![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | lick.mp3 | 18-Apr-2007 22:10 | 4.1K | |
![[SND]](/icons/sound2.gif) | luck.mp3 | 18-Apr-2007 23:26 | 4.3K | |
![[SND]](/icons/sound2.gif) | lek.mp3 | 18-Apr-2007 21:42 | 4.5K | |
![[SND]](/icons/sound2.gif) | like.mp3 | 18-Apr-2007 22:17 | 4.5K | |
![[SND]](/icons/sound2.gif) | Lovell.mp3 | 18-Apr-2007 23:19 | 4.6K | |
![[SND]](/icons/sound2.gif) | let.mp3 | 18-Apr-2007 21:54 | 4.6K | |
![[SND]](/icons/sound2.gif) | lit.mp3 | 18-Apr-2007 22:37 | 4.6K | |
![[SND]](/icons/sound2.gif) | lop.mp3 | 18-Apr-2007 23:10 | 4.6K | |
![[SND]](/icons/sound2.gif) | lough.mp3 | 18-Apr-2007 23:16 | 4.6K | |
![[SND]](/icons/sound2.gif) | luke.mp3 | 18-Apr-2007 23:29 | 4.6K | |
![[SND]](/icons/sound2.gif) | Lima.mp3 | 18-Apr-2007 22:19 | 4.8K | |
![[SND]](/icons/sound2.gif) | Luik.mp3 | 18-Apr-2007 23:29 | 4.8K | |
![[SND]](/icons/sound2.gif) | leak.mp3 | 18-Apr-2007 21:29 | 4.8K | |
![[SND]](/icons/sound2.gif) | lemma.mp3 | 18-Apr-2007 21:43 | 4.8K | |
![[SND]](/icons/sound2.gif) | licit.mp3 | 18-Apr-2007 22:10 | 4.8K | |
![[SND]](/icons/sound2.gif) | link.mp3 | 18-Apr-2007 22:28 | 4.8K | |
![[SND]](/icons/sound2.gif) | lint.mp3 | 18-Apr-2007 22:30 | 4.8K | |
![[SND]](/icons/sound2.gif) | lip.mp3 | 18-Apr-2007 22:31 | 4.8K | |
![[SND]](/icons/sound2.gif) | lite.mp3 | 18-Apr-2007 22:38 | 4.8K | |
![[SND]](/icons/sound2.gif) | look.mp3 | 18-Apr-2007 23:08 | 4.8K | |
![[SND]](/icons/sound2.gif) | loop.mp3 | 18-Apr-2007 23:09 | 4.8K | |
![[SND]](/icons/sound2.gif) | loot.mp3 | 18-Apr-2007 23:10 | 4.8K | |
![[SND]](/icons/sound2.gif) | Lake Clark National Park.mp3 | 18-Apr-2007 20:44 | 5.0K | |
![[SND]](/icons/sound2.gif) | Lake Worth.mp3 | 18-Apr-2007 20:44 | 5.0K | |
![[SND]](/icons/sound2.gif) | Lapp.mp3 | 18-Apr-2007 21:02 | 5.0K | |
![[SND]](/icons/sound2.gif) | League City.mp3 | 18-Apr-2007 21:28 | 5.0K | |
![[SND]](/icons/sound2.gif) | Leith.mp3 | 18-Apr-2007 21:42 | 5.0K | |
![[SND]](/icons/sound2.gif) | Lett.mp3 | 18-Apr-2007 21:55 | 5.0K | |
![[SND]](/icons/sound2.gif) | Lippi.mp3 | 18-Apr-2007 22:33 | 5.0K | |
![[SND]](/icons/sound2.gif) | Lowell.mp3 | 18-Apr-2007 23:20 | 5.0K | |
![[SND]](/icons/sound2.gif) | lack.mp3 | 18-Apr-2007 20:33 | 5.0K | |
![[SND]](/icons/sound2.gif) | lake.mp3 | 18-Apr-2007 20:44 | 5.0K | |
![[SND]](/icons/sound2.gif) | lakh.mp3 | 18-Apr-2007 20:45 | 5.0K | |
![[SND]](/icons/sound2.gif) | lat.mp3 | 18-Apr-2007 21:10 | 5.0K | |
![[SND]](/icons/sound2.gif) | late.mp3 | 18-Apr-2007 21:11 | 5.0K | |
![[SND]](/icons/sound2.gif) | leap.mp3 | 18-Apr-2007 21:30 | 5.0K | |
![[SND]](/icons/sound2.gif) | led.mp3 | 18-Apr-2007 21:34 | 5.0K | |
![[SND]](/icons/sound2.gif) | leek.mp3 | 18-Apr-2007 21:35 | 5.0K | |
![[SND]](/icons/sound2.gif) | letter.mp3 | 18-Apr-2007 21:55 | 5.0K | |
![[SND]](/icons/sound2.gif) | lev.mp3 | 18-Apr-2007 21:59 | 5.0K | |
![[SND]](/icons/sound2.gif) | limba.mp3 | 18-Apr-2007 22:20 | 5.0K | |
![[SND]](/icons/sound2.gif) | little.mp3 | 18-Apr-2007 22:42 | 5.0K | |
![[SND]](/icons/sound2.gif) | lope.mp3 | 18-Apr-2007 23:10 | 5.0K | |
![[SND]](/icons/sound2.gif) | loup.mp3 | 18-Apr-2007 23:17 | 5.0K | |
![[SND]](/icons/sound2.gif) | Lecky.mp3 | 18-Apr-2007 21:33 | 5.2K | |
![[SND]](/icons/sound2.gif) | Lena.mp3 | 18-Apr-2007 21:44 | 5.2K | |
![[SND]](/icons/sound2.gif) | Lunt.mp3 | 18-Apr-2007 23:34 | 5.2K | |
![[SND]](/icons/sound2.gif) | Lydia.mp3 | 18-Apr-2007 23:43 | 5.2K | |
![[SND]](/icons/sound2.gif) | Lys.mp3 | 18-Apr-2007 23:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | laic.mp3 | 18-Apr-2007 20:42 | 5.2K | |
![[SND]](/icons/sound2.gif) | lama.mp3 | 18-Apr-2007 20:46 | 5.2K | |
![[SND]](/icons/sound2.gif) | lap.mp3 | 18-Apr-2007 21:01 | 5.2K | |
![[SND]](/icons/sound2.gif) | lever.mp3 | 18-Apr-2007 22:00 | 5.2K | |
![[SND]](/icons/sound2.gif) | lied.mp3 | 18-Apr-2007 22:11 | 5.2K | |
![[SND]](/icons/sound2.gif) | light.mp3 | 18-Apr-2007 22:14 | 5.2K | |
![[SND]](/icons/sound2.gif) | liked.mp3 | 18-Apr-2007 22:17 | 5.2K | |
![[SND]](/icons/sound2.gif) | limpa.mp3 | 18-Apr-2007 22:22 | 5.2K | |
![[SND]](/icons/sound2.gif) | lippy.mp3 | 18-Apr-2007 22:34 | 5.2K | |
![[SND]](/icons/sound2.gif) | litter.mp3 | 18-Apr-2007 22:41 | 5.2K | |
![[SND]](/icons/sound2.gif) | loose.mp3 | 18-Apr-2007 23:09 | 5.2K | |
![[SND]](/icons/sound2.gif) | lot.mp3 | 18-Apr-2007 23:14 | 5.2K | |
![[SND]](/icons/sound2.gif) | lotte.mp3 | 18-Apr-2007 23:15 | 5.2K | |
![[SND]](/icons/sound2.gif) | loupe.mp3 | 18-Apr-2007 23:17 | 5.2K | |
![[SND]](/icons/sound2.gif) | luff.mp3 | 18-Apr-2007 23:28 | 5.2K | |
![[SND]](/icons/sound2.gif) | lump.mp3 | 18-Apr-2007 23:32 | 5.2K | |
![[SND]](/icons/sound2.gif) | lunar.mp3 | 18-Apr-2007 23:32 | 5.2K | |
![[SND]](/icons/sound2.gif) | lute.mp3 | 18-Apr-2007 23:38 | 5.2K | |
![[SND]](/icons/sound2.gif) | Liffey.mp3 | 18-Apr-2007 22:13 | 5.4K | |
![[SND]](/icons/sound2.gif) | Lilith.mp3 | 18-Apr-2007 22:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | Linnhe, Loch.mp3 | 18-Apr-2007 22:29 | 5.4K | |
![[SND]](/icons/sound2.gif) | Lippe.mp3 | 18-Apr-2007 22:33 | 5.4K | |
![[SND]](/icons/sound2.gif) | Livy.mp3 | 18-Apr-2007 22:46 | 5.4K | |
![[SND]](/icons/sound2.gif) | Locke.mp3 | 18-Apr-2007 22:53 | 5.4K | |
![[SND]](/icons/sound2.gif) | Loewe.mp3 | 18-Apr-2007 22:56 | 5.4K | |
![[SND]](/icons/sound2.gif) | Loewi.mp3 | 18-Apr-2007 22:56 | 5.4K | |
![[SND]](/icons/sound2.gif) | Lorn, Firth of.mp3 | 18-Apr-2007 23:13 | 5.4K | |
![[SND]](/icons/sound2.gif) | Louis.mp3 | 18-Apr-2007 23:16 | 5.4K | |
![[SND]](/icons/sound2.gif) | Lucca.mp3 | 18-Apr-2007 23:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | lac.mp3 | 18-Apr-2007 20:31 | 5.4K | |
![[SND]](/icons/sound2.gif) | ladle.mp3 | 18-Apr-2007 20:38 | 5.4K | |
![[SND]](/icons/sound2.gif) | lady.mp3 | 18-Apr-2007 20:38 | 5.4K | |
![[SND]](/icons/sound2.gif) | lark.mp3 | 18-Apr-2007 21:05 | 5.4K | |
![[SND]](/icons/sound2.gif) | leaf.mp3 | 18-Apr-2007 21:28 | 5.4K | |
![[SND]](/icons/sound2.gif) | leant.mp3 | 18-Apr-2007 21:29 | 5.4K | |
![[SND]](/icons/sound2.gif) | leapt.mp3 | 18-Apr-2007 21:30 | 5.4K | |
![[SND]](/icons/sound2.gif) | left.mp3 | 18-Apr-2007 21:36 | 5.4K | |
![[SND]](/icons/sound2.gif) | leg.mp3 | 18-Apr-2007 21:36 | 5.4K | |
![[SND]](/icons/sound2.gif) | leger line.mp3 | 18-Apr-2007 21:38 | 5.4K | |
![[SND]](/icons/sound2.gif) | lent.mp3 | 18-Apr-2007 21:47 | 5.4K | |
![[SND]](/icons/sound2.gif) | leva.mp3 | 18-Apr-2007 21:59 | 5.4K | |
![[SND]](/icons/sound2.gif) | lilt.mp3 | 18-Apr-2007 22:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | lily.mp3 | 18-Apr-2007 22:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | limit.mp3 | 18-Apr-2007 22:21 | 5.4K | |
![[SND]](/icons/sound2.gif) | limn.mp3 | 18-Apr-2007 22:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | limpet.mp3 | 18-Apr-2007 22:23 | 5.4K | |
![[SND]](/icons/sound2.gif) | linga.mp3 | 18-Apr-2007 22:27 | 5.4K | |
![[SND]](/icons/sound2.gif) | lipped.mp3 | 18-Apr-2007 22:33 | 5.4K | |
![[SND]](/icons/sound2.gif) | lippen.mp3 | 18-Apr-2007 22:33 | 5.4K | |
![[SND]](/icons/sound2.gif) | liquor.mp3 | 18-Apr-2007 22:35 | 5.4K | |
![[SND]](/icons/sound2.gif) | litre.mp3 | 18-Apr-2007 22:41 | 5.4K | |
![[SND]](/icons/sound2.gif) | live.mp3 | 18-Apr-2007 22:43 | 5.4K | |
![[SND]](/icons/sound2.gif) | llama.mp3 | 18-Apr-2007 22:47 | 5.4K | |
![[SND]](/icons/sound2.gif) | loaf.mp3 | 18-Apr-2007 22:48 | 5.4K | |
![[SND]](/icons/sound2.gif) | lout.mp3 | 18-Apr-2007 23:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | ludic.mp3 | 18-Apr-2007 23:28 | 5.4K | |
![[SND]](/icons/sound2.gif) | lurk.mp3 | 18-Apr-2007 23:36 | 5.4K | |
![[SND]](/icons/sound2.gif) | lymph.mp3 | 18-Apr-2007 23:43 | 5.4K | |
![[SND]](/icons/sound2.gif) | lytic.mp3 | 18-Apr-2007 23:53 | 5.4K | |
![[SND]](/icons/sound2.gif) | Lake Ijssel.mp3 | 18-Apr-2007 20:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | Laoighis.mp3 | 18-Apr-2007 21:00 | 5.5K | |
![[SND]](/icons/sound2.gif) | Laon.mp3 | 18-Apr-2007 21:00 | 5.5K | |
![[SND]](/icons/sound2.gif) | Le Mans.mp3 | 18-Apr-2007 21:24 | 5.5K | |
![[SND]](/icons/sound2.gif) | Leda.mp3 | 18-Apr-2007 21:34 | 5.5K | |
![[SND]](/icons/sound2.gif) | Leh.mp3 | 18-Apr-2007 21:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lehman Caves.mp3 | 18-Apr-2007 21:41 | 5.5K | |
![[SND]](/icons/sound2.gif) | Leie.mp3 | 18-Apr-2007 21:41 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lenin Peak.mp3 | 18-Apr-2007 21:46 | 5.5K | |
![[SND]](/icons/sound2.gif) | Leven, Loch.mp3 | 18-Apr-2007 22:00 | 5.5K | |
![[SND]](/icons/sound2.gif) | Libby.mp3 | 18-Apr-2007 22:06 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lindsey, Parts of.mp3 | 18-Apr-2007 22:25 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lubbock.mp3 | 18-Apr-2007 23:24 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lyly.mp3 | 18-Apr-2007 23:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lynn.mp3 | 18-Apr-2007 23:47 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lyons.mp3 | 18-Apr-2007 23:48 | 5.5K | |
![[SND]](/icons/sound2.gif) | laddie.mp3 | 18-Apr-2007 20:37 | 5.5K | |
![[SND]](/icons/sound2.gif) | lated.mp3 | 18-Apr-2007 21:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | later.mp3 | 18-Apr-2007 21:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | laugh.mp3 | 18-Apr-2007 21:16 | 5.5K | |
![[SND]](/icons/sound2.gif) | leafed.mp3 | 18-Apr-2007 21:28 | 5.5K | |
![[SND]](/icons/sound2.gif) | learnt.mp3 | 18-Apr-2007 21:30 | 5.5K | |
![[SND]](/icons/sound2.gif) | lee.mp3 | 18-Apr-2007 21:35 | 5.5K | |
![[SND]](/icons/sound2.gif) | length.mp3 | 18-Apr-2007 21:45 | 5.5K | |
![[SND]](/icons/sound2.gif) | levy.mp3 | 18-Apr-2007 22:02 | 5.5K | |
![[SND]](/icons/sound2.gif) | lid.mp3 | 18-Apr-2007 22:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | lieder.mp3 | 18-Apr-2007 22:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | lift.mp3 | 18-Apr-2007 22:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | limb.mp3 | 18-Apr-2007 22:20 | 5.5K | |
![[SND]](/icons/sound2.gif) | limmer.mp3 | 18-Apr-2007 22:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | limp.mp3 | 18-Apr-2007 22:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | limpid.mp3 | 18-Apr-2007 22:23 | 5.5K | |
![[SND]](/icons/sound2.gif) | liner.mp3 | 18-Apr-2007 22:26 | 5.5K | |
![[SND]](/icons/sound2.gif) | lineup.mp3 | 18-Apr-2007 22:26 | 5.5K | |
![[SND]](/icons/sound2.gif) | linked.mp3 | 18-Apr-2007 22:28 | 5.5K | |
![[SND]](/icons/sound2.gif) | linnet.mp3 | 18-Apr-2007 22:29 | 5.5K | |
![[SND]](/icons/sound2.gif) | lipping.mp3 | 18-Apr-2007 22:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | liquid.mp3 | 18-Apr-2007 22:34 | 5.5K | |
![[SND]](/icons/sound2.gif) | liter.mp3 | 18-Apr-2007 22:38 | 5.5K | |
![[SND]](/icons/sound2.gif) | litten.mp3 | 18-Apr-2007 22:41 | 5.5K | |
![[SND]](/icons/sound2.gif) | liver.mp3 | 18-Apr-2007 22:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | lock.mp3 | 18-Apr-2007 22:52 | 5.5K | |
![[SND]](/icons/sound2.gif) | looped.mp3 | 18-Apr-2007 23:09 | 5.5K | |
![[SND]](/icons/sound2.gif) | lota.mp3 | 18-Apr-2007 23:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | lotah.mp3 | 18-Apr-2007 23:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | lotic.mp3 | 18-Apr-2007 23:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | lubber.mp3 | 18-Apr-2007 23:24 | 5.5K | |
![[SND]](/icons/sound2.gif) | lunate.mp3 | 18-Apr-2007 23:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | lung.mp3 | 18-Apr-2007 23:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | lure.mp3 | 18-Apr-2007 23:36 | 5.5K | |
![[SND]](/icons/sound2.gif) | lyric.mp3 | 18-Apr-2007 23:49 | 5.5K | |
![[SND]](/icons/sound2.gif) | Lauder.mp3 | 18-Apr-2007 21:15 | 5.7K | |
![[SND]](/icons/sound2.gif) | Laue.mp3 | 18-Apr-2007 21:16 | 5.7K | |
![[SND]](/icons/sound2.gif) | Leonard.mp3 | 18-Apr-2007 21:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | Lewes.mp3 | 18-Apr-2007 22:02 | 5.7K | |
![[SND]](/icons/sound2.gif) | Lifford.mp3 | 18-Apr-2007 22:14 | 5.7K | |
![[SND]](/icons/sound2.gif) | Linz.mp3 | 18-Apr-2007 22:30 | 5.7K | |
![[SND]](/icons/sound2.gif) | Liszt.mp3 | 18-Apr-2007 22:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | Louth.mp3 | 18-Apr-2007 23:18 | 5.7K | |
![[SND]](/icons/sound2.gif) | Lycia.mp3 | 18-Apr-2007 23:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | Lynd.mp3 | 18-Apr-2007 23:46 | 5.7K | |
![[SND]](/icons/sound2.gif) | Lyra.mp3 | 18-Apr-2007 23:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | Lytton.mp3 | 18-Apr-2007 23:53 | 5.7K | |
![[SND]](/icons/sound2.gif) | l.mp3 | 18-Apr-2007 20:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | labor.mp3 | 18-Apr-2007 20:30 | 5.7K | |
![[SND]](/icons/sound2.gif) | ladder.mp3 | 18-Apr-2007 20:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | laky.mp3 | 18-Apr-2007 20:45 | 5.7K | |
![[SND]](/icons/sound2.gif) | lamber.mp3 | 18-Apr-2007 20:47 | 5.7K | |
![[SND]](/icons/sound2.gif) | lamby.mp3 | 18-Apr-2007 20:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | lamella.mp3 | 18-Apr-2007 20:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | lamp.mp3 | 18-Apr-2007 20:50 | 5.7K | |
![[SND]](/icons/sound2.gif) | lappet.mp3 | 18-Apr-2007 21:03 | 5.7K | |
![[SND]](/icons/sound2.gif) | lardy.mp3 | 18-Apr-2007 21:04 | 5.7K | |
![[SND]](/icons/sound2.gif) | larva.mp3 | 18-Apr-2007 21:06 | 5.7K | |
![[SND]](/icons/sound2.gif) | lea.mp3 | 18-Apr-2007 21:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | leader.mp3 | 18-Apr-2007 21:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | league.mp3 | 18-Apr-2007 21:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | lean.mp3 | 18-Apr-2007 21:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | leaned.mp3 | 18-Apr-2007 21:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | learned.mp3 | 18-Apr-2007 21:30 | 5.7K | |
![[SND]](/icons/sound2.gif) | legate.mp3 | 18-Apr-2007 21:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | lemur.mp3 | 18-Apr-2007 21:44 | 5.7K | |
![[SND]](/icons/sound2.gif) | leper.mp3 | 18-Apr-2007 21:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | ley.mp3 | 18-Apr-2007 22:04 | 5.7K | |
![[SND]](/icons/sound2.gif) | lib.mp3 | 18-Apr-2007 22:06 | 5.7K | |
![[SND]](/icons/sound2.gif) | libber.mp3 | 18-Apr-2007 22:06 | 5.7K | |
![[SND]](/icons/sound2.gif) | lief.mp3 | 18-Apr-2007 22:11 | 5.7K | |
![[SND]](/icons/sound2.gif) | lieu.mp3 | 18-Apr-2007 22:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | life.mp3 | 18-Apr-2007 22:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | lighter.mp3 | 18-Apr-2007 22:15 | 5.7K | |
![[SND]](/icons/sound2.gif) | limbic.mp3 | 18-Apr-2007 22:20 | 5.7K | |
![[SND]](/icons/sound2.gif) | limby.mp3 | 18-Apr-2007 22:20 | 5.7K | |
![[SND]](/icons/sound2.gif) | liminal.mp3 | 18-Apr-2007 22:21 | 5.7K | |
![[SND]](/icons/sound2.gif) | limner.mp3 | 18-Apr-2007 22:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | linkup.mp3 | 18-Apr-2007 22:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | linter.mp3 | 18-Apr-2007 22:30 | 5.7K | |
![[SND]](/icons/sound2.gif) | lira.mp3 | 18-Apr-2007 22:35 | 5.7K | |
![[SND]](/icons/sound2.gif) | list.mp3 | 18-Apr-2007 22:36 | 5.7K | |
![[SND]](/icons/sound2.gif) | lister.mp3 | 18-Apr-2007 22:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | lithic.mp3 | 18-Apr-2007 22:39 | 5.7K | |
![[SND]](/icons/sound2.gif) | lob.mp3 | 18-Apr-2007 22:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | loch.mp3 | 18-Apr-2007 22:52 | 5.7K | |
![[SND]](/icons/sound2.gif) | lollop.mp3 | 18-Apr-2007 23:02 | 5.7K | |
![[SND]](/icons/sound2.gif) | lolly.mp3 | 18-Apr-2007 23:02 | 5.7K | |
![[SND]](/icons/sound2.gif) | longer.mp3 | 18-Apr-2007 23:04 | 5.7K | |
![[SND]](/icons/sound2.gif) | looney.mp3 | 18-Apr-2007 23:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | loonie.mp3 | 18-Apr-2007 23:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | loony.mp3 | 18-Apr-2007 23:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | loth.mp3 | 18-Apr-2007 23:14 | 5.7K | |
![[SND]](/icons/sound2.gif) | lovat.mp3 | 18-Apr-2007 23:18 | 5.7K | |
![[SND]](/icons/sound2.gif) | lower.mp3 | 18-Apr-2007 23:20 | 5.7K | |
![[SND]](/icons/sound2.gif) | lubric.mp3 | 18-Apr-2007 23:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | lucre.mp3 | 18-Apr-2007 23:27 | 5.7K | |
![[SND]](/icons/sound2.gif) | lug.mp3 | 18-Apr-2007 23:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | lugger.mp3 | 18-Apr-2007 23:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | lum.mp3 | 18-Apr-2007 23:30 | 5.7K | |
![[SND]](/icons/sound2.gif) | lumpy.mp3 | 18-Apr-2007 23:32 | 5.7K | |
![[SND]](/icons/sound2.gif) | lush.mp3 | 18-Apr-2007 23:36 | 5.7K | |
![[SND]](/icons/sound2.gif) | LAN.mp3 | 18-Apr-2007 20:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lafitte.mp3 | 18-Apr-2007 20:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lahnda.mp3 | 18-Apr-2007 20:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lahti.mp3 | 18-Apr-2007 20:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lamarck.mp3 | 18-Apr-2007 20:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lannes.mp3 | 18-Apr-2007 20:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | Leahy.mp3 | 18-Apr-2007 21:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lehman.mp3 | 18-Apr-2007 21:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lehn.mp3 | 18-Apr-2007 21:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | Leighton.mp3 | 18-Apr-2007 21:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | Leine.mp3 | 18-Apr-2007 21:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | Leitrim.mp3 | 18-Apr-2007 21:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lenin.mp3 | 18-Apr-2007 21:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lennon.mp3 | 18-Apr-2007 21:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lerner.mp3 | 18-Apr-2007 21:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lerwick.mp3 | 18-Apr-2007 21:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | Leyte.mp3 | 18-Apr-2007 22:04 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lhasa.mp3 | 18-Apr-2007 22:04 | 5.9K | |
![[SND]](/icons/sound2.gif) | Libya.mp3 | 18-Apr-2007 22:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lille.mp3 | 18-Apr-2007 22:19 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lin.mp3 | 18-Apr-2007 22:23 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lincoln.mp3 | 18-Apr-2007 22:24 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lind.mp3 | 18-Apr-2007 22:24 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lodz.mp3 | 18-Apr-2007 22:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | Loeb.mp3 | 18-Apr-2007 22:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | Lyon.mp3 | 18-Apr-2007 23:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | lacquer.mp3 | 18-Apr-2007 20:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | lain.mp3 | 18-Apr-2007 20:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | lambda.mp3 | 18-Apr-2007 20:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | lamia.mp3 | 18-Apr-2007 20:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | lamina.mp3 | 18-Apr-2007 20:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | lank.mp3 | 18-Apr-2007 20:58 | 5.9K | |
![[SND]](/icons/sound2.gif) | lanner.mp3 | 18-Apr-2007 20:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | latent.mp3 | 18-Apr-2007 21:11 | 5.9K | |
![[SND]](/icons/sound2.gif) | law.mp3 | 18-Apr-2007 21:20 | 5.9K | |
![[SND]](/icons/sound2.gif) | leady.mp3 | 18-Apr-2007 21:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | leaguer.mp3 | 18-Apr-2007 21:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | leaker.mp3 | 18-Apr-2007 21:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | leash.mp3 | 18-Apr-2007 21:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | least.mp3 | 18-Apr-2007 21:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | lecher.mp3 | 18-Apr-2007 21:33 | 5.9K | |
![[SND]](/icons/sound2.gif) | ledge.mp3 | 18-Apr-2007 21:35 | 5.9K | |
![[SND]](/icons/sound2.gif) | leer.mp3 | 18-Apr-2007 21:35 | 5.9K | |
![[SND]](/icons/sound2.gif) | legal.mp3 | 18-Apr-2007 21:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | legit.mp3 | 18-Apr-2007 21:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | lei.mp3 | 18-Apr-2007 21:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | leke.mp3 | 18-Apr-2007 21:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | lettered.mp3 | 18-Apr-2007 21:55 | 5.9K | |
![[SND]](/icons/sound2.gif) | lettuce.mp3 | 18-Apr-2007 21:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | leu.mp3 | 18-Apr-2007 21:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | levee.mp3 | 18-Apr-2007 22:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | level.mp3 | 18-Apr-2007 22:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | licht.mp3 | 18-Apr-2007 22:10 | 5.9K | |
![[SND]](/icons/sound2.gif) | lie.mp3 | 18-Apr-2007 22:11 | 5.9K | |
![[SND]](/icons/sound2.gif) | limbeck.mp3 | 18-Apr-2007 22:20 | 5.9K | |
![[SND]](/icons/sound2.gif) | limo.mp3 | 18-Apr-2007 22:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | limpkin.mp3 | 18-Apr-2007 22:23 | 5.9K | |
![[SND]](/icons/sound2.gif) | linen.mp3 | 18-Apr-2007 22:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | lingua.mp3 | 18-Apr-2007 22:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | linn.mp3 | 18-Apr-2007 22:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | lintel.mp3 | 18-Apr-2007 22:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | listen.mp3 | 18-Apr-2007 22:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | littery.mp3 | 18-Apr-2007 22:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | lizard.mp3 | 18-Apr-2007 22:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | loaded.mp3 | 18-Apr-2007 22:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | lobar.mp3 | 18-Apr-2007 22:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | locker.mp3 | 18-Apr-2007 22:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | locket.mp3 | 18-Apr-2007 22:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | loess.mp3 | 18-Apr-2007 22:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | loner.mp3 | 18-Apr-2007 23:04 | 5.9K | |
![[SND]](/icons/sound2.gif) | loo.mp3 | 18-Apr-2007 23:08 | 5.9K | |
![[SND]](/icons/sound2.gif) | looker.mp3 | 18-Apr-2007 23:08 | 5.9K | |
![[SND]](/icons/sound2.gif) | looper.mp3 | 18-Apr-2007 23:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | lose.mp3 | 18-Apr-2007 23:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | louver.mp3 | 18-Apr-2007 23:18 | 5.9K | |
![[SND]](/icons/sound2.gif) | louvre.mp3 | 18-Apr-2007 23:18 | 5.9K | |
![[SND]](/icons/sound2.gif) | luce.mp3 | 18-Apr-2007 23:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | lucky.mp3 | 18-Apr-2007 23:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | lull.mp3 | 18-Apr-2007 23:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | lumbar.mp3 | 18-Apr-2007 23:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | lumber.mp3 | 18-Apr-2007 23:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | lumper.mp3 | 18-Apr-2007 23:32 | 5.9K | |
![[SND]](/icons/sound2.gif) | lunette.mp3 | 18-Apr-2007 23:33 | 5.9K | |
![[SND]](/icons/sound2.gif) | lurid.mp3 | 18-Apr-2007 23:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | lutz.mp3 | 18-Apr-2007 23:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | lynch.mp3 | 18-Apr-2007 23:45 | 5.9K | |
![[SND]](/icons/sound2.gif) | Labe.mp3 | 18-Apr-2007 20:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | Ladakh.mp3 | 18-Apr-2007 20:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | Laing.mp3 | 18-Apr-2007 20:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lange.mp3 | 18-Apr-2007 20:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | Larvik.mp3 | 18-Apr-2007 21:07 | 6.1K | |
![[SND]](/icons/sound2.gif) | Laughton.mp3 | 18-Apr-2007 21:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | Layton.mp3 | 18-Apr-2007 21:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | Leakey.mp3 | 18-Apr-2007 21:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lear.mp3 | 18-Apr-2007 21:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lettish.mp3 | 18-Apr-2007 21:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | Leuven.mp3 | 18-Apr-2007 21:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | Leyton.mp3 | 18-Apr-2007 22:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | Liard.mp3 | 18-Apr-2007 22:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | Libyan Desert.mp3 | 18-Apr-2007 22:09 | 6.1K | |
![[SND]](/icons/sound2.gif) | Liebig.mp3 | 18-Apr-2007 22:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lindley.mp3 | 18-Apr-2007 22:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lindsay.mp3 | 18-Apr-2007 22:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lindy.mp3 | 18-Apr-2007 22:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lipari.mp3 | 18-Apr-2007 22:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lipton.mp3 | 18-Apr-2007 22:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lisle.mp3 | 18-Apr-2007 22:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lockyer.mp3 | 18-Apr-2007 22:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | Logan.mp3 | 18-Apr-2007 22:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | Loki.mp3 | 18-Apr-2007 23:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lourdes.mp3 | 18-Apr-2007 23:17 | 6.1K | |
![[SND]](/icons/sound2.gif) | Louys.mp3 | 18-Apr-2007 23:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lukan.mp3 | 18-Apr-2007 23:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lund.mp3 | 18-Apr-2007 23:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lundy Island.mp3 | 18-Apr-2007 23:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lunen.mp3 | 18-Apr-2007 23:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lungki.mp3 | 18-Apr-2007 23:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | Luther.mp3 | 18-Apr-2007 23:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | Luton.mp3 | 18-Apr-2007 23:39 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lycra.mp3 | 18-Apr-2007 23:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lyell.mp3 | 18-Apr-2007 23:43 | 6.1K | |
![[SND]](/icons/sound2.gif) | labia.mp3 | 18-Apr-2007 20:29 | 6.1K | |
![[SND]](/icons/sound2.gif) | lad.mp3 | 18-Apr-2007 20:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | lager.mp3 | 18-Apr-2007 20:40 | 6.1K | |
![[SND]](/icons/sound2.gif) | lallan.mp3 | 18-Apr-2007 20:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | laminae.mp3 | 18-Apr-2007 20:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | landed.mp3 | 18-Apr-2007 20:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | languor.mp3 | 18-Apr-2007 20:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | lapin.mp3 | 18-Apr-2007 21:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | larrup.mp3 | 18-Apr-2007 21:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | larvae.mp3 | 18-Apr-2007 21:07 | 6.1K | |
![[SND]](/icons/sound2.gif) | latchet.mp3 | 18-Apr-2007 21:10 | 6.1K | |
![[SND]](/icons/sound2.gif) | laten.mp3 | 18-Apr-2007 21:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | launder.mp3 | 18-Apr-2007 21:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | layette.mp3 | 18-Apr-2007 21:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | layup.mp3 | 18-Apr-2007 21:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | leach.mp3 | 18-Apr-2007 21:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | lead-up.mp3 | 18-Apr-2007 21:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | lead up.mp3 | 18-Apr-2007 21:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | leaper.mp3 | 18-Apr-2007 21:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | lech.mp3 | 18-Apr-2007 21:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | lectin.mp3 | 18-Apr-2007 21:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | ledger.mp3 | 18-Apr-2007 21:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | ledgy.mp3 | 18-Apr-2007 21:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | leech.mp3 | 18-Apr-2007 21:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | lemon.mp3 | 18-Apr-2007 21:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | less.mp3 | 18-Apr-2007 21:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | lesser.mp3 | 18-Apr-2007 21:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | lest.mp3 | 18-Apr-2007 21:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | letup.mp3 | 18-Apr-2007 21:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | levin.mp3 | 18-Apr-2007 22:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | libra.mp3 | 18-Apr-2007 22:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | lictor.mp3 | 18-Apr-2007 22:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | lido.mp3 | 18-Apr-2007 22:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | liken.mp3 | 18-Apr-2007 22:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | lilied.mp3 | 18-Apr-2007 22:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | limbed.mp3 | 18-Apr-2007 22:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | limber.mp3 | 18-Apr-2007 22:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | limbus.mp3 | 18-Apr-2007 22:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | lime.mp3 | 18-Apr-2007 22:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | limen.mp3 | 18-Apr-2007 22:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | limey.mp3 | 18-Apr-2007 22:21 | 6.1K | |
![[SND]](/icons/sound2.gif) | limy.mp3 | 18-Apr-2007 22:23 | 6.1K | |
![[SND]](/icons/sound2.gif) | ling.mp3 | 18-Apr-2007 22:26 | 6.1K | |
![[SND]](/icons/sound2.gif) | linty.mp3 | 18-Apr-2007 22:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | lipid.mp3 | 18-Apr-2007 22:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | literal.mp3 | 18-Apr-2007 22:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | living.mp3 | 18-Apr-2007 22:46 | 6.1K | |
![[SND]](/icons/sound2.gif) | lo.mp3 | 18-Apr-2007 22:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | load.mp3 | 18-Apr-2007 22:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | loamy.mp3 | 18-Apr-2007 22:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | lobe.mp3 | 18-Apr-2007 22:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | local.mp3 | 18-Apr-2007 22:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | lode.mp3 | 18-Apr-2007 22:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | logy.mp3 | 18-Apr-2007 23:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | loiter.mp3 | 18-Apr-2007 23:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | loller.mp3 | 18-Apr-2007 23:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | loofah.mp3 | 18-Apr-2007 23:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | loopy.mp3 | 18-Apr-2007 23:09 | 6.1K | |
![[SND]](/icons/sound2.gif) | loti.mp3 | 18-Apr-2007 23:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | louche.mp3 | 18-Apr-2007 23:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | lover.mp3 | 18-Apr-2007 23:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | lube.mp3 | 18-Apr-2007 23:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | lucent.mp3 | 18-Apr-2007 23:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | lumen.mp3 | 18-Apr-2007 23:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | lumina.mp3 | 18-Apr-2007 23:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | lune.mp3 | 18-Apr-2007 23:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | lust.mp3 | 18-Apr-2007 23:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | Lacey.mp3 | 18-Apr-2007 20:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | Ladoga, Lake.mp3 | 18-Apr-2007 20:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | Landes.mp3 | 18-Apr-2007 20:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | Langer.mp3 | 18-Apr-2007 20:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | Larne.mp3 | 18-Apr-2007 21:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | Latimer.mp3 | 18-Apr-2007 21:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lawton.mp3 | 18-Apr-2007 21:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lee's Summit.mp3 | 18-Apr-2007 21:35 | 6.3K | |
![[SND]](/icons/sound2.gif) | Leeward Islands.mp3 | 18-Apr-2007 21:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | Leutze.mp3 | 18-Apr-2007 21:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | Leyden.mp3 | 18-Apr-2007 22:04 | 6.3K | |
![[SND]](/icons/sound2.gif) | Liao.mp3 | 18-Apr-2007 22:05 | 6.3K | |
![[SND]](/icons/sound2.gif) | Licking.mp3 | 18-Apr-2007 22:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | Line Islands.mp3 | 18-Apr-2007 22:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lod.mp3 | 18-Apr-2007 22:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lowes.mp3 | 18-Apr-2007 23:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lowry.mp3 | 18-Apr-2007 23:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lucan.mp3 | 18-Apr-2007 23:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lufkin.mp3 | 18-Apr-2007 23:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lugo.mp3 | 18-Apr-2007 23:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | Lynn Regis.mp3 | 18-Apr-2007 23:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | laager.mp3 | 18-Apr-2007 20:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | labella.mp3 | 18-Apr-2007 20:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | lace.mp3 | 18-Apr-2007 20:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | laced.mp3 | 18-Apr-2007 20:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | lackey.mp3 | 18-Apr-2007 20:33 | 6.3K | |
![[SND]](/icons/sound2.gif) | lacy.mp3 | 18-Apr-2007 20:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | lagan.mp3 | 18-Apr-2007 20:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | laid.mp3 | 18-Apr-2007 20:42 | 6.3K | |
![[SND]](/icons/sound2.gif) | lally column.mp3 | 18-Apr-2007 20:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | lam.mp3 | 18-Apr-2007 20:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | lamb.mp3 | 18-Apr-2007 20:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | lander.mp3 | 18-Apr-2007 20:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | langue.mp3 | 18-Apr-2007 20:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | languet.mp3 | 18-Apr-2007 20:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | lar.mp3 | 18-Apr-2007 21:04 | 6.3K | |
![[SND]](/icons/sound2.gif) | larch.mp3 | 18-Apr-2007 21:04 | 6.3K | |
![[SND]](/icons/sound2.gif) | larder.mp3 | 18-Apr-2007 21:04 | 6.3K | |
![[SND]](/icons/sound2.gif) | larum.mp3 | 18-Apr-2007 21:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | larval.mp3 | 18-Apr-2007 21:07 | 6.3K | |
![[SND]](/icons/sound2.gif) | launce.mp3 | 18-Apr-2007 21:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | laver.mp3 | 18-Apr-2007 21:19 | 6.3K | |
![[SND]](/icons/sound2.gif) | lay.mp3 | 18-Apr-2007 21:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | lead.mp3 | 18-Apr-2007 21:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | leafs.mp3 | 18-Apr-2007 21:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | learn.mp3 | 18-Apr-2007 21:30 | 6.3K | |
![[SND]](/icons/sound2.gif) | leery.mp3 | 18-Apr-2007 21:35 | 6.3K | |
![[SND]](/icons/sound2.gif) | lefty.mp3 | 18-Apr-2007 21:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | leggin.mp3 | 18-Apr-2007 21:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | legging.mp3 | 18-Apr-2007 21:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | leggy.mp3 | 18-Apr-2007 21:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | lend.mp3 | 18-Apr-2007 21:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | leno.mp3 | 18-Apr-2007 21:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | lensed.mp3 | 18-Apr-2007 21:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | leptin.mp3 | 18-Apr-2007 21:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | lesson.mp3 | 18-Apr-2007 21:54 | 6.3K | |
![[SND]](/icons/sound2.gif) | let's.mp3 | 18-Apr-2007 21:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | letch.mp3 | 18-Apr-2007 21:54 | 6.3K | |
![[SND]](/icons/sound2.gif) | leveler.mp3 | 18-Apr-2007 22:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | leveller.mp3 | 18-Apr-2007 22:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | lewd.mp3 | 18-Apr-2007 22:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | lewis.mp3 | 18-Apr-2007 22:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | lichen.mp3 | 18-Apr-2007 22:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | lien.mp3 | 18-Apr-2007 22:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | lier.mp3 | 18-Apr-2007 22:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | lifer.mp3 | 18-Apr-2007 22:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | ligament.mp3 | 18-Apr-2007 22:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | lights.mp3 | 18-Apr-2007 22:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | lignin.mp3 | 18-Apr-2007 22:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | limerick.mp3 | 18-Apr-2007 22:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | limited.mp3 | 18-Apr-2007 22:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | line.mp3 | 18-Apr-2007 22:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | lingam.mp3 | 18-Apr-2007 22:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | links.mp3 | 18-Apr-2007 22:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | linzer torte.mp3 | 18-Apr-2007 22:30 | 6.3K | |
![[SND]](/icons/sound2.gif) | lion.mp3 | 18-Apr-2007 22:30 | 6.3K | |
![[SND]](/icons/sound2.gif) | literate.mp3 | 18-Apr-2007 22:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | litterer.mp3 | 18-Apr-2007 22:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | livid.mp3 | 18-Apr-2007 22:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | livre.mp3 | 18-Apr-2007 22:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | llano.mp3 | 18-Apr-2007 22:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | loan.mp3 | 18-Apr-2007 22:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | loaner.mp3 | 18-Apr-2007 22:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | lobby.mp3 | 18-Apr-2007 22:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | logger.mp3 | 18-Apr-2007 22:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | loggie.mp3 | 18-Apr-2007 22:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | loggy.mp3 | 18-Apr-2007 22:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | logic.mp3 | 18-Apr-2007 22:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | loin.mp3 | 18-Apr-2007 23:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | london.mp3 | 18-Apr-2007 23:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | lopper.mp3 | 18-Apr-2007 23:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | lore.mp3 | 18-Apr-2007 23:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | lotto.mp3 | 18-Apr-2007 23:15 | 6.3K | |
![[SND]](/icons/sound2.gif) | louvred.mp3 | 18-Apr-2007 23:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | love.mp3 | 18-Apr-2007 23:19 | 6.3K | |
![[SND]](/icons/sound2.gif) | lowe.mp3 | 18-Apr-2007 23:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | lude.mp3 | 18-Apr-2007 23:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | luger.mp3 | 18-Apr-2007 23:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | lupin.mp3 | 18-Apr-2007 23:35 | 6.3K | |
![[SND]](/icons/sound2.gif) | lupine.mp3 | 18-Apr-2007 23:35 | 6.3K | |
![[SND]](/icons/sound2.gif) | lurcher.mp3 | 18-Apr-2007 23:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | lustra.mp3 | 18-Apr-2007 23:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | lux.mp3 | 18-Apr-2007 23:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | luxe.mp3 | 18-Apr-2007 23:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | lyre.mp3 | 18-Apr-2007 23:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | La Hogue.mp3 | 18-Apr-2007 20:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | La Salle.mp3 | 18-Apr-2007 20:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lae.mp3 | 18-Apr-2007 20:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lahore.mp3 | 18-Apr-2007 20:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lakota.mp3 | 18-Apr-2007 20:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lanark.mp3 | 18-Apr-2007 20:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lanier.mp3 | 18-Apr-2007 20:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lansing.mp3 | 18-Apr-2007 20:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lao.mp3 | 18-Apr-2007 21:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | Laski.mp3 | 18-Apr-2007 21:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | Laurium.mp3 | 18-Apr-2007 21:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | Leavis.mp3 | 18-Apr-2007 21:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lecco.mp3 | 18-Apr-2007 21:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | Leicester.mp3 | 18-Apr-2007 21:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | Leitha.mp3 | 18-Apr-2007 21:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | Leix.mp3 | 18-Apr-2007 21:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | Leland.mp3 | 18-Apr-2007 21:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lely.mp3 | 18-Apr-2007 21:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lepcha.mp3 | 18-Apr-2007 21:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lerida.mp3 | 18-Apr-2007 21:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lessing.mp3 | 18-Apr-2007 21:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | Linacre.mp3 | 18-Apr-2007 22:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lipara.mp3 | 18-Apr-2007 22:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lockhart.mp3 | 18-Apr-2007 22:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lolland.mp3 | 18-Apr-2007 23:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lollard.mp3 | 18-Apr-2007 23:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | Lordy.mp3 | 18-Apr-2007 23:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | Luanda.mp3 | 18-Apr-2007 23:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | Luwian.mp3 | 18-Apr-2007 23:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | la.mp3 | 18-Apr-2007 20:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | laari.mp3 | 18-Apr-2007 20:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | labret.mp3 | 18-Apr-2007 20:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | lacuna.mp3 | 18-Apr-2007 20:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | lade.mp3 | 18-Apr-2007 20:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | lag.mp3 | 18-Apr-2007 20:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | laggard.mp3 | 18-Apr-2007 20:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | lagging.mp3 | 18-Apr-2007 20:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | laker.mp3 | 18-Apr-2007 20:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | lamed.mp3 | 18-Apr-2007 20:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | lament.mp3 | 18-Apr-2007 20:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | laminin.mp3 | 18-Apr-2007 20:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | lancet.mp3 | 18-Apr-2007 20:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | land.mp3 | 18-Apr-2007 20:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | lane.mp3 | 18-Apr-2007 20:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | lanky.mp3 | 18-Apr-2007 20:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | lanyard.mp3 | 18-Apr-2007 21:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | larky.mp3 | 18-Apr-2007 21:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | lash.mp3 | 18-Apr-2007 21:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | lass.mp3 | 18-Apr-2007 21:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | lately.mp3 | 18-Apr-2007 21:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | lather.mp3 | 18-Apr-2007 21:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | latter.mp3 | 18-Apr-2007 21:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | laughter.mp3 | 18-Apr-2007 21:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | lava.mp3 | 18-Apr-2007 21:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | lave.mp3 | 18-Apr-2007 21:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | lawn.mp3 | 18-Apr-2007 21:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | lawny.mp3 | 18-Apr-2007 21:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | leafy.mp3 | 18-Apr-2007 21:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | leave.mp3 | 18-Apr-2007 21:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | leaven.mp3 | 18-Apr-2007 21:31 | 6.4K | |
![[SND]](/icons/sound2.gif) | lees.mp3 | 18-Apr-2007 21:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | legally.mp3 | 18-Apr-2007 21:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | legged.mp3 | 18-Apr-2007 21:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | legible.mp3 | 18-Apr-2007 21:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | legwork.mp3 | 18-Apr-2007 21:40 | 6.4K | |
![[SND]](/icons/sound2.gif) | leister.mp3 | 18-Apr-2007 21:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | leman.mp3 | 18-Apr-2007 21:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | lemming.mp3 | 18-Apr-2007 21:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | lengths.mp3 | 18-Apr-2007 21:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | lenient.mp3 | 18-Apr-2007 21:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | lentil.mp3 | 18-Apr-2007 21:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | leopard.mp3 | 18-Apr-2007 21:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | lessen.mp3 | 18-Apr-2007 21:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | levelly.mp3 | 18-Apr-2007 22:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | leveret.mp3 | 18-Apr-2007 22:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | levirate.mp3 | 18-Apr-2007 22:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | lexica.mp3 | 18-Apr-2007 22:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | liable.mp3 | 18-Apr-2007 22:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | liar.mp3 | 18-Apr-2007 22:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | lighting.mp3 | 18-Apr-2007 22:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | lightish.mp3 | 18-Apr-2007 22:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | lightly.mp3 | 18-Apr-2007 22:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | lightning.mp3 | 18-Apr-2007 22:15 | 6.4K | |
![[SND]](/icons/sound2.gif) | likuta.mp3 | 18-Apr-2007 22:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | linac.mp3 | 18-Apr-2007 22:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | lineal.mp3 | 18-Apr-2007 22:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | linear.mp3 | 18-Apr-2007 22:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | liney.mp3 | 18-Apr-2007 22:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | linger.mp3 | 18-Apr-2007 22:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | liniment.mp3 | 18-Apr-2007 22:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | lining.mp3 | 18-Apr-2007 22:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | lipidic.mp3 | 18-Apr-2007 22:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | lipstick.mp3 | 18-Apr-2007 22:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | liri.mp3 | 18-Apr-2007 22:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | lirot.mp3 | 18-Apr-2007 22:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | listel.mp3 | 18-Apr-2007 22:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | litany.mp3 | 18-Apr-2007 22:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | litigate.mp3 | 18-Apr-2007 22:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | littler.mp3 | 18-Apr-2007 22:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | liven.mp3 | 18-Apr-2007 22:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | loach.mp3 | 18-Apr-2007 22:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | loafer.mp3 | 18-Apr-2007 22:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | loam.mp3 | 18-Apr-2007 22:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | loath.mp3 | 18-Apr-2007 22:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | lockup.mp3 | 18-Apr-2007 22:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | locum.mp3 | 18-Apr-2007 22:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | loft.mp3 | 18-Apr-2007 22:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | loment.mp3 | 18-Apr-2007 23:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | long.mp3 | 18-Apr-2007 23:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | looby.mp3 | 18-Apr-2007 23:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | loom.mp3 | 18-Apr-2007 23:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | loran.mp3 | 18-Apr-2007 23:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | lord.mp3 | 18-Apr-2007 23:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | loris.mp3 | 18-Apr-2007 23:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | lorn.mp3 | 18-Apr-2007 23:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | lorry.mp3 | 18-Apr-2007 23:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | lory.mp3 | 18-Apr-2007 23:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | lost.mp3 | 18-Apr-2007 23:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | loving.mp3 | 18-Apr-2007 23:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | low.mp3 | 18-Apr-2007 23:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | lowly.mp3 | 18-Apr-2007 23:21 | 6.4K | |
![[SND]](/icons/sound2.gif) | lown.mp3 | 18-Apr-2007 23:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | loyal.mp3 | 18-Apr-2007 23:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | lucid.mp3 | 18-Apr-2007 23:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | luggage.mp3 | 18-Apr-2007 23:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | lumpen.mp3 | 18-Apr-2007 23:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | lunker.mp3 | 18-Apr-2007 23:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | lurdane.mp3 | 18-Apr-2007 23:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | luteal.mp3 | 18-Apr-2007 23:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | lutein.mp3 | 18-Apr-2007 23:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | luthier.mp3 | 18-Apr-2007 23:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | lye.mp3 | 18-Apr-2007 23:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | L'Amour.mp3 | 18-Apr-2007 20:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | La Tour.mp3 | 18-Apr-2007 20:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lake Jackson.mp3 | 18-Apr-2007 20:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lambeth.mp3 | 18-Apr-2007 20:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lammas.mp3 | 18-Apr-2007 20:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | Landon.mp3 | 18-Apr-2007 20:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | Langton.mp3 | 18-Apr-2007 20:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | Langtry.mp3 | 18-Apr-2007 20:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | Larissa.mp3 | 18-Apr-2007 21:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lavery.mp3 | 18-Apr-2007 21:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lawes.mp3 | 18-Apr-2007 21:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | Layamon.mp3 | 18-Apr-2007 21:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lebanon.mp3 | 18-Apr-2007 21:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | Leeds.mp3 | 18-Apr-2007 21:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lehar.mp3 | 18-Apr-2007 21:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lehigh.mp3 | 18-Apr-2007 21:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lemaitre.mp3 | 18-Apr-2007 21:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lenten.mp3 | 18-Apr-2007 21:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | Leuctra.mp3 | 18-Apr-2007 21:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lewisham.mp3 | 18-Apr-2007 22:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lifar.mp3 | 18-Apr-2007 22:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lillo.mp3 | 18-Apr-2007 22:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lion, Gulf of.mp3 | 18-Apr-2007 22:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lisbon.mp3 | 18-Apr-2007 22:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | Llull.mp3 | 18-Apr-2007 22:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | Loffler.mp3 | 18-Apr-2007 22:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lorenz.mp3 | 18-Apr-2007 23:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lothair I.mp3 | 18-Apr-2007 23:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lully.mp3 | 18-Apr-2007 23:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | Lutzen.mp3 | 18-Apr-2007 23:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | label.mp3 | 18-Apr-2007 20:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | labiate.mp3 | 18-Apr-2007 20:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | labrum.mp3 | 18-Apr-2007 20:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | lacing.mp3 | 18-Apr-2007 20:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | laconic.mp3 | 18-Apr-2007 20:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | lactic.mp3 | 18-Apr-2007 20:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | lacunar.mp3 | 18-Apr-2007 20:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | lacunate.mp3 | 18-Apr-2007 20:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | laden.mp3 | 18-Apr-2007 20:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | laird.mp3 | 18-Apr-2007 20:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | lalland.mp3 | 18-Apr-2007 20:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | lambent.mp3 | 18-Apr-2007 20:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | lamellae.mp3 | 18-Apr-2007 20:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | lamellar.mp3 | 18-Apr-2007 20:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | laminal.mp3 | 18-Apr-2007 20:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | laminar.mp3 | 18-Apr-2007 20:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | lang.mp3 | 18-Apr-2007 20:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | lapse.mp3 | 18-Apr-2007 21:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | lard.mp3 | 18-Apr-2007 21:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | laser.mp3 | 18-Apr-2007 21:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | lassie.mp3 | 18-Apr-2007 21:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | lateral.mp3 | 18-Apr-2007 21:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | laud.mp3 | 18-Apr-2007 21:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | launch.mp3 | 18-Apr-2007 21:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | laurel.mp3 | 18-Apr-2007 21:17 | 6.6K | |
![[SND]](/icons/sound2.gif) | leaden.mp3 | 18-Apr-2007 21:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | leadwork.mp3 | 18-Apr-2007 21:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | leal.mp3 | 18-Apr-2007 21:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | lease.mp3 | 18-Apr-2007 21:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | lection.mp3 | 18-Apr-2007 21:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | lecture.mp3 | 18-Apr-2007 21:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | lemony.mp3 | 18-Apr-2007 21:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | lentic.mp3 | 18-Apr-2007 21:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | leprotic.mp3 | 18-Apr-2007 21:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | lethe.mp3 | 18-Apr-2007 21:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | levelling.mp3 | 18-Apr-2007 22:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | lex.mp3 | 18-Apr-2007 22:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | liana.mp3 | 18-Apr-2007 22:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | licorice.mp3 | 18-Apr-2007 22:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | ligand.mp3 | 18-Apr-2007 22:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | ligate.mp3 | 18-Apr-2007 22:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | likable.mp3 | 18-Apr-2007 22:17 | 6.6K | |
![[SND]](/icons/sound2.gif) | likeable.mp3 | 18-Apr-2007 22:17 | 6.6K | |
![[SND]](/icons/sound2.gif) | liking.mp3 | 18-Apr-2007 22:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | lilac.mp3 | 18-Apr-2007 22:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | limbo.mp3 | 18-Apr-2007 22:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | limning.mp3 | 18-Apr-2007 22:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | linage.mp3 | 18-Apr-2007 22:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | lip-sync.mp3 | 18-Apr-2007 22:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | lip-synch.mp3 | 18-Apr-2007 22:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | lipa.mp3 | 18-Apr-2007 22:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | lire.mp3 | 18-Apr-2007 22:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | listener.mp3 | 18-Apr-2007 22:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | lithium.mp3 | 18-Apr-2007 22:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | litigant.mp3 | 18-Apr-2007 22:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | litmus.mp3 | 18-Apr-2007 22:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | livable.mp3 | 18-Apr-2007 22:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | liveable.mp3 | 18-Apr-2007 22:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | loading.mp3 | 18-Apr-2007 22:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | loaning.mp3 | 18-Apr-2007 22:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | loaves.mp3 | 18-Apr-2007 22:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | locally.mp3 | 18-Apr-2007 22:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | lodger.mp3 | 18-Apr-2007 22:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | lofty.mp3 | 18-Apr-2007 22:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | log.mp3 | 18-Apr-2007 22:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | loll.mp3 | 18-Apr-2007 23:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | longing.mp3 | 18-Apr-2007 23:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | lookup.mp3 | 18-Apr-2007 23:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | loon.mp3 | 18-Apr-2007 23:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | loosen.mp3 | 18-Apr-2007 23:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | loser.mp3 | 18-Apr-2007 23:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | luetic.mp3 | 18-Apr-2007 23:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | lummox.mp3 | 18-Apr-2007 23:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | lunge.mp3 | 18-Apr-2007 23:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | lunger.mp3 | 18-Apr-2007 23:34 | 6.6K | |
![[SND]](/icons/sound2.gif) | lupus.mp3 | 18-Apr-2007 23:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | lurch.mp3 | 18-Apr-2007 23:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | luster.mp3 | 18-Apr-2007 23:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | lustful.mp3 | 18-Apr-2007 23:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | lustre.mp3 | 18-Apr-2007 23:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | lusty.mp3 | 18-Apr-2007 23:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | lynx.mp3 | 18-Apr-2007 23:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | lyrate.mp3 | 18-Apr-2007 23:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | lyrical.mp3 | 18-Apr-2007 23:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | La Jolla.mp3 | 18-Apr-2007 20:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | La Plata Peak.mp3 | 18-Apr-2007 20:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | La Porte.mp3 | 18-Apr-2007 20:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lachine.mp3 | 18-Apr-2007 20:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | Laguna Beach.mp3 | 18-Apr-2007 20:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | Laius.mp3 | 18-Apr-2007 20:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lakewood.mp3 | 18-Apr-2007 20:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lallans.mp3 | 18-Apr-2007 20:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | Laos.mp3 | 18-Apr-2007 21:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | Laramie.mp3 | 18-Apr-2007 21:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lardner.mp3 | 18-Apr-2007 21:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | Latrobe.mp3 | 18-Apr-2007 21:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | Laudian.mp3 | 18-Apr-2007 21:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | Leacock.mp3 | 18-Apr-2007 21:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lebrun.mp3 | 18-Apr-2007 21:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lederman.mp3 | 18-Apr-2007 21:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lehmann.mp3 | 18-Apr-2007 21:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lenclos.mp3 | 18-Apr-2007 21:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | Leo.mp3 | 18-Apr-2007 21:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | Levi.mp3 | 18-Apr-2007 22:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | Limon.mp3 | 18-Apr-2007 22:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | Logoi.mp3 | 18-Apr-2007 22:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lolita.mp3 | 18-Apr-2007 23:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | Longs Peak.mp3 | 18-Apr-2007 23:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lorain.mp3 | 18-Apr-2007 23:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lorraine.mp3 | 18-Apr-2007 23:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | Louisville.mp3 | 18-Apr-2007 23:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | Loveland.mp3 | 18-Apr-2007 23:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lowlands.mp3 | 18-Apr-2007 23:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lowndes.mp3 | 18-Apr-2007 23:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lublin.mp3 | 18-Apr-2007 23:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lucas.mp3 | 18-Apr-2007 23:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | Luddite.mp3 | 18-Apr-2007 23:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lumumba.mp3 | 18-Apr-2007 23:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | Luray Caverns.mp3 | 18-Apr-2007 23:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | Luxor.mp3 | 18-Apr-2007 23:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lydian.mp3 | 18-Apr-2007 23:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | Lyttelton.mp3 | 18-Apr-2007 23:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | labial.mp3 | 18-Apr-2007 20:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | labium.mp3 | 18-Apr-2007 20:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | labored.mp3 | 18-Apr-2007 20:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | lading.mp3 | 18-Apr-2007 20:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | lagend.mp3 | 18-Apr-2007 20:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | lair.mp3 | 18-Apr-2007 20:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | lame.mp3 | 18-Apr-2007 20:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | lamellate.mp3 | 18-Apr-2007 20:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | lascar.mp3 | 18-Apr-2007 21:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | latch.mp3 | 18-Apr-2007 21:10 | 6.8K | |
![[SND]](/icons/sound2.gif) | lateener.mp3 | 18-Apr-2007 21:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | laugher.mp3 | 18-Apr-2007 21:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | launcher.mp3 | 18-Apr-2007 21:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | laverock.mp3 | 18-Apr-2007 21:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | lax.mp3 | 18-Apr-2007 21:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | layer.mp3 | 18-Apr-2007 21:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | layered.mp3 | 18-Apr-2007 21:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | leachate.mp3 | 18-Apr-2007 21:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | leaflet.mp3 | 18-Apr-2007 21:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | leaky.mp3 | 18-Apr-2007 21:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | leaning.mp3 | 18-Apr-2007 21:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | leasable.mp3 | 18-Apr-2007 21:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | leaves.mp3 | 18-Apr-2007 21:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | lector.mp3 | 18-Apr-2007 21:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | leeway.mp3 | 18-Apr-2007 21:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | legist.mp3 | 18-Apr-2007 21:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | lehua.mp3 | 18-Apr-2007 21:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | levant.mp3 | 18-Apr-2007 22:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | levering.mp3 | 18-Apr-2007 22:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | levo.mp3 | 18-Apr-2007 22:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | lexis.mp3 | 18-Apr-2007 22:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | liane.mp3 | 18-Apr-2007 22:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | liberal.mp3 | 18-Apr-2007 22:07 | 6.8K | |
![[SND]](/icons/sound2.gif) | lice.mp3 | 18-Apr-2007 22:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | light-foot.mp3 | 18-Apr-2007 22:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | lighten.mp3 | 18-Apr-2007 22:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | lightener.mp3 | 18-Apr-2007 22:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | ligula.mp3 | 18-Apr-2007 22:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | likening.mp3 | 18-Apr-2007 22:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | limiting.mp3 | 18-Apr-2007 22:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | linden.mp3 | 18-Apr-2007 22:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | lingo.mp3 | 18-Apr-2007 22:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | lingual.mp3 | 18-Apr-2007 22:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | linkage.mp3 | 18-Apr-2007 22:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | linkman.mp3 | 18-Apr-2007 22:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | lip-lock.mp3 | 18-Apr-2007 22:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | liplike.mp3 | 18-Apr-2007 22:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | liquate.mp3 | 18-Apr-2007 22:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | liquoring.mp3 | 18-Apr-2007 22:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | litchi.mp3 | 18-Apr-2007 22:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | litigable.mp3 | 18-Apr-2007 22:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | littermate.mp3 | 18-Apr-2007 22:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | littoral.mp3 | 18-Apr-2007 22:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | liturgy.mp3 | 18-Apr-2007 22:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | loathe.mp3 | 18-Apr-2007 22:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | lobate.mp3 | 18-Apr-2007 22:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | lobed.mp3 | 18-Apr-2007 22:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | lobo.mp3 | 18-Apr-2007 22:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | locate.mp3 | 18-Apr-2007 22:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | loco.mp3 | 18-Apr-2007 22:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | lodge.mp3 | 18-Apr-2007 22:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | logo.mp3 | 18-Apr-2007 22:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | lone.mp3 | 18-Apr-2007 23:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | look-in.mp3 | 18-Apr-2007 23:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | lookout.mp3 | 18-Apr-2007 23:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | lording.mp3 | 18-Apr-2007 23:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | lotos.mp3 | 18-Apr-2007 23:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | lots.mp3 | 18-Apr-2007 23:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | lotus.mp3 | 18-Apr-2007 23:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | lour.mp3 | 18-Apr-2007 23:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | louse.mp3 | 18-Apr-2007 23:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | lousy.mp3 | 18-Apr-2007 23:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | loutish.mp3 | 18-Apr-2007 23:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | lovage.mp3 | 18-Apr-2007 23:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | lox.mp3 | 18-Apr-2007 23:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | luckless.mp3 | 18-Apr-2007 23:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | lues.mp3 | 18-Apr-2007 23:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | luge.mp3 | 18-Apr-2007 23:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | lulu.mp3 | 18-Apr-2007 23:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | lumenal.mp3 | 18-Apr-2007 23:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | lumpily.mp3 | 18-Apr-2007 23:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | lumpish.mp3 | 18-Apr-2007 23:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | lunch.mp3 | 18-Apr-2007 23:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | luncheon.mp3 | 18-Apr-2007 23:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | lychee.mp3 | 18-Apr-2007 23:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | lying.mp3 | 18-Apr-2007 23:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | lysin.mp3 | 18-Apr-2007 23:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | L'viv.mp3 | 18-Apr-2007 23:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | LASIK.mp3 | 18-Apr-2007 21:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | La Mesa.mp3 | 18-Apr-2007 20:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lachish.mp3 | 18-Apr-2007 20:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lachlan.mp3 | 18-Apr-2007 20:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lakeland.mp3 | 18-Apr-2007 20:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | Landis.mp3 | 18-Apr-2007 20:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | Landor.mp3 | 18-Apr-2007 20:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | Langland.mp3 | 18-Apr-2007 20:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | Laplace.mp3 | 18-Apr-2007 21:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | Larousse.mp3 | 18-Apr-2007 21:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | Latina.mp3 | 18-Apr-2007 21:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | Latium.mp3 | 18-Apr-2007 21:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lattimore.mp3 | 18-Apr-2007 21:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | Latvia.mp3 | 18-Apr-2007 21:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | Laura.mp3 | 18-Apr-2007 21:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lawrence.mp3 | 18-Apr-2007 21:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | Layard.mp3 | 18-Apr-2007 21:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lejeune.mp3 | 18-Apr-2007 21:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | Leon.mp3 | 18-Apr-2007 21:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lesser Slave Lake.mp3 | 18-Apr-2007 21:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lias.mp3 | 18-Apr-2007 22:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | Libran.mp3 | 18-Apr-2007 22:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | Libyan.mp3 | 18-Apr-2007 22:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lilliput.mp3 | 18-Apr-2007 22:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | Limay.mp3 | 18-Apr-2007 22:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | Loire.mp3 | 18-Apr-2007 23:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lomami.mp3 | 18-Apr-2007 23:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | Londoner.mp3 | 18-Apr-2007 23:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lopez.mp3 | 18-Apr-2007 23:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lorentz.mp3 | 18-Apr-2007 23:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | Louvain.mp3 | 18-Apr-2007 23:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lulea.mp3 | 18-Apr-2007 23:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | Lutheran.mp3 | 18-Apr-2007 23:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | Luthuli.mp3 | 18-Apr-2007 23:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | lab.mp3 | 18-Apr-2007 20:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | labeler.mp3 | 18-Apr-2007 20:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | ladino.mp3 | 18-Apr-2007 20:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | ladling.mp3 | 18-Apr-2007 20:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | lahar.mp3 | 18-Apr-2007 20:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | laically.mp3 | 18-Apr-2007 20:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | laity.mp3 | 18-Apr-2007 20:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | lakefront.mp3 | 18-Apr-2007 20:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | lakelike.mp3 | 18-Apr-2007 20:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | lambert.mp3 | 18-Apr-2007 20:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | lamented.mp3 | 18-Apr-2007 20:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | lamprey.mp3 | 18-Apr-2007 20:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | lanai.mp3 | 18-Apr-2007 20:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | lancer.mp3 | 18-Apr-2007 20:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | languid.mp3 | 18-Apr-2007 20:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | lankily.mp3 | 18-Apr-2007 20:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | lariat.mp3 | 18-Apr-2007 21:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | larrigan.mp3 | 18-Apr-2007 21:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | larrikin.mp3 | 18-Apr-2007 21:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | last.mp3 | 18-Apr-2007 21:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | lateen.mp3 | 18-Apr-2007 21:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | latest.mp3 | 18-Apr-2007 21:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | lath.mp3 | 18-Apr-2007 21:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | lathe.mp3 | 18-Apr-2007 21:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | latke.mp3 | 18-Apr-2007 21:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | latten.mp3 | 18-Apr-2007 21:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | latterly.mp3 | 18-Apr-2007 21:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | latticed.mp3 | 18-Apr-2007 21:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | laudable.mp3 | 18-Apr-2007 21:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | laundrette.mp3 | 18-Apr-2007 21:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | lawman.mp3 | 18-Apr-2007 21:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | layout.mp3 | 18-Apr-2007 21:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | lazar.mp3 | 18-Apr-2007 21:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | leachable.mp3 | 18-Apr-2007 21:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | leading.mp3 | 18-Apr-2007 21:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | leakage.mp3 | 18-Apr-2007 21:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | leakily.mp3 | 18-Apr-2007 21:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | leather.mp3 | 18-Apr-2007 21:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | leathern.mp3 | 18-Apr-2007 21:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | leeward.mp3 | 18-Apr-2007 21:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | legend.mp3 | 18-Apr-2007 21:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | legion.mp3 | 18-Apr-2007 21:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | legitimate.mp3 | 18-Apr-2007 21:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | leisure.mp3 | 18-Apr-2007 21:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | lekvar.mp3 | 18-Apr-2007 21:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | lemmata.mp3 | 18-Apr-2007 21:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | lendable.mp3 | 18-Apr-2007 21:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | lengthen.mp3 | 18-Apr-2007 21:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | lengthy.mp3 | 18-Apr-2007 21:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | lenis.mp3 | 18-Apr-2007 21:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | lens.mp3 | 18-Apr-2007 21:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | lepidote.mp3 | 18-Apr-2007 21:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | letterer.mp3 | 18-Apr-2007 21:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | lettering.mp3 | 18-Apr-2007 21:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | letterman.mp3 | 18-Apr-2007 21:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | levier.mp3 | 18-Apr-2007 22:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | libel.mp3 | 18-Apr-2007 22:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | librae.mp3 | 18-Apr-2007 22:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | libretti.mp3 | 18-Apr-2007 22:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | lichened.mp3 | 18-Apr-2007 22:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | lickerish.mp3 | 18-Apr-2007 22:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | lightening.mp3 | 18-Apr-2007 22:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | lightless.mp3 | 18-Apr-2007 22:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | lightness.mp3 | 18-Apr-2007 22:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | lightship.mp3 | 18-Apr-2007 22:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | lignite.mp3 | 18-Apr-2007 22:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | ligulate.mp3 | 18-Apr-2007 22:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | likeness.mp3 | 18-Apr-2007 22:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | lineman.mp3 | 18-Apr-2007 22:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | lino.mp3 | 18-Apr-2007 22:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | lipe.mp3 | 18-Apr-2007 22:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | liquidly.mp3 | 18-Apr-2007 22:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | lisp.mp3 | 18-Apr-2007 22:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | listening.mp3 | 18-Apr-2007 22:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | lit crit.mp3 | 18-Apr-2007 22:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | litho.mp3 | 18-Apr-2007 22:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | litu.mp3 | 18-Apr-2007 22:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | lively.mp3 | 18-Apr-2007 22:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | livery.mp3 | 18-Apr-2007 22:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | loanable.mp3 | 18-Apr-2007 22:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | loden.mp3 | 18-Apr-2007 22:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | loggats.mp3 | 18-Apr-2007 22:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | loggets.mp3 | 18-Apr-2007 22:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | loquat.mp3 | 18-Apr-2007 23:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | losel.mp3 | 18-Apr-2007 23:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | losing.mp3 | 18-Apr-2007 23:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | loss.mp3 | 18-Apr-2007 23:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | lotion.mp3 | 18-Apr-2007 23:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | loud.mp3 | 18-Apr-2007 23:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | lovable.mp3 | 18-Apr-2007 23:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | loveable.mp3 | 18-Apr-2007 23:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | lowlight.mp3 | 18-Apr-2007 23:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | loyally.mp3 | 18-Apr-2007 23:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | luckily.mp3 | 18-Apr-2007 23:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | lunacy.mp3 | 18-Apr-2007 23:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | lunatic.mp3 | 18-Apr-2007 23:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | lunes.mp3 | 18-Apr-2007 23:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | lunged.mp3 | 18-Apr-2007 23:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | luscious.mp3 | 18-Apr-2007 23:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | lustral.mp3 | 18-Apr-2007 23:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | lustrum.mp3 | 18-Apr-2007 23:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | luteous.mp3 | 18-Apr-2007 23:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | lysis.mp3 | 18-Apr-2007 23:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | Ladies.mp3 | 18-Apr-2007 20:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ladin.mp3 | 18-Apr-2007 20:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lake Rudolf.mp3 | 18-Apr-2007 20:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | Laredo.mp3 | 18-Apr-2007 21:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lartet.mp3 | 18-Apr-2007 21:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lascaux.mp3 | 18-Apr-2007 21:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | Laubach.mp3 | 18-Apr-2007 21:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | Laurence.mp3 | 18-Apr-2007 21:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lausitz.mp3 | 18-Apr-2007 21:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | Laval.mp3 | 18-Apr-2007 21:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | Leawood.mp3 | 18-Apr-2007 21:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ledbetter.mp3 | 18-Apr-2007 21:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | Leinster.mp3 | 18-Apr-2007 21:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lenape.mp3 | 18-Apr-2007 21:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | Leonid.mp3 | 18-Apr-2007 21:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | Levite.mp3 | 18-Apr-2007 22:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | Libau.mp3 | 18-Apr-2007 22:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lindbergh.mp3 | 18-Apr-2007 22:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | Linnaean.mp3 | 18-Apr-2007 22:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | Linnean.mp3 | 18-Apr-2007 22:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lipetsk.mp3 | 18-Apr-2007 22:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lisieux.mp3 | 18-Apr-2007 22:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | Litani.mp3 | 18-Apr-2007 22:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | Littleton.mp3 | 18-Apr-2007 22:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | Livermore.mp3 | 18-Apr-2007 22:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lomas.mp3 | 18-Apr-2007 23:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lome.mp3 | 18-Apr-2007 23:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lorient.mp3 | 18-Apr-2007 23:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | Louise, Lake.mp3 | 18-Apr-2007 23:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | Lubeck.mp3 | 18-Apr-2007 23:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | Luderitz.mp3 | 18-Apr-2007 23:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | labellum.mp3 | 18-Apr-2007 20:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | laboring.mp3 | 18-Apr-2007 20:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | lacunae.mp3 | 18-Apr-2007 20:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | ladanum.mp3 | 18-Apr-2007 20:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | lagoon.mp3 | 18-Apr-2007 20:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | lance.mp3 | 18-Apr-2007 20:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | lancelet.mp3 | 18-Apr-2007 20:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | langley.mp3 | 18-Apr-2007 20:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | lanolin.mp3 | 18-Apr-2007 20:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | larboard.mp3 | 18-Apr-2007 21:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | largish.mp3 | 18-Apr-2007 21:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | lash-up.mp3 | 18-Apr-2007 21:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | lattice.mp3 | 18-Apr-2007 21:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | laughable.mp3 | 18-Apr-2007 21:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | laureate.mp3 | 18-Apr-2007 21:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | lawful.mp3 | 18-Apr-2007 21:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | lawsuit.mp3 | 18-Apr-2007 21:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | lawyer.mp3 | 18-Apr-2007 21:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | layover.mp3 | 18-Apr-2007 21:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | lazaret.mp3 | 18-Apr-2007 21:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | lazarette.mp3 | 18-Apr-2007 21:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | lazy.mp3 | 18-Apr-2007 21:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | lead-pipe.mp3 | 18-Apr-2007 21:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | leadsman.mp3 | 18-Apr-2007 21:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | leafage.mp3 | 18-Apr-2007 21:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | leaping.mp3 | 18-Apr-2007 21:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | leasing.mp3 | 18-Apr-2007 21:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | leatherette.mp3 | 18-Apr-2007 21:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | leatherneck.mp3 | 18-Apr-2007 21:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | lechery.mp3 | 18-Apr-2007 21:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | legibly.mp3 | 18-Apr-2007 21:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | legislate.mp3 | 18-Apr-2007 21:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | legless.mp3 | 18-Apr-2007 21:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | lento.mp3 | 18-Apr-2007 21:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | leprous.mp3 | 18-Apr-2007 21:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | lessoning.mp3 | 18-Apr-2007 21:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | lessor.mp3 | 18-Apr-2007 21:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | lethal.mp3 | 18-Apr-2007 21:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | leucite.mp3 | 18-Apr-2007 21:57 | 7.1K | |
![[SND]](/icons/sound2.gif) | levanter.mp3 | 18-Apr-2007 22:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | levator.mp3 | 18-Apr-2007 22:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | levity.mp3 | 18-Apr-2007 22:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | libeler.mp3 | 18-Apr-2007 22:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | liberate.mp3 | 18-Apr-2007 22:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | lichenous.mp3 | 18-Apr-2007 22:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | lidar.mp3 | 18-Apr-2007 22:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | lieutenant.mp3 | 18-Apr-2007 22:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | liftable.mp3 | 18-Apr-2007 22:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | lignitic.mp3 | 18-Apr-2007 22:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | ligulae.mp3 | 18-Apr-2007 22:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | likely.mp3 | 18-Apr-2007 22:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | lilting.mp3 | 18-Apr-2007 22:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | limeade.mp3 | 18-Apr-2007 22:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | limelight.mp3 | 18-Apr-2007 22:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | limitable.mp3 | 18-Apr-2007 22:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | limitless.mp3 | 18-Apr-2007 22:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | limnetic.mp3 | 18-Apr-2007 22:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | limonite.mp3 | 18-Apr-2007 22:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | lintwhite.mp3 | 18-Apr-2007 22:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | lipide.mp3 | 18-Apr-2007 22:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | lipless.mp3 | 18-Apr-2007 22:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | liqueur.mp3 | 18-Apr-2007 22:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | listing.mp3 | 18-Apr-2007 22:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | live-in.mp3 | 18-Apr-2007 22:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | liveried.mp3 | 18-Apr-2007 22:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | liverish.mp3 | 18-Apr-2007 22:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | livingly.mp3 | 18-Apr-2007 22:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | localite.mp3 | 18-Apr-2007 22:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | lochan.mp3 | 18-Apr-2007 22:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | lockable.mp3 | 18-Apr-2007 22:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | locknut.mp3 | 18-Apr-2007 22:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | lockout.mp3 | 18-Apr-2007 22:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | lockram.mp3 | 18-Apr-2007 22:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | locus.mp3 | 18-Apr-2007 22:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | lodgement.mp3 | 18-Apr-2007 22:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | lodgment.mp3 | 18-Apr-2007 22:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | loge.mp3 | 18-Apr-2007 22:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | logia.mp3 | 18-Apr-2007 22:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | loiterer.mp3 | 18-Apr-2007 23:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | lonesome.mp3 | 18-Apr-2007 23:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | lorica.mp3 | 18-Apr-2007 23:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | lossy.mp3 | 18-Apr-2007 23:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | louden.mp3 | 18-Apr-2007 23:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | lovably.mp3 | 18-Apr-2007 23:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | love-in.mp3 | 18-Apr-2007 23:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | lovely.mp3 | 18-Apr-2007 23:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | lowest.mp3 | 18-Apr-2007 23:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | lowland.mp3 | 18-Apr-2007 23:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | luau.mp3 | 18-Apr-2007 23:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | lumberman.mp3 | 18-Apr-2007 23:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | luminous.mp3 | 18-Apr-2007 23:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | lungwort.mp3 | 18-Apr-2007 23:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | lunule.mp3 | 18-Apr-2007 23:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | lustrate.mp3 | 18-Apr-2007 23:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | lwei.mp3 | 18-Apr-2007 23:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | lyart.mp3 | 18-Apr-2007 23:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | lyrically.mp3 | 18-Apr-2007 23:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | lysate.mp3 | 18-Apr-2007 23:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | lyse.mp3 | 18-Apr-2007 23:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | lytically.mp3 | 18-Apr-2007 23:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | La'youn.mp3 | 18-Apr-2007 21:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | La Follette.mp3 | 18-Apr-2007 20:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | LaSalle.mp3 | 18-Apr-2007 21:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | La Verne.mp3 | 18-Apr-2007 20:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | Ladakhi.mp3 | 18-Apr-2007 20:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | Laingian.mp3 | 18-Apr-2007 20:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lake Charles.mp3 | 18-Apr-2007 20:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lakeville.mp3 | 18-Apr-2007 20:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lammasch.mp3 | 18-Apr-2007 20:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lankester.mp3 | 18-Apr-2007 20:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | Laputan.mp3 | 18-Apr-2007 21:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lassalle.mp3 | 18-Apr-2007 21:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | Latin.mp3 | 18-Apr-2007 21:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | Laughlin.mp3 | 18-Apr-2007 21:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | Le Havre.mp3 | 18-Apr-2007 21:23 | 7.3K | |
![[SND]](/icons/sound2.gif) | Le Maine.mp3 | 18-Apr-2007 21:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | Leipzig.mp3 | 18-Apr-2007 21:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lenard.mp3 | 18-Apr-2007 21:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lenexa.mp3 | 18-Apr-2007 21:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | Leominster.mp3 | 18-Apr-2007 21:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | Liassic.mp3 | 18-Apr-2007 22:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | Libanus.mp3 | 18-Apr-2007 22:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | Liepaja.mp3 | 18-Apr-2007 22:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lisburn.mp3 | 18-Apr-2007 22:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lisburne, Cape.mp3 | 18-Apr-2007 22:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | Littre.mp3 | 18-Apr-2007 22:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | Loange.mp3 | 18-Apr-2007 22:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lobos, Point.mp3 | 18-Apr-2007 22:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | Loreto.mp3 | 18-Apr-2007 23:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lucifer.mp3 | 18-Apr-2007 23:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | Luganda.mp3 | 18-Apr-2007 23:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lugano.mp3 | 18-Apr-2007 23:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | Luneville.mp3 | 18-Apr-2007 23:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lurex.mp3 | 18-Apr-2007 23:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lydgate.mp3 | 18-Apr-2007 23:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lynnwood.mp3 | 18-Apr-2007 23:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | Lynwood.mp3 | 18-Apr-2007 23:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | labarum.mp3 | 18-Apr-2007 20:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | laburnum.mp3 | 18-Apr-2007 20:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | laceless.mp3 | 18-Apr-2007 20:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | lacelike.mp3 | 18-Apr-2007 20:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | lackaday.mp3 | 18-Apr-2007 20:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | lacquering.mp3 | 18-Apr-2007 20:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | lafayette.mp3 | 18-Apr-2007 20:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | laical.mp3 | 18-Apr-2007 20:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | lairdly.mp3 | 18-Apr-2007 20:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | laitance.mp3 | 18-Apr-2007 20:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | laminate.mp3 | 18-Apr-2007 20:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | langue d'oc.mp3 | 18-Apr-2007 20:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | lapel.mp3 | 18-Apr-2007 21:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | laptop.mp3 | 18-Apr-2007 21:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | largo.mp3 | 18-Apr-2007 21:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | lasagna.mp3 | 18-Apr-2007 21:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | lasagne.mp3 | 18-Apr-2007 21:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | latening.mp3 | 18-Apr-2007 21:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | latherer.mp3 | 18-Apr-2007 21:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | latish.mp3 | 18-Apr-2007 21:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | lats.mp3 | 18-Apr-2007 21:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | launderette.mp3 | 18-Apr-2007 21:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | layoff.mp3 | 18-Apr-2007 21:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | leadership.mp3 | 18-Apr-2007 21:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | lead off.mp3 | 18-Apr-2007 21:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | leaflike.mp3 | 18-Apr-2007 21:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | leakproof.mp3 | 18-Apr-2007 21:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | leaseback.mp3 | 18-Apr-2007 21:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | leathery.mp3 | 18-Apr-2007 21:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | leg-pull.mp3 | 18-Apr-2007 21:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | legacy.mp3 | 18-Apr-2007 21:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | leone.mp3 | 18-Apr-2007 21:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | lesion.mp3 | 18-Apr-2007 21:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | lessening.mp3 | 18-Apr-2007 21:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | leucitic.mp3 | 18-Apr-2007 21:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | levigate.mp3 | 18-Apr-2007 22:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | libido.mp3 | 18-Apr-2007 22:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | libretto.mp3 | 18-Apr-2007 22:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | lifeboat.mp3 | 18-Apr-2007 22:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | lifeful.mp3 | 18-Apr-2007 22:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | liftgate.mp3 | 18-Apr-2007 22:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | lightweight.mp3 | 18-Apr-2007 22:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | ligure.mp3 | 18-Apr-2007 22:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | limbless.mp3 | 18-Apr-2007 22:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | limpidly.mp3 | 18-Apr-2007 22:23 | 7.3K | |
![[SND]](/icons/sound2.gif) | lindane.mp3 | 18-Apr-2007 22:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | lip-read.mp3 | 18-Apr-2007 22:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | lisente.mp3 | 18-Apr-2007 22:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | lissom.mp3 | 18-Apr-2007 22:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | lissome.mp3 | 18-Apr-2007 22:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | listless.mp3 | 18-Apr-2007 22:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | litai.mp3 | 18-Apr-2007 22:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | litigator.mp3 | 18-Apr-2007 22:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | litigious.mp3 | 18-Apr-2007 22:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | littleness.mp3 | 18-Apr-2007 22:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | livening.mp3 | 18-Apr-2007 22:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | liverwort.mp3 | 18-Apr-2007 22:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | lobated.mp3 | 18-Apr-2007 22:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | lobular.mp3 | 18-Apr-2007 22:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | locomote.mp3 | 18-Apr-2007 22:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | locust.mp3 | 18-Apr-2007 22:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | logbook.mp3 | 18-Apr-2007 22:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | logged.mp3 | 18-Apr-2007 22:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | logical.mp3 | 18-Apr-2007 22:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | lonely.mp3 | 18-Apr-2007 23:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | loopily.mp3 | 18-Apr-2007 23:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | lordly.mp3 | 18-Apr-2007 23:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | lordotic.mp3 | 18-Apr-2007 23:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | lottery.mp3 | 18-Apr-2007 23:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | loveless.mp3 | 18-Apr-2007 23:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | lowboy.mp3 | 18-Apr-2007 23:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | lowery.mp3 | 18-Apr-2007 23:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | lubberly.mp3 | 18-Apr-2007 23:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | lubrical.mp3 | 18-Apr-2007 23:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | lubricant.mp3 | 18-Apr-2007 23:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | lugworm.mp3 | 18-Apr-2007 23:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | luminist.mp3 | 18-Apr-2007 23:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | lupanar.mp3 | 18-Apr-2007 23:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | lustrous.mp3 | 18-Apr-2007 23:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | L'vov.mp3 | 18-Apr-2007 23:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | La Crosse.mp3 | 18-Apr-2007 20:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | La Guaira.mp3 | 18-Apr-2007 20:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | La Habra.mp3 | 18-Apr-2007 20:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | La Manche.mp3 | 18-Apr-2007 20:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | La Mirada.mp3 | 18-Apr-2007 20:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | La Tene.mp3 | 18-Apr-2007 20:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lake Elsinore.mp3 | 18-Apr-2007 20:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lake Leman.mp3 | 18-Apr-2007 20:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lammermoor.mp3 | 18-Apr-2007 20:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | Laptev Sea.mp3 | 18-Apr-2007 21:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lassen Peak.mp3 | 18-Apr-2007 21:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | Latinate.mp3 | 18-Apr-2007 21:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | Latino.mp3 | 18-Apr-2007 21:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | Leamington.mp3 | 18-Apr-2007 21:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lefebvre.mp3 | 18-Apr-2007 21:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | Leger.mp3 | 18-Apr-2007 21:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lemberg.mp3 | 18-Apr-2007 21:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lepidus.mp3 | 18-Apr-2007 21:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lesage.mp3 | 18-Apr-2007 21:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | Limburger.mp3 | 18-Apr-2007 22:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lindleyan.mp3 | 18-Apr-2007 22:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lisztian.mp3 | 18-Apr-2007 22:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | Livingston.mp3 | 18-Apr-2007 22:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lockeian.mp3 | 18-Apr-2007 22:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | Locris.mp3 | 18-Apr-2007 22:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lollardy.mp3 | 18-Apr-2007 23:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lomax.mp3 | 18-Apr-2007 23:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lomond, Ben.mp3 | 18-Apr-2007 23:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lompoc.mp3 | 18-Apr-2007 23:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | Longford.mp3 | 18-Apr-2007 23:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | Loubet.mp3 | 18-Apr-2007 23:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lowestoft.mp3 | 18-Apr-2007 23:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | Luangue.mp3 | 18-Apr-2007 23:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | Luchow.mp3 | 18-Apr-2007 23:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lucite.mp3 | 18-Apr-2007 23:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lucretian.mp3 | 18-Apr-2007 23:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lucullan.mp3 | 18-Apr-2007 23:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | Luttelton.mp3 | 18-Apr-2007 23:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | Luzon.mp3 | 18-Apr-2007 23:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lwow.mp3 | 18-Apr-2007 23:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lycian.mp3 | 18-Apr-2007 23:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | Lysias.mp3 | 18-Apr-2007 23:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | labelling.mp3 | 18-Apr-2007 20:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | lacewing.mp3 | 18-Apr-2007 20:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | lactate.mp3 | 18-Apr-2007 20:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | lactonic.mp3 | 18-Apr-2007 20:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | lagoonal.mp3 | 18-Apr-2007 20:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | lamblike.mp3 | 18-Apr-2007 20:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | lamster.mp3 | 18-Apr-2007 20:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | landing.mp3 | 18-Apr-2007 20:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | language.mp3 | 18-Apr-2007 20:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | langur.mp3 | 18-Apr-2007 20:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | lanugo.mp3 | 18-Apr-2007 21:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | largely.mp3 | 18-Apr-2007 21:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | lashing.mp3 | 18-Apr-2007 21:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | lashings.mp3 | 18-Apr-2007 21:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | lasso.mp3 | 18-Apr-2007 21:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | latewood.mp3 | 18-Apr-2007 21:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | latigo.mp3 | 18-Apr-2007 21:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | lauan.mp3 | 18-Apr-2007 21:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | launderer.mp3 | 18-Apr-2007 21:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | laundering.mp3 | 18-Apr-2007 21:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | laundry.mp3 | 18-Apr-2007 21:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | lazily.mp3 | 18-Apr-2007 21:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | lead-in.mp3 | 18-Apr-2007 21:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | leadless.mp3 | 18-Apr-2007 21:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | leadoff.mp3 | 18-Apr-2007 21:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | leafless.mp3 | 18-Apr-2007 21:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | leally.mp3 | 18-Apr-2007 21:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | learnable.mp3 | 18-Apr-2007 21:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | leathering.mp3 | 18-Apr-2007 21:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | lecturing.mp3 | 18-Apr-2007 21:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | leeringly.mp3 | 18-Apr-2007 21:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | leftish.mp3 | 18-Apr-2007 21:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | leftward.mp3 | 18-Apr-2007 21:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | legator.mp3 | 18-Apr-2007 21:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | legendry.mp3 | 18-Apr-2007 21:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | lemniscate.mp3 | 18-Apr-2007 21:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | leprechaun.mp3 | 18-Apr-2007 21:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | lepta.mp3 | 18-Apr-2007 21:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | lesioned.mp3 | 18-Apr-2007 21:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | leverage.mp3 | 18-Apr-2007 22:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | levitate.mp3 | 18-Apr-2007 22:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | lexemic.mp3 | 18-Apr-2007 22:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | lexical.mp3 | 18-Apr-2007 22:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | liberty.mp3 | 18-Apr-2007 22:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | lidless.mp3 | 18-Apr-2007 22:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | lie-in.mp3 | 18-Apr-2007 22:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | lierne.mp3 | 18-Apr-2007 22:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | ligature.mp3 | 18-Apr-2007 22:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | light-headed.mp3 | 18-Apr-2007 22:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | light-year.mp3 | 18-Apr-2007 22:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | lighterage.mp3 | 18-Apr-2007 22:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | lightwood.mp3 | 18-Apr-2007 22:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | limbering.mp3 | 18-Apr-2007 22:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | limonene.mp3 | 18-Apr-2007 22:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | lineage.mp3 | 18-Apr-2007 22:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | linecut.mp3 | 18-Apr-2007 22:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | linocut.mp3 | 18-Apr-2007 22:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | liquidate.mp3 | 18-Apr-2007 22:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | listee.mp3 | 18-Apr-2007 22:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | lobster.mp3 | 18-Apr-2007 22:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | lobule.mp3 | 18-Apr-2007 22:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | locksmith.mp3 | 18-Apr-2007 22:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | locule.mp3 | 18-Apr-2007 22:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | log-in.mp3 | 18-Apr-2007 22:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | longan.mp3 | 18-Apr-2007 23:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | longboat.mp3 | 18-Apr-2007 23:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | longness.mp3 | 18-Apr-2007 23:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | loreal.mp3 | 18-Apr-2007 23:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | loverly.mp3 | 18-Apr-2007 23:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | lovesick.mp3 | 18-Apr-2007 23:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | lovesome.mp3 | 18-Apr-2007 23:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | low-end.mp3 | 18-Apr-2007 23:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | lowlife.mp3 | 18-Apr-2007 23:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | ls.mp3 | 18-Apr-2007 23:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | lungful.mp3 | 18-Apr-2007 23:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | lunkhead.mp3 | 18-Apr-2007 23:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | lustfully.mp3 | 18-Apr-2007 23:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | lustring.mp3 | 18-Apr-2007 23:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | lyase.mp3 | 18-Apr-2007 23:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | lychnis.mp3 | 18-Apr-2007 23:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | lymphoid.mp3 | 18-Apr-2007 23:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | lymphoma.mp3 | 18-Apr-2007 23:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | lyrism.mp3 | 18-Apr-2007 23:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | lysine.mp3 | 18-Apr-2007 23:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | La Farge.mp3 | 18-Apr-2007 20:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lacan.mp3 | 18-Apr-2007 20:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | Laccadive Islands.mp3 | 18-Apr-2007 20:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | Ladrone Islands.mp3 | 18-Apr-2007 20:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lake Havasu City.mp3 | 18-Apr-2007 20:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lake Nyasa.mp3 | 18-Apr-2007 20:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lake of Gennesaret.mp3 | 18-Apr-2007 20:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | Langmuir.mp3 | 18-Apr-2007 20:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | Laundromat.mp3 | 18-Apr-2007 21:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | Laurasia.mp3 | 18-Apr-2007 21:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lausanne.mp3 | 18-Apr-2007 21:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | Laysan.mp3 | 18-Apr-2007 21:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | Le Gallienne.mp3 | 18-Apr-2007 21:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lecce.mp3 | 18-Apr-2007 21:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | Leeuwenhoek.mp3 | 18-Apr-2007 21:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lemnos.mp3 | 18-Apr-2007 21:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | Leninite.mp3 | 18-Apr-2007 21:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lewiston.mp3 | 18-Apr-2007 22:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lewisville.mp3 | 18-Apr-2007 22:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | Librium.mp3 | 18-Apr-2007 22:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | Limburg.mp3 | 18-Apr-2007 22:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | Limoges.mp3 | 18-Apr-2007 22:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lingayat.mp3 | 18-Apr-2007 22:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lipchitz.mp3 | 18-Apr-2007 22:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | Little Rock.mp3 | 18-Apr-2007 22:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Livonia.mp3 | 18-Apr-2007 22:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lobito.mp3 | 18-Apr-2007 22:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lombok.mp3 | 18-Apr-2007 23:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lothringen.mp3 | 18-Apr-2007 23:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | Loughborough.mp3 | 18-Apr-2007 23:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lovelace.mp3 | 18-Apr-2007 23:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lu-ta.mp3 | 18-Apr-2007 23:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lucania, Mount.mp3 | 18-Apr-2007 23:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lucknow.mp3 | 18-Apr-2007 23:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | Luneburg.mp3 | 18-Apr-2007 23:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | Lyonais.mp3 | 18-Apr-2007 23:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | laborite.mp3 | 18-Apr-2007 20:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | laccolith.mp3 | 18-Apr-2007 20:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | lacework.mp3 | 18-Apr-2007 20:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | laches.mp3 | 18-Apr-2007 20:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | lachrymal.mp3 | 18-Apr-2007 20:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | lacquerer.mp3 | 18-Apr-2007 20:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | lacquerwork.mp3 | 18-Apr-2007 20:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | lacrimal.mp3 | 18-Apr-2007 20:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | lacunas.mp3 | 18-Apr-2007 20:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | ladder-back.mp3 | 18-Apr-2007 20:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | ladderlike.mp3 | 18-Apr-2007 20:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | ladening.mp3 | 18-Apr-2007 20:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | lamplight.mp3 | 18-Apr-2007 20:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | landau.mp3 | 18-Apr-2007 20:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | landmark.mp3 | 18-Apr-2007 20:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | landward.mp3 | 18-Apr-2007 20:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | languish.mp3 | 18-Apr-2007 20:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | lanneret.mp3 | 18-Apr-2007 20:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | lantern.mp3 | 18-Apr-2007 20:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | lanthanum.mp3 | 18-Apr-2007 20:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | lanthorn.mp3 | 18-Apr-2007 20:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | lapilli.mp3 | 18-Apr-2007 21:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | lapillus.mp3 | 18-Apr-2007 21:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | larcener.mp3 | 18-Apr-2007 21:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | lase.mp3 | 18-Apr-2007 21:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | lashins.mp3 | 18-Apr-2007 21:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | lasting.mp3 | 18-Apr-2007 21:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | laterite.mp3 | 18-Apr-2007 21:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | lateritic.mp3 | 18-Apr-2007 21:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | latex.mp3 | 18-Apr-2007 21:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | lathery.mp3 | 18-Apr-2007 21:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | lati.mp3 | 18-Apr-2007 21:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | latticework.mp3 | 18-Apr-2007 21:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | lavish.mp3 | 18-Apr-2007 21:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | lavrock.mp3 | 18-Apr-2007 21:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | lawless.mp3 | 18-Apr-2007 21:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | laxly.mp3 | 18-Apr-2007 21:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | layabout.mp3 | 18-Apr-2007 21:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | layman.mp3 | 18-Apr-2007 21:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | leanness.mp3 | 18-Apr-2007 21:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | learnedly.mp3 | 18-Apr-2007 21:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | leatherback.mp3 | 18-Apr-2007 21:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | lechwe.mp3 | 18-Apr-2007 21:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | lectern.mp3 | 18-Apr-2007 21:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | lectotype.mp3 | 18-Apr-2007 21:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | lecturer.mp3 | 18-Apr-2007 21:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | leges.mp3 | 18-Apr-2007 21:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | leghorn.mp3 | 18-Apr-2007 21:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | legionnaire.mp3 | 18-Apr-2007 21:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | legroom.mp3 | 18-Apr-2007 21:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | legume.mp3 | 18-Apr-2007 21:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | lenitive.mp3 | 18-Apr-2007 21:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | lethargy.mp3 | 18-Apr-2007 21:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | letterhead.mp3 | 18-Apr-2007 21:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | leucine.mp3 | 18-Apr-2007 21:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | leukemic.mp3 | 18-Apr-2007 21:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | leveraged.mp3 | 18-Apr-2007 22:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | lexeme.mp3 | 18-Apr-2007 22:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | liege.mp3 | 18-Apr-2007 22:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | lifeless.mp3 | 18-Apr-2007 22:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | lifelike.mp3 | 18-Apr-2007 22:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | liftoff.mp3 | 18-Apr-2007 22:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | light-handed.mp3 | 18-Apr-2007 22:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | lightproof.mp3 | 18-Apr-2007 22:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | lightsome.mp3 | 18-Apr-2007 22:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | lighttight.mp3 | 18-Apr-2007 22:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | ligneous.mp3 | 18-Apr-2007 22:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | liltingly.mp3 | 18-Apr-2007 22:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | limpidity.mp3 | 18-Apr-2007 22:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | limulus.mp3 | 18-Apr-2007 22:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | linerless.mp3 | 18-Apr-2007 22:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | lingerer.mp3 | 18-Apr-2007 22:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | lingering.mp3 | 18-Apr-2007 22:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | linguae.mp3 | 18-Apr-2007 22:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | lioness.mp3 | 18-Apr-2007 22:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | listenable.mp3 | 18-Apr-2007 22:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | literally.mp3 | 18-Apr-2007 22:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | literator.mp3 | 18-Apr-2007 22:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | lithe.mp3 | 18-Apr-2007 22:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | litterbug.mp3 | 18-Apr-2007 22:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | littleneck.mp3 | 18-Apr-2007 22:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | littlest.mp3 | 18-Apr-2007 22:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | lives.mp3 | 18-Apr-2007 22:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | lividity.mp3 | 18-Apr-2007 22:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | lobulate.mp3 | 18-Apr-2007 22:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | locater.mp3 | 18-Apr-2007 22:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | locator.mp3 | 18-Apr-2007 22:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | lockstep.mp3 | 18-Apr-2007 22:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | loessial.mp3 | 18-Apr-2007 22:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | loggia.mp3 | 18-Apr-2007 22:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | longest.mp3 | 18-Apr-2007 23:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | longish.mp3 | 18-Apr-2007 23:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | longneck.mp3 | 18-Apr-2007 23:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | loophole.mp3 | 18-Apr-2007 23:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | lordship.mp3 | 18-Apr-2007 23:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | louses.mp3 | 18-Apr-2007 23:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | lousewort.mp3 | 18-Apr-2007 23:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | lowball.mp3 | 18-Apr-2007 23:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | lowlander.mp3 | 18-Apr-2007 23:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | lubricate.mp3 | 18-Apr-2007 23:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | luculent.mp3 | 18-Apr-2007 23:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | lullaby.mp3 | 18-Apr-2007 23:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | luminaire.mp3 | 18-Apr-2007 23:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | luminary.mp3 | 18-Apr-2007 23:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | lustily.mp3 | 18-Apr-2007 23:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | lutefisk.mp3 | 18-Apr-2007 23:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | lych-gate.mp3 | 18-Apr-2007 23:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | lyddite.mp3 | 18-Apr-2007 23:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | lyses.mp3 | 18-Apr-2007 23:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | Landseer.mp3 | 18-Apr-2007 20:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | Laotian.mp3 | 18-Apr-2007 21:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lapland.mp3 | 18-Apr-2007 21:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lares.mp3 | 18-Apr-2007 21:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Launfal.mp3 | 18-Apr-2007 21:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | Laurier.mp3 | 18-Apr-2007 21:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | Leavisite.mp3 | 18-Apr-2007 21:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | Leeuwarden.mp3 | 18-Apr-2007 21:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | Leixoes.mp3 | 18-Apr-2007 21:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | Leninist.mp3 | 18-Apr-2007 21:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Leopold I.mp3 | 18-Apr-2007 21:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lesseps.mp3 | 18-Apr-2007 21:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Levantine.mp3 | 18-Apr-2007 22:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | Levis.mp3 | 18-Apr-2007 22:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | Levitical.mp3 | 18-Apr-2007 22:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lichfield.mp3 | 18-Apr-2007 22:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lidice.mp3 | 18-Apr-2007 22:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Linnaeus.mp3 | 18-Apr-2007 22:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lippmann.mp3 | 18-Apr-2007 22:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | Locrian.mp3 | 18-Apr-2007 22:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Loiza.mp3 | 18-Apr-2007 23:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | Longmont.mp3 | 18-Apr-2007 23:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lugansk.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | Lysippus.mp3 | 18-Apr-2007 23:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | laban.mp3 | 18-Apr-2007 20:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | labdanum.mp3 | 18-Apr-2007 20:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | labiche.mp3 | 18-Apr-2007 20:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | labour.mp3 | 18-Apr-2007 20:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | labra.mp3 | 18-Apr-2007 20:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lacker.mp3 | 18-Apr-2007 20:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | laclos.mp3 | 18-Apr-2007 20:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | lacquey.mp3 | 18-Apr-2007 20:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | lacrosse.mp3 | 18-Apr-2007 20:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | lactone.mp3 | 18-Apr-2007 20:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lacustrine.mp3 | 18-Apr-2007 20:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | lada.mp3 | 18-Apr-2007 20:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | ladoga.mp3 | 18-Apr-2007 20:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | ladon.mp3 | 18-Apr-2007 20:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | ladybug.mp3 | 18-Apr-2007 20:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | ladyship.mp3 | 18-Apr-2007 20:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | laevo.mp3 | 18-Apr-2007 20:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | laff.mp3 | 18-Apr-2007 20:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | lagged.mp3 | 18-Apr-2007 20:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | lagger.mp3 | 18-Apr-2007 20:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | laggin.mp3 | 18-Apr-2007 20:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | laguna.mp3 | 18-Apr-2007 20:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lagune.mp3 | 18-Apr-2007 20:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lah.mp3 | 18-Apr-2007 20:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lai.mp3 | 18-Apr-2007 20:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | laibach.mp3 | 18-Apr-2007 20:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | laigh.mp3 | 18-Apr-2007 20:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | laik.mp3 | 18-Apr-2007 20:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | laika.mp3 | 18-Apr-2007 20:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | lairy.mp3 | 18-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | laith.mp3 | 18-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lajolla.mp3 | 18-Apr-2007 20:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lakeside.mp3 | 18-Apr-2007 20:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | lalia.mp3 | 18-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | lall.mp3 | 18-Apr-2007 20:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | lalo.mp3 | 18-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamar.mp3 | 18-Apr-2007 20:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lambie.mp3 | 18-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lambing.mp3 | 18-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lambkill.mp3 | 18-Apr-2007 20:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamech.mp3 | 18-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamell.mp3 | 18-Apr-2007 20:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamin.mp3 | 18-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | laminated.mp3 | 18-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | laminator.mp3 | 18-Apr-2007 20:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamish.mp3 | 18-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamont.mp3 | 18-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamoureux.mp3 | 18-Apr-2007 20:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamus.mp3 | 18-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamut.mp3 | 18-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | lamy.mp3 | 18-Apr-2007 20:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | lana.mp3 | 18-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lanceted.mp3 | 18-Apr-2007 20:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lande.mp3 | 18-Apr-2007 20:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | landler.mp3 | 18-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | landlubber.mp3 | 18-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | lando.mp3 | 18-Apr-2007 20:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | laneway.mp3 | 18-Apr-2007 20:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | langued.mp3 | 18-Apr-2007 20:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | languorous.mp3 | 18-Apr-2007 20:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | lanny.mp3 | 18-Apr-2007 20:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | lansa.mp3 | 18-Apr-2007 20:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapalma.mp3 | 18-Apr-2007 21:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapar.mp3 | 18-Apr-2007 21:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapboard.mp3 | 18-Apr-2007 21:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapith.mp3 | 18-Apr-2007 21:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapper.mp3 | 18-Apr-2007 21:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapping.mp3 | 18-Apr-2007 21:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapsed.mp3 | 18-Apr-2007 21:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | lapwing.mp3 | 18-Apr-2007 21:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | larbaud.mp3 | 18-Apr-2007 21:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | larceny.mp3 | 18-Apr-2007 21:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | lardon.mp3 | 18-Apr-2007 21:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | lare.mp3 | 18-Apr-2007 21:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | laree.mp3 | 18-Apr-2007 21:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | larine.mp3 | 18-Apr-2007 21:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | larmen.mp3 | 18-Apr-2007 21:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | larn.mp3 | 18-Apr-2007 21:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | larry.mp3 | 18-Apr-2007 21:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | lars.mp3 | 18-Apr-2007 21:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | larsa.mp3 | 18-Apr-2007 21:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | larvi.mp3 | 18-Apr-2007 21:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | larynx.mp3 | 18-Apr-2007 21:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | lasa.mp3 | 18-Apr-2007 21:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | lashed.mp3 | 18-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | lashio.mp3 | 18-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | lashkar.mp3 | 18-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | lasker.mp3 | 18-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | lassa.mp3 | 18-Apr-2007 21:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | lata.mp3 | 18-Apr-2007 21:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | latah.mp3 | 18-Apr-2007 21:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | latecomer.mp3 | 18-Apr-2007 21:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | latency.mp3 | 18-Apr-2007 21:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | latene.mp3 | 18-Apr-2007 21:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | latrine.mp3 | 18-Apr-2007 21:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | latu.mp3 | 18-Apr-2007 21:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | laundress.mp3 | 18-Apr-2007 21:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | lauretta.mp3 | 18-Apr-2007 21:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | laurie.mp3 | 18-Apr-2007 21:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lauzon.mp3 | 18-Apr-2007 21:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lav.mp3 | 18-Apr-2007 21:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lavabo.mp3 | 18-Apr-2007 21:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lavage.mp3 | 18-Apr-2007 21:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lawyering.mp3 | 18-Apr-2007 21:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | lawyerlike.mp3 | 18-Apr-2007 21:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | layed.mp3 | 18-Apr-2007 21:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | layerage.mp3 | 18-Apr-2007 21:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | lays.mp3 | 18-Apr-2007 21:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | le.mp3 | 18-Apr-2007 21:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | leaded.mp3 | 18-Apr-2007 21:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | leadplant.mp3 | 18-Apr-2007 21:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | leadscrew.mp3 | 18-Apr-2007 21:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | leafstalk.mp3 | 18-Apr-2007 21:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | leag.mp3 | 18-Apr-2007 21:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | leah.mp3 | 18-Apr-2007 21:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | leaner.mp3 | 18-Apr-2007 21:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | leapfrog.mp3 | 18-Apr-2007 21:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | learner.mp3 | 18-Apr-2007 21:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | leatherlike.mp3 | 18-Apr-2007 21:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | leatherwork.mp3 | 18-Apr-2007 21:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | leavening.mp3 | 18-Apr-2007 21:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | leaver.mp3 | 18-Apr-2007 21:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | leavy.mp3 | 18-Apr-2007 21:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | leb.mp3 | 18-Apr-2007 21:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | leben.mp3 | 18-Apr-2007 21:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | leccer.mp3 | 18-Apr-2007 21:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | lecherous.mp3 | 18-Apr-2007 21:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | leching.mp3 | 18-Apr-2007 21:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | lecithin.mp3 | 18-Apr-2007 21:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | ledl.mp3 | 18-Apr-2007 21:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | ledoux.mp3 | 18-Apr-2007 21:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | leet.mp3 | 18-Apr-2007 21:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | leftist.mp3 | 18-Apr-2007 21:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | leftover.mp3 | 18-Apr-2007 21:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | legato.mp3 | 18-Apr-2007 21:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | legger.mp3 | 18-Apr-2007 21:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | leggs.mp3 | 18-Apr-2007 21:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | legionary.mp3 | 18-Apr-2007 21:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | lego.mp3 | 18-Apr-2007 21:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | lehr.mp3 | 18-Apr-2007 21:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | leica.mp3 | 18-Apr-2007 21:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | leiden.mp3 | 18-Apr-2007 21:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | leigh.mp3 | 18-Apr-2007 21:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | leisured.mp3 | 18-Apr-2007 21:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | leisurely.mp3 | 18-Apr-2007 21:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | lekker.mp3 | 18-Apr-2007 21:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lela.mp3 | 18-Apr-2007 21:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lem.mp3 | 18-Apr-2007 21:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lemans.mp3 | 18-Apr-2007 21:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lemme.mp3 | 18-Apr-2007 21:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lemmon.mp3 | 18-Apr-2007 21:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | lemo.mp3 | 18-Apr-2007 21:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | len.mp3 | 18-Apr-2007 21:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | lenca.mp3 | 18-Apr-2007 21:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | lendl.mp3 | 18-Apr-2007 21:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | lengthener.mp3 | 18-Apr-2007 21:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | lenition.mp3 | 18-Apr-2007 21:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lenny.mp3 | 18-Apr-2007 21:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lenore.mp3 | 18-Apr-2007 21:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lensless.mp3 | 18-Apr-2007 21:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lensman.mp3 | 18-Apr-2007 21:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lenya.mp3 | 18-Apr-2007 21:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | leona.mp3 | 18-Apr-2007 21:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | lep.mp3 | 18-Apr-2007 21:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | lepper.mp3 | 18-Apr-2007 21:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | leppy.mp3 | 18-Apr-2007 21:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lepra.mp3 | 18-Apr-2007 21:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | leprosy.mp3 | 18-Apr-2007 21:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | ler.mp3 | 18-Apr-2007 21:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lergi.mp3 | 18-Apr-2007 21:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lerna.mp3 | 18-Apr-2007 21:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | les.mp3 | 18-Apr-2007 21:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lesgueux.mp3 | 18-Apr-2007 21:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | leso.mp3 | 18-Apr-2007 21:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | leta.mp3 | 18-Apr-2007 21:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | letha.mp3 | 18-Apr-2007 21:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | lethally.mp3 | 18-Apr-2007 21:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | lets.mp3 | 18-Apr-2007 21:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | letted.mp3 | 18-Apr-2007 21:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | lettic.mp3 | 18-Apr-2007 21:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | lettie.mp3 | 18-Apr-2007 21:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | letting.mp3 | 18-Apr-2007 21:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | letty.mp3 | 18-Apr-2007 21:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | leuc.mp3 | 18-Apr-2007 21:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | leucas.mp3 | 18-Apr-2007 21:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | leud.mp3 | 18-Apr-2007 21:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | leuk.mp3 | 18-Apr-2007 21:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | leukas.mp3 | 18-Apr-2007 21:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | leukocyte.mp3 | 18-Apr-2007 21:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | leukocytic.mp3 | 18-Apr-2007 21:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | levau.mp3 | 18-Apr-2007 22:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | levelness.mp3 | 18-Apr-2007 22:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | leven.mp3 | 18-Apr-2007 22:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | leviable.mp3 | 18-Apr-2007 22:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | leviratic.mp3 | 18-Apr-2007 22:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | lew.mp3 | 18-Apr-2007 22:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | lez.mp3 | 18-Apr-2007 22:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | lezzie.mp3 | 18-Apr-2007 22:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | li.mp3 | 18-Apr-2007 22:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | lia.mp3 | 18-Apr-2007 22:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | liaise.mp3 | 18-Apr-2007 22:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | libe.mp3 | 18-Apr-2007 22:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | libelling.mp3 | 18-Apr-2007 22:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | liber.mp3 | 18-Apr-2007 22:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | libera.mp3 | 18-Apr-2007 22:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | liberator.mp3 | 18-Apr-2007 22:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | libia.mp3 | 18-Apr-2007 22:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | libid.mp3 | 18-Apr-2007 22:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | libor.mp3 | 18-Apr-2007 22:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | licet.mp3 | 18-Apr-2007 22:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | lich.mp3 | 18-Apr-2007 22:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | liddel.mp3 | 18-Apr-2007 22:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | lidia.mp3 | 18-Apr-2007 22:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | lieve.mp3 | 18-Apr-2007 22:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | lifeway.mp3 | 18-Apr-2007 22:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | lig.mp3 | 18-Apr-2007 22:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | ligger.mp3 | 18-Apr-2007 22:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | light-footed.mp3 | 18-Apr-2007 22:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | lign.mp3 | 18-Apr-2007 22:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | ligne.mp3 | 18-Apr-2007 22:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | ligni.mp3 | 18-Apr-2007 22:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | likker.mp3 | 18-Apr-2007 22:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lil.mp3 | 18-Apr-2007 22:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lili.mp3 | 18-Apr-2007 22:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | lilly.mp3 | 18-Apr-2007 22:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | limekiln.mp3 | 18-Apr-2007 22:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | limes.mp3 | 18-Apr-2007 22:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | limina.mp3 | 18-Apr-2007 22:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | limiter.mp3 | 18-Apr-2007 22:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | limitrophe.mp3 | 18-Apr-2007 22:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | limmy.mp3 | 18-Apr-2007 22:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | limpen.mp3 | 18-Apr-2007 22:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | lina.mp3 | 18-Apr-2007 22:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | linda.mp3 | 18-Apr-2007 22:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | lindt.mp3 | 18-Apr-2007 22:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | linesman.mp3 | 18-Apr-2007 22:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | lingoe.mp3 | 18-Apr-2007 22:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | lings.mp3 | 18-Apr-2007 22:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | lingu.mp3 | 18-Apr-2007 22:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | linhay.mp3 | 18-Apr-2007 22:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | linkboy.mp3 | 18-Apr-2007 22:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | linker.mp3 | 18-Apr-2007 22:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | linksman.mp3 | 18-Apr-2007 22:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | linnhe.mp3 | 18-Apr-2007 22:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | lins.mp3 | 18-Apr-2007 22:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | linstock.mp3 | 18-Apr-2007 22:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lintie.mp3 | 18-Apr-2007 22:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lintless.mp3 | 18-Apr-2007 22:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | linus.mp3 | 18-Apr-2007 22:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | liny.mp3 | 18-Apr-2007 22:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lions.mp3 | 18-Apr-2007 22:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | lip-reader.mp3 | 18-Apr-2007 22:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | lip-reading.mp3 | 18-Apr-2007 22:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | lipo.mp3 | 18-Apr-2007 22:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | lipper.mp3 | 18-Apr-2007 22:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | lippie.mp3 | 18-Apr-2007 22:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | liquescent.mp3 | 18-Apr-2007 22:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | liquidus.mp3 | 18-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | liquorice.mp3 | 18-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | liquorish.mp3 | 18-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | lir.mp3 | 18-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | lirella.mp3 | 18-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | liripipe.mp3 | 18-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | lisa.mp3 | 18-Apr-2007 22:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lise.mp3 | 18-Apr-2007 22:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lisse.mp3 | 18-Apr-2007 22:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lists.mp3 | 18-Apr-2007 22:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | literacy.mp3 | 18-Apr-2007 22:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | literatim.mp3 | 18-Apr-2007 22:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | lith.mp3 | 18-Apr-2007 22:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | lithia.mp3 | 18-Apr-2007 22:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | lithoid.mp3 | 18-Apr-2007 22:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | lithotomy.mp3 | 18-Apr-2007 22:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | lithy.mp3 | 18-Apr-2007 22:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lived-in.mp3 | 18-Apr-2007 22:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | livein.mp3 | 18-Apr-2007 22:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | livelong.mp3 | 18-Apr-2007 22:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | livered.mp3 | 18-Apr-2007 22:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | liveyer.mp3 | 18-Apr-2007 22:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | liz.mp3 | 18-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | liza.mp3 | 18-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lizzie.mp3 | 18-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lizzy.mp3 | 18-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | llewellyn.mp3 | 18-Apr-2007 22:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lloyd.mp3 | 18-Apr-2007 22:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lloyds.mp3 | 18-Apr-2007 22:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lludd.mp3 | 18-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | llwyd.mp3 | 18-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | llyr.mp3 | 18-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | lm.mp3 | 18-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | loader.mp3 | 18-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | loadie.mp3 | 18-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | loady.mp3 | 18-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | loanword.mp3 | 18-Apr-2007 22:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | lobber.mp3 | 18-Apr-2007 22:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | lobeline.mp3 | 18-Apr-2007 22:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lobi.mp3 | 18-Apr-2007 22:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lobolo.mp3 | 18-Apr-2007 22:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lobus.mp3 | 18-Apr-2007 22:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | loca.mp3 | 18-Apr-2007 22:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | loche.mp3 | 18-Apr-2007 22:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lochia.mp3 | 18-Apr-2007 22:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lockjaw.mp3 | 18-Apr-2007 22:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | locular.mp3 | 18-Apr-2007 22:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | lodged.mp3 | 18-Apr-2007 22:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | loe.mp3 | 18-Apr-2007 22:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | loesser.mp3 | 18-Apr-2007 22:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | loewy.mp3 | 18-Apr-2007 22:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | lofn.mp3 | 18-Apr-2007 22:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | log-on.mp3 | 18-Apr-2007 23:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | logging.mp3 | 18-Apr-2007 22:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | logi.mp3 | 18-Apr-2007 22:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | logie.mp3 | 18-Apr-2007 22:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | logue.mp3 | 18-Apr-2007 23:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | logwood.mp3 | 18-Apr-2007 23:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | loid.mp3 | 18-Apr-2007 23:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | loiret.mp3 | 18-Apr-2007 23:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | lois.mp3 | 18-Apr-2007 23:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | loja.mp3 | 18-Apr-2007 23:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | lola.mp3 | 18-Apr-2007 23:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | lolo.mp3 | 18-Apr-2007 23:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | loma.mp3 | 18-Apr-2007 23:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | lomond.mp3 | 18-Apr-2007 23:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | loneness.mp3 | 18-Apr-2007 23:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | longa.mp3 | 18-Apr-2007 23:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | longe.mp3 | 18-Apr-2007 23:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | longueur.mp3 | 18-Apr-2007 23:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | lonnie.mp3 | 18-Apr-2007 23:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | looey.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | loof.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | looie.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | look-alike.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | lookee.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | looking.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | lookit.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | looky.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | looming.mp3 | 18-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | looping.mp3 | 18-Apr-2007 23:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | loos.mp3 | 18-Apr-2007 23:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | loosening.mp3 | 18-Apr-2007 23:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | loper.mp3 | 18-Apr-2007 23:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | loph.mp3 | 18-Apr-2007 23:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | loppy.mp3 | 18-Apr-2007 23:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | lor.mp3 | 18-Apr-2007 23:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | loraine.mp3 | 18-Apr-2007 23:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | loral.mp3 | 18-Apr-2007 23:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorca.mp3 | 18-Apr-2007 23:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | loren.mp3 | 18-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorena.mp3 | 18-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | loretta.mp3 | 18-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorg.mp3 | 18-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorimer.mp3 | 18-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorin.mp3 | 18-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | loring.mp3 | 18-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorna.mp3 | 18-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorre.mp3 | 18-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | lorrie.mp3 | 18-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | losable.mp3 | 18-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | lote.mp3 | 18-Apr-2007 23:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | lothly.mp3 | 18-Apr-2007 23:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | lotta.mp3 | 18-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | lottie.mp3 | 18-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | lotze.mp3 | 18-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | lou.mp3 | 18-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | loudish.mp3 | 18-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | louella.mp3 | 18-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | louey.mp3 | 18-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | louhi.mp3 | 18-Apr-2007 23:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | louie.mp3 | 18-Apr-2007 23:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | louise.mp3 | 18-Apr-2007 23:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | loun.mp3 | 18-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | lounge.mp3 | 18-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | lounger.mp3 | 18-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | lourie.mp3 | 18-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | louring.mp3 | 18-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | loury.mp3 | 18-Apr-2007 23:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | louvar.mp3 | 18-Apr-2007 23:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | loved.mp3 | 18-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | lovejoy.mp3 | 18-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | lovelock.mp3 | 18-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | lovey.mp3 | 18-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | lovingly.mp3 | 18-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | low-tech.mp3 | 18-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | lowan.mp3 | 18-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | lowdown.mp3 | 18-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | lowrider.mp3 | 18-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | loy.mp3 | 18-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | loyd.mp3 | 18-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | loyola.mp3 | 18-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | lozenge.mp3 | 18-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | lozere.mp3 | 18-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | lozi.mp3 | 18-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | lu.mp3 | 18-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | luanne.mp3 | 18-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | luba.mp3 | 18-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | lubie.mp3 | 18-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | lubitsch.mp3 | 18-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | lubke.mp3 | 18-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | lubra.mp3 | 18-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | lubricous.mp3 | 18-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucarne.mp3 | 18-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucern.mp3 | 18-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucerne.mp3 | 18-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucia.mp3 | 18-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucian.mp3 | 18-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucida.mp3 | 18-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucidity.mp3 | 18-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucille.mp3 | 18-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | luckie.mp3 | 18-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | luckiness.mp3 | 18-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | lucy.mp3 | 18-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | lud.mp3 | 18-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | ludd.mp3 | 18-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | luderick.mp3 | 18-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | ludlow.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | ludo.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | ludwig.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | luebke.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | luella.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | luening.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | luffa.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | lugan.mp3 | 18-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | luggie.mp3 | 18-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | luing.mp3 | 18-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | luks.mp3 | 18-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | lulab.mp3 | 18-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lulav.mp3 | 18-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumbering.mp3 | 18-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumbo.mp3 | 18-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumin.mp3 | 18-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | luminance.mp3 | 18-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumine.mp3 | 18-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumini.mp3 | 18-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumme.mp3 | 18-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | lummix.mp3 | 18-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumpfish.mp3 | 18-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | lumpiness.mp3 | 18-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | luna.mp3 | 18-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | lunch-bucket.mp3 | 18-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | luncheonette.mp3 | 18-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | lunchroom.mp3 | 18-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | lunchy.mp3 | 18-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | lundy.mp3 | 18-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | luni.mp3 | 18-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | lunk.mp3 | 18-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | luny.mp3 | 18-Apr-2007 23:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | lunyu.mp3 | 18-Apr-2007 23:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | lur.mp3 | 18-Apr-2007 23:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | lurdan.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lurgy.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | luria.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lurie.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lurked.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lurker.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lurp.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lusher.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | lushy.mp3 | 18-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | luta.mp3 | 18-Apr-2007 23:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | lutsk.mp3 | 18-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | luv.mp3 | 18-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | luvian.mp3 | 18-Apr-2007 23:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | luxury.mp3 | 18-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lvov.mp3 | 18-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lwoff.mp3 | 18-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | ly.mp3 | 18-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyard.mp3 | 18-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | lych.mp3 | 18-Apr-2007 23:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | lydda.mp3 | 18-Apr-2007 23:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyle.mp3 | 18-Apr-2007 23:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyman.mp3 | 18-Apr-2007 23:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | lynda.mp3 | 18-Apr-2007 23:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyndsay.mp3 | 18-Apr-2007 23:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lynette.mp3 | 18-Apr-2007 23:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyo.mp3 | 18-Apr-2007 23:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyonnais.mp3 | 18-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyrist.mp3 | 18-Apr-2007 23:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | lysogen.mp3 | 18-Apr-2007 23:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyssa.mp3 | 18-Apr-2007 23:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | lythe.mp3 | 18-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | lytta.mp3 | 18-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | lyze.mp3 | 18-Apr-2007 23:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | La Guardia.mp3 | 18-Apr-2007 20:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | La Plata.mp3 | 18-Apr-2007 20:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | La Quinta.mp3 | 18-Apr-2007 20:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lachaise.mp3 | 18-Apr-2007 20:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | Laconian.mp3 | 18-Apr-2007 20:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lagash.mp3 | 18-Apr-2007 20:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lagos.mp3 | 18-Apr-2007 20:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lajas.mp3 | 18-Apr-2007 20:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lan-chou.mp3 | 18-Apr-2007 20:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | Langdale Pikes.mp3 | 18-Apr-2007 20:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | Languedoc.mp3 | 18-Apr-2007 20:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lanus.mp3 | 18-Apr-2007 21:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lapidus.mp3 | 18-Apr-2007 21:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lavinia.mp3 | 18-Apr-2007 21:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lawrentian.mp3 | 18-Apr-2007 21:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lazio.mp3 | 18-Apr-2007 21:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | Leander.mp3 | 18-Apr-2007 21:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lebanese.mp3 | 18-Apr-2007 21:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lederberg.mp3 | 18-Apr-2007 21:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | Legendre.mp3 | 18-Apr-2007 21:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lei-chou.mp3 | 18-Apr-2007 21:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | Leibovitz.mp3 | 18-Apr-2007 21:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lesotho.mp3 | 18-Apr-2007 21:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lethbridge.mp3 | 18-Apr-2007 21:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | Levi's.mp3 | 18-Apr-2007 22:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lexington.mp3 | 18-Apr-2007 22:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | Limousin.mp3 | 18-Apr-2007 22:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lingala.mp3 | 18-Apr-2007 22:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Linklater.mp3 | 18-Apr-2007 22:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | Liverpool.mp3 | 18-Apr-2007 22:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lombardy.mp3 | 18-Apr-2007 23:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lucayo.mp3 | 18-Apr-2007 23:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lucina.mp3 | 18-Apr-2007 23:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lucullus.mp3 | 18-Apr-2007 23:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ludhiana.mp3 | 18-Apr-2007 23:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Lugdunum.mp3 | 18-Apr-2007 23:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | lability.mp3 | 18-Apr-2007 20:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | laborer.mp3 | 18-Apr-2007 20:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | laccolithic.mp3 | 18-Apr-2007 20:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | lacerta.mp3 | 18-Apr-2007 20:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | laciniate.mp3 | 18-Apr-2007 20:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | laconism.mp3 | 18-Apr-2007 20:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | lacoste.mp3 | 18-Apr-2007 20:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | lact.mp3 | 18-Apr-2007 20:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | lacteal.mp3 | 18-Apr-2007 20:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | lactose.mp3 | 18-Apr-2007 20:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | ladida.mp3 | 18-Apr-2007 20:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | laennec.mp3 | 18-Apr-2007 20:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | laetitia.mp3 | 18-Apr-2007 20:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | laghouat.mp3 | 18-Apr-2007 20:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | lahabra.mp3 | 18-Apr-2007 20:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | lahogue.mp3 | 18-Apr-2007 20:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | laine.mp3 | 18-Apr-2007 20:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | lakeshore.mp3 | 18-Apr-2007 20:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | lamerie.mp3 | 18-Apr-2007 20:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | landless.mp3 | 18-Apr-2007 20:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | landus.mp3 | 18-Apr-2007 20:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | lapis.mp3 | 18-Apr-2007 21:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | lappage.mp3 | 18-Apr-2007 21:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | lappish.mp3 | 18-Apr-2007 21:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | lapstrake.mp3 | 18-Apr-2007 21:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | lapsus.mp3 | 18-Apr-2007 21:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | laputa.mp3 | 18-Apr-2007 21:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | large.mp3 | 18-Apr-2007 21:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | larioja.mp3 | 18-Apr-2007 21:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | lartigue.mp3 | 18-Apr-2007 21:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | laryngeal.mp3 | 18-Apr-2007 21:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | latchkey.mp3 | 18-Apr-2007 21:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | lathyritic.mp3 | 18-Apr-2007 21:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | laudably.mp3 | 18-Apr-2007 21:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | laughably.mp3 | 18-Apr-2007 21:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | lauroyl.mp3 | 18-Apr-2007 21:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | lavender.mp3 | 18-Apr-2007 21:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | lawfully.mp3 | 18-Apr-2007 21:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | lawgiver.mp3 | 18-Apr-2007 21:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | lawk.mp3 | 18-Apr-2007 21:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | laws.mp3 | 18-Apr-2007 21:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | laxative.mp3 | 18-Apr-2007 21:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | laxity.mp3 | 18-Apr-2007 21:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | layaway.mp3 | 18-Apr-2007 21:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | laze.mp3 | 18-Apr-2007 21:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | leadup.mp3 | 18-Apr-2007 21:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | leafhopper.mp3 | 18-Apr-2007 21:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | leary.mp3 | 18-Apr-2007 21:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | leatherleaf.mp3 | 18-Apr-2007 21:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | lebbek.mp3 | 18-Apr-2007 21:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | lectionary.mp3 | 18-Apr-2007 21:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | leechlike.mp3 | 18-Apr-2007 21:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | left-winger.mp3 | 18-Apr-2007 21:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | leftmost.mp3 | 18-Apr-2007 21:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | leg-o'-mutton.mp3 | 18-Apr-2007 21:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | leg-of-mutton.mp3 | 18-Apr-2007 21:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | legalist.mp3 | 18-Apr-2007 21:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | legation.mp3 | 18-Apr-2007 21:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | legman.mp3 | 18-Apr-2007 21:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | leloir.mp3 | 18-Apr-2007 21:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | lempira.mp3 | 18-Apr-2007 21:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | lenain.mp3 | 18-Apr-2007 21:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | lenity.mp3 | 18-Apr-2007 21:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | leonine.mp3 | 18-Apr-2007 21:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | leonora.mp3 | 18-Apr-2007 21:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | leppard.mp3 | 18-Apr-2007 21:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | lepton.mp3 | 18-Apr-2007 21:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | leptonic.mp3 | 18-Apr-2007 21:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | lepus.mp3 | 18-Apr-2007 21:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | lethean.mp3 | 18-Apr-2007 21:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | leukorrhea.mp3 | 18-Apr-2007 21:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | leukosis.mp3 | 18-Apr-2007 21:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | leukotomy.mp3 | 18-Apr-2007 21:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | lexically.mp3 | 18-Apr-2007 22:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | liang.mp3 | 18-Apr-2007 22:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | libelant.mp3 | 18-Apr-2007 22:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | libellant.mp3 | 18-Apr-2007 22:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | libellous.mp3 | 18-Apr-2007 22:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | libelous.mp3 | 18-Apr-2007 22:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | librate.mp3 | 18-Apr-2007 22:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | liegnitz.mp3 | 18-Apr-2007 22:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | life-giving.mp3 | 18-Apr-2007 22:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | liftman.mp3 | 18-Apr-2007 22:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | ligase.mp3 | 18-Apr-2007 22:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | liger.mp3 | 18-Apr-2007 22:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | lightface.mp3 | 18-Apr-2007 22:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | lighthouse.mp3 | 18-Apr-2007 22:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | ligule.mp3 | 18-Apr-2007 22:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | lillian.mp3 | 18-Apr-2007 22:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | lilo.mp3 | 18-Apr-2007 22:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | lilyan.mp3 | 18-Apr-2007 22:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | limewater.mp3 | 18-Apr-2007 22:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | limuli.mp3 | 18-Apr-2007 22:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | linar.mp3 | 18-Apr-2007 22:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | lindon.mp3 | 18-Apr-2007 22:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | lineally.mp3 | 18-Apr-2007 22:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | linguist.mp3 | 18-Apr-2007 22:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | linguistic.mp3 | 18-Apr-2007 22:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | linoleum.mp3 | 18-Apr-2007 22:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | linpiao.mp3 | 18-Apr-2007 22:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | linum.mp3 | 18-Apr-2007 22:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | linyu.mp3 | 18-Apr-2007 22:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | lionet.mp3 | 18-Apr-2007 22:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | liouville.mp3 | 18-Apr-2007 22:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | lipoid.mp3 | 18-Apr-2007 22:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | lirellate.mp3 | 18-Apr-2007 22:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | listed.mp3 | 18-Apr-2007 22:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | literalist.mp3 | 18-Apr-2007 22:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | literary.mp3 | 18-Apr-2007 22:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | literation.mp3 | 18-Apr-2007 22:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | lithops.mp3 | 18-Apr-2007 22:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | liturgist.mp3 | 18-Apr-2007 22:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | litvak.mp3 | 18-Apr-2007 22:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | liveliness.mp3 | 18-Apr-2007 22:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | liveout.mp3 | 18-Apr-2007 22:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | liveware.mp3 | 18-Apr-2007 22:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | lividness.mp3 | 18-Apr-2007 22:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | loathsome.mp3 | 18-Apr-2007 22:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | lobbyist.mp3 | 18-Apr-2007 22:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | lobe-fin.mp3 | 18-Apr-2007 22:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | lobose.mp3 | 18-Apr-2007 22:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | lobotomy.mp3 | 18-Apr-2007 22:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | locality.mp3 | 18-Apr-2007 22:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | lochus.mp3 | 18-Apr-2007 22:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | loci.mp3 | 18-Apr-2007 22:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | lockage.mp3 | 18-Apr-2007 22:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | locomotor.mp3 | 18-Apr-2007 22:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | lodging.mp3 | 18-Apr-2007 22:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | logically.mp3 | 18-Apr-2007 22:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | logistic.mp3 | 18-Apr-2007 22:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | logos.mp3 | 18-Apr-2007 23:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | lo mein.mp3 | 18-Apr-2007 22:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | longship.mp3 | 18-Apr-2007 23:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | longsome.mp3 | 18-Apr-2007 23:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | lookism.mp3 | 18-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | lordless.mp3 | 18-Apr-2007 23:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | lordling.mp3 | 18-Apr-2007 23:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | loricae.mp3 | 18-Apr-2007 23:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | lorikeet.mp3 | 18-Apr-2007 23:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | los.mp3 | 18-Apr-2007 23:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | lousily.mp3 | 18-Apr-2007 23:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | lousiness.mp3 | 18-Apr-2007 23:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | loveliness.mp3 | 18-Apr-2007 23:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | low-key.mp3 | 18-Apr-2007 23:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | low-rent.mp3 | 18-Apr-2007 23:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | lowlifes.mp3 | 18-Apr-2007 23:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | loyalist.mp3 | 18-Apr-2007 23:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | lubricity.mp3 | 18-Apr-2007 23:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | lucius.mp3 | 18-Apr-2007 23:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | lukacs.mp3 | 18-Apr-2007 23:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | lumberjack.mp3 | 18-Apr-2007 23:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | lumiere.mp3 | 18-Apr-2007 23:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | luminal.mp3 | 18-Apr-2007 23:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | lunaria.mp3 | 18-Apr-2007 23:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | lunation.mp3 | 18-Apr-2007 23:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | lungan.mp3 | 18-Apr-2007 23:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | lungeous.mp3 | 18-Apr-2007 23:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | lungfish.mp3 | 18-Apr-2007 23:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | lunkheaded.mp3 | 18-Apr-2007 23:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | luns.mp3 | 18-Apr-2007 23:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | lusterless.mp3 | 18-Apr-2007 23:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | lutist.mp3 | 18-Apr-2007 23:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | luxate.mp3 | 18-Apr-2007 23:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | lynen.mp3 | 18-Apr-2007 23:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | lyophilic.mp3 | 18-Apr-2007 23:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | lyricist.mp3 | 18-Apr-2007 23:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | L'Aquila.mp3 | 18-Apr-2007 21:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | L-dopa.mp3 | 18-Apr-2007 21:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | L-form.mp3 | 18-Apr-2007 22:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | La Grange.mp3 | 18-Apr-2007 20:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | La Palma.mp3 | 18-Apr-2007 20:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | La Paz.mp3 | 18-Apr-2007 20:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | Labrador.mp3 | 18-Apr-2007 20:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | Laconia.mp3 | 18-Apr-2007 20:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lamaze.mp3 | 18-Apr-2007 20:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lanfranc.mp3 | 18-Apr-2007 20:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lao-tzu.mp3 | 18-Apr-2007 21:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | Latakia.mp3 | 18-Apr-2007 21:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Laurentian Plateau.mp3 | 18-Apr-2007 21:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lazarus.mp3 | 18-Apr-2007 21:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | Le Carre.mp3 | 18-Apr-2007 21:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | Leavisian.mp3 | 18-Apr-2007 21:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | Leningrad.mp3 | 18-Apr-2007 21:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | Leopardi.mp3 | 18-Apr-2007 21:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | Li Peng.mp3 | 18-Apr-2007 22:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | Li Po.mp3 | 18-Apr-2007 22:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | Liberia.mp3 | 18-Apr-2007 22:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | Limavady.mp3 | 18-Apr-2007 22:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lincolnian.mp3 | 18-Apr-2007 22:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lisboan.mp3 | 18-Apr-2007 22:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | Livorno.mp3 | 18-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | Locarno.mp3 | 18-Apr-2007 22:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Luhans'k.mp3 | 18-Apr-2007 23:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lusaka.mp3 | 18-Apr-2007 23:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lushun.mp3 | 18-Apr-2007 23:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | Luxemburg.mp3 | 18-Apr-2007 23:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lyautey.mp3 | 18-Apr-2007 23:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lynchburg.mp3 | 18-Apr-2007 23:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | Lysander.mp3 | 18-Apr-2007 23:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | labio.mp3 | 18-Apr-2007 20:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | laboheme.mp3 | 18-Apr-2007 20:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | lacoruna.mp3 | 18-Apr-2007 20:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lacquerware.mp3 | 18-Apr-2007 20:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lacrymal.mp3 | 18-Apr-2007 20:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | ladleful.mp3 | 18-Apr-2007 20:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | ladrone.mp3 | 18-Apr-2007 20:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | ladyfish.mp3 | 18-Apr-2007 20:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | ladylike.mp3 | 18-Apr-2007 20:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | laelia.mp3 | 18-Apr-2007 20:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | laetrile.mp3 | 18-Apr-2007 20:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | lagen.mp3 | 18-Apr-2007 20:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | lagena.mp3 | 18-Apr-2007 20:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | lagnia.mp3 | 18-Apr-2007 20:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | lagonda.mp3 | 18-Apr-2007 20:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | laguardia.mp3 | 18-Apr-2007 20:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | laguerre.mp3 | 18-Apr-2007 20:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | lakme.mp3 | 18-Apr-2007 20:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lakoda.mp3 | 18-Apr-2007 20:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lala.mp3 | 18-Apr-2007 20:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamboy.mp3 | 18-Apr-2007 20:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamelli.mp3 | 18-Apr-2007 20:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamentable.mp3 | 18-Apr-2007 20:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamentably.mp3 | 18-Apr-2007 20:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamini.mp3 | 18-Apr-2007 20:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamino.mp3 | 18-Apr-2007 20:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamium.mp3 | 18-Apr-2007 20:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | lampara.mp3 | 18-Apr-2007 20:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | lampers.mp3 | 18-Apr-2007 20:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | lampion.mp3 | 18-Apr-2007 20:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | lamplighter.mp3 | 18-Apr-2007 20:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | lanac.mp3 | 18-Apr-2007 20:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lanate.mp3 | 18-Apr-2007 20:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lancome.mp3 | 18-Apr-2007 20:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | landfill.mp3 | 18-Apr-2007 20:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | landlady.mp3 | 18-Apr-2007 20:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | landlubbing.mp3 | 18-Apr-2007 20:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | landowner.mp3 | 18-Apr-2007 20:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | landscape.mp3 | 18-Apr-2007 20:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | landsman.mp3 | 18-Apr-2007 20:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | langlay.mp3 | 18-Apr-2007 20:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | lani.mp3 | 18-Apr-2007 20:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | lanthanon.mp3 | 18-Apr-2007 20:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | lanvin.mp3 | 18-Apr-2007 21:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | lanzhou.mp3 | 18-Apr-2007 21:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | laparo.mp3 | 18-Apr-2007 21:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | lapdog.mp3 | 18-Apr-2007 21:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | largen.mp3 | 18-Apr-2007 21:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | larkin.mp3 | 18-Apr-2007 21:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | larkiness.mp3 | 18-Apr-2007 21:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | larwood.mp3 | 18-Apr-2007 21:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | laryng.mp3 | 18-Apr-2007 21:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | laryngo.mp3 | 18-Apr-2007 21:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | lasing.mp3 | 18-Apr-2007 21:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | lathered.mp3 | 18-Apr-2007 21:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lathering.mp3 | 18-Apr-2007 21:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lathi.mp3 | 18-Apr-2007 21:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lathy.mp3 | 18-Apr-2007 21:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | latona.mp3 | 18-Apr-2007 21:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | latour.mp3 | 18-Apr-2007 21:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | latria.mp3 | 18-Apr-2007 21:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | latry.mp3 | 18-Apr-2007 21:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | lauda.mp3 | 18-Apr-2007 21:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | laudanum.mp3 | 18-Apr-2007 21:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | laudative.mp3 | 18-Apr-2007 21:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | laureen.mp3 | 18-Apr-2007 21:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | lauren.mp3 | 18-Apr-2007 21:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | laus Deo.mp3 | 18-Apr-2007 21:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | lavaliere.mp3 | 18-Apr-2007 21:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | lavalike.mp3 | 18-Apr-2007 21:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | lavalliere.mp3 | 18-Apr-2007 21:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | lavater.mp3 | 18-Apr-2007 21:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | lavation.mp3 | 18-Apr-2007 21:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | laveer.mp3 | 18-Apr-2007 21:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | lavern.mp3 | 18-Apr-2007 21:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | lavvy.mp3 | 18-Apr-2007 21:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | lawine.mp3 | 18-Apr-2007 21:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | lawmaker.mp3 | 18-Apr-2007 21:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | lawyerly.mp3 | 18-Apr-2007 21:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | laying.mp3 | 18-Apr-2007 21:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | leachy.mp3 | 18-Apr-2007 21:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | leadin.mp3 | 18-Apr-2007 21:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | leakiness.mp3 | 18-Apr-2007 21:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | lean-to.mp3 | 18-Apr-2007 21:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | leangle.mp3 | 18-Apr-2007 21:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | learig.mp3 | 18-Apr-2007 21:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | learning.mp3 | 18-Apr-2007 21:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | leasehold.mp3 | 18-Apr-2007 21:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | leather-lunged.mp3 | 18-Apr-2007 21:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | leaved.mp3 | 18-Apr-2007 21:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | leaving.mp3 | 18-Apr-2007 21:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | leblanc.mp3 | 18-Apr-2007 21:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | leblang.mp3 | 18-Apr-2007 21:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | lecarre.mp3 | 18-Apr-2007 21:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | lecithal.mp3 | 18-Apr-2007 21:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | leechee.mp3 | 18-Apr-2007 21:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | left-hand.mp3 | 18-Apr-2007 21:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | legalese.mp3 | 18-Apr-2007 21:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | legatee.mp3 | 18-Apr-2007 21:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | legateship.mp3 | 18-Apr-2007 21:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | legginess.mp3 | 18-Apr-2007 21:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | legong.mp3 | 18-Apr-2007 21:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | legree.mp3 | 18-Apr-2007 21:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | leguan.mp3 | 18-Apr-2007 21:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | leguia.mp3 | 18-Apr-2007 21:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | legumen.mp3 | 18-Apr-2007 21:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | lehavre.mp3 | 18-Apr-2007 21:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | leichou.mp3 | 18-Apr-2007 21:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | leipoa.mp3 | 18-Apr-2007 21:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | leizhou.mp3 | 18-Apr-2007 21:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | lemminglike.mp3 | 18-Apr-2007 21:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | lemonade.mp3 | 18-Apr-2007 21:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | lemonde.mp3 | 18-Apr-2007 21:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | lempa.mp3 | 18-Apr-2007 21:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | lemuel.mp3 | 18-Apr-2007 21:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | lenaea.mp3 | 18-Apr-2007 21:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | lending.mp3 | 18-Apr-2007 21:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lenfant.mp3 | 18-Apr-2007 21:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lenglen.mp3 | 18-Apr-2007 21:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lengthily.mp3 | 18-Apr-2007 21:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lenience.mp3 | 18-Apr-2007 21:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | leoben.mp3 | 18-Apr-2007 21:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | leopardess.mp3 | 18-Apr-2007 21:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | lepaya.mp3 | 18-Apr-2007 21:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | lepuy.mp3 | 18-Apr-2007 21:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lequear.mp3 | 18-Apr-2007 21:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lerot.mp3 | 18-Apr-2007 21:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lesbian.mp3 | 18-Apr-2007 21:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lesbo.mp3 | 18-Apr-2007 21:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lester.mp3 | 18-Apr-2007 21:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | letdown.mp3 | 18-Apr-2007 21:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | leto.mp3 | 18-Apr-2007 21:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | leucaena.mp3 | 18-Apr-2007 21:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | leuco.mp3 | 18-Apr-2007 21:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | leuko.mp3 | 18-Apr-2007 21:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | leukoma.mp3 | 18-Apr-2007 21:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | leukopenic.mp3 | 18-Apr-2007 21:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | levodopa.mp3 | 18-Apr-2007 22:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | lexes.mp3 | 18-Apr-2007 22:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | lexicon.mp3 | 18-Apr-2007 22:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | liaison.mp3 | 18-Apr-2007 22:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | liaodong.mp3 | 18-Apr-2007 22:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | libbys.mp3 | 18-Apr-2007 22:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | libelee.mp3 | 18-Apr-2007 22:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | libelist.mp3 | 18-Apr-2007 22:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | libellee.mp3 | 18-Apr-2007 22:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | liberalist.mp3 | 18-Apr-2007 22:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | liberally.mp3 | 18-Apr-2007 22:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | liblab.mp3 | 18-Apr-2007 22:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | libo.mp3 | 18-Apr-2007 22:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | libri.mp3 | 18-Apr-2007 22:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | lichee.mp3 | 18-Apr-2007 22:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | lickspittle.mp3 | 18-Apr-2007 22:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | liegeman.mp3 | 18-Apr-2007 22:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lifetime.mp3 | 18-Apr-2007 22:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | lifo.mp3 | 18-Apr-2007 22:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | lifter.mp3 | 18-Apr-2007 22:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | ligan.mp3 | 18-Apr-2007 22:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | ligation.mp3 | 18-Apr-2007 22:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | light bread.mp3 | 18-Apr-2007 22:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | lightbulb.mp3 | 18-Apr-2007 22:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | lightfaced.mp3 | 18-Apr-2007 22:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | lighthearted.mp3 | 18-Apr-2007 22:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | ligno.mp3 | 18-Apr-2007 22:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | likelihood.mp3 | 18-Apr-2007 22:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | lila.mp3 | 18-Apr-2007 22:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | lilian.mp3 | 18-Apr-2007 22:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | liman.mp3 | 18-Apr-2007 22:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | limbourg.mp3 | 18-Apr-2007 22:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | liming.mp3 | 18-Apr-2007 22:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | linares.mp3 | 18-Apr-2007 22:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | linbiao.mp3 | 18-Apr-2007 22:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | linchpin.mp3 | 18-Apr-2007 22:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | lindi.mp3 | 18-Apr-2007 22:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | lindsey.mp3 | 18-Apr-2007 22:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | linearly.mp3 | 18-Apr-2007 22:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | linerboard.mp3 | 18-Apr-2007 22:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | linguica.mp3 | 18-Apr-2007 22:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | lingula.mp3 | 18-Apr-2007 22:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | linin.mp3 | 18-Apr-2007 22:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | linne.mp3 | 18-Apr-2007 22:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | linney.mp3 | 18-Apr-2007 22:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | linsen.mp3 | 18-Apr-2007 22:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | linsey.mp3 | 18-Apr-2007 22:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | linton.mp3 | 18-Apr-2007 22:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | lionel.mp3 | 18-Apr-2007 22:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | lipan.mp3 | 18-Apr-2007 22:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | lipeng.mp3 | 18-Apr-2007 22:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | lipmann.mp3 | 18-Apr-2007 22:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | lipophilic.mp3 | 18-Apr-2007 22:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | lipuria.mp3 | 18-Apr-2007 22:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | liquefy.mp3 | 18-Apr-2007 22:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | liquidambar.mp3 | 18-Apr-2007 22:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | liquidity.mp3 | 18-Apr-2007 22:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | liquify.mp3 | 18-Apr-2007 22:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | lisao.mp3 | 18-Apr-2007 22:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | lisgar.mp3 | 18-Apr-2007 22:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | listeria.mp3 | 18-Apr-2007 22:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | litas.mp3 | 18-Apr-2007 22:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | lithophyte.mp3 | 18-Apr-2007 22:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | litzwire.mp3 | 18-Apr-2007 22:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | livelily.mp3 | 18-Apr-2007 22:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | livyer.mp3 | 18-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | liwan.mp3 | 18-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | lixue.mp3 | 18-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | liyuan.mp3 | 18-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | loanda.mp3 | 18-Apr-2007 22:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | loanee.mp3 | 18-Apr-2007 22:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | loathful.mp3 | 18-Apr-2007 22:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | loathing.mp3 | 18-Apr-2007 22:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | loathly.mp3 | 18-Apr-2007 22:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | loblolly.mp3 | 18-Apr-2007 22:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | locale.mp3 | 18-Apr-2007 22:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | localism.mp3 | 18-Apr-2007 22:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | location.mp3 | 18-Apr-2007 22:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | lockdown.mp3 | 18-Apr-2007 22:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | locoman.mp3 | 18-Apr-2007 22:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | loculed.mp3 | 18-Apr-2007 22:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | locution.mp3 | 18-Apr-2007 22:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | loftlike.mp3 | 18-Apr-2007 22:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | logania.mp3 | 18-Apr-2007 22:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | loganin.mp3 | 18-Apr-2007 22:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | logorrheic.mp3 | 18-Apr-2007 23:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | loiner.mp3 | 18-Apr-2007 23:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | loir.mp3 | 18-Apr-2007 23:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | lollipop.mp3 | 18-Apr-2007 23:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | lollypop.mp3 | 18-Apr-2007 23:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | loman.mp3 | 18-Apr-2007 23:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | longheaded.mp3 | 18-Apr-2007 23:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | longhi.mp3 | 18-Apr-2007 23:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | longworth.mp3 | 18-Apr-2007 23:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | longyi.mp3 | 18-Apr-2007 23:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | lonrho.mp3 | 18-Apr-2007 23:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | lop-eared.mp3 | 18-Apr-2007 23:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | lopho.mp3 | 18-Apr-2007 23:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | lopolith.mp3 | 18-Apr-2007 23:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | lorenzetti.mp3 | 18-Apr-2007 23:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lorenzo.mp3 | 18-Apr-2007 23:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lores.mp3 | 18-Apr-2007 23:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lorgnon.mp3 | 18-Apr-2007 23:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | lothian.mp3 | 18-Apr-2007 23:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | loughneagh.mp3 | 18-Apr-2007 23:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | louisdor.mp3 | 18-Apr-2007 23:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | loupgarou.mp3 | 18-Apr-2007 23:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | lowering.mp3 | 18-Apr-2007 23:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | lowing.mp3 | 18-Apr-2007 23:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | luach.mp3 | 18-Apr-2007 23:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | lucianne.mp3 | 18-Apr-2007 23:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | lucozade.mp3 | 18-Apr-2007 23:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | luda.mp3 | 18-Apr-2007 23:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | luhsun.mp3 | 18-Apr-2007 23:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | luminescent.mp3 | 18-Apr-2007 23:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | lumino.mp3 | 18-Apr-2007 23:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | lumpingly.mp3 | 18-Apr-2007 23:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | lunarite.mp3 | 18-Apr-2007 23:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | lunchtime.mp3 | 18-Apr-2007 23:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | lungchi.mp3 | 18-Apr-2007 23:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | lungee.mp3 | 18-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lungi.mp3 | 18-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lungworm.mp3 | 18-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lungyi.mp3 | 18-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lunula.mp3 | 18-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lunular.mp3 | 18-Apr-2007 23:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | lurcat.mp3 | 18-Apr-2007 23:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | lurking.mp3 | 18-Apr-2007 23:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | lurkola.mp3 | 18-Apr-2007 23:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | lustering.mp3 | 18-Apr-2007 23:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | lustihood.mp3 | 18-Apr-2007 23:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | lustiness.mp3 | 18-Apr-2007 23:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | luteo.mp3 | 18-Apr-2007 23:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | luthern.mp3 | 18-Apr-2007 23:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | luxun.mp3 | 18-Apr-2007 23:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | luzhou.mp3 | 18-Apr-2007 23:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | lycee.mp3 | 18-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | lycine.mp3 | 18-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | lycopene.mp3 | 18-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | lymehound.mp3 | 18-Apr-2007 23:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | lymphedema.mp3 | 18-Apr-2007 23:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | lyncean.mp3 | 18-Apr-2007 23:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | lyndora.mp3 | 18-Apr-2007 23:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | La Goulette.mp3 | 18-Apr-2007 20:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lake Baykal.mp3 | 18-Apr-2007 20:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lamarckian.mp3 | 18-Apr-2007 20:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lan Tau.mp3 | 18-Apr-2007 20:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | Latinist.mp3 | 18-Apr-2007 21:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | Latvian.mp3 | 18-Apr-2007 21:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lauderhill.mp3 | 18-Apr-2007 21:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | Laurentian Mountains.mp3 | 18-Apr-2007 21:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lawndale.mp3 | 18-Apr-2007 21:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lazarist.mp3 | 18-Apr-2007 21:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lelystad.mp3 | 18-Apr-2007 21:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | Leticia.mp3 | 18-Apr-2007 21:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Leviticus.mp3 | 18-Apr-2007 22:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lhotse.mp3 | 18-Apr-2007 22:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | Libreville.mp3 | 18-Apr-2007 22:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | Likasi.mp3 | 18-Apr-2007 22:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lincolnesque.mp3 | 18-Apr-2007 22:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lindisfarne.mp3 | 18-Apr-2007 22:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | Liotard.mp3 | 18-Apr-2007 22:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lisboa.mp3 | 18-Apr-2007 22:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | Livingstone.mp3 | 18-Apr-2007 22:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Livonian.mp3 | 18-Apr-2007 22:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lombard.mp3 | 18-Apr-2007 23:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lombardic.mp3 | 18-Apr-2007 23:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lomblen.mp3 | 18-Apr-2007 23:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | Longview.mp3 | 18-Apr-2007 23:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lord Howe Island.mp3 | 18-Apr-2007 23:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lusatia.mp3 | 18-Apr-2007 23:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lyonnesse.mp3 | 18-Apr-2007 23:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lysenko.mp3 | 18-Apr-2007 23:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | labially.mp3 | 18-Apr-2007 20:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | labile.mp3 | 18-Apr-2007 20:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | laborious.mp3 | 18-Apr-2007 20:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | laborsome.mp3 | 18-Apr-2007 20:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | laceiba.mp3 | 18-Apr-2007 20:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | lacerate.mp3 | 18-Apr-2007 20:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | lacily.mp3 | 18-Apr-2007 20:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | lackawanna.mp3 | 18-Apr-2007 20:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | lacking.mp3 | 18-Apr-2007 20:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | laconically.mp3 | 18-Apr-2007 20:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | lacretelle.mp3 | 18-Apr-2007 20:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | lactam.mp3 | 18-Apr-2007 20:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | lactary.mp3 | 18-Apr-2007 20:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | lacto.mp3 | 18-Apr-2007 20:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | lacumbre.mp3 | 18-Apr-2007 20:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | lacunal.mp3 | 18-Apr-2007 20:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | laddish.mp3 | 18-Apr-2007 20:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | lady's-smock.mp3 | 18-Apr-2007 20:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | laemmle.mp3 | 18-Apr-2007 20:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lafarge.mp3 | 18-Apr-2007 20:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lafite.mp3 | 18-Apr-2007 20:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lafta.mp3 | 18-Apr-2007 20:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | laggardly.mp3 | 18-Apr-2007 20:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | lagniappe.mp3 | 18-Apr-2007 20:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | lagomorph.mp3 | 18-Apr-2007 20:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | laguaira.mp3 | 18-Apr-2007 20:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | lakin.mp3 | 18-Apr-2007 20:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | lakshmi.mp3 | 18-Apr-2007 20:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | lalique.mp3 | 18-Apr-2007 20:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | lambency.mp3 | 18-Apr-2007 20:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | lambkin.mp3 | 18-Apr-2007 20:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | lampad.mp3 | 18-Apr-2007 20:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | lampadaire.mp3 | 18-Apr-2007 20:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | lampblack.mp3 | 18-Apr-2007 20:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | lampshell.mp3 | 18-Apr-2007 20:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | lanchow.mp3 | 18-Apr-2007 20:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | lancia.mp3 | 18-Apr-2007 20:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | landammann.mp3 | 18-Apr-2007 20:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | landaulet.mp3 | 18-Apr-2007 20:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | landers.mp3 | 18-Apr-2007 20:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | landman.mp3 | 18-Apr-2007 20:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | landslip.mp3 | 18-Apr-2007 20:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | landtag.mp3 | 18-Apr-2007 20:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | landwehr.mp3 | 18-Apr-2007 20:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | langiel.mp3 | 18-Apr-2007 20:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | langshan.mp3 | 18-Apr-2007 20:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | langston.mp3 | 18-Apr-2007 20:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | langsyne.mp3 | 18-Apr-2007 20:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | laniard.mp3 | 18-Apr-2007 20:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | lansdowne.mp3 | 18-Apr-2007 20:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | lantana.mp3 | 18-Apr-2007 20:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | laoshe.mp3 | 18-Apr-2007 21:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | laotzu.mp3 | 18-Apr-2007 21:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | laquila.mp3 | 18-Apr-2007 21:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | laraza.mp3 | 18-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | larcenous.mp3 | 18-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | lardoon.mp3 | 18-Apr-2007 21:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | largando.mp3 | 18-Apr-2007 21:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | larghetto.mp3 | 18-Apr-2007 21:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | laryngitic.mp3 | 18-Apr-2007 21:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | lasher.mp3 | 18-Apr-2007 21:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | lastly.mp3 | 18-Apr-2007 21:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | latching.mp3 | 18-Apr-2007 21:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | laterad.mp3 | 18-Apr-2007 21:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | lateran.mp3 | 18-Apr-2007 21:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | lathee.mp3 | 18-Apr-2007 21:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | latine.mp3 | 18-Apr-2007 21:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | latosol.mp3 | 18-Apr-2007 21:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | lattin.mp3 | 18-Apr-2007 21:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | laudation.mp3 | 18-Apr-2007 21:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | laughing.mp3 | 18-Apr-2007 21:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | lauric.mp3 | 18-Apr-2007 21:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | lawson.mp3 | 18-Apr-2007 21:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | lazulite.mp3 | 18-Apr-2007 21:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | leaderboard.mp3 | 18-Apr-2007 21:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | leaderless.mp3 | 18-Apr-2007 21:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | leaseman.mp3 | 18-Apr-2007 21:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | leatherwood.mp3 | 18-Apr-2007 21:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | leavings.mp3 | 18-Apr-2007 21:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | leed.mp3 | 18-Apr-2007 21:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | leftie.mp3 | 18-Apr-2007 21:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | leftism.mp3 | 18-Apr-2007 21:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | legalistic.mp3 | 18-Apr-2007 21:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | legality.mp3 | 18-Apr-2007 21:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | legendary.mp3 | 18-Apr-2007 21:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | legionella.mp3 | 18-Apr-2007 21:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | legislative.mp3 | 18-Apr-2007 21:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | leglen.mp3 | 18-Apr-2007 21:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | leguin.mp3 | 18-Apr-2007 21:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | lemniscal.mp3 | 18-Apr-2007 21:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | lend-lease.mp3 | 18-Apr-2007 21:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | lenes.mp3 | 18-Apr-2007 21:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | lengthening.mp3 | 18-Apr-2007 21:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | lenticel.mp3 | 18-Apr-2007 21:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | lenticle.mp3 | 18-Apr-2007 21:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | lentigo.mp3 | 18-Apr-2007 21:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | leoni.mp3 | 18-Apr-2007 21:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | leotard.mp3 | 18-Apr-2007 21:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | leotarded.mp3 | 18-Apr-2007 21:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | lepido.mp3 | 18-Apr-2007 21:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | lepto.mp3 | 18-Apr-2007 21:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | leros.mp3 | 18-Apr-2007 21:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | lesche.mp3 | 18-Apr-2007 21:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | leslie.mp3 | 18-Apr-2007 21:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | lessee.mp3 | 18-Apr-2007 21:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | letchworth.mp3 | 18-Apr-2007 21:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | lethargic.mp3 | 18-Apr-2007 21:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | letoile.mp3 | 18-Apr-2007 21:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | lettable.mp3 | 18-Apr-2007 21:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | leucothea.mp3 | 18-Apr-2007 21:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | leviter.mp3 | 18-Apr-2007 22:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | lewisite.mp3 | 18-Apr-2007 22:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | lewisson.mp3 | 18-Apr-2007 22:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | lexell.mp3 | 18-Apr-2007 22:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | lezbo.mp3 | 18-Apr-2007 22:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | libertine.mp3 | 18-Apr-2007 22:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | libidinal.mp3 | 18-Apr-2007 22:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | library.mp3 | 18-Apr-2007 22:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | licence.mp3 | 18-Apr-2007 22:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | license.mp3 | 18-Apr-2007 22:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | licenser.mp3 | 18-Apr-2007 22:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | licensor.mp3 | 18-Apr-2007 22:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | lichi.mp3 | 18-Apr-2007 22:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | liddelhart.mp3 | 18-Apr-2007 22:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | lifeline.mp3 | 18-Apr-2007 22:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | light-minded.mp3 | 18-Apr-2007 22:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | likewise.mp3 | 18-Apr-2007 22:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | lime-juicer.mp3 | 18-Apr-2007 22:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | limitary.mp3 | 18-Apr-2007 22:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | limitation.mp3 | 18-Apr-2007 22:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | limonitic.mp3 | 18-Apr-2007 22:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | limpsy.mp3 | 18-Apr-2007 22:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | lindemann.mp3 | 18-Apr-2007 22:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | line-haul.mp3 | 18-Apr-2007 22:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | lineament.mp3 | 18-Apr-2007 22:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | lingcod.mp3 | 18-Apr-2007 22:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | lionlike.mp3 | 18-Apr-2007 22:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | lipoidal.mp3 | 18-Apr-2007 22:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | lipolytic.mp3 | 18-Apr-2007 22:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | lipoma.mp3 | 18-Apr-2007 22:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | lips.mp3 | 18-Apr-2007 22:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | lipscomb.mp3 | 18-Apr-2007 22:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | literatus.mp3 | 18-Apr-2007 22:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lithemia.mp3 | 18-Apr-2007 22:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lithify.mp3 | 18-Apr-2007 22:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lithophile.mp3 | 18-Apr-2007 22:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | litterbag.mp3 | 18-Apr-2007 22:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | lituus.mp3 | 18-Apr-2007 22:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | liupang.mp3 | 18-Apr-2007 22:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | liuzhou.mp3 | 18-Apr-2007 22:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | liverleaf.mp3 | 18-Apr-2007 22:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | liveryman.mp3 | 18-Apr-2007 22:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | llosa.mp3 | 18-Apr-2007 22:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | loadstar.mp3 | 18-Apr-2007 22:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | loadstone.mp3 | 18-Apr-2007 22:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | lobbygow.mp3 | 18-Apr-2007 22:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | lobelia.mp3 | 18-Apr-2007 22:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | locative.mp3 | 18-Apr-2007 22:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | lochinvar.mp3 | 18-Apr-2007 22:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | locie.mp3 | 18-Apr-2007 22:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | lockean.mp3 | 18-Apr-2007 22:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | locking.mp3 | 18-Apr-2007 22:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | lockkeeper.mp3 | 18-Apr-2007 22:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | locoed.mp3 | 18-Apr-2007 22:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | loculi.mp3 | 18-Apr-2007 22:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | loculus.mp3 | 18-Apr-2007 22:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | lofi.mp3 | 18-Apr-2007 22:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | loftiness.mp3 | 18-Apr-2007 22:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | lofting.mp3 | 18-Apr-2007 22:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | loggerhead.mp3 | 18-Apr-2007 22:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | logophile.mp3 | 18-Apr-2007 23:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | logotype.mp3 | 18-Apr-2007 23:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | logroll.mp3 | 18-Apr-2007 23:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | lokey.mp3 | 18-Apr-2007 23:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | lomotil.mp3 | 18-Apr-2007 23:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | londrina.mp3 | 18-Apr-2007 23:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | longhand.mp3 | 18-Apr-2007 23:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | longi.mp3 | 18-Apr-2007 23:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | longies.mp3 | 18-Apr-2007 23:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | longingly.mp3 | 18-Apr-2007 23:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | longus.mp3 | 18-Apr-2007 23:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | longxi.mp3 | 18-Apr-2007 23:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | lookielou.mp3 | 18-Apr-2007 23:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | loopiness.mp3 | 18-Apr-2007 23:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | loosely.mp3 | 18-Apr-2007 23:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | loosing.mp3 | 18-Apr-2007 23:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | lorestan.mp3 | 18-Apr-2007 23:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | lorgnette.mp3 | 18-Apr-2007 23:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | losey.mp3 | 18-Apr-2007 23:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | lostness.mp3 | 18-Apr-2007 23:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | loudening.mp3 | 18-Apr-2007 23:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | louisa.mp3 | 18-Apr-2007 23:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | lounging.mp3 | 18-Apr-2007 23:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | loungy.mp3 | 18-Apr-2007 23:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | loupingill.mp3 | 18-Apr-2007 23:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | louser.mp3 | 18-Apr-2007 23:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | louvertie.mp3 | 18-Apr-2007 23:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | louverture.mp3 | 18-Apr-2007 23:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | lovebird.mp3 | 18-Apr-2007 23:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | lovelily.mp3 | 18-Apr-2007 23:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | lovelorn.mp3 | 18-Apr-2007 23:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | lovemaker.mp3 | 18-Apr-2007 23:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | lowcal.mp3 | 18-Apr-2007 23:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | lowness.mp3 | 18-Apr-2007 23:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | lowp.mp3 | 18-Apr-2007 23:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | lowres.mp3 | 18-Apr-2007 23:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | loyalty.mp3 | 18-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | lubyanka.mp3 | 18-Apr-2007 23:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | lucretia.mp3 | 18-Apr-2007 23:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | ludicrous.mp3 | 18-Apr-2007 23:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | luhsien.mp3 | 18-Apr-2007 23:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | lumberer.mp3 | 18-Apr-2007 23:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | lumbersome.mp3 | 18-Apr-2007 23:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | luminism.mp3 | 18-Apr-2007 23:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | lunarian.mp3 | 18-Apr-2007 23:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | lunchie.mp3 | 18-Apr-2007 23:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | lundberg.mp3 | 18-Apr-2007 23:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | lunik.mp3 | 18-Apr-2007 23:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | lupoma.mp3 | 18-Apr-2007 23:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | lupulin.mp3 | 18-Apr-2007 23:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | lures.mp3 | 18-Apr-2007 23:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | lusatian.mp3 | 18-Apr-2007 23:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | luso.mp3 | 18-Apr-2007 23:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | lusterer.mp3 | 18-Apr-2007 23:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | luting.mp3 | 18-Apr-2007 23:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lutong.mp3 | 18-Apr-2007 23:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | lutyens.mp3 | 18-Apr-2007 23:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | luxo.mp3 | 18-Apr-2007 23:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | luxon.mp3 | 18-Apr-2007 23:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | lymington.mp3 | 18-Apr-2007 23:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | lympho.mp3 | 18-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | lymphocyte.mp3 | 18-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | lymphocytic.mp3 | 18-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | lynchpin.mp3 | 18-Apr-2007 23:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | lyndon.mp3 | 18-Apr-2007 23:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | lyngvi.mp3 | 18-Apr-2007 23:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | lyricism.mp3 | 18-Apr-2007 23:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | lysandra.mp3 | 18-Apr-2007 23:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | lyso.mp3 | 18-Apr-2007 23:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | lyttleton.mp3 | 18-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | L'Enfant.mp3 | 18-Apr-2007 21:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ladysmith.mp3 | 18-Apr-2007 20:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lake Oswego.mp3 | 18-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lake Tiberias.mp3 | 18-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lammermuir.mp3 | 18-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lampedusa.mp3 | 18-Apr-2007 20:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lanarkshire.mp3 | 18-Apr-2007 20:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | Laplander.mp3 | 18-Apr-2007 21:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | Laxness.mp3 | 18-Apr-2007 21:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | Leavenworth.mp3 | 18-Apr-2007 21:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | Leesburg.mp3 | 18-Apr-2007 21:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | Leibniz.mp3 | 18-Apr-2007 21:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | Liaosi.mp3 | 18-Apr-2007 22:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Licinius.mp3 | 18-Apr-2007 22:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | Liguria.mp3 | 18-Apr-2007 22:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | Limnos.mp3 | 18-Apr-2007 22:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | Llanelly.mp3 | 18-Apr-2007 22:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lobengula.mp3 | 18-Apr-2007 22:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lofoten.mp3 | 18-Apr-2007 22:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | Longfellow.mp3 | 18-Apr-2007 23:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Longstreet.mp3 | 18-Apr-2007 23:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | Longueuil.mp3 | 18-Apr-2007 23:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lonnrot.mp3 | 18-Apr-2007 23:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | Los Banos.mp3 | 18-Apr-2007 23:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lu Hsun.mp3 | 18-Apr-2007 23:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lucania.mp3 | 18-Apr-2007 23:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lucayan.mp3 | 18-Apr-2007 23:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ludendorff.mp3 | 18-Apr-2007 23:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | Luzern.mp3 | 18-Apr-2007 23:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lycaonia.mp3 | 18-Apr-2007 23:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Lykabettos.mp3 | 18-Apr-2007 23:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | laaland.mp3 | 18-Apr-2007 20:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | labelable.mp3 | 18-Apr-2007 20:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | labrid.mp3 | 18-Apr-2007 20:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | labrusca.mp3 | 18-Apr-2007 20:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | labyrinth.mp3 | 18-Apr-2007 20:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | lachrymator.mp3 | 18-Apr-2007 20:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | lachrymose.mp3 | 18-Apr-2007 20:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | laconical.mp3 | 18-Apr-2007 20:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | laconicum.mp3 | 18-Apr-2007 20:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | lacrimator.mp3 | 18-Apr-2007 20:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | lactase.mp3 | 18-Apr-2007 20:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | lacteous.mp3 | 18-Apr-2007 20:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | lactometer.mp3 | 18-Apr-2007 20:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | ladylove.mp3 | 18-Apr-2007 20:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | laender.mp3 | 18-Apr-2007 20:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | laicism.mp3 | 18-Apr-2007 20:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | laid-back.mp3 | 18-Apr-2007 20:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | lajoie.mp3 | 18-Apr-2007 20:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | lakcell.mp3 | 18-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | lakehead.mp3 | 18-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | lakelet.mp3 | 18-Apr-2007 20:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | laksa.mp3 | 18-Apr-2007 20:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | lamancha.mp3 | 18-Apr-2007 20:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | lambada.mp3 | 18-Apr-2007 20:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | lambast.mp3 | 18-Apr-2007 20:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | lambaste.mp3 | 18-Apr-2007 20:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | lambrequin.mp3 | 18-Apr-2007 20:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | lamebrain.mp3 | 18-Apr-2007 20:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | lamesa.mp3 | 18-Apr-2007 20:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | laminose.mp3 | 18-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | lamirada.mp3 | 18-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | lamister.mp3 | 18-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | lampas.mp3 | 18-Apr-2007 20:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | lampwick.mp3 | 18-Apr-2007 20:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | lampyrid.mp3 | 18-Apr-2007 20:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | lancel.mp3 | 18-Apr-2007 20:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | lancers.mp3 | 18-Apr-2007 20:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | lancinate.mp3 | 18-Apr-2007 20:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | landini.mp3 | 18-Apr-2007 20:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | landline.mp3 | 18-Apr-2007 20:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | landmass.mp3 | 18-Apr-2007 20:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | landsting.mp3 | 18-Apr-2007 20:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | langrage.mp3 | 18-Apr-2007 20:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | languishment.mp3 | 18-Apr-2007 20:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | lanose.mp3 | 18-Apr-2007 20:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | lanson.mp3 | 18-Apr-2007 20:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | laoag.mp3 | 18-Apr-2007 21:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | laodice.mp3 | 18-Apr-2007 21:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | laomedon.mp3 | 18-Apr-2007 21:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | lapaz.mp3 | 18-Apr-2007 21:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | laplata.mp3 | 18-Apr-2007 21:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | lapsible.mp3 | 18-Apr-2007 21:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | laqueus.mp3 | 18-Apr-2007 21:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | larrocha.mp3 | 18-Apr-2007 21:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | lascelles.mp3 | 18-Apr-2007 21:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | lasdun.mp3 | 18-Apr-2007 21:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | laspezia.mp3 | 18-Apr-2007 21:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | lasque.mp3 | 18-Apr-2007 21:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | lassitude.mp3 | 18-Apr-2007 21:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | lassus.mp3 | 18-Apr-2007 21:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | lastingly.mp3 | 18-Apr-2007 21:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | latinic.mp3 | 18-Apr-2007 21:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | latrappe.mp3 | 18-Apr-2007 21:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | laudatory.mp3 | 18-Apr-2007 21:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | launchpad.mp3 | 18-Apr-2007 21:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | lavaret.mp3 | 18-Apr-2007 21:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | lawbreaker.mp3 | 18-Apr-2007 21:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | lawmaking.mp3 | 18-Apr-2007 21:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | laypeople.mp3 | 18-Apr-2007 21:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | laywoman.mp3 | 18-Apr-2007 21:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | lazyish.mp3 | 18-Apr-2007 21:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | ld.mp3 | 18-Apr-2007 21:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | ldopa.mp3 | 18-Apr-2007 21:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | leaf-cutter.mp3 | 18-Apr-2007 21:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | learnedness.mp3 | 18-Apr-2007 21:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | lebes.mp3 | 18-Apr-2007 21:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | lebesgue.mp3 | 18-Apr-2007 21:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | lecid.mp3 | 18-Apr-2007 21:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | lectureship.mp3 | 18-Apr-2007 21:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | lecuona.mp3 | 18-Apr-2007 21:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | left-hander.mp3 | 18-Apr-2007 21:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | legalism.mp3 | 18-Apr-2007 21:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | legatine.mp3 | 18-Apr-2007 21:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | legioned.mp3 | 18-Apr-2007 21:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | lemass.mp3 | 18-Apr-2007 21:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | lemessus.mp3 | 18-Apr-2007 21:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | leniency.mp3 | 18-Apr-2007 21:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | lenotre.mp3 | 18-Apr-2007 21:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | lenox.mp3 | 18-Apr-2007 21:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | leonov.mp3 | 18-Apr-2007 21:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | lepidolite.mp3 | 18-Apr-2007 21:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | leprose.mp3 | 18-Apr-2007 21:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | lepsy.mp3 | 18-Apr-2007 21:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | lethality.mp3 | 18-Apr-2007 21:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | leukemid.mp3 | 18-Apr-2007 21:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | leukorrheal.mp3 | 18-Apr-2007 21:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | levelheaded.mp3 | 18-Apr-2007 22:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | liatris.mp3 | 18-Apr-2007 22:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | liberec.mp3 | 18-Apr-2007 22:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | liberius.mp3 | 18-Apr-2007 22:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | libertas.mp3 | 18-Apr-2007 22:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | librettist.mp3 | 18-Apr-2007 22:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | licorous.mp3 | 18-Apr-2007 22:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | lidocaine.mp3 | 18-Apr-2007 22:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | lifework.mp3 | 18-Apr-2007 22:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | ligeti.mp3 | 18-Apr-2007 22:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | light-fingered.mp3 | 18-Apr-2007 22:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | light-rail.mp3 | 18-Apr-2007 22:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | lightfast.mp3 | 18-Apr-2007 22:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | lights-out.mp3 | 18-Apr-2007 22:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | lignify.mp3 | 18-Apr-2007 22:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | lignivorous.mp3 | 18-Apr-2007 22:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | likud.mp3 | 18-Apr-2007 22:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | lilangeni.mp3 | 18-Apr-2007 22:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | lillets.mp3 | 18-Apr-2007 22:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | limacon.mp3 | 18-Apr-2007 22:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | limbate.mp3 | 18-Apr-2007 22:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | lime-twig.mp3 | 18-Apr-2007 22:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | limicolous.mp3 | 18-Apr-2007 22:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | limitative.mp3 | 18-Apr-2007 22:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | linebred.mp3 | 18-Apr-2007 22:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | lingulate.mp3 | 18-Apr-2007 22:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | linoleate.mp3 | 18-Apr-2007 22:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | linseed.mp3 | 18-Apr-2007 22:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | lipase.mp3 | 18-Apr-2007 22:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | lippold.mp3 | 18-Apr-2007 22:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | liquation.mp3 | 18-Apr-2007 22:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | listener-in.mp3 | 18-Apr-2007 22:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | listerize.mp3 | 18-Apr-2007 22:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | liston.mp3 | 18-Apr-2007 22:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | litek.mp3 | 18-Apr-2007 22:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | literage.mp3 | 18-Apr-2007 22:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | literality.mp3 | 18-Apr-2007 22:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | literati.mp3 | 18-Apr-2007 22:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | lithesome.mp3 | 18-Apr-2007 22:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | lithograph.mp3 | 18-Apr-2007 22:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | lithomarge.mp3 | 18-Apr-2007 22:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | lithophane.mp3 | 18-Apr-2007 22:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | lithophone.mp3 | 18-Apr-2007 22:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | lithopone.mp3 | 18-Apr-2007 22:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | litigation.mp3 | 18-Apr-2007 22:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | liturgics.mp3 | 18-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | liveload.mp3 | 18-Apr-2007 22:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | liveoak.mp3 | 18-Apr-2007 22:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | liverrot.mp3 | 18-Apr-2007 22:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | lobation.mp3 | 18-Apr-2007 22:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | lobulus.mp3 | 18-Apr-2007 22:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | localwind.mp3 | 18-Apr-2007 22:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | locant.mp3 | 18-Apr-2007 22:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | lochness.mp3 | 18-Apr-2007 22:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | lockbox.mp3 | 18-Apr-2007 22:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | locker-room.mp3 | 18-Apr-2007 22:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | lockit.mp3 | 18-Apr-2007 22:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | lockwood.mp3 | 18-Apr-2007 22:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | locomotive.mp3 | 18-Apr-2007 22:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | locoweed.mp3 | 18-Apr-2007 22:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | loellingite.mp3 | 18-Apr-2007 22:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | loftsman.mp3 | 18-Apr-2007 22:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | loggias.mp3 | 18-Apr-2007 22:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | logion.mp3 | 18-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | logistical.mp3 | 18-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | logistics.mp3 | 18-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | lognormal.mp3 | 18-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | logogriph.mp3 | 18-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | lommix.mp3 | 18-Apr-2007 23:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | londonesque.mp3 | 18-Apr-2007 23:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | londres.mp3 | 18-Apr-2007 23:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | loneliness.mp3 | 18-Apr-2007 23:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | longbow.mp3 | 18-Apr-2007 23:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | longess.mp3 | 18-Apr-2007 23:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | longhair.mp3 | 18-Apr-2007 23:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | longhorn.mp3 | 18-Apr-2007 23:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | loniten.mp3 | 18-Apr-2007 23:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | look-see.mp3 | 18-Apr-2007 23:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | lookdown.mp3 | 18-Apr-2007 23:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | looksism.mp3 | 18-Apr-2007 23:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | loquitur.mp3 | 18-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | lorcha.mp3 | 18-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | lords.mp3 | 18-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | louisburg.mp3 | 18-Apr-2007 23:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | lovebug.mp3 | 18-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | lovefest.mp3 | 18-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | low-level.mp3 | 18-Apr-2007 23:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | lowbrow.mp3 | 18-Apr-2007 23:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | loxie.mp3 | 18-Apr-2007 23:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | lozenged.mp3 | 18-Apr-2007 23:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | luanshya.mp3 | 18-Apr-2007 23:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | luapula.mp3 | 18-Apr-2007 23:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | luces.mp3 | 18-Apr-2007 23:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | lucinda.mp3 | 18-Apr-2007 23:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | lucrative.mp3 | 18-Apr-2007 23:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | luftwaffe.mp3 | 18-Apr-2007 23:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | lugosi.mp3 | 18-Apr-2007 23:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | lugsail.mp3 | 18-Apr-2007 23:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | lugubrious.mp3 | 18-Apr-2007 23:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | luktung.mp3 | 18-Apr-2007 23:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | lumbago.mp3 | 18-Apr-2007 23:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | lumbrical.mp3 | 18-Apr-2007 23:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | lumhat.mp3 | 18-Apr-2007 23:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | lumisome.mp3 | 18-Apr-2007 23:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | lumpus.mp3 | 18-Apr-2007 23:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | lunarnaut.mp3 | 18-Apr-2007 23:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | lupous.mp3 | 18-Apr-2007 23:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | lustable.mp3 | 18-Apr-2007 23:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | lustered.mp3 | 18-Apr-2007 23:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | lutanist.mp3 | 18-Apr-2007 23:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | lutenist.mp3 | 18-Apr-2007 23:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | lutherism.mp3 | 18-Apr-2007 23:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | lutose.mp3 | 18-Apr-2007 23:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | luxation.mp3 | 18-Apr-2007 23:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | lymphatic.mp3 | 18-Apr-2007 23:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | lynchet.mp3 | 18-Apr-2007 23:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | lynching.mp3 | 18-Apr-2007 23:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | lynx-eyed.mp3 | 18-Apr-2007 23:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | lyrids.mp3 | 18-Apr-2007 23:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | lysi.mp3 | 18-Apr-2007 23:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | lysithea.mp3 | 18-Apr-2007 23:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | lysogenic.mp3 | 18-Apr-2007 23:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | lyte.mp3 | 18-Apr-2007 23:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | lyubertsy.mp3 | 18-Apr-2007 23:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | L'Estrange.mp3 | 18-Apr-2007 21:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | LP.mp3 | 18-Apr-2007 23:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | La Rochelle.mp3 | 18-Apr-2007 20:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | La Vendee.mp3 | 18-Apr-2007 20:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | Labuan.mp3 | 18-Apr-2007 20:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lamaistic.mp3 | 18-Apr-2007 20:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lamarckism.mp3 | 18-Apr-2007 20:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | Land's End.mp3 | 18-Apr-2007 20:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | Landsteiner.mp3 | 18-Apr-2007 20:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | Laveran.mp3 | 18-Apr-2007 21:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lawrencian.mp3 | 18-Apr-2007 21:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lebenswelt.mp3 | 18-Apr-2007 21:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | Leicestershire.mp3 | 18-Apr-2007 21:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | Leinsdorf.mp3 | 18-Apr-2007 21:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lesbos.mp3 | 18-Apr-2007 21:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | Levkas.mp3 | 18-Apr-2007 22:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | Liberian.mp3 | 18-Apr-2007 22:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | Liddell Hart.mp3 | 18-Apr-2007 22:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | Limpopo.mp3 | 18-Apr-2007 22:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lincolnshire.mp3 | 18-Apr-2007 22:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | Linlithgow.mp3 | 18-Apr-2007 22:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lohengrin.mp3 | 18-Apr-2007 23:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lollardism.mp3 | 18-Apr-2007 23:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lombardia.mp3 | 18-Apr-2007 23:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | Loyang.mp3 | 18-Apr-2007 23:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lutetia.mp3 | 18-Apr-2007 23:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lyallpur.mp3 | 18-Apr-2007 23:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | Lycurgus.mp3 | 18-Apr-2007 23:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | labatt.mp3 | 18-Apr-2007 20:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | lablab.mp3 | 18-Apr-2007 20:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | labourite.mp3 | 18-Apr-2007 20:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | lacerated.mp3 | 18-Apr-2007 20:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | lacertid.mp3 | 18-Apr-2007 20:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | lachesis.mp3 | 18-Apr-2007 20:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | lackluster.mp3 | 18-Apr-2007 20:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | lactescent.mp3 | 18-Apr-2007 20:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | ladyfinger.mp3 | 18-Apr-2007 20:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | laeotropic.mp3 | 18-Apr-2007 20:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | lafollette.mp3 | 18-Apr-2007 20:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | laicize.mp3 | 18-Apr-2007 20:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | lame-duck.mp3 | 18-Apr-2007 20:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | lamebrained.mp3 | 18-Apr-2007 20:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | lamination.mp3 | 18-Apr-2007 20:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | lampoon.mp3 | 18-Apr-2007 20:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | lancewood.mp3 | 18-Apr-2007 20:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | landform.mp3 | 18-Apr-2007 20:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | landgrab.mp3 | 18-Apr-2007 20:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | landholder.mp3 | 18-Apr-2007 20:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | landowning.mp3 | 18-Apr-2007 20:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | landsat.mp3 | 18-Apr-2007 20:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | landslid.mp3 | 18-Apr-2007 20:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | langlaufer.mp3 | 18-Apr-2007 20:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | langsat.mp3 | 18-Apr-2007 20:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | languette.mp3 | 18-Apr-2007 20:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | laniferous.mp3 | 18-Apr-2007 20:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | lansquenet.mp3 | 18-Apr-2007 20:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | lanthanide.mp3 | 18-Apr-2007 20:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | lanthanoid.mp3 | 18-Apr-2007 20:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | lapidary.mp3 | 18-Apr-2007 21:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | lapidate.mp3 | 18-Apr-2007 21:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | lapidist.mp3 | 18-Apr-2007 21:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | lapsable.mp3 | 18-Apr-2007 21:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | larcenist.mp3 | 18-Apr-2007 21:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | lardaceous.mp3 | 18-Apr-2007 21:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | larithmics.mp3 | 18-Apr-2007 21:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | larkspur.mp3 | 18-Apr-2007 21:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | lascivious.mp3 | 18-Apr-2007 21:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | lascruces.mp3 | 18-Apr-2007 21:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | lastex.mp3 | 18-Apr-2007 21:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | laticifer.mp3 | 18-Apr-2007 21:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | latinity.mp3 | 18-Apr-2007 21:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | latitude.mp3 | 18-Apr-2007 21:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | latter-day.mp3 | 18-Apr-2007 21:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | latuque.mp3 | 18-Apr-2007 21:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | laughingly.mp3 | 18-Apr-2007 21:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | laurate.mp3 | 18-Apr-2007 21:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | lautrec.mp3 | 18-Apr-2007 21:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | lay-by.mp3 | 18-Apr-2007 21:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | laziness.mp3 | 18-Apr-2007 21:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | leadfoot.mp3 | 18-Apr-2007 21:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | leading edge.mp3 | 18-Apr-2007 21:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | lead line.mp3 | 18-Apr-2007 21:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | leadman.mp3 | 18-Apr-2007 21:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | leadwort.mp3 | 18-Apr-2007 21:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | leakance.mp3 | 18-Apr-2007 21:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | leat.mp3 | 18-Apr-2007 21:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | lecrac.mp3 | 18-Apr-2007 21:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | left-handed.mp3 | 18-Apr-2007 21:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | legibility.mp3 | 18-Apr-2007 21:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | legitimist.mp3 | 18-Apr-2007 21:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | lehmbruck.mp3 | 18-Apr-2007 21:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | lekythus.mp3 | 18-Apr-2007 21:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | lemniscus.mp3 | 18-Apr-2007 21:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | lenitic.mp3 | 18-Apr-2007 21:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | leporid.mp3 | 18-Apr-2007 21:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | leporide.mp3 | 18-Apr-2007 21:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | leucosis.mp3 | 18-Apr-2007 21:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | leukemoid.mp3 | 18-Apr-2007 21:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | leukopenia.mp3 | 18-Apr-2007 21:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | leuricus.mp3 | 18-Apr-2007 21:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | levade.mp3 | 18-Apr-2007 21:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | levertov.mp3 | 18-Apr-2007 22:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | levulose.mp3 | 18-Apr-2007 22:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | leypoldt.mp3 | 18-Apr-2007 22:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | liegroup.mp3 | 18-Apr-2007 22:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | lieut.mp3 | 18-Apr-2007 22:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | life-form.mp3 | 18-Apr-2007 22:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | lifesaving.mp3 | 18-Apr-2007 22:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | ligeance.mp3 | 18-Apr-2007 22:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | lilaceous.mp3 | 18-Apr-2007 22:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | limequat.mp3 | 18-Apr-2007 22:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | limousine.mp3 | 18-Apr-2007 22:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | limp-wristed.mp3 | 18-Apr-2007 22:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | linarite.mp3 | 18-Apr-2007 22:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | linebacker.mp3 | 18-Apr-2007 22:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | lineolate.mp3 | 18-Apr-2007 22:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | linguine.mp3 | 18-Apr-2007 22:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | linguini.mp3 | 18-Apr-2007 22:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | linksland.mp3 | 18-Apr-2007 22:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | lipocyte.mp3 | 18-Apr-2007 22:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | liposome.mp3 | 18-Apr-2007 22:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | lipread.mp3 | 18-Apr-2007 22:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | liquefier.mp3 | 18-Apr-2007 22:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | liquidator.mp3 | 18-Apr-2007 22:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | liriope.mp3 | 18-Apr-2007 22:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | listenership.mp3 | 18-Apr-2007 22:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | literalness.mp3 | 18-Apr-2007 22:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | litharge.mp3 | 18-Apr-2007 22:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | lithotrite.mp3 | 18-Apr-2007 22:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | livability.mp3 | 18-Apr-2007 22:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | liveability.mp3 | 18-Apr-2007 22:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | live oak.mp3 | 18-Apr-2007 22:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | liverfluke.mp3 | 18-Apr-2007 22:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | liverwurst.mp3 | 18-Apr-2007 22:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | livestock.mp3 | 18-Apr-2007 22:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | livetrap.mp3 | 18-Apr-2007 22:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | lizbeth.mp3 | 18-Apr-2007 22:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | lo-fi.mp3 | 18-Apr-2007 22:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | lobbyism.mp3 | 18-Apr-2007 22:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | lobstering.mp3 | 18-Apr-2007 22:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | lobsterman.mp3 | 18-Apr-2007 22:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | lobstick.mp3 | 18-Apr-2007 22:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | locatable.mp3 | 18-Apr-2007 22:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | loccit.mp3 | 18-Apr-2007 22:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | lockport.mp3 | 18-Apr-2007 22:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | lockstitch.mp3 | 18-Apr-2007 22:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | locoism.mp3 | 18-Apr-2007 22:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | loftily.mp3 | 18-Apr-2007 22:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | logician.mp3 | 18-Apr-2007 22:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | logist.mp3 | 18-Apr-2007 22:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | logperch.mp3 | 18-Apr-2007 23:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | lollingite.mp3 | 18-Apr-2007 23:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | long-ago.mp3 | 18-Apr-2007 23:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | longitude.mp3 | 18-Apr-2007 23:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | looker-on.mp3 | 18-Apr-2007 23:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | loose-leaf.mp3 | 18-Apr-2007 23:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | lophodont.mp3 | 18-Apr-2007 23:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | lophophore.mp3 | 18-Apr-2007 23:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | lopsided.mp3 | 18-Apr-2007 23:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | lovecraft.mp3 | 18-Apr-2007 23:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | lovingest.mp3 | 18-Apr-2007 23:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | low-down.mp3 | 18-Apr-2007 23:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | low-keyed.mp3 | 18-Apr-2007 23:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | low-slung.mp3 | 18-Apr-2007 23:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | lowborn.mp3 | 18-Apr-2007 23:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | lowlives.mp3 | 18-Apr-2007 23:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | loxodont.mp3 | 18-Apr-2007 23:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | lubricious.mp3 | 18-Apr-2007 23:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | luciferin.mp3 | 18-Apr-2007 23:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | lucubrate.mp3 | 18-Apr-2007 23:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | luminaria.mp3 | 18-Apr-2007 23:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | lumpectomy.mp3 | 18-Apr-2007 23:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | lunarscape.mp3 | 18-Apr-2007 23:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | lunulate.mp3 | 18-Apr-2007 23:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | lupercus.mp3 | 18-Apr-2007 23:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | lusterware.mp3 | 18-Apr-2007 23:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | lutestring.mp3 | 18-Apr-2007 23:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | lycanthrope.mp3 | 18-Apr-2007 23:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | lyceum.mp3 | 18-Apr-2007 23:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | lychnoscope.mp3 | 18-Apr-2007 23:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | lycoris.mp3 | 18-Apr-2007 23:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | lygaeid.mp3 | 18-Apr-2007 23:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | lymphogram.mp3 | 18-Apr-2007 23:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | lymphokine.mp3 | 18-Apr-2007 23:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | lyrebird.mp3 | 18-Apr-2007 23:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | lysosome.mp3 | 18-Apr-2007 23:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | La Cumbre.mp3 | 18-Apr-2007 20:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | La Valliere.mp3 | 18-Apr-2007 20:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lacedaemon.mp3 | 18-Apr-2007 20:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lagerlof.mp3 | 18-Apr-2007 20:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lagrange.mp3 | 18-Apr-2007 20:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lake Leopold II.mp3 | 18-Apr-2007 20:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lamaist.mp3 | 18-Apr-2007 20:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lamartine.mp3 | 18-Apr-2007 20:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | Landrace.mp3 | 18-Apr-2007 20:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | Laristan.mp3 | 18-Apr-2007 21:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | Legnica.mp3 | 18-Apr-2007 21:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | Leningrader.mp3 | 18-Apr-2007 21:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | Leninism.mp3 | 18-Apr-2007 21:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | Ligurian.mp3 | 18-Apr-2007 22:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | Limehouse.mp3 | 18-Apr-2007 22:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lindesnes.mp3 | 18-Apr-2007 22:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | Linotype.mp3 | 18-Apr-2007 22:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lithuania.mp3 | 18-Apr-2007 22:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lorelei.mp3 | 18-Apr-2007 23:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | Los Gatos.mp3 | 18-Apr-2007 23:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | Luichow.mp3 | 18-Apr-2007 23:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | Lunenburg.mp3 | 18-Apr-2007 23:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | lamasery.mp3 | 18-Apr-2007 20:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | lammergeier.mp3 | 18-Apr-2007 20:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | lammergeyer.mp3 | 18-Apr-2007 20:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | lamppost.mp3 | 18-Apr-2007 20:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | lancinating.mp3 | 18-Apr-2007 20:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | landlocked.mp3 | 18-Apr-2007 20:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | landlubberly.mp3 | 18-Apr-2007 20:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | langbeinite.mp3 | 18-Apr-2007 20:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | langue d'oil.mp3 | 18-Apr-2007 20:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | lankiness.mp3 | 18-Apr-2007 20:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | lapful.mp3 | 18-Apr-2007 21:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | larvicide.mp3 | 18-Apr-2007 21:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | latices.mp3 | 18-Apr-2007 21:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | latosolic.mp3 | 18-Apr-2007 21:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | laureateship.mp3 | 18-Apr-2007 21:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | layperson.mp3 | 18-Apr-2007 21:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | lead time.mp3 | 18-Apr-2007 21:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | legalizer.mp3 | 18-Apr-2007 21:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | leghold trap.mp3 | 18-Apr-2007 21:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | leguminous.mp3 | 18-Apr-2007 21:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | lemnisci.mp3 | 18-Apr-2007 21:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | lengthiness.mp3 | 18-Apr-2007 21:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | lenticule.mp3 | 18-Apr-2007 21:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | leptotene.mp3 | 18-Apr-2007 21:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | leukemia.mp3 | 18-Apr-2007 21:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | leukoses.mp3 | 18-Apr-2007 21:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | levitation.mp3 | 18-Apr-2007 22:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | libation.mp3 | 18-Apr-2007 22:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | libecchio.mp3 | 18-Apr-2007 22:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | liberation.mp3 | 18-Apr-2007 22:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | licensure.mp3 | 18-Apr-2007 22:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | licentious.mp3 | 18-Apr-2007 22:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | life-support.mp3 | 18-Apr-2007 22:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | lifeguard.mp3 | 18-Apr-2007 22:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | lifelong.mp3 | 18-Apr-2007 22:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | lifesaver.mp3 | 18-Apr-2007 22:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | likability.mp3 | 18-Apr-2007 22:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | lily-white.mp3 | 18-Apr-2007 22:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | linearity.mp3 | 18-Apr-2007 22:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | lionhearted.mp3 | 18-Apr-2007 22:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | lipomata.mp3 | 18-Apr-2007 22:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | liquidize.mp3 | 18-Apr-2007 22:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | literature.mp3 | 18-Apr-2007 22:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | lithography.mp3 | 18-Apr-2007 22:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | lithology.mp3 | 18-Apr-2007 22:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | lithosol.mp3 | 18-Apr-2007 22:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | lithosphere.mp3 | 18-Apr-2007 22:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | live-box.mp3 | 18-Apr-2007 22:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | lixiviate.mp3 | 18-Apr-2007 22:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | lobectomy.mp3 | 18-Apr-2007 22:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | lobsterlike.mp3 | 18-Apr-2007 22:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | locational.mp3 | 18-Apr-2007 22:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | lodestone.mp3 | 18-Apr-2007 22:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | logjam.mp3 | 18-Apr-2007 22:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | logogram.mp3 | 18-Apr-2007 22:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | logograph.mp3 | 18-Apr-2007 22:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | long-liner.mp3 | 18-Apr-2007 23:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | longhouse.mp3 | 18-Apr-2007 23:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | long shot.mp3 | 18-Apr-2007 23:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | loosestrife.mp3 | 18-Apr-2007 23:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | loquacity.mp3 | 18-Apr-2007 23:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | low-minded.mp3 | 18-Apr-2007 23:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | lowbred.mp3 | 18-Apr-2007 23:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | lubberliness.mp3 | 18-Apr-2007 23:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | lubricator.mp3 | 18-Apr-2007 23:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | lucency.mp3 | 18-Apr-2007 23:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | luftmensch.mp3 | 18-Apr-2007 23:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | lumberyard.mp3 | 18-Apr-2007 23:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | lycopod.mp3 | 18-Apr-2007 23:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | lycosid.mp3 | 18-Apr-2007 23:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | lymphomata.mp3 | 18-Apr-2007 23:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | lyophile.mp3 | 18-Apr-2007 23:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | lyricalness.mp3 | 18-Apr-2007 23:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | LCD.mp3 | 18-Apr-2007 21:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | Laertes.mp3 | 18-Apr-2007 20:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lamaism.mp3 | 18-Apr-2007 20:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | Landowska.mp3 | 18-Apr-2007 20:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | Landsmaal.mp3 | 18-Apr-2007 20:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | Landsmal.mp3 | 18-Apr-2007 20:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | Langobard.mp3 | 18-Apr-2007 20:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | Las Vegas.mp3 | 18-Apr-2007 21:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | Launceston.mp3 | 18-Apr-2007 21:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | Le Puglie.mp3 | 18-Apr-2007 21:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | Leibnizian.mp3 | 18-Apr-2007 21:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | Leif Eriksson.mp3 | 18-Apr-2007 21:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lilongwe.mp3 | 18-Apr-2007 22:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | Linkoping.mp3 | 18-Apr-2007 22:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lipizzan.mp3 | 18-Apr-2007 22:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lipizzaner.mp3 | 18-Apr-2007 22:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lippizaner.mp3 | 18-Apr-2007 22:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | Logrono.mp3 | 18-Apr-2007 23:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | Londonderry.mp3 | 18-Apr-2007 23:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | Los Altos.mp3 | 18-Apr-2007 23:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lualaba.mp3 | 18-Apr-2007 23:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lucretius.mp3 | 18-Apr-2007 23:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | Lucullian.mp3 | 18-Apr-2007 23:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | lady-killer.mp3 | 18-Apr-2007 20:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | lambskin.mp3 | 18-Apr-2007 20:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | lampooner.mp3 | 18-Apr-2007 20:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | lampoonery.mp3 | 18-Apr-2007 20:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | land-grabber.mp3 | 18-Apr-2007 20:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | land-poor.mp3 | 18-Apr-2007 20:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | landfall.mp3 | 18-Apr-2007 20:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | landlord.mp3 | 18-Apr-2007 20:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | langlauf.mp3 | 18-Apr-2007 20:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | large-print.mp3 | 18-Apr-2007 21:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | latitudinal.mp3 | 18-Apr-2007 21:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | lauric acid.mp3 | 18-Apr-2007 21:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | lavatory.mp3 | 18-Apr-2007 21:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | lawfulness.mp3 | 18-Apr-2007 21:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | leadenness.mp3 | 18-Apr-2007 21:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | legerity.mp3 | 18-Apr-2007 21:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | legitimator.mp3 | 18-Apr-2007 21:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | leishmania.mp3 | 18-Apr-2007 21:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | lemures.mp3 | 18-Apr-2007 21:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | lepidoptera.mp3 | 18-Apr-2007 21:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | leprechaunish.mp3 | 18-Apr-2007 21:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | leptospire.mp3 | 18-Apr-2007 21:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | letterform.mp3 | 18-Apr-2007 21:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | levatores.mp3 | 18-Apr-2007 22:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | levigation.mp3 | 18-Apr-2007 22:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | libidinous.mp3 | 18-Apr-2007 22:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | life-care.mp3 | 18-Apr-2007 22:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | lifestyle.mp3 | 18-Apr-2007 22:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | lifeworld.mp3 | 18-Apr-2007 22:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | ligamentous.mp3 | 18-Apr-2007 22:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | lightplane.mp3 | 18-Apr-2007 22:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | lineality.mp3 | 18-Apr-2007 22:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | linebacking.mp3 | 18-Apr-2007 22:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | lingonberry.mp3 | 18-Apr-2007 22:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | linsang.mp3 | 18-Apr-2007 22:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | lionfish.mp3 | 18-Apr-2007 22:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | liposomal.mp3 | 18-Apr-2007 22:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | literarily.mp3 | 18-Apr-2007 22:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | lithologic.mp3 | 18-Apr-2007 22:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | lithotripter.mp3 | 18-Apr-2007 22:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | lithotriptor.mp3 | 18-Apr-2007 22:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | litotes.mp3 | 18-Apr-2007 22:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | liturgically.mp3 | 18-Apr-2007 22:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | lobulated.mp3 | 18-Apr-2007 22:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | localize.mp3 | 18-Apr-2007 22:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | lodestar.mp3 | 18-Apr-2007 22:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | lodicule.mp3 | 18-Apr-2007 22:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | logarithm.mp3 | 18-Apr-2007 22:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | logarithmic.mp3 | 18-Apr-2007 22:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | lognormally.mp3 | 18-Apr-2007 22:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | logorrhea.mp3 | 18-Apr-2007 23:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | logrolling.mp3 | 18-Apr-2007 23:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | long-run.mp3 | 18-Apr-2007 23:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | long-winded.mp3 | 18-Apr-2007 23:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | longeron.mp3 | 18-Apr-2007 23:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | lordosis.mp3 | 18-Apr-2007 23:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | loudmouth.mp3 | 18-Apr-2007 23:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | lowlihead.mp3 | 18-Apr-2007 23:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | lubricative.mp3 | 18-Apr-2007 23:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | luftmenschen.mp3 | 18-Apr-2007 23:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | luminesce.mp3 | 18-Apr-2007 23:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | lutetium.mp3 | 18-Apr-2007 23:38 | 9.1K | |
![[SND]](/icons/sound2.gif) | lymphographic.mp3 | 18-Apr-2007 23:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | lysimeter.mp3 | 18-Apr-2007 23:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | lysosomal.mp3 | 18-Apr-2007 23:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | La Linea.mp3 | 18-Apr-2007 20:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | La Mancha.mp3 | 18-Apr-2007 20:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | La Puente.mp3 | 18-Apr-2007 20:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | Lancaster.mp3 | 18-Apr-2007 20:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | Laodicea.mp3 | 18-Apr-2007 21:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | Laodicean.mp3 | 18-Apr-2007 21:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | Leonidas.mp3 | 18-Apr-2007 21:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | Leschetizky.mp3 | 18-Apr-2007 21:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | Liaoning.mp3 | 18-Apr-2007 22:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Liebknecht.mp3 | 18-Apr-2007 22:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | Lilliputian.mp3 | 18-Apr-2007 22:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | Lippizan.mp3 | 18-Apr-2007 22:33 | 9.3K | |
![[SND]](/icons/sound2.gif) | Litvinov.mp3 | 18-Apr-2007 22:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | Llanberis.mp3 | 18-Apr-2007 22:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | Lochgilphead.mp3 | 18-Apr-2007 22:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | Lombroso.mp3 | 18-Apr-2007 23:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | Long Xuyen.mp3 | 18-Apr-2007 23:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | Longinus.mp3 | 18-Apr-2007 23:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Louisiana.mp3 | 18-Apr-2007 23:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | Lubavitcher.mp3 | 18-Apr-2007 23:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | Luxemburger.mp3 | 18-Apr-2007 23:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | Lysimachus.mp3 | 18-Apr-2007 23:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | la-di-da.mp3 | 18-Apr-2007 20:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | la-la land.mp3 | 18-Apr-2007 20:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | lacerative.mp3 | 18-Apr-2007 20:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | lactational.mp3 | 18-Apr-2007 20:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | laid paper.mp3 | 18-Apr-2007 20:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | laminaria.mp3 | 18-Apr-2007 20:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | laminarin.mp3 | 18-Apr-2007 20:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | laminitis.mp3 | 18-Apr-2007 20:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | landholding.mp3 | 18-Apr-2007 20:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | landlessness.mp3 | 18-Apr-2007 20:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | laparotomy.mp3 | 18-Apr-2007 21:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | larynges.mp3 | 18-Apr-2007 21:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | latinize.mp3 | 18-Apr-2007 21:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | laundryman.mp3 | 18-Apr-2007 21:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | lavalava.mp3 | 18-Apr-2007 21:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | lawbreaking.mp3 | 18-Apr-2007 21:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | laxation.mp3 | 18-Apr-2007 21:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | leastways.mp3 | 18-Apr-2007 21:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | leastwise.mp3 | 18-Apr-2007 21:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | legalize.mp3 | 18-Apr-2007 21:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | legislature.mp3 | 18-Apr-2007 21:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | leishmanial.mp3 | 18-Apr-2007 21:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | lentamente.mp3 | 18-Apr-2007 21:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | lenticular.mp3 | 18-Apr-2007 21:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | letterpress.mp3 | 18-Apr-2007 21:56 | 9.3K | |
![[SND]](/icons/sound2.gif) | leviathan.mp3 | 18-Apr-2007 22:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | levitational.mp3 | 18-Apr-2007 22:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | liability.mp3 | 18-Apr-2007 22:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | liberalism.mp3 | 18-Apr-2007 22:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | liberalistic.mp3 | 18-Apr-2007 22:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | liberality.mp3 | 18-Apr-2007 22:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | liberatory.mp3 | 18-Apr-2007 22:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | libration.mp3 | 18-Apr-2007 22:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | licensable.mp3 | 18-Apr-2007 22:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | lieutenancy.mp3 | 18-Apr-2007 22:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | light-o'-love.mp3 | 18-Apr-2007 22:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | limnologic.mp3 | 18-Apr-2007 22:22 | 9.3K | |
![[SND]](/icons/sound2.gif) | lineation.mp3 | 18-Apr-2007 22:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | lingerie.mp3 | 18-Apr-2007 22:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | lingeringly.mp3 | 18-Apr-2007 22:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | lionize.mp3 | 18-Apr-2007 22:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | locked-in.mp3 | 18-Apr-2007 22:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | locksmithing.mp3 | 18-Apr-2007 22:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | locomotion.mp3 | 18-Apr-2007 22:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | locomotory.mp3 | 18-Apr-2007 22:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | logaoedic.mp3 | 18-Apr-2007 22:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | logistically.mp3 | 18-Apr-2007 22:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | logomachy.mp3 | 18-Apr-2007 22:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | loincloth.mp3 | 18-Apr-2007 23:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | longbowman.mp3 | 18-Apr-2007 23:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | longevity.mp3 | 18-Apr-2007 23:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | longline.mp3 | 18-Apr-2007 23:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | lotus-eater.mp3 | 18-Apr-2007 23:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | lovemaking.mp3 | 18-Apr-2007 23:19 | 9.3K | |
![[SND]](/icons/sound2.gif) | low-grade.mp3 | 18-Apr-2007 23:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | lowermost.mp3 | 18-Apr-2007 23:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | lukewarm.mp3 | 18-Apr-2007 23:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | lunisolar.mp3 | 18-Apr-2007 23:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | luxuriant.mp3 | 18-Apr-2007 23:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | LDL.mp3 | 18-Apr-2007 21:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | La Habana.mp3 | 18-Apr-2007 20:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | La Perouse.mp3 | 18-Apr-2007 20:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | Lagerkvist.mp3 | 18-Apr-2007 20:40 | 9.5K | |
![[SND]](/icons/sound2.gif) | Latinism.mp3 | 18-Apr-2007 21:13 | 9.5K | |
![[SND]](/icons/sound2.gif) | Les Eyzies.mp3 | 18-Apr-2007 21:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | Lietuva.mp3 | 18-Apr-2007 22:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | Lindenhurst.mp3 | 18-Apr-2007 22:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | Lippes loop.mp3 | 18-Apr-2007 22:33 | 9.5K | |
![[SND]](/icons/sound2.gif) | Llangefni.mp3 | 18-Apr-2007 22:47 | 9.5K | |
![[SND]](/icons/sound2.gif) | Lonsdale.mp3 | 18-Apr-2007 23:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | Louisiade Archipelago.mp3 | 18-Apr-2007 23:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | Luoyang.mp3 | 18-Apr-2007 23:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | labyrinthine.mp3 | 18-Apr-2007 20:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | lacrimation.mp3 | 18-Apr-2007 20:34 | 9.5K | |
![[SND]](/icons/sound2.gif) | lactogenic.mp3 | 18-Apr-2007 20:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | lamellibranch.mp3 | 18-Apr-2007 20:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | langouste.mp3 | 18-Apr-2007 20:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | lanuginous.mp3 | 18-Apr-2007 21:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | laparoscope.mp3 | 18-Apr-2007 21:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | largess.mp3 | 18-Apr-2007 21:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | largesse.mp3 | 18-Apr-2007 21:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | lathyrism.mp3 | 18-Apr-2007 21:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | latifundia.mp3 | 18-Apr-2007 21:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | laughingstock.mp3 | 18-Apr-2007 21:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | lavendering.mp3 | 18-Apr-2007 21:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | lawrencium.mp3 | 18-Apr-2007 21:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | lazaretto.mp3 | 18-Apr-2007 21:22 | 9.5K | |
![[SND]](/icons/sound2.gif) | leachability.mp3 | 18-Apr-2007 21:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | lead pencil.mp3 | 18-Apr-2007 21:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | lean-tos.mp3 | 18-Apr-2007 21:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | legitimism.mp3 | 18-Apr-2007 21:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | lemongrass.mp3 | 18-Apr-2007 21:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | lengthways.mp3 | 18-Apr-2007 21:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | lentando.mp3 | 18-Apr-2007 21:47 | 9.5K | |
![[SND]](/icons/sound2.gif) | lentissimo.mp3 | 18-Apr-2007 21:47 | 9.5K | |
![[SND]](/icons/sound2.gif) | leprosaria.mp3 | 18-Apr-2007 21:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | lethargically.mp3 | 18-Apr-2007 21:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | leukoplakic.mp3 | 18-Apr-2007 21:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | libeccio.mp3 | 18-Apr-2007 22:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | liberalize.mp3 | 18-Apr-2007 22:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | librational.mp3 | 18-Apr-2007 22:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | libriform.mp3 | 18-Apr-2007 22:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | lifeblood.mp3 | 18-Apr-2007 22:13 | 9.5K | |
![[SND]](/icons/sound2.gif) | limestone.mp3 | 18-Apr-2007 22:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | limitational.mp3 | 18-Apr-2007 22:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | limnology.mp3 | 18-Apr-2007 22:22 | 9.5K | |
![[SND]](/icons/sound2.gif) | linguistics.mp3 | 18-Apr-2007 22:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | lionizer.mp3 | 18-Apr-2007 22:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | literalism.mp3 | 18-Apr-2007 22:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | literalistic.mp3 | 18-Apr-2007 22:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | literalize.mp3 | 18-Apr-2007 22:38 | 9.5K | |
![[SND]](/icons/sound2.gif) | lithographic.mp3 | 18-Apr-2007 22:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | lithospheric.mp3 | 18-Apr-2007 22:40 | 9.5K | |
![[SND]](/icons/sound2.gif) | livelihood.mp3 | 18-Apr-2007 22:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | logographic.mp3 | 18-Apr-2007 22:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | lollygag.mp3 | 18-Apr-2007 23:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | longevous.mp3 | 18-Apr-2007 23:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | longicorn.mp3 | 18-Apr-2007 23:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | longueurs.mp3 | 18-Apr-2007 23:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | loudmouthed.mp3 | 18-Apr-2007 23:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | louma.mp3 | 18-Apr-2007 23:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | lovability.mp3 | 18-Apr-2007 23:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | luciferous.mp3 | 18-Apr-2007 23:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | luma.mp3 | 18-Apr-2007 23:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | lying-in.mp3 | 18-Apr-2007 23:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | lyme-hound.mp3 | 18-Apr-2007 23:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | lyonnaise.mp3 | 18-Apr-2007 23:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | lysimetric.mp3 | 18-Apr-2007 23:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | La Granja.mp3 | 18-Apr-2007 20:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lammastide.mp3 | 18-Apr-2007 20:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lancashire.mp3 | 18-Apr-2007 20:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lancelot.mp3 | 18-Apr-2007 20:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | Las Casas.mp3 | 18-Apr-2007 21:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | Las Cruces.mp3 | 18-Apr-2007 21:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lauderdale Lakes.mp3 | 18-Apr-2007 21:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lavoisier.mp3 | 18-Apr-2007 21:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lermontov.mp3 | 18-Apr-2007 21:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | Leverkusen.mp3 | 18-Apr-2007 22:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lilienthal.mp3 | 18-Apr-2007 22:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lithuanian.mp3 | 18-Apr-2007 22:40 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lodi.mp3 | 18-Apr-2007 22:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | Louis Philippe.mp3 | 18-Apr-2007 23:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | Luluabourg.mp3 | 18-Apr-2007 23:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | Lupercalia.mp3 | 18-Apr-2007 23:35 | 9.6K | |
![[SND]](/icons/sound2.gif) | landslide.mp3 | 18-Apr-2007 20:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | large-minded.mp3 | 18-Apr-2007 21:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | latchstring.mp3 | 18-Apr-2007 21:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | laureation.mp3 | 18-Apr-2007 21:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | lederhosen.mp3 | 18-Apr-2007 21:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | leeboard.mp3 | 18-Apr-2007 21:35 | 9.6K | |
![[SND]](/icons/sound2.gif) | left-brained.mp3 | 18-Apr-2007 21:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | legalistically.mp3 | 18-Apr-2007 21:37 | 9.6K | |
![[SND]](/icons/sound2.gif) | legislator.mp3 | 18-Apr-2007 21:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | legitimacy.mp3 | 18-Apr-2007 21:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | legitimize.mp3 | 18-Apr-2007 21:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | legitimizer.mp3 | 18-Apr-2007 21:40 | 9.6K | |
![[SND]](/icons/sound2.gif) | leitmotif.mp3 | 18-Apr-2007 21:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | leitmotiv.mp3 | 18-Apr-2007 21:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | lengthwise.mp3 | 18-Apr-2007 21:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | lepidopteran.mp3 | 18-Apr-2007 21:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | letterbox.mp3 | 18-Apr-2007 21:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | lexicality.mp3 | 18-Apr-2007 22:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | licentiate.mp3 | 18-Apr-2007 22:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | linearize.mp3 | 18-Apr-2007 22:25 | 9.6K | |
![[SND]](/icons/sound2.gif) | linebreeding.mp3 | 18-Apr-2007 22:26 | 9.6K | |
![[SND]](/icons/sound2.gif) | linguistical.mp3 | 18-Apr-2007 22:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | lipomatous.mp3 | 18-Apr-2007 22:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | lithotripsy.mp3 | 18-Apr-2007 22:40 | 9.6K | |
![[SND]](/icons/sound2.gif) | liturgical.mp3 | 18-Apr-2007 22:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | loadmaster.mp3 | 18-Apr-2007 22:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | lobe-finned.mp3 | 18-Apr-2007 22:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | lobscouse.mp3 | 18-Apr-2007 22:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | logocentric.mp3 | 18-Apr-2007 22:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | long-lining.mp3 | 18-Apr-2007 23:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | longanimity.mp3 | 18-Apr-2007 23:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | loud-hailer.mp3 | 18-Apr-2007 23:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | loungewear.mp3 | 18-Apr-2007 23:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | low-pressure.mp3 | 18-Apr-2007 23:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | luminosity.mp3 | 18-Apr-2007 23:31 | 9.6K | |
![[SND]](/icons/sound2.gif) | luteinize.mp3 | 18-Apr-2007 23:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | luteotrophic.mp3 | 18-Apr-2007 23:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | luxurious.mp3 | 18-Apr-2007 23:41 | 9.6K | |
![[SND]](/icons/sound2.gif) | lymphography.mp3 | 18-Apr-2007 23:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | lysogeny.mp3 | 18-Apr-2007 23:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | LPN.mp3 | 18-Apr-2007 23:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | La Bruyere.mp3 | 18-Apr-2007 20:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | La Camargue.mp3 | 18-Apr-2007 20:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | La Coruna.mp3 | 18-Apr-2007 20:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | La Mauricie National Park.mp3 | 18-Apr-2007 20:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | La Parida.mp3 | 18-Apr-2007 20:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | Labradorian.mp3 | 18-Apr-2007 20:31 | 9.8K | |
![[SND]](/icons/sound2.gif) | Lagrangian.mp3 | 18-Apr-2007 20:41 | 9.8K | |
![[SND]](/icons/sound2.gif) | Las Palmas.mp3 | 18-Apr-2007 21:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | Las Piedras.mp3 | 18-Apr-2007 21:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | Leni-Lenape.mp3 | 18-Apr-2007 21:46 | 9.8K | |
![[SND]](/icons/sound2.gif) | Lenni-Lenape.mp3 | 18-Apr-2007 21:46 | 9.8K | |
![[SND]](/icons/sound2.gif) | Leonardesque.mp3 | 18-Apr-2007 21:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | Leonides.mp3 | 18-Apr-2007 21:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | Liaotung.mp3 | 18-Apr-2007 22:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | Liaoyuan.mp3 | 18-Apr-2007 22:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | Linear B.mp3 | 18-Apr-2007 22:25 | 9.8K | |
![[SND]](/icons/sound2.gif) | Lingayen Gulf.mp3 | 18-Apr-2007 22:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | Litzmannstadt.mp3 | 18-Apr-2007 22:43 | 9.8K | |
![[SND]](/icons/sound2.gif) | Lobachevsky.mp3 | 18-Apr-2007 22:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | Lusitanian.mp3 | 18-Apr-2007 23:37 | 9.8K | |
![[SND]](/icons/sound2.gif) | Lutheranism.mp3 | 18-Apr-2007 23:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | laceration.mp3 | 18-Apr-2007 20:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | lachrymosity.mp3 | 18-Apr-2007 20:33 | 9.8K | |
![[SND]](/icons/sound2.gif) | lactation.mp3 | 18-Apr-2007 20:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | lactiferous.mp3 | 18-Apr-2007 20:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | lamb's-quarter.mp3 | 18-Apr-2007 20:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | lanceolate.mp3 | 18-Apr-2007 20:52 | 9.8K | |
![[SND]](/icons/sound2.gif) | landlordism.mp3 | 18-Apr-2007 20:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | lapidarian.mp3 | 18-Apr-2007 21:01 | 9.8K | |
![[SND]](/icons/sound2.gif) | laryngitis.mp3 | 18-Apr-2007 21:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | laryngoscope.mp3 | 18-Apr-2007 21:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | laudableness.mp3 | 18-Apr-2007 21:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | lazybones.mp3 | 18-Apr-2007 21:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | leave-taking.mp3 | 18-Apr-2007 21:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | lebensraum.mp3 | 18-Apr-2007 21:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | legislation.mp3 | 18-Apr-2007 21:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | lepromatous.mp3 | 18-Apr-2007 21:50 | 9.8K | |
![[SND]](/icons/sound2.gif) | lese-majeste.mp3 | 18-Apr-2007 21:53 | 9.8K | |
![[SND]](/icons/sound2.gif) | lese majesty.mp3 | 18-Apr-2007 21:53 | 9.8K | |
![[SND]](/icons/sound2.gif) | libertarian.mp3 | 18-Apr-2007 22:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | libertinage.mp3 | 18-Apr-2007 22:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | licensee.mp3 | 18-Apr-2007 22:09 | 9.8K | |
![[SND]](/icons/sound2.gif) | lightfastness.mp3 | 18-Apr-2007 22:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | like-minded.mp3 | 18-Apr-2007 22:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | lima bean.mp3 | 18-Apr-2007 22:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | linalool.mp3 | 18-Apr-2007 22:23 | 9.8K | |
![[SND]](/icons/sound2.gif) | line-item.mp3 | 18-Apr-2007 22:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | linecaster.mp3 | 18-Apr-2007 22:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | linecasting.mp3 | 18-Apr-2007 22:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | lithiasis.mp3 | 18-Apr-2007 22:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | lobulation.mp3 | 18-Apr-2007 22:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | loganberry.mp3 | 18-Apr-2007 22:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | logicalness.mp3 | 18-Apr-2007 22:58 | 9.8K | |
![[SND]](/icons/sound2.gif) | long-haired.mp3 | 18-Apr-2007 23:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | loquacious.mp3 | 18-Apr-2007 23:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | loudspeaker.mp3 | 18-Apr-2007 23:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | low-rise.mp3 | 18-Apr-2007 23:22 | 9.8K | |
![[SND]](/icons/sound2.gif) | luminescence.mp3 | 18-Apr-2007 23:31 | 9.8K | |
![[SND]](/icons/sound2.gif) | lustration.mp3 | 18-Apr-2007 23:37 | 9.8K | |
![[SND]](/icons/sound2.gif) | luteotropic.mp3 | 18-Apr-2007 23:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | lyophiled.mp3 | 18-Apr-2007 23:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | lysozyme.mp3 | 18-Apr-2007 23:52 | 9.8K | |
![[SND]](/icons/sound2.gif) | La Nina.mp3 | 18-Apr-2007 20:27 | 10K | |
![[SND]](/icons/sound2.gif) | La Rioja.mp3 | 18-Apr-2007 20:27 | 10K | |
![[SND]](/icons/sound2.gif) | Lancastrian.mp3 | 18-Apr-2007 20:52 | 10K | |
![[SND]](/icons/sound2.gif) | Langobardic.mp3 | 18-Apr-2007 20:57 | 10K | |
![[SND]](/icons/sound2.gif) | Le Bourget.mp3 | 18-Apr-2007 21:23 | 10K | |
![[SND]](/icons/sound2.gif) | Le Duc Tho.mp3 | 18-Apr-2007 21:23 | 10K | |
![[SND]](/icons/sound2.gif) | Leopoldville.mp3 | 18-Apr-2007 21:49 | 10K | |
![[SND]](/icons/sound2.gif) | Liaoyang.mp3 | 18-Apr-2007 22:05 | 10K | |
![[SND]](/icons/sound2.gif) | Llandrindod Wells.mp3 | 18-Apr-2007 22:47 | 10K | |
![[SND]](/icons/sound2.gif) | Lloyd George.mp3 | 18-Apr-2007 22:47 | 10K | |
![[SND]](/icons/sound2.gif) | Llullaillaco.mp3 | 18-Apr-2007 22:48 | 10K | |
![[SND]](/icons/sound2.gif) | Lombardian.mp3 | 18-Apr-2007 23:02 | 10K | |
![[SND]](/icons/sound2.gif) | Longobard.mp3 | 18-Apr-2007 23:06 | 10K | |
![[SND]](/icons/sound2.gif) | Longobardic.mp3 | 18-Apr-2007 23:06 | 10K | |
![[SND]](/icons/sound2.gif) | Lusitania.mp3 | 18-Apr-2007 23:37 | 10K | |
![[SND]](/icons/sound2.gif) | laminarian.mp3 | 18-Apr-2007 20:49 | 10K | |
![[SND]](/icons/sound2.gif) | langoustine.mp3 | 18-Apr-2007 20:57 | 10K | |
![[SND]](/icons/sound2.gif) | languishingly.mp3 | 18-Apr-2007 20:58 | 10K | |
![[SND]](/icons/sound2.gif) | lap-jointed.mp3 | 18-Apr-2007 21:02 | 10K | |
![[SND]](/icons/sound2.gif) | larvicidal.mp3 | 18-Apr-2007 21:07 | 10K | |
![[SND]](/icons/sound2.gif) | latus rectum.mp3 | 18-Apr-2007 21:15 | 10K | |
![[SND]](/icons/sound2.gif) | lecithinase.mp3 | 18-Apr-2007 21:33 | 10K | |
![[SND]](/icons/sound2.gif) | legislatorship.mp3 | 18-Apr-2007 21:39 | 10K | |
![[SND]](/icons/sound2.gif) | legitimation.mp3 | 18-Apr-2007 21:39 | 10K | |
![[SND]](/icons/sound2.gif) | leptocephalus.mp3 | 18-Apr-2007 21:51 | 10K | |
![[SND]](/icons/sound2.gif) | leptospiral.mp3 | 18-Apr-2007 21:52 | 10K | |
![[SND]](/icons/sound2.gif) | lespedeza.mp3 | 18-Apr-2007 21:53 | 10K | |
![[SND]](/icons/sound2.gif) | leucoplast.mp3 | 18-Apr-2007 21:57 | 10K | |
![[SND]](/icons/sound2.gif) | leukotriene.mp3 | 18-Apr-2007 21:59 | 10K | |
![[SND]](/icons/sound2.gif) | levamisole.mp3 | 18-Apr-2007 21:59 | 10K | |
![[SND]](/icons/sound2.gif) | lexicographic.mp3 | 18-Apr-2007 22:03 | 10K | |
![[SND]](/icons/sound2.gif) | librarian.mp3 | 18-Apr-2007 22:08 | 10K | |
![[SND]](/icons/sound2.gif) | libratory.mp3 | 18-Apr-2007 22:09 | 10K | |
![[SND]](/icons/sound2.gif) | lifemanship.mp3 | 18-Apr-2007 22:13 | 10K | |
![[SND]](/icons/sound2.gif) | light-of-love.mp3 | 18-Apr-2007 22:15 | 10K | |
![[SND]](/icons/sound2.gif) | linguistically.mp3 | 18-Apr-2007 22:28 | 10K | |
![[SND]](/icons/sound2.gif) | liposuction.mp3 | 18-Apr-2007 22:33 | 10K | |
![[SND]](/icons/sound2.gif) | lipotropic.mp3 | 18-Apr-2007 22:33 | 10K | |
![[SND]](/icons/sound2.gif) | liquidation.mp3 | 18-Apr-2007 22:35 | 10K | |
![[SND]](/icons/sound2.gif) | lithographer.mp3 | 18-Apr-2007 22:39 | 10K | |
![[SND]](/icons/sound2.gif) | live-bearer.mp3 | 18-Apr-2007 22:43 | 10K | |
![[SND]](/icons/sound2.gif) | logicality.mp3 | 18-Apr-2007 22:58 | 10K | |
![[SND]](/icons/sound2.gif) | logistician.mp3 | 18-Apr-2007 22:59 | 10K | |
![[SND]](/icons/sound2.gif) | long-lived.mp3 | 18-Apr-2007 23:06 | 10K | |
![[SND]](/icons/sound2.gif) | long-sighted.mp3 | 18-Apr-2007 23:06 | 10K | |
![[SND]](/icons/sound2.gif) | long johns.mp3 | 18-Apr-2007 23:04 | 10K | |
![[SND]](/icons/sound2.gif) | lotusland.mp3 | 18-Apr-2007 23:15 | 10K | |
![[SND]](/icons/sound2.gif) | loup-garou.mp3 | 18-Apr-2007 23:17 | 10K | |
![[SND]](/icons/sound2.gif) | loups-garous.mp3 | 18-Apr-2007 23:17 | 10K | |
![[SND]](/icons/sound2.gif) | lyam-hound.mp3 | 18-Apr-2007 23:41 | 10K | |
![[SND]](/icons/sound2.gif) | lymphomatous.mp3 | 18-Apr-2007 23:45 | 10K | |
![[SND]](/icons/sound2.gif) | LSD.mp3 | 18-Apr-2007 23:23 | 10K | |
![[SND]](/icons/sound2.gif) | La Serena.mp3 | 18-Apr-2007 20:27 | 10K | |
![[SND]](/icons/sound2.gif) | Lakshadweep.mp3 | 18-Apr-2007 20:45 | 10K | |
![[SND]](/icons/sound2.gif) | Lambrusco.mp3 | 18-Apr-2007 20:48 | 10K | |
![[SND]](/icons/sound2.gif) | Lassa fever.mp3 | 18-Apr-2007 21:09 | 10K | |
![[SND]](/icons/sound2.gif) | Lee's Birthday.mp3 | 18-Apr-2007 21:35 | 10K | |
![[SND]](/icons/sound2.gif) | Leone, Monte.mp3 | 18-Apr-2007 21:48 | 10K | |
![[SND]](/icons/sound2.gif) | Little Saint Bernard.mp3 | 18-Apr-2007 22:42 | 10K | |
![[SND]](/icons/sound2.gif) | Locofoco.mp3 | 18-Apr-2007 22:54 | 10K | |
![[SND]](/icons/sound2.gif) | Long Tom.mp3 | 18-Apr-2007 23:04 | 10K | |
![[SND]](/icons/sound2.gif) | Louisianan.mp3 | 18-Apr-2007 23:16 | 10K | |
![[SND]](/icons/sound2.gif) | Luciferian.mp3 | 18-Apr-2007 23:26 | 10K | |
![[SND]](/icons/sound2.gif) | Ludwigsburg.mp3 | 18-Apr-2007 23:28 | 10K | |
![[SND]](/icons/sound2.gif) | Lupercalian.mp3 | 18-Apr-2007 23:35 | 10K | |
![[SND]](/icons/sound2.gif) | lacto-ovo vegetarian.mp3 | 18-Apr-2007 20:36 | 10K | |
![[SND]](/icons/sound2.gif) | lamentation.mp3 | 18-Apr-2007 20:49 | 10K | |
![[SND]](/icons/sound2.gif) | landsliding.mp3 | 18-Apr-2007 20:55 | 10K | |
![[SND]](/icons/sound2.gif) | langostino.mp3 | 18-Apr-2007 20:57 | 10K | |
![[SND]](/icons/sound2.gif) | lang syne.mp3 | 18-Apr-2007 20:56 | 10K | |
![[SND]](/icons/sound2.gif) | latifundio.mp3 | 18-Apr-2007 21:12 | 10K | |
![[SND]](/icons/sound2.gif) | law-abiding.mp3 | 18-Apr-2007 21:20 | 10K | |
![[SND]](/icons/sound2.gif) | legerdemain.mp3 | 18-Apr-2007 21:38 | 10K | |
![[SND]](/icons/sound2.gif) | lepidopterist.mp3 | 18-Apr-2007 21:50 | 10K | |
![[SND]](/icons/sound2.gif) | leprosarium.mp3 | 18-Apr-2007 21:51 | 10K | |
![[SND]](/icons/sound2.gif) | lesbianism.mp3 | 18-Apr-2007 21:52 | 10K | |
![[SND]](/icons/sound2.gif) | letterboxed.mp3 | 18-Apr-2007 21:55 | 10K | |
![[SND]](/icons/sound2.gif) | lickety-split.mp3 | 18-Apr-2007 22:10 | 10K | |
![[SND]](/icons/sound2.gif) | lily-livered.mp3 | 18-Apr-2007 22:19 | 10K | |
![[SND]](/icons/sound2.gif) | lineamental.mp3 | 18-Apr-2007 22:25 | 10K | |
![[SND]](/icons/sound2.gif) | literariness.mp3 | 18-Apr-2007 22:38 | 10K | |
![[SND]](/icons/sound2.gif) | lithological.mp3 | 18-Apr-2007 22:40 | 10K | |
![[SND]](/icons/sound2.gif) | litterateur.mp3 | 18-Apr-2007 22:41 | 10K | |
![[SND]](/icons/sound2.gif) | live-forever.mp3 | 18-Apr-2007 22:44 | 10K | |
![[SND]](/icons/sound2.gif) | localizable.mp3 | 18-Apr-2007 22:51 | 10K | |
![[SND]](/icons/sound2.gif) | longspur.mp3 | 18-Apr-2007 23:06 | 10K | |
![[SND]](/icons/sound2.gif) | lothario.mp3 | 18-Apr-2007 23:14 | 10K | |
![[SND]](/icons/sound2.gif) | low-lying.mp3 | 18-Apr-2007 23:22 | 10K | |
![[SND]](/icons/sound2.gif) | luciferase.mp3 | 18-Apr-2007 23:26 | 10K | |
![[SND]](/icons/sound2.gif) | luminiferous.mp3 | 18-Apr-2007 23:31 | 10K | |
![[SND]](/icons/sound2.gif) | luna moth.mp3 | 18-Apr-2007 23:32 | 10K | |
![[SND]](/icons/sound2.gif) | luteotropin.mp3 | 18-Apr-2007 23:38 | 10K | |
![[SND]](/icons/sound2.gif) | luxuriate.mp3 | 18-Apr-2007 23:41 | 10K | |
![[SND]](/icons/sound2.gif) | lycanthropic.mp3 | 18-Apr-2007 23:42 | 10K | |
![[SND]](/icons/sound2.gif) | lycopodium.mp3 | 18-Apr-2007 23:42 | 10K | |
![[SND]](/icons/sound2.gif) | lymphoblast.mp3 | 18-Apr-2007 23:44 | 10K | |
![[SND]](/icons/sound2.gif) | lyophilize.mp3 | 18-Apr-2007 23:48 | 10K | |
![[SND]](/icons/sound2.gif) | La Spezia.mp3 | 18-Apr-2007 20:27 | 10K | |
![[SND]](/icons/sound2.gif) | Lag b'Omer.mp3 | 18-Apr-2007 20:40 | 10K | |
![[SND]](/icons/sound2.gif) | Laocoon.mp3 | 18-Apr-2007 21:00 | 10K | |
![[SND]](/icons/sound2.gif) | Laredo Bru.mp3 | 18-Apr-2007 21:04 | 10K | |
![[SND]](/icons/sound2.gif) | Leptis Magna.mp3 | 18-Apr-2007 21:51 | 10K | |
![[SND]](/icons/sound2.gif) | Lichtenstein.mp3 | 18-Apr-2007 22:10 | 10K | |
![[SND]](/icons/sound2.gif) | Lincolniana.mp3 | 18-Apr-2007 22:24 | 10K | |
![[SND]](/icons/sound2.gif) | Ljubljana.mp3 | 18-Apr-2007 22:46 | 10K | |
![[SND]](/icons/sound2.gif) | labradorite.mp3 | 18-Apr-2007 20:31 | 10K | |
![[SND]](/icons/sound2.gif) | labyrinthian.mp3 | 18-Apr-2007 20:31 | 10K | |
![[SND]](/icons/sound2.gif) | laciniation.mp3 | 18-Apr-2007 20:33 | 10K | |
![[SND]](/icons/sound2.gif) | lackadaisical.mp3 | 18-Apr-2007 20:33 | 10K | |
![[SND]](/icons/sound2.gif) | lackadaisically.mp3 | 18-Apr-2007 20:33 | 10K | |
![[SND]](/icons/sound2.gif) | largehearted.mp3 | 18-Apr-2007 21:05 | 10K | |
![[SND]](/icons/sound2.gif) | lateralize.mp3 | 18-Apr-2007 21:11 | 10K | |
![[SND]](/icons/sound2.gif) | latifundium.mp3 | 18-Apr-2007 21:12 | 10K | |
![[SND]](/icons/sound2.gif) | lentivirus.mp3 | 18-Apr-2007 21:47 | 10K | |
![[SND]](/icons/sound2.gif) | leptocephali.mp3 | 18-Apr-2007 21:51 | 10K | |
![[SND]](/icons/sound2.gif) | letterboxing.mp3 | 18-Apr-2007 21:55 | 10K | |
![[SND]](/icons/sound2.gif) | leukemogenic.mp3 | 18-Apr-2007 21:58 | 10K | |
![[SND]](/icons/sound2.gif) | lexicalize.mp3 | 18-Apr-2007 22:03 | 10K | |
![[SND]](/icons/sound2.gif) | lexicology.mp3 | 18-Apr-2007 22:03 | 10K | |
![[SND]](/icons/sound2.gif) | liebfraumilch.mp3 | 18-Apr-2007 22:11 | 10K | |
![[SND]](/icons/sound2.gif) | life-size.mp3 | 18-Apr-2007 22:13 | 10K | |
![[SND]](/icons/sound2.gif) | limnologist.mp3 | 18-Apr-2007 22:22 | 10K | |
![[SND]](/icons/sound2.gif) | lincomycin.mp3 | 18-Apr-2007 22:24 | 10K | |
![[SND]](/icons/sound2.gif) | lipogenesis.mp3 | 18-Apr-2007 22:32 | 10K | |
![[SND]](/icons/sound2.gif) | liquefaction.mp3 | 18-Apr-2007 22:34 | 10K | |
![[SND]](/icons/sound2.gif) | lithiases.mp3 | 18-Apr-2007 22:39 | 10K | |
![[SND]](/icons/sound2.gif) | loan-sharking.mp3 | 18-Apr-2007 22:49 | 10K | |
![[SND]](/icons/sound2.gif) | lobotomize.mp3 | 18-Apr-2007 22:50 | 10K | |
![[SND]](/icons/sound2.gif) | longshoring.mp3 | 18-Apr-2007 23:06 | 10K | |
![[SND]](/icons/sound2.gif) | longtime.mp3 | 18-Apr-2007 23:07 | 10K | |
![[SND]](/icons/sound2.gif) | lorazepam.mp3 | 18-Apr-2007 23:11 | 10K | |
![[SND]](/icons/sound2.gif) | lovey-dovey.mp3 | 18-Apr-2007 23:20 | 10K | |
![[SND]](/icons/sound2.gif) | lower-class.mp3 | 18-Apr-2007 23:20 | 10K | |
![[SND]](/icons/sound2.gif) | lowercase.mp3 | 18-Apr-2007 23:20 | 10K | |
![[SND]](/icons/sound2.gif) | lycanthropy.mp3 | 18-Apr-2007 23:42 | 10K | |
![[SND]](/icons/sound2.gif) | La Fontaine.mp3 | 18-Apr-2007 20:26 | 11K | |
![[SND]](/icons/sound2.gif) | LaFontaine.mp3 | 18-Apr-2007 20:40 | 11K | |
![[SND]](/icons/sound2.gif) | La Verendrye.mp3 | 18-Apr-2007 20:28 | 11K | |
![[SND]](/icons/sound2.gif) | Lambarene.mp3 | 18-Apr-2007 20:47 | 11K | |
![[SND]](/icons/sound2.gif) | Lamentations.mp3 | 18-Apr-2007 20:49 | 11K | |
![[SND]](/icons/sound2.gif) | Laurencin.mp3 | 18-Apr-2007 21:17 | 11K | |
![[SND]](/icons/sound2.gif) | Liechtenstein.mp3 | 18-Apr-2007 22:11 | 11K | |
![[SND]](/icons/sound2.gif) | Louis Seize.mp3 | 18-Apr-2007 23:16 | 11K | |
![[SND]](/icons/sound2.gif) | Lysenkoism.mp3 | 18-Apr-2007 23:50 | 11K | |
![[SND]](/icons/sound2.gif) | labialize.mp3 | 18-Apr-2007 20:29 | 11K | |
![[SND]](/icons/sound2.gif) | laborsaving.mp3 | 18-Apr-2007 20:30 | 11K | |
![[SND]](/icons/sound2.gif) | last-gasp.mp3 | 18-Apr-2007 21:10 | 11K | |
![[SND]](/icons/sound2.gif) | lazy Susan.mp3 | 18-Apr-2007 21:23 | 11K | |
![[SND]](/icons/sound2.gif) | legalization.mp3 | 18-Apr-2007 21:37 | 11K | |
![[SND]](/icons/sound2.gif) | lepidopterous.mp3 | 18-Apr-2007 21:50 | 11K | |
![[SND]](/icons/sound2.gif) | leucocidin.mp3 | 18-Apr-2007 21:57 | 11K | |
![[SND]](/icons/sound2.gif) | leukodystrophy.mp3 | 18-Apr-2007 21:58 | 11K | |
![[SND]](/icons/sound2.gif) | lexicographer.mp3 | 18-Apr-2007 22:03 | 11K | |
![[SND]](/icons/sound2.gif) | lichenology.mp3 | 18-Apr-2007 22:10 | 11K | |
![[SND]](/icons/sound2.gif) | life-sized.mp3 | 18-Apr-2007 22:13 | 11K | |
![[SND]](/icons/sound2.gif) | light-adapted.mp3 | 18-Apr-2007 22:15 | 11K | |
![[SND]](/icons/sound2.gif) | linguistician.mp3 | 18-Apr-2007 22:28 | 11K | |
![[SND]](/icons/sound2.gif) | lithification.mp3 | 18-Apr-2007 22:39 | 11K | |
![[SND]](/icons/sound2.gif) | lordoses.mp3 | 18-Apr-2007 23:11 | 11K | |
![[SND]](/icons/sound2.gif) | love-in-a-mist.mp3 | 18-Apr-2007 23:19 | 11K | |
![[SND]](/icons/sound2.gif) | lovelornness.mp3 | 18-Apr-2007 23:19 | 11K | |
![[SND]](/icons/sound2.gif) | lubrication.mp3 | 18-Apr-2007 23:24 | 11K | |
![[SND]](/icons/sound2.gif) | luteotrophin.mp3 | 18-Apr-2007 23:38 | 11K | |
![[SND]](/icons/sound2.gif) | lymphatically.mp3 | 18-Apr-2007 23:44 | 11K | |
![[SND]](/icons/sound2.gif) | lymphoblastic.mp3 | 18-Apr-2007 23:44 | 11K | |
![[SND]](/icons/sound2.gif) | lyophilizer.mp3 | 18-Apr-2007 23:49 | 11K | |
![[SND]](/icons/sound2.gif) | Laguna Niguel.mp3 | 18-Apr-2007 20:41 | 11K | |
![[SND]](/icons/sound2.gif) | Lepontine Alps.mp3 | 18-Apr-2007 21:50 | 11K | |
![[SND]](/icons/sound2.gif) | Levalloisian.mp3 | 18-Apr-2007 21:59 | 11K | |
![[SND]](/icons/sound2.gif) | Liechtensteiner.mp3 | 18-Apr-2007 22:11 | 11K | |
![[SND]](/icons/sound2.gif) | Liverpudlian.mp3 | 18-Apr-2007 22:45 | 11K | |
![[SND]](/icons/sound2.gif) | Los Angeles.mp3 | 18-Apr-2007 23:13 | 11K | |
![[SND]](/icons/sound2.gif) | Louis Treize.mp3 | 18-Apr-2007 23:16 | 11K | |
![[SND]](/icons/sound2.gif) | laboratory.mp3 | 18-Apr-2007 20:30 | 11K | |
![[SND]](/icons/sound2.gif) | laid-backness.mp3 | 18-Apr-2007 20:42 | 11K | |
![[SND]](/icons/sound2.gif) | laissez-faire.mp3 | 18-Apr-2007 20:43 | 11K | |
![[SND]](/icons/sound2.gif) | laryngology.mp3 | 18-Apr-2007 21:07 | 11K | |
![[SND]](/icons/sound2.gif) | laryngoscopy.mp3 | 18-Apr-2007 21:07 | 11K | |
![[SND]](/icons/sound2.gif) | lauryl alcohol.mp3 | 18-Apr-2007 21:18 | 11K | |
![[SND]](/icons/sound2.gif) | legendarily.mp3 | 18-Apr-2007 21:37 | 11K | |
![[SND]](/icons/sound2.gif) | legislatorial.mp3 | 18-Apr-2007 21:39 | 11K | |
![[SND]](/icons/sound2.gif) | legitimatize.mp3 | 18-Apr-2007 21:39 | 11K | |
![[SND]](/icons/sound2.gif) | letterspacing.mp3 | 18-Apr-2007 21:56 | 11K | |
![[SND]](/icons/sound2.gif) | leukopoietic.mp3 | 18-Apr-2007 21:59 | 11K | |
![[SND]](/icons/sound2.gif) | liberalizer.mp3 | 18-Apr-2007 22:07 | 11K | |
![[SND]](/icons/sound2.gif) | liberationist.mp3 | 18-Apr-2007 22:07 | 11K | |
![[SND]](/icons/sound2.gif) | libertinism.mp3 | 18-Apr-2007 22:08 | 11K | |
![[SND]](/icons/sound2.gif) | lithologically.mp3 | 18-Apr-2007 22:40 | 11K | |
![[SND]](/icons/sound2.gif) | longshoreman.mp3 | 18-Apr-2007 23:06 | 11K | |
![[SND]](/icons/sound2.gif) | lovastatin.mp3 | 18-Apr-2007 23:18 | 11K | |
![[SND]](/icons/sound2.gif) | low-spirited.mp3 | 18-Apr-2007 23:22 | 11K | |
![[SND]](/icons/sound2.gif) | loxodrome.mp3 | 18-Apr-2007 23:22 | 11K | |
![[SND]](/icons/sound2.gif) | Langerhans cell.mp3 | 18-Apr-2007 20:56 | 11K | |
![[SND]](/icons/sound2.gif) | Llandudno.mp3 | 18-Apr-2007 22:47 | 11K | |
![[SND]](/icons/sound2.gif) | Louisianian.mp3 | 18-Apr-2007 23:16 | 11K | |
![[SND]](/icons/sound2.gif) | Lubumbashi.mp3 | 18-Apr-2007 23:25 | 11K | |
![[SND]](/icons/sound2.gif) | labiodental.mp3 | 18-Apr-2007 20:29 | 11K | |
![[SND]](/icons/sound2.gif) | labiovelar.mp3 | 18-Apr-2007 20:29 | 11K | |
![[SND]](/icons/sound2.gif) | laisser-aller.mp3 | 18-Apr-2007 20:43 | 11K | |
![[SND]](/icons/sound2.gif) | landownership.mp3 | 18-Apr-2007 20:55 | 11K | |
![[SND]](/icons/sound2.gif) | laryngectomy.mp3 | 18-Apr-2007 21:07 | 11K | |
![[SND]](/icons/sound2.gif) | last-ditch.mp3 | 18-Apr-2007 21:10 | 11K | |
![[SND]](/icons/sound2.gif) | lexicography.mp3 | 18-Apr-2007 22:03 | 11K | |
![[SND]](/icons/sound2.gif) | libationary.mp3 | 18-Apr-2007 22:06 | 11K | |
![[SND]](/icons/sound2.gif) | lichenologist.mp3 | 18-Apr-2007 22:10 | 11K | |
![[SND]](/icons/sound2.gif) | lipolysis.mp3 | 18-Apr-2007 22:32 | 11K | |
![[SND]](/icons/sound2.gif) | lipotropin.mp3 | 18-Apr-2007 22:33 | 11K | |
![[SND]](/icons/sound2.gif) | live-action.mp3 | 18-Apr-2007 22:43 | 11K | |
![[SND]](/icons/sound2.gif) | lixiviation.mp3 | 18-Apr-2007 22:46 | 11K | |
![[SND]](/icons/sound2.gif) | long-range.mp3 | 18-Apr-2007 23:06 | 11K | |
![[SND]](/icons/sound2.gif) | long-term.mp3 | 18-Apr-2007 23:07 | 11K | |
![[SND]](/icons/sound2.gif) | lysolecithin.mp3 | 18-Apr-2007 23:52 | 11K | |
![[SND]](/icons/sound2.gif) | L-tryptophan.mp3 | 18-Apr-2007 23:23 | 11K | |
![[SND]](/icons/sound2.gif) | La Chaux-de-Fonds.mp3 | 18-Apr-2007 20:26 | 11K | |
![[SND]](/icons/sound2.gif) | Lac Saint-Jean.mp3 | 18-Apr-2007 20:31 | 11K | |
![[SND]](/icons/sound2.gif) | Lacedaemonian.mp3 | 18-Apr-2007 20:32 | 11K | |
![[SND]](/icons/sound2.gif) | Leconte de Lisle.mp3 | 18-Apr-2007 21:34 | 11K | |
![[SND]](/icons/sound2.gif) | Leyden jar.mp3 | 18-Apr-2007 22:04 | 11K | |
![[SND]](/icons/sound2.gif) | Linear A.mp3 | 18-Apr-2007 22:25 | 11K | |
![[SND]](/icons/sound2.gif) | Luxemburgian.mp3 | 18-Apr-2007 23:40 | 11K | |
![[SND]](/icons/sound2.gif) | lantern-jawed.mp3 | 18-Apr-2007 20:59 | 11K | |
![[SND]](/icons/sound2.gif) | laparoscopy.mp3 | 18-Apr-2007 21:01 | 11K | |
![[SND]](/icons/sound2.gif) | latinization.mp3 | 18-Apr-2007 21:13 | 11K | |
![[SND]](/icons/sound2.gif) | lignum vitae.mp3 | 18-Apr-2007 22:17 | 11K | |
![[SND]](/icons/sound2.gif) | long-suffering.mp3 | 18-Apr-2007 23:07 | 11K | |
![[SND]](/icons/sound2.gif) | loose-jointed.mp3 | 18-Apr-2007 23:09 | 11K | |
![[SND]](/icons/sound2.gif) | lucubration.mp3 | 18-Apr-2007 23:27 | 11K | |
![[SND]](/icons/sound2.gif) | lumbosacral.mp3 | 18-Apr-2007 23:30 | 11K | |
![[SND]](/icons/sound2.gif) | luxuriance.mp3 | 18-Apr-2007 23:40 | 11K | |
![[SND]](/icons/sound2.gif) | lysogenize.mp3 | 18-Apr-2007 23:52 | 11K | |
![[SND]](/icons/sound2.gif) | Lewis acid.mp3 | 18-Apr-2007 22:02 | 11K | |
![[SND]](/icons/sound2.gif) | Lewis and Clark Caverns.mp3 | 18-Apr-2007 22:02 | 11K | |
![[SND]](/icons/sound2.gif) | Lin Yu-t'ang.mp3 | 18-Apr-2007 22:23 | 11K | |
![[SND]](/icons/sound2.gif) | Los Angeleno.mp3 | 18-Apr-2007 23:13 | 11K | |
![[SND]](/icons/sound2.gif) | labyrinthodont.mp3 | 18-Apr-2007 20:31 | 11K | |
![[SND]](/icons/sound2.gif) | leishmaniasis.mp3 | 18-Apr-2007 21:42 | 11K | |
![[SND]](/icons/sound2.gif) | leukoplakia.mp3 | 18-Apr-2007 21:59 | 11K | |
![[SND]](/icons/sound2.gif) | lexicologist.mp3 | 18-Apr-2007 22:03 | 11K | |
![[SND]](/icons/sound2.gif) | lignification.mp3 | 18-Apr-2007 22:16 | 11K | |
![[SND]](/icons/sound2.gif) | limnological.mp3 | 18-Apr-2007 22:22 | 11K | |
![[SND]](/icons/sound2.gif) | listeriosis.mp3 | 18-Apr-2007 22:37 | 11K | |
![[SND]](/icons/sound2.gif) | literalization.mp3 | 18-Apr-2007 22:38 | 11K | |
![[SND]](/icons/sound2.gif) | logarithmically.mp3 | 18-Apr-2007 22:57 | 11K | |
![[SND]](/icons/sound2.gif) | logogrammatic.mp3 | 18-Apr-2007 22:59 | 11K | |
![[SND]](/icons/sound2.gif) | longitudinal.mp3 | 18-Apr-2007 23:05 | 11K | |
![[SND]](/icons/sound2.gif) | lose-lose.mp3 | 18-Apr-2007 23:13 | 11K | |
![[SND]](/icons/sound2.gif) | La Louviere.mp3 | 18-Apr-2007 20:27 | 11K | |
![[SND]](/icons/sound2.gif) | Li Hung-chang.mp3 | 18-Apr-2007 22:05 | 11K | |
![[SND]](/icons/sound2.gif) | Lobamba.mp3 | 18-Apr-2007 22:49 | 11K | |
![[SND]](/icons/sound2.gif) | l'etat, c'est moi.mp3 | 18-Apr-2007 21:54 | 11K | |
![[SND]](/icons/sound2.gif) | landscapist.mp3 | 18-Apr-2007 20:55 | 11K | |
![[SND]](/icons/sound2.gif) | lari.mp3 | 18-Apr-2007 21:05 | 11K | |
![[SND]](/icons/sound2.gif) | legitimization.mp3 | 18-Apr-2007 21:39 | 11K | |
![[SND]](/icons/sound2.gif) | letter-perfect.mp3 | 18-Apr-2007 21:56 | 11K | |
![[SND]](/icons/sound2.gif) | levonorgestrel.mp3 | 18-Apr-2007 22:02 | 11K | |
![[SND]](/icons/sound2.gif) | locus in quo.mp3 | 18-Apr-2007 22:55 | 11K | |
![[SND]](/icons/sound2.gif) | loop of Henle.mp3 | 18-Apr-2007 23:09 | 11K | |
![[SND]](/icons/sound2.gif) | louis d'or.mp3 | 18-Apr-2007 23:16 | 11K | |
![[SND]](/icons/sound2.gif) | Leoncavallo.mp3 | 18-Apr-2007 21:48 | 12K | |
![[SND]](/icons/sound2.gif) | Liederkranz.mp3 | 18-Apr-2007 22:11 | 12K | |
![[SND]](/icons/sound2.gif) | Louis Quinze.mp3 | 18-Apr-2007 23:16 | 12K | |
![[SND]](/icons/sound2.gif) | lapis lazuli.mp3 | 18-Apr-2007 21:02 | 12K | |
![[SND]](/icons/sound2.gif) | la reine le veut.mp3 | 18-Apr-2007 20:27 | 12K | |
![[SND]](/icons/sound2.gif) | laterization.mp3 | 18-Apr-2007 21:11 | 12K | |
![[SND]](/icons/sound2.gif) | lepidopterology.mp3 | 18-Apr-2007 21:50 | 12K | |
![[SND]](/icons/sound2.gif) | lionization.mp3 | 18-Apr-2007 22:31 | 12K | |
![[SND]](/icons/sound2.gif) | listerioses.mp3 | 18-Apr-2007 22:37 | 12K | |
![[SND]](/icons/sound2.gif) | localization.mp3 | 18-Apr-2007 22:51 | 12K | |
![[SND]](/icons/sound2.gif) | loculicidal.mp3 | 18-Apr-2007 22:55 | 12K | |
![[SND]](/icons/sound2.gif) | lognormality.mp3 | 18-Apr-2007 22:59 | 12K | |
![[SND]](/icons/sound2.gif) | lymphosarcoma.mp3 | 18-Apr-2007 23:45 | 12K | |
![[SND]](/icons/sound2.gif) | Levi-Strauss.mp3 | 18-Apr-2007 22:01 | 12K | |
![[SND]](/icons/sound2.gif) | Lhasa apso.mp3 | 18-Apr-2007 22:04 | 12K | |
![[SND]](/icons/sound2.gif) | Linlithgowshire.mp3 | 18-Apr-2007 22:29 | 12K | |
![[SND]](/icons/sound2.gif) | Longobardi.mp3 | 18-Apr-2007 23:06 | 12K | |
![[SND]](/icons/sound2.gif) | Luleburgaz.mp3 | 18-Apr-2007 23:30 | 12K | |
![[SND]](/icons/sound2.gif) | ladino clover.mp3 | 18-Apr-2007 20:37 | 12K | |
![[SND]](/icons/sound2.gif) | lady-in-waiting.mp3 | 18-Apr-2007 20:38 | 12K | |
![[SND]](/icons/sound2.gif) | letters close.mp3 | 18-Apr-2007 21:56 | 12K | |
![[SND]](/icons/sound2.gif) | levorotatory.mp3 | 18-Apr-2007 22:02 | 12K | |
![[SND]](/icons/sound2.gif) | lipoprotein.mp3 | 18-Apr-2007 22:33 | 12K | |
![[SND]](/icons/sound2.gif) | lovey-doveyness.mp3 | 18-Apr-2007 23:20 | 12K | |
![[SND]](/icons/sound2.gif) | loving-kindness.mp3 | 18-Apr-2007 23:20 | 12K | |
![[SND]](/icons/sound2.gif) | lysogenicity.mp3 | 18-Apr-2007 23:52 | 12K | |
![[SND]](/icons/sound2.gif) | Lago d'Averno.mp3 | 18-Apr-2007 20:41 | 12K | |
![[SND]](/icons/sound2.gif) | Le Calabrie.mp3 | 18-Apr-2007 21:23 | 12K | |
![[SND]](/icons/sound2.gif) | Leon de los Aldamas.mp3 | 18-Apr-2007 21:48 | 12K | |
![[SND]](/icons/sound2.gif) | Lien-yun-kang.mp3 | 18-Apr-2007 22:12 | 12K | |
![[SND]](/icons/sound2.gif) | Luang Prabang.mp3 | 18-Apr-2007 23:23 | 12K | |
![[SND]](/icons/sound2.gif) | labia minora.mp3 | 18-Apr-2007 20:29 | 12K | |
![[SND]](/icons/sound2.gif) | lactalbumin.mp3 | 18-Apr-2007 20:35 | 12K | |
![[SND]](/icons/sound2.gif) | lactoglobulin.mp3 | 18-Apr-2007 20:36 | 12K | |
![[SND]](/icons/sound2.gif) | laparoscopic.mp3 | 18-Apr-2007 21:01 | 12K | |
![[SND]](/icons/sound2.gif) | laparoscopist.mp3 | 18-Apr-2007 21:01 | 12K | |
![[SND]](/icons/sound2.gif) | lapsus calami.mp3 | 18-Apr-2007 21:03 | 12K | |
![[SND]](/icons/sound2.gif) | liberalization.mp3 | 18-Apr-2007 22:07 | 12K | |
![[SND]](/icons/sound2.gif) | linearization.mp3 | 18-Apr-2007 22:25 | 12K | |
![[SND]](/icons/sound2.gif) | linsey-woolsey.mp3 | 18-Apr-2007 22:30 | 12K | |
![[SND]](/icons/sound2.gif) | lipoic acid.mp3 | 18-Apr-2007 22:32 | 12K | |
![[SND]](/icons/sound2.gif) | lithographically.mp3 | 18-Apr-2007 22:39 | 12K | |
![[SND]](/icons/sound2.gif) | liturgiology.mp3 | 18-Apr-2007 22:42 | 12K | |
![[SND]](/icons/sound2.gif) | logocentrism.mp3 | 18-Apr-2007 22:59 | 12K | |
![[SND]](/icons/sound2.gif) | long-standing.mp3 | 18-Apr-2007 23:06 | 12K | |
![[SND]](/icons/sound2.gif) | luteinization.mp3 | 18-Apr-2007 23:38 | 12K | |
![[SND]](/icons/sound2.gif) | lygus bug.mp3 | 18-Apr-2007 23:43 | 12K | |
![[SND]](/icons/sound2.gif) | lymphadenitis.mp3 | 18-Apr-2007 23:44 | 12K | |
![[SND]](/icons/sound2.gif) | La Rochefoucauld.mp3 | 18-Apr-2007 20:27 | 12K | |
![[SND]](/icons/sound2.gif) | Lewis with Harris.mp3 | 18-Apr-2007 22:02 | 12K | |
![[SND]](/icons/sound2.gif) | lactobacillus.mp3 | 18-Apr-2007 20:35 | 12K | |
![[SND]](/icons/sound2.gif) | leukocytosis.mp3 | 18-Apr-2007 21:58 | 12K | |
![[SND]](/icons/sound2.gif) | lignosulfonate.mp3 | 18-Apr-2007 22:17 | 12K | |
![[SND]](/icons/sound2.gif) | lingua franca.mp3 | 18-Apr-2007 22:27 | 12K | |
![[SND]](/icons/sound2.gif) | loosey-goosey.mp3 | 18-Apr-2007 23:09 | 12K | |
![[SND]](/icons/sound2.gif) | lymphomatosis.mp3 | 18-Apr-2007 23:45 | 12K | |
![[SND]](/icons/sound2.gif) | Liu Shao-ch'i.mp3 | 18-Apr-2007 22:43 | 12K | |
![[SND]](/icons/sound2.gif) | Louis Quatorze.mp3 | 18-Apr-2007 23:16 | 12K | |
![[SND]](/icons/sound2.gif) | labialization.mp3 | 18-Apr-2007 20:29 | 12K | |
![[SND]](/icons/sound2.gif) | laryngectomee.mp3 | 18-Apr-2007 21:07 | 12K | |
![[SND]](/icons/sound2.gif) | laryngectomized.mp3 | 18-Apr-2007 21:07 | 12K | |
![[SND]](/icons/sound2.gif) | letters of marque.mp3 | 18-Apr-2007 21:56 | 12K | |
![[SND]](/icons/sound2.gif) | lexicographically.mp3 | 18-Apr-2007 22:03 | 12K | |
![[SND]](/icons/sound2.gif) | lexicological.mp3 | 18-Apr-2007 22:03 | 12K | |
![[SND]](/icons/sound2.gif) | librarianship.mp3 | 18-Apr-2007 22:08 | 12K | |
![[SND]](/icons/sound2.gif) | liturgiologist.mp3 | 18-Apr-2007 22:42 | 12K | |
![[SND]](/icons/sound2.gif) | logographically.mp3 | 18-Apr-2007 22:59 | 12K | |
![[SND]](/icons/sound2.gif) | lymphomatoses.mp3 | 18-Apr-2007 23:45 | 12K | |
![[SND]](/icons/sound2.gif) | La Florida.mp3 | 18-Apr-2007 20:26 | 13K | |
![[SND]](/icons/sound2.gif) | Levi-Straussian.mp3 | 18-Apr-2007 22:01 | 13K | |
![[SND]](/icons/sound2.gif) | London broil.mp3 | 18-Apr-2007 23:03 | 13K | |
![[SND]](/icons/sound2.gif) | Lopez Mateos.mp3 | 18-Apr-2007 23:10 | 13K | |
![[SND]](/icons/sound2.gif) | Lorraine cross.mp3 | 18-Apr-2007 23:13 | 13K | |
![[SND]](/icons/sound2.gif) | Lourenco Marques.mp3 | 18-Apr-2007 23:17 | 13K | |
![[SND]](/icons/sound2.gif) | l'etoile du nord.mp3 | 18-Apr-2007 21:55 | 13K | |
![[SND]](/icons/sound2.gif) | lateralization.mp3 | 18-Apr-2007 21:11 | 13K | |
![[SND]](/icons/sound2.gif) | latitudinarian.mp3 | 18-Apr-2007 21:13 | 13K | |
![[SND]](/icons/sound2.gif) | leptospiroses.mp3 | 18-Apr-2007 21:52 | 13K | |
![[SND]](/icons/sound2.gif) | leptospirosis.mp3 | 18-Apr-2007 21:52 | 13K | |
![[SND]](/icons/sound2.gif) | le roi le veut.mp3 | 18-Apr-2007 21:24 | 13K | |
![[SND]](/icons/sound2.gif) | lexicographical.mp3 | 18-Apr-2007 22:03 | 13K | |
![[SND]](/icons/sound2.gif) | lichenological.mp3 | 18-Apr-2007 22:10 | 13K | |
![[SND]](/icons/sound2.gif) | localizability.mp3 | 18-Apr-2007 22:51 | 13K | |
![[SND]](/icons/sound2.gif) | lusus naturae.mp3 | 18-Apr-2007 23:38 | 13K | |
![[SND]](/icons/sound2.gif) | Le Havre-de-Grace.mp3 | 18-Apr-2007 21:24 | 13K | |
![[SND]](/icons/sound2.gif) | Lopez Portillo.mp3 | 18-Apr-2007 23:10 | 13K | |
![[SND]](/icons/sound2.gif) | Louangphrabang.mp3 | 18-Apr-2007 23:15 | 13K | |
![[SND]](/icons/sound2.gif) | Lyme disease.mp3 | 18-Apr-2007 23:43 | 13K | |
![[SND]](/icons/sound2.gif) | labor-intensive.mp3 | 18-Apr-2007 20:30 | 13K | |
![[SND]](/icons/sound2.gif) | landlubberliness.mp3 | 18-Apr-2007 20:54 | 13K | |
![[SND]](/icons/sound2.gif) | leishmaniases.mp3 | 18-Apr-2007 21:42 | 13K | |
![[SND]](/icons/sound2.gif) | libertarianism.mp3 | 18-Apr-2007 22:07 | 13K | |
![[SND]](/icons/sound2.gif) | locum tenens.mp3 | 18-Apr-2007 22:55 | 13K | |
![[SND]](/icons/sound2.gif) | long-playing.mp3 | 18-Apr-2007 23:06 | 13K | |
![[SND]](/icons/sound2.gif) | lymphadenopathy.mp3 | 18-Apr-2007 23:44 | 13K | |
![[SND]](/icons/sound2.gif) | Lakeland terrier.mp3 | 18-Apr-2007 20:44 | 13K | |
![[SND]](/icons/sound2.gif) | Legionnaires' disease.mp3 | 18-Apr-2007 21:39 | 13K | |
![[SND]](/icons/sound2.gif) | Leonardo da Vinci.mp3 | 18-Apr-2007 21:48 | 13K | |
![[SND]](/icons/sound2.gif) | Liliuokalani.mp3 | 18-Apr-2007 22:19 | 13K | |
![[SND]](/icons/sound2.gif) | Lincoln's Birthday.mp3 | 18-Apr-2007 22:24 | 13K | |
![[SND]](/icons/sound2.gif) | lepidopterologist.mp3 | 18-Apr-2007 21:50 | 13K | |
![[SND]](/icons/sound2.gif) | leukopoiesis.mp3 | 18-Apr-2007 21:59 | 13K | |
![[SND]](/icons/sound2.gif) | life of Reilly.mp3 | 18-Apr-2007 22:12 | 13K | |
![[SND]](/icons/sound2.gif) | life of Riley.mp3 | 18-Apr-2007 22:12 | 13K | |
![[SND]](/icons/sound2.gif) | lymphangiogram.mp3 | 18-Apr-2007 23:44 | 13K | |
![[SND]](/icons/sound2.gif) | lysergic acid.mp3 | 18-Apr-2007 23:50 | 13K | |
![[SND]](/icons/sound2.gif) | Lianyungang.mp3 | 18-Apr-2007 22:05 | 13K | |
![[SND]](/icons/sound2.gif) | Llano Estacado.mp3 | 18-Apr-2007 22:47 | 13K | |
![[SND]](/icons/sound2.gif) | labia majora.mp3 | 18-Apr-2007 20:29 | 13K | |
![[SND]](/icons/sound2.gif) | la dolce vita.mp3 | 18-Apr-2007 20:26 | 13K | |
![[SND]](/icons/sound2.gif) | laicization.mp3 | 18-Apr-2007 20:42 | 13K | |
![[SND]](/icons/sound2.gif) | lepidopterological.mp3 | 18-Apr-2007 21:50 | 13K | |
![[SND]](/icons/sound2.gif) | labanotation.mp3 | 18-Apr-2007 20:28 | 13K | |
![[SND]](/icons/sound2.gif) | laissez-passer.mp3 | 18-Apr-2007 20:43 | 13K | |
![[SND]](/icons/sound2.gif) | lamina propria.mp3 | 18-Apr-2007 20:49 | 13K | |
![[SND]](/icons/sound2.gif) | le style, c'est l'homme.mp3 | 18-Apr-2007 21:24 | 13K | |
![[SND]](/icons/sound2.gif) | lobster thermidor.mp3 | 18-Apr-2007 22:50 | 13K | |
![[SND]](/icons/sound2.gif) | longcase clock.mp3 | 18-Apr-2007 23:04 | 13K | |
![[SND]](/icons/sound2.gif) | lymphocytosis.mp3 | 18-Apr-2007 23:44 | 13K | |
![[SND]](/icons/sound2.gif) | lyophilization.mp3 | 18-Apr-2007 23:48 | 13K | |
![[SND]](/icons/sound2.gif) | L'Hopital's rule.mp3 | 18-Apr-2007 22:04 | 13K | |
![[SND]](/icons/sound2.gif) | Levant storax.mp3 | 18-Apr-2007 22:00 | 13K | |
![[SND]](/icons/sound2.gif) | lacrimae rerum.mp3 | 18-Apr-2007 20:34 | 13K | |
![[SND]](/icons/sound2.gif) | lignocellulose.mp3 | 18-Apr-2007 22:17 | 13K | |
![[SND]](/icons/sound2.gif) | lithium niobate.mp3 | 18-Apr-2007 22:39 | 13K | |
![[SND]](/icons/sound2.gif) | locus classicus.mp3 | 18-Apr-2007 22:55 | 13K | |
![[SND]](/icons/sound2.gif) | long-sufferingly.mp3 | 18-Apr-2007 23:07 | 13K | |
![[SND]](/icons/sound2.gif) | longleaf pine.mp3 | 18-Apr-2007 23:06 | 13K | |
![[SND]](/icons/sound2.gif) | lymphogranuloma.mp3 | 18-Apr-2007 23:45 | 13K | |
![[SND]](/icons/sound2.gif) | lexicalization.mp3 | 18-Apr-2007 22:03 | 14K | |
![[SND]](/icons/sound2.gif) | L-asparaginase.mp3 | 18-Apr-2007 21:09 | 14K | |
![[SND]](/icons/sound2.gif) | Levallois-Perret.mp3 | 18-Apr-2007 21:59 | 14K | |
![[SND]](/icons/sound2.gif) | Lombardy poplar.mp3 | 18-Apr-2007 23:02 | 14K | |
![[SND]](/icons/sound2.gif) | lapsus linguae.mp3 | 18-Apr-2007 21:03 | 14K | |
![[SND]](/icons/sound2.gif) | latissimus dorsi.mp3 | 18-Apr-2007 21:13 | 14K | |
![[SND]](/icons/sound2.gif) | lignocellulosic.mp3 | 18-Apr-2007 22:17 | 14K | |
![[SND]](/icons/sound2.gif) | linguae francae.mp3 | 18-Apr-2007 22:27 | 14K | |
![[SND]](/icons/sound2.gif) | linoleic acid.mp3 | 18-Apr-2007 22:29 | 14K | |
![[SND]](/icons/sound2.gif) | linolenic acid.mp3 | 18-Apr-2007 22:29 | 14K | |
![[SND]](/icons/sound2.gif) | long-horned beetle.mp3 | 18-Apr-2007 23:05 | 14K | |
![[SND]](/icons/sound2.gif) | lymphangiography.mp3 | 18-Apr-2007 23:44 | 14K | |
![[SND]](/icons/sound2.gif) | latensification.mp3 | 18-Apr-2007 21:11 | 14K | |
![[SND]](/icons/sound2.gif) | latissimi dorsi.mp3 | 18-Apr-2007 21:13 | 14K | |
![[SND]](/icons/sound2.gif) | latitudinarianism.mp3 | 18-Apr-2007 21:13 | 14K | |
![[SND]](/icons/sound2.gif) | lysogenization.mp3 | 18-Apr-2007 23:52 | 14K | |
![[SND]](/icons/sound2.gif) | Labrador retriever.mp3 | 18-Apr-2007 20:30 | 14K | |
![[SND]](/icons/sound2.gif) | Laetare Sunday.mp3 | 18-Apr-2007 20:39 | 14K | |
![[SND]](/icons/sound2.gif) | Luigi Amedeo.mp3 | 18-Apr-2007 23:29 | 14K | |
![[SND]](/icons/sound2.gif) | lacto-vegetarian.mp3 | 18-Apr-2007 20:36 | 14K | |
![[SND]](/icons/sound2.gif) | leukemogenesis.mp3 | 18-Apr-2007 21:58 | 14K | |
![[SND]](/icons/sound2.gif) | lavaliere microphone.mp3 | 18-Apr-2007 21:19 | 14K | |
![[SND]](/icons/sound2.gif) | lavalier microphone.mp3 | 18-Apr-2007 21:19 | 14K | |
![[SND]](/icons/sound2.gif) | lettre de cachet.mp3 | 18-Apr-2007 21:56 | 14K | |
![[SND]](/icons/sound2.gif) | lettres de cachet.mp3 | 18-Apr-2007 21:56 | 14K | |
![[SND]](/icons/sound2.gif) | locum tenentes.mp3 | 18-Apr-2007 22:55 | 14K | |
![[SND]](/icons/sound2.gif) | lymphangiographic.mp3 | 18-Apr-2007 23:44 | 14K | |
![[SND]](/icons/sound2.gif) | Laplace transform.mp3 | 18-Apr-2007 21:02 | 15K | |
![[SND]](/icons/sound2.gif) | Leguia y Salcedo.mp3 | 18-Apr-2007 21:40 | 15K | |
![[SND]](/icons/sound2.gif) | locus ceruleus.mp3 | 18-Apr-2007 22:55 | 15K | |
![[SND]](/icons/sound2.gif) | locus coeruleus.mp3 | 18-Apr-2007 22:55 | 15K | |
![[SND]](/icons/sound2.gif) | lodgepole pine.mp3 | 18-Apr-2007 22:56 | 15K | |
![[SND]](/icons/sound2.gif) | Levi-Montalcini.mp3 | 18-Apr-2007 22:01 | 15K | |
![[SND]](/icons/sound2.gif) | largemouth bass.mp3 | 18-Apr-2007 21:05 | 15K | |
![[SND]](/icons/sound2.gif) | Lapsang souchong.mp3 | 18-Apr-2007 21:03 | 15K | |
![[SND]](/icons/sound2.gif) | l'union fait la force.mp3 | 18-Apr-2007 23:34 | 15K | |
![[SND]](/icons/sound2.gif) | laminae propriae.mp3 | 18-Apr-2007 20:49 | 15K | |
![[SND]](/icons/sound2.gif) | le roi s'avisera.mp3 | 18-Apr-2007 21:24 | 15K | |
![[SND]](/icons/sound2.gif) | long-leaved pine.mp3 | 18-Apr-2007 23:06 | 15K | |
![[SND]](/icons/sound2.gif) | Lou Gehrig's disease.mp3 | 18-Apr-2007 23:15 | 16K | |
![[SND]](/icons/sound2.gif) | Lomas de Zamora.mp3 | 18-Apr-2007 23:02 | 16K | |
![[SND]](/icons/sound2.gif) | lampbrush chromosome.mp3 | 18-Apr-2007 20:51 | 16K | |
![[SND]](/icons/sound2.gif) | loci classici.mp3 | 18-Apr-2007 22:52 | 16K | |
![[SND]](/icons/sound2.gif) | lares and penates.mp3 | 18-Apr-2007 21:04 | 16K | |
![[SND]](/icons/sound2.gif) | lipopolysaccharide.mp3 | 18-Apr-2007 22:33 | 16K | |
![[SND]](/icons/sound2.gif) | Ludwigshafen am Rhein.mp3 | 18-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | Lacus Asphaltites.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | labamba.mp3 | 18-Apr-2007 20:28 | 17K | |
![[SND]](/icons/sound2.gif) | labefaction.mp3 | 18-Apr-2007 20:28 | 17K | |
![[SND]](/icons/sound2.gif) | labelledamesansmerci.mp3 | 18-Apr-2007 20:29 | 17K | |
![[SND]](/icons/sound2.gif) | labetalol.mp3 | 18-Apr-2007 20:29 | 17K | |
![[SND]](/icons/sound2.gif) | labialism.mp3 | 18-Apr-2007 20:29 | 17K | |
![[SND]](/icons/sound2.gif) | labiamajora.mp3 | 18-Apr-2007 20:29 | 17K | |
![[SND]](/icons/sound2.gif) | labiaminora.mp3 | 18-Apr-2007 20:29 | 17K | |
![[SND]](/icons/sound2.gif) | labilize.mp3 | 18-Apr-2007 20:29 | 17K | |
![[SND]](/icons/sound2.gif) | labiogression.mp3 | 18-Apr-2007 20:29 | 17K | |
![[SND]](/icons/sound2.gif) | labonza.mp3 | 18-Apr-2007 20:30 | 17K | |
![[SND]](/icons/sound2.gif) | laborism.mp3 | 18-Apr-2007 20:30 | 17K | |
![[SND]](/icons/sound2.gif) | labor omnia vincit.mp3 | 18-Apr-2007 20:30 | 17K | |
![[SND]](/icons/sound2.gif) | labradorean.mp3 | 18-Apr-2007 20:31 | 17K | |
![[SND]](/icons/sound2.gif) | labradorescent.mp3 | 18-Apr-2007 20:31 | 17K | |
![[SND]](/icons/sound2.gif) | labruyere.mp3 | 18-Apr-2007 20:31 | 17K | |
![[SND]](/icons/sound2.gif) | labyrinthitis.mp3 | 18-Apr-2007 20:31 | 17K | |
![[SND]](/icons/sound2.gif) | lacampanella.mp3 | 18-Apr-2007 20:31 | 17K | |
![[SND]](/icons/sound2.gif) | laccadiveislands.mp3 | 18-Apr-2007 20:31 | 17K | |
![[SND]](/icons/sound2.gif) | lacebark.mp3 | 18-Apr-2007 20:32 | 17K | |
![[SND]](/icons/sound2.gif) | lacerant.mp3 | 18-Apr-2007 20:32 | 17K | |
![[SND]](/icons/sound2.gif) | lacertilian.mp3 | 18-Apr-2007 20:32 | 17K | |
![[SND]](/icons/sound2.gif) | lacertine.mp3 | 18-Apr-2007 20:32 | 17K | |
![[SND]](/icons/sound2.gif) | lachorrera.mp3 | 18-Apr-2007 20:33 | 17K | |
![[SND]](/icons/sound2.gif) | lachrymachristi.mp3 | 18-Apr-2007 20:33 | 17K | |
![[SND]](/icons/sound2.gif) | lachrymation.mp3 | 18-Apr-2007 20:33 | 17K | |
![[SND]](/icons/sound2.gif) | lachrymatory.mp3 | 18-Apr-2007 20:33 | 17K | |
![[SND]](/icons/sound2.gif) | lacombe.mp3 | 18-Apr-2007 20:34 | 17K | |
![[SND]](/icons/sound2.gif) | lacoperon.mp3 | 18-Apr-2007 20:34 | 17K | |
![[SND]](/icons/sound2.gif) | lacrimachristi.mp3 | 18-Apr-2007 20:34 | 17K | |
![[SND]](/icons/sound2.gif) | lacrimaererum.mp3 | 18-Apr-2007 20:34 | 17K | |
![[SND]](/icons/sound2.gif) | lacrimatory.mp3 | 18-Apr-2007 20:35 | 17K | |
![[SND]](/icons/sound2.gif) | lacrymation.mp3 | 18-Apr-2007 20:35 | 17K | |
![[SND]](/icons/sound2.gif) | lacrymator.mp3 | 18-Apr-2007 20:35 | 17K | |
![[SND]](/icons/sound2.gif) | lacrymatory.mp3 | 18-Apr-2007 20:35 | 17K | |
![[SND]](/icons/sound2.gif) | lactarian.mp3 | 18-Apr-2007 20:35 | 17K | |
![[SND]](/icons/sound2.gif) | lacti.mp3 | 18-Apr-2007 20:35 | 17K | |
![[SND]](/icons/sound2.gif) | lactoferrin.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lactoflavin.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lactonize.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lactosuria.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lacucaracha.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lacumparsita.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lacunose.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lacunule.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | lacussolis.mp3 | 18-Apr-2007 20:36 | 17K | |
![[SND]](/icons/sound2.gif) | ladakhcrisis.mp3 | 18-Apr-2007 20:37 | 17K | |
![[SND]](/icons/sound2.gif) | laddertron.mp3 | 18-Apr-2007 20:37 | 17K | |
![[SND]](/icons/sound2.gif) | ladeco.mp3 | 18-Apr-2007 20:37 | 17K | |
![[SND]](/icons/sound2.gif) | ladify.mp3 | 18-Apr-2007 20:37 | 17K | |
![[SND]](/icons/sound2.gif) | ladyborden.mp3 | 18-Apr-2007 20:38 | 17K | |
![[SND]](/icons/sound2.gif) | ladyfied.mp3 | 18-Apr-2007 20:38 | 17K | |
![[SND]](/icons/sound2.gif) | ladyfy.mp3 | 18-Apr-2007 20:38 | 17K | |
![[SND]](/icons/sound2.gif) | ladykin.mp3 | 18-Apr-2007 20:38 | 17K | |
![[SND]](/icons/sound2.gif) | ladyofshalott.mp3 | 18-Apr-2007 20:38 | 17K | |
![[SND]](/icons/sound2.gif) | laelaps.mp3 | 18-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | laestrygones.mp3 | 18-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | laetaresunday.mp3 | 18-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | laevulose.mp3 | 18-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | laffercurve.mp3 | 18-Apr-2007 20:39 | 17K | |
![[SND]](/icons/sound2.gif) | laforgue.mp3 | 18-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | lagbomer.mp3 | 18-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | lageniform.mp3 | 18-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | lagerfeld.mp3 | 18-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | laggengird.mp3 | 18-Apr-2007 20:40 | 17K | |
![[SND]](/icons/sound2.gif) | lagodenicaragua.mp3 | 18-Apr-2007 20:41 | 17K | |
![[SND]](/icons/sound2.gif) | lagomorpha.mp3 | 18-Apr-2007 20:41 | 17K | |
![[SND]](/icons/sound2.gif) | lagrangianfunction.mp3 | 18-Apr-2007 20:41 | 17K | |
![[SND]](/icons/sound2.gif) | lagranja.mp3 | 18-Apr-2007 20:41 | 17K | |
![[SND]](/icons/sound2.gif) | lagting.mp3 | 18-Apr-2007 20:41 | 17K | |
![[SND]](/icons/sound2.gif) | lahdidah.mp3 | 18-Apr-2007 20:42 | 17K | |
![[SND]](/icons/sound2.gif) | laicity.mp3 | 18-Apr-2007 20:42 | 17K | |
![[SND]](/icons/sound2.gif) | lailatulqadr.mp3 | 18-Apr-2007 20:42 | 17K | |
![[SND]](/icons/sound2.gif) | lairage.mp3 | 18-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | lairdutemps.mp3 | 18-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | laisseraller.mp3 | 18-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | laissezfaire.mp3 | 18-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | laissezpasser.mp3 | 18-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | laitdamandes.mp3 | 18-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | lajaras.mp3 | 18-Apr-2007 20:43 | 17K | |
![[SND]](/icons/sound2.gif) | lakewobegoneffect.mp3 | 18-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | lakicraterrow.mp3 | 18-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | lalang.mp3 | 18-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | lalapalooza.mp3 | 18-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | lalinea.mp3 | 18-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | lalitpur.mp3 | 18-Apr-2007 20:45 | 17K | |
![[SND]](/icons/sound2.gif) | lallation.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lallegro.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lallycolumn.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lallygag.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lalollo.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lalopathy.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | laloplegia.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lalouviere.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lamalaguena.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lamanche.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lamanonera.mp3 | 18-Apr-2007 20:46 | 17K | |
![[SND]](/icons/sound2.gif) | lamazemethod.mp3 | 18-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | lambdacism.mp3 | 18-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | lambdoid.mp3 | 18-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | lambdology.mp3 | 18-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | lamborghini.mp3 | 18-Apr-2007 20:47 | 17K | |
![[SND]](/icons/sound2.gif) | lambretta.mp3 | 18-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | lamellation.mp3 | 18-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | lamellicorn.mp3 | 18-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | lamellose.mp3 | 18-Apr-2007 20:48 | 17K | |
![[SND]](/icons/sound2.gif) | laminable.mp3 | 18-Apr-2007 20:49 | 17K | |
![[SND]](/icons/sound2.gif) | laminapropria.mp3 | 18-Apr-2007 20:49 | 17K | |
![[SND]](/icons/sound2.gif) | laminectomy.mp3 | 18-Apr-2007 20:49 | 17K | |
![[SND]](/icons/sound2.gif) | lamington.mp3 | 18-Apr-2007 20:49 | 17K | |
![[SND]](/icons/sound2.gif) | lammister.mp3 | 18-Apr-2007 20:50 | 17K | |
![[SND]](/icons/sound2.gif) | lampang.mp3 | 18-Apr-2007 20:50 | 17K | |
![[SND]](/icons/sound2.gif) | lampereel.mp3 | 18-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | lampern.mp3 | 18-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | lamprophony.mp3 | 18-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | lamprophyre.mp3 | 18-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | lampton.mp3 | 18-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | lamston.mp3 | 18-Apr-2007 20:51 | 17K | |
![[SND]](/icons/sound2.gif) | lanaset.mp3 | 18-Apr-2007 20:52 | 17K | |
![[SND]](/icons/sound2.gif) | lancang.mp3 | 18-Apr-2007 20:52 | 17K | |
![[SND]](/icons/sound2.gif) | lancetti.mp3 | 18-Apr-2007 20:52 | 17K | |
![[SND]](/icons/sound2.gif) | lanciers.mp3 | 18-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | lanciform.mp3 | 18-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | landdrost.mp3 | 18-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | landeshauptmann.mp3 | 18-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | landgrave.mp3 | 18-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | landgraviate.mp3 | 18-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | landgravine.mp3 | 18-Apr-2007 20:53 | 17K | |
![[SND]](/icons/sound2.gif) | landloper.mp3 | 18-Apr-2007 20:54 | 17K | |
![[SND]](/icons/sound2.gif) | landlordly.mp3 | 18-Apr-2007 20:54 | 17K | |
![[SND]](/icons/sound2.gif) | landocracy.mp3 | 18-Apr-2007 20:54 | 17K | |
![[SND]](/icons/sound2.gif) | landocrat.mp3 | 18-Apr-2007 20:54 | 17K | |
![[SND]](/icons/sound2.gif) | landofnod.mp3 | 18-Apr-2007 20:54 | 17K | |
![[SND]](/icons/sound2.gif) | landrost.mp3 | 18-Apr-2007 20:55 | 17K | |
![[SND]](/icons/sound2.gif) | landrumgriffinact.mp3 | 18-Apr-2007 20:55 | 17K | |
![[SND]](/icons/sound2.gif) | landscaper.mp3 | 18-Apr-2007 20:55 | 17K | |
![[SND]](/icons/sound2.gif) | landshut.mp3 | 18-Apr-2007 20:55 | 17K | |
![[SND]](/icons/sound2.gif) | landsknecht.mp3 | 18-Apr-2007 20:55 | 17K | |
![[SND]](/icons/sound2.gif) | landsmanshaft.mp3 | 18-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | landsturm.mp3 | 18-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | langeel.mp3 | 18-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | langerhans.mp3 | 18-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | langhanslayer.mp3 | 18-Apr-2007 20:56 | 17K | |
![[SND]](/icons/sound2.gif) | langosta.mp3 | 18-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | langreo.mp3 | 18-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | langresplateau.mp3 | 18-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | languedeboeuf.mp3 | 18-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | languedechat.mp3 | 18-Apr-2007 20:57 | 17K | |
![[SND]](/icons/sound2.gif) | languedoil.mp3 | 18-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | langueducocacola.mp3 | 18-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | languishing.mp3 | 18-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | laniary.mp3 | 18-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | lanina.mp3 | 18-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | lankanenglish.mp3 | 18-Apr-2007 20:58 | 17K | |
![[SND]](/icons/sound2.gif) | lanosterol.mp3 | 18-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | lanoxin.mp3 | 18-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | lansbury.mp3 | 18-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | lansign.mp3 | 18-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | lanskerline.mp3 | 18-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | lantianman.mp3 | 18-Apr-2007 20:59 | 17K | |
![[SND]](/icons/sound2.gif) | lanuginose.mp3 | 18-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | laodamas.mp3 | 18-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | laodamia.mp3 | 18-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | laodong.mp3 | 18-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | laojiao.mp3 | 18-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | laokoon.mp3 | 18-Apr-2007 21:00 | 17K | |
![[SND]](/icons/sound2.gif) | lapactic.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | lapaloma.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | laparectomy.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | laparotome.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | laparotomize.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | laperouse.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | laphroaig.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | lapicide.mp3 | 18-Apr-2007 21:01 | 17K | |
![[SND]](/icons/sound2.gif) | lapidescent.mp3 | 18-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | lapidicolous.mp3 | 18-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | lapidify.mp3 | 18-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | lapinagile.mp3 | 18-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | lapislazuli.mp3 | 18-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | laplacian.mp3 | 18-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | lappeenranta.mp3 | 18-Apr-2007 21:02 | 17K | |
![[SND]](/icons/sound2.gif) | lapsangsouchong.mp3 | 18-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | lapsuscalami.mp3 | 18-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | lapsuslinguae.mp3 | 18-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | lapsusmemoriae.mp3 | 18-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | laptevsea.mp3 | 18-Apr-2007 21:03 | 17K | |
![[SND]](/icons/sound2.gif) | lararium.mp3 | 18-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | lardydardy.mp3 | 18-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | largactil.mp3 | 18-Apr-2007 21:04 | 17K | |
![[SND]](/icons/sound2.gif) | largamente.mp3 | 18-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | largemouthbass.mp3 | 18-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | largocaballero.mp3 | 18-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | larixinicacid.mp3 | 18-Apr-2007 21:05 | 17K | |
![[SND]](/icons/sound2.gif) | larmorprecession.mp3 | 18-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | larnax.mp3 | 18-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | larochefoucauld.mp3 | 18-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | larochelle.mp3 | 18-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | larruping.mp3 | 18-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | larseniceshelf.mp3 | 18-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | larsporsenna.mp3 | 18-Apr-2007 21:06 | 17K | |
![[SND]](/icons/sound2.gif) | larviparous.mp3 | 18-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | larvivorous.mp3 | 18-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | laryngealize.mp3 | 18-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | laryngic.mp3 | 18-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | laryngotomy.mp3 | 18-Apr-2007 21:07 | 17K | |
![[SND]](/icons/sound2.gif) | lascala.mp3 | 18-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | lascasas.mp3 | 18-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | lascauxcave.mp3 | 18-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | laserena.mp3 | 18-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | lasertripsy.mp3 | 18-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | lasix.mp3 | 18-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | lasket.mp3 | 18-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | laskine.mp3 | 18-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | lasmeninas.mp3 | 18-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | laspalmas.mp3 | 18-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | lassafever.mp3 | 18-Apr-2007 21:09 | 17K | |
![[SND]](/icons/sound2.gif) | lassell.mp3 | 18-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | lassenpeak.mp3 | 18-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | lassetersgoldreef.mp3 | 18-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | lasvegas.mp3 | 18-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | latcheron.mp3 | 18-Apr-2007 21:10 | 17K | |
![[SND]](/icons/sound2.gif) | latensify.mp3 | 18-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | lateonset.mp3 | 18-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | laterality.mp3 | 18-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | laterigrade.mp3 | 18-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | lateritious.mp3 | 18-Apr-2007 21:11 | 17K | |
![[SND]](/icons/sound2.gif) | lateroversion.mp3 | 18-Apr-2007 21:12 | 17K | |
![[SND]](/icons/sound2.gif) | lathing.mp3 | 18-Apr-2007 21:12 | 17K | |
![[SND]](/icons/sound2.gif) | laticiferous.mp3 | 18-Apr-2007 21:12 | 17K | |
![[SND]](/icons/sound2.gif) | latifundism.mp3 | 18-Apr-2007 21:12 | 17K | |
![[SND]](/icons/sound2.gif) | latimeria.mp3 | 18-Apr-2007 21:13 | 17K | |
![[SND]](/icons/sound2.gif) | latinian.mp3 | 18-Apr-2007 21:13 | 17K | |
![[SND]](/icons/sound2.gif) | latinus.mp3 | 18-Apr-2007 21:13 | 17K | |
![[SND]](/icons/sound2.gif) | latissimusdorsi.mp3 | 18-Apr-2007 21:13 | 17K | |
![[SND]](/icons/sound2.gif) | latitudinous.mp3 | 18-Apr-2007 21:13 | 17K | |
![[SND]](/icons/sound2.gif) | latortue.mp3 | 18-Apr-2007 21:14 | 17K | |
![[SND]](/icons/sound2.gif) | latreutic.mp3 | 18-Apr-2007 21:14 | 17K | |
![[SND]](/icons/sound2.gif) | lattakia.mp3 | 18-Apr-2007 21:14 | 17K | |
![[SND]](/icons/sound2.gif) | lattermath.mp3 | 18-Apr-2007 21:14 | 17K | |
![[SND]](/icons/sound2.gif) | lattermost.mp3 | 18-Apr-2007 21:14 | 17K | |
![[SND]](/icons/sound2.gif) | latticing.mp3 | 18-Apr-2007 21:14 | 17K | |
![[SND]](/icons/sound2.gif) | latticinio.mp3 | 18-Apr-2007 21:15 | 17K | |
![[SND]](/icons/sound2.gif) | latusrectum.mp3 | 18-Apr-2007 21:15 | 17K | |
![[SND]](/icons/sound2.gif) | lauderdalelakes.mp3 | 18-Apr-2007 21:15 | 17K | |
![[SND]](/icons/sound2.gif) | laudianism.mp3 | 18-Apr-2007 21:16 | 17K | |
![[SND]](/icons/sound2.gif) | lauenburg.mp3 | 18-Apr-2007 21:16 | 17K | |
![[SND]](/icons/sound2.gif) | laulau.mp3 | 18-Apr-2007 21:16 | 17K | |
![[SND]](/icons/sound2.gif) | laumontite.mp3 | 18-Apr-2007 21:16 | 17K | |
![[SND]](/icons/sound2.gif) | launcelot.mp3 | 18-Apr-2007 21:16 | 17K | |
![[SND]](/icons/sound2.gif) | lauraceous.mp3 | 18-Apr-2007 21:17 | 17K | |
![[SND]](/icons/sound2.gif) | lauraldehyde.mp3 | 18-Apr-2007 21:17 | 17K | |
![[SND]](/icons/sound2.gif) | laurentian.mp3 | 18-Apr-2007 21:17 | 17K | |
![[SND]](/icons/sound2.gif) | laurentidespark.mp3 | 18-Apr-2007 21:17 | 17K | |
![[SND]](/icons/sound2.gif) | laurentius.mp3 | 18-Apr-2007 21:17 | 17K | |
![[SND]](/icons/sound2.gif) | laurentseries.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | laurite.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | laurustinus.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | laurylalcohol.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | lausdeo.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | lautenclavicymbal.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | lautertub.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | lautreamont.mp3 | 18-Apr-2007 21:18 | 17K | |
![[SND]](/icons/sound2.gif) | lavalleja.mp3 | 18-Apr-2007 21:19 | 17K | |
![[SND]](/icons/sound2.gif) | lavatorial.mp3 | 18-Apr-2007 21:19 | 17K | |
![[SND]](/icons/sound2.gif) | laverendrye.mp3 | 18-Apr-2007 21:19 | 17K | |
![[SND]](/icons/sound2.gif) | lavieenrose.mp3 | 18-Apr-2007 21:19 | 17K | |
![[SND]](/icons/sound2.gif) | lavolta.mp3 | 18-Apr-2007 21:20 | 17K | |
![[SND]](/icons/sound2.gif) | lavoris.mp3 | 18-Apr-2007 21:20 | 17K | |
![[SND]](/icons/sound2.gif) | lawing.mp3 | 18-Apr-2007 21:20 | 17K | |
![[SND]](/icons/sound2.gif) | lawkamussy.mp3 | 18-Apr-2007 21:20 | 17K | |
![[SND]](/icons/sound2.gif) | laxism.mp3 | 18-Apr-2007 21:21 | 17K | |
![[SND]](/icons/sound2.gif) | layering.mp3 | 18-Apr-2007 21:22 | 17K | |
![[SND]](/icons/sound2.gif) | lazboy.mp3 | 18-Apr-2007 21:22 | 17K | |
![[SND]](/icons/sound2.gif) | lazuli.mp3 | 18-Apr-2007 21:23 | 17K | |
![[SND]](/icons/sound2.gif) | lazuline.mp3 | 18-Apr-2007 21:23 | 17K | |
![[SND]](/icons/sound2.gif) | lazurite.mp3 | 18-Apr-2007 21:23 | 17K | |
![[SND]](/icons/sound2.gif) | lazzarone.mp3 | 18-Apr-2007 21:23 | 17K | |
![[SND]](/icons/sound2.gif) | lchaim.mp3 | 18-Apr-2007 21:23 | 17K | |
![[SND]](/icons/sound2.gif) | leadacetate.mp3 | 18-Apr-2007 21:24 | 17K | |
![[SND]](/icons/sound2.gif) | leadacidbattery.mp3 | 18-Apr-2007 21:24 | 17K | |
![[SND]](/icons/sound2.gif) | leadarsenate.mp3 | 18-Apr-2007 21:24 | 17K | |
![[SND]](/icons/sound2.gif) | leadazide.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadballoon.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadbeaterscockatoo.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadbelly.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadblock.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadcarbonate.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadchromate.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadcolic.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leaddioxide.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadenhallmarket.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leaderene.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leaderette.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadfooted.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadfree.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadglance.mp3 | 18-Apr-2007 21:25 | 17K | |
![[SND]](/icons/sound2.gif) | leadglass.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadglaze.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingarticle.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingblock.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingbusiness.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingcase.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingcoefficient.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingcounsel.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingdog.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingedge.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingindicators.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadinglady.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadinglight.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingman.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingmark.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingmotive.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingnote.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingquestion.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingrein.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingroove.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingstaff.mp3 | 18-Apr-2007 21:26 | 17K | |
![[SND]](/icons/sound2.gif) | leadingstrings.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadingtone.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadingwind.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadinwire.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadjoint.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadline.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadmonoxide.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadnitrate.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadoxide.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadpencil.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadperoxide.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadpipecinch.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadpoisoning.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadsheet.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadstory.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadswinging.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadtetraethyl.mp3 | 18-Apr-2007 21:27 | 17K | |
![[SND]](/icons/sound2.gif) | leadtime.mp3 | 18-Apr-2007 21:28 | 17K | |
![[SND]](/icons/sound2.gif) | leadtrack.mp3 | 18-Apr-2007 21:28 | 17K | |
![[SND]](/icons/sound2.gif) | leadtree.mp3 | 18-Apr-2007 21:28 | 17K | |
![[SND]](/icons/sound2.gif) | leadwhite.mp3 | 18-Apr-2007 21:28 | 17K | |
![[SND]](/icons/sound2.gif) | leadwool.mp3 | 18-Apr-2007 21:28 | 17K | |
![[SND]](/icons/sound2.gif) | leafleteer.mp3 | 18-Apr-2007 21:28 | 17K | |
![[SND]](/icons/sound2.gif) | leamingtonspa.mp3 | 18-Apr-2007 21:29 | 17K | |
![[SND]](/icons/sound2.gif) | leasat.mp3 | 18-Apr-2007 21:30 | 17K | |
![[SND]](/icons/sound2.gif) | leaseholder.mp3 | 18-Apr-2007 21:30 | 17K | |
![[SND]](/icons/sound2.gif) | leaselend.mp3 | 18-Apr-2007 21:30 | 17K | |
![[SND]](/icons/sound2.gif) | leasepurchase.mp3 | 18-Apr-2007 21:30 | 17K | |
![[SND]](/icons/sound2.gif) | leaserod.mp3 | 18-Apr-2007 21:30 | 17K | |
![[SND]](/icons/sound2.gif) | leastest.mp3 | 18-Apr-2007 21:31 | 17K | |
![[SND]](/icons/sound2.gif) | leatherlunged.mp3 | 18-Apr-2007 21:31 | 17K | |
![[SND]](/icons/sound2.gif) | leatheroid.mp3 | 18-Apr-2007 21:31 | 17K | |
![[SND]](/icons/sound2.gif) | lebkuchen.mp3 | 18-Apr-2007 21:32 | 17K | |
![[SND]](/icons/sound2.gif) | lebourget.mp3 | 18-Apr-2007 21:32 | 17K | |
![[SND]](/icons/sound2.gif) | lebowa.mp3 | 18-Apr-2007 21:32 | 17K | |
![[SND]](/icons/sound2.gif) | leboyer.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | lecateau.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | lechatelierite.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | lechatelierprinciple.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | lechayim.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | lechososopal.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | lechuguilla.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | leclanchecell.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | leclerc.mp3 | 18-Apr-2007 21:33 | 17K | |
![[SND]](/icons/sound2.gif) | leclere.mp3 | 18-Apr-2007 21:34 | 17K | |
![[SND]](/icons/sound2.gif) | lecontedelisle.mp3 | 18-Apr-2007 21:34 | 17K | |
![[SND]](/icons/sound2.gif) | lecoqdor.mp3 | 18-Apr-2007 21:34 | 17K | |
![[SND]](/icons/sound2.gif) | lecorbusier.mp3 | 18-Apr-2007 21:34 | 17K | |
![[SND]](/icons/sound2.gif) | lecreusot.mp3 | 18-Apr-2007 21:34 | 17K | |
![[SND]](/icons/sound2.gif) | lecythis.mp3 | 18-Apr-2007 21:34 | 17K | |
![[SND]](/icons/sound2.gif) | lecythus.mp3 | 18-Apr-2007 21:34 | 17K | |
![[SND]](/icons/sound2.gif) | leductho.mp3 | 18-Apr-2007 21:35 | 17K | |
![[SND]](/icons/sound2.gif) | ledzeppelin.mp3 | 18-Apr-2007 21:35 | 17K | |
![[SND]](/icons/sound2.gif) | leekystore.mp3 | 18-Apr-2007 21:35 | 17K | |
![[SND]](/icons/sound2.gif) | leerics.mp3 | 18-Apr-2007 21:35 | 17K | |
![[SND]](/icons/sound2.gif) | leewardislands.mp3 | 18-Apr-2007 21:36 | 17K | |
![[SND]](/icons/sound2.gif) | leewardly.mp3 | 18-Apr-2007 21:36 | 17K | |
![[SND]](/icons/sound2.gif) | lefanu.mp3 | 18-Apr-2007 21:36 | 17K | |
![[SND]](/icons/sound2.gif) | lefax.mp3 | 18-Apr-2007 21:36 | 17K | |
![[SND]](/icons/sound2.gif) | lefthander.mp3 | 18-Apr-2007 21:36 | 17K | |
![[SND]](/icons/sound2.gif) | legalized.mp3 | 18-Apr-2007 21:37 | 17K | |
![[SND]](/icons/sound2.gif) | legallienne.mp3 | 18-Apr-2007 21:37 | 17K | |
![[SND]](/icons/sound2.gif) | legaspi.mp3 | 18-Apr-2007 21:37 | 17K | |
![[SND]](/icons/sound2.gif) | legatealatere.mp3 | 18-Apr-2007 21:37 | 17K | |
![[SND]](/icons/sound2.gif) | legazpi.mp3 | 18-Apr-2007 21:37 | 17K | |
![[SND]](/icons/sound2.gif) | legendist.mp3 | 18-Apr-2007 21:38 | 17K | |
![[SND]](/icons/sound2.gif) | legendize.mp3 | 18-Apr-2007 21:38 | 17K | |
![[SND]](/icons/sound2.gif) | leggiero.mp3 | 18-Apr-2007 21:38 | 17K | |
![[SND]](/icons/sound2.gif) | leghemoglobin.mp3 | 18-Apr-2007 21:38 | 17K | |
![[SND]](/icons/sound2.gif) | legionellosis.mp3 | 18-Apr-2007 21:39 | 17K | |
![[SND]](/icons/sound2.gif) | legislatrix.mp3 | 18-Apr-2007 21:39 | 17K | |
![[SND]](/icons/sound2.gif) | legitim.mp3 | 18-Apr-2007 21:39 | 17K | |
![[SND]](/icons/sound2.gif) | legoglobin.mp3 | 18-Apr-2007 21:40 | 17K | |
![[SND]](/icons/sound2.gif) | legumin.mp3 | 18-Apr-2007 21:40 | 17K | |
![[SND]](/icons/sound2.gif) | lehayim.mp3 | 18-Apr-2007 21:40 | 17K | |
![[SND]](/icons/sound2.gif) | leibowitz.mp3 | 18-Apr-2007 21:41 | 17K | |
![[SND]](/icons/sound2.gif) | leichhardt.mp3 | 18-Apr-2007 21:41 | 17K | |
![[SND]](/icons/sound2.gif) | leiomyoma.mp3 | 18-Apr-2007 21:42 | 17K | |
![[SND]](/icons/sound2.gif) | lekin.mp3 | 18-Apr-2007 21:43 | 17K | |
![[SND]](/icons/sound2.gif) | lekythos.mp3 | 18-Apr-2007 21:43 | 17K | |
![[SND]](/icons/sound2.gif) | lemisanthrope.mp3 | 18-Apr-2007 21:43 | 17K | |
![[SND]](/icons/sound2.gif) | lemistral.mp3 | 18-Apr-2007 21:43 | 17K | |
![[SND]](/icons/sound2.gif) | lemmatize.mp3 | 18-Apr-2007 21:43 | 17K | |
![[SND]](/icons/sound2.gif) | lemminkainen.mp3 | 18-Apr-2007 21:44 | 17K | |
![[SND]](/icons/sound2.gif) | lemortedarthur.mp3 | 18-Apr-2007 21:44 | 17K | |
![[SND]](/icons/sound2.gif) | lempertoperation.mp3 | 18-Apr-2007 21:44 | 17K | |
![[SND]](/icons/sound2.gif) | lemuralia.mp3 | 18-Apr-2007 21:44 | 17K | |
![[SND]](/icons/sound2.gif) | lemuria.mp3 | 18-Apr-2007 21:44 | 17K | |
![[SND]](/icons/sound2.gif) | lemuroid.mp3 | 18-Apr-2007 21:44 | 17K | |
![[SND]](/icons/sound2.gif) | lengthman.mp3 | 18-Apr-2007 21:45 | 17K | |
![[SND]](/icons/sound2.gif) | lenilenape.mp3 | 18-Apr-2007 21:46 | 17K | |
![[SND]](/icons/sound2.gif) | leninabad.mp3 | 18-Apr-2007 21:46 | 17K | |
![[SND]](/icons/sound2.gif) | leninakan.mp3 | 18-Apr-2007 21:46 | 17K | |
![[SND]](/icons/sound2.gif) | leninskkuznetski.mp3 | 18-Apr-2007 21:46 | 17K | |
![[SND]](/icons/sound2.gif) | lennieandgeorge.mp3 | 18-Apr-2007 21:46 | 17K | |
![[SND]](/icons/sound2.gif) | lennilenape.mp3 | 18-Apr-2007 21:46 | 17K | |
![[SND]](/icons/sound2.gif) | lenticulate.mp3 | 18-Apr-2007 21:47 | 17K | |
![[SND]](/icons/sound2.gif) | lentiform.mp3 | 18-Apr-2007 21:47 | 17K | |
![[SND]](/icons/sound2.gif) | lentiginous.mp3 | 18-Apr-2007 21:47 | 17K | |
![[SND]](/icons/sound2.gif) | lentisk.mp3 | 18-Apr-2007 21:47 | 17K | |
![[SND]](/icons/sound2.gif) | lentoid.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | lenzslaw.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | leoafricanus.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | leofric.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | leoi.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | leonardodavinci.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | leonhardt.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | leonian.mp3 | 18-Apr-2007 21:48 | 17K | |
![[SND]](/icons/sound2.gif) | leontiasis.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | leontief.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | leontopodium.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | leontovich.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | leopold.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | leopon.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | leotine.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | lepanto.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | lepenskivir.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | lepidocrocite.mp3 | 18-Apr-2007 21:49 | 17K | |
![[SND]](/icons/sound2.gif) | lepidopteron.mp3 | 18-Apr-2007 21:50 | 17K | |
![[SND]](/icons/sound2.gif) | lepidosiren.mp3 | 18-Apr-2007 21:50 | 17K | |
![[SND]](/icons/sound2.gif) | lepidosis.mp3 | 18-Apr-2007 21:50 | 17K | |
![[SND]](/icons/sound2.gif) | lepontinealps.mp3 | 18-Apr-2007 21:50 | 17K | |
![[SND]](/icons/sound2.gif) | leporine.mp3 | 18-Apr-2007 21:50 | 17K | |
![[SND]](/icons/sound2.gif) | lepsius.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptodactylous.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptokurtic.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptokurtosis.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptophos.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptophyllous.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptoprosopic.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptorrhine.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptosome.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptospermum.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leptospira.mp3 | 18-Apr-2007 21:51 | 17K | |
![[SND]](/icons/sound2.gif) | leredoutable.mp3 | 18-Apr-2007 21:52 | 17K | |
![[SND]](/icons/sound2.gif) | lesbophobia.mp3 | 18-Apr-2007 21:52 | 17K | |
![[SND]](/icons/sound2.gif) | lescayes.mp3 | 18-Apr-2007 21:53 | 17K | |
![[SND]](/icons/sound2.gif) | lesemajesty.mp3 | 18-Apr-2007 21:53 | 17K | |
![[SND]](/icons/sound2.gif) | lesghian.mp3 | 18-Apr-2007 21:53 | 17K | |
![[SND]](/icons/sound2.gif) | lesmiserables.mp3 | 18-Apr-2007 21:53 | 17K | |
![[SND]](/icons/sound2.gif) | lesquerella.mp3 | 18-Apr-2007 21:53 | 17K | |
![[SND]](/icons/sound2.gif) | lestobiosis.mp3 | 18-Apr-2007 21:54 | 17K | |
![[SND]](/icons/sound2.gif) | lesvos.mp3 | 18-Apr-2007 21:54 | 17K | |
![[SND]](/icons/sound2.gif) | lesya.mp3 | 18-Apr-2007 21:54 | 17K | |
![[SND]](/icons/sound2.gif) | lethargize.mp3 | 18-Apr-2007 21:54 | 17K | |
![[SND]](/icons/sound2.gif) | lethiferous.mp3 | 18-Apr-2007 21:55 | 17K | |
![[SND]](/icons/sound2.gif) | letoiledunord.mp3 | 18-Apr-2007 21:55 | 17K | |
![[SND]](/icons/sound2.gif) | letouquet.mp3 | 18-Apr-2007 21:55 | 17K | |
![[SND]](/icons/sound2.gif) | letraset.mp3 | 18-Apr-2007 21:55 | 17K | |
![[SND]](/icons/sound2.gif) | letterless.mp3 | 18-Apr-2007 21:56 | 17K | |
![[SND]](/icons/sound2.gif) | letterzine.mp3 | 18-Apr-2007 21:56 | 17K | |
![[SND]](/icons/sound2.gif) | lettredecachet.mp3 | 18-Apr-2007 21:56 | 17K | |
![[SND]](/icons/sound2.gif) | lettredechange.mp3 | 18-Apr-2007 21:56 | 17K | |
![[SND]](/icons/sound2.gif) | lettredecreance.mp3 | 18-Apr-2007 21:56 | 17K | |
![[SND]](/icons/sound2.gif) | lettrism.mp3 | 18-Apr-2007 21:56 | 17K | |
![[SND]](/icons/sound2.gif) | letzeburgesch.mp3 | 18-Apr-2007 21:56 | 17K | |
![[SND]](/icons/sound2.gif) | leucemia.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucippus.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucobase.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucocratic.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucoderma.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucoline.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucomaine.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucon.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leuconostoc.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucoplakia.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucopoiesis.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucothoe.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucotome.mp3 | 18-Apr-2007 21:57 | 17K | |
![[SND]](/icons/sound2.gif) | leucotomy.mp3 | 18-Apr-2007 21:58 | 17K | |
![[SND]](/icons/sound2.gif) | leuenkephalin.mp3 | 18-Apr-2007 21:58 | 17K | |
![[SND]](/icons/sound2.gif) | leukoblast.mp3 | 18-Apr-2007 21:58 | 17K | |
![[SND]](/icons/sound2.gif) | leukocidin.mp3 | 18-Apr-2007 21:58 | 17K | |
![[SND]](/icons/sound2.gif) | leukocyt.mp3 | 18-Apr-2007 21:58 | 17K | |
![[SND]](/icons/sound2.gif) | leukoderma.mp3 | 18-Apr-2007 21:58 | 17K | |
![[SND]](/icons/sound2.gif) | leukopedesis.mp3 | 18-Apr-2007 21:59 | 17K | |
![[SND]](/icons/sound2.gif) | leukotaxine.mp3 | 18-Apr-2007 21:59 | 17K | |
![[SND]](/icons/sound2.gif) | levalloisperret.mp3 | 18-Apr-2007 21:59 | 17K | |
![[SND]](/icons/sound2.gif) | levallorphan.mp3 | 18-Apr-2007 21:59 | 17K | |
![[SND]](/icons/sound2.gif) | levarterenol.mp3 | 18-Apr-2007 22:00 | 17K | |
![[SND]](/icons/sound2.gif) | leverhulme.mp3 | 18-Apr-2007 22:00 | 17K | |
![[SND]](/icons/sound2.gif) | leverrier.mp3 | 18-Apr-2007 22:01 | 17K | |
![[SND]](/icons/sound2.gif) | levesongower.mp3 | 18-Apr-2007 22:01 | 17K | |
![[SND]](/icons/sound2.gif) | levistrauss.mp3 | 18-Apr-2007 22:01 | 17K | |
![[SND]](/icons/sound2.gif) | levorphanol.mp3 | 18-Apr-2007 22:02 | 17K | |
![[SND]](/icons/sound2.gif) | levulinicacid.mp3 | 18-Apr-2007 22:02 | 17K | |
![[SND]](/icons/sound2.gif) | levybruhl.mp3 | 18-Apr-2007 22:02 | 17K | |
![[SND]](/icons/sound2.gif) | lewisohn.mp3 | 18-Apr-2007 22:02 | 17K | |
![[SND]](/icons/sound2.gif) | lexan.mp3 | 18-Apr-2007 22:03 | 17K | |
![[SND]](/icons/sound2.gif) | lexdomicilii.mp3 | 18-Apr-2007 22:03 | 17K | |
![[SND]](/icons/sound2.gif) | lexfori.mp3 | 18-Apr-2007 22:03 | 17K | |
![[SND]](/icons/sound2.gif) | lexicostatistics.mp3 | 18-Apr-2007 22:03 | 17K | |
![[SND]](/icons/sound2.gif) | lexigram.mp3 | 18-Apr-2007 22:03 | 17K | |
![[SND]](/icons/sound2.gif) | lexigraphy.mp3 | 18-Apr-2007 22:03 | 17K | |
![[SND]](/icons/sound2.gif) | lexloci.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | lexnonscripta.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | lextalionis.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | leydigcell.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | lezemajesty.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | lezghian.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | lhasaapso.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | lhevinne.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | lhospital.mp3 | 18-Apr-2007 22:04 | 17K | |
![[SND]](/icons/sound2.gif) | liakoura.mp3 | 18-Apr-2007 22:05 | 17K | |
![[SND]](/icons/sound2.gif) | liangchichao.mp3 | 18-Apr-2007 22:05 | 17K | |
![[SND]](/icons/sound2.gif) | liaochengzhi.mp3 | 18-Apr-2007 22:05 | 17K | |
![[SND]](/icons/sound2.gif) | libava.mp3 | 18-Apr-2007 22:06 | 17K | |
![[SND]](/icons/sound2.gif) | liberalia.mp3 | 18-Apr-2007 22:07 | 17K | |
![[SND]](/icons/sound2.gif) | liberationism.mp3 | 18-Apr-2007 22:07 | 17K | |
![[SND]](/icons/sound2.gif) | libermanism.mp3 | 18-Apr-2007 22:07 | 17K | |
![[SND]](/icons/sound2.gif) | libero.mp3 | 18-Apr-2007 22:07 | 17K | |
![[SND]](/icons/sound2.gif) | libertad.mp3 | 18-Apr-2007 22:07 | 17K | |
![[SND]](/icons/sound2.gif) | liberticide.mp3 | 18-Apr-2007 22:08 | 17K | |
![[SND]](/icons/sound2.gif) | libertyman.mp3 | 18-Apr-2007 22:08 | 17K | |
![[SND]](/icons/sound2.gif) | libertyville.mp3 | 18-Apr-2007 22:08 | 17K | |
![[SND]](/icons/sound2.gif) | liberumveto.mp3 | 18-Apr-2007 22:08 | 17K | |
![[SND]](/icons/sound2.gif) | libidinize.mp3 | 18-Apr-2007 22:08 | 17K | |
![[SND]](/icons/sound2.gif) | licensed.mp3 | 18-Apr-2007 22:09 | 17K | |
![[SND]](/icons/sound2.gif) | lichenicacid.mp3 | 18-Apr-2007 22:10 | 17K | |
![[SND]](/icons/sound2.gif) | lichenification.mp3 | 18-Apr-2007 22:10 | 17K | |
![[SND]](/icons/sound2.gif) | lichenin.mp3 | 18-Apr-2007 22:10 | 17K | |
![[SND]](/icons/sound2.gif) | lichenism.mp3 | 18-Apr-2007 22:10 | 17K | |
![[SND]](/icons/sound2.gif) | lichenoid.mp3 | 18-Apr-2007 22:10 | 17K | |
![[SND]](/icons/sound2.gif) | lichenometry.mp3 | 18-Apr-2007 22:10 | 17K | |
![[SND]](/icons/sound2.gif) | licketysplit.mp3 | 18-Apr-2007 22:10 | 17K | |
![[SND]](/icons/sound2.gif) | lidenghui.mp3 | 18-Apr-2007 22:11 | 17K | |
![[SND]](/icons/sound2.gif) | liebermann.mp3 | 18-Apr-2007 22:11 | 17K | |
![[SND]](/icons/sound2.gif) | lienectomy.mp3 | 18-Apr-2007 22:12 | 17K | |
![[SND]](/icons/sound2.gif) | lienitis.mp3 | 18-Apr-2007 22:12 | 17K | |
![[SND]](/icons/sound2.gif) | lienteric.mp3 | 18-Apr-2007 22:12 | 17K | |
![[SND]](/icons/sound2.gif) | lientery.mp3 | 18-Apr-2007 22:12 | 17K | |
![[SND]](/icons/sound2.gif) | lienyunkang.mp3 | 18-Apr-2007 22:12 | 17K | |
![[SND]](/icons/sound2.gif) | liestal.mp3 | 18-Apr-2007 22:12 | 17K | |
![[SND]](/icons/sound2.gif) | lifeboatman.mp3 | 18-Apr-2007 22:13 | 17K | |
![[SND]](/icons/sound2.gif) | lifeofriley.mp3 | 18-Apr-2007 22:13 | 17K | |
![[SND]](/icons/sound2.gif) | lifties.mp3 | 18-Apr-2007 22:14 | 17K | |
![[SND]](/icons/sound2.gif) | ligamentum.mp3 | 18-Apr-2007 22:14 | 17K | |
![[SND]](/icons/sound2.gif) | lightolove.mp3 | 18-Apr-2007 22:15 | 17K | |
![[SND]](/icons/sound2.gif) | lightsat.mp3 | 18-Apr-2007 22:16 | 17K | |
![[SND]](/icons/sound2.gif) | lignaloes.mp3 | 18-Apr-2007 22:16 | 17K | |
![[SND]](/icons/sound2.gif) | lignicolous.mp3 | 18-Apr-2007 22:16 | 17K | |
![[SND]](/icons/sound2.gif) | lignitiferous.mp3 | 18-Apr-2007 22:16 | 17K | |
![[SND]](/icons/sound2.gif) | lignocaine.mp3 | 18-Apr-2007 22:17 | 17K | |
![[SND]](/icons/sound2.gif) | lignumvitae.mp3 | 18-Apr-2007 22:17 | 17K | |
![[SND]](/icons/sound2.gif) | ligroin.mp3 | 18-Apr-2007 22:17 | 17K | |
![[SND]](/icons/sound2.gif) | ligustrum.mp3 | 18-Apr-2007 22:17 | 17K | |
![[SND]](/icons/sound2.gif) | lihsiennien.mp3 | 18-Apr-2007 22:17 | 17K | |
![[SND]](/icons/sound2.gif) | lihsueh.mp3 | 18-Apr-2007 22:17 | 17K | |
![[SND]](/icons/sound2.gif) | lihungchang.mp3 | 18-Apr-2007 22:17 | 17K | |
![[SND]](/icons/sound2.gif) | likin.mp3 | 18-Apr-2007 22:18 | 17K | |
![[SND]](/icons/sound2.gif) | lilabner.mp3 | 18-Apr-2007 22:18 | 17K | |
![[SND]](/icons/sound2.gif) | lilburne.mp3 | 18-Apr-2007 22:18 | 17K | |
![[SND]](/icons/sound2.gif) | liliaceous.mp3 | 18-Apr-2007 22:18 | 17K | |
![[SND]](/icons/sound2.gif) | lillebaelt.mp3 | 18-Apr-2007 22:19 | 17K | |
![[SND]](/icons/sound2.gif) | lilleyandskinner.mp3 | 18-Apr-2007 22:19 | 17K | |
![[SND]](/icons/sound2.gif) | lillibullero.mp3 | 18-Apr-2007 22:19 | 17K | |
![[SND]](/icons/sound2.gif) | lillypilly.mp3 | 18-Apr-2007 22:19 | 17K | |
![[SND]](/icons/sound2.gif) | limabean.mp3 | 18-Apr-2007 22:19 | 17K | |
![[SND]](/icons/sound2.gif) | limacine.mp3 | 18-Apr-2007 22:19 | 17K | |
![[SND]](/icons/sound2.gif) | limassol.mp3 | 18-Apr-2007 22:20 | 17K | |
![[SND]](/icons/sound2.gif) | limfjord.mp3 | 18-Apr-2007 22:21 | 17K | |
![[SND]](/icons/sound2.gif) | limicoline.mp3 | 18-Apr-2007 22:21 | 17K | |
![[SND]](/icons/sound2.gif) | liminality.mp3 | 18-Apr-2007 22:21 | 17K | |
![[SND]](/icons/sound2.gif) | limitarian.mp3 | 18-Apr-2007 22:21 | 17K | |
![[SND]](/icons/sound2.gif) | limites.mp3 | 18-Apr-2007 22:21 | 17K | |
![[SND]](/icons/sound2.gif) | limivorous.mp3 | 18-Apr-2007 22:22 | 17K | |
![[SND]](/icons/sound2.gif) | limmasol.mp3 | 18-Apr-2007 22:22 | 17K | |
![[SND]](/icons/sound2.gif) | limnophilous.mp3 | 18-Apr-2007 22:22 | 17K | |
![[SND]](/icons/sound2.gif) | limonnaya.mp3 | 18-Apr-2007 22:22 | 17K | |
![[SND]](/icons/sound2.gif) | limuloid.mp3 | 18-Apr-2007 22:23 | 17K | |
![[SND]](/icons/sound2.gif) | linalylacetate.mp3 | 18-Apr-2007 22:23 | 17K | |
![[SND]](/icons/sound2.gif) | linaria.mp3 | 18-Apr-2007 22:23 | 17K | |
![[SND]](/icons/sound2.gif) | lincolnwood.mp3 | 18-Apr-2007 22:24 | 17K | |
![[SND]](/icons/sound2.gif) | lincrusta.mp3 | 18-Apr-2007 22:24 | 17K | |
![[SND]](/icons/sound2.gif) | linctus.mp3 | 18-Apr-2007 22:24 | 17K | |
![[SND]](/icons/sound2.gif) | lindegren.mp3 | 18-Apr-2007 22:24 | 17K | |
![[SND]](/icons/sound2.gif) | lindelofspace.mp3 | 18-Apr-2007 22:24 | 17K | |
![[SND]](/icons/sound2.gif) | linder.mp3 | 18-Apr-2007 22:24 | 17K | |
![[SND]](/icons/sound2.gif) | linenized.mp3 | 18-Apr-2007 22:26 | 17K | |
![[SND]](/icons/sound2.gif) | lingayata.mp3 | 18-Apr-2007 22:27 | 17K | |
![[SND]](/icons/sound2.gif) | lingayengulf.mp3 | 18-Apr-2007 22:27 | 17K | |
![[SND]](/icons/sound2.gif) | linguafranca.mp3 | 18-Apr-2007 22:27 | 17K | |
![[SND]](/icons/sound2.gif) | linguageral.mp3 | 18-Apr-2007 22:27 | 17K | |
![[SND]](/icons/sound2.gif) | linguaphone.mp3 | 18-Apr-2007 22:27 | 17K | |
![[SND]](/icons/sound2.gif) | linguiform.mp3 | 18-Apr-2007 22:28 | 17K | |
![[SND]](/icons/sound2.gif) | linoleic.mp3 | 18-Apr-2007 22:29 | 17K | |
![[SND]](/icons/sound2.gif) | linolenate.mp3 | 18-Apr-2007 22:29 | 17K | |
![[SND]](/icons/sound2.gif) | linolenicacid.mp3 | 18-Apr-2007 22:29 | 17K | |
![[SND]](/icons/sound2.gif) | linseywoolsey.mp3 | 18-Apr-2007 22:30 | 17K | |
![[SND]](/icons/sound2.gif) | linuron.mp3 | 18-Apr-2007 22:30 | 17K | |
![[SND]](/icons/sound2.gif) | linyutang.mp3 | 18-Apr-2007 22:30 | 17K | |
![[SND]](/icons/sound2.gif) | linzertorte.mp3 | 18-Apr-2007 22:30 | 17K | |
![[SND]](/icons/sound2.gif) | lioncel.mp3 | 18-Apr-2007 22:31 | 17K | |
![[SND]](/icons/sound2.gif) | lionism.mp3 | 18-Apr-2007 22:31 | 17K | |
![[SND]](/icons/sound2.gif) | lipaemia.mp3 | 18-Apr-2007 22:31 | 17K | |
![[SND]](/icons/sound2.gif) | lipariislands.mp3 | 18-Apr-2007 22:31 | 17K | |
![[SND]](/icons/sound2.gif) | lipectomy.mp3 | 18-Apr-2007 22:31 | 17K | |
![[SND]](/icons/sound2.gif) | lipemia.mp3 | 18-Apr-2007 22:31 | 17K | |
![[SND]](/icons/sound2.gif) | lipochrome.mp3 | 18-Apr-2007 22:32 | 17K | |
![[SND]](/icons/sound2.gif) | lipofuscin.mp3 | 18-Apr-2007 22:32 | 17K | |
![[SND]](/icons/sound2.gif) | lipography.mp3 | 18-Apr-2007 22:32 | 17K | |
![[SND]](/icons/sound2.gif) | lipoicacid.mp3 | 18-Apr-2007 22:32 | 17K | |
![[SND]](/icons/sound2.gif) | lipoidosis.mp3 | 18-Apr-2007 22:32 | 17K | |
![[SND]](/icons/sound2.gif) | lipopexia.mp3 | 18-Apr-2007 22:33 | 17K | |
![[SND]](/icons/sound2.gif) | lipoplast.mp3 | 18-Apr-2007 22:33 | 17K | |
![[SND]](/icons/sound2.gif) | lippershey.mp3 | 18-Apr-2007 22:33 | 17K | |
![[SND]](/icons/sound2.gif) | lippesloop.mp3 | 18-Apr-2007 22:33 | 17K | |
![[SND]](/icons/sound2.gif) | lipsalve.mp3 | 18-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | lipschitzcondition.mp3 | 18-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | liptauer.mp3 | 18-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | liquefacient.mp3 | 18-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | liquefied.mp3 | 18-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | liquesce.mp3 | 18-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | liquidizer.mp3 | 18-Apr-2007 22:35 | 17K | |
![[SND]](/icons/sound2.gif) | liradabraccio.mp3 | 18-Apr-2007 22:35 | 17K | |
![[SND]](/icons/sound2.gif) | liriodendron.mp3 | 18-Apr-2007 22:35 | 17K | |
![[SND]](/icons/sound2.gif) | lishihmin.mp3 | 18-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | lisichansk.mp3 | 18-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | lismore.mp3 | 18-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | lispendens.mp3 | 18-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | lissajousfigure.mp3 | 18-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | lissotrichous.mp3 | 18-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | listerellosis.mp3 | 18-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | listerine.mp3 | 18-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | listerism.mp3 | 18-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | listermint.mp3 | 18-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | listessotempo.mp3 | 18-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | litaipo.mp3 | 18-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | litdejustice.mp3 | 18-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | literarism.mp3 | 18-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | lithogenous.mp3 | 18-Apr-2007 22:39 | 17K | |
![[SND]](/icons/sound2.gif) | lithontriptic.mp3 | 18-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | lithotrity.mp3 | 18-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | lithotroph.mp3 | 18-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | lithuresis.mp3 | 18-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | lithuria.mp3 | 18-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | litmusless.mp3 | 18-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | littera scripta manet.mp3 | 18-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | litteratim.mp3 | 18-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | litterlout.mp3 | 18-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | littleendian.mp3 | 18-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | littlelordfauntleroy.mp3 | 18-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | littlerhody.mp3 | 18-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | littlish.mp3 | 18-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | littoria.mp3 | 18-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | liushaoqi.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | liveaction.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | livebag.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | livebearer.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | livebirth.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | liveborn.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | livebox.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | livecenter.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | livedin.mp3 | 18-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | livedo.mp3 | 18-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | liveforever.mp3 | 18-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | liveone.mp3 | 18-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | liveparking.mp3 | 18-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | liverchestnut.mp3 | 18-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | liverextract.mp3 | 18-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | liverofsulfur.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | liveroil.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | liversausage.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | liverspots.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | livespindle.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | livesteam.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | livewire.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | liviadrusilla.mp3 | 18-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | livraison.mp3 | 18-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | lixiannian.mp3 | 18-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | lixivium.mp3 | 18-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | lizhengdao.mp3 | 18-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | lladro.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | llanero.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | llanfair.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | llangollen.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | llanoestacado.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | llbean.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | llerascamargo.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | lleullawgyffes.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | lleynpeninsula.mp3 | 18-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | lloydsbank.mp3 | 18-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | lloydwebber.mp3 | 18-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | loadsamoney.mp3 | 18-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | loaiasis.mp3 | 18-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | lobotomized.mp3 | 18-Apr-2007 22:50 | 17K | |
![[SND]](/icons/sound2.gif) | lobulose.mp3 | 18-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | localizer.mp3 | 18-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | lochaberax.mp3 | 18-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | lockerbie.mp3 | 18-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | lockerlampson.mp3 | 18-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | lockheed.mp3 | 18-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | lockhornsthe.mp3 | 18-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | lockian.mp3 | 18-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | locknit.mp3 | 18-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | locksman.mp3 | 18-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | lococitato.mp3 | 18-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | locofocoism.mp3 | 18-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | locomobile.mp3 | 18-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | locoprimocitato.mp3 | 18-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | locosupracitato.mp3 | 18-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | locprimocit.mp3 | 18-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | loculate.mp3 | 18-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | locumtenens.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locuscaeruleus.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locusclassicus.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locusinquo.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locussigilli.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locusstandi.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locusta.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locutionary.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locutorium.mp3 | 18-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | locutory.mp3 | 18-Apr-2007 22:56 | 17K | |
![[SND]](/icons/sound2.gif) | lofotenislands.mp3 | 18-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | lofter.mp3 | 18-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | logagraphia.mp3 | 18-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | loganiaceous.mp3 | 18-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | loganstone.mp3 | 18-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | logganstone.mp3 | 18-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | logicalc.mp3 | 18-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | logicism.mp3 | 18-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | logicize.mp3 | 18-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | lognormaldistribution.mp3 | 18-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | logographer.mp3 | 18-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | logography.mp3 | 18-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | logomania.mp3 | 18-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | logopedics.mp3 | 18-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | lohan.mp3 | 18-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | lohtaewoo.mp3 | 18-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | loiasis.mp3 | 18-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | loicadre.mp3 | 18-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | loireatlantique.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | loiretcher.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | lokacara.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | lokayata.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | lokayatika.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | lokole.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | lokris.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | loksabha.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | loliginid.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | lollapalooza.mp3 | 18-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | lollorosso.mp3 | 18-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | lollos.mp3 | 18-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | lomalinda.mp3 | 18-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | lombardi.mp3 | 18-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | lombrosianschool.mp3 | 18-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | lomeconvention.mp3 | 18-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | lomein.mp3 | 18-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | londondocklands.mp3 | 18-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | londonfox.mp3 | 18-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | londonism.mp3 | 18-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | londonize.mp3 | 18-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | longaeval.mp3 | 18-Apr-2007 23:04 | 17K | |
![[SND]](/icons/sound2.gif) | longchamp.mp3 | 18-Apr-2007 23:04 | 17K | |
![[SND]](/icons/sound2.gif) | longeur.mp3 | 18-Apr-2007 23:04 | 17K | |
![[SND]](/icons/sound2.gif) | longeval.mp3 | 18-Apr-2007 23:04 | 17K | |
![[SND]](/icons/sound2.gif) | longines.mp3 | 18-Apr-2007 23:05 | 17K | |
![[SND]](/icons/sound2.gif) | longipennate.mp3 | 18-Apr-2007 23:05 | 17K | |
![[SND]](/icons/sound2.gif) | longirostral.mp3 | 18-Apr-2007 23:05 | 17K | |
![[SND]](/icons/sound2.gif) | longjenny.mp3 | 18-Apr-2007 23:05 | 17K | |
![[SND]](/icons/sound2.gif) | longleathouse.mp3 | 18-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | longlived.mp3 | 18-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | longshanks.mp3 | 18-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | longtonhall.mp3 | 18-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | longuette.mp3 | 18-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | longwind.mp3 | 18-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | longwinded.mp3 | 18-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | lonicera.mp3 | 18-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | lonsdalebelt.mp3 | 18-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | lonslesaunier.mp3 | 18-Apr-2007 23:08 | 17K | |
![[SND]](/icons/sound2.gif) | loogan.mp3 | 18-Apr-2007 23:08 | 17K | |
![[SND]](/icons/sound2.gif) | loopofhenle.mp3 | 18-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | looseness.mp3 | 18-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | looseygoosey.mp3 | 18-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | loovral.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lopatnikov.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lopedevega.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | loperamide.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lopezdeayala.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lopezdelegazpe.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lopezmateos.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lopezyfuentes.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lophobranch.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lopnor.mp3 | 18-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | lordolatry.mp3 | 18-Apr-2007 23:11 | 17K | |
![[SND]](/icons/sound2.gif) | loricate.mp3 | 18-Apr-2007 23:12 | 17K | |
![[SND]](/icons/sound2.gif) | lorisiform.mp3 | 18-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | losalamos.mp3 | 18-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | losangeleno.mp3 | 18-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | losangeles.mp3 | 18-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | loscaprichos.mp3 | 18-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | loschmidtsnumber.mp3 | 18-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | lotetgaronne.mp3 | 18-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | lothair.mp3 | 18-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | lotong.mp3 | 18-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | lotophagi.mp3 | 18-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | louisheel.mp3 | 18-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | louisi.mp3 | 18-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | louisnapoleon.mp3 | 18-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | louisquatorze.mp3 | 18-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | louisquinze.mp3 | 18-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | louisseize.mp3 | 18-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | louistreize.mp3 | 18-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | louisvuitton.mp3 | 18-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | lounsbury.mp3 | 18-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | loupcervier.mp3 | 18-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | lourencomarques.mp3 | 18-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | loutrophoros.mp3 | 18-Apr-2007 23:18 | 17K | |
![[SND]](/icons/sound2.gif) | loveydovey.mp3 | 18-Apr-2007 23:20 | 17K | |
![[SND]](/icons/sound2.gif) | lowenbrau.mp3 | 18-Apr-2007 23:20 | 17K | |
![[SND]](/icons/sound2.gif) | lowerempire.mp3 | 18-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | lowerhutt.mp3 | 18-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | lowerslobbovia.mp3 | 18-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | lowfi.mp3 | 18-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | lowitzarc.mp3 | 18-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | lowlived.mp3 | 18-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | lowrie.mp3 | 18-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | lowveld.mp3 | 18-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | loxodromic.mp3 | 18-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | loxodromics.mp3 | 18-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | loxygen.mp3 | 18-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | lozengy.mp3 | 18-Apr-2007 23:23 | 17K | |
![[SND]](/icons/sound2.gif) | lpam.mp3 | 18-Apr-2007 23:23 | 17K | |
![[SND]](/icons/sound2.gif) | luangprabang.mp3 | 18-Apr-2007 23:23 | 17K | |
![[SND]](/icons/sound2.gif) | lubangislands.mp3 | 18-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | lubricatory.mp3 | 18-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | lubritorium.mp3 | 18-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | lucasvanleyden.mp3 | 18-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | lucifugous.mp3 | 18-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | lucilius.mp3 | 18-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | luciusi.mp3 | 18-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | lucrece.mp3 | 18-Apr-2007 23:27 | 17K | |
![[SND]](/icons/sound2.gif) | lucystoner.mp3 | 18-Apr-2007 23:27 | 17K | |
![[SND]](/icons/sound2.gif) | ludwigshafen.mp3 | 18-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | lugones.mp3 | 18-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | lugouqiao.mp3 | 18-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | luguvallium.mp3 | 18-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | lukiko.mp3 | 18-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | lukouchiao.mp3 | 18-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | lumbricalis.mp3 | 18-Apr-2007 23:30 | 17K | |
![[SND]](/icons/sound2.gif) | lumbricoid.mp3 | 18-Apr-2007 23:30 | 17K | |
![[SND]](/icons/sound2.gif) | lumholtzskangaroo.mp3 | 18-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | luminophore.mp3 | 18-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | lumisterol.mp3 | 18-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | lumpenproletariat.mp3 | 18-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | lunanaut.mp3 | 18-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | lunilogical.mp3 | 18-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | lunokhod.mp3 | 18-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | luo.mp3 | 18-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | luoravetlan.mp3 | 18-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | lupiform.mp3 | 18-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | lupoid.mp3 | 18-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | lupusvulgaris.mp3 | 18-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | luristan.mp3 | 18-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | lusiadsthe.mp3 | 18-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | lustrine.mp3 | 18-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | lususnaturae.mp3 | 18-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | lutdesert.mp3 | 18-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | lutecium.mp3 | 18-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | luteolin.mp3 | 18-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | lutinebell.mp3 | 18-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | lutonhoo.mp3 | 18-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | lutuamian.mp3 | 18-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | lutzowholmbay.mp3 | 18-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | luwangschool.mp3 | 18-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | luxembourg.mp3 | 18-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | luxembourger.mp3 | 18-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | luxembourgian.mp3 | 18-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | luxian.mp3 | 18-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | luxullianite.mp3 | 18-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | lyamhound.mp3 | 18-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | lycaon.mp3 | 18-Apr-2007 23:42 | 17K | |
![[SND]](/icons/sound2.gif) | lykewake.mp3 | 18-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | lymedisease.mp3 | 18-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | lymegrass.mp3 | 18-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | lymeregis.mp3 | 18-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | lymphadenectomy.mp3 | 18-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | lymphadenoma.mp3 | 18-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | lymphangi.mp3 | 18-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | lymphangial.mp3 | 18-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | lymphangioma.mp3 | 18-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | lymphangitis.mp3 | 18-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | lymphatolysis.mp3 | 18-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | lymphocytopenia.mp3 | 18-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | lymphopenia.mp3 | 18-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | lymphopoiesis.mp3 | 18-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | lyocratic.mp3 | 18-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | lyolysis.mp3 | 18-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | lyricize.mp3 | 18-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | lyriform.mp3 | 18-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | lysergicacid.mp3 | 18-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | lysistrata.mp3 | 18-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | lysocline.mp3 | 18-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | lysogenesis.mp3 | 18-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | lysol.mp3 | 18-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | lysostaphin.mp3 | 18-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | lyssophobia.mp3 | 18-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | lystrosaurus.mp3 | 18-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | lythamsaintannes.mp3 | 18-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | lythraceous.mp3 | 18-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | lacklandairforcebase.mp3 | 18-Apr-2007 20:33 | 17K | |
![[SND]](/icons/sound2.gif) | lasagradafamilia.mp3 | 18-Apr-2007 21:08 | 17K | |
![[SND]](/icons/sound2.gif) | leidenfrostphenomenon.mp3 | 18-Apr-2007 21:41 | 17K | |
![[SND]](/icons/sound2.gif) | litteraehumaniores.mp3 | 18-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | leschnyhansyndrome.mp3 | 18-Apr-2007 21:53 | 18K | |
![[SND]](/icons/sound2.gif) | llandrindodwells.mp3 | 18-Apr-2007 22:47 | 18K | |
![[SND]](/icons/sound2.gif) | llywelynapgruffudd.mp3 | 18-Apr-2007 22:48 | 18K | |
![[SND]](/icons/sound2.gif) | locuspoenitentiae.mp3 | 18-Apr-2007 22:55 | 18K | |
![[SND]](/icons/sound2.gif) | lordstownsyndrome.mp3 | 18-Apr-2007 23:12 | 18K | |
![[SND]](/icons/sound2.gif) | lowse.mp3 | 18-Apr-2007 23:22 | 18K | |
![[SND]](/icons/sound2.gif) | la belle dame sans merci.mp3 | 18-Apr-2007 20:26 | 18K | |
![[SND]](/icons/sound2.gif) | lupus erythematosus.mp3 | 18-Apr-2007 23:35 | 18K | |
![[SND]](/icons/sound2.gif) | lafcadiosadventures.mp3 | 18-Apr-2007 20:39 | 18K | |
![[SND]](/icons/sound2.gif) | laughlinairforcebase.mp3 | 18-Apr-2007 21:16 | 18K | |
![[SND]](/icons/sound2.gif) | leukocytoblast.mp3 | 18-Apr-2007 21:58 | 18K | |
![[SND]](/icons/sound2.gif) | lupuserythematosus.mp3 | 18-Apr-2007 23:35 | 18K | |
![[SND]](/icons/sound2.gif) | lymphogranulomatoses.mp3 | 18-Apr-2007 23:45 | 18K | |
![[SND]](/icons/sound2.gif) | lymphogranulomatosis.mp3 | 18-Apr-2007 23:45 | 18K | |
![[SND]](/icons/sound2.gif) | litterae humaniores.mp3 | 18-Apr-2007 22:41 | 19K | |
![[SND]](/icons/sound2.gif) | laborare est orare.mp3 | 18-Apr-2007 20:30 | 20K | |
![[SND]](/icons/sound2.gif) | laudator temporis acti.mp3 | 18-Apr-2007 21:15 | 21K | |
![[SND]](/icons/sound2.gif) | lymphogranuloma venereum.mp3 | 18-Apr-2007 23:45 | 21K | |
![[SND]](/icons/sound2.gif) | le roi est mort, vive le roi.mp3 | 18-Apr-2007 21:24 | 22K | |
![[SND]](/icons/sound2.gif) | lymphogranuloma inguinale.mp3 | 18-Apr-2007 23:45 | 22K | |
![[SND]](/icons/sound2.gif) | lysergic acid diethylamide.mp3 | 18-Apr-2007 23:50 | 23K | |
![[SND]](/icons/sound2.gif) | Laccadive, Minicoy and Amindivi Islands.mp3 | 18-Apr-2007 20:31 | 23K | |
![[SND]](/icons/sound2.gif) | lymphocytic choriomeningitis.mp3 | 18-Apr-2007 23:44 | 23K | |
![[SND]](/icons/sound2.gif) | labandancenotationsystem.mp3 | 18-Apr-2007 20:28 | 27K | |
![[SND]](/icons/sound2.gif) | laborareestorare.mp3 | 18-Apr-2007 20:30 | 27K | |
![[SND]](/icons/sound2.gif) | laboromniavincit.mp3 | 18-Apr-2007 20:30 | 27K | |
![[SND]](/icons/sound2.gif) | ladislausi.mp3 | 18-Apr-2007 20:38 | 27K | |
![[SND]](/icons/sound2.gif) | ladyamherstspheasant.mp3 | 18-Apr-2007 20:38 | 27K | |
![[SND]](/icons/sound2.gif) | languedocroussillon.mp3 | 18-Apr-2007 20:58 | 27K | |
![[SND]](/icons/sound2.gif) | latitia.mp3 | 18-Apr-2007 21:13 | 27K | |
![[SND]](/icons/sound2.gif) | laudatortemporisacti.mp3 | 18-Apr-2007 21:15 | 27K | |
![[SND]](/icons/sound2.gif) | lazarillodetormes.mp3 | 18-Apr-2007 21:22 | 27K | |
![[SND]](/icons/sound2.gif) | lebourgeoisgentilhomme.mp3 | 18-Apr-2007 21:32 | 27K | |
![[SND]](/icons/sound2.gif) | leif.mp3 | 18-Apr-2007 21:41 | 27K | |
![[SND]](/icons/sound2.gif) | leila.mp3 | 18-Apr-2007 21:42 | 27K | |
![[SND]](/icons/sound2.gif) | lenoir.mp3 | 18-Apr-2007 21:47 | 27K | |
![[SND]](/icons/sound2.gif) | leroy.mp3 | 18-Apr-2007 21:52 | 27K | |
![[SND]](/icons/sound2.gif) | letitia.mp3 | 18-Apr-2007 21:55 | 27K | |
![[SND]](/icons/sound2.gif) | lineate.mp3 | 18-Apr-2007 22:26 | 27K | |
![[SND]](/icons/sound2.gif) | liutiaohu.mp3 | 18-Apr-2007 22:43 | 27K | |
![[SND]](/icons/sound2.gif) | lived.mp3 | 18-Apr-2007 22:43 | 27K | |
![[SND]](/icons/sound2.gif) | lloydaereoboliviano.mp3 | 18-Apr-2007 22:47 | 27K | |
![[SND]](/icons/sound2.gif) | llywelynapiorwerth.mp3 | 18-Apr-2007 22:48 | 27K | |
![[SND]](/icons/sound2.gif) | lopezportilloypacheco.mp3 | 18-Apr-2007 23:10 | 27K | |
![[SND]](/icons/sound2.gif) | lotpolishairlines.mp3 | 18-Apr-2007 23:15 | 27K | |
![[SND]](/icons/sound2.gif) | lubricatorium.mp3 | 18-Apr-2007 23:25 | 27K | |
![[SND]](/icons/sound2.gif) | lucusanonlucendo.mp3 | 18-Apr-2007 23:27 | 27K | |
![[SND]](/icons/sound2.gif) | lufthansagermanairlines.mp3 | 18-Apr-2007 23:28 | 27K | |
![[SND]](/icons/sound2.gif) | lysergicaciddiethylamide.mp3 | 18-Apr-2007 23:50 | 27K | |
![[SND]](/icons/sound2.gif) | leukemicreticuloendotheliosis.mp3 | 18-Apr-2007 21:58 | 27K | |
![[SND]](/icons/sound2.gif) | le c[oe]ur a ses raisons que la raison ne connait point.mp3 | 18-Apr-2007 21:23 | 31K | |
![[SND]](/icons/sound2.gif) | lasciate ogni speranza, voi ch'entrate.mp3 | 18-Apr-2007 21:08 | 35K | |
![[SND]](/icons/sound2.gif) | lasciateognisperanzavoichentrate.mp3 | 18-Apr-2007 21:08 | 36K | |
![[SND]](/icons/sound2.gif) | liberteegalitefraternite.mp3 | 18-Apr-2007 22:08 | 36K | |
|