelletal.mp3 | 20-Apr-2007 01:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | pelletier.mp3 | 20-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | pelletization.mp3 | 20-Apr-2007 01:05 | 11K | |
![[SND]](/icons/sound2.gif) | pelletize.mp3 | 20-Apr-2007 01:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | pelletizer.mp3 | 20-Apr-2007 01:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | pelletron.mp3 | 20-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | pellets.mp3 | 20-Apr-2007 01:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | pellicle.mp3 | 20-Apr-2007 01:05 | 6.3K | |
![[SND]](/icons/sound2.gif) | pelliot.mp3 | 20-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | pellirobsonchart.mp3 | 20-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | pellitory.mp3 | 20-Apr-2007 01:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | pellmell.mp3 | 20-Apr-2007 01:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | pell-mell.mp3 | 20-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | pellucid.mp3 | 20-Apr-2007 01:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | pellucidly.mp3 | 20-Apr-2007 01:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pelly.mp3 | 20-Apr-2007 01:06 | 5.5K | |
![[SND]](/icons/sound2.gif) | pelmanism.mp3 | 20-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | pelmanize.mp3 | 20-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | pelmeny.mp3 | 20-Apr-2007 01:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | pelmet.mp3 | 20-Apr-2007 01:06 | 5.7K | |
![[SND]](/icons/sound2.gif) | peloid.mp3 | 20-Apr-2007 01:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pelopidas.mp3 | 20-Apr-2007 01:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | Peloponnese.mp3 | 20-Apr-2007 01:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | Peloponnesian.mp3 | 20-Apr-2007 01:06 | 10K | |
![[SND]](/icons/sound2.gif) | peloponnesianwar.mp3 | 20-Apr-2007 01:06 | 27K | |
![[SND]](/icons/sound2.gif) | Peloponnesus.mp3 | 20-Apr-2007 01:06 | 10K | |
![[SND]](/icons/sound2.gif) | Peloponnisos.mp3 | 20-Apr-2007 01:06 | 11K | |
![[SND]](/icons/sound2.gif) | Pelops.mp3 | 20-Apr-2007 01:06 | 6.6K | |
![[SND]](/icons/sound2.gif) | peloria.mp3 | 20-Apr-2007 01:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | pelorize.mp3 | 20-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | pelorus.mp3 | 20-Apr-2007 01:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | pelota.mp3 | 20-Apr-2007 01:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | pelotas.mp3 | 20-Apr-2007 01:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | peloton.mp3 | 20-Apr-2007 01:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | pelt.mp3 | 20-Apr-2007 01:06 | 4.5K | |
![[SND]](/icons/sound2.gif) | pelta.mp3 | 20-Apr-2007 01:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | peltast.mp3 | 20-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | peltate.mp3 | 20-Apr-2007 01:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | pelter.mp3 | 20-Apr-2007 01:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | peltiereffect.mp3 | 20-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | pelting.mp3 | 20-Apr-2007 01:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | peltonwheel.mp3 | 20-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | peltry.mp3 | 20-Apr-2007 01:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | peludo.mp3 | 20-Apr-2007 01:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | pelves.mp3 | 20-Apr-2007 01:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | pelvic.mp3 | 20-Apr-2007 01:07 | 6.1K | |
![[SND]](/icons/sound2.gif) | pelvimetry.mp3 | 20-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | pelvis.mp3 | 20-Apr-2007 01:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | pelvises.mp3 | 20-Apr-2007 01:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | pelycosaur.mp3 | 20-Apr-2007 01:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | pematangsiantar.mp3 | 20-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | Pemba.mp3 | 20-Apr-2007 01:07 | 5.7K | |
![[SND]](/icons/sound2.gif) | pembina.mp3 | 20-Apr-2007 01:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pembroke Pines.mp3 | 20-Apr-2007 01:07 | 12K | |
![[SND]](/icons/sound2.gif) | Pembroke table.mp3 | 20-Apr-2007 01:07 | 10K | |
![[SND]](/icons/sound2.gif) | Pembroke.mp3 | 20-Apr-2007 01:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | pembrokepines.mp3 | 20-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | Pembrokeshire.mp3 | 20-Apr-2007 01:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | pemican.mp3 | 20-Apr-2007 01:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | pemmican.mp3 | 20-Apr-2007 01:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | pemoline.mp3 | 20-Apr-2007 01:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | pemphigus.mp3 | 20-Apr-2007 01:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | pen.mp3 | 20-Apr-2007 01:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | penal.mp3 | 20-Apr-2007 01:07 | 5.7K | |
![[SND]](/icons/sound2.gif) | penalization.mp3 | 20-Apr-2007 01:07 | 10K | |
![[SND]](/icons/sound2.gif) | penalize.mp3 | 20-Apr-2007 01:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | penally.mp3 | 20-Apr-2007 01:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | penalty.mp3 | 20-Apr-2007 01:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | penance.mp3 | 20-Apr-2007 01:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | Penang.mp3 | 20-Apr-2007 01:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | penanglawyer.mp3 | 20-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | penannular.mp3 | 20-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | Penates.mp3 | 20-Apr-2007 01:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | pence.mp3 | 20-Apr-2007 01:08 | 5.7K | |
![[SND]](/icons/sound2.gif) | pencel.mp3 | 20-Apr-2007 01:08 | 5.9K | |
![[SND]](/icons/sound2.gif) | penchant.mp3 | 20-Apr-2007 01:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | penche.mp3 | 20-Apr-2007 01:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pen-ch'i.mp3 | 20-Apr-2007 01:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | pencil.mp3 | 20-Apr-2007 01:08 | 5.9K | |
![[SND]](/icons/sound2.gif) | penciled.mp3 | 20-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | penciliform.mp3 | 20-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | penciling.mp3 | 20-Apr-2007 01:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | pencilling.mp3 | 20-Apr-2007 01:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pend Oreille.mp3 | 20-Apr-2007 01:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | pend.mp3 | 20-Apr-2007 01:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | penda.mp3 | 20-Apr-2007 01:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | pendant.mp3 | 20-Apr-2007 01:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | pendejo.mp3 | 20-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | Pendelikon.mp3 | 20-Apr-2007 01:08 | 10K | |
![[SND]](/icons/sound2.gif) | pendency.mp3 | 20-Apr-2007 01:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | pendent.mp3 | 20-Apr-2007 01:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | pendentelite.mp3 | 20-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | pendentive.mp3 | 20-Apr-2007 01:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | Penderecki.mp3 | 20-Apr-2007 01:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | pending.mp3 | 20-Apr-2007 01:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | pendleton.mp3 | 20-Apr-2007 01:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | pendragon.mp3 | 20-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | pendular.mp3 | 20-Apr-2007 01:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | pendulate.mp3 | 20-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | pendule.mp3 | 20-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | penduline.mp3 | 20-Apr-2007 01:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | pendulous.mp3 | 20-Apr-2007 01:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | pendulum.mp3 | 20-Apr-2007 01:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | pene.mp3 | 20-Apr-2007 01:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | Penedos de Sao Pedro e Sao Paulo.mp3 | 20-Apr-2007 01:09 | 24K | |
![[SND]](/icons/sound2.gif) | peneios.mp3 | 20-Apr-2007 01:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | Penelope.mp3 | 20-Apr-2007 01:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | peneplain.mp3 | 20-Apr-2007 01:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | peneplane.mp3 | 20-Apr-2007 01:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | penes.mp3 | 20-Apr-2007 01:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | penetrability.mp3 | 20-Apr-2007 01:09 | 10K | |
![[SND]](/icons/sound2.gif) | penetrable.mp3 | 20-Apr-2007 01:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | penetralia.mp3 | 20-Apr-2007 01:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | penetralium.mp3 | 20-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | penetrameter.mp3 | 20-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | penetrance.mp3 | 20-Apr-2007 01:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | penetrant.mp3 | 20-Apr-2007 01:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | penetrate.mp3 | 20-Apr-2007 01:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | penetrating.mp3 | 20-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | penetratingly.mp3 | 20-Apr-2007 01:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | penetration.mp3 | 20-Apr-2007 01:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | penetrative.mp3 | 20-Apr-2007 01:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | penetrometer.mp3 | 20-Apr-2007 01:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | Peneus.mp3 | 20-Apr-2007 01:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | pengchong.mp3 | 20-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | pengdehuai.mp3 | 20-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | penghu.mp3 | 20-Apr-2007 01:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | P'eng-hu.mp3 | 20-Apr-2007 01:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | pengo.mp3 | 20-Apr-2007 01:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | pengpu.mp3 | 20-Apr-2007 01:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Peng-pu.mp3 | 20-Apr-2007 01:10 | 10K | |
![[SND]](/icons/sound2.gif) | penguin.mp3 | 20-Apr-2007 01:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | pengzhen.mp3 | 20-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | penhaligons.mp3 | 20-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | penholder.mp3 | 20-Apr-2007 01:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | penhsi.mp3 | 20-Apr-2007 01:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pen-hsi.mp3 | 20-Apr-2007 01:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | penia.mp3 | 20-Apr-2007 01:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | penial.mp3 | 20-Apr-2007 01:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | penicil.mp3 | 20-Apr-2007 01:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | penicillamine.mp3 | 20-Apr-2007 01:10 | 10K | |
![[SND]](/icons/sound2.gif) | penicillate.mp3 | 20-Apr-2007 01:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | penicillia.mp3 | 20-Apr-2007 01:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | penicilliform.mp3 | 20-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | penicillin.mp3 | 20-Apr-2007 01:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | penicillinase.mp3 | 20-Apr-2007 01:11 | 10K | |
![[SND]](/icons/sound2.gif) | penicillium.mp3 | 20-Apr-2007 01:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | penile.mp3 | 20-Apr-2007 01:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | penillion.mp3 | 20-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | peninsula.mp3 | 20-Apr-2007 01:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | peninsular.mp3 | 20-Apr-2007 01:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | peninsulate.mp3 | 20-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | penis.mp3 | 20-Apr-2007 01:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | penitence.mp3 | 20-Apr-2007 01:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | penitent.mp3 | 20-Apr-2007 01:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | penitente.mp3 | 20-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | penitential.mp3 | 20-Apr-2007 01:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | penitentially.mp3 | 20-Apr-2007 01:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | penitentiary.mp3 | 20-Apr-2007 01:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | penknife.mp3 | 20-Apr-2007 01:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | penlight.mp3 | 20-Apr-2007 01:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | penlite.mp3 | 20-Apr-2007 01:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | penman.mp3 | 20-Apr-2007 01:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | penmanship.mp3 | 20-Apr-2007 01:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | Penn.mp3 | 20-Apr-2007 01:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | penna.mp3 | 20-Apr-2007 01:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | pennaceous.mp3 | 20-Apr-2007 01:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | pennant.mp3 | 20-Apr-2007 01:12 | 5.5K | |
![[SND]](/icons/sound2.gif) | pennate.mp3 | 20-Apr-2007 01:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | penne.mp3 | 20-Apr-2007 01:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pennell.mp3 | 20-Apr-2007 01:12 | 4.6K | |
![[SND]](/icons/sound2.gif) | penney.mp3 | 20-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | penni.mp3 | 20-Apr-2007 01:12 | 5.4K | |
![[SND]](/icons/sound2.gif) | pennia.mp3 | 20-Apr-2007 01:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | pennie.mp3 | 20-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | pennies.mp3 | 20-Apr-2007 01:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | penniform.mp3 | 20-Apr-2007 01:12 | 17K | |
![[SND]](/icons/sound2.gif) | penniless.mp3 | 20-Apr-2007 01:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | pennill.mp3 | 20-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pennine Alps.mp3 | 20-Apr-2007 01:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | penninealps.mp3 | 20-Apr-2007 01:12 | 17K | |
![[SND]](/icons/sound2.gif) | penning.mp3 | 20-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | penninite.mp3 | 20-Apr-2007 01:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | pennis.mp3 | 20-Apr-2007 01:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | pennon.mp3 | 20-Apr-2007 01:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | pennoncel.mp3 | 20-Apr-2007 01:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | pennorth.mp3 | 20-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | pennsy.mp3 | 20-Apr-2007 01:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pennsylvania Dutch.mp3 | 20-Apr-2007 01:12 | 12K | |
![[SND]](/icons/sound2.gif) | Pennsylvania.mp3 | 20-Apr-2007 01:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | Pennsylvanian.mp3 | 20-Apr-2007 01:12 | 10K | |
![[SND]](/icons/sound2.gif) | penny.mp3 | 20-Apr-2007 01:13 | 5.2K | |
![[SND]](/icons/sound2.gif) | penny-ante.mp3 | 20-Apr-2007 01:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | pennycress.mp3 | 20-Apr-2007 01:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | penny-pincher.mp3 | 20-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | penny-pinching.mp3 | 20-Apr-2007 01:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | pennyroyal.mp3 | 20-Apr-2007 01:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | pennyweight.mp3 | 20-Apr-2007 01:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | pennywhistle.mp3 | 20-Apr-2007 01:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | penny-wise.mp3 | 20-Apr-2007 01:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | pennywort.mp3 | 20-Apr-2007 01:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | pennyworth.mp3 | 20-Apr-2007 01:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | pennzoil.mp3 | 20-Apr-2007 01:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | Penobscot.mp3 | 20-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | penological.mp3 | 20-Apr-2007 01:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | penologist.mp3 | 20-Apr-2007 01:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | penology.mp3 | 20-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | penoncel.mp3 | 20-Apr-2007 01:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | Penrhyn.mp3 | 20-Apr-2007 01:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | penrith.mp3 | 20-Apr-2007 01:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | Penrose.mp3 | 20-Apr-2007 01:13 | 9.6K | |
![[SND]](/icons/sound2.gif) | Pensacola.mp3 | 20-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | pensee.mp3 | 20-Apr-2007 01:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | penshurstplace.mp3 | 20-Apr-2007 01:13 | 17K | |
![[SND]](/icons/sound2.gif) | pensil.mp3 | 20-Apr-2007 01:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | pensile.mp3 | 20-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | pension.mp3 | 20-Apr-2007 01:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | pensionable.mp3 | 20-Apr-2007 01:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pensionary.mp3 | 20-Apr-2007 01:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | pensione.mp3 | 20-Apr-2007 01:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | pensioneertrustee.mp3 | 20-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | pensioner.mp3 | 20-Apr-2007 01:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | pensioning.mp3 | 20-Apr-2007 01:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | pensionless.mp3 | 20-Apr-2007 01:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | pensive.mp3 | 20-Apr-2007 01:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | penstemon.mp3 | 20-Apr-2007 01:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | penster.mp3 | 20-Apr-2007 01:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | penstock.mp3 | 20-Apr-2007 01:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | pent.mp3 | 20-Apr-2007 01:14 | 4.6K | |
![[SND]](/icons/sound2.gif) | penta.mp3 | 20-Apr-2007 01:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pentachlorophenol.mp3 | 20-Apr-2007 01:14 | 12K | |
![[SND]](/icons/sound2.gif) | pentachord.mp3 | 20-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | pentacle.mp3 | 20-Apr-2007 01:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | pentad.mp3 | 20-Apr-2007 01:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | pentadactyl.mp3 | 20-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | pentagon.mp3 | 20-Apr-2007 01:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | pentagonal.mp3 | 20-Apr-2007 01:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | pentagonally.mp3 | 20-Apr-2007 01:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | Pentagonese.mp3 | 20-Apr-2007 01:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | pentagonoid.mp3 | 20-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | pentagram.mp3 | 20-Apr-2007 01:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | pentagynous.mp3 | 20-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | pentahedral.mp3 | 20-Apr-2007 01:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | pentahedron.mp3 | 20-Apr-2007 01:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | pentalogy.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentalpha.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentameronthe.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentamerous.mp3 | 20-Apr-2007 01:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | pentameter.mp3 | 20-Apr-2007 01:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | pentamidine.mp3 | 20-Apr-2007 01:15 | 10K | |
![[SND]](/icons/sound2.gif) | pentandrous.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentane.mp3 | 20-Apr-2007 01:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | pentangle.mp3 | 20-Apr-2007 01:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | pentangular.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentanoicacid.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentanol.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentapeptide.mp3 | 20-Apr-2007 01:15 | 10K | |
![[SND]](/icons/sound2.gif) | pentaploid.mp3 | 20-Apr-2007 01:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | pentaploidy.mp3 | 20-Apr-2007 01:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | pentapody.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | Pentapolis.mp3 | 20-Apr-2007 01:15 | 10K | |
![[SND]](/icons/sound2.gif) | pentaptych.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentaquine.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentarchy.mp3 | 20-Apr-2007 01:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | pentastich.mp3 | 20-Apr-2007 01:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | pentastomid.mp3 | 20-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | pentastyle.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | pentastylos.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | Pentateuch.mp3 | 20-Apr-2007 01:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | pentathlete.mp3 | 20-Apr-2007 01:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | pentathlon.mp3 | 20-Apr-2007 01:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | pentatomic.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | pentatonic.mp3 | 20-Apr-2007 01:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | pentatonism.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | pentavalent.mp3 | 20-Apr-2007 01:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | pentazocine.mp3 | 20-Apr-2007 01:16 | 11K | |
![[SND]](/icons/sound2.gif) | Pentecost.mp3 | 20-Apr-2007 01:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pentecostal.mp3 | 20-Apr-2007 01:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pentecostalism.mp3 | 20-Apr-2007 01:16 | 10K | |
![[SND]](/icons/sound2.gif) | Pentecostalist.mp3 | 20-Apr-2007 01:16 | 11K | |
![[SND]](/icons/sound2.gif) | pentecostarion.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | pentelicus.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | pentelikon.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | pentene.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | penthesilea.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | pentheus.mp3 | 20-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | penthouse.mp3 | 20-Apr-2007 01:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | Penticton.mp3 | 20-Apr-2007 01:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | pentimenti.mp3 | 20-Apr-2007 01:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | pentimento.mp3 | 20-Apr-2007 01:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | Pentland Firth.mp3 | 20-Apr-2007 01:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | pentlandfirth.mp3 | 20-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | pentlandite.mp3 | 20-Apr-2007 01:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | pentobarbital.mp3 | 20-Apr-2007 01:17 | 11K | |
![[SND]](/icons/sound2.gif) | pentobarbitone.mp3 | 20-Apr-2007 01:17 | 11K | |
![[SND]](/icons/sound2.gif) | pentode.mp3 | 20-Apr-2007 01:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | pentolite.mp3 | 20-Apr-2007 01:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | pentomic.mp3 | 20-Apr-2007 01:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | pentomino.mp3 | 20-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | penton.mp3 | 20-Apr-2007 01:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | pentonvilleprison.mp3 | 20-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | pentosan.mp3 | 20-Apr-2007 01:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | pentose.mp3 | 20-Apr-2007 01:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | pentoside.mp3 | 20-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | Pentothal.mp3 | 20-Apr-2007 01:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | pentoxide.mp3 | 20-Apr-2007 01:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | pentstemon.mp3 | 20-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | penturbia.mp3 | 20-Apr-2007 01:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | pentyl.mp3 | 20-Apr-2007 01:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | pentylenetetrazol.mp3 | 20-Apr-2007 01:17 | 13K | |
![[SND]](/icons/sound2.gif) | penuche.mp3 | 20-Apr-2007 01:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | penuchle.mp3 | 20-Apr-2007 01:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | Penuelas.mp3 | 20-Apr-2007 01:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | penult.mp3 | 20-Apr-2007 01:17 | 5.7K | |
![[SND]](/icons/sound2.gif) | penultima.mp3 | 20-Apr-2007 01:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | penultimate.mp3 | 20-Apr-2007 01:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | penumbra.mp3 | 20-Apr-2007 01:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | penumbrae.mp3 | 20-Apr-2007 01:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | penumbral.mp3 | 20-Apr-2007 01:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | penurious.mp3 | 20-Apr-2007 01:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | penury.mp3 | 20-Apr-2007 01:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | penutian.mp3 | 20-Apr-2007 01:18 | 17K | |
![[SND]](/icons/sound2.gif) | penyen.mp3 | 20-Apr-2007 01:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | Penza.mp3 | 20-Apr-2007 01:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | Penzance.mp3 | 20-Apr-2007 01:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | Penzhina.mp3 | 20-Apr-2007 01:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | Penzhinskaya.mp3 | 20-Apr-2007 01:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | Penzias.mp3 | 20-Apr-2007 01:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | peo.mp3 | 20-Apr-2007 01:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | peola.mp3 | 20-Apr-2007 01:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | peon.mp3 | 20-Apr-2007 01:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | peonage.mp3 | 20-Apr-2007 01:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | peones.mp3 | 20-Apr-2007 01:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | peonied.mp3 | 20-Apr-2007 01:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | peony.mp3 | 20-Apr-2007 01:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | people.mp3 | 20-Apr-2007 01:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | peoplehood.mp3 | 20-Apr-2007 01:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | peopleless.mp3 | 20-Apr-2007 01:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | peopling.mp3 | 20-Apr-2007 01:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | Peoria.mp3 | 20-Apr-2007 01:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | pep.mp3 | 20-Apr-2007 01:18 | 3.9K | |
![[SND]](/icons/sound2.gif) | pepelemoko.mp3 | 20-Apr-2007 01:19 | 17K | |
![[SND]](/icons/sound2.gif) | pepelopez.mp3 | 20-Apr-2007 01:19 | 17K | |
![[SND]](/icons/sound2.gif) | peperino.mp3 | 20-Apr-2007 01:19 | 17K | |
![[SND]](/icons/sound2.gif) | peperomia.mp3 | 20-Apr-2007 01:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | peperoni.mp3 | 20-Apr-2007 01:19 | 17K | |
![[SND]](/icons/sound2.gif) | Pepin III.mp3 | 20-Apr-2007 01:19 | 5.5K | |
![[SND]](/icons/sound2.gif) | Pepin, Lake.mp3 | 20-Apr-2007 01:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | pepin.mp3 | 20-Apr-2007 01:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | pepino.mp3 | 20-Apr-2007 01:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | pepita.mp3 | 20-Apr-2007 01:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | peplos.mp3 | 20-Apr-2007 01:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | peplum.mp3 | 20-Apr-2007 01:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | peplumed.mp3 | 20-Apr-2007 01:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | peplus.mp3 | 20-Apr-2007 01:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | pepo.mp3 | 20-Apr-2007 01:19 | 5.9K | |
![[SND]](/icons/sound2.gif) | pepped.mp3 | 20-Apr-2007 01:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | pepper.mp3 | 20-Apr-2007 01:19 | 5.7K | |
![[SND]](/icons/sound2.gif) | pepper-and-salt.mp3 | 20-Apr-2007 01:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | pepperbox.mp3 | 20-Apr-2007 01:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | peppercorn.mp3 | 20-Apr-2007 01:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | pepperer.mp3 | 20-Apr-2007 01:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | peppergrass.mp3 | 20-Apr-2007 01:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | pepperidge.mp3 | 20-Apr-2007 01:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | pepperiness.mp3 | 20-Apr-2007 01:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | peppering.mp3 | 20-Apr-2007 01:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | peppermint.mp3 | 20-Apr-2007 01:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | pepperminty.mp3 | 20-Apr-2007 01:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | pepperoni.mp3 | 20-Apr-2007 01:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | peppershrike.mp3 | 20-Apr-2007 01:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | peppertree.mp3 | 20-Apr-2007 01:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | pepperwort.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | peppery.mp3 | 20-Apr-2007 01:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | peppy.mp3 | 20-Apr-2007 01:20 | 5.7K | |
![[SND]](/icons/sound2.gif) | pepsi.mp3 | 20-Apr-2007 01:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | pepsico.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | pepsicola.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | pepsification.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | pepsin.mp3 | 20-Apr-2007 01:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | pepsinate.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | pepsinogen.mp3 | 20-Apr-2007 01:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | pepsodent.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | pepstatin.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | peptic.mp3 | 20-Apr-2007 01:20 | 5.5K | |
![[SND]](/icons/sound2.gif) | peptidase.mp3 | 20-Apr-2007 01:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | peptide.mp3 | 20-Apr-2007 01:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | peptidic.mp3 | 20-Apr-2007 01:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | peptidoglycan.mp3 | 20-Apr-2007 01:20 | 13K | |
![[SND]](/icons/sound2.gif) | peptidolytic.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | peptize.mp3 | 20-Apr-2007 01:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | peptobismol.mp3 | 20-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | peptolytic.mp3 | 20-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | peptone.mp3 | 20-Apr-2007 01:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | peptonize.mp3 | 20-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | Pepys.mp3 | 20-Apr-2007 01:21 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pepysian.mp3 | 20-Apr-2007 01:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | pequiste.mp3 | 20-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | pequod.mp3 | 20-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | Pequot.mp3 | 20-Apr-2007 01:21 | 6.4K | |
![[SND]](/icons/sound2.gif) | per angusta ad augusta.mp3 | 20-Apr-2007 01:21 | 22K | |
![[SND]](/icons/sound2.gif) | per annum.mp3 | 20-Apr-2007 01:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | per capita.mp3 | 20-Apr-2007 01:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | per cent.mp3 | 20-Apr-2007 01:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | per centum.mp3 | 20-Apr-2007 01:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | per contra.mp3 | 20-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | per curiam.mp3 | 20-Apr-2007 01:21 | 10K | |
![[SND]](/icons/sound2.gif) | per diem.mp3 | 20-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | per mensem.mp3 | 20-Apr-2007 01:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | per mill.mp3 | 20-Apr-2007 01:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | per se.mp3 | 20-Apr-2007 01:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | per stirpes.mp3 | 20-Apr-2007 01:21 | 10K | |
![[SND]](/icons/sound2.gif) | per.mp3 | 20-Apr-2007 01:21 | 5.2K | |
![[SND]](/icons/sound2.gif) | Pera.mp3 | 20-Apr-2007 01:21 | 4.6K | |
![[SND]](/icons/sound2.gif) | peracid.mp3 | 20-Apr-2007 01:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | peradventure.mp3 | 20-Apr-2007 01:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | peraea.mp3 | 20-Apr-2007 01:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | perai.mp3 | 20-Apr-2007 01:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | Perak.mp3 | 20-Apr-2007 01:22 | 4.5K | |
![[SND]](/icons/sound2.gif) | perambulate.mp3 | 20-Apr-2007 01:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | perambulation.mp3 | 20-Apr-2007 01:22 | 11K | |
![[SND]](/icons/sound2.gif) | perambulator.mp3 | 20-Apr-2007 01:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | perambulatory.mp3 | 20-Apr-2007 01:22 | 11K | |
![[SND]](/icons/sound2.gif) | perangustaadaugusta.mp3 | 20-Apr-2007 01:22 | 45K | |
![[SND]](/icons/sound2.gif) | perannum.mp3 | 20-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | perarduaadastra.mp3 | 20-Apr-2007 01:22 | 36K | |
![[SND]](/icons/sound2.gif) | perborate.mp3 | 20-Apr-2007 01:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | perborax.mp3 | 20-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | perboricacid.mp3 | 20-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | perbromate.mp3 | 20-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | perbromicacid.mp3 | 20-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | perbunan.mp3 | 20-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | perc.mp3 | 20-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | percale.mp3 | 20-Apr-2007 01:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | percaline.mp3 | 20-Apr-2007 01:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | percapita.mp3 | 20-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | perceivable.mp3 | 20-Apr-2007 01:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | perceivably.mp3 | 20-Apr-2007 01:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | perceive.mp3 | 20-Apr-2007 01:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | percent.mp3 | 20-Apr-2007 01:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | percentage.mp3 | 20-Apr-2007 01:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | percenter.mp3 | 20-Apr-2007 01:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | percentile.mp3 | 20-Apr-2007 01:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | percentum.mp3 | 20-Apr-2007 01:23 | 17K | |
![[SND]](/icons/sound2.gif) | percept.mp3 | 20-Apr-2007 01:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | perceptibility.mp3 | 20-Apr-2007 01:23 | 11K | |
![[SND]](/icons/sound2.gif) | perceptible.mp3 | 20-Apr-2007 01:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | perceptibly.mp3 | 20-Apr-2007 01:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | perception.mp3 | 20-Apr-2007 01:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | perceptional.mp3 | 20-Apr-2007 01:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | perceptive.mp3 | 20-Apr-2007 01:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | perceptivity.mp3 | 20-Apr-2007 01:23 | 10K | |
![[SND]](/icons/sound2.gif) | perceptual.mp3 | 20-Apr-2007 01:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | Perceval.mp3 | 20-Apr-2007 01:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | perch.mp3 | 20-Apr-2007 01:23 | 5.4K | |
![[SND]](/icons/sound2.gif) | perchance.mp3 | 20-Apr-2007 01:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | perche.mp3 | 20-Apr-2007 01:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | percher.mp3 | 20-Apr-2007 01:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | Percheron.mp3 | 20-Apr-2007 01:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | perchery.mp3 | 20-Apr-2007 01:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | perchlorate.mp3 | 20-Apr-2007 01:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | perchloric acid.mp3 | 20-Apr-2007 01:23 | 11K | |
![[SND]](/icons/sound2.gif) | perchloric.mp3 | 20-Apr-2007 01:23 | 17K | |
![[SND]](/icons/sound2.gif) | perchloride.mp3 | 20-Apr-2007 01:23 | 17K | |
![[SND]](/icons/sound2.gif) | perchlorinate.mp3 | 20-Apr-2007 01:23 | 17K | |
![[SND]](/icons/sound2.gif) | perchloro.mp3 | 20-Apr-2007 01:23 | 17K | |
![[SND]](/icons/sound2.gif) | perchloroethylene.mp3 | 20-Apr-2007 01:24 | 13K | |
![[SND]](/icons/sound2.gif) | perchromicacid.mp3 | 20-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | perchta.mp3 | 20-Apr-2007 01:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | perciatelli.mp3 | 20-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | percipience.mp3 | 20-Apr-2007 01:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | percipient.mp3 | 20-Apr-2007 01:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | percival.mp3 | 20-Apr-2007 01:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | perclose.mp3 | 20-Apr-2007 01:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | percodan.mp3 | 20-Apr-2007 01:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | percoid.mp3 | 20-Apr-2007 01:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | percolate.mp3 | 20-Apr-2007 01:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | percolation.mp3 | 20-Apr-2007 01:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | percolator.mp3 | 20-Apr-2007 01:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | percontra.mp3 | 20-Apr-2007 01:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | percuriam.mp3 | 20-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | percurrent.mp3 | 20-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | percuss.mp3 | 20-Apr-2007 01:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | percussion.mp3 | 20-Apr-2007 01:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | percussionist.mp3 | 20-Apr-2007 01:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | percussive.mp3 | 20-Apr-2007 01:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | percussor.mp3 | 20-Apr-2007 01:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | percutaneous.mp3 | 20-Apr-2007 01:24 | 10K | |
![[SND]](/icons/sound2.gif) | Percy.mp3 | 20-Apr-2007 01:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | perdendosi.mp3 | 20-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | Perdido.mp3 | 20-Apr-2007 01:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | perdie.mp3 | 20-Apr-2007 01:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | perdiem.mp3 | 20-Apr-2007 01:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | perdita.mp3 | 20-Apr-2007 01:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | perdition.mp3 | 20-Apr-2007 01:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | perdreau.mp3 | 20-Apr-2007 01:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | perdrix.mp3 | 20-Apr-2007 01:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | perdu.mp3 | 20-Apr-2007 01:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | perdue.mp3 | 20-Apr-2007 01:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | perdurability.mp3 | 20-Apr-2007 01:25 | 11K | |
![[SND]](/icons/sound2.gif) | perdurable.mp3 | 20-Apr-2007 01:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | perdurably.mp3 | 20-Apr-2007 01:25 | 10K | |
![[SND]](/icons/sound2.gif) | perdure.mp3 | 20-Apr-2007 01:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | pere.mp3 | 20-Apr-2007 01:25 | 5.2K | |
![[SND]](/icons/sound2.gif) | Perea.mp3 | 20-Apr-2007 01:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | pereant qui ante nos nostra dixerunt.mp3 | 20-Apr-2007 01:25 | 29K | |
![[SND]](/icons/sound2.gif) | peredavidsdeer.mp3 | 20-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | peregrinate.mp3 | 20-Apr-2007 01:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | peregrination.mp3 | 20-Apr-2007 01:25 | 11K | |
![[SND]](/icons/sound2.gif) | peregrine.mp3 | 20-Apr-2007 01:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | pereion.mp3 | 20-Apr-2007 01:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | pereiopod.mp3 | 20-Apr-2007 01:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | pereira.mp3 | 20-Apr-2007 01:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | pereirabark.mp3 | 20-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | pereirine.mp3 | 20-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | Perelman.mp3 | 20-Apr-2007 01:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | peremptorily.mp3 | 20-Apr-2007 01:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | peremptoriness.mp3 | 20-Apr-2007 01:26 | 10K | |
![[SND]](/icons/sound2.gif) | peremptory.mp3 | 20-Apr-2007 01:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | perendale.mp3 | 20-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | perennate.mp3 | 20-Apr-2007 01:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | perennation.mp3 | 20-Apr-2007 01:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | perennial.mp3 | 20-Apr-2007 01:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | perennially.mp3 | 20-Apr-2007 01:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | perennity.mp3 | 20-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | perentie.mp3 | 20-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | pereon.mp3 | 20-Apr-2007 01:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | pereonite.mp3 | 20-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | pereopod.mp3 | 20-Apr-2007 01:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | Peres.mp3 | 20-Apr-2007 01:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | perestroika.mp3 | 20-Apr-2007 01:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | peretz.mp3 | 20-Apr-2007 01:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | pereunt et imputantur.mp3 | 20-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | Perez de Cuellar.mp3 | 20-Apr-2007 01:26 | 13K | |
![[SND]](/icons/sound2.gif) | Perez Galdos.mp3 | 20-Apr-2007 01:26 | 12K | |
![[SND]](/icons/sound2.gif) | Perez Rodriguez.mp3 | 20-Apr-2007 01:26 | 13K | |
![[SND]](/icons/sound2.gif) | perezdecuellar.mp3 | 20-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | perezgaldos.mp3 | 20-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | perfboard.mp3 | 20-Apr-2007 01:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | perfect.mp3 | 20-Apr-2007 01:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | perfecta.mp3 | 20-Apr-2007 01:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | perfect-bound.mp3 | 20-Apr-2007 01:27 | 9.6K | |
![[SND]](/icons/sound2.gif) | perfecter.mp3 | 20-Apr-2007 01:27 | 17K | |
![[SND]](/icons/sound2.gif) | perfectibility.mp3 | 20-Apr-2007 01:27 | 11K | |
![[SND]](/icons/sound2.gif) | perfectible.mp3 | 20-Apr-2007 01:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | perfection.mp3 | 20-Apr-2007 01:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | perfectionism.mp3 | 20-Apr-2007 01:27 | 11K | |
![[SND]](/icons/sound2.gif) | perfectionist.mp3 | 20-Apr-2007 01:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | perfectionistic.mp3 | 20-Apr-2007 01:27 | 10K | |
![[SND]](/icons/sound2.gif) | perfective.mp3 | 20-Apr-2007 01:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | perfectivity.mp3 | 20-Apr-2007 01:27 | 10K | |
![[SND]](/icons/sound2.gif) | perfectivize.mp3 | 20-Apr-2007 01:27 | 17K | |
![[SND]](/icons/sound2.gif) | perfectly.mp3 | 20-Apr-2007 01:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | perfectness.mp3 | 20-Apr-2007 01:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | perfecto.mp3 | 20-Apr-2007 01:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | perfector.mp3 | 20-Apr-2007 01:27 | 17K | |
![[SND]](/icons/sound2.gif) | perfervid.mp3 | 20-Apr-2007 01:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | perfide Albion.mp3 | 20-Apr-2007 01:27 | 12K | |
![[SND]](/icons/sound2.gif) | perfidealbion.mp3 | 20-Apr-2007 01:27 | 17K | |
![[SND]](/icons/sound2.gif) | perfidious.mp3 | 20-Apr-2007 01:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | perfidy.mp3 | 20-Apr-2007 01:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | perfin.mp3 | 20-Apr-2007 01:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | perfluorocarbon.mp3 | 20-Apr-2007 01:27 | 12K | |
![[SND]](/icons/sound2.gif) | perfluorochemical.mp3 | 20-Apr-2007 01:27 | 17K | |
![[SND]](/icons/sound2.gif) | perfoliate.mp3 | 20-Apr-2007 01:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | perforate.mp3 | 20-Apr-2007 01:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | perforated.mp3 | 20-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | perforation.mp3 | 20-Apr-2007 01:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | perforator.mp3 | 20-Apr-2007 01:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | perforce.mp3 | 20-Apr-2007 01:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | perform.mp3 | 20-Apr-2007 01:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | performability.mp3 | 20-Apr-2007 01:28 | 11K | |
![[SND]](/icons/sound2.gif) | performable.mp3 | 20-Apr-2007 01:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | performance.mp3 | 20-Apr-2007 01:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | performative.mp3 | 20-Apr-2007 01:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | performatory.mp3 | 20-Apr-2007 01:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | performer.mp3 | 20-Apr-2007 01:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | performing.mp3 | 20-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | perfume.mp3 | 20-Apr-2007 01:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | perfumer.mp3 | 20-Apr-2007 01:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | perfumery.mp3 | 20-Apr-2007 01:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | perfunctorily.mp3 | 20-Apr-2007 01:28 | 10K | |
![[SND]](/icons/sound2.gif) | perfunctoriness.mp3 | 20-Apr-2007 01:28 | 11K | |
![[SND]](/icons/sound2.gif) | perfunctory.mp3 | 20-Apr-2007 01:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | perfusate.mp3 | 20-Apr-2007 01:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | perfuse.mp3 | 20-Apr-2007 01:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | perfusion.mp3 | 20-Apr-2007 01:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | perfusionist.mp3 | 20-Apr-2007 01:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | Perga.mp3 | 20-Apr-2007 01:28 | 5.2K | |
![[SND]](/icons/sound2.gif) | pergameneous.mp3 | 20-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | Pergamos.mp3 | 20-Apr-2007 01:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pergamum.mp3 | 20-Apr-2007 01:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | Pergamus.mp3 | 20-Apr-2007 01:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | pergana.mp3 | 20-Apr-2007 01:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | pergelisol.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | pergola.mp3 | 20-Apr-2007 01:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pergolesi.mp3 | 20-Apr-2007 01:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | pergonal.mp3 | 20-Apr-2007 01:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | pergunnah.mp3 | 20-Apr-2007 01:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | perhaps.mp3 | 20-Apr-2007 01:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | perhydrogenate.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | perhydrogenize.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | peri.mp3 | 20-Apr-2007 01:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | periagua.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | periander.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | perianth.mp3 | 20-Apr-2007 01:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | periapsis.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | periapt.mp3 | 20-Apr-2007 01:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | periarteritisnodosa.mp3 | 20-Apr-2007 01:29 | 18K | |
![[SND]](/icons/sound2.gif) | periastron.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | periblem.mp3 | 20-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | pericardia.mp3 | 20-Apr-2007 01:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | pericardial.mp3 | 20-Apr-2007 01:29 | 9.6K | |
![[SND]](/icons/sound2.gif) | pericarditis.mp3 | 20-Apr-2007 01:29 | 11K | |
![[SND]](/icons/sound2.gif) | pericardium.mp3 | 20-Apr-2007 01:29 | 10K | |
![[SND]](/icons/sound2.gif) | pericarp.mp3 | 20-Apr-2007 01:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | pericementum.mp3 | 20-Apr-2007 01:30 | 17K | |
![[SND]](/icons/sound2.gif) | perichaetium.mp3 | 20-Apr-2007 01:30 | 17K | |
![[SND]](/icons/sound2.gif) | perichondral.mp3 | 20-Apr-2007 01:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | perichondria.mp3 | 20-Apr-2007 01:30 | 10K | |
![[SND]](/icons/sound2.gif) | perichondrium.mp3 | 20-Apr-2007 01:30 | 11K | |
![[SND]](/icons/sound2.gif) | periclase.mp3 | 20-Apr-2007 01:30 | 17K | |
![[SND]](/icons/sound2.gif) | Periclean.mp3 | 20-Apr-2007 01:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pericles.mp3 | 20-Apr-2007 01:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | periclinal.mp3 | 20-Apr-2007 01:30 | 17K | |
![[SND]](/icons/sound2.gif) | pericline.mp3 | 20-Apr-2007 01:30 | 17K | |
![[SND]](/icons/sound2.gif) | pericope.mp3 | 20-Apr-2007 01:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | pericrania.mp3 | 20-Apr-2007 01:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | pericranial.mp3 | 20-Apr-2007 01:30 | 10K | |
![[SND]](/icons/sound2.gif) | pericranium.mp3 | 20-Apr-2007 01:30 | 10K | |
![[SND]](/icons/sound2.gif) | pericycle.mp3 | 20-Apr-2007 01:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | pericyclic.mp3 | 20-Apr-2007 01:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | pericynthion.mp3 | 20-Apr-2007 01:30 | 17K | |
![[SND]](/icons/sound2.gif) | periderm.mp3 | 20-Apr-2007 01:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | peridia.mp3 | 20-Apr-2007 01:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | peridium.mp3 | 20-Apr-2007 01:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | peridot.mp3 | 20-Apr-2007 01:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | peridotic.mp3 | 20-Apr-2007 01:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | peridotite.mp3 | 20-Apr-2007 01:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | peridotitic.mp3 | 20-Apr-2007 01:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | perigean.mp3 | 20-Apr-2007 01:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | perigeantide.mp3 | 20-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | perigee.mp3 | 20-Apr-2007 01:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | perigon.mp3 | 20-Apr-2007 01:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | perigonium.mp3 | 20-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | Perigord.mp3 | 20-Apr-2007 01:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | perigordian.mp3 | 20-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | Perigueux.mp3 | 20-Apr-2007 01:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | perigynous.mp3 | 20-Apr-2007 01:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | perigyny.mp3 | 20-Apr-2007 01:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | perihelia.mp3 | 20-Apr-2007 01:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | perihelial.mp3 | 20-Apr-2007 01:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | perihelion.mp3 | 20-Apr-2007 01:31 | 10K | |
![[SND]](/icons/sound2.gif) | perikarya.mp3 | 20-Apr-2007 01:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | perikaryal.mp3 | 20-Apr-2007 01:31 | 10K | |
![[SND]](/icons/sound2.gif) | perikaryon.mp3 | 20-Apr-2007 01:31 | 11K | |
![[SND]](/icons/sound2.gif) | peril.mp3 | 20-Apr-2007 01:31 | 5.5K | |
![[SND]](/icons/sound2.gif) | perilla.mp3 | 20-Apr-2007 01:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | perilous.mp3 | 20-Apr-2007 01:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | perilune.mp3 | 20-Apr-2007 01:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | perilymph.mp3 | 20-Apr-2007 01:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | Perim.mp3 | 20-Apr-2007 01:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | perimenopausal.mp3 | 20-Apr-2007 01:31 | 12K | |
![[SND]](/icons/sound2.gif) | perimenopause.mp3 | 20-Apr-2007 01:31 | 11K | |
![[SND]](/icons/sound2.gif) | perimeter.mp3 | 20-Apr-2007 01:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | perimorph.mp3 | 20-Apr-2007 01:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | perimpossibile.mp3 | 20-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | perimysia.mp3 | 20-Apr-2007 01:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | perimysium.mp3 | 20-Apr-2007 01:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | perinatal.mp3 | 20-Apr-2007 01:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | perinatally.mp3 | 20-Apr-2007 01:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | perinatologist.mp3 | 20-Apr-2007 01:32 | 13K | |
![[SND]](/icons/sound2.gif) | perinatology.mp3 | 20-Apr-2007 01:32 | 11K | |
![[SND]](/icons/sound2.gif) | perincuriam.mp3 | 20-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | perinde.mp3 | 20-Apr-2007 01:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | perinea.mp3 | 20-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | perineal.mp3 | 20-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | perinephrium.mp3 | 20-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | perineum.mp3 | 20-Apr-2007 01:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | perineuria.mp3 | 20-Apr-2007 01:32 | 9.6K | |
![[SND]](/icons/sound2.gif) | perineurium.mp3 | 20-Apr-2007 01:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | period.mp3 | 20-Apr-2007 01:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | periodate.mp3 | 20-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | periodic acid.mp3 | 20-Apr-2007 01:32 | 13K | |
![[SND]](/icons/sound2.gif) | periodic.mp3 | 20-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | periodicacid.mp3 | 20-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | periodical.mp3 | 20-Apr-2007 01:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | periodically.mp3 | 20-Apr-2007 01:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | periodicdecimal.mp3 | 20-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | periodicfunction.mp3 | 20-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | periodicity.mp3 | 20-Apr-2007 01:32 | 10K | |
![[SND]](/icons/sound2.gif) | periodiclaw.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | periodicmotion.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | periodicsentence.mp3 | 20-Apr-2007 01:33 | 18K | |
![[SND]](/icons/sound2.gif) | periodicsystem.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | periodictable.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | periodide.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | periodization.mp3 | 20-Apr-2007 01:33 | 12K | |
![[SND]](/icons/sound2.gif) | periodontal.mp3 | 20-Apr-2007 01:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | periodontally.mp3 | 20-Apr-2007 01:33 | 10K | |
![[SND]](/icons/sound2.gif) | periodontics.mp3 | 20-Apr-2007 01:33 | 11K | |
![[SND]](/icons/sound2.gif) | periodontist.mp3 | 20-Apr-2007 01:33 | 11K | |
![[SND]](/icons/sound2.gif) | periodontitis.mp3 | 20-Apr-2007 01:33 | 12K | |
![[SND]](/icons/sound2.gif) | periodontium.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | periodontology.mp3 | 20-Apr-2007 01:33 | 13K | |
![[SND]](/icons/sound2.gif) | periodontosis.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | perioeci.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | perionychia.mp3 | 20-Apr-2007 01:33 | 11K | |
![[SND]](/icons/sound2.gif) | perionychium.mp3 | 20-Apr-2007 01:33 | 11K | |
![[SND]](/icons/sound2.gif) | perioperative.mp3 | 20-Apr-2007 01:33 | 11K | |
![[SND]](/icons/sound2.gif) | periostea.mp3 | 20-Apr-2007 01:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | periosteal.mp3 | 20-Apr-2007 01:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | periosteum.mp3 | 20-Apr-2007 01:33 | 9.8K | |
![[SND]](/icons/sound2.gif) | periostitis.mp3 | 20-Apr-2007 01:33 | 11K | |
![[SND]](/icons/sound2.gif) | periostracum.mp3 | 20-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | periotic.mp3 | 20-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | peripatetic.mp3 | 20-Apr-2007 01:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | peripatetically.mp3 | 20-Apr-2007 01:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | Peripateticism.mp3 | 20-Apr-2007 01:34 | 12K | |
![[SND]](/icons/sound2.gif) | peripatus.mp3 | 20-Apr-2007 01:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | peripeteia.mp3 | 20-Apr-2007 01:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | peripety.mp3 | 20-Apr-2007 01:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | peripherad.mp3 | 20-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | peripheral.mp3 | 20-Apr-2007 01:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | peripheralism.mp3 | 20-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | peripheric.mp3 | 20-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | periphery.mp3 | 20-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | periphrases.mp3 | 20-Apr-2007 01:34 | 10K | |
![[SND]](/icons/sound2.gif) | periphrasis.mp3 | 20-Apr-2007 01:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | periphrastic.mp3 | 20-Apr-2007 01:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | periphrastically.mp3 | 20-Apr-2007 01:34 | 11K | |
![[SND]](/icons/sound2.gif) | periphytic.mp3 | 20-Apr-2007 01:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | periphyton.mp3 | 20-Apr-2007 01:34 | 9.5K | |
![[SND]](/icons/sound2.gif) | periplasm.mp3 | 20-Apr-2007 01:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | periplasmic.mp3 | 20-Apr-2007 01:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | periplast.mp3 | 20-Apr-2007 01:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | periplus.mp3 | 20-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | periproct.mp3 | 20-Apr-2007 01:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | peripteral.mp3 | 20-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | periptery.mp3 | 20-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | perique.mp3 | 20-Apr-2007 01:35 | 5.9K | |
![[SND]](/icons/sound2.gif) | perisarc.mp3 | 20-Apr-2007 01:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | periscope.mp3 | 20-Apr-2007 01:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | periscopic.mp3 | 20-Apr-2007 01:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | periselenium.mp3 | 20-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | perish.mp3 | 20-Apr-2007 01:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | perishability.mp3 | 20-Apr-2007 01:35 | 10K | |
![[SND]](/icons/sound2.gif) | perishable.mp3 | 20-Apr-2007 01:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | perished.mp3 | 20-Apr-2007 01:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | perisher.mp3 | 20-Apr-2007 01:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | perishing.mp3 | 20-Apr-2007 01:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | perisperm.mp3 | 20-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | perispomenon.mp3 | 20-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | perispore.mp3 | 20-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | perissodactyl.mp3 | 20-Apr-2007 01:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | peristalith.mp3 | 20-Apr-2007 01:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | peristalses.mp3 | 20-Apr-2007 01:35 | 11K | |
![[SND]](/icons/sound2.gif) | peristalsis.mp3 | 20-Apr-2007 01:35 | 11K | |
![[SND]](/icons/sound2.gif) | peristaltic.mp3 | 20-Apr-2007 01:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | peristerite.mp3 | 20-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | peristome.mp3 | 20-Apr-2007 01:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | peristomial.mp3 | 20-Apr-2007 01:35 | 9.6K | |
![[SND]](/icons/sound2.gif) | peristyle.mp3 | 20-Apr-2007 01:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | peristylium.mp3 | 20-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | peritectic.mp3 | 20-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | perithecia.mp3 | 20-Apr-2007 01:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | perithecial.mp3 | 20-Apr-2007 01:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | perithecium.mp3 | 20-Apr-2007 01:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | perithelium.mp3 | 20-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | peritonea.mp3 | 20-Apr-2007 01:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | peritoneal.mp3 | 20-Apr-2007 01:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | peritonealize.mp3 | 20-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | peritoneally.mp3 | 20-Apr-2007 01:36 | 10K | |
![[SND]](/icons/sound2.gif) | peritoneum.mp3 | 20-Apr-2007 01:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | peritoneums.mp3 | 20-Apr-2007 01:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | peritonitis.mp3 | 20-Apr-2007 01:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | peritonsillarabscess.mp3 | 20-Apr-2007 01:36 | 27K | |
![[SND]](/icons/sound2.gif) | peritrichate.mp3 | 20-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | peritrichous.mp3 | 20-Apr-2007 01:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | peritus.mp3 | 20-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | periwig.mp3 | 20-Apr-2007 01:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | periwigged.mp3 | 20-Apr-2007 01:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | periwinkle.mp3 | 20-Apr-2007 01:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | perjure.mp3 | 20-Apr-2007 01:36 | 5.7K | |
![[SND]](/icons/sound2.gif) | perjured.mp3 | 20-Apr-2007 01:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | perjurer.mp3 | 20-Apr-2007 01:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | perjuring.mp3 | 20-Apr-2007 01:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | perjurious.mp3 | 20-Apr-2007 01:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | perjury.mp3 | 20-Apr-2007 01:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | perk.mp3 | 20-Apr-2007 01:37 | 4.3K | |
![[SND]](/icons/sound2.gif) | perked.mp3 | 20-Apr-2007 01:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | perkerupper.mp3 | 20-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | perkily.mp3 | 20-Apr-2007 01:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | perkin.mp3 | 20-Apr-2007 01:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | perkiness.mp3 | 20-Apr-2007 01:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | Perkins.mp3 | 20-Apr-2007 01:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | perkmeister.mp3 | 20-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | perky.mp3 | 20-Apr-2007 01:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | Perl.mp3 | 20-Apr-2007 01:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | perle.mp3 | 20-Apr-2007 01:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | perlea.mp3 | 20-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | perlemon.mp3 | 20-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | Perlis.mp3 | 20-Apr-2007 01:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | perlite.mp3 | 20-Apr-2007 01:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | perlitic.mp3 | 20-Apr-2007 01:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | Perlman.mp3 | 20-Apr-2007 01:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | perlocutionary.mp3 | 20-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | perlucidus.mp3 | 20-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | perm.mp3 | 20-Apr-2007 01:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | Perm'.mp3 | 20-Apr-2007 01:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | permaculture.mp3 | 20-Apr-2007 01:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | permafrost.mp3 | 20-Apr-2007 01:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | permalloy.mp3 | 20-Apr-2007 01:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | permanence.mp3 | 20-Apr-2007 01:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | permanency.mp3 | 20-Apr-2007 01:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | permanent.mp3 | 20-Apr-2007 01:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | permanganate.mp3 | 20-Apr-2007 01:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | permanganic.mp3 | 20-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | permapress.mp3 | 20-Apr-2007 01:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | permeability.mp3 | 20-Apr-2007 01:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | permeable.mp3 | 20-Apr-2007 01:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | permeameter.mp3 | 20-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | permeance.mp3 | 20-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | permeant.mp3 | 20-Apr-2007 01:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | permease.mp3 | 20-Apr-2007 01:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | permeate.mp3 | 20-Apr-2007 01:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | permeation.mp3 | 20-Apr-2007 01:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | permeative.mp3 | 20-Apr-2007 01:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | permensem.mp3 | 20-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | permethrin.mp3 | 20-Apr-2007 01:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | Permian.mp3 | 20-Apr-2007 01:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | permic.mp3 | 20-Apr-2007 01:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | permill.mp3 | 20-Apr-2007 01:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | permillage.mp3 | 20-Apr-2007 01:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | permissibility.mp3 | 20-Apr-2007 01:38 | 10K | |
![[SND]](/icons/sound2.gif) | permissible.mp3 | 20-Apr-2007 01:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | permissibleness.mp3 | 20-Apr-2007 01:38 | 11K | |
![[SND]](/icons/sound2.gif) | permissibly.mp3 | 20-Apr-2007 01:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | permission.mp3 | 20-Apr-2007 01:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | permissive.mp3 | 20-Apr-2007 01:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | permissivism.mp3 | 20-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | permit.mp3 | 20-Apr-2007 01:39 | 5.5K | |
![[SND]](/icons/sound2.gif) | permittee.mp3 | 20-Apr-2007 01:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | permittivity.mp3 | 20-Apr-2007 01:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | permobil.mp3 | 20-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | permonosulfuricacid.mp3 | 20-Apr-2007 01:39 | 27K | |
![[SND]](/icons/sound2.gif) | permutable.mp3 | 20-Apr-2007 01:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | permutate.mp3 | 20-Apr-2007 01:39 | 27K | |
![[SND]](/icons/sound2.gif) | permutation.mp3 | 20-Apr-2007 01:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | permutational.mp3 | 20-Apr-2007 01:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | permute.mp3 | 20-Apr-2007 01:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | permutit.mp3 | 20-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | permutite.mp3 | 20-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | pern.mp3 | 20-Apr-2007 01:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pernambuco.mp3 | 20-Apr-2007 01:39 | 11K | |
![[SND]](/icons/sound2.gif) | pernancy.mp3 | 20-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | pernicious.mp3 | 20-Apr-2007 01:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | pernickety.mp3 | 20-Apr-2007 01:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pernik.mp3 | 20-Apr-2007 01:39 | 5.7K | |
![[SND]](/icons/sound2.gif) | pernio.mp3 | 20-Apr-2007 01:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | pernoctate.mp3 | 20-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | pernoctation.mp3 | 20-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | Pernod.mp3 | 20-Apr-2007 01:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | pernor.mp3 | 20-Apr-2007 01:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | Peron.mp3 | 20-Apr-2007 01:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | peroneal.mp3 | 20-Apr-2007 01:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | peroneus.mp3 | 20-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | peronism.mp3 | 20-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | peronist.mp3 | 20-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | peronista.mp3 | 20-Apr-2007 01:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | peroral.mp3 | 20-Apr-2007 01:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | perorally.mp3 | 20-Apr-2007 01:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | perorate.mp3 | 20-Apr-2007 01:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | peroration.mp3 | 20-Apr-2007 01:40 | 9.6K | |
![[SND]](/icons/sound2.gif) | perorational.mp3 | 20-Apr-2007 01:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | perot.mp3 | 20-Apr-2007 01:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | perotinus.mp3 | 20-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | perovskite.mp3 | 20-Apr-2007 01:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | peroxidase.mp3 | 20-Apr-2007 01:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | peroxidate.mp3 | 20-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | peroxidation.mp3 | 20-Apr-2007 01:40 | 10K | |
![[SND]](/icons/sound2.gif) | peroxide.mp3 | 20-Apr-2007 01:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | peroxidic.mp3 | 20-Apr-2007 01:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | peroxidize.mp3 | 20-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | peroxisomal.mp3 | 20-Apr-2007 01:40 | 10K | |
![[SND]](/icons/sound2.gif) | peroxisome.mp3 | 20-Apr-2007 01:40 | 10K | |
![[SND]](/icons/sound2.gif) | peroxy.mp3 | 20-Apr-2007 01:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | peroxyacetyl nitrate.mp3 | 20-Apr-2007 01:40 | 15K | |
![[SND]](/icons/sound2.gif) | perp.mp3 | 20-Apr-2007 01:41 | 4.5K | |
![[SND]](/icons/sound2.gif) | perpend.mp3 | 20-Apr-2007 01:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | perpendicular.mp3 | 20-Apr-2007 01:41 | 9.6K | |
![[SND]](/icons/sound2.gif) | perpendicularity.mp3 | 20-Apr-2007 01:41 | 12K | |
![[SND]](/icons/sound2.gif) | perpendicularly.mp3 | 20-Apr-2007 01:41 | 11K | |
![[SND]](/icons/sound2.gif) | perpent.mp3 | 20-Apr-2007 01:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | perpetrate.mp3 | 20-Apr-2007 01:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | perpetration.mp3 | 20-Apr-2007 01:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | perpetrator.mp3 | 20-Apr-2007 01:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | perpetual.mp3 | 20-Apr-2007 01:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | perpetuate.mp3 | 20-Apr-2007 01:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | perpetuation.mp3 | 20-Apr-2007 01:41 | 11K | |
![[SND]](/icons/sound2.gif) | perpetuator.mp3 | 20-Apr-2007 01:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | perpetuity.mp3 | 20-Apr-2007 01:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | perpetuummobile.mp3 | 20-Apr-2007 01:41 | 17K | |
![[SND]](/icons/sound2.gif) | perphenazine.mp3 | 20-Apr-2007 01:41 | 9.8K | |
![[SND]](/icons/sound2.gif) | Perpignan.mp3 | 20-Apr-2007 01:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | perplex.mp3 | 20-Apr-2007 01:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | perplexed.mp3 | 20-Apr-2007 01:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | perplexedly.mp3 | 20-Apr-2007 01:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | perplexity.mp3 | 20-Apr-2007 01:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | perprocurationem.mp3 | 20-Apr-2007 01:41 | 17K | |
![[SND]](/icons/sound2.gif) | perquisite.mp3 | 20-Apr-2007 01:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | perquisition.mp3 | 20-Apr-2007 01:42 | 17K | |
![[SND]](/icons/sound2.gif) | Perrault.mp3 | 20-Apr-2007 01:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | perret.mp3 | 20-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | perrier.mp3 | 20-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | perrierjouet.mp3 | 20-Apr-2007 01:42 | 17K | |
![[SND]](/icons/sound2.gif) | Perrin.mp3 | 20-Apr-2007 01:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | Perris.mp3 | 20-Apr-2007 01:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | perron.mp3 | 20-Apr-2007 01:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | perronet.mp3 | 20-Apr-2007 01:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | perrot.mp3 | 20-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | perry.mp3 | 20-Apr-2007 01:42 | 5.4K | |
![[SND]](/icons/sound2.gif) | perryrhodan.mp3 | 20-Apr-2007 01:42 | 17K | |
![[SND]](/icons/sound2.gif) | perrysburg.mp3 | 20-Apr-2007 01:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | persalt.mp3 | 20-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | perse.mp3 | 20-Apr-2007 01:42 | 5.5K | |
![[SND]](/icons/sound2.gif) | persea.mp3 | 20-Apr-2007 01:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | persecute.mp3 | 20-Apr-2007 01:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | persecutee.mp3 | 20-Apr-2007 01:42 | 10K | |
![[SND]](/icons/sound2.gif) | persecution.mp3 | 20-Apr-2007 01:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | persecutive.mp3 | 20-Apr-2007 01:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | persecutor.mp3 | 20-Apr-2007 01:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | persecutory.mp3 | 20-Apr-2007 01:42 | 9.8K | |
![[SND]](/icons/sound2.gif) | Perseid.mp3 | 20-Apr-2007 01:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | perseity.mp3 | 20-Apr-2007 01:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Persephone.mp3 | 20-Apr-2007 01:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | Persepolis.mp3 | 20-Apr-2007 01:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | perses.mp3 | 20-Apr-2007 01:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | Perseus.mp3 | 20-Apr-2007 01:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | perseverance.mp3 | 20-Apr-2007 01:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | perseverate.mp3 | 20-Apr-2007 01:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | perseveration.mp3 | 20-Apr-2007 01:43 | 11K | |
![[SND]](/icons/sound2.gif) | perseverative.mp3 | 20-Apr-2007 01:43 | 11K | |
![[SND]](/icons/sound2.gif) | persevere.mp3 | 20-Apr-2007 01:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | persevering.mp3 | 20-Apr-2007 01:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pershing.mp3 | 20-Apr-2007 01:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | Persia.mp3 | 20-Apr-2007 01:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | Persian.mp3 | 20-Apr-2007 01:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | persicaria.mp3 | 20-Apr-2007 01:43 | 17K | |
![[SND]](/icons/sound2.gif) | persichetti.mp3 | 20-Apr-2007 01:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | persiennes.mp3 | 20-Apr-2007 01:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | persiflage.mp3 | 20-Apr-2007 01:43 | 10K | |
![[SND]](/icons/sound2.gif) | persil.mp3 | 20-Apr-2007 01:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | persimmon.mp3 | 20-Apr-2007 01:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | Persis.mp3 | 20-Apr-2007 01:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | persist.mp3 | 20-Apr-2007 01:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | persistence.mp3 | 20-Apr-2007 01:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | persistency.mp3 | 20-Apr-2007 01:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | persistent.mp3 | 20-Apr-2007 01:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | Persius.mp3 | 20-Apr-2007 01:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | persnicketiness.mp3 | 20-Apr-2007 01:43 | 11K | |
![[SND]](/icons/sound2.gif) | persnickety.mp3 | 20-Apr-2007 01:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | person.mp3 | 20-Apr-2007 01:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | persona grata.mp3 | 20-Apr-2007 01:44 | 11K | |
![[SND]](/icons/sound2.gif) | persona non grata.mp3 | 20-Apr-2007 01:44 | 13K | |
![[SND]](/icons/sound2.gif) | persona.mp3 | 20-Apr-2007 01:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | personable.mp3 | 20-Apr-2007 01:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | personae.mp3 | 20-Apr-2007 01:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | personage.mp3 | 20-Apr-2007 01:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | personagrata.mp3 | 20-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | personal.mp3 | 20-Apr-2007 01:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | personalia.mp3 | 20-Apr-2007 01:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | personalism.mp3 | 20-Apr-2007 01:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | personalist.mp3 | 20-Apr-2007 01:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | personalistic.mp3 | 20-Apr-2007 01:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | personality.mp3 | 20-Apr-2007 01:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | personalization.mp3 | 20-Apr-2007 01:44 | 12K | |
![[SND]](/icons/sound2.gif) | personalize.mp3 | 20-Apr-2007 01:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | personally.mp3 | 20-Apr-2007 01:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | personalty.mp3 | 20-Apr-2007 01:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | personanongrata.mp3 | 20-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | personate.mp3 | 20-Apr-2007 01:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | personation.mp3 | 20-Apr-2007 01:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | personative.mp3 | 20-Apr-2007 01:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | personator.mp3 | 20-Apr-2007 01:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | personhood.mp3 | 20-Apr-2007 01:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | person-hour.mp3 | 20-Apr-2007 01:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | personification.mp3 | 20-Apr-2007 01:45 | 12K | |
![[SND]](/icons/sound2.gif) | personifier.mp3 | 20-Apr-2007 01:45 | 11K | |
![[SND]](/icons/sound2.gif) | personify.mp3 | 20-Apr-2007 01:45 | 10K | |
![[SND]](/icons/sound2.gif) | personnel.mp3 | 20-Apr-2007 01:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | personology.mp3 | 20-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | persorption.mp3 | 20-Apr-2007 01:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | perspectival.mp3 | 20-Apr-2007 01:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | perspective.mp3 | 20-Apr-2007 01:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | perspectivism.mp3 | 20-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | Perspex.mp3 | 20-Apr-2007 01:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | perspicacious.mp3 | 20-Apr-2007 01:45 | 11K | |
![[SND]](/icons/sound2.gif) | perspicacity.mp3 | 20-Apr-2007 01:45 | 11K | |
![[SND]](/icons/sound2.gif) | perspicuity.mp3 | 20-Apr-2007 01:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | perspicuous.mp3 | 20-Apr-2007 01:45 | 10K | |
![[SND]](/icons/sound2.gif) | perspicuously.mp3 | 20-Apr-2007 01:45 | 10K | |
![[SND]](/icons/sound2.gif) | perspiration.mp3 | 20-Apr-2007 01:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | perspiratory.mp3 | 20-Apr-2007 01:45 | 10K | |
![[SND]](/icons/sound2.gif) | perspire.mp3 | 20-Apr-2007 01:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | perstirpes.mp3 | 20-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | persuadable.mp3 | 20-Apr-2007 01:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | persuade.mp3 | 20-Apr-2007 01:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | persuader.mp3 | 20-Apr-2007 01:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | persuasible.mp3 | 20-Apr-2007 01:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | persuasion.mp3 | 20-Apr-2007 01:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | persuasive.mp3 | 20-Apr-2007 01:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | persulfate.mp3 | 20-Apr-2007 01:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | persulfuricacid.mp3 | 20-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | pert.mp3 | 20-Apr-2007 01:46 | 4.5K | |
![[SND]](/icons/sound2.gif) | pertain.mp3 | 20-Apr-2007 01:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | pertelote.mp3 | 20-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | Perth Amboy.mp3 | 20-Apr-2007 01:46 | 9.8K | |
![[SND]](/icons/sound2.gif) | Perth.mp3 | 20-Apr-2007 01:46 | 5.4K | |
![[SND]](/icons/sound2.gif) | perthamboy.mp3 | 20-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | perthite.mp3 | 20-Apr-2007 01:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Perthshire.mp3 | 20-Apr-2007 01:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | pertinacious.mp3 | 20-Apr-2007 01:46 | 10K | |
![[SND]](/icons/sound2.gif) | pertinacity.mp3 | 20-Apr-2007 01:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | pertinence.mp3 | 20-Apr-2007 01:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | pertinency.mp3 | 20-Apr-2007 01:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | pertinent.mp3 | 20-Apr-2007 01:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | pertini.mp3 | 20-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | pertsovka.mp3 | 20-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | perturb.mp3 | 20-Apr-2007 01:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | perturbable.mp3 | 20-Apr-2007 01:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | perturbation.mp3 | 20-Apr-2007 01:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | perturbational.mp3 | 20-Apr-2007 01:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | perturbative.mp3 | 20-Apr-2007 01:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | pertussis.mp3 | 20-Apr-2007 01:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Peru.mp3 | 20-Apr-2007 01:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | Perugia.mp3 | 20-Apr-2007 01:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | Perugino.mp3 | 20-Apr-2007 01:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | peruke.mp3 | 20-Apr-2007 01:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | peruked.mp3 | 20-Apr-2007 01:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | perusal.mp3 | 20-Apr-2007 01:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | peruse.mp3 | 20-Apr-2007 01:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | perutz.mp3 | 20-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Peruvian.mp3 | 20-Apr-2007 01:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | Peruzzi.mp3 | 20-Apr-2007 01:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | perv.mp3 | 20-Apr-2007 01:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | pervade.mp3 | 20-Apr-2007 01:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | pervasion.mp3 | 20-Apr-2007 01:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | pervasive.mp3 | 20-Apr-2007 01:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | perve.mp3 | 20-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | perverse.mp3 | 20-Apr-2007 01:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | perversion.mp3 | 20-Apr-2007 01:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | perversity.mp3 | 20-Apr-2007 01:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | perversive.mp3 | 20-Apr-2007 01:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | pervert.mp3 | 20-Apr-2007 01:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | perverted.mp3 | 20-Apr-2007 01:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | pervicacious.mp3 | 20-Apr-2007 01:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | pervious.mp3 | 20-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | pervouralsk.mp3 | 20-Apr-2007 01:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | pervy.mp3 | 20-Apr-2007 01:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | pes.mp3 | 20-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pesach.mp3 | 20-Apr-2007 01:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | pesade.mp3 | 20-Apr-2007 01:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | pesante.mp3 | 20-Apr-2007 01:48 | 17K | |
![[SND]](/icons/sound2.gif) | Pesaro.mp3 | 20-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pescadores.mp3 | 20-Apr-2007 01:48 | 11K | |
![[SND]](/icons/sound2.gif) | Pescara.mp3 | 20-Apr-2007 01:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | peseta.mp3 | 20-Apr-2007 01:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | pesewa.mp3 | 20-Apr-2007 01:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | Peshawar.mp3 | 20-Apr-2007 01:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | peshitta.mp3 | 20-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | peshwa.mp3 | 20-Apr-2007 01:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pesky.mp3 | 20-Apr-2007 01:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | peso.mp3 | 20-Apr-2007 01:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | pessary.mp3 | 20-Apr-2007 01:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | pessimal.mp3 | 20-Apr-2007 01:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pessimism.mp3 | 20-Apr-2007 01:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pessimist.mp3 | 20-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pessimistic.mp3 | 20-Apr-2007 01:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | pessimistically.mp3 | 20-Apr-2007 01:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | pessimize.mp3 | 20-Apr-2007 01:48 | 17K | |
![[SND]](/icons/sound2.gif) | pessimum.mp3 | 20-Apr-2007 01:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | pessoa.mp3 | 20-Apr-2007 01:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pest.mp3 | 20-Apr-2007 01:48 | 5.2K | |
![[SND]](/icons/sound2.gif) | Pestalozzi.mp3 | 20-Apr-2007 01:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | pester.mp3 | 20-Apr-2007 01:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | pestering.mp3 | 20-Apr-2007 01:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | pesthole.mp3 | 20-Apr-2007 01:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | pesthouse.mp3 | 20-Apr-2007 01:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | pesticidal.mp3 | 20-Apr-2007 01:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | pesticide.mp3 | 20-Apr-2007 01:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | pestiferous.mp3 | 20-Apr-2007 01:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | pestilence.mp3 | 20-Apr-2007 01:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | pestilent.mp3 | 20-Apr-2007 01:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | pestilential.mp3 | 20-Apr-2007 01:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | pestilentially.mp3 | 20-Apr-2007 01:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | pestle.mp3 | 20-Apr-2007 01:49 | 5.0K | |
![[SND]](/icons/sound2.gif) | pestling.mp3 | 20-Apr-2007 01:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | pesto.mp3 | 20-Apr-2007 01:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | pestology.mp3 | 20-Apr-2007 01:49 | 17K | |
![[SND]](/icons/sound2.gif) | pesty.mp3 | 20-Apr-2007 01:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | PET scan.mp3 | 20-Apr-2007 01:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | pet.mp3 | 20-Apr-2007 01:49 | 4.1K | |
![[SND]](/icons/sound2.gif) | peta.mp3 | 20-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | petachtikva.mp3 | 20-Apr-2007 01:49 | 17K | |
![[SND]](/icons/sound2.gif) | Petah Tiqwa.mp3 | 20-Apr-2007 01:49 | 11K | |
![[SND]](/icons/sound2.gif) | Petain.mp3 | 20-Apr-2007 01:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | petal.mp3 | 20-Apr-2007 01:49 | 4.5K | |
![[SND]](/icons/sound2.gif) | petala.mp3 | 20-Apr-2007 01:49 | 17K | |
![[SND]](/icons/sound2.gif) | petaliferous.mp3 | 20-Apr-2007 01:49 | 17K | |
![[SND]](/icons/sound2.gif) | petaline.mp3 | 20-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | petalite.mp3 | 20-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | petalled.mp3 | 20-Apr-2007 01:50 | 5.7K | |
![[SND]](/icons/sound2.gif) | petallike.mp3 | 20-Apr-2007 01:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | petalody.mp3 | 20-Apr-2007 01:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | petaloid.mp3 | 20-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | petalon.mp3 | 20-Apr-2007 01:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | petalous.mp3 | 20-Apr-2007 01:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | Petaluma.mp3 | 20-Apr-2007 01:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | petanque.mp3 | 20-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | petard.mp3 | 20-Apr-2007 01:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | Petare.mp3 | 20-Apr-2007 01:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | petasos.mp3 | 20-Apr-2007 01:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | petasus.mp3 | 20-Apr-2007 01:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | petaurist.mp3 | 20-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | petbottle.mp3 | 20-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | petcock.mp3 | 20-Apr-2007 01:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | pete.mp3 | 20-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | petechia.mp3 | 20-Apr-2007 01:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | petechiae.mp3 | 20-Apr-2007 01:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | petechial.mp3 | 20-Apr-2007 01:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | petechiate.mp3 | 20-Apr-2007 01:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | peteman.mp3 | 20-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | petenitza.mp3 | 20-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | Peter Claver.mp3 | 20-Apr-2007 01:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | Peter I.mp3 | 20-Apr-2007 01:50 | 5.0K | |
![[SND]](/icons/sound2.gif) | Peter Lombard.mp3 | 20-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | Peter Pan.mp3 | 20-Apr-2007 01:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | peter.mp3 | 20-Apr-2007 01:51 | 5.0K | |
![[SND]](/icons/sound2.gif) | Peterborough, Soke of.mp3 | 20-Apr-2007 01:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | Peterborough.mp3 | 20-Apr-2007 01:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | Peterhof.mp3 | 20-Apr-2007 01:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | peterlee.mp3 | 20-Apr-2007 01:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | peterloomassacre.mp3 | 20-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | peterman.mp3 | 20-Apr-2007 01:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | petermannpeak.mp3 | 20-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | peterpan.mp3 | 20-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | peterpiper.mp3 | 20-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | Peters.mp3 | 20-Apr-2007 01:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | Petersburg.mp3 | 20-Apr-2007 01:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | petersham.mp3 | 20-Apr-2007 01:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Peterson.mp3 | 20-Apr-2007 01:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | peterstuyvesant.mp3 | 20-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | pethidine.mp3 | 20-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | petillant.mp3 | 20-Apr-2007 01:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | petiolar.mp3 | 20-Apr-2007 01:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | petiolate.mp3 | 20-Apr-2007 01:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | petiole.mp3 | 20-Apr-2007 01:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | petioled.mp3 | 20-Apr-2007 01:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | petiolule.mp3 | 20-Apr-2007 01:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | petipa.mp3 | 20-Apr-2007 01:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | petit bourgeois.mp3 | 20-Apr-2007 01:51 | 11K | |
![[SND]](/icons/sound2.gif) | petit four.mp3 | 20-Apr-2007 01:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | petit fours.mp3 | 20-Apr-2007 01:52 | 11K | |
![[SND]](/icons/sound2.gif) | petit jury.mp3 | 20-Apr-2007 01:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | petit mal.mp3 | 20-Apr-2007 01:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | petit point.mp3 | 20-Apr-2007 01:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | petit.mp3 | 20-Apr-2007 01:52 | 4.3K | |
![[SND]](/icons/sound2.gif) | petitbeurre.mp3 | 20-Apr-2007 01:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | petitbourgeois.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | Petitcodiac.mp3 | 20-Apr-2007 01:52 | 9.8K | |
![[SND]](/icons/sound2.gif) | petitdejeuner.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | petite sirah.mp3 | 20-Apr-2007 01:52 | 11K | |
![[SND]](/icons/sound2.gif) | petite.mp3 | 20-Apr-2007 01:52 | 5.7K | |
![[SND]](/icons/sound2.gif) | petitebourgeoise.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | petitebourgeoisie.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | petitemarmite.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | petitfeu.mp3 | 20-Apr-2007 01:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | petitfour.mp3 | 20-Apr-2007 01:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | petitio principii.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | petition.mp3 | 20-Apr-2007 01:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | petitionary.mp3 | 20-Apr-2007 01:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | petitioner.mp3 | 20-Apr-2007 01:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | petitioning.mp3 | 20-Apr-2007 01:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | petitioprincipii.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | petitjury.mp3 | 20-Apr-2007 01:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | petitlarceny.mp3 | 20-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | petitmaitre.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petit-maitre.mp3 | 20-Apr-2007 01:53 | 10K | |
![[SND]](/icons/sound2.gif) | petitmal.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petitor.mp3 | 20-Apr-2007 01:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | petitpoint.mp3 | 20-Apr-2007 01:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | petitschevaux.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petitserjeanty.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petits-maitres.mp3 | 20-Apr-2007 01:53 | 10K | |
![[SND]](/icons/sound2.gif) | petitspois.mp3 | 20-Apr-2007 01:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | petittreason.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petitverre.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petitvin.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | peto.mp3 | 20-Apr-2007 01:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Petofi.mp3 | 20-Apr-2007 01:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | petoncle.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petr.mp3 | 20-Apr-2007 01:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Petra.mp3 | 20-Apr-2007 01:53 | 5.5K | |
![[SND]](/icons/sound2.gif) | petrale sole.mp3 | 20-Apr-2007 01:53 | 12K | |
![[SND]](/icons/sound2.gif) | Petrarch.mp3 | 20-Apr-2007 01:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | Petrarchan sonnet.mp3 | 20-Apr-2007 01:53 | 12K | |
![[SND]](/icons/sound2.gif) | Petrarchan.mp3 | 20-Apr-2007 01:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | petrarchism.mp3 | 20-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | petrarchist.mp3 | 20-Apr-2007 01:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | petrel.mp3 | 20-Apr-2007 01:53 | 5.5K | |
![[SND]](/icons/sound2.gif) | petri dish.mp3 | 20-Apr-2007 01:53 | 10K | |
![[SND]](/icons/sound2.gif) | petri.mp3 | 20-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | petridish.mp3 | 20-Apr-2007 01:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | Petrie.mp3 | 20-Apr-2007 01:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | petrifaction.mp3 | 20-Apr-2007 01:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | petrification.mp3 | 20-Apr-2007 01:54 | 10K | |
![[SND]](/icons/sound2.gif) | petrify.mp3 | 20-Apr-2007 01:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | petrillo.mp3 | 20-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Petrine.mp3 | 20-Apr-2007 01:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | petrinism.mp3 | 20-Apr-2007 01:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | petro.mp3 | 20-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | petrobrusian.mp3 | 20-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | petrochemical.mp3 | 20-Apr-2007 01:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | petrochemistry.mp3 | 20-Apr-2007 01:54 | 11K | |
![[SND]](/icons/sound2.gif) | petrodollar.mp3 | 20-Apr-2007 01:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | Petrodvorets.mp3 | 20-Apr-2007 01:54 | 13K | |
![[SND]](/icons/sound2.gif) | petrogenesis.mp3 | 20-Apr-2007 01:54 | 12K | |
![[SND]](/icons/sound2.gif) | petrogenetic.mp3 | 20-Apr-2007 01:54 | 10K | |
![[SND]](/icons/sound2.gif) | petroglyph.mp3 | 20-Apr-2007 01:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | Petrograd.mp3 | 20-Apr-2007 01:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | petrogram.mp3 | 20-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | petrographer.mp3 | 20-Apr-2007 01:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | petrographic.mp3 | 20-Apr-2007 01:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | petrographical.mp3 | 20-Apr-2007 01:54 | 10K | |
![[SND]](/icons/sound2.gif) | petrographically.mp3 | 20-Apr-2007 01:54 | 11K | |
![[SND]](/icons/sound2.gif) | petrography.mp3 | 20-Apr-2007 01:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | petrol.mp3 | 20-Apr-2007 01:55 | 5.2K | |
![[SND]](/icons/sound2.gif) | petrolatum.mp3 | 20-Apr-2007 01:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | petrolene.mp3 | 20-Apr-2007 01:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | petroleum.mp3 | 20-Apr-2007 01:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | petrolic.mp3 | 20-Apr-2007 01:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | petroliferous.mp3 | 20-Apr-2007 01:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | petrolina.mp3 | 20-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | petrologic.mp3 | 20-Apr-2007 01:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | petrological.mp3 | 20-Apr-2007 01:55 | 10K | |
![[SND]](/icons/sound2.gif) | petrologically.mp3 | 20-Apr-2007 01:55 | 11K | |
![[SND]](/icons/sound2.gif) | petrologist.mp3 | 20-Apr-2007 01:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | petrology.mp3 | 20-Apr-2007 01:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | petronel.mp3 | 20-Apr-2007 01:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | petronella.mp3 | 20-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | Petronian.mp3 | 20-Apr-2007 01:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Petronius.mp3 | 20-Apr-2007 01:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | Petropavlovsk- Kamchatskiy.mp3 | 20-Apr-2007 01:55 | 21K | |
![[SND]](/icons/sound2.gif) | Petropavlovsk.mp3 | 20-Apr-2007 01:55 | 12K | |
![[SND]](/icons/sound2.gif) | petropavlovskkamchatski.mp3 | 20-Apr-2007 01:55 | 27K | |
![[SND]](/icons/sound2.gif) | Petropolis.mp3 | 20-Apr-2007 01:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | petrosal.mp3 | 20-Apr-2007 01:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | petrosian.mp3 | 20-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | petrouchka.mp3 | 20-Apr-2007 01:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | petrous.mp3 | 20-Apr-2007 01:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | Petrovsk.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | Petrozavodsk.mp3 | 20-Apr-2007 01:56 | 10K | |
![[SND]](/icons/sound2.gif) | Petsamo.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | petscan.mp3 | 20-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | petscanner.mp3 | 20-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | petsel.mp3 | 20-Apr-2007 01:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | petti.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | petticoat.mp3 | 20-Apr-2007 01:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | petticoated.mp3 | 20-Apr-2007 01:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | pettifog.mp3 | 20-Apr-2007 01:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | pettifogger.mp3 | 20-Apr-2007 01:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | pettifoggery.mp3 | 20-Apr-2007 01:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | pettifogging.mp3 | 20-Apr-2007 01:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | pettily.mp3 | 20-Apr-2007 01:56 | 5.5K | |
![[SND]](/icons/sound2.gif) | pettiness.mp3 | 20-Apr-2007 01:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | petting.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pettipants.mp3 | 20-Apr-2007 01:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | pettish.mp3 | 20-Apr-2007 01:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | pettiskirt.mp3 | 20-Apr-2007 01:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | pettislip.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pettitoes.mp3 | 20-Apr-2007 01:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | pettle.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | petto.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | petty.mp3 | 20-Apr-2007 01:56 | 4.5K | |
![[SND]](/icons/sound2.gif) | pettyfitzmaurice.mp3 | 20-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | petulance.mp3 | 20-Apr-2007 01:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | petulancy.mp3 | 20-Apr-2007 01:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | petulant.mp3 | 20-Apr-2007 01:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | petunia.mp3 | 20-Apr-2007 01:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | petuntse.mp3 | 20-Apr-2007 01:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | peu a peu.mp3 | 20-Apr-2007 01:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | peu de chose.mp3 | 20-Apr-2007 01:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | peuapeu.mp3 | 20-Apr-2007 01:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | peudechose.mp3 | 20-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | peugeot.mp3 | 20-Apr-2007 01:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | peul.mp3 | 20-Apr-2007 01:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pevsner.mp3 | 20-Apr-2007 01:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | pew.mp3 | 20-Apr-2007 01:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | pewage.mp3 | 20-Apr-2007 01:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | pewee.mp3 | 20-Apr-2007 01:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | pewholder.mp3 | 20-Apr-2007 01:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | pewit.mp3 | 20-Apr-2007 01:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pewter.mp3 | 20-Apr-2007 01:57 | 5.5K | |
![[SND]](/icons/sound2.gif) | pewterer.mp3 | 20-Apr-2007 01:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | peyote.mp3 | 20-Apr-2007 01:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | peyotism.mp3 | 20-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | peyotl.mp3 | 20-Apr-2007 01:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | peyton.mp3 | 20-Apr-2007 01:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | peytral.mp3 | 20-Apr-2007 01:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pez.mp3 | 20-Apr-2007 01:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pfalz.mp3 | 20-Apr-2007 01:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | pfennig.mp3 | 20-Apr-2007 01:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | pfennige.mp3 | 20-Apr-2007 01:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | pfennigs.mp3 | 20-Apr-2007 01:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | pfft.mp3 | 20-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pfitzner.mp3 | 20-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pfizer.mp3 | 20-Apr-2007 01:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pforzheim.mp3 | 20-Apr-2007 01:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | pfui.mp3 | 20-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pfundseries.mp3 | 20-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | PG.mp3 | 20-Apr-2007 01:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | PG-13.mp3 | 20-Apr-2007 01:58 | 13K | |
![[SND]](/icons/sound2.gif) | pH.mp3 | 20-Apr-2007 01:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | phacelia.mp3 | 20-Apr-2007 01:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | phacoemulsification.mp3 | 20-Apr-2007 01:58 | 18K | |
![[SND]](/icons/sound2.gif) | phacolite.mp3 | 20-Apr-2007 01:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | phacolith.mp3 | 20-Apr-2007 01:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | phaeacia.mp3 | 20-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Phaedra.mp3 | 20-Apr-2007 01:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | Phaedrus.mp3 | 20-Apr-2007 01:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | phaenna.mp3 | 20-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | phaestus.mp3 | 20-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Phaethon.mp3 | 20-Apr-2007 01:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | phaeton.mp3 | 20-Apr-2007 01:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | phaetonincident.mp3 | 20-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | phage.mp3 | 20-Apr-2007 01:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | phagedena.mp3 | 20-Apr-2007 01:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | phagia.mp3 | 20-Apr-2007 01:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | phago.mp3 | 20-Apr-2007 01:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | phagocyte.mp3 | 20-Apr-2007 01:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | phagocytic.mp3 | 20-Apr-2007 01:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | phagocytize.mp3 | 20-Apr-2007 01:59 | 11K | |
![[SND]](/icons/sound2.gif) | phagocytose.mp3 | 20-Apr-2007 01:59 | 10K | |
![[SND]](/icons/sound2.gif) | phagocytoses.mp3 | 20-Apr-2007 01:59 | 13K | |
![[SND]](/icons/sound2.gif) | phagocytosis.mp3 | 20-Apr-2007 01:59 | 11K | |
![[SND]](/icons/sound2.gif) | phagocytotic.mp3 | 20-Apr-2007 01:59 | 11K | |
![[SND]](/icons/sound2.gif) | phagomania.mp3 | 20-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | phagophobia.mp3 | 20-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | phagosome.mp3 | 20-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | phagous.mp3 | 20-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | phagun.mp3 | 20-Apr-2007 01:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | phagy.mp3 | 20-Apr-2007 01:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | phainopepla.mp3 | 20-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | phaistos.mp3 | 20-Apr-2007 01:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | phakoemulsification.mp3 | 20-Apr-2007 01:59 | 18K | |
![[SND]](/icons/sound2.gif) | phalaenopses.mp3 | 20-Apr-2007 01:59 | 11K | |
![[SND]](/icons/sound2.gif) | phalaenopsis.mp3 | 20-Apr-2007 01:59 | 11K | |
![[SND]](/icons/sound2.gif) | phalangal.mp3 | 20-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | phalange.mp3 | 20-Apr-2007 01:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | phalangeal.mp3 | 20-Apr-2007 01:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | phalanger.mp3 | 20-Apr-2007 01:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | phalanges.mp3 | 20-Apr-2007 02:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | phalangist.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phalansterian.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phalansterianism.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phalanstery.mp3 | 20-Apr-2007 02:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | phalanx.mp3 | 20-Apr-2007 02:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | phalarope.mp3 | 20-Apr-2007 02:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | phalera.mp3 | 20-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | phalli.mp3 | 20-Apr-2007 02:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | phallic.mp3 | 20-Apr-2007 02:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | phallically.mp3 | 20-Apr-2007 02:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | phallicism.mp3 | 20-Apr-2007 02:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | phallocentric.mp3 | 20-Apr-2007 02:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | phallocentrism.mp3 | 20-Apr-2007 02:00 | 10K | |
![[SND]](/icons/sound2.gif) | phallocrat.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phallocratic.mp3 | 20-Apr-2007 02:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | phalloidin.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phallotoxin.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phallus.mp3 | 20-Apr-2007 02:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | phanariot.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phane.mp3 | 20-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | phanerite.mp3 | 20-Apr-2007 02:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | phanerocrystalline.mp3 | 20-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | phanerogam.mp3 | 20-Apr-2007 02:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | phanerogamia.mp3 | 20-Apr-2007 02:01 | 27K | |
![[SND]](/icons/sound2.gif) | phanerophyte.mp3 | 20-Apr-2007 02:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | Phanerozoic.mp3 | 20-Apr-2007 02:01 | 10K | |
![[SND]](/icons/sound2.gif) | phano.mp3 | 20-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | phanotron.mp3 | 20-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | phantasize.mp3 | 20-Apr-2007 02:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | phantasm.mp3 | 20-Apr-2007 02:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | phantasma.mp3 | 20-Apr-2007 02:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | phantasmagoria.mp3 | 20-Apr-2007 02:01 | 12K | |
![[SND]](/icons/sound2.gif) | phantasmagoric.mp3 | 20-Apr-2007 02:01 | 11K | |
![[SND]](/icons/sound2.gif) | phantasmagorical.mp3 | 20-Apr-2007 02:01 | 13K | |
![[SND]](/icons/sound2.gif) | phantasmagory.mp3 | 20-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | phantasmal.mp3 | 20-Apr-2007 02:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | phantasmata.mp3 | 20-Apr-2007 02:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | phantasmic.mp3 | 20-Apr-2007 02:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | phantast.mp3 | 20-Apr-2007 02:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | phantasy.mp3 | 20-Apr-2007 02:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | phantom.mp3 | 20-Apr-2007 02:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | phantomlike.mp3 | 20-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | phany.mp3 | 20-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pharaoh.mp3 | 20-Apr-2007 02:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | pharaonic.mp3 | 20-Apr-2007 02:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | pharisaic.mp3 | 20-Apr-2007 02:01 | 11K | |
![[SND]](/icons/sound2.gif) | pharisaical.mp3 | 20-Apr-2007 02:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | pharisaically.mp3 | 20-Apr-2007 02:01 | 11K | |
![[SND]](/icons/sound2.gif) | pharisaicalness.mp3 | 20-Apr-2007 02:01 | 12K | |
![[SND]](/icons/sound2.gif) | pharisaism.mp3 | 20-Apr-2007 02:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | pharisee.mp3 | 20-Apr-2007 02:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | pharmacal.mp3 | 20-Apr-2007 02:02 | 17K | |
![[SND]](/icons/sound2.gif) | pharmaceutical.mp3 | 20-Apr-2007 02:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | pharmaceutically.mp3 | 20-Apr-2007 02:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | pharmaceutics.mp3 | 20-Apr-2007 02:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | pharmacist.mp3 | 20-Apr-2007 02:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | pharmaco.mp3 | 20-Apr-2007 02:02 | 17K | |
![[SND]](/icons/sound2.gif) | pharmacodynamic.mp3 | 20-Apr-2007 02:02 | 12K | |
![[SND]](/icons/sound2.gif) | pharmacodynamically.mp3 | 20-Apr-2007 02:02 | 14K | |
![[SND]](/icons/sound2.gif) | pharmacodynamics.mp3 | 20-Apr-2007 02:02 | 13K | |
![[SND]](/icons/sound2.gif) | pharmacognostic.mp3 | 20-Apr-2007 02:02 | 12K | |
![[SND]](/icons/sound2.gif) | pharmacognostical.mp3 | 20-Apr-2007 02:02 | 13K | |
![[SND]](/icons/sound2.gif) | pharmacognosy.mp3 | 20-Apr-2007 02:02 | 11K | |
![[SND]](/icons/sound2.gif) | pharmacokinetic.mp3 | 20-Apr-2007 02:02 | 12K | |
![[SND]](/icons/sound2.gif) | pharmacokinetics.mp3 | 20-Apr-2007 02:02 | 13K | |
![[SND]](/icons/sound2.gif) | pharmacolite.mp3 | 20-Apr-2007 02:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | pharmacologic.mp3 | 20-Apr-2007 02:02 | 10K | |
![[SND]](/icons/sound2.gif) | pharmacological.mp3 | 20-Apr-2007 02:02 | 12K | |
![[SND]](/icons/sound2.gif) | pharmacologically.mp3 | 20-Apr-2007 02:02 | 12K | |
![[SND]](/icons/sound2.gif) | pharmacologist.mp3 | 20-Apr-2007 02:02 | 12K | |
![[SND]](/icons/sound2.gif) | pharmacology.mp3 | 20-Apr-2007 02:02 | 10K | |
![[SND]](/icons/sound2.gif) | pharmacopeia.mp3 | 20-Apr-2007 02:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | pharmacopeial.mp3 | 20-Apr-2007 02:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | pharmacopoeia.mp3 | 20-Apr-2007 02:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | pharmacotherapy.mp3 | 20-Apr-2007 02:03 | 12K | |
![[SND]](/icons/sound2.gif) | pharmacy.mp3 | 20-Apr-2007 02:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pharos.mp3 | 20-Apr-2007 02:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pharr.mp3 | 20-Apr-2007 02:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pharsala.mp3 | 20-Apr-2007 02:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | pharsalia.mp3 | 20-Apr-2007 02:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pharsalus.mp3 | 20-Apr-2007 02:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | pharyng.mp3 | 20-Apr-2007 02:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | pharyngalize.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharyngeal.mp3 | 20-Apr-2007 02:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | pharyngealize.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharyngectomy.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharynges.mp3 | 20-Apr-2007 02:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | pharyngitides.mp3 | 20-Apr-2007 02:03 | 12K | |
![[SND]](/icons/sound2.gif) | pharyngitis.mp3 | 20-Apr-2007 02:03 | 10K | |
![[SND]](/icons/sound2.gif) | pharyngo.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharyngocele.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharyngology.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharyngoscope.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharyngoscopy.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharyngotomy.mp3 | 20-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | pharynx.mp3 | 20-Apr-2007 02:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | phase.mp3 | 20-Apr-2007 02:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | phased.mp3 | 20-Apr-2007 02:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | phasedown.mp3 | 20-Apr-2007 02:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | phaseout.mp3 | 20-Apr-2007 02:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | phasia.mp3 | 20-Apr-2007 02:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | phasic.mp3 | 20-Apr-2007 02:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | phasing.mp3 | 20-Apr-2007 02:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | phasis.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | phasmid.mp3 | 20-Apr-2007 02:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | phasor.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | phat.mp3 | 20-Apr-2007 02:04 | 5.0K | |
![[SND]](/icons/sound2.gif) | phatic.mp3 | 20-Apr-2007 02:04 | 5.5K | |
![[SND]](/icons/sound2.gif) | phatically.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | phazed.mp3 | 20-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | phd.mp3 | 20-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | pheasant.mp3 | 20-Apr-2007 02:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | pheasantry.mp3 | 20-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | pheba.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | phebe.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | phedinkus.mp3 | 20-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | phedre.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | pheidippides.mp3 | 20-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | phellem.mp3 | 20-Apr-2007 02:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | phelloderm.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | phellogen.mp3 | 20-Apr-2007 02:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | phelonion.mp3 | 20-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | phelps.mp3 | 20-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | phen.mp3 | 20-Apr-2007 02:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenacaine.mp3 | 20-Apr-2007 02:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | phenacetin.mp3 | 20-Apr-2007 02:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | phenacite.mp3 | 20-Apr-2007 02:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenagle.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenakite.mp3 | 20-Apr-2007 02:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | phenanthraquinone.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenanthrene.mp3 | 20-Apr-2007 02:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | phenanthrenequinone.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenarsazinechloride.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenate.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenazine.mp3 | 20-Apr-2007 02:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenazocine.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenazopyridine.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phencyclidine.mp3 | 20-Apr-2007 02:05 | 10K | |
![[SND]](/icons/sound2.gif) | phene.mp3 | 20-Apr-2007 02:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | phenelzine.mp3 | 20-Apr-2007 02:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | phenethicillin.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenethylalcohol.mp3 | 20-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | phenetic.mp3 | 20-Apr-2007 02:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | pheneticist.mp3 | 20-Apr-2007 02:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | phenetics.mp3 | 20-Apr-2007 02:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenetidine.mp3 | 20-Apr-2007 02:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | phenetole.mp3 | 20-Apr-2007 02:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | phen-fen.mp3 | 20-Apr-2007 02:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | phenformin.mp3 | 20-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | phengite.mp3 | 20-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | phenicia.mp3 | 20-Apr-2007 02:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | phenies.mp3 | 20-Apr-2007 02:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | Phenix City.mp3 | 20-Apr-2007 02:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | phenix.mp3 | 20-Apr-2007 02:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | phenixcity.mp3 | 20-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | phenmetrazine.mp3 | 20-Apr-2007 02:06 | 11K | |
![[SND]](/icons/sound2.gif) | pheno.mp3 | 20-Apr-2007 02:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | phenobarbital.mp3 | 20-Apr-2007 02:06 | 11K | |
![[SND]](/icons/sound2.gif) | phenobarbitone.mp3 | 20-Apr-2007 02:06 | 12K | |
![[SND]](/icons/sound2.gif) | phenocopy.mp3 | 20-Apr-2007 02:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenocryst.mp3 | 20-Apr-2007 02:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | phenocrystic.mp3 | 20-Apr-2007 02:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | phenogram.mp3 | 20-Apr-2007 02:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenol.mp3 | 20-Apr-2007 02:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | phenolate.mp3 | 20-Apr-2007 02:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | phenolated.mp3 | 20-Apr-2007 02:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | phenolic.mp3 | 20-Apr-2007 02:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | phenolion.mp3 | 20-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | phenolize.mp3 | 20-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | phenological.mp3 | 20-Apr-2007 02:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | phenologically.mp3 | 20-Apr-2007 02:06 | 10K | |
![[SND]](/icons/sound2.gif) | phenology.mp3 | 20-Apr-2007 02:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | phenolphthalein.mp3 | 20-Apr-2007 02:07 | 10K | |
![[SND]](/icons/sound2.gif) | phenolsulfonephthalein.mp3 | 20-Apr-2007 02:07 | 27K | |
![[SND]](/icons/sound2.gif) | phenom.mp3 | 20-Apr-2007 02:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | phenomena.mp3 | 20-Apr-2007 02:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | phenomenal.mp3 | 20-Apr-2007 02:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | phenomenalism.mp3 | 20-Apr-2007 02:07 | 10K | |
![[SND]](/icons/sound2.gif) | phenomenalist.mp3 | 20-Apr-2007 02:07 | 9.6K | |
![[SND]](/icons/sound2.gif) | phenomenalistic.mp3 | 20-Apr-2007 02:07 | 11K | |
![[SND]](/icons/sound2.gif) | phenomenalistically.mp3 | 20-Apr-2007 02:07 | 13K | |
![[SND]](/icons/sound2.gif) | phenomenalize.mp3 | 20-Apr-2007 02:07 | 17K | |
![[SND]](/icons/sound2.gif) | phenomenally.mp3 | 20-Apr-2007 02:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | phenomenism.mp3 | 20-Apr-2007 02:07 | 17K | |
![[SND]](/icons/sound2.gif) | phenomenological.mp3 | 20-Apr-2007 02:07 | 12K | |
![[SND]](/icons/sound2.gif) | phenomenologically.mp3 | 20-Apr-2007 02:07 | 13K | |
![[SND]](/icons/sound2.gif) | phenomenologist.mp3 | 20-Apr-2007 02:07 | 13K | |
![[SND]](/icons/sound2.gif) | phenomenology.mp3 | 20-Apr-2007 02:07 | 12K | |
![[SND]](/icons/sound2.gif) | phenomenon.mp3 | 20-Apr-2007 02:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | phenoplast.mp3 | 20-Apr-2007 02:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | phenothiazine.mp3 | 20-Apr-2007 02:07 | 12K | |
![[SND]](/icons/sound2.gif) | phenotype.mp3 | 20-Apr-2007 02:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | phenotypic.mp3 | 20-Apr-2007 02:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenotypical.mp3 | 20-Apr-2007 02:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | phenotypically.mp3 | 20-Apr-2007 02:07 | 10K | |
![[SND]](/icons/sound2.gif) | phenoxide.mp3 | 20-Apr-2007 02:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | phenoxy.mp3 | 20-Apr-2007 02:07 | 17K | |
![[SND]](/icons/sound2.gif) | phentermine.mp3 | 20-Apr-2007 02:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | phentolamine.mp3 | 20-Apr-2007 02:08 | 10K | |
![[SND]](/icons/sound2.gif) | phenyl.mp3 | 20-Apr-2007 02:08 | 5.4K | |
![[SND]](/icons/sound2.gif) | phenylalanine.mp3 | 20-Apr-2007 02:08 | 11K | |
![[SND]](/icons/sound2.gif) | phenylbutazone.mp3 | 20-Apr-2007 02:08 | 12K | |
![[SND]](/icons/sound2.gif) | phenyldiethanolamine.mp3 | 20-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | phenylene.mp3 | 20-Apr-2007 02:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | phenylephrine.mp3 | 20-Apr-2007 02:08 | 10K | |
![[SND]](/icons/sound2.gif) | phenylethylamine.mp3 | 20-Apr-2007 02:08 | 14K | |
![[SND]](/icons/sound2.gif) | phenylethylbarbituricacid.mp3 | 20-Apr-2007 02:08 | 18K | |
![[SND]](/icons/sound2.gif) | phenylformicacid.mp3 | 20-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | phenylic.mp3 | 20-Apr-2007 02:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | phenylicacid.mp3 | 20-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | phenylketonuria.mp3 | 20-Apr-2007 02:08 | 13K | |
![[SND]](/icons/sound2.gif) | phenylketonuric.mp3 | 20-Apr-2007 02:08 | 12K | |
![[SND]](/icons/sound2.gif) | phenylmethylcarbinylacetate.mp3 | 20-Apr-2007 02:08 | 18K | |
![[SND]](/icons/sound2.gif) | phenylpropanolamine.mp3 | 20-Apr-2007 02:08 | 14K | |
![[SND]](/icons/sound2.gif) | phenylthiocarbamide.mp3 | 20-Apr-2007 02:08 | 16K | |
![[SND]](/icons/sound2.gif) | phenylthiourea.mp3 | 20-Apr-2007 02:08 | 14K | |
![[SND]](/icons/sound2.gif) | phenylvalerate.mp3 | 20-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | phenytoin.mp3 | 20-Apr-2007 02:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | pheochromocytoma.mp3 | 20-Apr-2007 02:08 | 13K | |
![[SND]](/icons/sound2.gif) | pheochromocytomata.mp3 | 20-Apr-2007 02:08 | 13K | |
![[SND]](/icons/sound2.gif) | pheon.mp3 | 20-Apr-2007 02:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pherae.mp3 | 20-Apr-2007 02:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | pherentasin.mp3 | 20-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | phereses.mp3 | 20-Apr-2007 02:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | pheresis.mp3 | 20-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | pheromonal.mp3 | 20-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | pheromone.mp3 | 20-Apr-2007 02:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | phew.mp3 | 20-Apr-2007 02:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | phfft.mp3 | 20-Apr-2007 02:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | Phi Beta Kappa.mp3 | 20-Apr-2007 02:09 | 10K | |
![[SND]](/icons/sound2.gif) | phi.mp3 | 20-Apr-2007 02:09 | 5.5K | |
![[SND]](/icons/sound2.gif) | phial.mp3 | 20-Apr-2007 02:09 | 5.5K | |
![[SND]](/icons/sound2.gif) | phiale.mp3 | 20-Apr-2007 02:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | phibbi.mp3 | 20-Apr-2007 02:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | phibetakappa.mp3 | 20-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | phibete.mp3 | 20-Apr-2007 02:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | phichol.mp3 | 20-Apr-2007 02:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | phidian.mp3 | 20-Apr-2007 02:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | Phidias.mp3 | 20-Apr-2007 02:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | phidippides.mp3 | 20-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | phil.mp3 | 20-Apr-2007 02:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | philabeg.mp3 | 20-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | Philadelphia lawyer.mp3 | 20-Apr-2007 02:09 | 12K | |
![[SND]](/icons/sound2.gif) | Philadelphia.mp3 | 20-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | Philadelphian.mp3 | 20-Apr-2007 02:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | philadelphus.mp3 | 20-Apr-2007 02:09 | 10K | |
![[SND]](/icons/sound2.gif) | Philae.mp3 | 20-Apr-2007 02:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | philander.mp3 | 20-Apr-2007 02:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | philanderer.mp3 | 20-Apr-2007 02:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | philandering.mp3 | 20-Apr-2007 02:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | philanthrope.mp3 | 20-Apr-2007 02:10 | 17K | |
![[SND]](/icons/sound2.gif) | philanthropic.mp3 | 20-Apr-2007 02:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | philanthropical.mp3 | 20-Apr-2007 02:10 | 11K | |
![[SND]](/icons/sound2.gif) | philanthropically.mp3 | 20-Apr-2007 02:10 | 12K | |
![[SND]](/icons/sound2.gif) | philanthropist.mp3 | 20-Apr-2007 02:10 | 10K | |
![[SND]](/icons/sound2.gif) | philanthropize.mp3 | 20-Apr-2007 02:10 | 17K | |
![[SND]](/icons/sound2.gif) | philanthropoid.mp3 | 20-Apr-2007 02:10 | 10K | |
![[SND]](/icons/sound2.gif) | philanthropy.mp3 | 20-Apr-2007 02:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | philatelic.mp3 | 20-Apr-2007 02:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | philatelically.mp3 | 20-Apr-2007 02:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | philatelist.mp3 | 20-Apr-2007 02:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | philately.mp3 | 20-Apr-2007 02:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | philby.mp3 | 20-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | phile.mp3 | 20-Apr-2007 02:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | Philemon.mp3 | 20-Apr-2007 02:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | philharmoniaorchestra.mp3 | 20-Apr-2007 02:10 | 27K | |
![[SND]](/icons/sound2.gif) | philharmonic.mp3 | 20-Apr-2007 02:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | philhellene.mp3 | 20-Apr-2007 02:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | philhellenic.mp3 | 20-Apr-2007 02:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | philhellenism.mp3 | 20-Apr-2007 02:10 | 10K | |
![[SND]](/icons/sound2.gif) | philhellenist.mp3 | 20-Apr-2007 02:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | philibeg.mp3 | 20-Apr-2007 02:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | philic.mp3 | 20-Apr-2007 02:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | Philip.mp3 | 20-Apr-2007 02:11 | 5.2K | |
![[SND]](/icons/sound2.gif) | philippa.mp3 | 20-Apr-2007 02:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Philippeville.mp3 | 20-Apr-2007 02:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | Philippi.mp3 | 20-Apr-2007 02:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | Philippian.mp3 | 20-Apr-2007 02:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | Philippians.mp3 | 20-Apr-2007 02:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | philippic.mp3 | 20-Apr-2007 02:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | philippina.mp3 | 20-Apr-2007 02:11 | 17K | |
![[SND]](/icons/sound2.gif) | Philippine Islands.mp3 | 20-Apr-2007 02:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | Philippine mahogany.mp3 | 20-Apr-2007 02:11 | 13K | |
![[SND]](/icons/sound2.gif) | philippine.mp3 | 20-Apr-2007 02:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | Philippines.mp3 | 20-Apr-2007 02:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | Philippopolis.mp3 | 20-Apr-2007 02:11 | 11K | |
![[SND]](/icons/sound2.gif) | philippus.mp3 | 20-Apr-2007 02:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Philips.mp3 | 20-Apr-2007 02:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | philism.mp3 | 20-Apr-2007 02:11 | 17K | |
![[SND]](/icons/sound2.gif) | philistia.mp3 | 20-Apr-2007 02:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | Philistine.mp3 | 20-Apr-2007 02:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | philistinism.mp3 | 20-Apr-2007 02:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | phillip.mp3 | 20-Apr-2007 02:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Phillips.mp3 | 20-Apr-2007 02:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | phillipsburg.mp3 | 20-Apr-2007 02:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | phillipsite.mp3 | 20-Apr-2007 02:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | Phillpotts.mp3 | 20-Apr-2007 02:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | phillumenist.mp3 | 20-Apr-2007 02:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | phillumeny.mp3 | 20-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | philly.mp3 | 20-Apr-2007 02:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Philo Judaeus.mp3 | 20-Apr-2007 02:12 | 13K | |
![[SND]](/icons/sound2.gif) | philo.mp3 | 20-Apr-2007 02:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | philobiblist.mp3 | 20-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | Philoctetes.mp3 | 20-Apr-2007 02:12 | 11K | |
![[SND]](/icons/sound2.gif) | philodendra.mp3 | 20-Apr-2007 02:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | philodendron.mp3 | 20-Apr-2007 02:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | philography.mp3 | 20-Apr-2007 02:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | philogyny.mp3 | 20-Apr-2007 02:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | philojudaeus.mp3 | 20-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | philologian.mp3 | 20-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | philological.mp3 | 20-Apr-2007 02:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | philologically.mp3 | 20-Apr-2007 02:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | philologist.mp3 | 20-Apr-2007 02:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | philologize.mp3 | 20-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | philologue.mp3 | 20-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | philology.mp3 | 20-Apr-2007 02:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | philomath.mp3 | 20-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | Philomel.mp3 | 20-Apr-2007 02:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | Philomela.mp3 | 20-Apr-2007 02:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | philopena.mp3 | 20-Apr-2007 02:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | philoprogenitive.mp3 | 20-Apr-2007 02:13 | 12K | |
![[SND]](/icons/sound2.gif) | philosophaster.mp3 | 20-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | philosophe.mp3 | 20-Apr-2007 02:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | philosopher.mp3 | 20-Apr-2007 02:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | philosophic.mp3 | 20-Apr-2007 02:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | philosophical.mp3 | 20-Apr-2007 02:13 | 9.6K | |
![[SND]](/icons/sound2.gif) | philosophically.mp3 | 20-Apr-2007 02:13 | 10K | |
![[SND]](/icons/sound2.gif) | philosophism.mp3 | 20-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | philosophize.mp3 | 20-Apr-2007 02:13 | 11K | |
![[SND]](/icons/sound2.gif) | philosophy.mp3 | 20-Apr-2007 02:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | philotechnic.mp3 | 20-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | philous.mp3 | 20-Apr-2007 02:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | philovance.mp3 | 20-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | philter.mp3 | 20-Apr-2007 02:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | philtre.mp3 | 20-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | philtrum.mp3 | 20-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | phily.mp3 | 20-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | phimosis.mp3 | 20-Apr-2007 02:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | phineas.mp3 | 20-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | phineus.mp3 | 20-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | phitsanulok.mp3 | 20-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | phiz.mp3 | 20-Apr-2007 02:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | phizgig.mp3 | 20-Apr-2007 02:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | phizzer.mp3 | 20-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | phlebectomy.mp3 | 20-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | phlebitis.mp3 | 20-Apr-2007 02:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | phlebo.mp3 | 20-Apr-2007 02:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | phlebogram.mp3 | 20-Apr-2007 02:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | phlebography.mp3 | 20-Apr-2007 02:14 | 17K | |
![[SND]](/icons/sound2.gif) | phleboid.mp3 | 20-Apr-2007 02:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | phlebology.mp3 | 20-Apr-2007 02:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | phlebotome.mp3 | 20-Apr-2007 02:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | phlebotomic.mp3 | 20-Apr-2007 02:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | phlebotomist.mp3 | 20-Apr-2007 02:14 | 10K | |
![[SND]](/icons/sound2.gif) | phlebotomize.mp3 | 20-Apr-2007 02:14 | 17K | |
![[SND]](/icons/sound2.gif) | phlebotomus fever.mp3 | 20-Apr-2007 02:14 | 12K | |
![[SND]](/icons/sound2.gif) | phlebotomusfever.mp3 | 20-Apr-2007 02:14 | 17K | |
![[SND]](/icons/sound2.gif) | phlebotomy.mp3 | 20-Apr-2007 02:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | Phlegethon.mp3 | 20-Apr-2007 02:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | phlegm.mp3 | 20-Apr-2007 02:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | phlegmatic.mp3 | 20-Apr-2007 02:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | phlegmatically.mp3 | 20-Apr-2007 02:14 | 10K | |
![[SND]](/icons/sound2.gif) | phlegmon.mp3 | 20-Apr-2007 02:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | phlegmy.mp3 | 20-Apr-2007 02:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | phloem.mp3 | 20-Apr-2007 02:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | phlogistic.mp3 | 20-Apr-2007 02:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | phlogisticatedair.mp3 | 20-Apr-2007 02:14 | 17K | |
![[SND]](/icons/sound2.gif) | phlogiston.mp3 | 20-Apr-2007 02:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | phlogopite.mp3 | 20-Apr-2007 02:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | phlorizin.mp3 | 20-Apr-2007 02:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | phloroglucinol.mp3 | 20-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | phlorrhizin.mp3 | 20-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | phlox.mp3 | 20-Apr-2007 02:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | phlug.mp3 | 20-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | phlyctena.mp3 | 20-Apr-2007 02:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | phlyctenule.mp3 | 20-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | Phnom Penh.mp3 | 20-Apr-2007 02:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | phobe.mp3 | 20-Apr-2007 02:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | phobia.mp3 | 20-Apr-2007 02:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | phobic.mp3 | 20-Apr-2007 02:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | phobos.mp3 | 20-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | phobous.mp3 | 20-Apr-2007 02:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | Phocaea.mp3 | 20-Apr-2007 02:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | Phocaean.mp3 | 20-Apr-2007 02:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | Phocian.mp3 | 20-Apr-2007 02:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | phocine.mp3 | 20-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | Phocion.mp3 | 20-Apr-2007 02:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | Phocis.mp3 | 20-Apr-2007 02:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | phocomelia.mp3 | 20-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | phocus.mp3 | 20-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | phoebe.mp3 | 20-Apr-2007 02:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | Phoebus.mp3 | 20-Apr-2007 02:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | Phoenicia.mp3 | 20-Apr-2007 02:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | Phoenician.mp3 | 20-Apr-2007 02:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | phoenix.mp3 | 20-Apr-2007 02:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | phoenixlike.mp3 | 20-Apr-2007 02:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | phoenixville.mp3 | 20-Apr-2007 02:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | phokomelia.mp3 | 20-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | pholas.mp3 | 20-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | pholidota.mp3 | 20-Apr-2007 02:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | phomvibane.mp3 | 20-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | phon.mp3 | 20-Apr-2007 02:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | phonate.mp3 | 20-Apr-2007 02:16 | 5.7K | |
![[SND]](/icons/sound2.gif) | phonathon.mp3 | 20-Apr-2007 02:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | phonation.mp3 | 20-Apr-2007 02:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | phone.mp3 | 20-Apr-2007 02:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | phone-in.mp3 | 20-Apr-2007 02:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | phonematic.mp3 | 20-Apr-2007 02:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | phonematics.mp3 | 20-Apr-2007 02:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | phoneme.mp3 | 20-Apr-2007 02:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | phonemic.mp3 | 20-Apr-2007 02:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | phonemically.mp3 | 20-Apr-2007 02:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | phonemicist.mp3 | 20-Apr-2007 02:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | phonemicize.mp3 | 20-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | phonemics.mp3 | 20-Apr-2007 02:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | phonendoscope.mp3 | 20-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | phoner.mp3 | 20-Apr-2007 02:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | phonesthemic.mp3 | 20-Apr-2007 02:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | phonetic.mp3 | 20-Apr-2007 02:17 | 6.4K | |
![[SND]](/icons/sound2.gif) | phonetically.mp3 | 20-Apr-2007 02:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | phonetician.mp3 | 20-Apr-2007 02:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | phoneticist.mp3 | 20-Apr-2007 02:17 | 17K | |
![[SND]](/icons/sound2.gif) | phoneticize.mp3 | 20-Apr-2007 02:17 | 17K | |
![[SND]](/icons/sound2.gif) | phonetics.mp3 | 20-Apr-2007 02:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | phonetist.mp3 | 20-Apr-2007 02:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | phonevision.mp3 | 20-Apr-2007 02:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | phoney.mp3 | 20-Apr-2007 02:17 | 5.2K | |
![[SND]](/icons/sound2.gif) | phonia.mp3 | 20-Apr-2007 02:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | phoniatrics.mp3 | 20-Apr-2007 02:17 | 17K | |
![[SND]](/icons/sound2.gif) | phonic.mp3 | 20-Apr-2007 02:17 | 5.5K | |
![[SND]](/icons/sound2.gif) | phonically.mp3 | 20-Apr-2007 02:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | phonics.mp3 | 20-Apr-2007 02:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | phonie.mp3 | 20-Apr-2007 02:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | phonily.mp3 | 20-Apr-2007 02:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | phoniness.mp3 | 20-Apr-2007 02:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | phono.mp3 | 20-Apr-2007 02:17 | 5.9K | |
![[SND]](/icons/sound2.gif) | phonocardiogram.mp3 | 20-Apr-2007 02:17 | 12K | |
![[SND]](/icons/sound2.gif) | phonocardiograph.mp3 | 20-Apr-2007 02:17 | 11K | |
![[SND]](/icons/sound2.gif) | phonocardiographic.mp3 | 20-Apr-2007 02:17 | 13K | |
![[SND]](/icons/sound2.gif) | phonocardiography.mp3 | 20-Apr-2007 02:17 | 13K | |
![[SND]](/icons/sound2.gif) | phonogram.mp3 | 20-Apr-2007 02:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | phonograph.mp3 | 20-Apr-2007 02:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | phonographer.mp3 | 20-Apr-2007 02:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | phonographic.mp3 | 20-Apr-2007 02:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | phonographically.mp3 | 20-Apr-2007 02:18 | 11K | |
![[SND]](/icons/sound2.gif) | phonography.mp3 | 20-Apr-2007 02:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | phonolite.mp3 | 20-Apr-2007 02:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | phonologic.mp3 | 20-Apr-2007 02:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | phonological.mp3 | 20-Apr-2007 02:18 | 10K | |
![[SND]](/icons/sound2.gif) | phonologically.mp3 | 20-Apr-2007 02:18 | 10K | |
![[SND]](/icons/sound2.gif) | phonologicalrule.mp3 | 20-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | phonologist.mp3 | 20-Apr-2007 02:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | phonology.mp3 | 20-Apr-2007 02:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | phonomania.mp3 | 20-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | phonometer.mp3 | 20-Apr-2007 02:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | phonon.mp3 | 20-Apr-2007 02:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | phonophore.mp3 | 20-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | phonoscope.mp3 | 20-Apr-2007 02:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | phonotactic.mp3 | 20-Apr-2007 02:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | phonotactics.mp3 | 20-Apr-2007 02:18 | 10K | |
![[SND]](/icons/sound2.gif) | phonotype.mp3 | 20-Apr-2007 02:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | phonotypy.mp3 | 20-Apr-2007 02:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | phonusbolonus.mp3 | 20-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | phony.mp3 | 20-Apr-2007 02:18 | 5.2K | |
![[SND]](/icons/sound2.gif) | phony-baloney.mp3 | 20-Apr-2007 02:18 | 11K | |
![[SND]](/icons/sound2.gif) | phoo.mp3 | 20-Apr-2007 02:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | phooey.mp3 | 20-Apr-2007 02:18 | 5.2K | |
![[SND]](/icons/sound2.gif) | phorate.mp3 | 20-Apr-2007 02:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | phorbol.mp3 | 20-Apr-2007 02:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | phore.mp3 | 20-Apr-2007 02:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | phoresis.mp3 | 20-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | phoresy.mp3 | 20-Apr-2007 02:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | phormium.mp3 | 20-Apr-2007 02:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | phoronid.mp3 | 20-Apr-2007 02:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | phorous.mp3 | 20-Apr-2007 02:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | phos.mp3 | 20-Apr-2007 02:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | phosgene.mp3 | 20-Apr-2007 02:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | phosgenite.mp3 | 20-Apr-2007 02:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | phosph.mp3 | 20-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | phosphagen.mp3 | 20-Apr-2007 02:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | phosphamidon.mp3 | 20-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | phosphatase.mp3 | 20-Apr-2007 02:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | phosphate.mp3 | 20-Apr-2007 02:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | phosphatic.mp3 | 20-Apr-2007 02:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | phosphatide.mp3 | 20-Apr-2007 02:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | phosphatidic.mp3 | 20-Apr-2007 02:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | phosphatidyl.mp3 | 20-Apr-2007 02:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | phosphatidylcholine.mp3 | 20-Apr-2007 02:19 | 14K | |
![[SND]](/icons/sound2.gif) | phosphatidylethanolamine.mp3 | 20-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | phosphatization.mp3 | 20-Apr-2007 02:19 | 12K | |
![[SND]](/icons/sound2.gif) | phosphatize.mp3 | 20-Apr-2007 02:19 | 10K | |
![[SND]](/icons/sound2.gif) | phosphaturia.mp3 | 20-Apr-2007 02:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | phosphene.mp3 | 20-Apr-2007 02:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | phosphide.mp3 | 20-Apr-2007 02:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | phosphine.mp3 | 20-Apr-2007 02:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | phosphite.mp3 | 20-Apr-2007 02:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | phospho.mp3 | 20-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | phosphocreatine.mp3 | 20-Apr-2007 02:20 | 13K | |
![[SND]](/icons/sound2.gif) | phosphodiesterase.mp3 | 20-Apr-2007 02:20 | 15K | |
![[SND]](/icons/sound2.gif) | phosphoenolpyruvate.mp3 | 20-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | phosphoenolpyruvic acid.mp3 | 20-Apr-2007 02:20 | 20K | |
![[SND]](/icons/sound2.gif) | phosphofructokinase.mp3 | 20-Apr-2007 02:20 | 16K | |
![[SND]](/icons/sound2.gif) | phosphoglucomutase.mp3 | 20-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | phosphoglyceraldehyde.mp3 | 20-Apr-2007 02:20 | 15K | |
![[SND]](/icons/sound2.gif) | phosphoglycerate.mp3 | 20-Apr-2007 02:20 | 12K | |
![[SND]](/icons/sound2.gif) | phosphoglyceric acid.mp3 | 20-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | phosphokinase.mp3 | 20-Apr-2007 02:20 | 12K | |
![[SND]](/icons/sound2.gif) | phospholipase.mp3 | 20-Apr-2007 02:20 | 13K | |
![[SND]](/icons/sound2.gif) | phospholipid.mp3 | 20-Apr-2007 02:20 | 10K | |
![[SND]](/icons/sound2.gif) | phosphomonoesterase.mp3 | 20-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | phosphonium.mp3 | 20-Apr-2007 02:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | phosphoprotein.mp3 | 20-Apr-2007 02:20 | 12K | |
![[SND]](/icons/sound2.gif) | phosphor.mp3 | 20-Apr-2007 02:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | phosphorate.mp3 | 20-Apr-2007 02:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | phosphore.mp3 | 20-Apr-2007 02:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | phosphoresce.mp3 | 20-Apr-2007 02:20 | 10K | |
![[SND]](/icons/sound2.gif) | phosphorescence.mp3 | 20-Apr-2007 02:20 | 11K | |
![[SND]](/icons/sound2.gif) | phosphorescent.mp3 | 20-Apr-2007 02:20 | 10K | |
![[SND]](/icons/sound2.gif) | phosphoreted.mp3 | 20-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | phosphoric.mp3 | 20-Apr-2007 02:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | phosphorism.mp3 | 20-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | phosphorite.mp3 | 20-Apr-2007 02:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | phosphoritic.mp3 | 20-Apr-2007 02:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | phosphorize.mp3 | 20-Apr-2007 02:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | phosphoro.mp3 | 20-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | phosphorolysis.mp3 | 20-Apr-2007 02:21 | 12K | |
![[SND]](/icons/sound2.gif) | phosphorolytic.mp3 | 20-Apr-2007 02:21 | 11K | |
![[SND]](/icons/sound2.gif) | phosphoroscope.mp3 | 20-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | phosphorous.mp3 | 20-Apr-2007 02:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | phosphorus.mp3 | 20-Apr-2007 02:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | phosphoruspentoxide.mp3 | 20-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | phosphorussesquisulfide.mp3 | 20-Apr-2007 02:21 | 18K | |
![[SND]](/icons/sound2.gif) | phosphoryl.mp3 | 20-Apr-2007 02:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | phosphorylase.mp3 | 20-Apr-2007 02:21 | 11K | |
![[SND]](/icons/sound2.gif) | phosphorylate.mp3 | 20-Apr-2007 02:21 | 11K | |
![[SND]](/icons/sound2.gif) | phosphorylation.mp3 | 20-Apr-2007 02:21 | 12K | |
![[SND]](/icons/sound2.gif) | phosphorylative.mp3 | 20-Apr-2007 02:21 | 10K | |
![[SND]](/icons/sound2.gif) | phosphureted.mp3 | 20-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | phossyjaw.mp3 | 20-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | phosvel.mp3 | 20-Apr-2007 02:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | phot.mp3 | 20-Apr-2007 02:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | photalgia.mp3 | 20-Apr-2007 02:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | photic.mp3 | 20-Apr-2007 02:21 | 5.4K | |
![[SND]](/icons/sound2.gif) | photically.mp3 | 20-Apr-2007 02:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | photics.mp3 | 20-Apr-2007 02:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | photinia.mp3 | 20-Apr-2007 02:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | photino.mp3 | 20-Apr-2007 02:22 | 17K | |
![[SND]](/icons/sound2.gif) | photism.mp3 | 20-Apr-2007 02:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | photius.mp3 | 20-Apr-2007 02:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | photo op.mp3 | 20-Apr-2007 02:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | photo.mp3 | 20-Apr-2007 02:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | photoaging.mp3 | 20-Apr-2007 02:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | photoautotroph.mp3 | 20-Apr-2007 02:22 | 12K | |
![[SND]](/icons/sound2.gif) | photoautotrophic.mp3 | 20-Apr-2007 02:22 | 12K | |
![[SND]](/icons/sound2.gif) | photoautotrophically.mp3 | 20-Apr-2007 02:22 | 13K | |
![[SND]](/icons/sound2.gif) | photobathic.mp3 | 20-Apr-2007 02:22 | 17K | |
![[SND]](/icons/sound2.gif) | photobiologic.mp3 | 20-Apr-2007 02:22 | 11K | |
![[SND]](/icons/sound2.gif) | photobiological.mp3 | 20-Apr-2007 02:22 | 12K | |
![[SND]](/icons/sound2.gif) | photobiologist.mp3 | 20-Apr-2007 02:22 | 13K | |
![[SND]](/icons/sound2.gif) | photobiology.mp3 | 20-Apr-2007 02:22 | 12K | |
![[SND]](/icons/sound2.gif) | photocathode.mp3 | 20-Apr-2007 02:22 | 10K | |
![[SND]](/icons/sound2.gif) | photocell.mp3 | 20-Apr-2007 02:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | photochemical.mp3 | 20-Apr-2007 02:22 | 9.3K | |
![[SND]](/icons/sound2.gif) | photochemically.mp3 | 20-Apr-2007 02:22 | 12K | |
![[SND]](/icons/sound2.gif) | photochemist.mp3 | 20-Apr-2007 02:22 | 10K | |
![[SND]](/icons/sound2.gif) | photochemistry.mp3 | 20-Apr-2007 02:22 | 11K | |
![[SND]](/icons/sound2.gif) | photochromic.mp3 | 20-Apr-2007 02:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | photochromism.mp3 | 20-Apr-2007 02:22 | 10K | |
![[SND]](/icons/sound2.gif) | photocoagulation.mp3 | 20-Apr-2007 02:23 | 14K | |
![[SND]](/icons/sound2.gif) | photocompose.mp3 | 20-Apr-2007 02:23 | 11K | |
![[SND]](/icons/sound2.gif) | photocomposition.mp3 | 20-Apr-2007 02:23 | 12K | |
![[SND]](/icons/sound2.gif) | photoconductive.mp3 | 20-Apr-2007 02:23 | 11K | |
![[SND]](/icons/sound2.gif) | photoconductivity.mp3 | 20-Apr-2007 02:23 | 13K | |
![[SND]](/icons/sound2.gif) | photocopy.mp3 | 20-Apr-2007 02:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | photocurrent.mp3 | 20-Apr-2007 02:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | photodecomposition.mp3 | 20-Apr-2007 02:23 | 14K | |
![[SND]](/icons/sound2.gif) | photodegradable.mp3 | 20-Apr-2007 02:23 | 11K | |
![[SND]](/icons/sound2.gif) | photodetector.mp3 | 20-Apr-2007 02:23 | 10K | |
![[SND]](/icons/sound2.gif) | photodiode.mp3 | 20-Apr-2007 02:23 | 10K | |
![[SND]](/icons/sound2.gif) | photodisintegrate.mp3 | 20-Apr-2007 02:23 | 12K | |
![[SND]](/icons/sound2.gif) | photodisintegration.mp3 | 20-Apr-2007 02:23 | 14K | |
![[SND]](/icons/sound2.gif) | photodissociate.mp3 | 20-Apr-2007 02:23 | 12K | |
![[SND]](/icons/sound2.gif) | photodissociation.mp3 | 20-Apr-2007 02:23 | 14K | |
![[SND]](/icons/sound2.gif) | photoduplicate.mp3 | 20-Apr-2007 02:23 | 11K | |
![[SND]](/icons/sound2.gif) | photoduplication.mp3 | 20-Apr-2007 02:23 | 12K | |
![[SND]](/icons/sound2.gif) | photodynamic.mp3 | 20-Apr-2007 02:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | photodynamically.mp3 | 20-Apr-2007 02:23 | 12K | |
![[SND]](/icons/sound2.gif) | photoelectric.mp3 | 20-Apr-2007 02:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | photoelectrically.mp3 | 20-Apr-2007 02:23 | 11K | |
![[SND]](/icons/sound2.gif) | photoelectron.mp3 | 20-Apr-2007 02:23 | 10K | |
![[SND]](/icons/sound2.gif) | photoelectronic.mp3 | 20-Apr-2007 02:23 | 11K | |
![[SND]](/icons/sound2.gif) | photoemission.mp3 | 20-Apr-2007 02:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | photoemissive.mp3 | 20-Apr-2007 02:23 | 10K | |
![[SND]](/icons/sound2.gif) | photoengrave.mp3 | 20-Apr-2007 02:24 | 11K | |
![[SND]](/icons/sound2.gif) | photo-essay.mp3 | 20-Apr-2007 02:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | photoexcitation.mp3 | 20-Apr-2007 02:24 | 14K | |
![[SND]](/icons/sound2.gif) | photoexcited.mp3 | 20-Apr-2007 02:24 | 10K | |
![[SND]](/icons/sound2.gif) | photofinisher.mp3 | 20-Apr-2007 02:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | photofinishing.mp3 | 20-Apr-2007 02:24 | 10K | |
![[SND]](/icons/sound2.gif) | photofit.mp3 | 20-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | photoflash.mp3 | 20-Apr-2007 02:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | photoflood.mp3 | 20-Apr-2007 02:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | photofluorogram.mp3 | 20-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | photofluorography.mp3 | 20-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | photog.mp3 | 20-Apr-2007 02:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | photogen.mp3 | 20-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | photogene.mp3 | 20-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | photogenic.mp3 | 20-Apr-2007 02:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | photogenically.mp3 | 20-Apr-2007 02:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | photogeologic.mp3 | 20-Apr-2007 02:24 | 11K | |
![[SND]](/icons/sound2.gif) | photogeological.mp3 | 20-Apr-2007 02:24 | 13K | |
![[SND]](/icons/sound2.gif) | photogeologist.mp3 | 20-Apr-2007 02:24 | 13K | |
![[SND]](/icons/sound2.gif) | photogeology.mp3 | 20-Apr-2007 02:24 | 12K | |
![[SND]](/icons/sound2.gif) | photoglyph.mp3 | 20-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | photogram.mp3 | 20-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | photogrammetric.mp3 | 20-Apr-2007 02:24 | 9.6K | |
![[SND]](/icons/sound2.gif) | photogrammetrist.mp3 | 20-Apr-2007 02:24 | 11K | |
![[SND]](/icons/sound2.gif) | photogrammetry.mp3 | 20-Apr-2007 02:25 | 10K | |
![[SND]](/icons/sound2.gif) | photograph.mp3 | 20-Apr-2007 02:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | photographer.mp3 | 20-Apr-2007 02:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | photographic.mp3 | 20-Apr-2007 02:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | photographica.mp3 | 20-Apr-2007 02:25 | 17K | |
![[SND]](/icons/sound2.gif) | photographically.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photography.mp3 | 20-Apr-2007 02:25 | 10K | |
![[SND]](/icons/sound2.gif) | photogravure.mp3 | 20-Apr-2007 02:25 | 10K | |
![[SND]](/icons/sound2.gif) | photoinduced.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photoinduction.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photoinductive.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photointerpretation.mp3 | 20-Apr-2007 02:25 | 13K | |
![[SND]](/icons/sound2.gif) | photointerpreter.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photoionization.mp3 | 20-Apr-2007 02:25 | 13K | |
![[SND]](/icons/sound2.gif) | photoionize.mp3 | 20-Apr-2007 02:25 | 12K | |
![[SND]](/icons/sound2.gif) | photojournalism.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photojournalist.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photojournalistic.mp3 | 20-Apr-2007 02:25 | 12K | |
![[SND]](/icons/sound2.gif) | photokinesis.mp3 | 20-Apr-2007 02:25 | 12K | |
![[SND]](/icons/sound2.gif) | photokinetic.mp3 | 20-Apr-2007 02:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | photolitho.mp3 | 20-Apr-2007 02:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | photolithograph.mp3 | 20-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | photolithographic.mp3 | 20-Apr-2007 02:25 | 12K | |
![[SND]](/icons/sound2.gif) | photolithographically.mp3 | 20-Apr-2007 02:25 | 13K | |
![[SND]](/icons/sound2.gif) | photolithography.mp3 | 20-Apr-2007 02:25 | 12K | |
![[SND]](/icons/sound2.gif) | photolysis.mp3 | 20-Apr-2007 02:26 | 11K | |
![[SND]](/icons/sound2.gif) | photolytic.mp3 | 20-Apr-2007 02:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | photolytically.mp3 | 20-Apr-2007 02:26 | 10K | |
![[SND]](/icons/sound2.gif) | photolyzable.mp3 | 20-Apr-2007 02:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | photolyze.mp3 | 20-Apr-2007 02:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | photomap.mp3 | 20-Apr-2007 02:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | photomask.mp3 | 20-Apr-2007 02:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | photomat.mp3 | 20-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | photomaton.mp3 | 20-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | photomechanical.mp3 | 20-Apr-2007 02:26 | 10K | |
![[SND]](/icons/sound2.gif) | photomechanically.mp3 | 20-Apr-2007 02:26 | 12K | |
![[SND]](/icons/sound2.gif) | photometer.mp3 | 20-Apr-2007 02:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | photometric.mp3 | 20-Apr-2007 02:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | photometrically.mp3 | 20-Apr-2007 02:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | photometry.mp3 | 20-Apr-2007 02:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | photomicrograph.mp3 | 20-Apr-2007 02:26 | 11K | |
![[SND]](/icons/sound2.gif) | photomicrographic.mp3 | 20-Apr-2007 02:26 | 12K | |
![[SND]](/icons/sound2.gif) | photomicrography.mp3 | 20-Apr-2007 02:26 | 11K | |
![[SND]](/icons/sound2.gif) | photomontage.mp3 | 20-Apr-2007 02:26 | 12K | |
![[SND]](/icons/sound2.gif) | photomorphogenesis.mp3 | 20-Apr-2007 02:26 | 14K | |
![[SND]](/icons/sound2.gif) | photomorphogenic.mp3 | 20-Apr-2007 02:26 | 11K | |
![[SND]](/icons/sound2.gif) | photomosaic.mp3 | 20-Apr-2007 02:26 | 10K | |
![[SND]](/icons/sound2.gif) | photomultiplier tube.mp3 | 20-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | photomural.mp3 | 20-Apr-2007 02:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | photon.mp3 | 20-Apr-2007 02:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | photonasty.mp3 | 20-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | photonegative.mp3 | 20-Apr-2007 02:27 | 9.6K | |
![[SND]](/icons/sound2.gif) | photonic.mp3 | 20-Apr-2007 02:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | photonics.mp3 | 20-Apr-2007 02:27 | 9.6K | |
![[SND]](/icons/sound2.gif) | photonuclear.mp3 | 20-Apr-2007 02:27 | 9.6K | |
![[SND]](/icons/sound2.gif) | photo-offset.mp3 | 20-Apr-2007 02:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | photooxidation.mp3 | 20-Apr-2007 02:27 | 13K | |
![[SND]](/icons/sound2.gif) | photooxidative.mp3 | 20-Apr-2007 02:27 | 11K | |
![[SND]](/icons/sound2.gif) | photooxidize.mp3 | 20-Apr-2007 02:27 | 13K | |
![[SND]](/icons/sound2.gif) | photopathy.mp3 | 20-Apr-2007 02:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | photoperiod.mp3 | 20-Apr-2007 02:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | photoperiodic.mp3 | 20-Apr-2007 02:27 | 12K | |
![[SND]](/icons/sound2.gif) | photoperiodically.mp3 | 20-Apr-2007 02:27 | 13K | |
![[SND]](/icons/sound2.gif) | photoperiodism.mp3 | 20-Apr-2007 02:27 | 12K | |
![[SND]](/icons/sound2.gif) | photophase.mp3 | 20-Apr-2007 02:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | photophilic.mp3 | 20-Apr-2007 02:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | photophobia.mp3 | 20-Apr-2007 02:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | photophobic.mp3 | 20-Apr-2007 02:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | photophore.mp3 | 20-Apr-2007 02:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | photophosphorylation.mp3 | 20-Apr-2007 02:27 | 14K | |
![[SND]](/icons/sound2.gif) | photopia.mp3 | 20-Apr-2007 02:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | photopic.mp3 | 20-Apr-2007 02:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | photoplay.mp3 | 20-Apr-2007 02:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | photopolarimeter.mp3 | 20-Apr-2007 02:27 | 12K | |
![[SND]](/icons/sound2.gif) | photopolymer.mp3 | 20-Apr-2007 02:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | photopositive.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photoproduct.mp3 | 20-Apr-2007 02:28 | 10K | |
![[SND]](/icons/sound2.gif) | photoreaction.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photoreactivating.mp3 | 20-Apr-2007 02:28 | 13K | |
![[SND]](/icons/sound2.gif) | photoreactivation.mp3 | 20-Apr-2007 02:28 | 14K | |
![[SND]](/icons/sound2.gif) | photo-realism.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photo-realist.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photo-realistic.mp3 | 20-Apr-2007 02:28 | 12K | |
![[SND]](/icons/sound2.gif) | photorecce.mp3 | 20-Apr-2007 02:28 | 17K | |
![[SND]](/icons/sound2.gif) | photoreception.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photoreceptive.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photoreceptor.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photoreconnaissance.mp3 | 20-Apr-2007 02:28 | 13K | |
![[SND]](/icons/sound2.gif) | photoreduce.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photoreduction.mp3 | 20-Apr-2007 02:28 | 10K | |
![[SND]](/icons/sound2.gif) | photorefractive keratectomy.mp3 | 20-Apr-2007 02:28 | 19K | |
![[SND]](/icons/sound2.gif) | photoreproduction.mp3 | 20-Apr-2007 02:28 | 12K | |
![[SND]](/icons/sound2.gif) | photoresist.mp3 | 20-Apr-2007 02:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | photorespiration.mp3 | 20-Apr-2007 02:28 | 12K | |
![[SND]](/icons/sound2.gif) | photosensitive.mp3 | 20-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | photosensitivity.mp3 | 20-Apr-2007 02:28 | 13K | |
![[SND]](/icons/sound2.gif) | photosensitization.mp3 | 20-Apr-2007 02:28 | 14K | |
![[SND]](/icons/sound2.gif) | photosensitize.mp3 | 20-Apr-2007 02:28 | 13K | |
![[SND]](/icons/sound2.gif) | photoset.mp3 | 20-Apr-2007 02:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | photosphere.mp3 | 20-Apr-2007 02:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | photospheric.mp3 | 20-Apr-2007 02:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | photostat.mp3 | 20-Apr-2007 02:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | photostatic.mp3 | 20-Apr-2007 02:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | photosynthate.mp3 | 20-Apr-2007 02:29 | 9.6K | |
![[SND]](/icons/sound2.gif) | photosynthesis.mp3 | 20-Apr-2007 02:29 | 11K | |
![[SND]](/icons/sound2.gif) | photosynthesize.mp3 | 20-Apr-2007 02:29 | 13K | |
![[SND]](/icons/sound2.gif) | photosynthetic.mp3 | 20-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | photosynthetically.mp3 | 20-Apr-2007 02:29 | 12K | |
![[SND]](/icons/sound2.gif) | photosystem.mp3 | 20-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | phototactic.mp3 | 20-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | phototactically.mp3 | 20-Apr-2007 02:29 | 11K | |
![[SND]](/icons/sound2.gif) | phototaxis.mp3 | 20-Apr-2007 02:29 | 11K | |
![[SND]](/icons/sound2.gif) | phototelegraphy.mp3 | 20-Apr-2007 02:29 | 11K | |
![[SND]](/icons/sound2.gif) | phototherapy.mp3 | 20-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | phototonus.mp3 | 20-Apr-2007 02:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | phototoxic.mp3 | 20-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | phototoxicity.mp3 | 20-Apr-2007 02:29 | 12K | |
![[SND]](/icons/sound2.gif) | phototransistor.mp3 | 20-Apr-2007 02:29 | 12K | |
![[SND]](/icons/sound2.gif) | phototroph.mp3 | 20-Apr-2007 02:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | phototropic.mp3 | 20-Apr-2007 02:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | phototropically.mp3 | 20-Apr-2007 02:29 | 9.8K | |
![[SND]](/icons/sound2.gif) | phototropism.mp3 | 20-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | phototube.mp3 | 20-Apr-2007 02:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | phototypesetting.mp3 | 20-Apr-2007 02:29 | 11K | |
![[SND]](/icons/sound2.gif) | photovoltaic.mp3 | 20-Apr-2007 02:29 | 11K | |
![[SND]](/icons/sound2.gif) | phpht.mp3 | 20-Apr-2007 02:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | Phra Nakhon Si Ayutthaya.mp3 | 20-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | phragmites.mp3 | 20-Apr-2007 02:30 | 10K | |
![[SND]](/icons/sound2.gif) | phragmoplast.mp3 | 20-Apr-2007 02:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | phrasal.mp3 | 20-Apr-2007 02:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | phrasally.mp3 | 20-Apr-2007 02:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | phrase.mp3 | 20-Apr-2007 02:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | phrasemaker.mp3 | 20-Apr-2007 02:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | phrasemaking.mp3 | 20-Apr-2007 02:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | phrasemonger.mp3 | 20-Apr-2007 02:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | phrasemongering.mp3 | 20-Apr-2007 02:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | phraseogram.mp3 | 20-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | phraseograph.mp3 | 20-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | phraseological.mp3 | 20-Apr-2007 02:30 | 11K | |
![[SND]](/icons/sound2.gif) | phraseologist.mp3 | 20-Apr-2007 02:30 | 11K | |
![[SND]](/icons/sound2.gif) | phraseology.mp3 | 20-Apr-2007 02:30 | 10K | |
![[SND]](/icons/sound2.gif) | phrasing.mp3 | 20-Apr-2007 02:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | phratry.mp3 | 20-Apr-2007 02:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | phreak.mp3 | 20-Apr-2007 02:30 | 4.8K | |
![[SND]](/icons/sound2.gif) | phreaker.mp3 | 20-Apr-2007 02:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | phreaking.mp3 | 20-Apr-2007 02:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | phreatic.mp3 | 20-Apr-2007 02:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | phreatophyte.mp3 | 20-Apr-2007 02:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | phreatophytic.mp3 | 20-Apr-2007 02:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | phren.mp3 | 20-Apr-2007 02:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | phrenetic.mp3 | 20-Apr-2007 02:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | phrenia.mp3 | 20-Apr-2007 02:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | phrenic.mp3 | 20-Apr-2007 02:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | phrenitis.mp3 | 20-Apr-2007 02:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | phreno.mp3 | 20-Apr-2007 02:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | phrenological.mp3 | 20-Apr-2007 02:31 | 10K | |
![[SND]](/icons/sound2.gif) | phrenologist.mp3 | 20-Apr-2007 02:31 | 10K | |
![[SND]](/icons/sound2.gif) | phrenology.mp3 | 20-Apr-2007 02:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | phrensy.mp3 | 20-Apr-2007 02:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | phrixus.mp3 | 20-Apr-2007 02:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | phronesis.mp3 | 20-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | Phrygia.mp3 | 20-Apr-2007 02:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | Phrygian.mp3 | 20-Apr-2007 02:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | phryne.mp3 | 20-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | pht.mp3 | 20-Apr-2007 02:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | phthalate.mp3 | 20-Apr-2007 02:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | phthalic acid.mp3 | 20-Apr-2007 02:31 | 11K | |
![[SND]](/icons/sound2.gif) | phthalocyanine.mp3 | 20-Apr-2007 02:31 | 12K | |
![[SND]](/icons/sound2.gif) | phthiriasis.mp3 | 20-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | phthises.mp3 | 20-Apr-2007 02:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | phthisic.mp3 | 20-Apr-2007 02:31 | 5.2K | |
![[SND]](/icons/sound2.gif) | phthisical.mp3 | 20-Apr-2007 02:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | phthisis.mp3 | 20-Apr-2007 02:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | phugoid.mp3 | 20-Apr-2007 02:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | phuket.mp3 | 20-Apr-2007 02:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | phumfed.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phumiphonaduldet.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phut.mp3 | 20-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | phutz.mp3 | 20-Apr-2007 02:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | phy.mp3 | 20-Apr-2007 02:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | phyceae.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phyco.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phycobilin.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phycobiont.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phycocyanin.mp3 | 20-Apr-2007 02:32 | 11K | |
![[SND]](/icons/sound2.gif) | phycoerythrin.mp3 | 20-Apr-2007 02:32 | 11K | |
![[SND]](/icons/sound2.gif) | phycological.mp3 | 20-Apr-2007 02:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | phycologist.mp3 | 20-Apr-2007 02:32 | 10K | |
![[SND]](/icons/sound2.gif) | phycology.mp3 | 20-Apr-2007 02:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | phycomycete.mp3 | 20-Apr-2007 02:32 | 10K | |
![[SND]](/icons/sound2.gif) | phycomycetes.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phycomycetous.mp3 | 20-Apr-2007 02:32 | 12K | |
![[SND]](/icons/sound2.gif) | Phyfe.mp3 | 20-Apr-2007 02:32 | 4.6K | |
![[SND]](/icons/sound2.gif) | phyl.mp3 | 20-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyla.mp3 | 20-Apr-2007 02:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | phylactery.mp3 | 20-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | phylactic.mp3 | 20-Apr-2007 02:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | phylae.mp3 | 20-Apr-2007 02:32 | 5.9K | |
![[SND]](/icons/sound2.gif) | phylakopi.mp3 | 20-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | phyle.mp3 | 20-Apr-2007 02:32 | 5.9K | |
![[SND]](/icons/sound2.gif) | phyletic.mp3 | 20-Apr-2007 02:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | phyletically.mp3 | 20-Apr-2007 02:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | phyletics.mp3 | 20-Apr-2007 02:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | phyll.mp3 | 20-Apr-2007 02:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyllary.mp3 | 20-Apr-2007 02:33 | 5.9K | |
![[SND]](/icons/sound2.gif) | phyllid.mp3 | 20-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | phyllis.mp3 | 20-Apr-2007 02:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyllite.mp3 | 20-Apr-2007 02:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyllo.mp3 | 20-Apr-2007 02:33 | 6.3K | |
![[SND]](/icons/sound2.gif) | phylloclade.mp3 | 20-Apr-2007 02:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | phyllocladous.mp3 | 20-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | phyllode.mp3 | 20-Apr-2007 02:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | phyllodium.mp3 | 20-Apr-2007 02:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | phyllody.mp3 | 20-Apr-2007 02:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | phylloid.mp3 | 20-Apr-2007 02:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyllomania.mp3 | 20-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | phyllome.mp3 | 20-Apr-2007 02:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | phyllophagous.mp3 | 20-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | phyllophore.mp3 | 20-Apr-2007 02:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | phyllopod.mp3 | 20-Apr-2007 02:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | phylloquinone.mp3 | 20-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | phyllostome.mp3 | 20-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | phyllotactic.mp3 | 20-Apr-2007 02:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | phyllotaxis.mp3 | 20-Apr-2007 02:33 | 12K | |
![[SND]](/icons/sound2.gif) | phyllotaxy.mp3 | 20-Apr-2007 02:33 | 9.5K | |
![[SND]](/icons/sound2.gif) | phyllous.mp3 | 20-Apr-2007 02:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | phylloxera.mp3 | 20-Apr-2007 02:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | phylo.mp3 | 20-Apr-2007 02:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | phylogenetic.mp3 | 20-Apr-2007 02:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | phylogenetically.mp3 | 20-Apr-2007 02:34 | 12K | |
![[SND]](/icons/sound2.gif) | phylogeny.mp3 | 20-Apr-2007 02:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | phylon.mp3 | 20-Apr-2007 02:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | phylum.mp3 | 20-Apr-2007 02:34 | 5.7K | |
![[SND]](/icons/sound2.gif) | phyma.mp3 | 20-Apr-2007 02:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyre.mp3 | 20-Apr-2007 02:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | phys ed.mp3 | 20-Apr-2007 02:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | physed.mp3 | 20-Apr-2007 02:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | physiatrics.mp3 | 20-Apr-2007 02:34 | 17K | |
![[SND]](/icons/sound2.gif) | physiatrist.mp3 | 20-Apr-2007 02:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | physiatry.mp3 | 20-Apr-2007 02:34 | 17K | |
![[SND]](/icons/sound2.gif) | physic.mp3 | 20-Apr-2007 02:34 | 5.4K | |
![[SND]](/icons/sound2.gif) | physical.mp3 | 20-Apr-2007 02:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | physicalism.mp3 | 20-Apr-2007 02:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | physicalist.mp3 | 20-Apr-2007 02:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | physicalistic.mp3 | 20-Apr-2007 02:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | physicality.mp3 | 20-Apr-2007 02:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | physicalize.mp3 | 20-Apr-2007 02:34 | 11K | |
![[SND]](/icons/sound2.gif) | physically.mp3 | 20-Apr-2007 02:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | physicalness.mp3 | 20-Apr-2007 02:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | physicals.mp3 | 20-Apr-2007 02:34 | 17K | |
![[SND]](/icons/sound2.gif) | physician.mp3 | 20-Apr-2007 02:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | physicist.mp3 | 20-Apr-2007 02:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | physicky.mp3 | 20-Apr-2007 02:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | physico.mp3 | 20-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | physicochemical.mp3 | 20-Apr-2007 02:35 | 10K | |
![[SND]](/icons/sound2.gif) | physicochemically.mp3 | 20-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | physics.mp3 | 20-Apr-2007 02:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | physio.mp3 | 20-Apr-2007 02:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | physiocrat.mp3 | 20-Apr-2007 02:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | physiocratic.mp3 | 20-Apr-2007 02:35 | 10K | |
![[SND]](/icons/sound2.gif) | physiognomic.mp3 | 20-Apr-2007 02:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | physiognomical.mp3 | 20-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | physiognomically.mp3 | 20-Apr-2007 02:35 | 12K | |
![[SND]](/icons/sound2.gif) | physiognomy.mp3 | 20-Apr-2007 02:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | physiographer.mp3 | 20-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | physiographic.mp3 | 20-Apr-2007 02:35 | 10K | |
![[SND]](/icons/sound2.gif) | physiographical.mp3 | 20-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | physiography.mp3 | 20-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | physiolatry.mp3 | 20-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | physiologic.mp3 | 20-Apr-2007 02:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | physiological.mp3 | 20-Apr-2007 02:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | physiologically.mp3 | 20-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | physiologist.mp3 | 20-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | physiology.mp3 | 20-Apr-2007 02:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | physiometry.mp3 | 20-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | physiopathologic.mp3 | 20-Apr-2007 02:36 | 14K | |
![[SND]](/icons/sound2.gif) | physiopathological.mp3 | 20-Apr-2007 02:36 | 14K | |
![[SND]](/icons/sound2.gif) | physiopathology.mp3 | 20-Apr-2007 02:36 | 13K | |
![[SND]](/icons/sound2.gif) | physiotherapist.mp3 | 20-Apr-2007 02:36 | 12K | |
![[SND]](/icons/sound2.gif) | physiotherapy.mp3 | 20-Apr-2007 02:36 | 11K | |
![[SND]](/icons/sound2.gif) | physique.mp3 | 20-Apr-2007 02:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | physis.mp3 | 20-Apr-2007 02:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | physo.mp3 | 20-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | physoclistous.mp3 | 20-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | physostigmine.mp3 | 20-Apr-2007 02:36 | 11K | |
![[SND]](/icons/sound2.gif) | physostomous.mp3 | 20-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | phyt.mp3 | 20-Apr-2007 02:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | phytane.mp3 | 20-Apr-2007 02:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | phytate.mp3 | 20-Apr-2007 02:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyte.mp3 | 20-Apr-2007 02:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | phyticacid.mp3 | 20-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | phytin.mp3 | 20-Apr-2007 02:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | phyto.mp3 | 20-Apr-2007 02:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | phytoalexin.mp3 | 20-Apr-2007 02:36 | 11K | |
![[SND]](/icons/sound2.gif) | phytochemical.mp3 | 20-Apr-2007 02:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | phytochemically.mp3 | 20-Apr-2007 02:36 | 9.3K | |
![[SND]](/icons/sound2.gif) | phytochemist.mp3 | 20-Apr-2007 02:36 | 10K | |
![[SND]](/icons/sound2.gif) | phytochemistry.mp3 | 20-Apr-2007 02:36 | 11K | |
![[SND]](/icons/sound2.gif) | phytochrome.mp3 | 20-Apr-2007 02:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | phytocide.mp3 | 20-Apr-2007 02:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | phytocoenosis.mp3 | 20-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | phytoestrogen.mp3 | 20-Apr-2007 02:37 | 11K | |
![[SND]](/icons/sound2.gif) | phytoflagellate.mp3 | 20-Apr-2007 02:37 | 11K | |
![[SND]](/icons/sound2.gif) | phytogenic.mp3 | 20-Apr-2007 02:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | phytogeny.mp3 | 20-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | phytogeographer.mp3 | 20-Apr-2007 02:37 | 12K | |
![[SND]](/icons/sound2.gif) | phytogeographic.mp3 | 20-Apr-2007 02:37 | 12K | |
![[SND]](/icons/sound2.gif) | phytogeographical.mp3 | 20-Apr-2007 02:37 | 13K | |
![[SND]](/icons/sound2.gif) | phytogeographically.mp3 | 20-Apr-2007 02:37 | 13K | |
![[SND]](/icons/sound2.gif) | phytogeography.mp3 | 20-Apr-2007 02:37 | 12K | |
![[SND]](/icons/sound2.gif) | phytography.mp3 | 20-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | phytohemagglutinin.mp3 | 20-Apr-2007 02:37 | 13K | |
![[SND]](/icons/sound2.gif) | phytohormone.mp3 | 20-Apr-2007 02:37 | 10K | |
![[SND]](/icons/sound2.gif) | phytol.mp3 | 20-Apr-2007 02:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | phytolite.mp3 | 20-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | phytolith.mp3 | 20-Apr-2007 02:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | phytology.mp3 | 20-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | phytomer.mp3 | 20-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | phyton.mp3 | 20-Apr-2007 02:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | phytonadione.mp3 | 20-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | phytonic.mp3 | 20-Apr-2007 02:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | phytopathogen.mp3 | 20-Apr-2007 02:37 | 11K | |
![[SND]](/icons/sound2.gif) | phytopathogenic.mp3 | 20-Apr-2007 02:37 | 12K | |
![[SND]](/icons/sound2.gif) | phytopathological.mp3 | 20-Apr-2007 02:37 | 13K | |
![[SND]](/icons/sound2.gif) | phytopathology.mp3 | 20-Apr-2007 02:37 | 11K | |
![[SND]](/icons/sound2.gif) | phytophagous.mp3 | 20-Apr-2007 02:38 | 11K | |
![[SND]](/icons/sound2.gif) | phytophthora.mp3 | 20-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | phytoplankter.mp3 | 20-Apr-2007 02:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | phytoplankton.mp3 | 20-Apr-2007 02:38 | 10K | |
![[SND]](/icons/sound2.gif) | phytoplanktonic.mp3 | 20-Apr-2007 02:38 | 12K | |
![[SND]](/icons/sound2.gif) | phytoplasm.mp3 | 20-Apr-2007 02:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | phytoplasma.mp3 | 20-Apr-2007 02:38 | 11K | |
![[SND]](/icons/sound2.gif) | phytosaur.mp3 | 20-Apr-2007 02:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | phytosociological.mp3 | 20-Apr-2007 02:38 | 14K | |
![[SND]](/icons/sound2.gif) | phytosociology.mp3 | 20-Apr-2007 02:38 | 13K | |
![[SND]](/icons/sound2.gif) | phytosterol.mp3 | 20-Apr-2007 02:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | phytosuccivorous.mp3 | 20-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | phytotomy.mp3 | 20-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | phytotoxic.mp3 | 20-Apr-2007 02:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | phytotoxicity.mp3 | 20-Apr-2007 02:38 | 12K | |
![[SND]](/icons/sound2.gif) | phytotron.mp3 | 20-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | phytozoon.mp3 | 20-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | pi.mp3 | 20-Apr-2007 02:38 | 5.4K | |
![[SND]](/icons/sound2.gif) | pia mater.mp3 | 20-Apr-2007 02:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | pia.mp3 | 20-Apr-2007 02:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | Piacenza.mp3 | 20-Apr-2007 02:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | piacular.mp3 | 20-Apr-2007 02:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | Piaf.mp3 | 20-Apr-2007 02:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | piaffe.mp3 | 20-Apr-2007 02:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | piaffer.mp3 | 20-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | Piaget.mp3 | 20-Apr-2007 02:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | Piagetian.mp3 | 20-Apr-2007 02:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | pial.mp3 | 20-Apr-2007 02:39 | 5.5K | |
![[SND]](/icons/sound2.gif) | piamater.mp3 | 20-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | pian.mp3 | 20-Apr-2007 02:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | pianette.mp3 | 20-Apr-2007 02:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | pianino.mp3 | 20-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | pianism.mp3 | 20-Apr-2007 02:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | pianissimi.mp3 | 20-Apr-2007 02:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | pianissimo.mp3 | 20-Apr-2007 02:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | pianist.mp3 | 20-Apr-2007 02:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | pianistic.mp3 | 20-Apr-2007 02:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | pianistically.mp3 | 20-Apr-2007 02:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | piano.mp3 | 20-Apr-2007 02:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | pianoforte.mp3 | 20-Apr-2007 02:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | pianola.mp3 | 20-Apr-2007 02:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | pianonobile.mp3 | 20-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | piarist.mp3 | 20-Apr-2007 02:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | piassava.mp3 | 20-Apr-2007 02:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | piaster.mp3 | 20-Apr-2007 02:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | piastre.mp3 | 20-Apr-2007 02:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | piat.mp3 | 20-Apr-2007 02:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | piatigorsk.mp3 | 20-Apr-2007 02:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | piatigorsky.mp3 | 20-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | Piauhy.mp3 | 20-Apr-2007 02:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | piaui.mp3 | 20-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | Piave.mp3 | 20-Apr-2007 02:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | piazza.mp3 | 20-Apr-2007 02:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | piazze.mp3 | 20-Apr-2007 02:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | piazzi.mp3 | 20-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | pibal.mp3 | 20-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | pibgorn.mp3 | 20-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | piblokto.mp3 | 20-Apr-2007 02:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | pibroch.mp3 | 20-Apr-2007 02:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | Pic de Nethou.mp3 | 20-Apr-2007 02:40 | 12K | |
![[SND]](/icons/sound2.gif) | pic.mp3 | 20-Apr-2007 02:40 | 3.9K | |
![[SND]](/icons/sound2.gif) | pica.mp3 | 20-Apr-2007 02:40 | 5.2K | |
![[SND]](/icons/sound2.gif) | picabia.mp3 | 20-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | picadillo.mp3 | 20-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | picador.mp3 | 20-Apr-2007 02:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | picadores.mp3 | 20-Apr-2007 02:40 | 9.5K | |
![[SND]](/icons/sound2.gif) | picadors.mp3 | 20-Apr-2007 02:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | picaninny.mp3 | 20-Apr-2007 02:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | picante.mp3 | 20-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | picara.mp3 | 20-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | Picard.mp3 | 20-Apr-2007 02:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | Picardie.mp3 | 20-Apr-2007 02:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | Picardy.mp3 | 20-Apr-2007 02:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | picaresque.mp3 | 20-Apr-2007 02:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | picaro.mp3 | 20-Apr-2007 02:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | picaroon.mp3 | 20-Apr-2007 02:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | Picasso.mp3 | 20-Apr-2007 02:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | Picassoesque.mp3 | 20-Apr-2007 02:41 | 10K | |
![[SND]](/icons/sound2.gif) | picayune.mp3 | 20-Apr-2007 02:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | picayunish.mp3 | 20-Apr-2007 02:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | piccadilly.mp3 | 20-Apr-2007 02:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | piccalilli.mp3 | 20-Apr-2007 02:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | piccanin.mp3 | 20-Apr-2007 02:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | piccaninny.mp3 | 20-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | Piccard.mp3 | 20-Apr-2007 02:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | piccata.mp3 | 20-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | piccinni.mp3 | 20-Apr-2007 02:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | piccolo.mp3 | 20-Apr-2007 02:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | piccoloist.mp3 | 20-Apr-2007 02:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | pice.mp3 | 20-Apr-2007 02:41 | 5.7K | |
![[SND]](/icons/sound2.gif) | Picenum.mp3 | 20-Apr-2007 02:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | piceous.mp3 | 20-Apr-2007 02:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | pich.mp3 | 20-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | pichiciago.mp3 | 20-Apr-2007 02:41 | 17K | |
![[SND]](/icons/sound2.gif) | picholine.mp3 | 20-Apr-2007 02:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | pick.mp3 | 20-Apr-2007 02:41 | 3.8K | |
![[SND]](/icons/sound2.gif) | pickaback.mp3 | 20-Apr-2007 02:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | pick-and-roll.mp3 | 20-Apr-2007 02:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | pickaninny.mp3 | 20-Apr-2007 02:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | pickaroon.mp3 | 20-Apr-2007 02:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | pickax.mp3 | 20-Apr-2007 02:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | picked.mp3 | 20-Apr-2007 02:42 | 5.0K | |
![[SND]](/icons/sound2.gif) | pickeer.mp3 | 20-Apr-2007 02:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | pickel.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | pickelhaube.mp3 | 20-Apr-2007 02:42 | 17K | |
![[SND]](/icons/sound2.gif) | pickens.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | picker.mp3 | 20-Apr-2007 02:42 | 4.6K | |
![[SND]](/icons/sound2.gif) | pickerel.mp3 | 20-Apr-2007 02:42 | 5.5K | |
![[SND]](/icons/sound2.gif) | pickerelweed.mp3 | 20-Apr-2007 02:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pickering.mp3 | 20-Apr-2007 02:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | pickeringite.mp3 | 20-Apr-2007 02:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | picket.mp3 | 20-Apr-2007 02:42 | 4.5K | |
![[SND]](/icons/sound2.gif) | picketboat.mp3 | 20-Apr-2007 02:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | Pickett.mp3 | 20-Apr-2007 02:42 | 4.3K | |
![[SND]](/icons/sound2.gif) | pickford.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | pickin.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | picking.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | pickings.mp3 | 20-Apr-2007 02:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | pickle.mp3 | 20-Apr-2007 02:42 | 4.6K | |
![[SND]](/icons/sound2.gif) | pickled.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | pickler.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | pickleweed.mp3 | 20-Apr-2007 02:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | pickling.mp3 | 20-Apr-2007 02:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | picklock.mp3 | 20-Apr-2007 02:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | pickman.mp3 | 20-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | pick-me-up.mp3 | 20-Apr-2007 02:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | pickoff.mp3 | 20-Apr-2007 02:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | pickpocket.mp3 | 20-Apr-2007 02:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | pickproof.mp3 | 20-Apr-2007 02:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | picksdisease.mp3 | 20-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | pickthank.mp3 | 20-Apr-2007 02:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | pickup.mp3 | 20-Apr-2007 02:43 | 5.4K | |
![[SND]](/icons/sound2.gif) | pickwick.mp3 | 20-Apr-2007 02:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pickwickian.mp3 | 20-Apr-2007 02:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | pickwickianism.mp3 | 20-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | picky.mp3 | 20-Apr-2007 02:43 | 5.0K | |
![[SND]](/icons/sound2.gif) | picloram.mp3 | 20-Apr-2007 02:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | picnic.mp3 | 20-Apr-2007 02:43 | 5.4K | |
![[SND]](/icons/sound2.gif) | picnicky.mp3 | 20-Apr-2007 02:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | picnometer.mp3 | 20-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | Pico della Mirandola.mp3 | 20-Apr-2007 02:43 | 14K | |
![[SND]](/icons/sound2.gif) | Pico Rivera.mp3 | 20-Apr-2007 02:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | pico.mp3 | 20-Apr-2007 02:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | picodeaneto.mp3 | 20-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | picodellamirandola.mp3 | 20-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | picogram.mp3 | 20-Apr-2007 02:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | picoline.mp3 | 20-Apr-2007 02:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | picomole.mp3 | 20-Apr-2007 02:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | picong.mp3 | 20-Apr-2007 02:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | picornavirus.mp3 | 20-Apr-2007 02:43 | 11K | |
![[SND]](/icons/sound2.gif) | picosecond.mp3 | 20-Apr-2007 02:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | picot.mp3 | 20-Apr-2007 02:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | picotee.mp3 | 20-Apr-2007 02:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | picquet.mp3 | 20-Apr-2007 02:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | picramicacid.mp3 | 20-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | picrate.mp3 | 20-Apr-2007 02:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | picric acid.mp3 | 20-Apr-2007 02:44 | 11K | |
![[SND]](/icons/sound2.gif) | picric.mp3 | 20-Apr-2007 02:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | picrite.mp3 | 20-Apr-2007 02:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | picro.mp3 | 20-Apr-2007 02:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | picrol.mp3 | 20-Apr-2007 02:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | picronitricacid.mp3 | 20-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | picrotoxin.mp3 | 20-Apr-2007 02:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | Pict.mp3 | 20-Apr-2007 02:44 | 4.6K | |
![[SND]](/icons/sound2.gif) | Pictish.mp3 | 20-Apr-2007 02:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | pictogram.mp3 | 20-Apr-2007 02:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | pictograph.mp3 | 20-Apr-2007 02:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | pictographic.mp3 | 20-Apr-2007 02:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | pictography.mp3 | 20-Apr-2007 02:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | pictor.mp3 | 20-Apr-2007 02:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | pictorial.mp3 | 20-Apr-2007 02:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | pictorialism.mp3 | 20-Apr-2007 02:44 | 11K | |
![[SND]](/icons/sound2.gif) | pictorialist.mp3 | 20-Apr-2007 02:44 | 11K | |
![[SND]](/icons/sound2.gif) | pictorialization.mp3 | 20-Apr-2007 02:44 | 13K | |
![[SND]](/icons/sound2.gif) | pictorialize.mp3 | 20-Apr-2007 02:44 | 12K | |
![[SND]](/icons/sound2.gif) | pictorially.mp3 | 20-Apr-2007 02:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | picture.mp3 | 20-Apr-2007 02:45 | 5.5K | |
![[SND]](/icons/sound2.gif) | picturedom.mp3 | 20-Apr-2007 02:45 | 17K | |
![[SND]](/icons/sound2.gif) | picturephone.mp3 | 20-Apr-2007 02:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | picturesome.mp3 | 20-Apr-2007 02:45 | 17K | |
![[SND]](/icons/sound2.gif) | picturesque.mp3 | 20-Apr-2007 02:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | picturing.mp3 | 20-Apr-2007 02:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | picturization.mp3 | 20-Apr-2007 02:45 | 10K | |
![[SND]](/icons/sound2.gif) | picturize.mp3 | 20-Apr-2007 02:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | picul.mp3 | 20-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | piculet.mp3 | 20-Apr-2007 02:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | picumnus.mp3 | 20-Apr-2007 02:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | picus.mp3 | 20-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | piddle.mp3 | 20-Apr-2007 02:45 | 4.5K | |
![[SND]](/icons/sound2.gif) | piddling.mp3 | 20-Apr-2007 02:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | piddly.mp3 | 20-Apr-2007 02:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | piddock.mp3 | 20-Apr-2007 02:45 | 4.5K | |
![[SND]](/icons/sound2.gif) | pide.mp3 | 20-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | pidgeon.mp3 | 20-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | pidgin.mp3 | 20-Apr-2007 02:45 | 5.4K | |
![[SND]](/icons/sound2.gif) | pidginization.mp3 | 20-Apr-2007 02:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | pidginize.mp3 | 20-Apr-2007 02:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | pidog.mp3 | 20-Apr-2007 02:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | pidyonhaben.mp3 | 20-Apr-2007 02:45 | 17K | |
![[SND]](/icons/sound2.gif) | pie.mp3 | 20-Apr-2007 02:45 | 5.4K | |
![[SND]](/icons/sound2.gif) | piebald.mp3 | 20-Apr-2007 02:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | piece de resistance.mp3 | 20-Apr-2007 02:46 | 15K | |
![[SND]](/icons/sound2.gif) | piece d'occasion.mp3 | 20-Apr-2007 02:46 | 12K | |
![[SND]](/icons/sound2.gif) | piece justificative.mp3 | 20-Apr-2007 02:46 | 15K | |
![[SND]](/icons/sound2.gif) | piece montee.mp3 | 20-Apr-2007 02:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | piece.mp3 | 20-Apr-2007 02:46 | 5.4K | |
![[SND]](/icons/sound2.gif) | pieceathese.mp3 | 20-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | piecederesistance.mp3 | 20-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | piecedoccasion.mp3 | 20-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | piece-dye.mp3 | 20-Apr-2007 02:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | piecemeal.mp3 | 20-Apr-2007 02:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | piecener.mp3 | 20-Apr-2007 02:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | piecer.mp3 | 20-Apr-2007 02:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | pieces de resistance.mp3 | 20-Apr-2007 02:46 | 15K | |
![[SND]](/icons/sound2.gif) | piecewise.mp3 | 20-Apr-2007 02:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | piecework.mp3 | 20-Apr-2007 02:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | pieceworker.mp3 | 20-Apr-2007 02:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | piecrust.mp3 | 20-Apr-2007 02:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | pied.mp3 | 20-Apr-2007 02:46 | 6.1K | |
![[SND]](/icons/sound2.gif) | piedaterre.mp3 | 20-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | pied-a-terre.mp3 | 20-Apr-2007 02:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | pieddebiche.mp3 | 20-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | piedfort.mp3 | 20-Apr-2007 02:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | piedmont.mp3 | 20-Apr-2007 02:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | Piedmontese.mp3 | 20-Apr-2007 02:46 | 10K | |
![[SND]](/icons/sound2.gif) | piedmontite.mp3 | 20-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | piednoir.mp3 | 20-Apr-2007 02:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | Piedras Negras.mp3 | 20-Apr-2007 02:47 | 12K | |
![[SND]](/icons/sound2.gif) | piedrasnegras.mp3 | 20-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | pieds-a-terre.mp3 | 20-Apr-2007 02:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | pie-eyed.mp3 | 20-Apr-2007 02:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | pie-faced.mp3 | 20-Apr-2007 02:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | piefort.mp3 | 20-Apr-2007 02:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | piehole.mp3 | 20-Apr-2007 02:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | pieman.mp3 | 20-Apr-2007 02:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | Piemonte.mp3 | 20-Apr-2007 02:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | piend.mp3 | 20-Apr-2007 02:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | pieplant.mp3 | 20-Apr-2007 02:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | pier.mp3 | 20-Apr-2007 02:47 | 5.5K | |
![[SND]](/icons/sound2.gif) | pierce.mp3 | 20-Apr-2007 02:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | pierced.mp3 | 20-Apr-2007 02:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | piercer.mp3 | 20-Apr-2007 02:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | piercing.mp3 | 20-Apr-2007 02:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | piercingly.mp3 | 20-Apr-2007 02:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pieria.mp3 | 20-Apr-2007 02:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pierian.mp3 | 20-Apr-2007 02:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | pierid.mp3 | 20-Apr-2007 02:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | pierides.mp3 | 20-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | pieris.mp3 | 20-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | Piero della Francesca.mp3 | 20-Apr-2007 02:47 | 16K | |
![[SND]](/icons/sound2.gif) | pierodicosimo.mp3 | 20-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | pierogi.mp3 | 20-Apr-2007 02:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | Pierre.mp3 | 20-Apr-2007 02:48 | 5.4K | |
![[SND]](/icons/sound2.gif) | Pierrefonds.mp3 | 20-Apr-2007 02:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | pierrette.mp3 | 20-Apr-2007 02:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pierrot.mp3 | 20-Apr-2007 02:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | piersplowman.mp3 | 20-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | pies.mp3 | 20-Apr-2007 02:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | piet.mp3 | 20-Apr-2007 02:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pieta.mp3 | 20-Apr-2007 02:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | pietas.mp3 | 20-Apr-2007 02:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pietermaritzburg.mp3 | 20-Apr-2007 02:48 | 11K | |
![[SND]](/icons/sound2.gif) | pietism.mp3 | 20-Apr-2007 02:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pietist.mp3 | 20-Apr-2007 02:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | pietistic.mp3 | 20-Apr-2007 02:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | pietistically.mp3 | 20-Apr-2007 02:48 | 12K | |
![[SND]](/icons/sound2.gif) | pietmyvrous.mp3 | 20-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | pietrodacortona.mp3 | 20-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | piety.mp3 | 20-Apr-2007 02:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | piezo.mp3 | 20-Apr-2007 02:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | piezoelectric.mp3 | 20-Apr-2007 02:48 | 13K | |
![[SND]](/icons/sound2.gif) | piezoelectrically.mp3 | 20-Apr-2007 02:48 | 14K | |
![[SND]](/icons/sound2.gif) | piezoelectricity.mp3 | 20-Apr-2007 02:48 | 16K | |
![[SND]](/icons/sound2.gif) | piezometer.mp3 | 20-Apr-2007 02:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | piezometric.mp3 | 20-Apr-2007 02:48 | 10K | |
![[SND]](/icons/sound2.gif) | piezometry.mp3 | 20-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | piff.mp3 | 20-Apr-2007 02:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | piffed.mp3 | 20-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | piffle.mp3 | 20-Apr-2007 02:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | piffled.mp3 | 20-Apr-2007 02:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | pifflicated.mp3 | 20-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | piffling.mp3 | 20-Apr-2007 02:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | piffy.mp3 | 20-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | pig.mp3 | 20-Apr-2007 02:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | pigalle.mp3 | 20-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | pigboat.mp3 | 20-Apr-2007 02:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | pigeon.mp3 | 20-Apr-2007 02:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | pigeongram.mp3 | 20-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | pigeonhole.mp3 | 20-Apr-2007 02:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | pigeonholer.mp3 | 20-Apr-2007 02:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | pigeonite.mp3 | 20-Apr-2007 02:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | pigeon-livered.mp3 | 20-Apr-2007 02:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | pigeonry.mp3 | 20-Apr-2007 02:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | pigeon-toed.mp3 | 20-Apr-2007 02:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | pigeonwing.mp3 | 20-Apr-2007 02:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | pigfish.mp3 | 20-Apr-2007 02:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | pigger.mp3 | 20-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | piggery.mp3 | 20-Apr-2007 02:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | piggie.mp3 | 20-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | piggin.mp3 | 20-Apr-2007 02:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | pigging.mp3 | 20-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | piggish.mp3 | 20-Apr-2007 02:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | piggott.mp3 | 20-Apr-2007 02:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | piggy.mp3 | 20-Apr-2007 02:50 | 5.4K | |
![[SND]](/icons/sound2.gif) | piggyback.mp3 | 20-Apr-2007 02:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | piggywiggy.mp3 | 20-Apr-2007 02:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | pigheaded.mp3 | 20-Apr-2007 02:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | piglead.mp3 | 20-Apr-2007 02:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | piglet.mp3 | 20-Apr-2007 02:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | piglike.mp3 | 20-Apr-2007 02:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | pigling.mp3 | 20-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | pigment.mp3 | 20-Apr-2007 02:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | pigmentary.mp3 | 20-Apr-2007 02:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | pigmentation.mp3 | 20-Apr-2007 02:50 | 10K | |
![[SND]](/icons/sound2.gif) | pigmy.mp3 | 20-Apr-2007 02:50 | 5.5K | |
![[SND]](/icons/sound2.gif) | pignoli.mp3 | 20-Apr-2007 02:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | pignolia.mp3 | 20-Apr-2007 02:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | pignon.mp3 | 20-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | pignorate.mp3 | 20-Apr-2007 02:50 | 17K | |
![[SND]](/icons/sound2.gif) | pignus.mp3 | 20-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | pignut.mp3 | 20-Apr-2007 02:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | pig-out.mp3 | 20-Apr-2007 02:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | pigpen.mp3 | 20-Apr-2007 02:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pigs, Bay of.mp3 | 20-Apr-2007 02:50 | 5.4K | |
![[SND]](/icons/sound2.gif) | pigs.mp3 | 20-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | pigskin.mp3 | 20-Apr-2007 02:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | pigsney.mp3 | 20-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | pigstick.mp3 | 20-Apr-2007 02:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | pigsty.mp3 | 20-Apr-2007 02:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | pigswill.mp3 | 20-Apr-2007 02:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | pigtail.mp3 | 20-Apr-2007 02:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | pigtailed.mp3 | 20-Apr-2007 02:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | pigweed.mp3 | 20-Apr-2007 02:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | pijaw.mp3 | 20-Apr-2007 02:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pik Kommunizma.mp3 | 20-Apr-2007 02:51 | 12K | |
![[SND]](/icons/sound2.gif) | Pik Pobedy.mp3 | 20-Apr-2007 02:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | pika.mp3 | 20-Apr-2007 02:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | pikake.mp3 | 20-Apr-2007 02:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | pikau.mp3 | 20-Apr-2007 02:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | pike.mp3 | 20-Apr-2007 02:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | pikeblenny.mp3 | 20-Apr-2007 02:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | piked.mp3 | 20-Apr-2007 02:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | pikelet.mp3 | 20-Apr-2007 02:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | pikeman.mp3 | 20-Apr-2007 02:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | pikeminnow.mp3 | 20-Apr-2007 02:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | pikeperch.mp3 | 20-Apr-2007 02:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | piker.mp3 | 20-Apr-2007 02:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | Pikes Peak.mp3 | 20-Apr-2007 02:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | pikespeak.mp3 | 20-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | pikestaff.mp3 | 20-Apr-2007 02:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | pikesville.mp3 | 20-Apr-2007 02:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | pikey.mp3 | 20-Apr-2007 02:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | piki.mp3 | 20-Apr-2007 02:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | piking.mp3 | 20-Apr-2007 02:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | pilaf.mp3 | 20-Apr-2007 02:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | pilaff.mp3 | 20-Apr-2007 02:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | pilar.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilaster.mp3 | 20-Apr-2007 02:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | pilastered.mp3 | 20-Apr-2007 02:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | pilastrade.mp3 | 20-Apr-2007 02:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pilate.mp3 | 20-Apr-2007 02:52 | 5.2K | |
![[SND]](/icons/sound2.gif) | Pilates.mp3 | 20-Apr-2007 02:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | pilatory.mp3 | 20-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | Pilatus.mp3 | 20-Apr-2007 02:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | pilau.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilaw.mp3 | 20-Apr-2007 02:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | pilch.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilchard.mp3 | 20-Apr-2007 02:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pilcomayo.mp3 | 20-Apr-2007 02:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | pilcrow.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pile.mp3 | 20-Apr-2007 02:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | pilea.mp3 | 20-Apr-2007 02:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | pileate.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pileated.mp3 | 20-Apr-2007 02:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | piled.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilei.mp3 | 20-Apr-2007 02:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | pileless.mp3 | 20-Apr-2007 02:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | pileolated.mp3 | 20-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | pileous.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pileum.mp3 | 20-Apr-2007 02:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pileup.mp3 | 20-Apr-2007 02:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | pileus.mp3 | 20-Apr-2007 02:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | pilewort.mp3 | 20-Apr-2007 02:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | pilfer.mp3 | 20-Apr-2007 02:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | pilferable.mp3 | 20-Apr-2007 02:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | pilferage.mp3 | 20-Apr-2007 02:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | pilfered.mp3 | 20-Apr-2007 02:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | pilferer.mp3 | 20-Apr-2007 02:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | pilfering.mp3 | 20-Apr-2007 02:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | pilferproof.mp3 | 20-Apr-2007 02:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | pilgarlic.mp3 | 20-Apr-2007 02:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | pilgerism.mp3 | 20-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | pilgrim.mp3 | 20-Apr-2007 02:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | pilgrimage.mp3 | 20-Apr-2007 02:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | pilgrimize.mp3 | 20-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | pili.mp3 | 20-Apr-2007 02:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | piliferous.mp3 | 20-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | piliform.mp3 | 20-Apr-2007 02:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilikia.mp3 | 20-Apr-2007 02:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | piling.mp3 | 20-Apr-2007 02:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pilion.mp3 | 20-Apr-2007 02:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pilipinas.mp3 | 20-Apr-2007 02:53 | 11K | |
![[SND]](/icons/sound2.gif) | Pilipino.mp3 | 20-Apr-2007 02:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | pilkingtonreport.mp3 | 20-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | pill.mp3 | 20-Apr-2007 02:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | pillage.mp3 | 20-Apr-2007 02:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | pillar.mp3 | 20-Apr-2007 02:54 | 5.7K | |
![[SND]](/icons/sound2.gif) | pillar-box.mp3 | 20-Apr-2007 02:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | pillaret.mp3 | 20-Apr-2007 02:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pillars of Hercules.mp3 | 20-Apr-2007 02:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | pillbox.mp3 | 20-Apr-2007 02:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | pillion.mp3 | 20-Apr-2007 02:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | pilliwinks.mp3 | 20-Apr-2007 02:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | pillock.mp3 | 20-Apr-2007 02:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | pillory.mp3 | 20-Apr-2007 02:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | pillow.mp3 | 20-Apr-2007 02:54 | 6.3K | |
![[SND]](/icons/sound2.gif) | pillowcase.mp3 | 20-Apr-2007 02:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | pillowed.mp3 | 20-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | pillowy.mp3 | 20-Apr-2007 02:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | pillsbury.mp3 | 20-Apr-2007 02:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | pillule.mp3 | 20-Apr-2007 02:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | pillwort.mp3 | 20-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | pilocarpine.mp3 | 20-Apr-2007 02:54 | 11K | |
![[SND]](/icons/sound2.gif) | pilon.mp3 | 20-Apr-2007 02:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilonidal.mp3 | 20-Apr-2007 02:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pilos.mp3 | 20-Apr-2007 02:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | pilose.mp3 | 20-Apr-2007 02:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | pilosity.mp3 | 20-Apr-2007 02:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | pilot.mp3 | 20-Apr-2007 02:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | pilotage.mp3 | 20-Apr-2007 02:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | pilothouse.mp3 | 20-Apr-2007 02:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | piloti.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | piloting.mp3 | 20-Apr-2007 02:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | pilotless.mp3 | 20-Apr-2007 02:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | pilotweed.mp3 | 20-Apr-2007 02:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | pilous.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilpul.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pils.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilsen.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilsener.mp3 | 20-Apr-2007 02:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | pilsner.mp3 | 20-Apr-2007 02:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | pilsnerurquell.mp3 | 20-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | Pilsudski.mp3 | 20-Apr-2007 02:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Piltdown man.mp3 | 20-Apr-2007 02:55 | 13K | |
![[SND]](/icons/sound2.gif) | piltdownman.mp3 | 20-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | pilular.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilule.mp3 | 20-Apr-2007 02:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | pilum.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pilumnus.mp3 | 20-Apr-2007 02:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | pilus.mp3 | 20-Apr-2007 02:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | pily.mp3 | 20-Apr-2007 02:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pima cotton.mp3 | 20-Apr-2007 02:55 | 11K | |
![[SND]](/icons/sound2.gif) | Pima.mp3 | 20-Apr-2007 02:55 | 5.4K | |
![[SND]](/icons/sound2.gif) | Piman.mp3 | 20-Apr-2007 02:55 | 5.9K | |
![[SND]](/icons/sound2.gif) | pimelicacid.mp3 | 20-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | pimentdoux.mp3 | 20-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | pimento.mp3 | 20-Apr-2007 02:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | pi-meson.mp3 | 20-Apr-2007 02:56 | 12K | |
![[SND]](/icons/sound2.gif) | pimiento.mp3 | 20-Apr-2007 02:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pimlico.mp3 | 20-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pimms.mp3 | 20-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pimola.mp3 | 20-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pimp.mp3 | 20-Apr-2007 02:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | pimpernel.mp3 | 20-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pimping.mp3 | 20-Apr-2007 02:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | pimpish.mp3 | 20-Apr-2007 02:56 | 17K | |
![[SND]](/icons/sound2.gif) | pimple.mp3 | 20-Apr-2007 02:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | pimpled.mp3 | 20-Apr-2007 02:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | pimply.mp3 | 20-Apr-2007 02:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | pimpmobile.mp3 | 20-Apr-2007 02:56 | 10K | |
![[SND]](/icons/sound2.gif) | pimps.mp3 | 20-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pimpsy.mp3 | 20-Apr-2007 02:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | pin.mp3 | 20-Apr-2007 02:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | pina cloth.mp3 | 20-Apr-2007 02:56 | 12K | |
![[SND]](/icons/sound2.gif) | pina colada.mp3 | 20-Apr-2007 02:56 | 12K | |
![[SND]](/icons/sound2.gif) | pina.mp3 | 20-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinaceous.mp3 | 20-Apr-2007 02:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | pinacoid.mp3 | 20-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinacolada.mp3 | 20-Apr-2007 02:56 | 17K | |
![[SND]](/icons/sound2.gif) | pinafore.mp3 | 20-Apr-2007 02:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinafored.mp3 | 20-Apr-2007 02:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | pinang.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pinar del Rio.mp3 | 20-Apr-2007 02:57 | 12K | |
![[SND]](/icons/sound2.gif) | pinard.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinardelrio.mp3 | 20-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | pinaster.mp3 | 20-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | pinata.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pinatubo, Mount.mp3 | 20-Apr-2007 02:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | pinatubo.mp3 | 20-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | pinball.mp3 | 20-Apr-2007 02:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | pinbone.mp3 | 20-Apr-2007 02:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinc.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pincenez.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pince-nez.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pincer.mp3 | 20-Apr-2007 02:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | pincerlike.mp3 | 20-Apr-2007 02:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | pincers.mp3 | 20-Apr-2007 02:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | pincette.mp3 | 20-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | pinch.mp3 | 20-Apr-2007 02:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | pinchback.mp3 | 20-Apr-2007 02:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | pinchbeck.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinche.mp3 | 20-Apr-2007 02:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | pincher.mp3 | 20-Apr-2007 02:57 | 5.9K | |
![[SND]](/icons/sound2.gif) | pinchgut.mp3 | 20-Apr-2007 02:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | pinch-hit.mp3 | 20-Apr-2007 02:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | Pinchot.mp3 | 20-Apr-2007 02:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | pinchpenny.mp3 | 20-Apr-2007 02:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pinckney.mp3 | 20-Apr-2007 02:58 | 5.4K | |
![[SND]](/icons/sound2.gif) | pincus.mp3 | 20-Apr-2007 02:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | pincushion.mp3 | 20-Apr-2007 02:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | pindan.mp3 | 20-Apr-2007 02:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pindar.mp3 | 20-Apr-2007 02:58 | 5.5K | |
![[SND]](/icons/sound2.gif) | pindari.mp3 | 20-Apr-2007 02:58 | 17K | |
![[SND]](/icons/sound2.gif) | Pindaric.mp3 | 20-Apr-2007 02:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinder.mp3 | 20-Apr-2007 02:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pindling.mp3 | 20-Apr-2007 02:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pindolol.mp3 | 20-Apr-2007 02:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pindopalm.mp3 | 20-Apr-2007 02:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | pindown.mp3 | 20-Apr-2007 02:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pindus Mountains.mp3 | 20-Apr-2007 02:58 | 6.8K | |
![[SND]](/icons/sound2.gif) | pindus.mp3 | 20-Apr-2007 02:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pine Bluff.mp3 | 20-Apr-2007 02:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | pine.mp3 | 20-Apr-2007 02:58 | 6.8K | |
![[SND]](/icons/sound2.gif) | pineal.mp3 | 20-Apr-2007 02:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | pinealectomize.mp3 | 20-Apr-2007 02:58 | 14K | |
![[SND]](/icons/sound2.gif) | pinealectomy.mp3 | 20-Apr-2007 02:58 | 12K | |
![[SND]](/icons/sound2.gif) | pineapple.mp3 | 20-Apr-2007 02:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | pineau.mp3 | 20-Apr-2007 02:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinebarrens.mp3 | 20-Apr-2007 02:58 | 17K | |
![[SND]](/icons/sound2.gif) | pinebluff.mp3 | 20-Apr-2007 02:58 | 17K | |
![[SND]](/icons/sound2.gif) | pinecone.mp3 | 20-Apr-2007 02:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | pinedrops.mp3 | 20-Apr-2007 02:58 | 9.5K | |
![[SND]](/icons/sound2.gif) | pinel.mp3 | 20-Apr-2007 02:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | pineland.mp3 | 20-Apr-2007 02:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | pinelands.mp3 | 20-Apr-2007 02:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pinellas Park.mp3 | 20-Apr-2007 02:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | pinellaspark.mp3 | 20-Apr-2007 02:59 | 17K | |
![[SND]](/icons/sound2.gif) | pinene.mp3 | 20-Apr-2007 02:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | Pinero.mp3 | 20-Apr-2007 02:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | pinery.mp3 | 20-Apr-2007 02:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | pines.mp3 | 20-Apr-2007 02:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinesap.mp3 | 20-Apr-2007 02:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | pineta.mp3 | 20-Apr-2007 02:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | pinetum.mp3 | 20-Apr-2007 02:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | pinewood.mp3 | 20-Apr-2007 02:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | piney.mp3 | 20-Apr-2007 02:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinfeather.mp3 | 20-Apr-2007 02:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | pinfish.mp3 | 20-Apr-2007 02:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | pinfold.mp3 | 20-Apr-2007 02:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | ping.mp3 | 20-Apr-2007 02:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | pinga.mp3 | 20-Apr-2007 02:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinger.mp3 | 20-Apr-2007 02:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | pinghsin.mp3 | 20-Apr-2007 02:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | pingo.mp3 | 20-Apr-2007 02:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | pingpong.mp3 | 20-Apr-2007 02:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | ping-pong.mp3 | 20-Apr-2007 02:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | pinguid.mp3 | 20-Apr-2007 02:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinguin.mp3 | 20-Apr-2007 02:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | pingwing.mp3 | 20-Apr-2007 03:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | pinhead.mp3 | 20-Apr-2007 03:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | pinheaded.mp3 | 20-Apr-2007 03:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | pinhole.mp3 | 20-Apr-2007 03:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | pinion.mp3 | 20-Apr-2007 03:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | pinioned.mp3 | 20-Apr-2007 03:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pinios.mp3 | 20-Apr-2007 03:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinite.mp3 | 20-Apr-2007 03:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinitol.mp3 | 20-Apr-2007 03:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | pink.mp3 | 20-Apr-2007 03:00 | 5.5K | |
![[SND]](/icons/sound2.gif) | pinked.mp3 | 20-Apr-2007 03:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinken.mp3 | 20-Apr-2007 03:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinkers.mp3 | 20-Apr-2007 03:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pinkerton.mp3 | 20-Apr-2007 03:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | pinkeye.mp3 | 20-Apr-2007 03:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinkgin.mp3 | 20-Apr-2007 03:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | pinkham.mp3 | 20-Apr-2007 03:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinkhi.mp3 | 20-Apr-2007 03:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pinkiang.mp3 | 20-Apr-2007 03:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | pinkie.mp3 | 20-Apr-2007 03:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | pinkish.mp3 | 20-Apr-2007 03:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | pinkly.mp3 | 20-Apr-2007 03:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | pinko.mp3 | 20-Apr-2007 03:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | pinkowsley.mp3 | 20-Apr-2007 03:00 | 17K | |
![[SND]](/icons/sound2.gif) | pinkroot.mp3 | 20-Apr-2007 03:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | pinkster.mp3 | 20-Apr-2007 03:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinky.mp3 | 20-Apr-2007 03:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | pinna.mp3 | 20-Apr-2007 03:01 | 5.0K | |
![[SND]](/icons/sound2.gif) | pinnace.mp3 | 20-Apr-2007 03:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | pinnacle.mp3 | 20-Apr-2007 03:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | pinnacling.mp3 | 20-Apr-2007 03:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | pinnae.mp3 | 20-Apr-2007 03:01 | 5.2K | |
![[SND]](/icons/sound2.gif) | pinnate.mp3 | 20-Apr-2007 03:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | pinnati.mp3 | 20-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | pinnatifid.mp3 | 20-Apr-2007 03:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | pinnation.mp3 | 20-Apr-2007 03:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinnatiped.mp3 | 20-Apr-2007 03:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | pinnatisect.mp3 | 20-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | pinned.mp3 | 20-Apr-2007 03:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinner.mp3 | 20-Apr-2007 03:01 | 5.2K | |
![[SND]](/icons/sound2.gif) | pinni.mp3 | 20-Apr-2007 03:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinnigrade.mp3 | 20-Apr-2007 03:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinniped.mp3 | 20-Apr-2007 03:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | pinnula.mp3 | 20-Apr-2007 03:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinnulate.mp3 | 20-Apr-2007 03:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinnule.mp3 | 20-Apr-2007 03:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | pinny.mp3 | 20-Apr-2007 03:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | pinocchio.mp3 | 20-Apr-2007 03:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pinochet (Ugarte).mp3 | 20-Apr-2007 03:01 | 14K | |
![[SND]](/icons/sound2.gif) | pinochetugarte.mp3 | 20-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | pinochle.mp3 | 20-Apr-2007 03:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | pinocytic.mp3 | 20-Apr-2007 03:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | pinocytose.mp3 | 20-Apr-2007 03:02 | 17K | |
![[SND]](/icons/sound2.gif) | pinocytoses.mp3 | 20-Apr-2007 03:02 | 12K | |
![[SND]](/icons/sound2.gif) | pinocytosis.mp3 | 20-Apr-2007 03:02 | 12K | |
![[SND]](/icons/sound2.gif) | pinocytotic.mp3 | 20-Apr-2007 03:02 | 11K | |
![[SND]](/icons/sound2.gif) | pinocytotically.mp3 | 20-Apr-2007 03:02 | 13K | |
![[SND]](/icons/sound2.gif) | pinole.mp3 | 20-Apr-2007 03:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | pinon.mp3 | 20-Apr-2007 03:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | pinones.mp3 | 20-Apr-2007 03:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | pinonjay.mp3 | 20-Apr-2007 03:02 | 17K | |
![[SND]](/icons/sound2.gif) | pinot blanc.mp3 | 20-Apr-2007 03:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | pinot grigio.mp3 | 20-Apr-2007 03:02 | 11K | |
![[SND]](/icons/sound2.gif) | pinot noir.mp3 | 20-Apr-2007 03:02 | 12K | |
![[SND]](/icons/sound2.gif) | pinot.mp3 | 20-Apr-2007 03:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinotage.mp3 | 20-Apr-2007 03:02 | 17K | |
![[SND]](/icons/sound2.gif) | pinotblanc.mp3 | 20-Apr-2007 03:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinotchardonnay.mp3 | 20-Apr-2007 03:02 | 17K | |
![[SND]](/icons/sound2.gif) | pinotnoir.mp3 | 20-Apr-2007 03:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinpoint.mp3 | 20-Apr-2007 03:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | pinprick.mp3 | 20-Apr-2007 03:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | pins.mp3 | 20-Apr-2007 03:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinscher.mp3 | 20-Apr-2007 03:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pinsetter.mp3 | 20-Apr-2007 03:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pinsk.mp3 | 20-Apr-2007 03:02 | 5.5K | |
![[SND]](/icons/sound2.gif) | pinspotter.mp3 | 20-Apr-2007 03:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | pinstripe.mp3 | 20-Apr-2007 03:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | pin-striped.mp3 | 20-Apr-2007 03:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | pint.mp3 | 20-Apr-2007 03:03 | 5.7K | |
![[SND]](/icons/sound2.gif) | pinta.mp3 | 20-Apr-2007 03:03 | 5.5K | |
![[SND]](/icons/sound2.gif) | pin-table.mp3 | 20-Apr-2007 03:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | pintadera.mp3 | 20-Apr-2007 03:03 | 17K | |
![[SND]](/icons/sound2.gif) | pintado.mp3 | 20-Apr-2007 03:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | pintail.mp3 | 20-Apr-2007 03:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | pintano.mp3 | 20-Apr-2007 03:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pinter.mp3 | 20-Apr-2007 03:03 | 4.8K | |
![[SND]](/icons/sound2.gif) | Pinteresque.mp3 | 20-Apr-2007 03:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | pintle.mp3 | 20-Apr-2007 03:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | pinto.mp3 | 20-Apr-2007 03:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | pintschgas.mp3 | 20-Apr-2007 03:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | pint-size.mp3 | 20-Apr-2007 03:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | pint-sized.mp3 | 20-Apr-2007 03:03 | 9.8K | |
![[SND]](/icons/sound2.gif) | pintubi.mp3 | 20-Apr-2007 03:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pinturicchio.mp3 | 20-Apr-2007 03:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | pinup.mp3 | 20-Apr-2007 03:03 | 5.9K | |
![[SND]](/icons/sound2.gif) | pinwale.mp3 | 20-Apr-2007 03:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | pinwalecorduroy.mp3 | 20-Apr-2007 03:03 | 17K | |
![[SND]](/icons/sound2.gif) | pinweed.mp3 | 20-Apr-2007 03:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | pinwheel.mp3 | 20-Apr-2007 03:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinwinnie.mp3 | 20-Apr-2007 03:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | pinworm.mp3 | 20-Apr-2007 03:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | pinxit.mp3 | 20-Apr-2007 03:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | pinxter flower.mp3 | 20-Apr-2007 03:04 | 13K | |
![[SND]](/icons/sound2.gif) | pinxter.mp3 | 20-Apr-2007 03:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | piny.mp3 | 20-Apr-2007 03:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | pinyin.mp3 | 20-Apr-2007 03:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | pinyon.mp3 | 20-Apr-2007 03:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | pinza.mp3 | 20-Apr-2007 03:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pinzon.mp3 | 20-Apr-2007 03:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | pio.mp3 | 20-Apr-2007 03:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | piolet.mp3 | 20-Apr-2007 03:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | pion.mp3 | 20-Apr-2007 03:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | pioneer.mp3 | 20-Apr-2007 03:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | pionic.mp3 | 20-Apr-2007 03:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | pionium.mp3 | 20-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | piosity.mp3 | 20-Apr-2007 03:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | Piotrkow Trybunalski.mp3 | 20-Apr-2007 03:04 | 15K | |
![[SND]](/icons/sound2.gif) | pioupiou.mp3 | 20-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | pious.mp3 | 20-Apr-2007 03:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | Piozzi.mp3 | 20-Apr-2007 03:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | pip.mp3 | 20-Apr-2007 03:04 | 4.6K | |
![[SND]](/icons/sound2.gif) | pipa.mp3 | 20-Apr-2007 03:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | pipage.mp3 | 20-Apr-2007 03:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | pipal.mp3 | 20-Apr-2007 03:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | pipe.mp3 | 20-Apr-2007 03:04 | 5.4K | |
![[SND]](/icons/sound2.gif) | pipeage.mp3 | 20-Apr-2007 03:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | piped.mp3 | 20-Apr-2007 03:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | pipefish.mp3 | 20-Apr-2007 03:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | pipeful.mp3 | 20-Apr-2007 03:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | pipeless.mp3 | 20-Apr-2007 03:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | pipelike.mp3 | 20-Apr-2007 03:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | pipeline.mp3 | 20-Apr-2007 03:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | pipemma.mp3 | 20-Apr-2007 03:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | piper.mp3 | 20-Apr-2007 03:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | piperaceous.mp3 | 20-Apr-2007 03:05 | 17K | |
![[SND]](/icons/sound2.gif) | piperacillin.mp3 | 20-Apr-2007 03:05 | 17K | |
![[SND]](/icons/sound2.gif) | piperade.mp3 | 20-Apr-2007 03:05 | 17K | |
![[SND]](/icons/sound2.gif) | piperazine.mp3 | 20-Apr-2007 03:05 | 11K | |
![[SND]](/icons/sound2.gif) | piperidine.mp3 | 20-Apr-2007 03:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | piperine.mp3 | 20-Apr-2007 03:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | piperonal.mp3 | 20-Apr-2007 03:05 | 11K | |
![[SND]](/icons/sound2.gif) | piperonyl butoxide.mp3 | 20-Apr-2007 03:05 | 20K | |
![[SND]](/icons/sound2.gif) | piperonylbutoxide.mp3 | 20-Apr-2007 03:05 | 27K | |
![[SND]](/icons/sound2.gif) | Pipestone National Monument.mp3 | 20-Apr-2007 03:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | pipestone.mp3 | 20-Apr-2007 03:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | pipet.mp3 | 20-Apr-2007 03:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | pipette.mp3 | 20-Apr-2007 03:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | pipi.mp3 | 20-Apr-2007 03:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | piping.mp3 | 20-Apr-2007 03:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | pipistrelle.mp3 | 20-Apr-2007 03:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | pipit.mp3 | 20-Apr-2007 03:05 | 5.4K | |
![[SND]](/icons/sound2.gif) | pipkin.mp3 | 20-Apr-2007 03:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | pippa.mp3 | 20-Apr-2007 03:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | pipped.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | pipper.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | pipperoo.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | pippie.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | pippin.mp3 | 20-Apr-2007 03:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | pippip.mp3 | 20-Apr-2007 03:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | pip-pip.mp3 | 20-Apr-2007 03:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | pippypoo.mp3 | 20-Apr-2007 03:06 | 17K | |
![[SND]](/icons/sound2.gif) | pipsissewa.mp3 | 20-Apr-2007 03:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | pipsqueak.mp3 | 20-Apr-2007 03:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | pip-squeak.mp3 | 20-Apr-2007 03:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | pipsy.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | pipy.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | piquada.mp3 | 20-Apr-2007 03:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | piquancy.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | piquant.mp3 | 20-Apr-2007 03:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | pique.mp3 | 20-Apr-2007 03:06 | 5.2K | |
![[SND]](/icons/sound2.gif) | piquet.mp3 | 20-Apr-2007 03:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | piquette.mp3 | 20-Apr-2007 03:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | pir.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | pira.mp3 | 20-Apr-2007 03:06 | 17K | |
![[SND]](/icons/sound2.gif) | piracetam.mp3 | 20-Apr-2007 03:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | piracicaba.mp3 | 20-Apr-2007 03:06 | 17K | |
![[SND]](/icons/sound2.gif) | piracy.mp3 | 20-Apr-2007 03:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | Piraeus.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | piragua.mp3 | 20-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | Piraievs.mp3 | 20-Apr-2007 03:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pirandellian.mp3 | 20-Apr-2007 03:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | Pirandello.mp3 | 20-Apr-2007 03:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | Piranesi.mp3 | 20-Apr-2007 03:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | piranha.mp3 | 20-Apr-2007 03:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | pirarucu.mp3 | 20-Apr-2007 03:07 | 11K | |
![[SND]](/icons/sound2.gif) | pirate.mp3 | 20-Apr-2007 03:07 | 6.3K | |
![[SND]](/icons/sound2.gif) | piratical.mp3 | 20-Apr-2007 03:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | piratically.mp3 | 20-Apr-2007 03:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | piraya.mp3 | 20-Apr-2007 03:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | pire.mp3 | 20-Apr-2007 03:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | pirelli.mp3 | 20-Apr-2007 03:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pirineos.mp3 | 20-Apr-2007 03:07 | 11K | |
![[SND]](/icons/sound2.gif) | piripiri.mp3 | 20-Apr-2007 03:07 | 17K | |
![[SND]](/icons/sound2.gif) | pirithous.mp3 | 20-Apr-2007 03:07 | 17K | |
![[SND]](/icons/sound2.gif) | pirkeavoth.mp3 | 20-Apr-2007 03:07 | 17K | |
![[SND]](/icons/sound2.gif) | Pirmasens.mp3 | 20-Apr-2007 03:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | pirn.mp3 | 20-Apr-2007 03:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | Pirna.mp3 | 20-Apr-2007 03:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | piro.mp3 | 20-Apr-2007 03:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | pirog.mp3 | 20-Apr-2007 03:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | pirogen.mp3 | 20-Apr-2007 03:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | pirogi.mp3 | 20-Apr-2007 03:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | pirogue.mp3 | 20-Apr-2007 03:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | piroplasm.mp3 | 20-Apr-2007 03:07 | 10K | |
![[SND]](/icons/sound2.gif) | piroplasma.mp3 | 20-Apr-2007 03:08 | 10K | |
![[SND]](/icons/sound2.gif) | piroplasmata.mp3 | 20-Apr-2007 03:08 | 11K | |
![[SND]](/icons/sound2.gif) | piroplasmosis.mp3 | 20-Apr-2007 03:08 | 17K | |
![[SND]](/icons/sound2.gif) | piroshki.mp3 | 20-Apr-2007 03:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | pirouette.mp3 | 20-Apr-2007 03:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | piroxicam.mp3 | 20-Apr-2007 03:08 | 17K | |
![[SND]](/icons/sound2.gif) | pirozhki.mp3 | 20-Apr-2007 03:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | pis aller.mp3 | 20-Apr-2007 03:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | pis allers.mp3 | 20-Apr-2007 03:08 | 11K | |
![[SND]](/icons/sound2.gif) | pis.mp3 | 20-Apr-2007 03:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | Pisa.mp3 | 20-Apr-2007 03:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | pisaller.mp3 | 20-Apr-2007 03:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pisan.mp3 | 20-Apr-2007 03:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | pisanello.mp3 | 20-Apr-2007 03:08 | 17K | |
![[SND]](/icons/sound2.gif) | Pisano.mp3 | 20-Apr-2007 03:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | pisay.mp3 | 20-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | piscary.mp3 | 20-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | Piscataqua.mp3 | 20-Apr-2007 03:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | piscatology.mp3 | 20-Apr-2007 03:08 | 17K | |
![[SND]](/icons/sound2.gif) | piscator.mp3 | 20-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | piscatorial.mp3 | 20-Apr-2007 03:08 | 11K | |
![[SND]](/icons/sound2.gif) | piscatory.mp3 | 20-Apr-2007 03:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | Piscean.mp3 | 20-Apr-2007 03:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pisces.mp3 | 20-Apr-2007 03:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | pisci.mp3 | 20-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | piscicide.mp3 | 20-Apr-2007 03:08 | 17K | |
![[SND]](/icons/sound2.gif) | pisciculture.mp3 | 20-Apr-2007 03:09 | 10K | |
![[SND]](/icons/sound2.gif) | piscina.mp3 | 20-Apr-2007 03:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | piscine.mp3 | 20-Apr-2007 03:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | piscisaustrinus.mp3 | 20-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | piscivore.mp3 | 20-Apr-2007 03:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | piscivorous.mp3 | 20-Apr-2007 03:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | pisco.mp3 | 20-Apr-2007 03:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | pisedeterre.mp3 | 20-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | Pisgah, Mount.mp3 | 20-Apr-2007 03:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | pisgah.mp3 | 20-Apr-2007 03:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | pish.mp3 | 20-Apr-2007 03:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | pisher.mp3 | 20-Apr-2007 03:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | pishogue.mp3 | 20-Apr-2007 03:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | pishpek.mp3 | 20-Apr-2007 03:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pisidia.mp3 | 20-Apr-2007 03:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | Pisidian.mp3 | 20-Apr-2007 03:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | pisiform.mp3 | 20-Apr-2007 03:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | Pisistratus.mp3 | 20-Apr-2007 03:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | pismire.mp3 | 20-Apr-2007 03:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | pismo clam.mp3 | 20-Apr-2007 03:09 | 13K | |
![[SND]](/icons/sound2.gif) | pismoclam.mp3 | 20-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | piso.mp3 | 20-Apr-2007 03:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | pisolite.mp3 | 20-Apr-2007 03:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | pisolith.mp3 | 20-Apr-2007 03:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | pisolitic.mp3 | 20-Apr-2007 03:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | piss.mp3 | 20-Apr-2007 03:10 | 5.4K | |
![[SND]](/icons/sound2.gif) | pissabed.mp3 | 20-Apr-2007 03:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | pissant.mp3 | 20-Apr-2007 03:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | Pissarro.mp3 | 20-Apr-2007 03:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | pissed.mp3 | 20-Apr-2007 03:10 | 6.1K | |
![[SND]](/icons/sound2.gif) | pisser.mp3 | 20-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | pissing.mp3 | 20-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | pisso.mp3 | 20-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | pissoir.mp3 | 20-Apr-2007 03:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | pisspiration.mp3 | 20-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | piss-poor.mp3 | 20-Apr-2007 03:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | pissy.mp3 | 20-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | pistache.mp3 | 20-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | pistachio.mp3 | 20-Apr-2007 03:10 | 11K | |
![[SND]](/icons/sound2.gif) | pistareen.mp3 | 20-Apr-2007 03:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | piste.mp3 | 20-Apr-2007 03:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | pistil.mp3 | 20-Apr-2007 03:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | pistillate.mp3 | 20-Apr-2007 03:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | pistilliferous.mp3 | 20-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | pistilline.mp3 | 20-Apr-2007 03:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pistoia.mp3 | 20-Apr-2007 03:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | pistol.mp3 | 20-Apr-2007 03:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | pistole.mp3 | 20-Apr-2007 03:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | pistoleer.mp3 | 20-Apr-2007 03:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | pistolero.mp3 | 20-Apr-2007 03:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | pistology.mp3 | 20-Apr-2007 03:11 | 17K | |
![[SND]](/icons/sound2.gif) | piston.mp3 | 20-Apr-2007 03:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | pistou.mp3 | 20-Apr-2007 03:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | pit.mp3 | 20-Apr-2007 03:11 | 4.6K | |
![[SND]](/icons/sound2.gif) | pita.mp3 | 20-Apr-2007 03:11 | 5.4K | |
![[SND]](/icons/sound2.gif) | pitahaya.mp3 | 20-Apr-2007 03:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | pitaka.mp3 | 20-Apr-2007 03:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | pitanga.mp3 | 20-Apr-2007 03:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | pitapat.mp3 | 20-Apr-2007 03:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | pit-a-pat.mp3 | 20-Apr-2007 03:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pitcairn Island.mp3 | 20-Apr-2007 03:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pitcairner.mp3 | 20-Apr-2007 03:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | pitcairnisland.mp3 | 20-Apr-2007 03:11 | 17K | |
![[SND]](/icons/sound2.gif) | pitch.mp3 | 20-Apr-2007 03:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | pitch-black.mp3 | 20-Apr-2007 03:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | pitchblende.mp3 | 20-Apr-2007 03:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | pitch-dark.mp3 | 20-Apr-2007 03:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | pitched.mp3 | 20-Apr-2007 03:11 | 6.3K | |
![[SND]](/icons/sound2.gif) | pitcher.mp3 | 20-Apr-2007 03:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | pitcherful.mp3 | 20-Apr-2007 03:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | pitchfork.mp3 | 20-Apr-2007 03:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | pitching.mp3 | 20-Apr-2007 03:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | pitchlake.mp3 | 20-Apr-2007 03:11 | 17K | |
![[SND]](/icons/sound2.gif) | pitchman.mp3 | 20-Apr-2007 03:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | pitchometer.mp3 | 20-Apr-2007 03:11 | 17K | |
![[SND]](/icons/sound2.gif) | pitchout.mp3 | 20-Apr-2007 03:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | pitch-perfect.mp3 | 20-Apr-2007 03:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | pitchpole.mp3 | 20-Apr-2007 03:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | pitchwoman.mp3 | 20-Apr-2007 03:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | pitchy.mp3 | 20-Apr-2007 03:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | piteous.mp3 | 20-Apr-2007 03:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | Pitesti.mp3 | 20-Apr-2007 03:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | pitfall.mp3 | 20-Apr-2007 03:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | pith.mp3 | 20-Apr-2007 03:12 | 5.0K | |
![[SND]](/icons/sound2.gif) | pithead.mp3 | 20-Apr-2007 03:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | pithecanthrope.mp3 | 20-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | pithecanthropine.mp3 | 20-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | pithecanthropoid.mp3 | 20-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | pithecanthropus.mp3 | 20-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | pithecoid.mp3 | 20-Apr-2007 03:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | pithily.mp3 | 20-Apr-2007 03:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | pithiness.mp3 | 20-Apr-2007 03:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | pithom.mp3 | 20-Apr-2007 03:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | pithos.mp3 | 20-Apr-2007 03:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | pithy.mp3 | 20-Apr-2007 03:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | pitiable.mp3 | 20-Apr-2007 03:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | pitiably.mp3 | 20-Apr-2007 03:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | pitier.mp3 | 20-Apr-2007 03:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | pitiful.mp3 | 20-Apr-2007 03:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | pitifully.mp3 | 20-Apr-2007 03:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | pitifulness.mp3 | 20-Apr-2007 03:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | pitiless.mp3 | 20-Apr-2007 03:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | pitjantjatjara.mp3 | 20-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | pitman.mp3 | 20-Apr-2007 03:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | pitmen.mp3 | 20-Apr-2007 03:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | pitocin.mp3 | 20-Apr-2007 03:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | piton.mp3 | 20-Apr-2007 03:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | pitooi.mp3 | 20-Apr-2007 03:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | pitot tube.mp3 | 20-Apr-2007 03:13 | 11K | |
![[SND]](/icons/sound2.gif) | pitot-static tube.mp3 | 20-Apr-2007 03:13 | 16K | |
![[SND]](/icons/sound2.gif) | pitotstatictube.mp3 | 20-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | pitottube.mp3 | 20-Apr-2007 03:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | pitpan.mp3 | 20-Apr-2007 03:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | pitprop.mp3 | 20-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | pitri.mp3 | 20-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pitt.mp3 | 20-Apr-2007 03:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | pitta.mp3 | 20-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | pittacus.mp3 | 20-Apr-2007 03:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | pittance.mp3 | 20-Apr-2007 03:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | pitted.mp3 | 20-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | pitterpatter.mp3 | 20-Apr-2007 03:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | pitter-patter.mp3 | 20-Apr-2007 03:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | pitting.mp3 | 20-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | pittite.mp3 | 20-Apr-2007 03:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | pittosporum.mp3 | 20-Apr-2007 03:13 | 10K | |
![[SND]](/icons/sound2.gif) | Pitt-Rivers.mp3 | 20-Apr-2007 03:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | Pittsburg.mp3 | 20-Apr-2007 03:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pittsburgh.mp3 | 20-Apr-2007 03:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pittsburgher.mp3 | 20-Apr-2007 03:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | Pittsfield.mp3 | 20-Apr-2007 03:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | pitty.mp3 | 20-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pittypat.mp3 | 20-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | pituitary.mp3 | 20-Apr-2007 03:14 | 11K | |
![[SND]](/icons/sound2.gif) | pituitous.mp3 | 20-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | pituitrin.mp3 | 20-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | pituri.mp3 | 20-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pity.mp3 | 20-Apr-2007 03:14 | 5.4K | |
![[SND]](/icons/sound2.gif) | pitying.mp3 | 20-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pityingly.mp3 | 20-Apr-2007 03:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | pityriasis.mp3 | 20-Apr-2007 03:14 | 11K | |
![[SND]](/icons/sound2.gif) | pityroid.mp3 | 20-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | piu.mp3 | 20-Apr-2007 03:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | piupiu.mp3 | 20-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | piura.mp3 | 20-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pius.mp3 | 20-Apr-2007 03:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | piusii.mp3 | 20-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | piute.mp3 | 20-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | pivot.mp3 | 20-Apr-2007 03:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | pivotable.mp3 | 20-Apr-2007 03:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | pivotal.mp3 | 20-Apr-2007 03:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | pivotally.mp3 | 20-Apr-2007 03:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | pivoting.mp3 | 20-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | pivotman.mp3 | 20-Apr-2007 03:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | pix.mp3 | 20-Apr-2007 03:15 | 5.9K | |
![[SND]](/icons/sound2.gif) | pixel.mp3 | 20-Apr-2007 03:15 | 6.3K | |
![[SND]](/icons/sound2.gif) | pixie.mp3 | 20-Apr-2007 03:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | pixieish.mp3 | 20-Apr-2007 03:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | pixilated.mp3 | 20-Apr-2007 03:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | pixilation.mp3 | 20-Apr-2007 03:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | pixillated.mp3 | 20-Apr-2007 03:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | pixy.mp3 | 20-Apr-2007 03:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | piyyut.mp3 | 20-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | pizaine.mp3 | 20-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pizarro.mp3 | 20-Apr-2007 03:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | pizazz.mp3 | 20-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | pizazzy.mp3 | 20-Apr-2007 03:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | pize.mp3 | 20-Apr-2007 03:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | pizza.mp3 | 20-Apr-2007 03:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | pizzalike.mp3 | 20-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | pizzazz.mp3 | 20-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | pizzeria.mp3 | 20-Apr-2007 03:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | pizzicati.mp3 | 20-Apr-2007 03:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | pizzicato.mp3 | 20-Apr-2007 03:15 | 10K | |
![[SND]](/icons/sound2.gif) | pizzle.mp3 | 20-Apr-2007 03:15 | 5.9K | |
![[SND]](/icons/sound2.gif) | pjs.mp3 | 20-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | pj's.mp3 | 20-Apr-2007 03:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | PK.mp3 | 20-Apr-2007 03:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | plaas.mp3 | 20-Apr-2007 03:16 | 17K | |
![[SND]](/icons/sound2.gif) | placability.mp3 | 20-Apr-2007 03:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | placable.mp3 | 20-Apr-2007 03:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | placably.mp3 | 20-Apr-2007 03:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | placage.mp3 | 20-Apr-2007 03:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | placard.mp3 | 20-Apr-2007 03:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | placas.mp3 | 20-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | placate.mp3 | 20-Apr-2007 03:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | placatingly.mp3 | 20-Apr-2007 03:16 | 9.8K | |
![[SND]](/icons/sound2.gif) | placation.mp3 | 20-Apr-2007 03:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | placative.mp3 | 20-Apr-2007 03:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | placatory.mp3 | 20-Apr-2007 03:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | placcate.mp3 | 20-Apr-2007 03:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | place aux dames.mp3 | 20-Apr-2007 03:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | place.mp3 | 20-Apr-2007 03:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | placeable.mp3 | 20-Apr-2007 03:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | placebo.mp3 | 20-Apr-2007 03:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | placeholder.mp3 | 20-Apr-2007 03:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | placekick.mp3 | 20-Apr-2007 03:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | placeless.mp3 | 20-Apr-2007 03:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | placeman.mp3 | 20-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | placement.mp3 | 20-Apr-2007 03:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | place-name.mp3 | 20-Apr-2007 03:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | placenta.mp3 | 20-Apr-2007 03:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | placentae.mp3 | 20-Apr-2007 03:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | placental.mp3 | 20-Apr-2007 03:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | placentate.mp3 | 20-Apr-2007 03:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | placentation.mp3 | 20-Apr-2007 03:17 | 11K | |
![[SND]](/icons/sound2.gif) | Placentia.mp3 | 20-Apr-2007 03:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | placentography.mp3 | 20-Apr-2007 03:17 | 17K | |
![[SND]](/icons/sound2.gif) | placepigalle.mp3 | 20-Apr-2007 03:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | placer.mp3 | 20-Apr-2007 03:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | placet.mp3 | 20-Apr-2007 03:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | Placid, Lake.mp3 | 20-Apr-2007 03:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | placid.mp3 | 20-Apr-2007 03:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | placidity.mp3 | 20-Apr-2007 03:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | placidly.mp3 | 20-Apr-2007 03:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | placido.mp3 | 20-Apr-2007 03:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | placidosdisk.mp3 | 20-Apr-2007 03:17 | 17K | |
![[SND]](/icons/sound2.gif) | placidyl.mp3 | 20-Apr-2007 03:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | placing.mp3 | 20-Apr-2007 03:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | plack.mp3 | 20-Apr-2007 03:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | plackart.mp3 | 20-Apr-2007 03:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | placket.mp3 | 20-Apr-2007 03:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | placode.mp3 | 20-Apr-2007 03:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | placoderm.mp3 | 20-Apr-2007 03:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | placoid.mp3 | 20-Apr-2007 03:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | plafond.mp3 | 20-Apr-2007 03:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | plagal.mp3 | 20-Apr-2007 03:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | plage.mp3 | 20-Apr-2007 03:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | plagiarism.mp3 | 20-Apr-2007 03:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | plagiarist.mp3 | 20-Apr-2007 03:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | plagiaristic.mp3 | 20-Apr-2007 03:18 | 10K | |
![[SND]](/icons/sound2.gif) | plagiarize.mp3 | 20-Apr-2007 03:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | plagiary.mp3 | 20-Apr-2007 03:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | plagio.mp3 | 20-Apr-2007 03:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | plagioclase.mp3 | 20-Apr-2007 03:18 | 12K | |
![[SND]](/icons/sound2.gif) | plagiohedral.mp3 | 20-Apr-2007 03:18 | 17K | |
![[SND]](/icons/sound2.gif) | plagiotropic.mp3 | 20-Apr-2007 03:18 | 14K | |
![[SND]](/icons/sound2.gif) | plagiotropism.mp3 | 20-Apr-2007 03:18 | 17K | |
![[SND]](/icons/sound2.gif) | plague.mp3 | 20-Apr-2007 03:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | plaguesome.mp3 | 20-Apr-2007 03:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | plaguey.mp3 | 20-Apr-2007 03:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | plaguily.mp3 | 20-Apr-2007 03:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | plaguy.mp3 | 20-Apr-2007 03:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | plaice.mp3 | 20-Apr-2007 03:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | plaid.mp3 | 20-Apr-2007 03:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | plaidcymru.mp3 | 20-Apr-2007 03:18 | 17K | |
![[SND]](/icons/sound2.gif) | plaided.mp3 | 20-Apr-2007 03:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | plain Jane.mp3 | 20-Apr-2007 03:18 | 11K | |
![[SND]](/icons/sound2.gif) | plain.mp3 | 20-Apr-2007 03:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | plainchant.mp3 | 20-Apr-2007 03:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | plainclothes.mp3 | 20-Apr-2007 03:18 | 12K | |
![[SND]](/icons/sound2.gif) | plainclothesman.mp3 | 20-Apr-2007 03:18 | 13K | |
![[SND]](/icons/sound2.gif) | plainer.mp3 | 20-Apr-2007 03:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | Plainfield.mp3 | 20-Apr-2007 03:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | plain-Jane.mp3 | 20-Apr-2007 03:18 | 11K | |
![[SND]](/icons/sound2.gif) | plain-laid.mp3 | 20-Apr-2007 03:19 | 10K | |
![[SND]](/icons/sound2.gif) | plainly.mp3 | 20-Apr-2007 03:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | plainness.mp3 | 20-Apr-2007 03:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | Plains of Abraham.mp3 | 20-Apr-2007 03:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Plains.mp3 | 20-Apr-2007 03:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | plainsman.mp3 | 20-Apr-2007 03:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | plainsong.mp3 | 20-Apr-2007 03:19 | 10K | |
![[SND]](/icons/sound2.gif) | plainspoken.mp3 | 20-Apr-2007 03:19 | 11K | |
![[SND]](/icons/sound2.gif) | plainspokenness.mp3 | 20-Apr-2007 03:19 | 13K | |
![[SND]](/icons/sound2.gif) | plaint.mp3 | 20-Apr-2007 03:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | plaintext.mp3 | 20-Apr-2007 03:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | plaintful.mp3 | 20-Apr-2007 03:19 | 17K | |
![[SND]](/icons/sound2.gif) | plaintiff.mp3 | 20-Apr-2007 03:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | plaintive.mp3 | 20-Apr-2007 03:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | plainview.mp3 | 20-Apr-2007 03:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | plaister.mp3 | 20-Apr-2007 03:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | plait.mp3 | 20-Apr-2007 03:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | plaiting.mp3 | 20-Apr-2007 03:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | plan.mp3 | 20-Apr-2007 03:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | planar.mp3 | 20-Apr-2007 03:19 | 6.3K | |
![[SND]](/icons/sound2.gif) | planaria.mp3 | 20-Apr-2007 03:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | planarian.mp3 | 20-Apr-2007 03:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | planarity.mp3 | 20-Apr-2007 03:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | planate.mp3 | 20-Apr-2007 03:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | planation.mp3 | 20-Apr-2007 03:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | plancer.mp3 | 20-Apr-2007 03:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | planch.mp3 | 20-Apr-2007 03:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | planchet.mp3 | 20-Apr-2007 03:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | planchette.mp3 | 20-Apr-2007 03:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | Planck.mp3 | 20-Apr-2007 03:20 | 4.8K | |
![[SND]](/icons/sound2.gif) | Planck's constant.mp3 | 20-Apr-2007 03:20 | 13K | |
![[SND]](/icons/sound2.gif) | plane.mp3 | 20-Apr-2007 03:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | planeload.mp3 | 20-Apr-2007 03:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | planer tree.mp3 | 20-Apr-2007 03:20 | 11K | |
![[SND]](/icons/sound2.gif) | planer.mp3 | 20-Apr-2007 03:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | planertree.mp3 | 20-Apr-2007 03:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | planet.mp3 | 20-Apr-2007 03:20 | 5.9K | |
![[SND]](/icons/sound2.gif) | planetaria.mp3 | 20-Apr-2007 03:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | planetarium.mp3 | 20-Apr-2007 03:20 | 11K | |
![[SND]](/icons/sound2.gif) | planetary.mp3 | 20-Apr-2007 03:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | planetesimal.mp3 | 20-Apr-2007 03:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | planetlike.mp3 | 20-Apr-2007 03:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | planetoid.mp3 | 20-Apr-2007 03:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | planetoidal.mp3 | 20-Apr-2007 03:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | planetokhod.mp3 | 20-Apr-2007 03:20 | 17K | |
![[SND]](/icons/sound2.gif) | planetological.mp3 | 20-Apr-2007 03:20 | 12K | |
![[SND]](/icons/sound2.gif) | planetologist.mp3 | 20-Apr-2007 03:20 | 12K | |
![[SND]](/icons/sound2.gif) | planetology.mp3 | 20-Apr-2007 03:20 | 11K | |
![[SND]](/icons/sound2.gif) | planetran.mp3 | 20-Apr-2007 03:20 | 17K | |
![[SND]](/icons/sound2.gif) | planet-stricken.mp3 | 20-Apr-2007 03:20 | 10K | |
![[SND]](/icons/sound2.gif) | planet-struck.mp3 | 20-Apr-2007 03:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | planetwide.mp3 | 20-Apr-2007 03:21 | 10K | |
![[SND]](/icons/sound2.gif) | planetx.mp3 | 20-Apr-2007 03:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | planform.mp3 | 20-Apr-2007 03:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | planfulness.mp3 | 20-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | plangency.mp3 | 20-Apr-2007 03:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | plangent.mp3 | 20-Apr-2007 03:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | planh.mp3 | 20-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | plani.mp3 | 20-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | planiform.mp3 | 20-Apr-2007 03:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | planify.mp3 | 20-Apr-2007 03:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | planigraph.mp3 | 20-Apr-2007 03:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | planimeter.mp3 | 20-Apr-2007 03:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | planimetric.mp3 | 20-Apr-2007 03:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | planimetrically.mp3 | 20-Apr-2007 03:21 | 10K | |
![[SND]](/icons/sound2.gif) | planimetry.mp3 | 20-Apr-2007 03:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | planish.mp3 | 20-Apr-2007 03:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | planisphere.mp3 | 20-Apr-2007 03:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | planispheric.mp3 | 20-Apr-2007 03:21 | 9.8K | |
![[SND]](/icons/sound2.gif) | plank.mp3 | 20-Apr-2007 03:21 | 5.9K | |
![[SND]](/icons/sound2.gif) | planker.mp3 | 20-Apr-2007 03:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | planking.mp3 | 20-Apr-2007 03:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | plankter.mp3 | 20-Apr-2007 03:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | plankton.mp3 | 20-Apr-2007 03:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | planktonic.mp3 | 20-Apr-2007 03:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | planktotrophic.mp3 | 20-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | planless.mp3 | 20-Apr-2007 03:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | planner.mp3 | 20-Apr-2007 03:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | planning.mp3 | 20-Apr-2007 03:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | Plano.mp3 | 20-Apr-2007 03:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | planoblast.mp3 | 20-Apr-2007 03:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | plano-concave.mp3 | 20-Apr-2007 03:22 | 12K | |
![[SND]](/icons/sound2.gif) | plano-convex.mp3 | 20-Apr-2007 03:22 | 13K | |
![[SND]](/icons/sound2.gif) | planographic.mp3 | 20-Apr-2007 03:22 | 9.3K | |
![[SND]](/icons/sound2.gif) | planography.mp3 | 20-Apr-2007 03:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | planometer.mp3 | 20-Apr-2007 03:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | planosol.mp3 | 20-Apr-2007 03:22 | 17K | |
![[SND]](/icons/sound2.gif) | plansheer.mp3 | 20-Apr-2007 03:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | Plant City.mp3 | 20-Apr-2007 03:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | plant.mp3 | 20-Apr-2007 03:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | plantable.mp3 | 20-Apr-2007 03:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | plantae.mp3 | 20-Apr-2007 03:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | Plantagenet.mp3 | 20-Apr-2007 03:22 | 11K | |
![[SND]](/icons/sound2.gif) | plantagenista.mp3 | 20-Apr-2007 03:22 | 17K | |
![[SND]](/icons/sound2.gif) | plantain.mp3 | 20-Apr-2007 03:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | plantar.mp3 | 20-Apr-2007 03:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | plantation.mp3 | 20-Apr-2007 03:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | planter.mp3 | 20-Apr-2007 03:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | planters.mp3 | 20-Apr-2007 03:22 | 17K | |
![[SND]](/icons/sound2.gif) | plantigrade.mp3 | 20-Apr-2007 03:22 | 9.8K | |
![[SND]](/icons/sound2.gif) | plantimal.mp3 | 20-Apr-2007 03:22 | 17K | |
![[SND]](/icons/sound2.gif) | Plantin.mp3 | 20-Apr-2007 03:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | planting.mp3 | 20-Apr-2007 03:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | plantlet.mp3 | 20-Apr-2007 03:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | plantlike.mp3 | 20-Apr-2007 03:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | plantocracy.mp3 | 20-Apr-2007 03:23 | 12K | |
![[SND]](/icons/sound2.gif) | plantsman.mp3 | 20-Apr-2007 03:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | planula.mp3 | 20-Apr-2007 03:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | planulae.mp3 | 20-Apr-2007 03:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | planxty.mp3 | 20-Apr-2007 03:23 | 17K | |
![[SND]](/icons/sound2.gif) | plaque.mp3 | 20-Apr-2007 03:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | plaquette.mp3 | 20-Apr-2007 03:23 | 17K | |
![[SND]](/icons/sound2.gif) | plash.mp3 | 20-Apr-2007 03:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | plashy.mp3 | 20-Apr-2007 03:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | plasia.mp3 | 20-Apr-2007 03:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | plasis.mp3 | 20-Apr-2007 03:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | plasm.mp3 | 20-Apr-2007 03:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | plasma.mp3 | 20-Apr-2007 03:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | plasmagel.mp3 | 20-Apr-2007 03:23 | 10K | |
![[SND]](/icons/sound2.gif) | plasmagene.mp3 | 20-Apr-2007 03:23 | 10K | |
![[SND]](/icons/sound2.gif) | plasmalemma.mp3 | 20-Apr-2007 03:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | plasmalogen.mp3 | 20-Apr-2007 03:23 | 17K | |
![[SND]](/icons/sound2.gif) | plasmapheresis.mp3 | 20-Apr-2007 03:23 | 11K | |
![[SND]](/icons/sound2.gif) | plasmasol.mp3 | 20-Apr-2007 03:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | plasmasphere.mp3 | 20-Apr-2007 03:23 | 17K | |
![[SND]](/icons/sound2.gif) | plasmatic.mp3 | 20-Apr-2007 03:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | plasmid.mp3 | 20-Apr-2007 03:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | plasmin.mp3 | 20-Apr-2007 03:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | plasminogen.mp3 | 20-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | plasmo.mp3 | 20-Apr-2007 03:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | plasmochin.mp3 | 20-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | plasmocyte.mp3 | 20-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | plasmodesm.mp3 | 20-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | plasmodesma.mp3 | 20-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | plasmodesmas.mp3 | 20-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | plasmodesmata.mp3 | 20-Apr-2007 03:24 | 12K | |
![[SND]](/icons/sound2.gif) | plasmodia.mp3 | 20-Apr-2007 03:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | plasmodiocarp.mp3 | 20-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | plasmodium.mp3 | 20-Apr-2007 03:24 | 9.6K | |
![[SND]](/icons/sound2.gif) | plasmogamy.mp3 | 20-Apr-2007 03:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | plasmoid.mp3 | 20-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | plasmolysis.mp3 | 20-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | plasmolytic.mp3 | 20-Apr-2007 03:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | plasmolyze.mp3 | 20-Apr-2007 03:24 | 10K | |
![[SND]](/icons/sound2.gif) | plasmon.mp3 | 20-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | plasmoptysis.mp3 | 20-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | plasmoquine.mp3 | 20-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | plasmosome.mp3 | 20-Apr-2007 03:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | Plassey.mp3 | 20-Apr-2007 03:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | plast.mp3 | 20-Apr-2007 03:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | plaster of paris.mp3 | 20-Apr-2007 03:24 | 15K | |
![[SND]](/icons/sound2.gif) | plaster.mp3 | 20-Apr-2007 03:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | plasterboard.mp3 | 20-Apr-2007 03:25 | 10K | |
![[SND]](/icons/sound2.gif) | plastered.mp3 | 20-Apr-2007 03:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | plasterer.mp3 | 20-Apr-2007 03:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | plastering.mp3 | 20-Apr-2007 03:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | plasterwork.mp3 | 20-Apr-2007 03:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | plastery.mp3 | 20-Apr-2007 03:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | plastic.mp3 | 20-Apr-2007 03:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | plastically.mp3 | 20-Apr-2007 03:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | plasticated.mp3 | 20-Apr-2007 03:25 | 17K | |
![[SND]](/icons/sound2.gif) | plasticene.mp3 | 20-Apr-2007 03:25 | 10K | |
![[SND]](/icons/sound2.gif) | plasticine.mp3 | 20-Apr-2007 03:25 | 10K | |
![[SND]](/icons/sound2.gif) | plasticity.mp3 | 20-Apr-2007 03:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | plasticization.mp3 | 20-Apr-2007 03:25 | 13K | |
![[SND]](/icons/sound2.gif) | plasticize.mp3 | 20-Apr-2007 03:25 | 10K | |
![[SND]](/icons/sound2.gif) | plasticizer.mp3 | 20-Apr-2007 03:25 | 11K | |
![[SND]](/icons/sound2.gif) | plasticky.mp3 | 20-Apr-2007 03:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | plastics.mp3 | 20-Apr-2007 03:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | plasticware.mp3 | 20-Apr-2007 03:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | plastid.mp3 | 20-Apr-2007 03:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | plastidial.mp3 | 20-Apr-2007 03:25 | 9.8K | |
![[SND]](/icons/sound2.gif) | plastique.mp3 | 20-Apr-2007 03:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | plastiqueur.mp3 | 20-Apr-2007 03:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | plastisol.mp3 | 20-Apr-2007 03:25 | 9.6K | |
![[SND]](/icons/sound2.gif) | plasto.mp3 | 20-Apr-2007 03:25 | 17K | |
![[SND]](/icons/sound2.gif) | plastocyanin.mp3 | 20-Apr-2007 03:25 | 12K | |
![[SND]](/icons/sound2.gif) | plastogene.mp3 | 20-Apr-2007 03:26 | 17K | |
![[SND]](/icons/sound2.gif) | plastometer.mp3 | 20-Apr-2007 03:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | plastoquinone.mp3 | 20-Apr-2007 03:26 | 13K | |
![[SND]](/icons/sound2.gif) | plastotype.mp3 | 20-Apr-2007 03:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | plastral.mp3 | 20-Apr-2007 03:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | plastron.mp3 | 20-Apr-2007 03:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | plasty.mp3 | 20-Apr-2007 03:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | plasy.mp3 | 20-Apr-2007 03:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | plat du jour.mp3 | 20-Apr-2007 03:26 | 10K | |
![[SND]](/icons/sound2.gif) | plat.mp3 | 20-Apr-2007 03:26 | 5.5K | |
![[SND]](/icons/sound2.gif) | Plata, Rio de la.mp3 | 20-Apr-2007 03:26 | 12K | |
![[SND]](/icons/sound2.gif) | plata.mp3 | 20-Apr-2007 03:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | Plataea.mp3 | 20-Apr-2007 03:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | Plataeae.mp3 | 20-Apr-2007 03:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | Plataean.mp3 | 20-Apr-2007 03:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | platan.mp3 | 20-Apr-2007 03:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | platanna.mp3 | 20-Apr-2007 03:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | platband.mp3 | 20-Apr-2007 03:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | platdujour.mp3 | 20-Apr-2007 03:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | plate.mp3 | 20-Apr-2007 03:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | plateau.mp3 | 20-Apr-2007 03:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | plateausproblem.mp3 | 20-Apr-2007 03:26 | 17K | |
![[SND]](/icons/sound2.gif) | plateaux.mp3 | 20-Apr-2007 03:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | plated.mp3 | 20-Apr-2007 03:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | plateful.mp3 | 20-Apr-2007 03:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | plateglass.mp3 | 20-Apr-2007 03:27 | 11K | |
![[SND]](/icons/sound2.gif) | platelet.mp3 | 20-Apr-2007 03:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | platelike.mp3 | 20-Apr-2007 03:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | platemaker.mp3 | 20-Apr-2007 03:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | platemaking.mp3 | 20-Apr-2007 03:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | platen.mp3 | 20-Apr-2007 03:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | plater.mp3 | 20-Apr-2007 03:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | plateresque.mp3 | 20-Apr-2007 03:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | platform.mp3 | 20-Apr-2007 03:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | Plath.mp3 | 20-Apr-2007 03:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | platina.mp3 | 20-Apr-2007 03:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | platinate.mp3 | 20-Apr-2007 03:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | plating.mp3 | 20-Apr-2007 03:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | platinic.mp3 | 20-Apr-2007 03:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | platiniferous.mp3 | 20-Apr-2007 03:27 | 17K | |
![[SND]](/icons/sound2.gif) | platiniridium.mp3 | 20-Apr-2007 03:27 | 17K | |
![[SND]](/icons/sound2.gif) | platinite.mp3 | 20-Apr-2007 03:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | platinize.mp3 | 20-Apr-2007 03:27 | 10K | |
![[SND]](/icons/sound2.gif) | platinocyanic.mp3 | 20-Apr-2007 03:27 | 17K | |
![[SND]](/icons/sound2.gif) | platinocyanide.mp3 | 20-Apr-2007 03:27 | 14K | |
![[SND]](/icons/sound2.gif) | platinoid.mp3 | 20-Apr-2007 03:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | platinotype.mp3 | 20-Apr-2007 03:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | platinous.mp3 | 20-Apr-2007 03:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | platinum.mp3 | 20-Apr-2007 03:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | platitude.mp3 | 20-Apr-2007 03:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | platitudinal.mp3 | 20-Apr-2007 03:27 | 11K | |
![[SND]](/icons/sound2.gif) | platitudinarian.mp3 | 20-Apr-2007 03:28 | 14K | |
![[SND]](/icons/sound2.gif) | platitudinize.mp3 | 20-Apr-2007 03:28 | 13K | |
![[SND]](/icons/sound2.gif) | platitudinous.mp3 | 20-Apr-2007 03:28 | 12K | |
![[SND]](/icons/sound2.gif) | Plato.mp3 | 20-Apr-2007 03:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | Platonic.mp3 | 20-Apr-2007 03:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | platonically.mp3 | 20-Apr-2007 03:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | Platonism.mp3 | 20-Apr-2007 03:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | Platonist.mp3 | 20-Apr-2007 03:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | Platonistic.mp3 | 20-Apr-2007 03:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | Platonize.mp3 | 20-Apr-2007 03:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | platoon.mp3 | 20-Apr-2007 03:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | plats du jour.mp3 | 20-Apr-2007 03:28 | 10K | |
![[SND]](/icons/sound2.gif) | Plattdeutsch.mp3 | 20-Apr-2007 03:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | Platte.mp3 | 20-Apr-2007 03:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | platteland.mp3 | 20-Apr-2007 03:28 | 17K | |
![[SND]](/icons/sound2.gif) | Plattensee.mp3 | 20-Apr-2007 03:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | platter.mp3 | 20-Apr-2007 03:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | platterful.mp3 | 20-Apr-2007 03:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | plattnationalpark.mp3 | 20-Apr-2007 03:28 | 18K | |
![[SND]](/icons/sound2.gif) | Plattsburgh.mp3 | 20-Apr-2007 03:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | platy.mp3 | 20-Apr-2007 03:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | platycephalic.mp3 | 20-Apr-2007 03:28 | 17K | |
![[SND]](/icons/sound2.gif) | platycnemia.mp3 | 20-Apr-2007 03:28 | 17K | |
![[SND]](/icons/sound2.gif) | platyfish.mp3 | 20-Apr-2007 03:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | platyhelminth.mp3 | 20-Apr-2007 03:28 | 11K | |
![[SND]](/icons/sound2.gif) | platyhelminthes.mp3 | 20-Apr-2007 03:29 | 17K | |
![[SND]](/icons/sound2.gif) | platyhelminthic.mp3 | 20-Apr-2007 03:29 | 11K | |
![[SND]](/icons/sound2.gif) | platykurtic.mp3 | 20-Apr-2007 03:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | platykurtosis.mp3 | 20-Apr-2007 03:29 | 17K | |
![[SND]](/icons/sound2.gif) | platypi.mp3 | 20-Apr-2007 03:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | platypod.mp3 | 20-Apr-2007 03:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | platypus.mp3 | 20-Apr-2007 03:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | platyrrhine.mp3 | 20-Apr-2007 03:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | platysma.mp3 | 20-Apr-2007 03:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | plaudit.mp3 | 20-Apr-2007 03:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | Plauen im Vogtland.mp3 | 20-Apr-2007 03:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | Plauen.mp3 | 20-Apr-2007 03:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | plausibility.mp3 | 20-Apr-2007 03:29 | 9.6K | |
![[SND]](/icons/sound2.gif) | plausible.mp3 | 20-Apr-2007 03:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | plausibly.mp3 | 20-Apr-2007 03:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | plausive.mp3 | 20-Apr-2007 03:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | Plautine.mp3 | 20-Apr-2007 03:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | Plautus.mp3 | 20-Apr-2007 03:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | plax.mp3 | 20-Apr-2007 03:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | play.mp3 | 20-Apr-2007 03:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | playa.mp3 | 20-Apr-2007 03:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | playability.mp3 | 20-Apr-2007 03:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | playable.mp3 | 20-Apr-2007 03:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | playact.mp3 | 20-Apr-2007 03:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | playback.mp3 | 20-Apr-2007 03:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | playbill.mp3 | 20-Apr-2007 03:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | playbook.mp3 | 20-Apr-2007 03:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | playboy.mp3 | 20-Apr-2007 03:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | play-by-play.mp3 | 20-Apr-2007 03:30 | 11K | |
![[SND]](/icons/sound2.gif) | playdate.mp3 | 20-Apr-2007 03:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | playdoh.mp3 | 20-Apr-2007 03:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | player.mp3 | 20-Apr-2007 03:30 | 6.3K | |
![[SND]](/icons/sound2.gif) | players.mp3 | 20-Apr-2007 03:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | playfellow.mp3 | 20-Apr-2007 03:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | playfield.mp3 | 20-Apr-2007 03:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | playful.mp3 | 20-Apr-2007 03:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | playfully.mp3 | 20-Apr-2007 03:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | playgirl.mp3 | 20-Apr-2007 03:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | playgoer.mp3 | 20-Apr-2007 03:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | playground.mp3 | 20-Apr-2007 03:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | playgroup.mp3 | 20-Apr-2007 03:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | playhouse.mp3 | 20-Apr-2007 03:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | playing card.mp3 | 20-Apr-2007 03:30 | 11K | |
![[SND]](/icons/sound2.gif) | playland.mp3 | 20-Apr-2007 03:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | playlet.mp3 | 20-Apr-2007 03:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | playlist.mp3 | 20-Apr-2007 03:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | playmaker.mp3 | 20-Apr-2007 03:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | playmaking.mp3 | 20-Apr-2007 03:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | playmate.mp3 | 20-Apr-2007 03:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | play-off.mp3 | 20-Apr-2007 03:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | playpen.mp3 | 20-Apr-2007 03:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | playroom.mp3 | 20-Apr-2007 03:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | playsome.mp3 | 20-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | playsuit.mp3 | 20-Apr-2007 03:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | playtex.mp3 | 20-Apr-2007 03:31 | 17K | |
![[SND]](/icons/sound2.gif) | plaything.mp3 | 20-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | playtime.mp3 | 20-Apr-2007 03:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | playwear.mp3 | 20-Apr-2007 03:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | playwright.mp3 | 20-Apr-2007 03:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | playwrighting.mp3 | 20-Apr-2007 03:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | playwriting.mp3 | 20-Apr-2007 03:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | plaza.mp3 | 20-Apr-2007 03:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | plazadetoros.mp3 | 20-Apr-2007 03:31 | 17K | |
![[SND]](/icons/sound2.gif) | plazalasso.mp3 | 20-Apr-2007 03:31 | 17K | |
![[SND]](/icons/sound2.gif) | plea bargaining.mp3 | 20-Apr-2007 03:31 | 9.8K | |
![[SND]](/icons/sound2.gif) | plea.mp3 | 20-Apr-2007 03:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | pleach.mp3 | 20-Apr-2007 03:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | plead.mp3 | 20-Apr-2007 03:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | pleadable.mp3 | 20-Apr-2007 03:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | pleaded.mp3 | 20-Apr-2007 03:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | pleader.mp3 | 20-Apr-2007 03:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleading.mp3 | 20-Apr-2007 03:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleadingly.mp3 | 20-Apr-2007 03:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | pleasance.mp3 | 20-Apr-2007 03:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pleasant Island.mp3 | 20-Apr-2007 03:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | pleasant.mp3 | 20-Apr-2007 03:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | Pleasanton.mp3 | 20-Apr-2007 03:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | pleasantry.mp3 | 20-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | pleasantville.mp3 | 20-Apr-2007 03:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | please.mp3 | 20-Apr-2007 03:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | pleased.mp3 | 20-Apr-2007 03:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | pleasence.mp3 | 20-Apr-2007 03:32 | 17K | |
![[SND]](/icons/sound2.gif) | pleaser.mp3 | 20-Apr-2007 03:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | pleasing.mp3 | 20-Apr-2007 03:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | pleasingly.mp3 | 20-Apr-2007 03:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | pleasurability.mp3 | 20-Apr-2007 03:32 | 11K | |
![[SND]](/icons/sound2.gif) | pleasurable.mp3 | 20-Apr-2007 03:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | pleasurableness.mp3 | 20-Apr-2007 03:32 | 12K | |
![[SND]](/icons/sound2.gif) | pleasurably.mp3 | 20-Apr-2007 03:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | pleasure.mp3 | 20-Apr-2007 03:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | pleasureless.mp3 | 20-Apr-2007 03:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | pleasuring.mp3 | 20-Apr-2007 03:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleat.mp3 | 20-Apr-2007 03:32 | 5.7K | |
![[SND]](/icons/sound2.gif) | pleatless.mp3 | 20-Apr-2007 03:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | pleb.mp3 | 20-Apr-2007 03:32 | 5.7K | |
![[SND]](/icons/sound2.gif) | plebby.mp3 | 20-Apr-2007 03:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | plebe.mp3 | 20-Apr-2007 03:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | plebeian.mp3 | 20-Apr-2007 03:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | plebeianism.mp3 | 20-Apr-2007 03:32 | 10K | |
![[SND]](/icons/sound2.gif) | plebes.mp3 | 20-Apr-2007 03:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | plebiocologist.mp3 | 20-Apr-2007 03:32 | 17K | |
![[SND]](/icons/sound2.gif) | plebiscitary.mp3 | 20-Apr-2007 03:32 | 11K | |
![[SND]](/icons/sound2.gif) | plebiscite.mp3 | 20-Apr-2007 03:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | plebs.mp3 | 20-Apr-2007 03:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | plecopteran.mp3 | 20-Apr-2007 03:33 | 10K | |
![[SND]](/icons/sound2.gif) | plectognath.mp3 | 20-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | plectra.mp3 | 20-Apr-2007 03:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | plectron.mp3 | 20-Apr-2007 03:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | plectrum.mp3 | 20-Apr-2007 03:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | pled.mp3 | 20-Apr-2007 03:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | pledge.mp3 | 20-Apr-2007 03:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | pledgee.mp3 | 20-Apr-2007 03:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | pledger.mp3 | 20-Apr-2007 03:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | pledget.mp3 | 20-Apr-2007 03:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | pledgor.mp3 | 20-Apr-2007 03:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | pleep.mp3 | 20-Apr-2007 03:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | plegia.mp3 | 20-Apr-2007 03:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | pleiad.mp3 | 20-Apr-2007 03:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | Pleiades.mp3 | 20-Apr-2007 03:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | plein air.mp3 | 20-Apr-2007 03:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | pleinair.mp3 | 20-Apr-2007 03:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | pleinairism.mp3 | 20-Apr-2007 03:33 | 10K | |
![[SND]](/icons/sound2.gif) | pleinairist.mp3 | 20-Apr-2007 03:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | pleio.mp3 | 20-Apr-2007 03:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | pleiocene.mp3 | 20-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | pleiomery.mp3 | 20-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | pleione.mp3 | 20-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | pleiophylly.mp3 | 20-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | pleiotaxy.mp3 | 20-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | pleiotropic.mp3 | 20-Apr-2007 03:34 | 10K | |
![[SND]](/icons/sound2.gif) | pleiotropy.mp3 | 20-Apr-2007 03:34 | 11K | |
![[SND]](/icons/sound2.gif) | Pleistocene.mp3 | 20-Apr-2007 03:34 | 10K | |
![[SND]](/icons/sound2.gif) | Plekhanov.mp3 | 20-Apr-2007 03:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | plena.mp3 | 20-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | plenary.mp3 | 20-Apr-2007 03:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | plench.mp3 | 20-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | plenipotent.mp3 | 20-Apr-2007 03:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | plenipotentiary.mp3 | 20-Apr-2007 03:34 | 12K | |
![[SND]](/icons/sound2.gif) | plenish.mp3 | 20-Apr-2007 03:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | plenitude.mp3 | 20-Apr-2007 03:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | plenitudinous.mp3 | 20-Apr-2007 03:34 | 11K | |
![[SND]](/icons/sound2.gif) | pleno jure.mp3 | 20-Apr-2007 03:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | plenojure.mp3 | 20-Apr-2007 03:34 | 17K | |
![[SND]](/icons/sound2.gif) | plenteous.mp3 | 20-Apr-2007 03:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | plentiful.mp3 | 20-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | plentifully.mp3 | 20-Apr-2007 03:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | plentitude.mp3 | 20-Apr-2007 03:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | plenty.mp3 | 20-Apr-2007 03:34 | 6.3K | |
![[SND]](/icons/sound2.gif) | plenum.mp3 | 20-Apr-2007 03:34 | 5.7K | |
![[SND]](/icons/sound2.gif) | pleo.mp3 | 20-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleochroic.mp3 | 20-Apr-2007 03:34 | 10K | |
![[SND]](/icons/sound2.gif) | pleochroism.mp3 | 20-Apr-2007 03:34 | 12K | |
![[SND]](/icons/sound2.gif) | pleomorphic.mp3 | 20-Apr-2007 03:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | pleomorphism.mp3 | 20-Apr-2007 03:34 | 11K | |
![[SND]](/icons/sound2.gif) | pleon.mp3 | 20-Apr-2007 03:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleonasm.mp3 | 20-Apr-2007 03:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | pleonastic.mp3 | 20-Apr-2007 03:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | pleonastically.mp3 | 20-Apr-2007 03:35 | 11K | |
![[SND]](/icons/sound2.gif) | pleophagous.mp3 | 20-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | pleopod.mp3 | 20-Apr-2007 03:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | pleoptics.mp3 | 20-Apr-2007 03:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | plerocercoid.mp3 | 20-Apr-2007 03:35 | 12K | |
![[SND]](/icons/sound2.gif) | plesio.mp3 | 20-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | plesiosaur.mp3 | 20-Apr-2007 03:35 | 11K | |
![[SND]](/icons/sound2.gif) | plessey.mp3 | 20-Apr-2007 03:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | plessor.mp3 | 20-Apr-2007 03:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | plethora.mp3 | 20-Apr-2007 03:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | plethoric.mp3 | 20-Apr-2007 03:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | plethysmogram.mp3 | 20-Apr-2007 03:35 | 12K | |
![[SND]](/icons/sound2.gif) | plethysmograph.mp3 | 20-Apr-2007 03:35 | 12K | |
![[SND]](/icons/sound2.gif) | plethysmographic.mp3 | 20-Apr-2007 03:35 | 13K | |
![[SND]](/icons/sound2.gif) | plethysmographically.mp3 | 20-Apr-2007 03:35 | 13K | |
![[SND]](/icons/sound2.gif) | plethysmography.mp3 | 20-Apr-2007 03:35 | 12K | |
![[SND]](/icons/sound2.gif) | pleugh.mp3 | 20-Apr-2007 03:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleur.mp3 | 20-Apr-2007 03:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleura.mp3 | 20-Apr-2007 03:35 | 5.7K | |
![[SND]](/icons/sound2.gif) | pleurae.mp3 | 20-Apr-2007 03:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | pleural.mp3 | 20-Apr-2007 03:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | pleurisy.mp3 | 20-Apr-2007 03:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | pleurite.mp3 | 20-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | pleuritic.mp3 | 20-Apr-2007 03:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | pleuro.mp3 | 20-Apr-2007 03:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | pleurocarpous.mp3 | 20-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | pleurocentesis.mp3 | 20-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | pleurodont.mp3 | 20-Apr-2007 03:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | pleurodynia.mp3 | 20-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | pleurogenous.mp3 | 20-Apr-2007 03:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | pleuron.mp3 | 20-Apr-2007 03:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | pleuropneumonia.mp3 | 20-Apr-2007 03:36 | 11K | |
![[SND]](/icons/sound2.gif) | pleurotomy.mp3 | 20-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | pleuston.mp3 | 20-Apr-2007 03:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | pleustonic.mp3 | 20-Apr-2007 03:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pleven.mp3 | 20-Apr-2007 03:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | plew.mp3 | 20-Apr-2007 03:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | plex.mp3 | 20-Apr-2007 03:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | plexal.mp3 | 20-Apr-2007 03:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | plexiform.mp3 | 20-Apr-2007 03:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | Plexiglas.mp3 | 20-Apr-2007 03:36 | 10K | |
![[SND]](/icons/sound2.gif) | pleximeter.mp3 | 20-Apr-2007 03:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | plexor.mp3 | 20-Apr-2007 03:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | plexus.mp3 | 20-Apr-2007 03:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | plexuses.mp3 | 20-Apr-2007 03:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | pliability.mp3 | 20-Apr-2007 03:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | pliable.mp3 | 20-Apr-2007 03:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | pliableness.mp3 | 20-Apr-2007 03:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | pliably.mp3 | 20-Apr-2007 03:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | pliancy.mp3 | 20-Apr-2007 03:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | pliant.mp3 | 20-Apr-2007 03:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | plica.mp3 | 20-Apr-2007 03:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | plicae.mp3 | 20-Apr-2007 03:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | plicate.mp3 | 20-Apr-2007 03:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | plication.mp3 | 20-Apr-2007 03:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | plie.mp3 | 20-Apr-2007 03:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | plier.mp3 | 20-Apr-2007 03:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | pliers.mp3 | 20-Apr-2007 03:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | plight.mp3 | 20-Apr-2007 03:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | plim.mp3 | 20-Apr-2007 03:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | plimsoll.mp3 | 20-Apr-2007 03:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | pling.mp3 | 20-Apr-2007 03:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | plink.mp3 | 20-Apr-2007 03:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | plinth.mp3 | 20-Apr-2007 03:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | plinthite.mp3 | 20-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | Pliny.mp3 | 20-Apr-2007 03:37 | 5.0K | |
![[SND]](/icons/sound2.gif) | plio.mp3 | 20-Apr-2007 03:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pliocene.mp3 | 20-Apr-2007 03:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | pliofilm.mp3 | 20-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | pliotron.mp3 | 20-Apr-2007 03:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | pliqueajour.mp3 | 20-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | plique-a-jour.mp3 | 20-Apr-2007 03:37 | 11K | |
![[SND]](/icons/sound2.gif) | plisetskaya.mp3 | 20-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | pliskie.mp3 | 20-Apr-2007 03:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | plisky.mp3 | 20-Apr-2007 03:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | plisse.mp3 | 20-Apr-2007 03:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | ploat.mp3 | 20-Apr-2007 03:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | ploce.mp3 | 20-Apr-2007 03:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | Plock.mp3 | 20-Apr-2007 03:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | plod.mp3 | 20-Apr-2007 03:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | ploddingly.mp3 | 20-Apr-2007 03:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | plodge.mp3 | 20-Apr-2007 03:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ploesti.mp3 | 20-Apr-2007 03:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | ploid.mp3 | 20-Apr-2007 03:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | ploidy.mp3 | 20-Apr-2007 03:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | plokta.mp3 | 20-Apr-2007 03:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | plomb.mp3 | 20-Apr-2007 03:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | plomer.mp3 | 20-Apr-2007 03:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | ploms.mp3 | 20-Apr-2007 03:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | plonk.mp3 | 20-Apr-2007 03:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | plonked.mp3 | 20-Apr-2007 03:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | plonker.mp3 | 20-Apr-2007 03:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | plonko.mp3 | 20-Apr-2007 03:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | plook.mp3 | 20-Apr-2007 03:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | ploot.mp3 | 20-Apr-2007 03:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | plootered.mp3 | 20-Apr-2007 03:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | plop.mp3 | 20-Apr-2007 03:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | plosion.mp3 | 20-Apr-2007 03:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | plosive.mp3 | 20-Apr-2007 03:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | plot.mp3 | 20-Apr-2007 03:39 | 5.7K | |
![[SND]](/icons/sound2.gif) | Plotinian.mp3 | 20-Apr-2007 03:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | plotinism.mp3 | 20-Apr-2007 03:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | Plotinus.mp3 | 20-Apr-2007 03:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | plotless.mp3 | 20-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | plotline.mp3 | 20-Apr-2007 03:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | plottage.mp3 | 20-Apr-2007 03:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | plotter.mp3 | 20-Apr-2007 03:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | plotthound.mp3 | 20-Apr-2007 03:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | plotting.mp3 | 20-Apr-2007 03:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | plotty.mp3 | 20-Apr-2007 03:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | plotz.mp3 | 20-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | plotzed.mp3 | 20-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | plough.mp3 | 20-Apr-2007 03:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | ploughed.mp3 | 20-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ploughman's lunch.mp3 | 20-Apr-2007 03:39 | 12K | |
![[SND]](/icons/sound2.gif) | plouk.mp3 | 20-Apr-2007 03:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | plouter.mp3 | 20-Apr-2007 03:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | Plovdiv.mp3 | 20-Apr-2007 03:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | plover.mp3 | 20-Apr-2007 03:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | plow.mp3 | 20-Apr-2007 03:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | plowable.mp3 | 20-Apr-2007 03:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | plowback.mp3 | 20-Apr-2007 03:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | plowboy.mp3 | 20-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | plowdenreport.mp3 | 20-Apr-2007 03:39 | 17K | |
![[SND]](/icons/sound2.gif) | plowed.mp3 | 20-Apr-2007 03:39 | 17K | |
![[SND]](/icons/sound2.gif) | plower.mp3 | 20-Apr-2007 03:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | plowman.mp3 | 20-Apr-2007 03:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | plowright.mp3 | 20-Apr-2007 03:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | plowshare.mp3 | 20-Apr-2007 03:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | plowter.mp3 | 20-Apr-2007 03:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | plowwind.mp3 | 20-Apr-2007 03:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | ploy.mp3 | 20-Apr-2007 03:40 | 6.1K | |
![[SND]](/icons/sound2.gif) | plu.mp3 | 20-Apr-2007 03:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | pluck.mp3 | 20-Apr-2007 03:40 | 5.0K | |
![[SND]](/icons/sound2.gif) | plucked.mp3 | 20-Apr-2007 03:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | pluckily.mp3 | 20-Apr-2007 03:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | pluckiness.mp3 | 20-Apr-2007 03:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | pluckless.mp3 | 20-Apr-2007 03:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | plucky.mp3 | 20-Apr-2007 03:40 | 5.9K | |
![[SND]](/icons/sound2.gif) | plue.mp3 | 20-Apr-2007 03:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | plug.mp3 | 20-Apr-2007 03:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | plugged.mp3 | 20-Apr-2007 03:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | plugged-in.mp3 | 20-Apr-2007 03:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | plugger.mp3 | 20-Apr-2007 03:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | plugging.mp3 | 20-Apr-2007 03:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | plug-in.mp3 | 20-Apr-2007 03:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | plugola.mp3 | 20-Apr-2007 03:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | plug-ugly.mp3 | 20-Apr-2007 03:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | plugumentary.mp3 | 20-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | pluke.mp3 | 20-Apr-2007 03:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | plum.mp3 | 20-Apr-2007 03:41 | 5.4K | |
![[SND]](/icons/sound2.gif) | plumage.mp3 | 20-Apr-2007 03:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | plumaged.mp3 | 20-Apr-2007 03:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | plumassier.mp3 | 20-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | plumate.mp3 | 20-Apr-2007 03:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumb.mp3 | 20-Apr-2007 03:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | plumbaginaceous.mp3 | 20-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | plumbaginous.mp3 | 20-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | plumbago.mp3 | 20-Apr-2007 03:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | plumbeous.mp3 | 20-Apr-2007 03:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumber.mp3 | 20-Apr-2007 03:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | plumbery.mp3 | 20-Apr-2007 03:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumbic.mp3 | 20-Apr-2007 03:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumbicon.mp3 | 20-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | plumbiferous.mp3 | 20-Apr-2007 03:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | plumbing.mp3 | 20-Apr-2007 03:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | plumbism.mp3 | 20-Apr-2007 03:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | plumbless.mp3 | 20-Apr-2007 03:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | plumbous.mp3 | 20-Apr-2007 03:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumbum.mp3 | 20-Apr-2007 03:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumcot.mp3 | 20-Apr-2007 03:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | plume.mp3 | 20-Apr-2007 03:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | plumed.mp3 | 20-Apr-2007 03:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumelet.mp3 | 20-Apr-2007 03:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | plumeria.mp3 | 20-Apr-2007 03:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | plumicorn.mp3 | 20-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | plumlike.mp3 | 20-Apr-2007 03:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | plummer.mp3 | 20-Apr-2007 03:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | plummet.mp3 | 20-Apr-2007 03:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | plummy.mp3 | 20-Apr-2007 03:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | plumose.mp3 | 20-Apr-2007 03:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | plump.mp3 | 20-Apr-2007 03:42 | 5.2K | |
![[SND]](/icons/sound2.gif) | plumpen.mp3 | 20-Apr-2007 03:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | plumper.mp3 | 20-Apr-2007 03:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | plumpish.mp3 | 20-Apr-2007 03:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | plumply.mp3 | 20-Apr-2007 03:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | plumpness.mp3 | 20-Apr-2007 03:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | plumpy.mp3 | 20-Apr-2007 03:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | plumskin.mp3 | 20-Apr-2007 03:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | plumulaceous.mp3 | 20-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | plumulate.mp3 | 20-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | plumule.mp3 | 20-Apr-2007 03:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | plumulose.mp3 | 20-Apr-2007 03:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | plumy.mp3 | 20-Apr-2007 03:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | pluna.mp3 | 20-Apr-2007 03:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | plunder.mp3 | 20-Apr-2007 03:43 | 5.9K | |
![[SND]](/icons/sound2.gif) | plunderage.mp3 | 20-Apr-2007 03:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | plunderer.mp3 | 20-Apr-2007 03:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | plundering.mp3 | 20-Apr-2007 03:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | plunderous.mp3 | 20-Apr-2007 03:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | plunge.mp3 | 20-Apr-2007 03:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | plunger.mp3 | 20-Apr-2007 03:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | plunk.mp3 | 20-Apr-2007 03:43 | 5.0K | |
![[SND]](/icons/sound2.gif) | plunker.mp3 | 20-Apr-2007 03:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | plunket.mp3 | 20-Apr-2007 03:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | plunkie.mp3 | 20-Apr-2007 03:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | pluperfect.mp3 | 20-Apr-2007 03:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | plural.mp3 | 20-Apr-2007 03:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | pluralism.mp3 | 20-Apr-2007 03:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | pluralist.mp3 | 20-Apr-2007 03:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | pluralistic.mp3 | 20-Apr-2007 03:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | pluralistically.mp3 | 20-Apr-2007 03:43 | 11K | |
![[SND]](/icons/sound2.gif) | plurality.mp3 | 20-Apr-2007 03:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | pluralization.mp3 | 20-Apr-2007 03:43 | 11K | |
![[SND]](/icons/sound2.gif) | pluralize.mp3 | 20-Apr-2007 03:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | plurally.mp3 | 20-Apr-2007 03:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | pluri.mp3 | 20-Apr-2007 03:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | pluriliteral.mp3 | 20-Apr-2007 03:43 | 17K | |
![[SND]](/icons/sound2.gif) | pluripotent.mp3 | 20-Apr-2007 03:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | plurry.mp3 | 20-Apr-2007 03:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | plus ca change, plus c'est la meme chose.mp3 | 20-Apr-2007 03:44 | 25K | |
![[SND]](/icons/sound2.gif) | plus royaliste que le roi.mp3 | 20-Apr-2007 03:44 | 17K | |
![[SND]](/icons/sound2.gif) | plus.mp3 | 20-Apr-2007 03:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | pluscachangepluscestlamemechose.mp3 | 20-Apr-2007 03:44 | 36K | |
![[SND]](/icons/sound2.gif) | pluses.mp3 | 20-Apr-2007 03:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | plush.mp3 | 20-Apr-2007 03:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | plushery.mp3 | 20-Apr-2007 03:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | plushy.mp3 | 20-Apr-2007 03:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | plusroyalistequeleroi.mp3 | 20-Apr-2007 03:44 | 27K | |
![[SND]](/icons/sound2.gif) | plussage.mp3 | 20-Apr-2007 03:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | Plutarch.mp3 | 20-Apr-2007 03:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | Plutarchan.mp3 | 20-Apr-2007 03:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Plutarchian.mp3 | 20-Apr-2007 03:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | plutarchy.mp3 | 20-Apr-2007 03:44 | 17K | |
![[SND]](/icons/sound2.gif) | plute.mp3 | 20-Apr-2007 03:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | pluteus.mp3 | 20-Apr-2007 03:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pluto.mp3 | 20-Apr-2007 03:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | plutocracy.mp3 | 20-Apr-2007 03:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | plutocrat.mp3 | 20-Apr-2007 03:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | plutocratic.mp3 | 20-Apr-2007 03:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | plutocratically.mp3 | 20-Apr-2007 03:44 | 11K | |
![[SND]](/icons/sound2.gif) | plutolatry.mp3 | 20-Apr-2007 03:44 | 17K | |
![[SND]](/icons/sound2.gif) | pluton.mp3 | 20-Apr-2007 03:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | plutonian.mp3 | 20-Apr-2007 03:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | plutonic.mp3 | 20-Apr-2007 03:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | plutonism.mp3 | 20-Apr-2007 03:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | plutonium.mp3 | 20-Apr-2007 03:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | plutonomy.mp3 | 20-Apr-2007 03:45 | 17K | |
![[SND]](/icons/sound2.gif) | plutus.mp3 | 20-Apr-2007 03:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | pluvial.mp3 | 20-Apr-2007 03:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | pluviometer.mp3 | 20-Apr-2007 03:45 | 17K | |
![[SND]](/icons/sound2.gif) | pluviose.mp3 | 20-Apr-2007 03:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | pluvious.mp3 | 20-Apr-2007 03:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | ply.mp3 | 20-Apr-2007 03:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | plyer.mp3 | 20-Apr-2007 03:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | plyglass.mp3 | 20-Apr-2007 03:45 | 17K | |
![[SND]](/icons/sound2.gif) | Plymouth Rock.mp3 | 20-Apr-2007 03:45 | 11K | |
![[SND]](/icons/sound2.gif) | Plymouth.mp3 | 20-Apr-2007 03:45 | 5.7K | |
![[SND]](/icons/sound2.gif) | plyometric.mp3 | 20-Apr-2007 03:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | plyometrics.mp3 | 20-Apr-2007 03:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | plywood.mp3 | 20-Apr-2007 03:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | Plzen.mp3 | 20-Apr-2007 03:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | PMS.mp3 | 20-Apr-2007 03:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | pnambic.mp3 | 20-Apr-2007 03:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | pnea.mp3 | 20-Apr-2007 03:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | pneudraulic.mp3 | 20-Apr-2007 03:45 | 17K | |
![[SND]](/icons/sound2.gif) | pneuma.mp3 | 20-Apr-2007 03:45 | 5.5K | |
![[SND]](/icons/sound2.gif) | pneumat.mp3 | 20-Apr-2007 03:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | pneumatic.mp3 | 20-Apr-2007 03:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | pneumatically.mp3 | 20-Apr-2007 03:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | pneumaticity.mp3 | 20-Apr-2007 03:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | pneumatics.mp3 | 20-Apr-2007 03:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | pneumato.mp3 | 20-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | pneumatocyst.mp3 | 20-Apr-2007 03:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | pneumatograph.mp3 | 20-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | pneumatology.mp3 | 20-Apr-2007 03:46 | 11K | |
![[SND]](/icons/sound2.gif) | pneumatolysis.mp3 | 20-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | pneumatolytic.mp3 | 20-Apr-2007 03:46 | 10K | |
![[SND]](/icons/sound2.gif) | pneumatometer.mp3 | 20-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | pneumatophore.mp3 | 20-Apr-2007 03:46 | 9.6K | |
![[SND]](/icons/sound2.gif) | pneumectomy.mp3 | 20-Apr-2007 03:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | pneumo.mp3 | 20-Apr-2007 03:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | pneumococcal.mp3 | 20-Apr-2007 03:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | pneumococci.mp3 | 20-Apr-2007 03:46 | 11K | |
![[SND]](/icons/sound2.gif) | pneumococcus.mp3 | 20-Apr-2007 03:46 | 10K | |
![[SND]](/icons/sound2.gif) | pneumoconioses.mp3 | 20-Apr-2007 03:46 | 13K | |
![[SND]](/icons/sound2.gif) | pneumoconiosis.mp3 | 20-Apr-2007 03:46 | 13K | |
![[SND]](/icons/sound2.gif) | Pneumocystis carinii pneumonia.mp3 | 20-Apr-2007 03:46 | 24K | |
![[SND]](/icons/sound2.gif) | pneumocystispneumonia.mp3 | 20-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | pneumograph.mp3 | 20-Apr-2007 03:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | pneumography.mp3 | 20-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | pneumon.mp3 | 20-Apr-2007 03:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | pneumonectomy.mp3 | 20-Apr-2007 03:46 | 10K | |
![[SND]](/icons/sound2.gif) | pneumonia.mp3 | 20-Apr-2007 03:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | pneumonic.mp3 | 20-Apr-2007 03:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | pneumonitis.mp3 | 20-Apr-2007 03:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | pneumono.mp3 | 20-Apr-2007 03:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | pneumonoconiosis.mp3 | 20-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | pneumonoultramicroscopicsilicovolcanoconiosis.mp3 | 20-Apr-2007 03:47 | 45K | |
![[SND]](/icons/sound2.gif) | pneumothorax.mp3 | 20-Apr-2007 03:47 | 11K | |
![[SND]](/icons/sound2.gif) | pnoea.mp3 | 20-Apr-2007 03:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | pnyx.mp3 | 20-Apr-2007 03:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Po Hai.mp3 | 20-Apr-2007 03:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | Po.mp3 | 20-Apr-2007 03:47 | 5.0K | |
![[SND]](/icons/sound2.gif) | poa.mp3 | 20-Apr-2007 03:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | poaceous.mp3 | 20-Apr-2007 03:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | poach.mp3 | 20-Apr-2007 03:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | poacher.mp3 | 20-Apr-2007 03:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | poaching.mp3 | 20-Apr-2007 03:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | poachy.mp3 | 20-Apr-2007 03:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pobeda Peak.mp3 | 20-Apr-2007 03:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | poblacion.mp3 | 20-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | poblador.mp3 | 20-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | poblano.mp3 | 20-Apr-2007 03:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | poboy.mp3 | 20-Apr-2007 03:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | po'boy.mp3 | 20-Apr-2007 03:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | Pocahontas.mp3 | 20-Apr-2007 03:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | pocas palabras.mp3 | 20-Apr-2007 03:47 | 14K | |
![[SND]](/icons/sound2.gif) | Pocatello.mp3 | 20-Apr-2007 03:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | pochade.mp3 | 20-Apr-2007 03:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | pochard.mp3 | 20-Apr-2007 03:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | poche.mp3 | 20-Apr-2007 03:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pochette.mp3 | 20-Apr-2007 03:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pochismo.mp3 | 20-Apr-2007 03:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pocho.mp3 | 20-Apr-2007 03:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pock.mp3 | 20-Apr-2007 03:48 | 5.5K | |
![[SND]](/icons/sound2.gif) | pocked.mp3 | 20-Apr-2007 03:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pocket.mp3 | 20-Apr-2007 03:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | pocketable.mp3 | 20-Apr-2007 03:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pocketbook.mp3 | 20-Apr-2007 03:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | pocketful.mp3 | 20-Apr-2007 03:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | pocketing.mp3 | 20-Apr-2007 03:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | pocketknife.mp3 | 20-Apr-2007 03:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | pocket-size.mp3 | 20-Apr-2007 03:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | pocket-sized.mp3 | 20-Apr-2007 03:48 | 10K | |
![[SND]](/icons/sound2.gif) | pockety.mp3 | 20-Apr-2007 03:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | pockmark.mp3 | 20-Apr-2007 03:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | pocky.mp3 | 20-Apr-2007 03:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | poco a poco.mp3 | 20-Apr-2007 03:48 | 13K | |
![[SND]](/icons/sound2.gif) | poco.mp3 | 20-Apr-2007 03:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | pocoapoco.mp3 | 20-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | pococurante.mp3 | 20-Apr-2007 03:48 | 13K | |
![[SND]](/icons/sound2.gif) | pococurantism.mp3 | 20-Apr-2007 03:48 | 15K | |
![[SND]](/icons/sound2.gif) | Pocono Mountains.mp3 | 20-Apr-2007 03:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | poconomountains.mp3 | 20-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | pocosdecaldas.mp3 | 20-Apr-2007 03:49 | 17K | |
![[SND]](/icons/sound2.gif) | pocosin.mp3 | 20-Apr-2007 03:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | poculiform.mp3 | 20-Apr-2007 03:49 | 17K | |
![[SND]](/icons/sound2.gif) | pod.mp3 | 20-Apr-2007 03:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | poda.mp3 | 20-Apr-2007 03:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | podagra.mp3 | 20-Apr-2007 03:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | podalgia.mp3 | 20-Apr-2007 03:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | podalic.mp3 | 20-Apr-2007 03:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | poddy.mp3 | 20-Apr-2007 03:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | pode.mp3 | 20-Apr-2007 03:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | podesta.mp3 | 20-Apr-2007 03:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | podetiiform.mp3 | 20-Apr-2007 03:49 | 17K | |
![[SND]](/icons/sound2.gif) | podetium.mp3 | 20-Apr-2007 03:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | podge.mp3 | 20-Apr-2007 03:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | Podgorica.mp3 | 20-Apr-2007 03:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | Podgorny.mp3 | 20-Apr-2007 03:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | podgy.mp3 | 20-Apr-2007 03:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | podia.mp3 | 20-Apr-2007 03:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | podiatric.mp3 | 20-Apr-2007 03:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | podiatrist.mp3 | 20-Apr-2007 03:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | podiatry.mp3 | 20-Apr-2007 03:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | podite.mp3 | 20-Apr-2007 03:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | podium.mp3 | 20-Apr-2007 03:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | podmall.mp3 | 20-Apr-2007 03:49 | 17K | |
![[SND]](/icons/sound2.gif) | podo.mp3 | 20-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | podocarp.mp3 | 20-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | podocarpus.mp3 | 20-Apr-2007 03:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | pododynia.mp3 | 20-Apr-2007 03:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | Podolia.mp3 | 20-Apr-2007 03:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | podoloffcup.mp3 | 20-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | Podolsk.mp3 | 20-Apr-2007 03:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | Podol'sk.mp3 | 20-Apr-2007 03:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | podomere.mp3 | 20-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | podophyllin.mp3 | 20-Apr-2007 03:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | podophyllum.mp3 | 20-Apr-2007 03:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | podotheca.mp3 | 20-Apr-2007 03:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | podous.mp3 | 20-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | pods.mp3 | 20-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | podsnappery.mp3 | 20-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | podsol.mp3 | 20-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | podsolization.mp3 | 20-Apr-2007 03:50 | 12K | |
![[SND]](/icons/sound2.gif) | podsolize.mp3 | 20-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | Podunk.mp3 | 20-Apr-2007 03:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | podzol.mp3 | 20-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | podzolic.mp3 | 20-Apr-2007 03:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | podzolization.mp3 | 20-Apr-2007 03:50 | 12K | |
![[SND]](/icons/sound2.gif) | podzolize.mp3 | 20-Apr-2007 03:50 | 11K | |
![[SND]](/icons/sound2.gif) | POE.mp3 | 20-Apr-2007 03:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | poeciliid.mp3 | 20-Apr-2007 03:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | poem.mp3 | 20-Apr-2007 03:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | poena.mp3 | 20-Apr-2007 03:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | poenology.mp3 | 20-Apr-2007 03:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | poesy.mp3 | 20-Apr-2007 03:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | poet.mp3 | 20-Apr-2007 03:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | poeta nascitur, non fit.mp3 | 20-Apr-2007 03:51 | 24K | |
![[SND]](/icons/sound2.gif) | poetanasciturnonfit.mp3 | 20-Apr-2007 03:51 | 27K | |
![[SND]](/icons/sound2.gif) | poetaster.mp3 | 20-Apr-2007 03:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | poete maudit.mp3 | 20-Apr-2007 03:51 | 11K | |
![[SND]](/icons/sound2.gif) | poetess.mp3 | 20-Apr-2007 03:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | poetic.mp3 | 20-Apr-2007 03:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | poetical.mp3 | 20-Apr-2007 03:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | poetically.mp3 | 20-Apr-2007 03:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | poeticalness.mp3 | 20-Apr-2007 03:51 | 10K | |
![[SND]](/icons/sound2.gif) | poeticism.mp3 | 20-Apr-2007 03:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | poeticize.mp3 | 20-Apr-2007 03:51 | 11K | |
![[SND]](/icons/sound2.gif) | poetics.mp3 | 20-Apr-2007 03:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | poeticule.mp3 | 20-Apr-2007 03:51 | 17K | |
![[SND]](/icons/sound2.gif) | poetize.mp3 | 20-Apr-2007 03:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | poetry.mp3 | 20-Apr-2007 03:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | pofaced.mp3 | 20-Apr-2007 03:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | po-faced.mp3 | 20-Apr-2007 03:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | pogamoggan.mp3 | 20-Apr-2007 03:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | pogany.mp3 | 20-Apr-2007 03:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | pogey.mp3 | 20-Apr-2007 03:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | pogge.mp3 | 20-Apr-2007 03:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | poggie.mp3 | 20-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | poggle.mp3 | 20-Apr-2007 03:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | poggler.mp3 | 20-Apr-2007 03:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | pogie.mp3 | 20-Apr-2007 03:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pogo stick.mp3 | 20-Apr-2007 03:52 | 10K | |
![[SND]](/icons/sound2.gif) | pogo.mp3 | 20-Apr-2007 03:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pogonia.mp3 | 20-Apr-2007 03:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | pogonip.mp3 | 20-Apr-2007 03:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | pogonology.mp3 | 20-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | pogonophoran.mp3 | 20-Apr-2007 03:52 | 9.8K | |
![[SND]](/icons/sound2.gif) | pogonotomy.mp3 | 20-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | pogonotrophy.mp3 | 20-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | pogostick.mp3 | 20-Apr-2007 03:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | pogrom.mp3 | 20-Apr-2007 03:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | pogromist.mp3 | 20-Apr-2007 03:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | pogue.mp3 | 20-Apr-2007 03:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pogy.mp3 | 20-Apr-2007 03:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | pohai.mp3 | 20-Apr-2007 03:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | pohjola.mp3 | 20-Apr-2007 03:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pohnpei.mp3 | 20-Apr-2007 03:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | pohutukawa.mp3 | 20-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | poi.mp3 | 20-Apr-2007 03:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | Poictiers.mp3 | 20-Apr-2007 03:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | poiesis.mp3 | 20-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | poietic.mp3 | 20-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | poignance.mp3 | 20-Apr-2007 03:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | poignancy.mp3 | 20-Apr-2007 03:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | poignant.mp3 | 20-Apr-2007 03:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | poikil.mp3 | 20-Apr-2007 03:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | poikilitic.mp3 | 20-Apr-2007 03:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | poikiloblast.mp3 | 20-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | poikiloblastic.mp3 | 20-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | poikilocyte.mp3 | 20-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | poikilotherm.mp3 | 20-Apr-2007 03:53 | 11K | |
![[SND]](/icons/sound2.gif) | poikilothermal.mp3 | 20-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | poikilothermic.mp3 | 20-Apr-2007 03:53 | 12K | |
![[SND]](/icons/sound2.gif) | poil.mp3 | 20-Apr-2007 03:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | poilu.mp3 | 20-Apr-2007 03:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | poimenics.mp3 | 20-Apr-2007 03:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | Poincare.mp3 | 20-Apr-2007 03:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | poincareconjecture.mp3 | 20-Apr-2007 03:54 | 27K | |
![[SND]](/icons/sound2.gif) | poinciana.mp3 | 20-Apr-2007 03:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | poind.mp3 | 20-Apr-2007 03:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | poindexter.mp3 | 20-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | poing.mp3 | 20-Apr-2007 03:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | poinsettia.mp3 | 20-Apr-2007 03:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | point d'appui.mp3 | 20-Apr-2007 03:54 | 11K | |
![[SND]](/icons/sound2.gif) | point de repere.mp3 | 20-Apr-2007 03:54 | 12K | |
![[SND]](/icons/sound2.gif) | Point Pelee National Park.mp3 | 20-Apr-2007 03:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | point.mp3 | 20-Apr-2007 03:54 | 5.2K | |
![[SND]](/icons/sound2.gif) | pointal.mp3 | 20-Apr-2007 03:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | point-blank.mp3 | 20-Apr-2007 03:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | pointcoupe.mp3 | 20-Apr-2007 03:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | pointdalencon.mp3 | 20-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | pointdangleterre.mp3 | 20-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | pointdappui.mp3 | 20-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | pointdegaze.mp3 | 20-Apr-2007 03:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | pointdehongrie.mp3 | 20-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | pointdesprit.mp3 | 20-Apr-2007 03:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | pointdevice.mp3 | 20-Apr-2007 03:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | point-device.mp3 | 20-Apr-2007 03:54 | 10K | |
![[SND]](/icons/sound2.gif) | pointe.mp3 | 20-Apr-2007 03:54 | 6.3K | |
![[SND]](/icons/sound2.gif) | pointeapitre.mp3 | 20-Apr-2007 03:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | Pointe-a-Pitre.mp3 | 20-Apr-2007 03:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | pointeauxtrembles.mp3 | 20-Apr-2007 03:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | pointeclaire.mp3 | 20-Apr-2007 03:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pointe-Claire.mp3 | 20-Apr-2007 03:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | pointed.mp3 | 20-Apr-2007 03:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | pointel.mp3 | 20-Apr-2007 03:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pointelle.mp3 | 20-Apr-2007 03:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | pointenoire.mp3 | 20-Apr-2007 03:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | Pointe-Noire.mp3 | 20-Apr-2007 03:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | pointer.mp3 | 20-Apr-2007 03:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | pointille.mp3 | 20-Apr-2007 03:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | pointillism.mp3 | 20-Apr-2007 03:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | pointillist.mp3 | 20-Apr-2007 03:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | pointillistic.mp3 | 20-Apr-2007 03:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | pointing.mp3 | 20-Apr-2007 03:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pointless.mp3 | 20-Apr-2007 03:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | pointman.mp3 | 20-Apr-2007 03:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | pointreyeslilac.mp3 | 20-Apr-2007 03:55 | 17K | |
![[SND]](/icons/sound2.gif) | points d'appui.mp3 | 20-Apr-2007 03:55 | 11K | |
![[SND]](/icons/sound2.gif) | point-shaving.mp3 | 20-Apr-2007 03:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | pointsman.mp3 | 20-Apr-2007 03:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | pointtire.mp3 | 20-Apr-2007 03:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | pointy.mp3 | 20-Apr-2007 03:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | pointy-head.mp3 | 20-Apr-2007 03:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | pointy-headed.mp3 | 20-Apr-2007 03:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | poiret.mp3 | 20-Apr-2007 03:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | poirot.mp3 | 20-Apr-2007 03:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | poise.mp3 | 20-Apr-2007 03:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | poiser.mp3 | 20-Apr-2007 03:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | poiseuilleslaw.mp3 | 20-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | poisha.mp3 | 20-Apr-2007 03:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | poison.mp3 | 20-Apr-2007 03:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | poisoner.mp3 | 20-Apr-2007 03:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | poisoning.mp3 | 20-Apr-2007 03:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | poisonous.mp3 | 20-Apr-2007 03:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | poisonwood.mp3 | 20-Apr-2007 03:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | Poisson distribution.mp3 | 20-Apr-2007 03:56 | 19K | |
![[SND]](/icons/sound2.gif) | poissondistribution.mp3 | 20-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | poitier.mp3 | 20-Apr-2007 03:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | poitiers.mp3 | 20-Apr-2007 03:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | poitin.mp3 | 20-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | Poitou.mp3 | 20-Apr-2007 03:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | poitoucharentes.mp3 | 20-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | poitrel.mp3 | 20-Apr-2007 03:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | poitrine.mp3 | 20-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | pokal.mp3 | 20-Apr-2007 03:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | poke.mp3 | 20-Apr-2007 03:56 | 5.4K | |
![[SND]](/icons/sound2.gif) | pokeberry.mp3 | 20-Apr-2007 03:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | pokelogan.mp3 | 20-Apr-2007 03:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | poker.mp3 | 20-Apr-2007 03:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | poker-faced.mp3 | 20-Apr-2007 03:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | pokerino.mp3 | 20-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | pokesy.mp3 | 20-Apr-2007 03:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | pokeweed.mp3 | 20-Apr-2007 03:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | pokey.mp3 | 20-Apr-2007 03:57 | 5.5K | |
![[SND]](/icons/sound2.gif) | pokie.mp3 | 20-Apr-2007 03:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | pokily.mp3 | 20-Apr-2007 03:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | pokiness.mp3 | 20-Apr-2007 03:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | poky.mp3 | 20-Apr-2007 03:57 | 5.5K | |
![[SND]](/icons/sound2.gif) | Pol Pot.mp3 | 20-Apr-2007 03:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | pol.mp3 | 20-Apr-2007 03:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | pola.mp3 | 20-Apr-2007 03:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | Polab.mp3 | 20-Apr-2007 03:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | Polabian.mp3 | 20-Apr-2007 03:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | polacca.mp3 | 20-Apr-2007 03:57 | 17K | |
![[SND]](/icons/sound2.gif) | Polack.mp3 | 20-Apr-2007 03:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | polacre.mp3 | 20-Apr-2007 03:57 | 17K | |
![[SND]](/icons/sound2.gif) | Poland China.mp3 | 20-Apr-2007 03:57 | 11K | |
![[SND]](/icons/sound2.gif) | Poland.mp3 | 20-Apr-2007 03:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | polanski.mp3 | 20-Apr-2007 03:57 | 17K | |
![[SND]](/icons/sound2.gif) | Polanyi.mp3 | 20-Apr-2007 03:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | polar.mp3 | 20-Apr-2007 03:57 | 5.7K | |
![[SND]](/icons/sound2.gif) | polari.mp3 | 20-Apr-2007 03:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | polarimeter.mp3 | 20-Apr-2007 03:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | polarimetric.mp3 | 20-Apr-2007 03:57 | 12K | |
![[SND]](/icons/sound2.gif) | polarimetry.mp3 | 20-Apr-2007 03:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | Polaris.mp3 | 20-Apr-2007 03:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | polariscope.mp3 | 20-Apr-2007 03:57 | 10K | |
![[SND]](/icons/sound2.gif) | polariscopic.mp3 | 20-Apr-2007 03:58 | 11K | |
![[SND]](/icons/sound2.gif) | polarity.mp3 | 20-Apr-2007 03:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | polarizability.mp3 | 20-Apr-2007 03:58 | 12K | |
![[SND]](/icons/sound2.gif) | polarizable.mp3 | 20-Apr-2007 03:58 | 10K | |
![[SND]](/icons/sound2.gif) | polarization.mp3 | 20-Apr-2007 03:58 | 11K | |
![[SND]](/icons/sound2.gif) | polarize.mp3 | 20-Apr-2007 03:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | polarized.mp3 | 20-Apr-2007 03:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | polarizer.mp3 | 20-Apr-2007 03:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | polarly.mp3 | 20-Apr-2007 03:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | polarogram.mp3 | 20-Apr-2007 03:58 | 17K | |
![[SND]](/icons/sound2.gif) | polarograph.mp3 | 20-Apr-2007 03:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | polarographic.mp3 | 20-Apr-2007 03:58 | 11K | |
![[SND]](/icons/sound2.gif) | polarographically.mp3 | 20-Apr-2007 03:58 | 12K | |
![[SND]](/icons/sound2.gif) | polarography.mp3 | 20-Apr-2007 03:58 | 11K | |
![[SND]](/icons/sound2.gif) | Polaroid.mp3 | 20-Apr-2007 03:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | polaron.mp3 | 20-Apr-2007 03:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | polatouche.mp3 | 20-Apr-2007 03:58 | 17K | |
![[SND]](/icons/sound2.gif) | polavision.mp3 | 20-Apr-2007 03:58 | 17K | |
![[SND]](/icons/sound2.gif) | polder.mp3 | 20-Apr-2007 03:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | pole.mp3 | 20-Apr-2007 03:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | poleax.mp3 | 20-Apr-2007 03:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | polecat.mp3 | 20-Apr-2007 03:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | poleis.mp3 | 20-Apr-2007 03:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | poleless.mp3 | 20-Apr-2007 03:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | polemarch.mp3 | 20-Apr-2007 03:58 | 17K | |
![[SND]](/icons/sound2.gif) | polemic.mp3 | 20-Apr-2007 03:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | polemical.mp3 | 20-Apr-2007 03:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | polemically.mp3 | 20-Apr-2007 03:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | polemicist.mp3 | 20-Apr-2007 03:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | polemicize.mp3 | 20-Apr-2007 03:59 | 11K | |
![[SND]](/icons/sound2.gif) | polemics.mp3 | 20-Apr-2007 03:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | polemist.mp3 | 20-Apr-2007 03:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | polemize.mp3 | 20-Apr-2007 03:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | polemology.mp3 | 20-Apr-2007 03:59 | 17K | |
![[SND]](/icons/sound2.gif) | polemoniaceous.mp3 | 20-Apr-2007 03:59 | 17K | |
![[SND]](/icons/sound2.gif) | polemonium.mp3 | 20-Apr-2007 03:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | polenta.mp3 | 20-Apr-2007 03:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | poler.mp3 | 20-Apr-2007 03:59 | 5.7K | |
![[SND]](/icons/sound2.gif) | polestar.mp3 | 20-Apr-2007 03:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | poleward.mp3 | 20-Apr-2007 03:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | poley.mp3 | 20-Apr-2007 03:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | poleyn.mp3 | 20-Apr-2007 03:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | polianite.mp3 | 20-Apr-2007 03:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | police.mp3 | 20-Apr-2007 03:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | policeman.mp3 | 20-Apr-2007 03:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | policemotu.mp3 | 20-Apr-2007 03:59 | 17K | |
![[SND]](/icons/sound2.gif) | policewoman.mp3 | 20-Apr-2007 03:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | policier.mp3 | 20-Apr-2007 03:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | policlinic.mp3 | 20-Apr-2007 03:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | policy.mp3 | 20-Apr-2007 03:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | policyholder.mp3 | 20-Apr-2007 04:00 | 10K | |
![[SND]](/icons/sound2.gif) | polignac.mp3 | 20-Apr-2007 04:00 | 17K | |
![[SND]](/icons/sound2.gif) | polimetrician.mp3 | 20-Apr-2007 04:00 | 17K | |
![[SND]](/icons/sound2.gif) | polimetrics.mp3 | 20-Apr-2007 04:00 | 17K | |
![[SND]](/icons/sound2.gif) | polingboard.mp3 | 20-Apr-2007 04:00 | 17K | |
![[SND]](/icons/sound2.gif) | polio.mp3 | 20-Apr-2007 04:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | poliomyelitis.mp3 | 20-Apr-2007 04:00 | 13K | |
![[SND]](/icons/sound2.gif) | poliovirus.mp3 | 20-Apr-2007 04:00 | 11K | |
![[SND]](/icons/sound2.gif) | polis.mp3 | 20-Apr-2007 04:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | polisario.mp3 | 20-Apr-2007 04:00 | 17K | |
![[SND]](/icons/sound2.gif) | polisci.mp3 | 20-Apr-2007 04:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | poli-sci.mp3 | 20-Apr-2007 04:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | Polish.mp3 | 20-Apr-2007 04:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | polished.mp3 | 20-Apr-2007 04:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | politburo.mp3 | 20-Apr-2007 04:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | polite.mp3 | 20-Apr-2007 04:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | politesse.mp3 | 20-Apr-2007 04:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | Politian.mp3 | 20-Apr-2007 04:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | politic.mp3 | 20-Apr-2007 04:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | political.mp3 | 20-Apr-2007 04:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | politicalization.mp3 | 20-Apr-2007 04:00 | 12K | |
![[SND]](/icons/sound2.gif) | politicalize.mp3 | 20-Apr-2007 04:00 | 11K | |
![[SND]](/icons/sound2.gif) | politically.mp3 | 20-Apr-2007 04:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | politician.mp3 | 20-Apr-2007 04:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | politicide.mp3 | 20-Apr-2007 04:00 | 17K | |
![[SND]](/icons/sound2.gif) | politicization.mp3 | 20-Apr-2007 04:01 | 11K | |
![[SND]](/icons/sound2.gif) | politicize.mp3 | 20-Apr-2007 04:01 | 10K | |
![[SND]](/icons/sound2.gif) | politick.mp3 | 20-Apr-2007 04:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | politicking.mp3 | 20-Apr-2007 04:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | politico.mp3 | 20-Apr-2007 04:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | politics.mp3 | 20-Apr-2007 04:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | polity.mp3 | 20-Apr-2007 04:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | polje.mp3 | 20-Apr-2007 04:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | polk.mp3 | 20-Apr-2007 04:01 | 4.1K | |
![[SND]](/icons/sound2.gif) | polka dot.mp3 | 20-Apr-2007 04:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | polka.mp3 | 20-Apr-2007 04:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | polkadot.mp3 | 20-Apr-2007 04:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | polka-dotted.mp3 | 20-Apr-2007 04:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | poll.mp3 | 20-Apr-2007 04:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | pollack.mp3 | 20-Apr-2007 04:01 | 5.4K | |
![[SND]](/icons/sound2.gif) | pollaiuolo.mp3 | 20-Apr-2007 04:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | pollakiuria.mp3 | 20-Apr-2007 04:01 | 17K | |
![[SND]](/icons/sound2.gif) | pollan.mp3 | 20-Apr-2007 04:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollard.mp3 | 20-Apr-2007 04:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | pollbook.mp3 | 20-Apr-2007 04:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | polled.mp3 | 20-Apr-2007 04:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | pollee.mp3 | 20-Apr-2007 04:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | pollen.mp3 | 20-Apr-2007 04:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | pollenate.mp3 | 20-Apr-2007 04:01 | 17K | |
![[SND]](/icons/sound2.gif) | pollend.mp3 | 20-Apr-2007 04:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | polleniferous.mp3 | 20-Apr-2007 04:01 | 17K | |
![[SND]](/icons/sound2.gif) | pollenizer.mp3 | 20-Apr-2007 04:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | pollenosis.mp3 | 20-Apr-2007 04:02 | 10K | |
![[SND]](/icons/sound2.gif) | poller.mp3 | 20-Apr-2007 04:02 | 5.9K | |
![[SND]](/icons/sound2.gif) | pollera.mp3 | 20-Apr-2007 04:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollero.mp3 | 20-Apr-2007 04:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollevil.mp3 | 20-Apr-2007 04:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | pollex.mp3 | 20-Apr-2007 04:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | pollice verso.mp3 | 20-Apr-2007 04:02 | 11K | |
![[SND]](/icons/sound2.gif) | pollices.mp3 | 20-Apr-2007 04:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | polliceverso.mp3 | 20-Apr-2007 04:02 | 17K | |
![[SND]](/icons/sound2.gif) | pollicitation.mp3 | 20-Apr-2007 04:02 | 17K | |
![[SND]](/icons/sound2.gif) | pollie.mp3 | 20-Apr-2007 04:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollin.mp3 | 20-Apr-2007 04:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollinate.mp3 | 20-Apr-2007 04:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | pollination.mp3 | 20-Apr-2007 04:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | pollinator.mp3 | 20-Apr-2007 04:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | polling.mp3 | 20-Apr-2007 04:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollini.mp3 | 20-Apr-2007 04:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | pollinia.mp3 | 20-Apr-2007 04:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | pollinic.mp3 | 20-Apr-2007 04:02 | 17K | |
![[SND]](/icons/sound2.gif) | polliniferous.mp3 | 20-Apr-2007 04:02 | 17K | |
![[SND]](/icons/sound2.gif) | pollinium.mp3 | 20-Apr-2007 04:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | pollinize.mp3 | 20-Apr-2007 04:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | pollinizer.mp3 | 20-Apr-2007 04:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | pollinose.mp3 | 20-Apr-2007 04:02 | 17K | |
![[SND]](/icons/sound2.gif) | pollinosis.mp3 | 20-Apr-2007 04:02 | 10K | |
![[SND]](/icons/sound2.gif) | Pollio.mp3 | 20-Apr-2007 04:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | polliwog.mp3 | 20-Apr-2007 04:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | pollo.mp3 | 20-Apr-2007 04:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollock.mp3 | 20-Apr-2007 04:03 | 5.4K | |
![[SND]](/icons/sound2.gif) | pollockstoymuseum.mp3 | 20-Apr-2007 04:03 | 17K | |
![[SND]](/icons/sound2.gif) | polloi.mp3 | 20-Apr-2007 04:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | pollparrot.mp3 | 20-Apr-2007 04:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | pollster.mp3 | 20-Apr-2007 04:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | polltaker.mp3 | 20-Apr-2007 04:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | polltax.mp3 | 20-Apr-2007 04:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | polltaxer.mp3 | 20-Apr-2007 04:03 | 17K | |
![[SND]](/icons/sound2.gif) | pollucite.mp3 | 20-Apr-2007 04:03 | 17K | |
![[SND]](/icons/sound2.gif) | pollutant.mp3 | 20-Apr-2007 04:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | pollute.mp3 | 20-Apr-2007 04:03 | 5.7K | |
![[SND]](/icons/sound2.gif) | polluted.mp3 | 20-Apr-2007 04:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | pollution.mp3 | 20-Apr-2007 04:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | pollutive.mp3 | 20-Apr-2007 04:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | Pollux.mp3 | 20-Apr-2007 04:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | polly.mp3 | 20-Apr-2007 04:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pollyanna.mp3 | 20-Apr-2007 04:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pollyannaish.mp3 | 20-Apr-2007 04:03 | 11K | |
![[SND]](/icons/sound2.gif) | Pollyannish.mp3 | 20-Apr-2007 04:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | pollywog.mp3 | 20-Apr-2007 04:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | polo.mp3 | 20-Apr-2007 04:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | polock.mp3 | 20-Apr-2007 04:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | polocrosse.mp3 | 20-Apr-2007 04:04 | 17K | |
![[SND]](/icons/sound2.gif) | polocyte.mp3 | 20-Apr-2007 04:04 | 17K | |
![[SND]](/icons/sound2.gif) | poloidal.mp3 | 20-Apr-2007 04:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | poloist.mp3 | 20-Apr-2007 04:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | polonaise.mp3 | 20-Apr-2007 04:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | polone.mp3 | 20-Apr-2007 04:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | polo-neck.mp3 | 20-Apr-2007 04:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Polonia.mp3 | 20-Apr-2007 04:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | polonium.mp3 | 20-Apr-2007 04:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | Polonius.mp3 | 20-Apr-2007 04:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | polonize.mp3 | 20-Apr-2007 04:04 | 17K | |
![[SND]](/icons/sound2.gif) | polonnaruwa.mp3 | 20-Apr-2007 04:04 | 17K | |
![[SND]](/icons/sound2.gif) | polony.mp3 | 20-Apr-2007 04:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | polos.mp3 | 20-Apr-2007 04:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | polpot.mp3 | 20-Apr-2007 04:04 | 17K | |
![[SND]](/icons/sound2.gif) | Polska.mp3 | 20-Apr-2007 04:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | Poltava.mp3 | 20-Apr-2007 04:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | poltergeist.mp3 | 20-Apr-2007 04:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | poltfoot.mp3 | 20-Apr-2007 04:04 | 17K | |
![[SND]](/icons/sound2.gif) | Poltoratsk.mp3 | 20-Apr-2007 04:04 | 11K | |
![[SND]](/icons/sound2.gif) | poltroon.mp3 | 20-Apr-2007 04:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | poltroonery.mp3 | 20-Apr-2007 04:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | poly Ipoly C.mp3 | 20-Apr-2007 04:04 | 15K | |
![[SND]](/icons/sound2.gif) | poly(A).mp3 | 20-Apr-2007 04:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | poly.mp3 | 20-Apr-2007 04:04 | 5.5K | |
![[SND]](/icons/sound2.gif) | polyacrylamide.mp3 | 20-Apr-2007 04:04 | 11K | |
![[SND]](/icons/sound2.gif) | polyacrylonitrile.mp3 | 20-Apr-2007 04:05 | 14K | |
![[SND]](/icons/sound2.gif) | polyadelphous.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | polyadenylic acid.mp3 | 20-Apr-2007 04:05 | 15K | |
![[SND]](/icons/sound2.gif) | polyadic.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | polyalcohol.mp3 | 20-Apr-2007 04:05 | 10K | |
![[SND]](/icons/sound2.gif) | polyamide.mp3 | 20-Apr-2007 04:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | polyamine.mp3 | 20-Apr-2007 04:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyandric.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | polyandrist.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | polyandrous.mp3 | 20-Apr-2007 04:05 | 11K | |
![[SND]](/icons/sound2.gif) | polyandry.mp3 | 20-Apr-2007 04:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | polyantha.mp3 | 20-Apr-2007 04:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | polyantharose.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | polyanthi.mp3 | 20-Apr-2007 04:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | polyanthus.mp3 | 20-Apr-2007 04:05 | 11K | |
![[SND]](/icons/sound2.gif) | polyarch.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | polyarchy.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | polyatomic.mp3 | 20-Apr-2007 04:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | polybasite.mp3 | 20-Apr-2007 04:05 | 17K | |
![[SND]](/icons/sound2.gif) | Polybius.mp3 | 20-Apr-2007 04:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | polybrominated biphenyl.mp3 | 20-Apr-2007 04:05 | 16K | |
![[SND]](/icons/sound2.gif) | polybus.mp3 | 20-Apr-2007 04:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | polybutadiene.mp3 | 20-Apr-2007 04:05 | 14K | |
![[SND]](/icons/sound2.gif) | polycarbonate.mp3 | 20-Apr-2007 04:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | Polycarp.mp3 | 20-Apr-2007 04:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | polycarpic.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | polycell.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | polycentric.mp3 | 20-Apr-2007 04:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | polycentrism.mp3 | 20-Apr-2007 04:06 | 11K | |
![[SND]](/icons/sound2.gif) | polychaete.mp3 | 20-Apr-2007 04:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | polychasium.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | polychlorinated biphenyl.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | polychlorinatedbiphenyl.mp3 | 20-Apr-2007 04:06 | 27K | |
![[SND]](/icons/sound2.gif) | polychotomous.mp3 | 20-Apr-2007 04:06 | 12K | |
![[SND]](/icons/sound2.gif) | polychotomy.mp3 | 20-Apr-2007 04:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | polychromatic.mp3 | 20-Apr-2007 04:06 | 10K | |
![[SND]](/icons/sound2.gif) | polychromatophilia.mp3 | 20-Apr-2007 04:06 | 14K | |
![[SND]](/icons/sound2.gif) | polychromatophilic.mp3 | 20-Apr-2007 04:06 | 13K | |
![[SND]](/icons/sound2.gif) | polychrome.mp3 | 20-Apr-2007 04:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | polychromous.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | polychromy.mp3 | 20-Apr-2007 04:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | polychronicon.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | polycistronic.mp3 | 20-Apr-2007 04:06 | 11K | |
![[SND]](/icons/sound2.gif) | polyclad.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | Polycleitus.mp3 | 20-Apr-2007 04:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | polyclinic.mp3 | 20-Apr-2007 04:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | polyclitus.mp3 | 20-Apr-2007 04:06 | 17K | |
![[SND]](/icons/sound2.gif) | polyclonal.mp3 | 20-Apr-2007 04:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | polycondensation.mp3 | 20-Apr-2007 04:06 | 13K | |
![[SND]](/icons/sound2.gif) | polyconic projection.mp3 | 20-Apr-2007 04:06 | 14K | |
![[SND]](/icons/sound2.gif) | polycot.mp3 | 20-Apr-2007 04:07 | 17K | |
![[SND]](/icons/sound2.gif) | Polycrates.mp3 | 20-Apr-2007 04:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | polycrystal.mp3 | 20-Apr-2007 04:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | polycrystalline.mp3 | 20-Apr-2007 04:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | polycyclic.mp3 | 20-Apr-2007 04:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | polycyesis.mp3 | 20-Apr-2007 04:07 | 17K | |
![[SND]](/icons/sound2.gif) | polycystic.mp3 | 20-Apr-2007 04:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | polycythemia vera.mp3 | 20-Apr-2007 04:07 | 14K | |
![[SND]](/icons/sound2.gif) | polycythemia.mp3 | 20-Apr-2007 04:07 | 11K | |
![[SND]](/icons/sound2.gif) | polycythemiavera.mp3 | 20-Apr-2007 04:07 | 27K | |
![[SND]](/icons/sound2.gif) | polycythemic.mp3 | 20-Apr-2007 04:07 | 10K | |
![[SND]](/icons/sound2.gif) | polydactyl.mp3 | 20-Apr-2007 04:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | polydactyly.mp3 | 20-Apr-2007 04:07 | 10K | |
![[SND]](/icons/sound2.gif) | polydaemonism.mp3 | 20-Apr-2007 04:07 | 17K | |
![[SND]](/icons/sound2.gif) | polydemic.mp3 | 20-Apr-2007 04:07 | 17K | |
![[SND]](/icons/sound2.gif) | polydeuces.mp3 | 20-Apr-2007 04:07 | 17K | |
![[SND]](/icons/sound2.gif) | polydipsia.mp3 | 20-Apr-2007 04:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | polydipsic.mp3 | 20-Apr-2007 04:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | polydisperse.mp3 | 20-Apr-2007 04:07 | 10K | |
![[SND]](/icons/sound2.gif) | polydispersity.mp3 | 20-Apr-2007 04:07 | 11K | |
![[SND]](/icons/sound2.gif) | polydomous.mp3 | 20-Apr-2007 04:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | polydontia.mp3 | 20-Apr-2007 04:07 | 17K | |
![[SND]](/icons/sound2.gif) | polydor.mp3 | 20-Apr-2007 04:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | Polydorus.mp3 | 20-Apr-2007 04:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | polyelectrolyte.mp3 | 20-Apr-2007 04:07 | 11K | |
![[SND]](/icons/sound2.gif) | polyembryonic.mp3 | 20-Apr-2007 04:08 | 11K | |
![[SND]](/icons/sound2.gif) | polyembryony.mp3 | 20-Apr-2007 04:08 | 11K | |
![[SND]](/icons/sound2.gif) | polyene.mp3 | 20-Apr-2007 04:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | polyenic.mp3 | 20-Apr-2007 04:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | polyester.mp3 | 20-Apr-2007 04:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | polyesterification.mp3 | 20-Apr-2007 04:08 | 15K | |
![[SND]](/icons/sound2.gif) | polyestrous.mp3 | 20-Apr-2007 04:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | polyethylene.mp3 | 20-Apr-2007 04:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | polygala.mp3 | 20-Apr-2007 04:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | polygamic.mp3 | 20-Apr-2007 04:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | polygamist.mp3 | 20-Apr-2007 04:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | polygamize.mp3 | 20-Apr-2007 04:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | polygamophile.mp3 | 20-Apr-2007 04:08 | 17K | |
![[SND]](/icons/sound2.gif) | polygamous.mp3 | 20-Apr-2007 04:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | polygamy.mp3 | 20-Apr-2007 04:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | polygene.mp3 | 20-Apr-2007 04:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | polygenesis.mp3 | 20-Apr-2007 04:08 | 11K | |
![[SND]](/icons/sound2.gif) | polygenetic.mp3 | 20-Apr-2007 04:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | polygenic.mp3 | 20-Apr-2007 04:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | polygenism.mp3 | 20-Apr-2007 04:08 | 17K | |
![[SND]](/icons/sound2.gif) | polygenous.mp3 | 20-Apr-2007 04:08 | 17K | |
![[SND]](/icons/sound2.gif) | polygeny.mp3 | 20-Apr-2007 04:08 | 17K | |
![[SND]](/icons/sound2.gif) | polyglot.mp3 | 20-Apr-2007 04:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | polyglotism.mp3 | 20-Apr-2007 04:08 | 10K | |
![[SND]](/icons/sound2.gif) | polyglottism.mp3 | 20-Apr-2007 04:08 | 10K | |
![[SND]](/icons/sound2.gif) | Polygnotus.mp3 | 20-Apr-2007 04:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | polygon.mp3 | 20-Apr-2007 04:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | polygonaceous.mp3 | 20-Apr-2007 04:09 | 17K | |
![[SND]](/icons/sound2.gif) | polygonal.mp3 | 20-Apr-2007 04:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | polygonally.mp3 | 20-Apr-2007 04:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | polygonum.mp3 | 20-Apr-2007 04:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | polygram.mp3 | 20-Apr-2007 04:09 | 17K | |
![[SND]](/icons/sound2.gif) | polygraph.mp3 | 20-Apr-2007 04:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | polygrapher.mp3 | 20-Apr-2007 04:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | polygraphic.mp3 | 20-Apr-2007 04:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | polygraphist.mp3 | 20-Apr-2007 04:09 | 10K | |
![[SND]](/icons/sound2.gif) | polygraphy.mp3 | 20-Apr-2007 04:09 | 17K | |
![[SND]](/icons/sound2.gif) | polygynist.mp3 | 20-Apr-2007 04:09 | 17K | |
![[SND]](/icons/sound2.gif) | polygynoecial.mp3 | 20-Apr-2007 04:09 | 17K | |
![[SND]](/icons/sound2.gif) | polygynous.mp3 | 20-Apr-2007 04:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | polygyny.mp3 | 20-Apr-2007 04:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | polyhedra.mp3 | 20-Apr-2007 04:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyhedral.mp3 | 20-Apr-2007 04:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | polyhedron.mp3 | 20-Apr-2007 04:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyhedroses.mp3 | 20-Apr-2007 04:09 | 13K | |
![[SND]](/icons/sound2.gif) | polyhedrosis.mp3 | 20-Apr-2007 04:09 | 12K | |
![[SND]](/icons/sound2.gif) | polyhistor.mp3 | 20-Apr-2007 04:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyhistoric.mp3 | 20-Apr-2007 04:09 | 10K | |
![[SND]](/icons/sound2.gif) | polyhydroxy.mp3 | 20-Apr-2007 04:09 | 11K | |
![[SND]](/icons/sound2.gif) | Polyhymnia.mp3 | 20-Apr-2007 04:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | polyic.mp3 | 20-Apr-2007 04:09 | 17K | |
![[SND]](/icons/sound2.gif) | polyisoprene.mp3 | 20-Apr-2007 04:10 | 12K | |
![[SND]](/icons/sound2.gif) | polyketide.mp3 | 20-Apr-2007 04:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | polylysine.mp3 | 20-Apr-2007 04:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | polymastigote.mp3 | 20-Apr-2007 04:10 | 17K | |
![[SND]](/icons/sound2.gif) | polymath.mp3 | 20-Apr-2007 04:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | polymathic.mp3 | 20-Apr-2007 04:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | polymathy.mp3 | 20-Apr-2007 04:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | polymer.mp3 | 20-Apr-2007 04:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | polymerase.mp3 | 20-Apr-2007 04:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | polymeric.mp3 | 20-Apr-2007 04:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | polymerism.mp3 | 20-Apr-2007 04:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | polymerization.mp3 | 20-Apr-2007 04:10 | 11K | |
![[SND]](/icons/sound2.gif) | polymerize.mp3 | 20-Apr-2007 04:10 | 10K | |
![[SND]](/icons/sound2.gif) | polymerous.mp3 | 20-Apr-2007 04:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | polymethyl methacrylate.mp3 | 20-Apr-2007 04:10 | 16K | |
![[SND]](/icons/sound2.gif) | polymnia.mp3 | 20-Apr-2007 04:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | polymorph.mp3 | 20-Apr-2007 04:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | polymorphic.mp3 | 20-Apr-2007 04:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | polymorphically.mp3 | 20-Apr-2007 04:10 | 11K | |
![[SND]](/icons/sound2.gif) | polymorphism.mp3 | 20-Apr-2007 04:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | polymorphonuclear.mp3 | 20-Apr-2007 04:10 | 13K | |
![[SND]](/icons/sound2.gif) | polymorphous.mp3 | 20-Apr-2007 04:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | polymyalgiarheumatica.mp3 | 20-Apr-2007 04:10 | 18K | |
![[SND]](/icons/sound2.gif) | polymyositis.mp3 | 20-Apr-2007 04:10 | 11K | |
![[SND]](/icons/sound2.gif) | polymyxin.mp3 | 20-Apr-2007 04:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Polynesia.mp3 | 20-Apr-2007 04:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | Polynesian.mp3 | 20-Apr-2007 04:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | polyneuritis.mp3 | 20-Apr-2007 04:11 | 11K | |
![[SND]](/icons/sound2.gif) | polynia.mp3 | 20-Apr-2007 04:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | Polynices.mp3 | 20-Apr-2007 04:11 | 11K | |
![[SND]](/icons/sound2.gif) | polynomial.mp3 | 20-Apr-2007 04:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | polynosic.mp3 | 20-Apr-2007 04:11 | 17K | |
![[SND]](/icons/sound2.gif) | polynuclear.mp3 | 20-Apr-2007 04:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | polynucleotide.mp3 | 20-Apr-2007 04:11 | 11K | |
![[SND]](/icons/sound2.gif) | polynya.mp3 | 20-Apr-2007 04:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | polynyi.mp3 | 20-Apr-2007 04:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyoestrous.mp3 | 20-Apr-2007 04:11 | 17K | |
![[SND]](/icons/sound2.gif) | polyol.mp3 | 20-Apr-2007 04:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | polyolbion.mp3 | 20-Apr-2007 04:11 | 17K | |
![[SND]](/icons/sound2.gif) | polyolefin.mp3 | 20-Apr-2007 04:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | polyomavirus.mp3 | 20-Apr-2007 04:11 | 14K | |
![[SND]](/icons/sound2.gif) | polyomino.mp3 | 20-Apr-2007 04:11 | 17K | |
![[SND]](/icons/sound2.gif) | polyonymous.mp3 | 20-Apr-2007 04:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | polyopia.mp3 | 20-Apr-2007 04:11 | 17K | |
![[SND]](/icons/sound2.gif) | polyp.mp3 | 20-Apr-2007 04:11 | 5.0K | |
![[SND]](/icons/sound2.gif) | polypary.mp3 | 20-Apr-2007 04:11 | 17K | |
![[SND]](/icons/sound2.gif) | polyped.mp3 | 20-Apr-2007 04:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | polypeptide.mp3 | 20-Apr-2007 04:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | polypeptidic.mp3 | 20-Apr-2007 04:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | polypetalous.mp3 | 20-Apr-2007 04:11 | 10K | |
![[SND]](/icons/sound2.gif) | polyphagia.mp3 | 20-Apr-2007 04:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | polyphagous.mp3 | 20-Apr-2007 04:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyphagy.mp3 | 20-Apr-2007 04:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | polyphase.mp3 | 20-Apr-2007 04:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | polyphasic.mp3 | 20-Apr-2007 04:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | Polyphemus.mp3 | 20-Apr-2007 04:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | polyphenol.mp3 | 20-Apr-2007 04:12 | 11K | |
![[SND]](/icons/sound2.gif) | polyphenolic.mp3 | 20-Apr-2007 04:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | polyphiloprogenitive.mp3 | 20-Apr-2007 04:12 | 15K | |
![[SND]](/icons/sound2.gif) | polyphone.mp3 | 20-Apr-2007 04:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | polyphonic.mp3 | 20-Apr-2007 04:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | polyphonically.mp3 | 20-Apr-2007 04:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | polyphonous.mp3 | 20-Apr-2007 04:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | polyphony.mp3 | 20-Apr-2007 04:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | polyphyletic.mp3 | 20-Apr-2007 04:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | polyphyletically.mp3 | 20-Apr-2007 04:12 | 11K | |
![[SND]](/icons/sound2.gif) | polyphyodont.mp3 | 20-Apr-2007 04:12 | 17K | |
![[SND]](/icons/sound2.gif) | polypide.mp3 | 20-Apr-2007 04:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | polypidom.mp3 | 20-Apr-2007 04:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | polyploid.mp3 | 20-Apr-2007 04:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | polyploidy.mp3 | 20-Apr-2007 04:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | polypnea.mp3 | 20-Apr-2007 04:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | polypod.mp3 | 20-Apr-2007 04:12 | 17K | |
![[SND]](/icons/sound2.gif) | polypody.mp3 | 20-Apr-2007 04:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | polypoid.mp3 | 20-Apr-2007 04:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | polypore.mp3 | 20-Apr-2007 04:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | polyposis.mp3 | 20-Apr-2007 04:12 | 17K | |
![[SND]](/icons/sound2.gif) | polypous.mp3 | 20-Apr-2007 04:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | polypropylene.mp3 | 20-Apr-2007 04:13 | 10K | |
![[SND]](/icons/sound2.gif) | polyprotic.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polyprotodont.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polyptych.mp3 | 20-Apr-2007 04:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | polypus.mp3 | 20-Apr-2007 04:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyrhythm.mp3 | 20-Apr-2007 04:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | polyrhythmic.mp3 | 20-Apr-2007 04:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyrhythmically.mp3 | 20-Apr-2007 04:13 | 10K | |
![[SND]](/icons/sound2.gif) | polyribonucleotide.mp3 | 20-Apr-2007 04:13 | 16K | |
![[SND]](/icons/sound2.gif) | polyribosomal.mp3 | 20-Apr-2007 04:13 | 12K | |
![[SND]](/icons/sound2.gif) | polyribosome.mp3 | 20-Apr-2007 04:13 | 11K | |
![[SND]](/icons/sound2.gif) | polys.mp3 | 20-Apr-2007 04:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | polysaccharide.mp3 | 20-Apr-2007 04:13 | 11K | |
![[SND]](/icons/sound2.gif) | polysemic.mp3 | 20-Apr-2007 04:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | polysemous.mp3 | 20-Apr-2007 04:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | polysemy.mp3 | 20-Apr-2007 04:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | polysepalous.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polysome.mp3 | 20-Apr-2007 04:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | polysomic.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polysomnogram.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polysorbate.mp3 | 20-Apr-2007 04:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | polyspast.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polyspermia.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polyspermy.mp3 | 20-Apr-2007 04:13 | 17K | |
![[SND]](/icons/sound2.gif) | polystichous.mp3 | 20-Apr-2007 04:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | polystyle.mp3 | 20-Apr-2007 04:14 | 17K | |
![[SND]](/icons/sound2.gif) | polystyrene.mp3 | 20-Apr-2007 04:14 | 10K | |
![[SND]](/icons/sound2.gif) | polysulfide.mp3 | 20-Apr-2007 04:14 | 11K | |
![[SND]](/icons/sound2.gif) | polysyllabic.mp3 | 20-Apr-2007 04:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | polysyllabically.mp3 | 20-Apr-2007 04:14 | 11K | |
![[SND]](/icons/sound2.gif) | polysyllable.mp3 | 20-Apr-2007 04:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | polysynaptic.mp3 | 20-Apr-2007 04:14 | 10K | |
![[SND]](/icons/sound2.gif) | polysynaptically.mp3 | 20-Apr-2007 04:14 | 11K | |
![[SND]](/icons/sound2.gif) | polysyndeton.mp3 | 20-Apr-2007 04:14 | 11K | |
![[SND]](/icons/sound2.gif) | polysynthesism.mp3 | 20-Apr-2007 04:14 | 17K | |
![[SND]](/icons/sound2.gif) | polytechnic.mp3 | 20-Apr-2007 04:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | polytene.mp3 | 20-Apr-2007 04:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | polyteny.mp3 | 20-Apr-2007 04:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | polytheism.mp3 | 20-Apr-2007 04:14 | 9.3K | |
![[SND]](/icons/sound2.gif) | polytheist.mp3 | 20-Apr-2007 04:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | polytheistic.mp3 | 20-Apr-2007 04:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | polytheistical.mp3 | 20-Apr-2007 04:14 | 10K | |
![[SND]](/icons/sound2.gif) | polythene.mp3 | 20-Apr-2007 04:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | polytocous.mp3 | 20-Apr-2007 04:14 | 17K | |
![[SND]](/icons/sound2.gif) | polytomy.mp3 | 20-Apr-2007 04:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | polytonal.mp3 | 20-Apr-2007 04:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | polytonality.mp3 | 20-Apr-2007 04:14 | 11K | |
![[SND]](/icons/sound2.gif) | polytonally.mp3 | 20-Apr-2007 04:14 | 9.3K | |
![[SND]](/icons/sound2.gif) | polytriglyph.mp3 | 20-Apr-2007 04:14 | 17K | |
![[SND]](/icons/sound2.gif) | polytrophic.mp3 | 20-Apr-2007 04:14 | 17K | |
![[SND]](/icons/sound2.gif) | polytype.mp3 | 20-Apr-2007 04:14 | 17K | |
![[SND]](/icons/sound2.gif) | polytypic.mp3 | 20-Apr-2007 04:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | polyunsaturated.mp3 | 20-Apr-2007 04:15 | 12K | |
![[SND]](/icons/sound2.gif) | polyurethane.mp3 | 20-Apr-2007 04:15 | 11K | |
![[SND]](/icons/sound2.gif) | polyuria.mp3 | 20-Apr-2007 04:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | polyvalence.mp3 | 20-Apr-2007 04:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | polyvalent.mp3 | 20-Apr-2007 04:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | polyversity.mp3 | 20-Apr-2007 04:15 | 17K | |
![[SND]](/icons/sound2.gif) | polyvinyl.mp3 | 20-Apr-2007 04:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | polyvinylformal.mp3 | 20-Apr-2007 04:15 | 17K | |
![[SND]](/icons/sound2.gif) | polyvinylpyrrolidone.mp3 | 20-Apr-2007 04:15 | 18K | |
![[SND]](/icons/sound2.gif) | polyvoltine.mp3 | 20-Apr-2007 04:15 | 17K | |
![[SND]](/icons/sound2.gif) | polywater.mp3 | 20-Apr-2007 04:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | polyxena.mp3 | 20-Apr-2007 04:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyzoa.mp3 | 20-Apr-2007 04:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | polyzoan.mp3 | 20-Apr-2007 04:15 | 17K | |
![[SND]](/icons/sound2.gif) | polyzoarium.mp3 | 20-Apr-2007 04:15 | 17K | |
![[SND]](/icons/sound2.gif) | polyzoic.mp3 | 20-Apr-2007 04:15 | 17K | |
![[SND]](/icons/sound2.gif) | Pom.mp3 | 20-Apr-2007 04:15 | 5.9K | |
![[SND]](/icons/sound2.gif) | pomace.mp3 | 20-Apr-2007 04:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | pomaceous.mp3 | 20-Apr-2007 04:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | pomade.mp3 | 20-Apr-2007 04:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | pomalift.mp3 | 20-Apr-2007 04:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | pomander.mp3 | 20-Apr-2007 04:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | pomarinejaeger.mp3 | 20-Apr-2007 04:15 | 27K | |
![[SND]](/icons/sound2.gif) | pomato.mp3 | 20-Apr-2007 04:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | pomatum.mp3 | 20-Apr-2007 04:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | pombal.mp3 | 20-Apr-2007 04:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | pombe.mp3 | 20-Apr-2007 04:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | pome.mp3 | 20-Apr-2007 04:16 | 5.7K | |
![[SND]](/icons/sound2.gif) | pomegranate.mp3 | 20-Apr-2007 04:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | pomelo.mp3 | 20-Apr-2007 04:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | pomeranchucktheorem.mp3 | 20-Apr-2007 04:16 | 17K | |
![[SND]](/icons/sound2.gif) | Pomerania.mp3 | 20-Apr-2007 04:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pomeranian.mp3 | 20-Apr-2007 04:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | Pomerelia.mp3 | 20-Apr-2007 04:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | pomeron.mp3 | 20-Apr-2007 04:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | pomey.mp3 | 20-Apr-2007 04:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | pomfret.mp3 | 20-Apr-2007 04:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | pomfretcake.mp3 | 20-Apr-2007 04:16 | 17K | |
![[SND]](/icons/sound2.gif) | pomgolia.mp3 | 20-Apr-2007 04:16 | 17K | |
![[SND]](/icons/sound2.gif) | pomiculture.mp3 | 20-Apr-2007 04:16 | 17K | |
![[SND]](/icons/sound2.gif) | pomiferous.mp3 | 20-Apr-2007 04:16 | 17K | |
![[SND]](/icons/sound2.gif) | pommard.mp3 | 20-Apr-2007 04:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | pomme.mp3 | 20-Apr-2007 04:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | pommeblanche.mp3 | 20-Apr-2007 04:16 | 17K | |
![[SND]](/icons/sound2.gif) | pommedeterre.mp3 | 20-Apr-2007 04:16 | 17K | |
![[SND]](/icons/sound2.gif) | pommee.mp3 | 20-Apr-2007 04:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | pommel.mp3 | 20-Apr-2007 04:16 | 5.2K | |
![[SND]](/icons/sound2.gif) | pommelling.mp3 | 20-Apr-2007 04:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | pommelo.mp3 | 20-Apr-2007 04:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pommerellen.mp3 | 20-Apr-2007 04:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pommern.mp3 | 20-Apr-2007 04:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | pommeryandgreno.mp3 | 20-Apr-2007 04:17 | 17K | |
![[SND]](/icons/sound2.gif) | pommesfrites.mp3 | 20-Apr-2007 04:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pommie.mp3 | 20-Apr-2007 04:17 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pommy.mp3 | 20-Apr-2007 04:17 | 6.1K | |
![[SND]](/icons/sound2.gif) | Pomo.mp3 | 20-Apr-2007 04:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | pomological.mp3 | 20-Apr-2007 04:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | pomologist.mp3 | 20-Apr-2007 04:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | pomology.mp3 | 20-Apr-2007 04:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pomona.mp3 | 20-Apr-2007 04:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | Pomorze.mp3 | 20-Apr-2007 04:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | pomp.mp3 | 20-Apr-2007 04:17 | 4.5K | |
![[SND]](/icons/sound2.gif) | pompadour.mp3 | 20-Apr-2007 04:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | pompadoured.mp3 | 20-Apr-2007 04:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | Pompano Beach.mp3 | 20-Apr-2007 04:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | pompano.mp3 | 20-Apr-2007 04:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | pompanobeach.mp3 | 20-Apr-2007 04:17 | 17K | |
![[SND]](/icons/sound2.gif) | pompeia.mp3 | 20-Apr-2007 04:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | pompeian.mp3 | 20-Apr-2007 04:17 | 17K | |
![[SND]](/icons/sound2.gif) | Pompeii.mp3 | 20-Apr-2007 04:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | Pompeiian.mp3 | 20-Apr-2007 04:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | pompelmous.mp3 | 20-Apr-2007 04:17 | 17K | |
![[SND]](/icons/sound2.gif) | pompesdisease.mp3 | 20-Apr-2007 04:17 | 17K | |
![[SND]](/icons/sound2.gif) | pompevanmeerdervoort.mp3 | 20-Apr-2007 04:17 | 27K | |
![[SND]](/icons/sound2.gif) | Pompey.mp3 | 20-Apr-2007 04:17 | 5.5K | |
![[SND]](/icons/sound2.gif) | Pompidou.mp3 | 20-Apr-2007 04:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | pompier.mp3 | 20-Apr-2007 04:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | pompilid.mp3 | 20-Apr-2007 04:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | pompom.mp3 | 20-Apr-2007 04:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | pom-pom.mp3 | 20-Apr-2007 04:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | pompon.mp3 | 20-Apr-2007 04:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | pomposity.mp3 | 20-Apr-2007 04:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | pomposo.mp3 | 20-Apr-2007 04:18 | 17K | |
![[SND]](/icons/sound2.gif) | pompous.mp3 | 20-Apr-2007 04:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | pon.mp3 | 20-Apr-2007 04:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ponape.mp3 | 20-Apr-2007 04:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | Ponca City.mp3 | 20-Apr-2007 04:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | ponca.mp3 | 20-Apr-2007 04:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | poncacity.mp3 | 20-Apr-2007 04:18 | 17K | |
![[SND]](/icons/sound2.gif) | Ponce de Leon.mp3 | 20-Apr-2007 04:18 | 11K | |
![[SND]](/icons/sound2.gif) | ponce.mp3 | 20-Apr-2007 04:18 | 5.9K | |
![[SND]](/icons/sound2.gif) | ponceau.mp3 | 20-Apr-2007 04:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | poncedeleon.mp3 | 20-Apr-2007 04:18 | 17K | |
![[SND]](/icons/sound2.gif) | poncelet.mp3 | 20-Apr-2007 04:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ponchielli.mp3 | 20-Apr-2007 04:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | poncho.mp3 | 20-Apr-2007 04:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | poncy.mp3 | 20-Apr-2007 04:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | pond.mp3 | 20-Apr-2007 04:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | pondage.mp3 | 20-Apr-2007 04:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | ponder.mp3 | 20-Apr-2007 04:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | ponderable.mp3 | 20-Apr-2007 04:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | ponderation.mp3 | 20-Apr-2007 04:19 | 17K | |
![[SND]](/icons/sound2.gif) | ponderer.mp3 | 20-Apr-2007 04:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | pondering.mp3 | 20-Apr-2007 04:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | ponderosa pine.mp3 | 20-Apr-2007 04:19 | 14K | |
![[SND]](/icons/sound2.gif) | ponderosapine.mp3 | 20-Apr-2007 04:19 | 17K | |
![[SND]](/icons/sound2.gif) | ponderous.mp3 | 20-Apr-2007 04:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pondicherry.mp3 | 20-Apr-2007 04:19 | 10K | |
![[SND]](/icons/sound2.gif) | Pondichery.mp3 | 20-Apr-2007 04:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | pondo.mp3 | 20-Apr-2007 04:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | pondok.mp3 | 20-Apr-2007 04:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | pondoland.mp3 | 20-Apr-2007 04:19 | 17K | |
![[SND]](/icons/sound2.gif) | ponds.mp3 | 20-Apr-2007 04:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | pondweed.mp3 | 20-Apr-2007 04:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | pone.mp3 | 20-Apr-2007 04:19 | 6.3K | |
![[SND]](/icons/sound2.gif) | pong.mp3 | 20-Apr-2007 04:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | ponga.mp3 | 20-Apr-2007 04:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | pongal.mp3 | 20-Apr-2007 04:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | pongee.mp3 | 20-Apr-2007 04:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | pongid.mp3 | 20-Apr-2007 04:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | pongo.mp3 | 20-Apr-2007 04:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | pongolia.mp3 | 20-Apr-2007 04:19 | 17K | |
![[SND]](/icons/sound2.gif) | poniard.mp3 | 20-Apr-2007 04:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | ponograph.mp3 | 20-Apr-2007 04:19 | 17K | |
![[SND]](/icons/sound2.gif) | ponor.mp3 | 20-Apr-2007 04:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | pons asinorum.mp3 | 20-Apr-2007 04:19 | 13K | |
![[SND]](/icons/sound2.gif) | pons Varolii.mp3 | 20-Apr-2007 04:19 | 13K | |
![[SND]](/icons/sound2.gif) | pons.mp3 | 20-Apr-2007 04:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | ponsasinorum.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | Ponselle.mp3 | 20-Apr-2007 04:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | ponsvarolii.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | Pont l'eveque.mp3 | 20-Apr-2007 04:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | pont.mp3 | 20-Apr-2007 04:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ponta Delgada.mp3 | 20-Apr-2007 04:20 | 10K | |
![[SND]](/icons/sound2.gif) | pontadelgada.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | pontage.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | pontagrossa.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | Pontchartrain, Lake.mp3 | 20-Apr-2007 04:20 | 10K | |
![[SND]](/icons/sound2.gif) | pontchartrain.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | Pontefract.mp3 | 20-Apr-2007 04:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | pontes.mp3 | 20-Apr-2007 04:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | Pontevedra.mp3 | 20-Apr-2007 04:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | ponti.mp3 | 20-Apr-2007 04:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | Pontiac.mp3 | 20-Apr-2007 04:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | pontian.mp3 | 20-Apr-2007 04:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | Pontianak.mp3 | 20-Apr-2007 04:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | pontic.mp3 | 20-Apr-2007 04:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | ponticello.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | pontifex.mp3 | 20-Apr-2007 04:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | pontiff.mp3 | 20-Apr-2007 04:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | pontific.mp3 | 20-Apr-2007 04:20 | 17K | |
![[SND]](/icons/sound2.gif) | pontifical.mp3 | 20-Apr-2007 04:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | pontificalia.mp3 | 20-Apr-2007 04:21 | 17K | |
![[SND]](/icons/sound2.gif) | pontifically.mp3 | 20-Apr-2007 04:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | pontificate.mp3 | 20-Apr-2007 04:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | pontification.mp3 | 20-Apr-2007 04:21 | 11K | |
![[SND]](/icons/sound2.gif) | pontificator.mp3 | 20-Apr-2007 04:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | pontifices.mp3 | 20-Apr-2007 04:21 | 11K | |
![[SND]](/icons/sound2.gif) | pontil.mp3 | 20-Apr-2007 04:21 | 5.2K | |
![[SND]](/icons/sound2.gif) | Pontine Islands.mp3 | 20-Apr-2007 04:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | pontine.mp3 | 20-Apr-2007 04:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | pontiuspilate.mp3 | 20-Apr-2007 04:21 | 17K | |
![[SND]](/icons/sound2.gif) | pontleveque.mp3 | 20-Apr-2007 04:21 | 17K | |
![[SND]](/icons/sound2.gif) | pontlevis.mp3 | 20-Apr-2007 04:21 | 17K | |
![[SND]](/icons/sound2.gif) | pontocaine.mp3 | 20-Apr-2007 04:21 | 17K | |
![[SND]](/icons/sound2.gif) | pontoise.mp3 | 20-Apr-2007 04:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | pontonier.mp3 | 20-Apr-2007 04:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | pontoon.mp3 | 20-Apr-2007 04:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | pontoppidan.mp3 | 20-Apr-2007 04:21 | 17K | |
![[SND]](/icons/sound2.gif) | Pontormo.mp3 | 20-Apr-2007 04:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pontus Euxinus.mp3 | 20-Apr-2007 04:21 | 13K | |
![[SND]](/icons/sound2.gif) | Pontus.mp3 | 20-Apr-2007 04:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | pontuseuxinus.mp3 | 20-Apr-2007 04:21 | 17K | |
![[SND]](/icons/sound2.gif) | ponty.mp3 | 20-Apr-2007 04:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | Pontypool.mp3 | 20-Apr-2007 04:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | Pontypridd.mp3 | 20-Apr-2007 04:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | pony.mp3 | 20-Apr-2007 04:21 | 5.2K | |
![[SND]](/icons/sound2.gif) | ponytail.mp3 | 20-Apr-2007 04:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | ponytailed.mp3 | 20-Apr-2007 04:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ponzi scheme.mp3 | 20-Apr-2007 04:22 | 11K | |
![[SND]](/icons/sound2.gif) | ponzi.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | poo.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | poobah.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | poo-bah.mp3 | 20-Apr-2007 04:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | pooch.mp3 | 20-Apr-2007 04:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | poochy.mp3 | 20-Apr-2007 04:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | pood.mp3 | 20-Apr-2007 04:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | poodle.mp3 | 20-Apr-2007 04:22 | 5.0K | |
![[SND]](/icons/sound2.gif) | poof.mp3 | 20-Apr-2007 04:22 | 5.0K | |
![[SND]](/icons/sound2.gif) | pooftah.mp3 | 20-Apr-2007 04:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | poofter.mp3 | 20-Apr-2007 04:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | poogye.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | pooh.mp3 | 20-Apr-2007 04:22 | 4.8K | |
![[SND]](/icons/sound2.gif) | poohbah.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | pooh-bah.mp3 | 20-Apr-2007 04:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | poohed.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | poohpooh.mp3 | 20-Apr-2007 04:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | pooh-pooh.mp3 | 20-Apr-2007 04:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | pooja.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | pooka.mp3 | 20-Apr-2007 04:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | pool.mp3 | 20-Apr-2007 04:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | Poole.mp3 | 20-Apr-2007 04:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | poolmalebo.mp3 | 20-Apr-2007 04:22 | 17K | |
![[SND]](/icons/sound2.gif) | poolroom.mp3 | 20-Apr-2007 04:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | poolside.mp3 | 20-Apr-2007 04:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | poon.mp3 | 20-Apr-2007 04:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | Poona.mp3 | 20-Apr-2007 04:23 | 5.2K | |
![[SND]](/icons/sound2.gif) | poonce.mp3 | 20-Apr-2007 04:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | poontang.mp3 | 20-Apr-2007 04:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | poop.mp3 | 20-Apr-2007 04:23 | 4.1K | |
![[SND]](/icons/sound2.gif) | pooped.mp3 | 20-Apr-2007 04:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | pooper.mp3 | 20-Apr-2007 04:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | pooperscooper.mp3 | 20-Apr-2007 04:23 | 17K | |
![[SND]](/icons/sound2.gif) | pooper-scooper.mp3 | 20-Apr-2007 04:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | poopie.mp3 | 20-Apr-2007 04:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | poopied.mp3 | 20-Apr-2007 04:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | poopieplops.mp3 | 20-Apr-2007 04:23 | 17K | |
![[SND]](/icons/sound2.gif) | poopkie.mp3 | 20-Apr-2007 04:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | Poopo, Lake.mp3 | 20-Apr-2007 04:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | poopo.mp3 | 20-Apr-2007 04:23 | 17K | |
![[SND]](/icons/sound2.gif) | poopoo.mp3 | 20-Apr-2007 04:23 | 27K | |
![[SND]](/icons/sound2.gif) | poopsie.mp3 | 20-Apr-2007 04:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | poopy.mp3 | 20-Apr-2007 04:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | Poor Clare.mp3 | 20-Apr-2007 04:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | poor.mp3 | 20-Apr-2007 04:23 | 5.2K | |
![[SND]](/icons/sound2.gif) | poordo.mp3 | 20-Apr-2007 04:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | poorhouse.mp3 | 20-Apr-2007 04:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | poorish.mp3 | 20-Apr-2007 04:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | poorly.mp3 | 20-Apr-2007 04:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | poormouth.mp3 | 20-Apr-2007 04:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | poor-mouth.mp3 | 20-Apr-2007 04:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | poor-spirited.mp3 | 20-Apr-2007 04:24 | 11K | |
![[SND]](/icons/sound2.gif) | poort.mp3 | 20-Apr-2007 04:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | poortith.mp3 | 20-Apr-2007 04:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | poot.mp3 | 20-Apr-2007 04:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | pooter.mp3 | 20-Apr-2007 04:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | pooterish.mp3 | 20-Apr-2007 04:24 | 17K | |
![[SND]](/icons/sound2.gif) | poove.mp3 | 20-Apr-2007 04:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | pop eye.mp3 | 20-Apr-2007 04:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | pop.mp3 | 20-Apr-2007 04:24 | 4.3K | |
![[SND]](/icons/sound2.gif) | popadam.mp3 | 20-Apr-2007 04:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | popayan.mp3 | 20-Apr-2007 04:24 | 17K | |
![[SND]](/icons/sound2.gif) | popcorn.mp3 | 20-Apr-2007 04:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | pope.mp3 | 20-Apr-2007 04:24 | 4.5K | |
![[SND]](/icons/sound2.gif) | Popean.mp3 | 20-Apr-2007 04:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | popedom.mp3 | 20-Apr-2007 04:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | popeline.mp3 | 20-Apr-2007 04:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | poper.mp3 | 20-Apr-2007 04:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | popery.mp3 | 20-Apr-2007 04:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | popeye.mp3 | 20-Apr-2007 04:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | pop-eyed.mp3 | 20-Apr-2007 04:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | popgun.mp3 | 20-Apr-2007 04:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | popinac.mp3 | 20-Apr-2007 04:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | popinjay.mp3 | 20-Apr-2007 04:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | popish.mp3 | 20-Apr-2007 04:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | popism.mp3 | 20-Apr-2007 04:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | popit.mp3 | 20-Apr-2007 04:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | poplar.mp3 | 20-Apr-2007 04:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | poplarism.mp3 | 20-Apr-2007 04:25 | 17K | |
![[SND]](/icons/sound2.gif) | Pople.mp3 | 20-Apr-2007 04:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | poplin.mp3 | 20-Apr-2007 04:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | popliteal.mp3 | 20-Apr-2007 04:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | popliteus.mp3 | 20-Apr-2007 04:25 | 17K | |
![[SND]](/icons/sound2.gif) | popmobility.mp3 | 20-Apr-2007 04:25 | 17K | |
![[SND]](/icons/sound2.gif) | popo.mp3 | 20-Apr-2007 04:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | Popocatepetl.mp3 | 20-Apr-2007 04:25 | 12K | |
![[SND]](/icons/sound2.gif) | popolvuh.mp3 | 20-Apr-2007 04:25 | 17K | |
![[SND]](/icons/sound2.gif) | popov.mp3 | 20-Apr-2007 04:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | popover.mp3 | 20-Apr-2007 04:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | poppa.mp3 | 20-Apr-2007 04:25 | 5.0K | |
![[SND]](/icons/sound2.gif) | poppadom.mp3 | 20-Apr-2007 04:25 | 17K | |
![[SND]](/icons/sound2.gif) | poppaeasabina.mp3 | 20-Apr-2007 04:25 | 17K | |
![[SND]](/icons/sound2.gif) | poppe.mp3 | 20-Apr-2007 04:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | popped.mp3 | 20-Apr-2007 04:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | popper.mp3 | 20-Apr-2007 04:25 | 5.2K | |
![[SND]](/icons/sound2.gif) | poppet.mp3 | 20-Apr-2007 04:25 | 5.2K | |
![[SND]](/icons/sound2.gif) | poppied.mp3 | 20-Apr-2007 04:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | popping.mp3 | 20-Apr-2007 04:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | poppingcrease.mp3 | 20-Apr-2007 04:25 | 17K | |
![[SND]](/icons/sound2.gif) | poppit.mp3 | 20-Apr-2007 04:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | popple.mp3 | 20-Apr-2007 04:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | poppy.mp3 | 20-Apr-2007 04:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | poppycock.mp3 | 20-Apr-2007 04:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | poppyhead.mp3 | 20-Apr-2007 04:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | pops.mp3 | 20-Apr-2007 04:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | Popsicle.mp3 | 20-Apr-2007 04:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | popsie.mp3 | 20-Apr-2007 04:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | popskisprivatearmy.mp3 | 20-Apr-2007 04:26 | 17K | |
![[SND]](/icons/sound2.gif) | popster.mp3 | 20-Apr-2007 04:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | popsy.mp3 | 20-Apr-2007 04:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | pop-top.mp3 | 20-Apr-2007 04:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | populace.mp3 | 20-Apr-2007 04:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | popular.mp3 | 20-Apr-2007 04:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | popularist.mp3 | 20-Apr-2007 04:26 | 17K | |
![[SND]](/icons/sound2.gif) | popularity.mp3 | 20-Apr-2007 04:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | popularization.mp3 | 20-Apr-2007 04:26 | 11K | |
![[SND]](/icons/sound2.gif) | popularize.mp3 | 20-Apr-2007 04:26 | 10K | |
![[SND]](/icons/sound2.gif) | popularizer.mp3 | 20-Apr-2007 04:26 | 10K | |
![[SND]](/icons/sound2.gif) | popularly.mp3 | 20-Apr-2007 04:26 | 17K | |
![[SND]](/icons/sound2.gif) | populate.mp3 | 20-Apr-2007 04:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | population.mp3 | 20-Apr-2007 04:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | populational.mp3 | 20-Apr-2007 04:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | populism.mp3 | 20-Apr-2007 04:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | Populist.mp3 | 20-Apr-2007 04:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | populistic.mp3 | 20-Apr-2007 04:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | populous.mp3 | 20-Apr-2007 04:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | populuxe.mp3 | 20-Apr-2007 04:26 | 17K | |
![[SND]](/icons/sound2.gif) | pop-up.mp3 | 20-Apr-2007 04:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | porangi.mp3 | 20-Apr-2007 04:27 | 17K | |
![[SND]](/icons/sound2.gif) | porbandar.mp3 | 20-Apr-2007 04:27 | 17K | |
![[SND]](/icons/sound2.gif) | porbeagle.mp3 | 20-Apr-2007 04:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | porc.mp3 | 20-Apr-2007 04:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | porcelain.mp3 | 20-Apr-2007 04:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | porcelainite.mp3 | 20-Apr-2007 04:27 | 17K | |
![[SND]](/icons/sound2.gif) | porcelainize.mp3 | 20-Apr-2007 04:27 | 10K | |
![[SND]](/icons/sound2.gif) | porcelainlike.mp3 | 20-Apr-2007 04:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | porcelanic.mp3 | 20-Apr-2007 04:27 | 17K | |
![[SND]](/icons/sound2.gif) | porcellaneous.mp3 | 20-Apr-2007 04:27 | 11K | |
![[SND]](/icons/sound2.gif) | porch.mp3 | 20-Apr-2007 04:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | porcine.mp3 | 20-Apr-2007 04:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | porcini.mp3 | 20-Apr-2007 04:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | porcino.mp3 | 20-Apr-2007 04:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | porcupine.mp3 | 20-Apr-2007 04:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | pore.mp3 | 20-Apr-2007 04:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | porfavor.mp3 | 20-Apr-2007 04:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | porge.mp3 | 20-Apr-2007 04:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | porgy.mp3 | 20-Apr-2007 04:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | pori.mp3 | 20-Apr-2007 04:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | porifer.mp3 | 20-Apr-2007 04:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | porifera.mp3 | 20-Apr-2007 04:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | poriferan.mp3 | 20-Apr-2007 04:27 | 17K | |
![[SND]](/icons/sound2.gif) | poriferous.mp3 | 20-Apr-2007 04:27 | 17K | |
![[SND]](/icons/sound2.gif) | poriform.mp3 | 20-Apr-2007 04:27 | 17K | |
![[SND]](/icons/sound2.gif) | porion.mp3 | 20-Apr-2007 04:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | porirua.mp3 | 20-Apr-2007 04:28 | 17K | |
![[SND]](/icons/sound2.gif) | porism.mp3 | 20-Apr-2007 04:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | pork.mp3 | 20-Apr-2007 04:28 | 4.8K | |
![[SND]](/icons/sound2.gif) | porkbarreler.mp3 | 20-Apr-2007 04:28 | 17K | |
![[SND]](/icons/sound2.gif) | porkburger.mp3 | 20-Apr-2007 04:28 | 17K | |
![[SND]](/icons/sound2.gif) | porked.mp3 | 20-Apr-2007 04:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | porker.mp3 | 20-Apr-2007 04:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | porket.mp3 | 20-Apr-2007 04:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | Porkkala Peninsula.mp3 | 20-Apr-2007 04:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | porkpie hat.mp3 | 20-Apr-2007 04:28 | 11K | |
![[SND]](/icons/sound2.gif) | porky.mp3 | 20-Apr-2007 04:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | Porlamar.mp3 | 20-Apr-2007 04:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | porlock.mp3 | 20-Apr-2007 04:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | porn.mp3 | 20-Apr-2007 04:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | pornie.mp3 | 20-Apr-2007 04:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | porno.mp3 | 20-Apr-2007 04:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | pornocracy.mp3 | 20-Apr-2007 04:28 | 17K | |
![[SND]](/icons/sound2.gif) | pornogenarian.mp3 | 20-Apr-2007 04:28 | 17K | |
![[SND]](/icons/sound2.gif) | pornographer.mp3 | 20-Apr-2007 04:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | pornographic.mp3 | 20-Apr-2007 04:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | pornographically.mp3 | 20-Apr-2007 04:28 | 10K | |
![[SND]](/icons/sound2.gif) | pornography.mp3 | 20-Apr-2007 04:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | porny.mp3 | 20-Apr-2007 04:28 | 5.2K | |
![[SND]](/icons/sound2.gif) | poromeric.mp3 | 20-Apr-2007 04:28 | 17K | |
![[SND]](/icons/sound2.gif) | pororoca.mp3 | 20-Apr-2007 04:28 | 17K | |
![[SND]](/icons/sound2.gif) | porose.mp3 | 20-Apr-2007 04:29 | 17K | |
![[SND]](/icons/sound2.gif) | porosity.mp3 | 20-Apr-2007 04:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | porous.mp3 | 20-Apr-2007 04:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | porphyria.mp3 | 20-Apr-2007 04:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | porphyrin.mp3 | 20-Apr-2007 04:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | porphyritic.mp3 | 20-Apr-2007 04:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | porphyrization.mp3 | 20-Apr-2007 04:29 | 17K | |
![[SND]](/icons/sound2.gif) | porphyrize.mp3 | 20-Apr-2007 04:29 | 17K | |
![[SND]](/icons/sound2.gif) | porphyrogenite.mp3 | 20-Apr-2007 04:29 | 17K | |
![[SND]](/icons/sound2.gif) | porphyroid.mp3 | 20-Apr-2007 04:29 | 17K | |
![[SND]](/icons/sound2.gif) | porphyropsin.mp3 | 20-Apr-2007 04:29 | 9.6K | |
![[SND]](/icons/sound2.gif) | porphyry.mp3 | 20-Apr-2007 04:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | porpoise.mp3 | 20-Apr-2007 04:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | porraceous.mp3 | 20-Apr-2007 04:29 | 17K | |
![[SND]](/icons/sound2.gif) | porrect.mp3 | 20-Apr-2007 04:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | porridge.mp3 | 20-Apr-2007 04:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | porridgy.mp3 | 20-Apr-2007 04:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | porringer.mp3 | 20-Apr-2007 04:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | porroprism.mp3 | 20-Apr-2007 04:29 | 17K | |
![[SND]](/icons/sound2.gif) | porsche.mp3 | 20-Apr-2007 04:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | porsena.mp3 | 20-Apr-2007 04:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Porson.mp3 | 20-Apr-2007 04:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | Port Arthur.mp3 | 20-Apr-2007 04:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | Port Blair.mp3 | 20-Apr-2007 04:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | Port Chester.mp3 | 20-Apr-2007 04:29 | 10K | |
![[SND]](/icons/sound2.gif) | Port Coquitlam.mp3 | 20-Apr-2007 04:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | port de bras.mp3 | 20-Apr-2007 04:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Port du Salut.mp3 | 20-Apr-2007 04:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | Port Elizabeth.mp3 | 20-Apr-2007 04:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | Port Everglades.mp3 | 20-Apr-2007 04:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | Port Hedland.mp3 | 20-Apr-2007 04:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | Port Huron.mp3 | 20-Apr-2007 04:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | Port Jackson.mp3 | 20-Apr-2007 04:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | Port Laoise.mp3 | 20-Apr-2007 04:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | Port Louis.mp3 | 20-Apr-2007 04:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | Port Lyautey.mp3 | 20-Apr-2007 04:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | Port Mahon.mp3 | 20-Apr-2007 04:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | Port Moody.mp3 | 20-Apr-2007 04:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | Port Moresby.mp3 | 20-Apr-2007 04:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | Port Orange.mp3 | 20-Apr-2007 04:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | Port Phillip Bay.mp3 | 20-Apr-2007 04:30 | 5.5K | |
![[SND]](/icons/sound2.gif) | Port Royal.mp3 | 20-Apr-2007 04:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | Port Royalist.mp3 | 20-Apr-2007 04:30 | 10K | |
![[SND]](/icons/sound2.gif) | Port Said.mp3 | 20-Apr-2007 04:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | Port Saint Lucie.mp3 | 20-Apr-2007 04:30 | 10K | |
![[SND]](/icons/sound2.gif) | Port Salut.mp3 | 20-Apr-2007 04:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | port.mp3 | 20-Apr-2007 04:30 | 5.0K | |
![[SND]](/icons/sound2.gif) | porta.mp3 | 20-Apr-2007 04:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | portabella.mp3 | 20-Apr-2007 04:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | portabello.mp3 | 20-Apr-2007 04:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | portability.mp3 | 20-Apr-2007 04:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | portable.mp3 | 20-Apr-2007 04:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | portably.mp3 | 20-Apr-2007 04:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | portadown.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portage.mp3 | 20-Apr-2007 04:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | portagelaprairie.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portakabin.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portal.mp3 | 20-Apr-2007 04:31 | 5.0K | |
![[SND]](/icons/sound2.gif) | portalberni.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portamenti.mp3 | 20-Apr-2007 04:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | portamento.mp3 | 20-Apr-2007 04:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | portance.mp3 | 20-Apr-2007 04:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | portangeles.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portapak.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portative.mp3 | 20-Apr-2007 04:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | portauprince.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | Port-au-Prince.mp3 | 20-Apr-2007 04:31 | 11K | |
![[SND]](/icons/sound2.gif) | portblair.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portcolborne.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portcoquitlam.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portcrayon.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portcullis.mp3 | 20-Apr-2007 04:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | portdebras.mp3 | 20-Apr-2007 04:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | portdusalut.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | porte cochere.mp3 | 20-Apr-2007 04:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | Porte.mp3 | 20-Apr-2007 04:31 | 4.6K | |
![[SND]](/icons/sound2.gif) | portecochere.mp3 | 20-Apr-2007 04:31 | 17K | |
![[SND]](/icons/sound2.gif) | portemonnaie.mp3 | 20-Apr-2007 04:32 | 17K | |
![[SND]](/icons/sound2.gif) | portend.mp3 | 20-Apr-2007 04:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | portent.mp3 | 20-Apr-2007 04:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | portentous.mp3 | 20-Apr-2007 04:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | porter.mp3 | 20-Apr-2007 04:32 | 5.2K | |
![[SND]](/icons/sound2.gif) | porterage.mp3 | 20-Apr-2007 04:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | porteress.mp3 | 20-Apr-2007 04:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | porterhouse.mp3 | 20-Apr-2007 04:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | Porterville.mp3 | 20-Apr-2007 04:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | portetienne.mp3 | 20-Apr-2007 04:32 | 17K | |
![[SND]](/icons/sound2.gif) | portfolio.mp3 | 20-Apr-2007 04:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | portgentil.mp3 | 20-Apr-2007 04:32 | 17K | |
![[SND]](/icons/sound2.gif) | portharcourt.mp3 | 20-Apr-2007 04:32 | 17K | |
![[SND]](/icons/sound2.gif) | porthole.mp3 | 20-Apr-2007 04:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | porthueneme.mp3 | 20-Apr-2007 04:32 | 17K | |
![[SND]](/icons/sound2.gif) | Portia.mp3 | 20-Apr-2007 04:32 | 5.9K | |
![[SND]](/icons/sound2.gif) | portico.mp3 | 20-Apr-2007 04:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | porticoed.mp3 | 20-Apr-2007 04:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | portiere.mp3 | 20-Apr-2007 04:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | portinari.mp3 | 20-Apr-2007 04:32 | 17K | |
![[SND]](/icons/sound2.gif) | porting.mp3 | 20-Apr-2007 04:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | portion.mp3 | 20-Apr-2007 04:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | portioner.mp3 | 20-Apr-2007 04:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | portioning.mp3 | 20-Apr-2007 04:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | portionless.mp3 | 20-Apr-2007 04:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | portland cement.mp3 | 20-Apr-2007 04:32 | 10K | |
![[SND]](/icons/sound2.gif) | Portland.mp3 | 20-Apr-2007 04:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | Portlander.mp3 | 20-Apr-2007 04:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | Portlaoighise.mp3 | 20-Apr-2007 04:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | portlaoise.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portlavaca.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portlouis.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portly.mp3 | 20-Apr-2007 04:33 | 5.9K | |
![[SND]](/icons/sound2.gif) | portlyautey.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portmanteau.mp3 | 20-Apr-2007 04:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | portmanteaux.mp3 | 20-Apr-2007 04:33 | 11K | |
![[SND]](/icons/sound2.gif) | portmoresby.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portneches.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portnoy.mp3 | 20-Apr-2007 04:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | Porto Alegre.mp3 | 20-Apr-2007 04:33 | 11K | |
![[SND]](/icons/sound2.gif) | Porto Rico.mp3 | 20-Apr-2007 04:33 | 9.3K | |
![[SND]](/icons/sound2.gif) | Porto Velho.mp3 | 20-Apr-2007 04:33 | 12K | |
![[SND]](/icons/sound2.gif) | Porto.mp3 | 20-Apr-2007 04:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | portoalegre.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portoamelia.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portobello.mp3 | 20-Apr-2007 04:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | portobelloroad.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | Portobelo.mp3 | 20-Apr-2007 04:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | portofino.mp3 | 20-Apr-2007 04:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | portolano.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portondown.mp3 | 20-Apr-2007 04:33 | 17K | |
![[SND]](/icons/sound2.gif) | portonovo.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | Porto-Novo.mp3 | 20-Apr-2007 04:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | portorfordcedar.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portorico.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portovelho.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portpirie.mp3 | 20-Apr-2007 04:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | portrait.mp3 | 20-Apr-2007 04:34 | 5.7K | |
![[SND]](/icons/sound2.gif) | portraitist.mp3 | 20-Apr-2007 04:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | portraiture.mp3 | 20-Apr-2007 04:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | portray.mp3 | 20-Apr-2007 04:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | portrayal.mp3 | 20-Apr-2007 04:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | portreeve.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portress.mp3 | 20-Apr-2007 04:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | portroyal.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portroyalist.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portsaid.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portsalut.mp3 | 20-Apr-2007 04:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | portsider.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | Portsmouth.mp3 | 20-Apr-2007 04:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | portstlucie.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | Portugal.mp3 | 20-Apr-2007 04:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | portugoose.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | Portuguese.mp3 | 20-Apr-2007 04:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | portulaca.mp3 | 20-Apr-2007 04:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | portulacaceous.mp3 | 20-Apr-2007 04:34 | 17K | |
![[SND]](/icons/sound2.gif) | portune.mp3 | 20-Apr-2007 04:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | Port-Vila.mp3 | 20-Apr-2007 04:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | port-wine stain.mp3 | 20-Apr-2007 04:35 | 13K | |
![[SND]](/icons/sound2.gif) | Porz am Rhein.mp3 | 20-Apr-2007 04:35 | 11K | |
![[SND]](/icons/sound2.gif) | posada.mp3 | 20-Apr-2007 04:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | posadas.mp3 | 20-Apr-2007 04:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | pose.mp3 | 20-Apr-2007 04:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | Poseidon.mp3 | 20-Apr-2007 04:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | Poseidonia.mp3 | 20-Apr-2007 04:35 | 10K | |
![[SND]](/icons/sound2.gif) | Posen.mp3 | 20-Apr-2007 04:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | poser.mp3 | 20-Apr-2007 04:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | poserish.mp3 | 20-Apr-2007 04:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | poseur.mp3 | 20-Apr-2007 04:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | posey.mp3 | 20-Apr-2007 04:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | posh.mp3 | 20-Apr-2007 04:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | posho.mp3 | 20-Apr-2007 04:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | posigrade.mp3 | 20-Apr-2007 04:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | posit.mp3 | 20-Apr-2007 04:35 | 5.9K | |
![[SND]](/icons/sound2.gif) | posited.mp3 | 20-Apr-2007 04:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | positing.mp3 | 20-Apr-2007 04:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | position.mp3 | 20-Apr-2007 04:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | positional.mp3 | 20-Apr-2007 04:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | positioner.mp3 | 20-Apr-2007 04:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | positioning.mp3 | 20-Apr-2007 04:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | positive.mp3 | 20-Apr-2007 04:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | positively.mp3 | 20-Apr-2007 04:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | positiveness.mp3 | 20-Apr-2007 04:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | positivism.mp3 | 20-Apr-2007 04:36 | 10K | |
![[SND]](/icons/sound2.gif) | positivist.mp3 | 20-Apr-2007 04:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | positivistic.mp3 | 20-Apr-2007 04:36 | 11K | |
![[SND]](/icons/sound2.gif) | positivistically.mp3 | 20-Apr-2007 04:36 | 12K | |
![[SND]](/icons/sound2.gif) | positivity.mp3 | 20-Apr-2007 04:36 | 10K | |
![[SND]](/icons/sound2.gif) | positron.mp3 | 20-Apr-2007 04:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | positronium.mp3 | 20-Apr-2007 04:36 | 10K | |
![[SND]](/icons/sound2.gif) | posole.mp3 | 20-Apr-2007 04:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | posology.mp3 | 20-Apr-2007 04:36 | 17K | |
![[SND]](/icons/sound2.gif) | poss.mp3 | 20-Apr-2007 04:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | posse.mp3 | 20-Apr-2007 04:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | possecomitatus.mp3 | 20-Apr-2007 04:36 | 17K | |
![[SND]](/icons/sound2.gif) | possesh.mp3 | 20-Apr-2007 04:36 | 17K | |
![[SND]](/icons/sound2.gif) | possess.mp3 | 20-Apr-2007 04:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | possessed.mp3 | 20-Apr-2007 04:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | possessedly.mp3 | 20-Apr-2007 04:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | possessedness.mp3 | 20-Apr-2007 04:36 | 10K | |
![[SND]](/icons/sound2.gif) | possession.mp3 | 20-Apr-2007 04:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | possessional.mp3 | 20-Apr-2007 04:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | possessionless.mp3 | 20-Apr-2007 04:36 | 10K | |
![[SND]](/icons/sound2.gif) | possessive.mp3 | 20-Apr-2007 04:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | possessor.mp3 | 20-Apr-2007 04:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | possessory.mp3 | 20-Apr-2007 04:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | posset.mp3 | 20-Apr-2007 04:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | possibilist.mp3 | 20-Apr-2007 04:36 | 17K | |
![[SND]](/icons/sound2.gif) | possibility.mp3 | 20-Apr-2007 04:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | possible.mp3 | 20-Apr-2007 04:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | possibly.mp3 | 20-Apr-2007 04:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | possie.mp3 | 20-Apr-2007 04:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | posslq.mp3 | 20-Apr-2007 04:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | possum.mp3 | 20-Apr-2007 04:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | possy.mp3 | 20-Apr-2007 04:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | post hoc, ergo propter hoc.mp3 | 20-Apr-2007 04:37 | 21K | |
![[SND]](/icons/sound2.gif) | post hoc.mp3 | 20-Apr-2007 04:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | post meridiem.mp3 | 20-Apr-2007 04:37 | 11K | |
![[SND]](/icons/sound2.gif) | post obitum.mp3 | 20-Apr-2007 04:37 | 10K | |
![[SND]](/icons/sound2.gif) | post.mp3 | 20-Apr-2007 04:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | postage.mp3 | 20-Apr-2007 04:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | postal.mp3 | 20-Apr-2007 04:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | postaxial.mp3 | 20-Apr-2007 04:37 | 9.8K | |
![[SND]](/icons/sound2.gif) | postbag.mp3 | 20-Apr-2007 04:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | postbellum.mp3 | 20-Apr-2007 04:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | postbox.mp3 | 20-Apr-2007 04:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | postboy.mp3 | 20-Apr-2007 04:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | postcard.mp3 | 20-Apr-2007 04:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | postcardlike.mp3 | 20-Apr-2007 04:37 | 11K | |
![[SND]](/icons/sound2.gif) | postcava.mp3 | 20-Apr-2007 04:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | postcaval.mp3 | 20-Apr-2007 04:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | postcibal.mp3 | 20-Apr-2007 04:37 | 17K | |
![[SND]](/icons/sound2.gif) | postclassic.mp3 | 20-Apr-2007 04:37 | 10K | |
![[SND]](/icons/sound2.gif) | postclassical.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | postcode.mp3 | 20-Apr-2007 04:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | post-communion.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | postconsumer.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | postcranial.mp3 | 20-Apr-2007 04:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | postdate.mp3 | 20-Apr-2007 04:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | postdiluvian.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | postdoc.mp3 | 20-Apr-2007 04:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | postdoctoral.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | postdoctorate.mp3 | 20-Apr-2007 04:38 | 10K | |
![[SND]](/icons/sound2.gif) | poste restante.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | postemergence.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | poster.mp3 | 20-Apr-2007 04:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | posterestante.mp3 | 20-Apr-2007 04:38 | 17K | |
![[SND]](/icons/sound2.gif) | posteriad.mp3 | 20-Apr-2007 04:38 | 17K | |
![[SND]](/icons/sound2.gif) | posterior.mp3 | 20-Apr-2007 04:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | posteriority.mp3 | 20-Apr-2007 04:38 | 12K | |
![[SND]](/icons/sound2.gif) | posterity.mp3 | 20-Apr-2007 04:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | posterization.mp3 | 20-Apr-2007 04:38 | 17K | |
![[SND]](/icons/sound2.gif) | postern.mp3 | 20-Apr-2007 04:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | posterolateral.mp3 | 20-Apr-2007 04:38 | 12K | |
![[SND]](/icons/sound2.gif) | postexilic.mp3 | 20-Apr-2007 04:38 | 11K | |
![[SND]](/icons/sound2.gif) | postface.mp3 | 20-Apr-2007 04:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | postfactum.mp3 | 20-Apr-2007 04:38 | 17K | |
![[SND]](/icons/sound2.gif) | postfeminist.mp3 | 20-Apr-2007 04:38 | 10K | |
![[SND]](/icons/sound2.gif) | postfix.mp3 | 20-Apr-2007 04:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | postfordism.mp3 | 20-Apr-2007 04:39 | 17K | |
![[SND]](/icons/sound2.gif) | post-free.mp3 | 20-Apr-2007 04:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | postganglionic.mp3 | 20-Apr-2007 04:39 | 13K | |
![[SND]](/icons/sound2.gif) | postgrad.mp3 | 20-Apr-2007 04:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | postgraduate.mp3 | 20-Apr-2007 04:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | posthaste.mp3 | 20-Apr-2007 04:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | posthoc.mp3 | 20-Apr-2007 04:39 | 17K | |
![[SND]](/icons/sound2.gif) | posthocergopropterhoc.mp3 | 20-Apr-2007 04:39 | 27K | |
![[SND]](/icons/sound2.gif) | posthole.mp3 | 20-Apr-2007 04:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | post-horse.mp3 | 20-Apr-2007 04:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | posthumous.mp3 | 20-Apr-2007 04:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | posthypnotic.mp3 | 20-Apr-2007 04:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | postical.mp3 | 20-Apr-2007 04:39 | 17K | |
![[SND]](/icons/sound2.gif) | postiche.mp3 | 20-Apr-2007 04:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | posticous.mp3 | 20-Apr-2007 04:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | posticum.mp3 | 20-Apr-2007 04:39 | 17K | |
![[SND]](/icons/sound2.gif) | postie.mp3 | 20-Apr-2007 04:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | postier.mp3 | 20-Apr-2007 04:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | postil.mp3 | 20-Apr-2007 04:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | postilion.mp3 | 20-Apr-2007 04:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | postillion.mp3 | 20-Apr-2007 04:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | Postimpressionism.mp3 | 20-Apr-2007 04:39 | 13K | |
![[SND]](/icons/sound2.gif) | Postimpressionist.mp3 | 20-Apr-2007 04:39 | 12K | |
![[SND]](/icons/sound2.gif) | Postimpressionistic.mp3 | 20-Apr-2007 04:39 | 13K | |
![[SND]](/icons/sound2.gif) | posting.mp3 | 20-Apr-2007 04:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | post-Kantian.mp3 | 20-Apr-2007 04:40 | 10K | |
![[SND]](/icons/sound2.gif) | postlapsarian.mp3 | 20-Apr-2007 04:40 | 12K | |
![[SND]](/icons/sound2.gif) | postliminium.mp3 | 20-Apr-2007 04:40 | 17K | |
![[SND]](/icons/sound2.gif) | postliminy.mp3 | 20-Apr-2007 04:40 | 17K | |
![[SND]](/icons/sound2.gif) | postliterate.mp3 | 20-Apr-2007 04:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | postlude.mp3 | 20-Apr-2007 04:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | postludium.mp3 | 20-Apr-2007 04:40 | 17K | |
![[SND]](/icons/sound2.gif) | postman.mp3 | 20-Apr-2007 04:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | postmark.mp3 | 20-Apr-2007 04:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | postmaster.mp3 | 20-Apr-2007 04:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | postmastership.mp3 | 20-Apr-2007 04:40 | 11K | |
![[SND]](/icons/sound2.gif) | postmenopausal.mp3 | 20-Apr-2007 04:40 | 11K | |
![[SND]](/icons/sound2.gif) | postmenopausally.mp3 | 20-Apr-2007 04:40 | 11K | |
![[SND]](/icons/sound2.gif) | postmenopause.mp3 | 20-Apr-2007 04:40 | 11K | |
![[SND]](/icons/sound2.gif) | postmeridiem.mp3 | 20-Apr-2007 04:40 | 17K | |
![[SND]](/icons/sound2.gif) | postmillenarianism.mp3 | 20-Apr-2007 04:40 | 15K | |
![[SND]](/icons/sound2.gif) | postmillennial.mp3 | 20-Apr-2007 04:40 | 10K | |
![[SND]](/icons/sound2.gif) | postmillennialism.mp3 | 20-Apr-2007 04:40 | 13K | |
![[SND]](/icons/sound2.gif) | postmillennialist.mp3 | 20-Apr-2007 04:40 | 12K | |
![[SND]](/icons/sound2.gif) | postmistress.mp3 | 20-Apr-2007 04:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | postmodern.mp3 | 20-Apr-2007 04:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | postmodernism.mp3 | 20-Apr-2007 04:40 | 12K | |
![[SND]](/icons/sound2.gif) | postmodernist.mp3 | 20-Apr-2007 04:40 | 11K | |
![[SND]](/icons/sound2.gif) | postmodernity.mp3 | 20-Apr-2007 04:40 | 11K | |
![[SND]](/icons/sound2.gif) | postmortem.mp3 | 20-Apr-2007 04:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | postnasal drip.mp3 | 20-Apr-2007 04:40 | 12K | |
![[SND]](/icons/sound2.gif) | postnatal.mp3 | 20-Apr-2007 04:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | postnuptial.mp3 | 20-Apr-2007 04:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | postobitum.mp3 | 20-Apr-2007 04:41 | 17K | |
![[SND]](/icons/sound2.gif) | poston.mp3 | 20-Apr-2007 04:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | postop.mp3 | 20-Apr-2007 04:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | post-op.mp3 | 20-Apr-2007 04:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | postoperative.mp3 | 20-Apr-2007 04:41 | 10K | |
![[SND]](/icons/sound2.gif) | postorbital.mp3 | 20-Apr-2007 04:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | postpaid.mp3 | 20-Apr-2007 04:41 | 9.6K | |
![[SND]](/icons/sound2.gif) | postpartum.mp3 | 20-Apr-2007 04:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | postponable.mp3 | 20-Apr-2007 04:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | postpone.mp3 | 20-Apr-2007 04:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | postponement.mp3 | 20-Apr-2007 04:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | postpose.mp3 | 20-Apr-2007 04:41 | 17K | |
![[SND]](/icons/sound2.gif) | postposition.mp3 | 20-Apr-2007 04:41 | 9.6K | |
![[SND]](/icons/sound2.gif) | postpositional.mp3 | 20-Apr-2007 04:41 | 10K | |
![[SND]](/icons/sound2.gif) | postpositive.mp3 | 20-Apr-2007 04:41 | 10K | |
![[SND]](/icons/sound2.gif) | postprandial.mp3 | 20-Apr-2007 04:41 | 10K | |
![[SND]](/icons/sound2.gif) | postprandially.mp3 | 20-Apr-2007 04:41 | 9.8K | |
![[SND]](/icons/sound2.gif) | postproduction.mp3 | 20-Apr-2007 04:41 | 10K | |
![[SND]](/icons/sound2.gif) | postremogeniture.mp3 | 20-Apr-2007 04:41 | 17K | |
![[SND]](/icons/sound2.gif) | postrorse.mp3 | 20-Apr-2007 04:41 | 17K | |
![[SND]](/icons/sound2.gif) | postscript.mp3 | 20-Apr-2007 04:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | post-structuralism.mp3 | 20-Apr-2007 04:41 | 14K | |
![[SND]](/icons/sound2.gif) | post-structuralist.mp3 | 20-Apr-2007 04:41 | 14K | |
![[SND]](/icons/sound2.gif) | postsurgical.mp3 | 20-Apr-2007 04:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | postsurgically.mp3 | 20-Apr-2007 04:42 | 10K | |
![[SND]](/icons/sound2.gif) | postsynaptic.mp3 | 20-Apr-2007 04:42 | 10K | |
![[SND]](/icons/sound2.gif) | postsynaptically.mp3 | 20-Apr-2007 04:42 | 12K | |
![[SND]](/icons/sound2.gif) | postsynch.mp3 | 20-Apr-2007 04:42 | 17K | |
![[SND]](/icons/sound2.gif) | posttension.mp3 | 20-Apr-2007 04:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | posttest.mp3 | 20-Apr-2007 04:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | posttoasties.mp3 | 20-Apr-2007 04:42 | 17K | |
![[SND]](/icons/sound2.gif) | posttranscriptional.mp3 | 20-Apr-2007 04:42 | 14K | |
![[SND]](/icons/sound2.gif) | posttransfusion.mp3 | 20-Apr-2007 04:42 | 12K | |
![[SND]](/icons/sound2.gif) | posttranslational.mp3 | 20-Apr-2007 04:42 | 12K | |
![[SND]](/icons/sound2.gif) | postulancy.mp3 | 20-Apr-2007 04:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | postulant.mp3 | 20-Apr-2007 04:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | postulate.mp3 | 20-Apr-2007 04:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | postulation.mp3 | 20-Apr-2007 04:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | postulational.mp3 | 20-Apr-2007 04:42 | 10K | |
![[SND]](/icons/sound2.gif) | postulator.mp3 | 20-Apr-2007 04:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | postural.mp3 | 20-Apr-2007 04:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | posture.mp3 | 20-Apr-2007 04:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | posturer.mp3 | 20-Apr-2007 04:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | posturize.mp3 | 20-Apr-2007 04:42 | 17K | |
![[SND]](/icons/sound2.gif) | postvocalic.mp3 | 20-Apr-2007 04:42 | 10K | |
![[SND]](/icons/sound2.gif) | postwar.mp3 | 20-Apr-2007 04:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | postyup.mp3 | 20-Apr-2007 04:42 | 17K | |
![[SND]](/icons/sound2.gif) | posy.mp3 | 20-Apr-2007 04:42 | 6.3K | |
![[SND]](/icons/sound2.gif) | pot likker.mp3 | 20-Apr-2007 04:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | pot.mp3 | 20-Apr-2007 04:43 | 4.6K | |
![[SND]](/icons/sound2.gif) | potability.mp3 | 20-Apr-2007 04:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | potable.mp3 | 20-Apr-2007 04:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | potableness.mp3 | 20-Apr-2007 04:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | potae.mp3 | 20-Apr-2007 04:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | potage.mp3 | 20-Apr-2007 04:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | potamic.mp3 | 20-Apr-2007 04:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | potamogale.mp3 | 20-Apr-2007 04:43 | 17K | |
![[SND]](/icons/sound2.gif) | potamology.mp3 | 20-Apr-2007 04:43 | 17K | |
![[SND]](/icons/sound2.gif) | potamoplankton.mp3 | 20-Apr-2007 04:43 | 17K | |
![[SND]](/icons/sound2.gif) | potance.mp3 | 20-Apr-2007 04:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | potash.mp3 | 20-Apr-2007 04:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | potass.mp3 | 20-Apr-2007 04:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | potassa.mp3 | 20-Apr-2007 04:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | potassic.mp3 | 20-Apr-2007 04:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | potassium.mp3 | 20-Apr-2007 04:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | potassiumcobaltinitrite.mp3 | 20-Apr-2007 04:43 | 27K | |
|