![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | a votre sante.mp3 | 13-Apr-2007 22:32 | 12K | |
![[SND]](/icons/sound2.gif) | a tort et a travers.mp3 | 13-Apr-2007 22:32 | 16K | |
![[SND]](/icons/sound2.gif) | a tergo.mp3 | 13-Apr-2007 22:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | a tempo.mp3 | 13-Apr-2007 22:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | arenite.mp3 | 14-Apr-2007 03:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | arenicolous.mp3 | 14-Apr-2007 03:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | arene.mp3 | 14-Apr-2007 03:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | arendt.mp3 | 14-Apr-2007 03:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | arenavirus.mp3 | 14-Apr-2007 03:57 | 10K | |
![[SND]](/icons/sound2.gif) | arenaceous.mp3 | 14-Apr-2007 03:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | arena.mp3 | 14-Apr-2007 03:57 | 5.5K | |
![[SND]](/icons/sound2.gif) | areligious.mp3 | 14-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | areg.mp3 | 14-Apr-2007 03:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | arecoline.mp3 | 14-Apr-2007 03:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | areca.mp3 | 14-Apr-2007 03:56 | 5.2K | |
![[SND]](/icons/sound2.gif) | areaway.mp3 | 14-Apr-2007 03:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | areavitellina.mp3 | 14-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | areavasculosa.mp3 | 14-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | areapellucida.mp3 | 14-Apr-2007 03:56 | 27K | |
![[SND]](/icons/sound2.gif) | areaopaca.mp3 | 14-Apr-2007 03:56 | 17K | |
![[SND]](/icons/sound2.gif) | areally.mp3 | 14-Apr-2007 03:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | areal.mp3 | 14-Apr-2007 03:56 | 5.4K | |
![[SND]](/icons/sound2.gif) | area.mp3 | 14-Apr-2007 03:56 | 4.6K | |
![[SND]](/icons/sound2.gif) | are.mp3 | 14-Apr-2007 03:56 | 4.3K | |
![[SND]](/icons/sound2.gif) | arduousness.mp3 | 14-Apr-2007 03:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | arduous.mp3 | 14-Apr-2007 03:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | ardor.mp3 | 14-Apr-2007 03:56 | 4.1K | |
![[SND]](/icons/sound2.gif) | ardent.mp3 | 14-Apr-2007 03:56 | 4.6K | |
![[SND]](/icons/sound2.gif) | ardency.mp3 | 14-Apr-2007 03:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | ardella.mp3 | 14-Apr-2007 03:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | ardeid.mp3 | 14-Apr-2007 03:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | ardeb.mp3 | 14-Apr-2007 03:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | ard.mp3 | 14-Apr-2007 03:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | arcussenilis.mp3 | 14-Apr-2007 03:55 | 17K | |
![[SND]](/icons/sound2.gif) | arcus.mp3 | 14-Apr-2007 03:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | arcuation.mp3 | 14-Apr-2007 03:55 | 17K | |
![[SND]](/icons/sound2.gif) | arcuately.mp3 | 14-Apr-2007 03:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | arcuate.mp3 | 14-Apr-2007 03:55 | 5.4K | |
![[SND]](/icons/sound2.gif) | arcturian.mp3 | 14-Apr-2007 03:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | arctophile.mp3 | 14-Apr-2007 03:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | arctogeic.mp3 | 14-Apr-2007 03:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | arctogaea.mp3 | 14-Apr-2007 03:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | arctiid.mp3 | 14-Apr-2007 03:55 | 17K | |
![[SND]](/icons/sound2.gif) | arctically.mp3 | 14-Apr-2007 03:55 | 5.2K | |
![[SND]](/icons/sound2.gif) | arctic.mp3 | 14-Apr-2007 03:55 | 4.5K | |
![[SND]](/icons/sound2.gif) | arctangent.mp3 | 14-Apr-2007 03:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | arcsine.mp3 | 14-Apr-2007 03:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | arcosolium.mp3 | 14-Apr-2007 03:55 | 17K | |
![[SND]](/icons/sound2.gif) | arcos.mp3 | 14-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | arcology.mp3 | 14-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | arcograph.mp3 | 14-Apr-2007 03:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | arcoflowitz.mp3 | 14-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | arco.mp3 | 14-Apr-2007 03:54 | 5.0K | |
![[SND]](/icons/sound2.gif) | arcking.mp3 | 14-Apr-2007 03:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | arcked.mp3 | 14-Apr-2007 03:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | arcing.mp3 | 14-Apr-2007 03:54 | 5.2K | |
![[SND]](/icons/sound2.gif) | arcimboldi.mp3 | 14-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | arciform.mp3 | 14-Apr-2007 03:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | archy.mp3 | 14-Apr-2007 03:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | archway.mp3 | 14-Apr-2007 03:54 | 5.5K | |
![[SND]](/icons/sound2.gif) | archsee.mp3 | 14-Apr-2007 03:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | archrival.mp3 | 14-Apr-2007 03:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | archpriestship.mp3 | 14-Apr-2007 03:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | archpriest.mp3 | 14-Apr-2007 03:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | archosaurian.mp3 | 14-Apr-2007 03:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | archosaur.mp3 | 14-Apr-2007 03:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | archoplasmic.mp3 | 14-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | archoplasm.mp3 | 14-Apr-2007 03:54 | 17K | |
![[SND]](/icons/sound2.gif) | archonship.mp3 | 14-Apr-2007 03:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | archon.mp3 | 14-Apr-2007 03:54 | 5.7K | |
![[SND]](/icons/sound2.gif) | archology.mp3 | 14-Apr-2007 03:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | archness.mp3 | 14-Apr-2007 03:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | archly.mp3 | 14-Apr-2007 03:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | archlute.mp3 | 14-Apr-2007 03:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | archivolt.mp3 | 14-Apr-2007 03:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | archivist.mp3 | 14-Apr-2007 03:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | archive.mp3 | 14-Apr-2007 03:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | archivally.mp3 | 14-Apr-2007 03:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | archival.mp3 | 14-Apr-2007 03:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | architraved.mp3 | 14-Apr-2007 03:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | architrave.mp3 | 14-Apr-2007 03:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | architectureparlante.mp3 | 14-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | architecture.mp3 | 14-Apr-2007 03:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | architecturally.mp3 | 14-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | architectural.mp3 | 14-Apr-2007 03:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | architectonics.mp3 | 14-Apr-2007 03:53 | 11K | |
![[SND]](/icons/sound2.gif) | architectonically.mp3 | 14-Apr-2007 03:53 | 10K | |
![[SND]](/icons/sound2.gif) | architectonic.mp3 | 14-Apr-2007 03:53 | 9.3K | |
![[SND]](/icons/sound2.gif) | architect.mp3 | 14-Apr-2007 03:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | archiplasmic.mp3 | 14-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | archiplasm.mp3 | 14-Apr-2007 03:53 | 17K | |
![[SND]](/icons/sound2.gif) | archipielagodecolon.mp3 | 14-Apr-2007 03:53 | 27K | |
![[SND]](/icons/sound2.gif) | archiphoneme.mp3 | 14-Apr-2007 03:53 | 27K | |
![[SND]](/icons/sound2.gif) | archipelago.mp3 | 14-Apr-2007 03:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | archipelagic.mp3 | 14-Apr-2007 03:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | archipelagian.mp3 | 14-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | arching.mp3 | 14-Apr-2007 03:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | archine.mp3 | 14-Apr-2007 03:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | archimandrite.mp3 | 14-Apr-2007 03:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | archimage.mp3 | 14-Apr-2007 03:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | archilochus.mp3 | 14-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | archilochian.mp3 | 14-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | archil.mp3 | 14-Apr-2007 03:52 | 4.3K | |
![[SND]](/icons/sound2.gif) | archiepiscopate.mp3 | 14-Apr-2007 03:52 | 10K | |
![[SND]](/icons/sound2.gif) | archiepiscopally.mp3 | 14-Apr-2007 03:52 | 9.8K | |
![[SND]](/icons/sound2.gif) | archiepiscopal.mp3 | 14-Apr-2007 03:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | archiepiscopacy.mp3 | 14-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | archiebunkerism.mp3 | 14-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | archie.mp3 | 14-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | archidiaconate.mp3 | 14-Apr-2007 03:52 | 17K | |
![[SND]](/icons/sound2.gif) | archidiaconal.mp3 | 14-Apr-2007 03:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | archicarp.mp3 | 14-Apr-2007 03:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | archibald.mp3 | 14-Apr-2007 03:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | archiater.mp3 | 14-Apr-2007 03:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | archi.mp3 | 14-Apr-2007 03:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | archfool.mp3 | 14-Apr-2007 03:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | archfoe.mp3 | 14-Apr-2007 03:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | archfiend.mp3 | 14-Apr-2007 03:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | archetypically.mp3 | 14-Apr-2007 03:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | archetypical.mp3 | 14-Apr-2007 03:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | archetype.mp3 | 14-Apr-2007 03:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | archetypally.mp3 | 14-Apr-2007 03:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | archetypal.mp3 | 14-Apr-2007 03:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | archetto.mp3 | 14-Apr-2007 03:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | archesporium.mp3 | 14-Apr-2007 03:51 | 17K | |
![[SND]](/icons/sound2.gif) | archesporial.mp3 | 14-Apr-2007 03:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | archespore.mp3 | 14-Apr-2007 03:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | archesnationalpark.mp3 | 14-Apr-2007 03:51 | 17K | |
![[SND]](/icons/sound2.gif) | archery.mp3 | 14-Apr-2007 03:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | archers.mp3 | 14-Apr-2007 03:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | archerfish.mp3 | 14-Apr-2007 03:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | archer.mp3 | 14-Apr-2007 03:51 | 4.5K | |
![[SND]](/icons/sound2.gif) | archeometry.mp3 | 14-Apr-2007 03:51 | 17K | |
![[SND]](/icons/sound2.gif) | archeometrist.mp3 | 14-Apr-2007 03:51 | 17K | |
![[SND]](/icons/sound2.gif) | archeomagnetismdating.mp3 | 14-Apr-2007 03:51 | 17K | |
![[SND]](/icons/sound2.gif) | archeology.mp3 | 14-Apr-2007 03:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | archeologic.mp3 | 14-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | archeocyte.mp3 | 14-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | archeoastronomy.mp3 | 14-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | archeoastronomical.mp3 | 14-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | archeo.mp3 | 14-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | archenteron.mp3 | 14-Apr-2007 03:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | archenteric.mp3 | 14-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | archenemy.mp3 | 14-Apr-2007 03:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | archencephalon.mp3 | 14-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | archemorus.mp3 | 14-Apr-2007 03:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | archegonium.mp3 | 14-Apr-2007 03:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | archegoniate.mp3 | 14-Apr-2007 03:50 | 17K | |
![[SND]](/icons/sound2.gif) | archegonial.mp3 | 14-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | archegonia.mp3 | 14-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | arched.mp3 | 14-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | archebanc.mp3 | 14-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | arche.mp3 | 14-Apr-2007 03:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | archdukedom.mp3 | 14-Apr-2007 03:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | archduke.mp3 | 14-Apr-2007 03:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | archduchy.mp3 | 14-Apr-2007 03:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | archduchess.mp3 | 14-Apr-2007 03:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | archducal.mp3 | 14-Apr-2007 03:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | archdioceses.mp3 | 14-Apr-2007 03:50 | 12K | |
![[SND]](/icons/sound2.gif) | archdiocese.mp3 | 14-Apr-2007 03:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | archdiocesan.mp3 | 14-Apr-2007 03:49 | 10K | |
![[SND]](/icons/sound2.gif) | archdeaconship.mp3 | 14-Apr-2007 03:49 | 17K | |
![[SND]](/icons/sound2.gif) | archdeaconry.mp3 | 14-Apr-2007 03:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | archdeacon.mp3 | 14-Apr-2007 03:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | archconservative.mp3 | 14-Apr-2007 03:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | archconfraternity.mp3 | 14-Apr-2007 03:49 | 17K | |
![[SND]](/icons/sound2.gif) | archbishopric.mp3 | 14-Apr-2007 03:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | archbishop.mp3 | 14-Apr-2007 03:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | archbanc.mp3 | 14-Apr-2007 03:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | archanthropine.mp3 | 14-Apr-2007 03:49 | 17K | |
![[SND]](/icons/sound2.gif) | archangelical.mp3 | 14-Apr-2007 03:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | archangelic.mp3 | 14-Apr-2007 03:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | archangel.mp3 | 14-Apr-2007 03:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | archaizer.mp3 | 14-Apr-2007 03:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | archaize.mp3 | 14-Apr-2007 03:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | archaistic.mp3 | 14-Apr-2007 03:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | archaist.mp3 | 14-Apr-2007 03:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | archaism.mp3 | 14-Apr-2007 03:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | archaically.mp3 | 14-Apr-2007 03:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | archaic.mp3 | 14-Apr-2007 03:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | archaeornis.mp3 | 14-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | archaeopteryx.mp3 | 14-Apr-2007 03:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | archaeometry.mp3 | 14-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | archaeometrist.mp3 | 14-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | archaeology.mp3 | 14-Apr-2007 03:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | archaeologist.mp3 | 14-Apr-2007 03:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | archaeologically.mp3 | 14-Apr-2007 03:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | archaeological.mp3 | 14-Apr-2007 03:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | archaeocyte.mp3 | 14-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | archaeocyathid.mp3 | 14-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | archaeoastronomy.mp3 | 14-Apr-2007 03:48 | 11K | |
![[SND]](/icons/sound2.gif) | archaeo.mp3 | 14-Apr-2007 03:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | archaebacterium.mp3 | 14-Apr-2007 03:48 | 11K | |
![[SND]](/icons/sound2.gif) | archaebacteria.mp3 | 14-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | archaean.mp3 | 14-Apr-2007 03:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | archaeal.mp3 | 14-Apr-2007 03:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | archaea.mp3 | 14-Apr-2007 03:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | arch.mp3 | 14-Apr-2007 03:48 | 4.6K | |
![[SND]](/icons/sound2.gif) | arcform.mp3 | 14-Apr-2007 03:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | arcesilaus.mp3 | 14-Apr-2007 03:48 | 17K | |
![[SND]](/icons/sound2.gif) | arcella.mp3 | 14-Apr-2007 03:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | arced.mp3 | 14-Apr-2007 03:48 | 4.1K | |
![[SND]](/icons/sound2.gif) | arcdetriomphe.mp3 | 14-Apr-2007 03:47 | 18K | |
![[SND]](/icons/sound2.gif) | arcd.mp3 | 14-Apr-2007 03:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | arccosine.mp3 | 14-Apr-2007 03:47 | 10K | |
![[SND]](/icons/sound2.gif) | arcboutant.mp3 | 14-Apr-2007 03:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | arcature.mp3 | 14-Apr-2007 03:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | arcas.mp3 | 14-Apr-2007 03:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | arcaro.mp3 | 14-Apr-2007 03:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | arcanumarcanorum.mp3 | 14-Apr-2007 03:47 | 27K | |
![[SND]](/icons/sound2.gif) | arcanum.mp3 | 14-Apr-2007 03:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | arcanist.mp3 | 14-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | arcaneness.mp3 | 14-Apr-2007 03:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | arcane.mp3 | 14-Apr-2007 03:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | arcana.mp3 | 14-Apr-2007 03:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | arcadocyprian.mp3 | 14-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | arcading.mp3 | 14-Apr-2007 03:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | arcadic.mp3 | 14-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | arcadianly.mp3 | 14-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | arcadian.mp3 | 14-Apr-2007 03:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | arcadia.mp3 | 14-Apr-2007 03:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | arcadesambo.mp3 | 14-Apr-2007 03:47 | 27K | |
![[SND]](/icons/sound2.gif) | arcadenik.mp3 | 14-Apr-2007 03:47 | 17K | |
![[SND]](/icons/sound2.gif) | arcaded.mp3 | 14-Apr-2007 03:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | arcade.mp3 | 14-Apr-2007 03:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | arca.mp3 | 14-Apr-2007 03:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | arc.mp3 | 14-Apr-2007 03:46 | 3.6K | |
![[SND]](/icons/sound2.gif) | arbys.mp3 | 14-Apr-2007 03:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | arbutus.mp3 | 14-Apr-2007 03:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | arbuckle.mp3 | 14-Apr-2007 03:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | arbroath.mp3 | 14-Apr-2007 03:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | arbovirus.mp3 | 14-Apr-2007 03:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | arbovirology.mp3 | 14-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | arbour.mp3 | 14-Apr-2007 03:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | arborvitae.mp3 | 14-Apr-2007 03:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | arborous.mp3 | 14-Apr-2007 03:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | arborize.mp3 | 14-Apr-2007 03:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | arborization.mp3 | 14-Apr-2007 03:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | arborist.mp3 | 14-Apr-2007 03:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | arborio rice.mp3 | 14-Apr-2007 03:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | arboriform.mp3 | 14-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | arboriculturist.mp3 | 14-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | arboriculture.mp3 | 14-Apr-2007 03:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | arboricultural.mp3 | 14-Apr-2007 03:46 | 9.6K | |
![[SND]](/icons/sound2.gif) | arboretum.mp3 | 14-Apr-2007 03:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | arboreta.mp3 | 14-Apr-2007 03:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | arboresque.mp3 | 14-Apr-2007 03:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | arborescently.mp3 | 14-Apr-2007 03:46 | 17K | |
![[SND]](/icons/sound2.gif) | arborescent.mp3 | 14-Apr-2007 03:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | arborescence.mp3 | 14-Apr-2007 03:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | arboreous.mp3 | 14-Apr-2007 03:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | arbored.mp3 | 14-Apr-2007 03:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | arboreally.mp3 | 14-Apr-2007 03:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | arboreal.mp3 | 14-Apr-2007 03:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | arbor.mp3 | 14-Apr-2007 03:45 | 4.8K | |
![[SND]](/icons/sound2.gif) | arblayd.mp3 | 14-Apr-2007 03:45 | 17K | |
![[SND]](/icons/sound2.gif) | arbitress.mp3 | 14-Apr-2007 03:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | arbitratorship.mp3 | 14-Apr-2007 03:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | arbitrator.mp3 | 14-Apr-2007 03:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | arbitrative.mp3 | 14-Apr-2007 03:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | arbitrationist.mp3 | 14-Apr-2007 03:45 | 17K | |
![[SND]](/icons/sound2.gif) | arbitrational.mp3 | 14-Apr-2007 03:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | arbitration.mp3 | 14-Apr-2007 03:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | arbitrate.mp3 | 14-Apr-2007 03:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | arbitrary.mp3 | 14-Apr-2007 03:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | arbitrariness.mp3 | 14-Apr-2007 03:45 | 10K | |
![[SND]](/icons/sound2.gif) | arbitrarily.mp3 | 14-Apr-2007 03:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | arbitrament.mp3 | 14-Apr-2007 03:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | arbitral.mp3 | 14-Apr-2007 03:45 | 5.5K | |
![[SND]](/icons/sound2.gif) | arbitrageur.mp3 | 14-Apr-2007 03:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | arbitrager.mp3 | 14-Apr-2007 03:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | arbitrage.mp3 | 14-Apr-2007 03:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | arbitrable.mp3 | 14-Apr-2007 03:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | arbiter elegantiarum.mp3 | 14-Apr-2007 03:44 | 17K | |
![[SND]](/icons/sound2.gif) | arbiterelegantiae.mp3 | 14-Apr-2007 03:44 | 18K | |
![[SND]](/icons/sound2.gif) | arbiter.mp3 | 14-Apr-2007 03:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | arbela.mp3 | 14-Apr-2007 03:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | arbalister.mp3 | 14-Apr-2007 03:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | arbalist.mp3 | 14-Apr-2007 03:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | arbalest.mp3 | 14-Apr-2007 03:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | arbakanfoth.mp3 | 14-Apr-2007 03:44 | 17K | |
![[SND]](/icons/sound2.gif) | arb.mp3 | 14-Apr-2007 03:44 | 4.8K | |
![[SND]](/icons/sound2.gif) | arawn.mp3 | 14-Apr-2007 03:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | araucarian.mp3 | 14-Apr-2007 03:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | araucaria.mp3 | 14-Apr-2007 03:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | araucania.mp3 | 14-Apr-2007 03:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | araucana.mp3 | 14-Apr-2007 03:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | aratusofsicyon.mp3 | 14-Apr-2007 03:44 | 18K | |
![[SND]](/icons/sound2.gif) | arational.mp3 | 14-Apr-2007 03:44 | 17K | |
![[SND]](/icons/sound2.gif) | araroba.mp3 | 14-Apr-2007 03:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | araponga.mp3 | 14-Apr-2007 03:43 | 17K | |
![[SND]](/icons/sound2.gif) | arapesh.mp3 | 14-Apr-2007 03:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | arapaima.mp3 | 14-Apr-2007 03:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | aranyaka.mp3 | 14-Apr-2007 03:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | aranrhod.mp3 | 14-Apr-2007 03:43 | 17K | |
![[SND]](/icons/sound2.gif) | aranjuez.mp3 | 14-Apr-2007 03:43 | 17K | |
![[SND]](/icons/sound2.gif) | araneose.mp3 | 14-Apr-2007 03:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | araneid.mp3 | 14-Apr-2007 03:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | aranda.mp3 | 14-Apr-2007 03:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | aran.mp3 | 14-Apr-2007 03:43 | 17K | |
![[SND]](/icons/sound2.gif) | aramis.mp3 | 14-Apr-2007 03:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | aramid.mp3 | 14-Apr-2007 03:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | aramean.mp3 | 14-Apr-2007 03:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | aramco.mp3 | 14-Apr-2007 03:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | aramburu.mp3 | 14-Apr-2007 03:43 | 17K | |
![[SND]](/icons/sound2.gif) | arama.mp3 | 14-Apr-2007 03:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | aralsea.mp3 | 14-Apr-2007 03:43 | 17K | |
![[SND]](/icons/sound2.gif) | arallu.mp3 | 14-Apr-2007 03:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | araliaceous.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | aralia.mp3 | 14-Apr-2007 03:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | araldite.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | arakanyoma.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | arak.mp3 | 14-Apr-2007 03:42 | 5.4K | |
![[SND]](/icons/sound2.gif) | aragonitic.mp3 | 14-Apr-2007 03:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | aragonite.mp3 | 14-Apr-2007 03:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | aragoman.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | aragats.mp3 | 14-Apr-2007 03:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | arafurasea.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | arafat.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | araeosystyle.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | araeostyle.mp3 | 14-Apr-2007 03:42 | 17K | |
![[SND]](/icons/sound2.gif) | arachnophobic.mp3 | 14-Apr-2007 03:42 | 10K | |
![[SND]](/icons/sound2.gif) | arachnophobia.mp3 | 14-Apr-2007 03:42 | 11K | |
![[SND]](/icons/sound2.gif) | arachnophobe.mp3 | 14-Apr-2007 03:41 | 11K | |
![[SND]](/icons/sound2.gif) | arachnology.mp3 | 14-Apr-2007 03:41 | 11K | |
![[SND]](/icons/sound2.gif) | arachnologist.mp3 | 14-Apr-2007 03:41 | 12K | |
![[SND]](/icons/sound2.gif) | arachnological.mp3 | 14-Apr-2007 03:41 | 13K | |
![[SND]](/icons/sound2.gif) | arachnoiditis.mp3 | 14-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | arachnoid.mp3 | 14-Apr-2007 03:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | arachnitis.mp3 | 14-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | arachnid.mp3 | 14-Apr-2007 03:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | arachne.mp3 | 14-Apr-2007 03:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | arachisoil.mp3 | 14-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | arachis oil.mp3 | 14-Apr-2007 03:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | arachidonicacid.mp3 | 14-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | arachidonic acid.mp3 | 14-Apr-2007 03:41 | 12K | |
![[SND]](/icons/sound2.gif) | arachidic.mp3 | 14-Apr-2007 03:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | araceous.mp3 | 14-Apr-2007 03:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | aracatuba.mp3 | 14-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | aracari.mp3 | 14-Apr-2007 03:41 | 17K | |
![[SND]](/icons/sound2.gif) | arac.mp3 | 14-Apr-2007 03:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | arable.mp3 | 14-Apr-2007 03:41 | 4.8K | |
![[SND]](/icons/sound2.gif) | arabis.mp3 | 14-Apr-2007 03:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | arabinoside.mp3 | 14-Apr-2007 03:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | arabinosic.mp3 | 14-Apr-2007 03:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | arabinose.mp3 | 14-Apr-2007 03:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | arability.mp3 | 14-Apr-2007 03:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | arabicize.mp3 | 14-Apr-2007 03:40 | 9.8K | |
![[SND]](/icons/sound2.gif) | arabicization.mp3 | 14-Apr-2007 03:40 | 11K | |
![[SND]](/icons/sound2.gif) | arabicacoffee.mp3 | 14-Apr-2007 03:40 | 17K | |
![[SND]](/icons/sound2.gif) | arabica.mp3 | 14-Apr-2007 03:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | arabiapetraea.mp3 | 14-Apr-2007 03:40 | 17K | |
![[SND]](/icons/sound2.gif) | arabiafelix.mp3 | 14-Apr-2007 03:40 | 17K | |
![[SND]](/icons/sound2.gif) | arabiadeserta.mp3 | 14-Apr-2007 03:40 | 17K | |
![[SND]](/icons/sound2.gif) | arabesquely.mp3 | 14-Apr-2007 03:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | arabesque.mp3 | 14-Apr-2007 03:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | arabel.mp3 | 14-Apr-2007 03:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | araban.mp3 | 14-Apr-2007 03:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | araa.mp3 | 14-Apr-2007 03:40 | 17K | |
![[SND]](/icons/sound2.gif) | ara.mp3 | 14-Apr-2007 03:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | ar.mp3 | 14-Apr-2007 03:40 | 4.6K | |
![[SND]](/icons/sound2.gif) | aquosity.mp3 | 14-Apr-2007 03:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | aquose.mp3 | 14-Apr-2007 03:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | aquo.mp3 | 14-Apr-2007 03:39 | 17K | |
![[SND]](/icons/sound2.gif) | aquiver.mp3 | 14-Apr-2007 03:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | aquinist.mp3 | 14-Apr-2007 03:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | aquinas.mp3 | 14-Apr-2007 03:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | aquilo.mp3 | 14-Apr-2007 03:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | aquilinity.mp3 | 14-Apr-2007 03:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | aquiline.mp3 | 14-Apr-2007 03:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | aquileia.mp3 | 14-Apr-2007 03:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | aquilegia.mp3 | 14-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | aquiferous.mp3 | 14-Apr-2007 03:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | aquifer.mp3 | 14-Apr-2007 03:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | aquiculturist.mp3 | 14-Apr-2007 03:39 | 17K | |
![[SND]](/icons/sound2.gif) | aquiculture.mp3 | 14-Apr-2007 03:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | aquiclude.mp3 | 14-Apr-2007 03:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | aqui.mp3 | 14-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | aqueousness.mp3 | 14-Apr-2007 03:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | aqueous.mp3 | 14-Apr-2007 03:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | aqueductofsylvius.mp3 | 14-Apr-2007 03:39 | 18K | |
![[SND]](/icons/sound2.gif) | aqueduct.mp3 | 14-Apr-2007 03:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | aquavitae.mp3 | 14-Apr-2007 03:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | aqua vitae.mp3 | 14-Apr-2007 03:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | aquavit.mp3 | 14-Apr-2007 03:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | aquatintist.mp3 | 14-Apr-2007 03:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | aquatint.mp3 | 14-Apr-2007 03:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | aquatically.mp3 | 14-Apr-2007 03:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | aquatic.mp3 | 14-Apr-2007 03:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | aquatel.mp3 | 14-Apr-2007 03:38 | 17K | |
![[SND]](/icons/sound2.gif) | aquascutum.mp3 | 14-Apr-2007 03:38 | 17K | |
![[SND]](/icons/sound2.gif) | aquarobics.mp3 | 14-Apr-2007 03:38 | 17K | |
![[SND]](/icons/sound2.gif) | aquarium.mp3 | 14-Apr-2007 03:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | aquarist.mp3 | 14-Apr-2007 03:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | aquarids.mp3 | 14-Apr-2007 03:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | aquaria.mp3 | 14-Apr-2007 03:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | aquarellist.mp3 | 14-Apr-2007 03:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | aquarelle.mp3 | 14-Apr-2007 03:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | aquaregia.mp3 | 14-Apr-2007 03:38 | 17K | |
![[SND]](/icons/sound2.gif) | aqua regia.mp3 | 14-Apr-2007 03:37 | 11K | |
![[SND]](/icons/sound2.gif) | aquapura.mp3 | 14-Apr-2007 03:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | aquapulsegun.mp3 | 14-Apr-2007 03:38 | 17K | |
![[SND]](/icons/sound2.gif) | aquaplane.mp3 | 14-Apr-2007 03:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | aquaphobia.mp3 | 14-Apr-2007 03:38 | 17K | |
![[SND]](/icons/sound2.gif) | aquanautics.mp3 | 14-Apr-2007 03:38 | 17K | |
![[SND]](/icons/sound2.gif) | aquanaut.mp3 | 14-Apr-2007 03:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | aquamarine.mp3 | 14-Apr-2007 03:38 | 11K | |
![[SND]](/icons/sound2.gif) | aquamanile.mp3 | 14-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | aqualunger.mp3 | 14-Apr-2007 03:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | aqualung.mp3 | 14-Apr-2007 03:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | aqua fortis.mp3 | 14-Apr-2007 03:37 | 10K | |
![[SND]](/icons/sound2.gif) | aqua et igni interdictus.mp3 | 14-Apr-2007 03:37 | 21K | |
![[SND]](/icons/sound2.gif) | aquaerobics.mp3 | 14-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | aquaerob.mp3 | 14-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | aquaemanale.mp3 | 14-Apr-2007 03:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | aquae.mp3 | 14-Apr-2007 03:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | aquadag.mp3 | 14-Apr-2007 03:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | aquaculturist.mp3 | 14-Apr-2007 03:37 | 12K | |
![[SND]](/icons/sound2.gif) | aquaculture.mp3 | 14-Apr-2007 03:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | aquacultural.mp3 | 14-Apr-2007 03:37 | 10K | |
![[SND]](/icons/sound2.gif) | aquacade.mp3 | 14-Apr-2007 03:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | aquaammoniae.mp3 | 14-Apr-2007 03:37 | 17K | |
![[SND]](/icons/sound2.gif) | aqua.mp3 | 14-Apr-2007 03:37 | 5.0K | |
![[SND]](/icons/sound2.gif) | apyrexia.mp3 | 14-Apr-2007 03:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | apyretic.mp3 | 14-Apr-2007 03:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | apyrase.mp3 | 14-Apr-2007 03:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | apus.mp3 | 14-Apr-2007 03:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | apurpose.mp3 | 14-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | apuntadarco.mp3 | 14-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | aptness.mp3 | 14-Apr-2007 03:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | aptly.mp3 | 14-Apr-2007 03:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | aptitudinally.mp3 | 14-Apr-2007 03:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | aptitudinal.mp3 | 14-Apr-2007 03:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | aptitude.mp3 | 14-Apr-2007 03:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | apteryx.mp3 | 14-Apr-2007 03:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | apterygote.mp3 | 14-Apr-2007 03:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | apterygial.mp3 | 14-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | apterous.mp3 | 14-Apr-2007 03:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | apterium.mp3 | 14-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | apterism.mp3 | 14-Apr-2007 03:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | apterial.mp3 | 14-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | apteral.mp3 | 14-Apr-2007 03:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | apt.mp3 | 14-Apr-2007 03:36 | 5.0K | |
![[SND]](/icons/sound2.gif) | apsyrtus.mp3 | 14-Apr-2007 03:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | apsu.mp3 | 14-Apr-2007 03:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | apstar.mp3 | 14-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | apsleyhouse.mp3 | 14-Apr-2007 03:36 | 17K | |
![[SND]](/icons/sound2.gif) | apsis.mp3 | 14-Apr-2007 03:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | apsidiole.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | apsides.mp3 | 14-Apr-2007 03:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | apsidally.mp3 | 14-Apr-2007 03:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | apsidal.mp3 | 14-Apr-2007 03:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | apse.mp3 | 14-Apr-2007 03:35 | 5.2K | |
![[SND]](/icons/sound2.gif) | apsaras.mp3 | 14-Apr-2007 03:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | aprowl.mp3 | 14-Apr-2007 03:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | aprotic.mp3 | 14-Apr-2007 03:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | aprosexia.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | aproposderien.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | a propos de rien.mp3 | 13-Apr-2007 22:32 | 14K | |
![[SND]](/icons/sound2.gif) | a propos de bottes.mp3 | 13-Apr-2007 22:32 | 11K | |
![[SND]](/icons/sound2.gif) | apropos.mp3 | 14-Apr-2007 03:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | apronlike.mp3 | 14-Apr-2007 03:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | aproned.mp3 | 14-Apr-2007 03:35 | 5.7K | |
![[SND]](/icons/sound2.gif) | apron.mp3 | 14-Apr-2007 03:35 | 5.4K | |
![[SND]](/icons/sound2.gif) | apriority.mp3 | 14-Apr-2007 03:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | aprioristically.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | apriorism.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | apriori.mp3 | 14-Apr-2007 03:35 | 36K | |
![[SND]](/icons/sound2.gif) | a priori.mp3 | 13-Apr-2007 22:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | apricot.mp3 | 14-Apr-2007 03:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | apresski.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | apresoline.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | apres nous le deluge.mp3 | 14-Apr-2007 03:34 | 18K | |
![[SND]](/icons/sound2.gif) | apresmoiledeluge.mp3 | 14-Apr-2007 03:35 | 17K | |
![[SND]](/icons/sound2.gif) | apres moi le deluge.mp3 | 14-Apr-2007 03:34 | 16K | |
![[SND]](/icons/sound2.gif) | apresmidi.mp3 | 14-Apr-2007 03:34 | 17K | |
![[SND]](/icons/sound2.gif) | apresguerre.mp3 | 14-Apr-2007 03:34 | 17K | |
![[SND]](/icons/sound2.gif) | apres.mp3 | 14-Apr-2007 03:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | apres-ski.mp3 | 14-Apr-2007 03:35 | 11K | |
![[SND]](/icons/sound2.gif) | apraxic.mp3 | 14-Apr-2007 03:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | apraxia.mp3 | 14-Apr-2007 03:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | apractic.mp3 | 14-Apr-2007 03:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | apra.mp3 | 14-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | appurtenant.mp3 | 14-Apr-2007 03:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | appurtenance.mp3 | 14-Apr-2007 03:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | appulsively.mp3 | 14-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | appulse.mp3 | 14-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | apps.mp3 | 14-Apr-2007 03:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | approximative.mp3 | 14-Apr-2007 03:34 | 11K | |
![[SND]](/icons/sound2.gif) | approximation.mp3 | 14-Apr-2007 03:34 | 11K | |
![[SND]](/icons/sound2.gif) | approximately.mp3 | 14-Apr-2007 03:34 | 17K | |
![[SND]](/icons/sound2.gif) | approximate.mp3 | 14-Apr-2007 03:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | approximant.mp3 | 14-Apr-2007 03:34 | 17K | |
![[SND]](/icons/sound2.gif) | approximal.mp3 | 14-Apr-2007 03:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | approvingly.mp3 | 14-Apr-2007 03:34 | 9.3K | |
![[SND]](/icons/sound2.gif) | approving.mp3 | 14-Apr-2007 03:34 | 17K | |
![[SND]](/icons/sound2.gif) | approver.mp3 | 14-Apr-2007 03:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | approvedness.mp3 | 14-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | approved.mp3 | 14-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | approve.mp3 | 14-Apr-2007 03:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | approval.mp3 | 14-Apr-2007 03:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | approvably.mp3 | 14-Apr-2007 03:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | approvable.mp3 | 14-Apr-2007 03:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | appropriator.mp3 | 14-Apr-2007 03:33 | 9.8K | |
![[SND]](/icons/sound2.gif) | appropriativeness.mp3 | 14-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | appropriative.mp3 | 14-Apr-2007 03:33 | 9.5K | |
![[SND]](/icons/sound2.gif) | appropriation.mp3 | 14-Apr-2007 03:33 | 10K | |
![[SND]](/icons/sound2.gif) | appropriateness.mp3 | 14-Apr-2007 03:33 | 27K | |
![[SND]](/icons/sound2.gif) | appropriate.mp3 | 14-Apr-2007 03:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | appropriacy.mp3 | 14-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | appropriable.mp3 | 14-Apr-2007 03:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | approbatory.mp3 | 14-Apr-2007 03:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | approbator.mp3 | 14-Apr-2007 03:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | approbativeness.mp3 | 14-Apr-2007 03:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | approbative.mp3 | 14-Apr-2007 03:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | approbation.mp3 | 14-Apr-2007 03:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | approbate.mp3 | 14-Apr-2007 03:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | approachless.mp3 | 14-Apr-2007 03:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | approaching.mp3 | 14-Apr-2007 03:33 | 17K | |
![[SND]](/icons/sound2.gif) | approachableness.mp3 | 14-Apr-2007 03:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | approachable.mp3 | 14-Apr-2007 03:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | approachability.mp3 | 14-Apr-2007 03:33 | 11K | |
![[SND]](/icons/sound2.gif) | approach.mp3 | 14-Apr-2007 03:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | appro.mp3 | 14-Apr-2007 03:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | apprizer.mp3 | 14-Apr-2007 03:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | apprize.mp3 | 14-Apr-2007 03:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | apprise.mp3 | 14-Apr-2007 03:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | appressorium.mp3 | 14-Apr-2007 03:32 | 10K | |
![[SND]](/icons/sound2.gif) | appressoria.mp3 | 14-Apr-2007 03:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | appressed.mp3 | 14-Apr-2007 03:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | apprenticeship.mp3 | 14-Apr-2007 03:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | apprentice.mp3 | 14-Apr-2007 03:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | apprehensiveness.mp3 | 14-Apr-2007 03:32 | 17K | |
![[SND]](/icons/sound2.gif) | apprehensive.mp3 | 14-Apr-2007 03:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | apprehension.mp3 | 14-Apr-2007 03:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | apprehensibly.mp3 | 14-Apr-2007 03:32 | 10K | |
![[SND]](/icons/sound2.gif) | apprehensible.mp3 | 14-Apr-2007 03:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | apprehender.mp3 | 14-Apr-2007 03:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | apprehend.mp3 | 14-Apr-2007 03:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | appreciatory.mp3 | 14-Apr-2007 03:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | appreciator.mp3 | 14-Apr-2007 03:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | appreciativeness.mp3 | 14-Apr-2007 03:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | appreciative.mp3 | 14-Apr-2007 03:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | appreciational.mp3 | 14-Apr-2007 03:32 | 17K | |
![[SND]](/icons/sound2.gif) | appreciation.mp3 | 14-Apr-2007 03:32 | 11K | |
![[SND]](/icons/sound2.gif) | appreciate.mp3 | 14-Apr-2007 03:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | appreciably.mp3 | 14-Apr-2007 03:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | appreciable.mp3 | 14-Apr-2007 03:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | appraisive.mp3 | 14-Apr-2007 03:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | appraisingly.mp3 | 14-Apr-2007 03:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | appraising.mp3 | 14-Apr-2007 03:31 | 17K | |
![[SND]](/icons/sound2.gif) | appraiser.mp3 | 14-Apr-2007 03:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | appraisement.mp3 | 14-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | appraisee.mp3 | 14-Apr-2007 03:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | appraise.mp3 | 14-Apr-2007 03:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | appraisal.mp3 | 14-Apr-2007 03:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | appraisable.mp3 | 14-Apr-2007 03:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | appositively.mp3 | 14-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | appositive.mp3 | 14-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | appositionally.mp3 | 14-Apr-2007 03:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | appositional.mp3 | 14-Apr-2007 03:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | apposition.mp3 | 14-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | appositeness.mp3 | 14-Apr-2007 03:31 | 27K | |
![[SND]](/icons/sound2.gif) | apposite.mp3 | 14-Apr-2007 03:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | appose.mp3 | 14-Apr-2007 03:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | apposable.mp3 | 14-Apr-2007 03:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | apportionment.mp3 | 14-Apr-2007 03:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | apportioning.mp3 | 14-Apr-2007 03:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | apportioner.mp3 | 14-Apr-2007 03:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | apportionable.mp3 | 14-Apr-2007 03:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | apportion.mp3 | 14-Apr-2007 03:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | apport.mp3 | 14-Apr-2007 03:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | appomattox.mp3 | 14-Apr-2007 03:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | appointor.mp3 | 14-Apr-2007 03:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | appointment.mp3 | 14-Apr-2007 03:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | appointive.mp3 | 14-Apr-2007 03:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | appointer.mp3 | 14-Apr-2007 03:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | appointee.mp3 | 14-Apr-2007 03:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | appointed.mp3 | 14-Apr-2007 03:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | appoint.mp3 | 14-Apr-2007 03:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | appoggiatura.mp3 | 14-Apr-2007 03:30 | 10K | |
![[SND]](/icons/sound2.gif) | apply.mp3 | 14-Apr-2007 03:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | applique.mp3 | 14-Apr-2007 03:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | applier.mp3 | 14-Apr-2007 03:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | applied.mp3 | 14-Apr-2007 03:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | applicatory.mp3 | 14-Apr-2007 03:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | applicatorily.mp3 | 14-Apr-2007 03:30 | 27K | |
![[SND]](/icons/sound2.gif) | applicator.mp3 | 14-Apr-2007 03:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | applicatively.mp3 | 14-Apr-2007 03:30 | 27K | |
![[SND]](/icons/sound2.gif) | applicative.mp3 | 14-Apr-2007 03:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | application.mp3 | 14-Apr-2007 03:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | applicant.mp3 | 14-Apr-2007 03:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | applicably.mp3 | 14-Apr-2007 03:30 | 27K | |
![[SND]](/icons/sound2.gif) | applicable.mp3 | 14-Apr-2007 03:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | applicability.mp3 | 14-Apr-2007 03:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | appliance.mp3 | 14-Apr-2007 03:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | applet.mp3 | 14-Apr-2007 03:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | applesnits.mp3 | 14-Apr-2007 03:29 | 17K | |
![[SND]](/icons/sound2.gif) | appleseed.mp3 | 14-Apr-2007 03:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | applesauce.mp3 | 14-Apr-2007 03:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | applejack.mp3 | 14-Apr-2007 03:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | applecart.mp3 | 14-Apr-2007 03:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | appleby.mp3 | 14-Apr-2007 03:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | apple.mp3 | 14-Apr-2007 03:29 | 5.5K | |
![[SND]](/icons/sound2.gif) | apple-polish.mp3 | 14-Apr-2007 03:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | apple-pie.mp3 | 14-Apr-2007 03:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | apple-knocker.mp3 | 14-Apr-2007 03:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | apple-cheeked.mp3 | 14-Apr-2007 03:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | applausive.mp3 | 14-Apr-2007 03:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | applause.mp3 | 14-Apr-2007 03:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | applaudingly.mp3 | 14-Apr-2007 03:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | applaudably.mp3 | 14-Apr-2007 03:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | applaudable.mp3 | 14-Apr-2007 03:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | applaud.mp3 | 14-Apr-2007 03:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | applanate.mp3 | 14-Apr-2007 03:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | appie.mp3 | 14-Apr-2007 03:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | appianway.mp3 | 14-Apr-2007 03:29 | 17K | |
![[SND]](/icons/sound2.gif) | appia.mp3 | 14-Apr-2007 03:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | appetizingly.mp3 | 14-Apr-2007 03:29 | 10K | |
![[SND]](/icons/sound2.gif) | appetizing.mp3 | 14-Apr-2007 03:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | appetizer.mp3 | 14-Apr-2007 03:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | appetitive.mp3 | 14-Apr-2007 03:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | appetite.mp3 | 14-Apr-2007 03:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | appetent.mp3 | 14-Apr-2007 03:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | appetency.mp3 | 14-Apr-2007 03:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | appetence.mp3 | 14-Apr-2007 03:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | appestat.mp3 | 14-Apr-2007 03:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | appertain.mp3 | 14-Apr-2007 03:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | appersonation.mp3 | 14-Apr-2007 03:28 | 17K | |
![[SND]](/icons/sound2.gif) | apperceptively.mp3 | 14-Apr-2007 03:28 | 17K | |
![[SND]](/icons/sound2.gif) | apperceptive.mp3 | 14-Apr-2007 03:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | apperception.mp3 | 14-Apr-2007 03:28 | 9.8K | |
![[SND]](/icons/sound2.gif) | apperceive.mp3 | 14-Apr-2007 03:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | appenzellinnerrhoden.mp3 | 14-Apr-2007 03:28 | 18K | |
![[SND]](/icons/sound2.gif) | appenzeller.mp3 | 14-Apr-2007 03:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | appenzellausserrhoden.mp3 | 14-Apr-2007 03:28 | 17K | |
![[SND]](/icons/sound2.gif) | appentice.mp3 | 14-Apr-2007 03:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | appendix.mp3 | 14-Apr-2007 03:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | appendiculate.mp3 | 14-Apr-2007 03:28 | 17K | |
![[SND]](/icons/sound2.gif) | appendicular.mp3 | 14-Apr-2007 03:28 | 10K | |
![[SND]](/icons/sound2.gif) | appendicle.mp3 | 14-Apr-2007 03:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | appendicitis.mp3 | 14-Apr-2007 03:28 | 11K | |
![[SND]](/icons/sound2.gif) | appendices.mp3 | 14-Apr-2007 03:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | appendicectomy.mp3 | 14-Apr-2007 03:28 | 12K | |
![[SND]](/icons/sound2.gif) | appendiceal.mp3 | 14-Apr-2007 03:28 | 27K | |
![[SND]](/icons/sound2.gif) | appendency.mp3 | 14-Apr-2007 03:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | appendectomy.mp3 | 14-Apr-2007 03:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | appendant.mp3 | 14-Apr-2007 03:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | appendaged.mp3 | 14-Apr-2007 03:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | appendage.mp3 | 14-Apr-2007 03:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | append.mp3 | 14-Apr-2007 03:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | appellor.mp3 | 14-Apr-2007 03:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | appellee.mp3 | 14-Apr-2007 03:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | appellativeness.mp3 | 14-Apr-2007 03:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | appellative.mp3 | 14-Apr-2007 03:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | appellationdorigine.mp3 | 14-Apr-2007 03:27 | 27K | |
![[SND]](/icons/sound2.gif) | appellationcontrolee.mp3 | 14-Apr-2007 03:27 | 18K | |
![[SND]](/icons/sound2.gif) | appellation.mp3 | 14-Apr-2007 03:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | appellate.mp3 | 14-Apr-2007 03:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | appellant.mp3 | 14-Apr-2007 03:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | appel.mp3 | 14-Apr-2007 03:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | appeasingly.mp3 | 14-Apr-2007 03:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | appeasement.mp3 | 14-Apr-2007 03:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | appease.mp3 | 14-Apr-2007 03:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | appeasable.mp3 | 14-Apr-2007 03:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | appearing.mp3 | 14-Apr-2007 03:27 | 17K | |
![[SND]](/icons/sound2.gif) | appearance.mp3 | 14-Apr-2007 03:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | appear.mp3 | 14-Apr-2007 03:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | appealingness.mp3 | 14-Apr-2007 03:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | appealingly.mp3 | 14-Apr-2007 03:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | appealing.mp3 | 14-Apr-2007 03:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | appealer.mp3 | 14-Apr-2007 03:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | appealable.mp3 | 14-Apr-2007 03:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | appealability.mp3 | 14-Apr-2007 03:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | appeal.mp3 | 14-Apr-2007 03:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | appassionato.mp3 | 14-Apr-2007 03:26 | 17K | |
![[SND]](/icons/sound2.gif) | apparitor.mp3 | 14-Apr-2007 03:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | apparitional.mp3 | 14-Apr-2007 03:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | apparition.mp3 | 14-Apr-2007 03:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | apparentwind.mp3 | 14-Apr-2007 03:26 | 17K | |
![[SND]](/icons/sound2.gif) | apparentness.mp3 | 14-Apr-2007 03:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | apparently.mp3 | 14-Apr-2007 03:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | apparentement.mp3 | 14-Apr-2007 03:26 | 17K | |
![[SND]](/icons/sound2.gif) | apparent.mp3 | 14-Apr-2007 03:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | apparel.mp3 | 14-Apr-2007 03:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | apparatuscriticus.mp3 | 14-Apr-2007 03:26 | 17K | |
![[SND]](/icons/sound2.gif) | apparatus.mp3 | 14-Apr-2007 03:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | apparatchiki.mp3 | 14-Apr-2007 03:26 | 10K | |
![[SND]](/icons/sound2.gif) | apparatchik.mp3 | 14-Apr-2007 03:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | apparat.mp3 | 14-Apr-2007 03:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | appanage.mp3 | 14-Apr-2007 03:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | appaloosa.mp3 | 14-Apr-2007 03:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | appallingly.mp3 | 14-Apr-2007 03:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | appalling.mp3 | 14-Apr-2007 03:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | appalled.mp3 | 14-Apr-2007 03:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | appall.mp3 | 14-Apr-2007 03:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | appal.mp3 | 14-Apr-2007 03:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | app.mp3 | 14-Apr-2007 03:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | apotropaism.mp3 | 14-Apr-2007 03:25 | 17K | |
![[SND]](/icons/sound2.gif) | apotropaically.mp3 | 14-Apr-2007 03:25 | 12K | |
![[SND]](/icons/sound2.gif) | apotropaic.mp3 | 14-Apr-2007 03:25 | 11K | |
![[SND]](/icons/sound2.gif) | apotheosize.mp3 | 14-Apr-2007 03:25 | 12K | |
![[SND]](/icons/sound2.gif) | apotheosis.mp3 | 14-Apr-2007 03:25 | 11K | |
![[SND]](/icons/sound2.gif) | apotheoses.mp3 | 14-Apr-2007 03:25 | 11K | |
![[SND]](/icons/sound2.gif) | apothem.mp3 | 14-Apr-2007 03:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | apothegmatically.mp3 | 14-Apr-2007 03:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | apothegmatic.mp3 | 14-Apr-2007 03:25 | 10K | |
![[SND]](/icons/sound2.gif) | apothegm.mp3 | 14-Apr-2007 03:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | apothecium.mp3 | 14-Apr-2007 03:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | apothecial.mp3 | 14-Apr-2007 03:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | apothecia.mp3 | 14-Apr-2007 03:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | apothecary.mp3 | 14-Apr-2007 03:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | apothecariesmeasure.mp3 | 14-Apr-2007 03:25 | 27K | |
![[SND]](/icons/sound2.gif) | apostrophize.mp3 | 14-Apr-2007 03:25 | 10K | |
![[SND]](/icons/sound2.gif) | apostrophic.mp3 | 14-Apr-2007 03:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | apostrophe.mp3 | 14-Apr-2007 03:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | apostolos.mp3 | 14-Apr-2007 03:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | apostolicity.mp3 | 14-Apr-2007 03:25 | 11K | |
![[SND]](/icons/sound2.gif) | apostolicalness.mp3 | 14-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | apostolic.mp3 | 14-Apr-2007 03:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | apostolate.mp3 | 14-Apr-2007 03:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | apostleship.mp3 | 14-Apr-2007 03:24 | 9.6K | |
![[SND]](/icons/sound2.gif) | apostle.mp3 | 14-Apr-2007 03:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | apostil.mp3 | 14-Apr-2007 03:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | aposteriori.mp3 | 14-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | a posteriori.mp3 | 13-Apr-2007 22:32 | 14K | |
![[SND]](/icons/sound2.gif) | apostatize.mp3 | 14-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | apostatism.mp3 | 14-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | apostatically.mp3 | 14-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | apostate.mp3 | 14-Apr-2007 03:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | apostasy.mp3 | 14-Apr-2007 03:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | apospory.mp3 | 14-Apr-2007 03:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | aposporous.mp3 | 14-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | aposiopetic.mp3 | 14-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | aposiopesis.mp3 | 14-Apr-2007 03:24 | 12K | |
![[SND]](/icons/sound2.gif) | aposiopeses.mp3 | 14-Apr-2007 03:24 | 13K | |
![[SND]](/icons/sound2.gif) | aposematically.mp3 | 14-Apr-2007 03:24 | 11K | |
![[SND]](/icons/sound2.gif) | aposematic.mp3 | 14-Apr-2007 03:24 | 9.8K | |
![[SND]](/icons/sound2.gif) | aposelenium.mp3 | 14-Apr-2007 03:24 | 17K | |
![[SND]](/icons/sound2.gif) | aport.mp3 | 14-Apr-2007 03:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | aporia.mp3 | 14-Apr-2007 03:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | apopyle.mp3 | 14-Apr-2007 03:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | apoptotic.mp3 | 14-Apr-2007 03:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | apoptosis.mp3 | 14-Apr-2007 03:23 | 11K | |
![[SND]](/icons/sound2.gif) | apoptoses.mp3 | 14-Apr-2007 03:23 | 11K | |
![[SND]](/icons/sound2.gif) | apoplexy.mp3 | 14-Apr-2007 03:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | apoplectoid.mp3 | 14-Apr-2007 03:23 | 17K | |
![[SND]](/icons/sound2.gif) | apoplectically.mp3 | 14-Apr-2007 03:23 | 10K | |
![[SND]](/icons/sound2.gif) | apoplectic.mp3 | 14-Apr-2007 03:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | apophysis.mp3 | 14-Apr-2007 03:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | apophyses.mp3 | 14-Apr-2007 03:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | apophyseal.mp3 | 14-Apr-2007 03:23 | 10K | |
![[SND]](/icons/sound2.gif) | apophysary.mp3 | 14-Apr-2007 03:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | apophyllite.mp3 | 14-Apr-2007 03:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | apophyge.mp3 | 14-Apr-2007 03:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | apophthegmatical.mp3 | 14-Apr-2007 03:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | apophthegm.mp3 | 14-Apr-2007 03:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | apophony.mp3 | 14-Apr-2007 03:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | apophonic.mp3 | 14-Apr-2007 03:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | apophis.mp3 | 14-Apr-2007 03:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | apophasis.mp3 | 14-Apr-2007 03:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | apopemptic.mp3 | 14-Apr-2007 03:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | aponeurotic.mp3 | 14-Apr-2007 03:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | aponeurosis.mp3 | 14-Apr-2007 03:23 | 11K | |
![[SND]](/icons/sound2.gif) | apomorphine.mp3 | 14-Apr-2007 03:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | apomixis.mp3 | 14-Apr-2007 03:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | apomixes.mp3 | 14-Apr-2007 03:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | apomictically.mp3 | 14-Apr-2007 03:22 | 9.5K | |
![[SND]](/icons/sound2.gif) | apomictic.mp3 | 14-Apr-2007 03:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | apomict.mp3 | 14-Apr-2007 03:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | apolune.mp3 | 14-Apr-2007 03:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | apology.mp3 | 14-Apr-2007 03:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | apologue.mp3 | 14-Apr-2007 03:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | apologizer.mp3 | 14-Apr-2007 03:22 | 17K | |
![[SND]](/icons/sound2.gif) | apologize.mp3 | 14-Apr-2007 03:22 | 9.8K | |
![[SND]](/icons/sound2.gif) | apologist.mp3 | 14-Apr-2007 03:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | apologia pro vita sua.mp3 | 14-Apr-2007 03:22 | 18K | |
![[SND]](/icons/sound2.gif) | apologia.mp3 | 14-Apr-2007 03:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | apologetics.mp3 | 14-Apr-2007 03:22 | 10K | |
![[SND]](/icons/sound2.gif) | apologetically.mp3 | 14-Apr-2007 03:22 | 11K | |
![[SND]](/icons/sound2.gif) | apologetic.mp3 | 14-Apr-2007 03:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | apologal.mp3 | 14-Apr-2007 03:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | apollinaris.mp3 | 14-Apr-2007 03:22 | 17K | |
![[SND]](/icons/sound2.gif) | apoliticism.mp3 | 14-Apr-2007 03:22 | 11K | |
![[SND]](/icons/sound2.gif) | apolitically.mp3 | 14-Apr-2007 03:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | apolitical.mp3 | 14-Apr-2007 03:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | apolipoprotein.mp3 | 14-Apr-2007 03:22 | 15K | |
![[SND]](/icons/sound2.gif) | apolaustic.mp3 | 14-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | apokatastatic.mp3 | 14-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | apokatastasis.mp3 | 14-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | apoint.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | a point.mp3 | 13-Apr-2007 22:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | apographical.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apograph.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apogeic.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apogee.mp3 | 14-Apr-2007 03:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | apogean.mp3 | 14-Apr-2007 03:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | apogamy.mp3 | 14-Apr-2007 03:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | apogamously.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apoenzyme.mp3 | 14-Apr-2007 03:21 | 11K | |
![[SND]](/icons/sound2.gif) | apodosis.mp3 | 14-Apr-2007 03:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | apodoses.mp3 | 14-Apr-2007 03:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | apodization.mp3 | 14-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | apodictically.mp3 | 14-Apr-2007 03:21 | 10K | |
![[SND]](/icons/sound2.gif) | apodictic.mp3 | 14-Apr-2007 03:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | apodeme.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apodematal.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apodeipnon.mp3 | 14-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | apodeictically.mp3 | 14-Apr-2007 03:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | apodeictic.mp3 | 14-Apr-2007 03:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | apodal.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apod.mp3 | 14-Apr-2007 03:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | apocynthion.mp3 | 14-Apr-2007 03:21 | 17K | |
![[SND]](/icons/sound2.gif) | apocynaceous.mp3 | 14-Apr-2007 03:20 | 17K | |
![[SND]](/icons/sound2.gif) | apocryphalness.mp3 | 14-Apr-2007 03:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | apocryphally.mp3 | 14-Apr-2007 03:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | apocryphal.mp3 | 14-Apr-2007 03:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | apocrypha.mp3 | 14-Apr-2007 03:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | apocrine.mp3 | 14-Apr-2007 03:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | apocopic.mp3 | 14-Apr-2007 03:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | apocope.mp3 | 14-Apr-2007 03:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | apocopation.mp3 | 14-Apr-2007 03:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | apocopate.mp3 | 14-Apr-2007 03:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | apochromatism.mp3 | 14-Apr-2007 03:20 | 17K | |
![[SND]](/icons/sound2.gif) | apochromatic.mp3 | 14-Apr-2007 03:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | apocarpy.mp3 | 14-Apr-2007 03:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | apocarpous.mp3 | 14-Apr-2007 03:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | apocarp.mp3 | 14-Apr-2007 03:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | apocalyptist.mp3 | 14-Apr-2007 03:20 | 11K | |
![[SND]](/icons/sound2.gif) | apocalyptism.mp3 | 14-Apr-2007 03:20 | 11K | |
![[SND]](/icons/sound2.gif) | apocalypticism.mp3 | 14-Apr-2007 03:20 | 12K | |
![[SND]](/icons/sound2.gif) | apocalyptician.mp3 | 14-Apr-2007 03:20 | 17K | |
![[SND]](/icons/sound2.gif) | apocalyptically.mp3 | 14-Apr-2007 03:20 | 10K | |
![[SND]](/icons/sound2.gif) | apocalyptical.mp3 | 14-Apr-2007 03:20 | 10K | |
![[SND]](/icons/sound2.gif) | apocalyptic.mp3 | 14-Apr-2007 03:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | apocalypse.mp3 | 14-Apr-2007 03:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | apoapsis.mp3 | 14-Apr-2007 03:20 | 17K | |
![[SND]](/icons/sound2.gif) | apo.mp3 | 14-Apr-2007 03:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | apnoeic.mp3 | 14-Apr-2007 03:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | apneustic.mp3 | 14-Apr-2007 03:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | apneusis.mp3 | 14-Apr-2007 03:19 | 17K | |
![[SND]](/icons/sound2.gif) | apneic.mp3 | 14-Apr-2007 03:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | apnea.mp3 | 14-Apr-2007 03:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | aplomb.mp3 | 14-Apr-2007 03:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | aplitic.mp3 | 14-Apr-2007 03:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | aplite.mp3 | 14-Apr-2007 03:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | aplenty.mp3 | 14-Apr-2007 03:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | aplastic anemia.mp3 | 14-Apr-2007 03:19 | 14K | |
![[SND]](/icons/sound2.gif) | aplastic.mp3 | 14-Apr-2007 03:19 | 17K | |
![[SND]](/icons/sound2.gif) | aplasia.mp3 | 14-Apr-2007 03:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | aplanospore.mp3 | 14-Apr-2007 03:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | aplanogamete.mp3 | 14-Apr-2007 03:19 | 17K | |
![[SND]](/icons/sound2.gif) | aplanetic.mp3 | 14-Apr-2007 03:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | aplanatically.mp3 | 14-Apr-2007 03:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | aplanatic.mp3 | 14-Apr-2007 03:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | aplacophoran.mp3 | 14-Apr-2007 03:19 | 17K | |
![[SND]](/icons/sound2.gif) | aplacental.mp3 | 14-Apr-2007 03:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | apivorous.mp3 | 14-Apr-2007 03:19 | 17K | |
![[SND]](/icons/sound2.gif) | apishness.mp3 | 14-Apr-2007 03:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | apish.mp3 | 14-Apr-2007 03:19 | 5.7K | |
![[SND]](/icons/sound2.gif) | apiology.mp3 | 14-Apr-2007 03:18 | 17K | |
![[SND]](/icons/sound2.gif) | apiologist.mp3 | 14-Apr-2007 03:18 | 17K | |
![[SND]](/icons/sound2.gif) | apiezon.mp3 | 14-Apr-2007 03:18 | 17K | |
![[SND]](/icons/sound2.gif) | apied.mp3 | 14-Apr-2007 03:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | a pied.mp3 | 13-Apr-2007 22:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | apiece.mp3 | 14-Apr-2007 03:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | apiculus.mp3 | 14-Apr-2007 03:18 | 36K | |
![[SND]](/icons/sound2.gif) | apiculturist.mp3 | 14-Apr-2007 03:18 | 11K | |
![[SND]](/icons/sound2.gif) | apiculture.mp3 | 14-Apr-2007 03:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | apicultural.mp3 | 14-Apr-2007 03:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | apiculate.mp3 | 14-Apr-2007 03:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | apico.mp3 | 14-Apr-2007 03:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | apices.mp3 | 14-Apr-2007 03:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | apically.mp3 | 14-Apr-2007 03:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | apical.mp3 | 14-Apr-2007 03:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | apiary.mp3 | 14-Apr-2007 03:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | apiarist.mp3 | 14-Apr-2007 03:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | apiarian.mp3 | 14-Apr-2007 03:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | apian.mp3 | 14-Apr-2007 03:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | apiaceous.mp3 | 14-Apr-2007 03:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | aphylly.mp3 | 14-Apr-2007 03:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | aphyllous.mp3 | 14-Apr-2007 03:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | aphthous.mp3 | 14-Apr-2007 03:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | aphtha.mp3 | 14-Apr-2007 03:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | aphrodisiacal.mp3 | 14-Apr-2007 03:17 | 12K | |
![[SND]](/icons/sound2.gif) | aphrodisiac.mp3 | 14-Apr-2007 03:17 | 11K | |
![[SND]](/icons/sound2.gif) | aphrodisia.mp3 | 14-Apr-2007 03:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | aphotic.mp3 | 14-Apr-2007 03:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | aphorizer.mp3 | 14-Apr-2007 03:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | aphorize.mp3 | 14-Apr-2007 03:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | aphoristically.mp3 | 14-Apr-2007 03:17 | 10K | |
![[SND]](/icons/sound2.gif) | aphoristic.mp3 | 14-Apr-2007 03:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | aphorist.mp3 | 14-Apr-2007 03:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | aphorismatic.mp3 | 14-Apr-2007 03:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | aphorism.mp3 | 14-Apr-2007 03:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | aphonic.mp3 | 14-Apr-2007 03:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | aphonia.mp3 | 14-Apr-2007 03:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | apholate.mp3 | 14-Apr-2007 03:17 | 17K | |
![[SND]](/icons/sound2.gif) | aphis.mp3 | 14-Apr-2007 03:17 | 6.6K | |
![[SND]](/icons/sound2.gif) | aphidious.mp3 | 14-Apr-2007 03:17 | 27K | |
![[SND]](/icons/sound2.gif) | aphides.mp3 | 14-Apr-2007 03:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | aphid.mp3 | 14-Apr-2007 03:17 | 5.5K | |
![[SND]](/icons/sound2.gif) | aphicide.mp3 | 14-Apr-2007 03:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | aphetically.mp3 | 14-Apr-2007 03:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | aphetic.mp3 | 14-Apr-2007 03:17 | 6.4K | |
![[SND]](/icons/sound2.gif) | aphesis.mp3 | 14-Apr-2007 03:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | apheses.mp3 | 14-Apr-2007 03:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | apheretic.mp3 | 14-Apr-2007 03:17 | 36K | |
![[SND]](/icons/sound2.gif) | apheresis.mp3 | 14-Apr-2007 03:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | aphereses.mp3 | 14-Apr-2007 03:17 | 11K | |
![[SND]](/icons/sound2.gif) | aphemia.mp3 | 14-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | apheliotropically.mp3 | 14-Apr-2007 03:16 | 17K | |
![[SND]](/icons/sound2.gif) | apheliotropic.mp3 | 14-Apr-2007 03:16 | 17K | |
![[SND]](/icons/sound2.gif) | aphelion.mp3 | 14-Apr-2007 03:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | aphelian.mp3 | 14-Apr-2007 03:16 | 27K | |
![[SND]](/icons/sound2.gif) | aphelia.mp3 | 14-Apr-2007 03:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | aphelandra.mp3 | 14-Apr-2007 03:16 | 17K | |
![[SND]](/icons/sound2.gif) | aphasiologist.mp3 | 14-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | aphasic.mp3 | 14-Apr-2007 03:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | aphasia.mp3 | 14-Apr-2007 03:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | aphanitic.mp3 | 14-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | aphanite.mp3 | 14-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | aphakia.mp3 | 14-Apr-2007 03:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | aphagia.mp3 | 14-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | aphaeretic.mp3 | 14-Apr-2007 03:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | aphaeresis.mp3 | 14-Apr-2007 03:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | aphaereses.mp3 | 14-Apr-2007 03:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | aphacial.mp3 | 14-Apr-2007 03:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | apgar.mp3 | 14-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | apfelstrudel.mp3 | 14-Apr-2007 03:16 | 17K | |
![[SND]](/icons/sound2.gif) | apex.mp3 | 14-Apr-2007 03:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | a peu pres.mp3 | 13-Apr-2007 22:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | apetaly.mp3 | 14-Apr-2007 03:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | apetalous.mp3 | 14-Apr-2007 03:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | apery.mp3 | 14-Apr-2007 03:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | aperturismo.mp3 | 14-Apr-2007 03:15 | 17K | |
![[SND]](/icons/sound2.gif) | apertured.mp3 | 14-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | aperture.mp3 | 14-Apr-2007 03:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | apertometer.mp3 | 14-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | aperitive.mp3 | 14-Apr-2007 03:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | aperitif.mp3 | 14-Apr-2007 03:15 | 10K | |
![[SND]](/icons/sound2.gif) | aperiodicity.mp3 | 14-Apr-2007 03:15 | 13K | |
![[SND]](/icons/sound2.gif) | aperiodically.mp3 | 14-Apr-2007 03:15 | 11K | |
![[SND]](/icons/sound2.gif) | aperiodic.mp3 | 14-Apr-2007 03:15 | 10K | |
![[SND]](/icons/sound2.gif) | aperient.mp3 | 14-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | apercu.mp3 | 14-Apr-2007 03:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | apepsy.mp3 | 14-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | apepi.mp3 | 14-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | apeman.mp3 | 14-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | apelike.mp3 | 14-Apr-2007 03:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | apeiron.mp3 | 14-Apr-2007 03:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | aped.mp3 | 14-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | apec.mp3 | 14-Apr-2007 03:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | apeak.mp3 | 14-Apr-2007 03:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | ape.mp3 | 14-Apr-2007 03:15 | 4.6K | |
![[SND]](/icons/sound2.gif) | ape-man.mp3 | 14-Apr-2007 03:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | apatosaurus.mp3 | 14-Apr-2007 03:14 | 11K | |
![[SND]](/icons/sound2.gif) | apatite.mp3 | 14-Apr-2007 03:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | apathy.mp3 | 14-Apr-2007 03:14 | 7.3K | |
![[SND]](/icons/sound2.gif) | apathetically.mp3 | 14-Apr-2007 03:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | apathetic.mp3 | 14-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | apatetic.mp3 | 14-Apr-2007 03:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | apastron.mp3 | 14-Apr-2007 03:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | apast.mp3 | 14-Apr-2007 03:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | apartness.mp3 | 14-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | apartmentize.mp3 | 14-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | apartmental.mp3 | 14-Apr-2007 03:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | apartment.mp3 | 14-Apr-2007 03:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | aparthotel.mp3 | 14-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | apartheid.mp3 | 14-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | apart.mp3 | 14-Apr-2007 03:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | aparri.mp3 | 14-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | aparejo.mp3 | 14-Apr-2007 03:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | aparavidya.mp3 | 14-Apr-2007 03:14 | 17K | |
![[SND]](/icons/sound2.gif) | apar.mp3 | 14-Apr-2007 03:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | apapane.mp3 | 14-Apr-2007 03:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | apanage.mp3 | 14-Apr-2007 03:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | apamin.mp3 | 14-Apr-2007 03:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | apalacheebay.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | apagoge.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | apachestate.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | apacheplume.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | apachedance.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | apache.mp3 | 14-Apr-2007 03:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | apace.mp3 | 14-Apr-2007 03:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | apa.mp3 | 14-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | ap.mp3 | 14-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | a outrance.mp3 | 13-Apr-2007 22:31 | 10K | |
![[SND]](/icons/sound2.gif) | aoul.mp3 | 14-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | aoudad.mp3 | 14-Apr-2007 03:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | aoteoroa.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | aortoiliac.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | aortography.mp3 | 14-Apr-2007 03:13 | 11K | |
![[SND]](/icons/sound2.gif) | aortographic.mp3 | 14-Apr-2007 03:13 | 10K | |
![[SND]](/icons/sound2.gif) | aortoclasia.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | aorto.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | aortitis.mp3 | 14-Apr-2007 03:13 | 17K | |
![[SND]](/icons/sound2.gif) | aortic.mp3 | 14-Apr-2007 03:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | aortal.mp3 | 14-Apr-2007 03:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | aortae.mp3 | 14-Apr-2007 03:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | aorta.mp3 | 14-Apr-2007 03:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | aoristically.mp3 | 14-Apr-2007 03:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | aoristic.mp3 | 14-Apr-2007 03:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | aorist.mp3 | 14-Apr-2007 03:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | aone.mp3 | 14-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | aole.mp3 | 14-Apr-2007 03:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | aok.mp3 | 14-Apr-2007 03:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | aoede.mp3 | 14-Apr-2007 03:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | aodai.mp3 | 14-Apr-2007 03:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | anzus.mp3 | 14-Apr-2007 03:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | anzuk.mp3 | 14-Apr-2007 03:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | anzherosudzhensk.mp3 | 14-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | anzengruber.mp3 | 14-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | anzanite.mp3 | 14-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | anzam.mp3 | 14-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | anzaas.mp3 | 14-Apr-2007 03:12 | 17K | |
![[SND]](/icons/sound2.gif) | anza.mp3 | 14-Apr-2007 03:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | anywise.mp3 | 14-Apr-2007 03:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | anywheres.mp3 | 14-Apr-2007 03:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | anywhere.mp3 | 14-Apr-2007 03:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | anyways.mp3 | 14-Apr-2007 03:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | anyway.mp3 | 14-Apr-2007 03:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | anytime.mp3 | 14-Apr-2007 03:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | anything.mp3 | 14-Apr-2007 03:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | anyplace.mp3 | 14-Apr-2007 03:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | anyone.mp3 | 14-Apr-2007 03:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | anymore.mp3 | 14-Apr-2007 03:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | anyhow.mp3 | 14-Apr-2007 03:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | anyhoo.mp3 | 14-Apr-2007 03:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | anybody.mp3 | 14-Apr-2007 03:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | any.mp3 | 14-Apr-2007 03:11 | 4.8K | |
![[SND]](/icons/sound2.gif) | anxiousness.mp3 | 14-Apr-2007 03:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | anxious.mp3 | 14-Apr-2007 03:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | anxiolytic.mp3 | 14-Apr-2007 03:11 | 10K | |
![[SND]](/icons/sound2.gif) | anxiety.mp3 | 14-Apr-2007 03:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | anvil.mp3 | 14-Apr-2007 03:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | anus.mp3 | 14-Apr-2007 03:11 | 5.7K | |
![[SND]](/icons/sound2.gif) | anurous.mp3 | 14-Apr-2007 03:11 | 27K | |
![[SND]](/icons/sound2.gif) | anuric.mp3 | 14-Apr-2007 03:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | anuria.mp3 | 14-Apr-2007 03:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | anuretic.mp3 | 14-Apr-2007 03:11 | 17K | |
![[SND]](/icons/sound2.gif) | anuresis.mp3 | 14-Apr-2007 03:11 | 17K | |
![[SND]](/icons/sound2.gif) | anuran.mp3 | 14-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | anunnaki.mp3 | 14-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | anum.mp3 | 14-Apr-2007 03:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | anucleolate.mp3 | 14-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | anucleate.mp3 | 14-Apr-2007 03:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | anuclear.mp3 | 14-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | anu.mp3 | 14-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | antwren.mp3 | 14-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | anturane.mp3 | 14-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | antu.mp3 | 14-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | antsy.mp3 | 14-Apr-2007 03:10 | 5.9K | |
![[SND]](/icons/sound2.gif) | antsirane.mp3 | 14-Apr-2007 03:10 | 17K | |
![[SND]](/icons/sound2.gif) | antsiness.mp3 | 14-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | antrum.mp3 | 14-Apr-2007 03:10 | 6.1K | |
![[SND]](/icons/sound2.gif) | antrorsely.mp3 | 14-Apr-2007 03:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | antrorse.mp3 | 14-Apr-2007 03:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | antron.mp3 | 14-Apr-2007 03:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | antre.mp3 | 14-Apr-2007 03:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | antral.mp3 | 14-Apr-2007 03:09 | 6.1K | |
![[SND]](/icons/sound2.gif) | antra.mp3 | 14-Apr-2007 03:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | antonymy.mp3 | 14-Apr-2007 03:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | antonymous.mp3 | 14-Apr-2007 03:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | antonymic.mp3 | 14-Apr-2007 03:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | antonym.mp3 | 14-Apr-2007 03:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | antonov.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | antonomastically.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | antonomasia.mp3 | 14-Apr-2007 03:09 | 11K | |
![[SND]](/icons/sound2.gif) | antonioni.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | antonio.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | antoninuspius.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | antoninianus.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | antoninewall.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | antonia.mp3 | 14-Apr-2007 03:09 | 36K | |
![[SND]](/icons/sound2.gif) | antonellodamessina.mp3 | 14-Apr-2007 03:09 | 17K | |
![[SND]](/icons/sound2.gif) | anton.mp3 | 14-Apr-2007 03:09 | 36K | |
![[SND]](/icons/sound2.gif) | antoinette.mp3 | 14-Apr-2007 03:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | antoine.mp3 | 14-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | antodontalgic.mp3 | 14-Apr-2007 03:08 | 17K | |
![[SND]](/icons/sound2.gif) | antlike.mp3 | 14-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | antliate.mp3 | 14-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | antlia.mp3 | 14-Apr-2007 03:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | antlerless.mp3 | 14-Apr-2007 03:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | antlerite.mp3 | 14-Apr-2007 03:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | antlered.mp3 | 14-Apr-2007 03:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | antler.mp3 | 14-Apr-2007 03:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | antixerophthalmicvitamin.mp3 | 14-Apr-2007 03:08 | 27K | |
![[SND]](/icons/sound2.gif) | antiwhite.mp3 | 14-Apr-2007 03:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | antivitamin.mp3 | 14-Apr-2007 03:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | antivenom.mp3 | 14-Apr-2007 03:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | antivenin.mp3 | 14-Apr-2007 03:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | antitypically.mp3 | 14-Apr-2007 03:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | antitype.mp3 | 14-Apr-2007 03:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | antitussive.mp3 | 14-Apr-2007 03:08 | 10K | |
![[SND]](/icons/sound2.gif) | antitruster.mp3 | 14-Apr-2007 03:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | antitrust.mp3 | 14-Apr-2007 03:08 | 10K | |
![[SND]](/icons/sound2.gif) | antitragus.mp3 | 14-Apr-2007 03:08 | 17K | |
![[SND]](/icons/sound2.gif) | antitoxin.mp3 | 14-Apr-2007 03:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | antitoxic.mp3 | 14-Apr-2007 03:08 | 9.6K | |
![[SND]](/icons/sound2.gif) | antithyroid.mp3 | 14-Apr-2007 03:07 | 10K | |
![[SND]](/icons/sound2.gif) | antithrombin.mp3 | 14-Apr-2007 03:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | antithetically.mp3 | 14-Apr-2007 03:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | antithetical.mp3 | 14-Apr-2007 03:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | antithetic.mp3 | 14-Apr-2007 03:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | antithesis.mp3 | 14-Apr-2007 03:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | antitheses.mp3 | 14-Apr-2007 03:07 | 10K | |
![[SND]](/icons/sound2.gif) | antisymmetric.mp3 | 14-Apr-2007 03:07 | 10K | |
![[SND]](/icons/sound2.gif) | antistyle.mp3 | 14-Apr-2007 03:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | antistrophically.mp3 | 14-Apr-2007 03:07 | 11K | |
![[SND]](/icons/sound2.gif) | antistrophic.mp3 | 14-Apr-2007 03:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | antistrophe.mp3 | 14-Apr-2007 03:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | antistatic.mp3 | 14-Apr-2007 03:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | antistat.mp3 | 14-Apr-2007 03:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | antispasmodic.mp3 | 14-Apr-2007 03:07 | 11K | |
![[SND]](/icons/sound2.gif) | antisolar.mp3 | 14-Apr-2007 03:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | antisocially.mp3 | 14-Apr-2007 03:07 | 11K | |
![[SND]](/icons/sound2.gif) | antisocial.mp3 | 14-Apr-2007 03:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | antiserum.mp3 | 14-Apr-2007 03:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | antisepticize.mp3 | 14-Apr-2007 03:07 | 17K | |
![[SND]](/icons/sound2.gif) | antiseptically.mp3 | 14-Apr-2007 03:07 | 9.5K | |
![[SND]](/icons/sound2.gif) | antiseptic.mp3 | 14-Apr-2007 03:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | antisepsis.mp3 | 14-Apr-2007 03:07 | 9.6K | |
![[SND]](/icons/sound2.gif) | antisense.mp3 | 14-Apr-2007 03:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | antiscorbutic.mp3 | 14-Apr-2007 03:06 | 11K | |
![[SND]](/icons/sound2.gif) | antirrhinum.mp3 | 14-Apr-2007 03:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | antiroman.mp3 | 14-Apr-2007 03:06 | 17K | |
![[SND]](/icons/sound2.gif) | antirheumatic.mp3 | 14-Apr-2007 03:06 | 10K | |
![[SND]](/icons/sound2.gif) | antiretroviral.mp3 | 14-Apr-2007 03:06 | 11K | |
![[SND]](/icons/sound2.gif) | antirejection.mp3 | 14-Apr-2007 03:06 | 12K | |
![[SND]](/icons/sound2.gif) | antiquity.mp3 | 14-Apr-2007 03:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | antiquer.mp3 | 14-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | antiqueness.mp3 | 14-Apr-2007 03:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | antique.mp3 | 14-Apr-2007 03:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | antiquation.mp3 | 14-Apr-2007 03:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | antiquatedness.mp3 | 14-Apr-2007 03:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | antiquated.mp3 | 14-Apr-2007 03:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | antiquate.mp3 | 14-Apr-2007 03:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | antiquary.mp3 | 14-Apr-2007 03:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | antiquark.mp3 | 14-Apr-2007 03:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | antiquarianism.mp3 | 14-Apr-2007 03:06 | 12K | |
![[SND]](/icons/sound2.gif) | antiquarian.mp3 | 14-Apr-2007 03:06 | 10K | |
![[SND]](/icons/sound2.gif) | antipyrotic.mp3 | 14-Apr-2007 03:06 | 17K | |
![[SND]](/icons/sound2.gif) | antipyrine.mp3 | 14-Apr-2007 03:05 | 10K | |
![[SND]](/icons/sound2.gif) | antipyretic.mp3 | 14-Apr-2007 03:05 | 10K | |
![[SND]](/icons/sound2.gif) | antipsychotic.mp3 | 14-Apr-2007 03:05 | 11K | |
![[SND]](/icons/sound2.gif) | antiproton.mp3 | 14-Apr-2007 03:05 | 11K | |
![[SND]](/icons/sound2.gif) | antipope.mp3 | 14-Apr-2007 03:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | antipollution.mp3 | 14-Apr-2007 03:05 | 10K | |
![[SND]](/icons/sound2.gif) | antipoetic.mp3 | 14-Apr-2007 03:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | antipodes.mp3 | 14-Apr-2007 03:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | antipodean.mp3 | 14-Apr-2007 03:05 | 10K | |
![[SND]](/icons/sound2.gif) | antipode.mp3 | 14-Apr-2007 03:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | antipodal.mp3 | 14-Apr-2007 03:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | antiphrastically.mp3 | 14-Apr-2007 03:05 | 17K | |
![[SND]](/icons/sound2.gif) | antiphrasis.mp3 | 14-Apr-2007 03:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | antiphrases.mp3 | 14-Apr-2007 03:05 | 11K | |
![[SND]](/icons/sound2.gif) | antiphony.mp3 | 14-Apr-2007 03:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | antiphonically.mp3 | 14-Apr-2007 03:05 | 17K | |
![[SND]](/icons/sound2.gif) | antiphonary.mp3 | 14-Apr-2007 03:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | antiphonally.mp3 | 14-Apr-2007 03:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | antiphonal.mp3 | 14-Apr-2007 03:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | antiphon.mp3 | 14-Apr-2007 03:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | antiphlogistine.mp3 | 14-Apr-2007 03:05 | 17K | |
![[SND]](/icons/sound2.gif) | antiphlogistic.mp3 | 14-Apr-2007 03:05 | 11K | |
![[SND]](/icons/sound2.gif) | antiperspirant.mp3 | 14-Apr-2007 03:05 | 10K | |
![[SND]](/icons/sound2.gif) | antipersonnel.mp3 | 14-Apr-2007 03:05 | 11K | |
![[SND]](/icons/sound2.gif) | antipedal.mp3 | 14-Apr-2007 03:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | antipathy.mp3 | 14-Apr-2007 03:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | antipathist.mp3 | 14-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | antipathic.mp3 | 14-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | antipatheticalness.mp3 | 14-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | antipathetically.mp3 | 14-Apr-2007 03:04 | 11K | |
![[SND]](/icons/sound2.gif) | antipathetic.mp3 | 14-Apr-2007 03:04 | 10K | |
![[SND]](/icons/sound2.gif) | antipasto.mp3 | 14-Apr-2007 03:04 | 9.8K | |
![[SND]](/icons/sound2.gif) | antipasti.mp3 | 14-Apr-2007 03:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | antiparticle.mp3 | 14-Apr-2007 03:04 | 11K | |
![[SND]](/icons/sound2.gif) | antiparallel.mp3 | 14-Apr-2007 03:04 | 11K | |
![[SND]](/icons/sound2.gif) | antiparabema.mp3 | 14-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | antiozonant.mp3 | 14-Apr-2007 03:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | antioxidant.mp3 | 14-Apr-2007 03:04 | 10K | |
![[SND]](/icons/sound2.gif) | antiodontalgic.mp3 | 14-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | antiochusiv.mp3 | 14-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | antiochusiii.mp3 | 14-Apr-2007 03:04 | 17K | |
![[SND]](/icons/sound2.gif) | antinuke.mp3 | 14-Apr-2007 03:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | antinucleon.mp3 | 14-Apr-2007 03:04 | 11K | |
![[SND]](/icons/sound2.gif) | antinuclear.mp3 | 14-Apr-2007 03:03 | 11K | |
![[SND]](/icons/sound2.gif) | antinovelist.mp3 | 14-Apr-2007 03:03 | 11K | |
![[SND]](/icons/sound2.gif) | antinovel.mp3 | 14-Apr-2007 03:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | antinous.mp3 | 14-Apr-2007 03:03 | 17K | |
![[SND]](/icons/sound2.gif) | antinomy.mp3 | 14-Apr-2007 03:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | antinomically.mp3 | 14-Apr-2007 03:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | antinomic.mp3 | 14-Apr-2007 03:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | antinomianism.mp3 | 14-Apr-2007 03:03 | 11K | |
![[SND]](/icons/sound2.gif) | antinomian.mp3 | 14-Apr-2007 03:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | antinode.mp3 | 14-Apr-2007 03:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | antinodal.mp3 | 14-Apr-2007 03:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | anting.mp3 | 14-Apr-2007 03:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | antineutron.mp3 | 14-Apr-2007 03:03 | 11K | |
![[SND]](/icons/sound2.gif) | antineutrino.mp3 | 14-Apr-2007 03:03 | 11K | |
![[SND]](/icons/sound2.gif) | antineoplaston.mp3 | 14-Apr-2007 03:03 | 17K | |
![[SND]](/icons/sound2.gif) | antineoplastic.mp3 | 14-Apr-2007 03:03 | 13K | |
![[SND]](/icons/sound2.gif) | antimycina.mp3 | 14-Apr-2007 03:03 | 17K | |
![[SND]](/icons/sound2.gif) | antimycin A.mp3 | 14-Apr-2007 03:03 | 12K | |
![[SND]](/icons/sound2.gif) | antimonypentasulfide.mp3 | 14-Apr-2007 03:03 | 18K | |
![[SND]](/icons/sound2.gif) | antimonyl.mp3 | 14-Apr-2007 03:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | antimony.mp3 | 14-Apr-2007 03:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | antimonous.mp3 | 14-Apr-2007 03:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | antimonite.mp3 | 14-Apr-2007 03:03 | 17K | |
![[SND]](/icons/sound2.gif) | antimonide.mp3 | 14-Apr-2007 03:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | antimonic.mp3 | 14-Apr-2007 03:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | antimonial.mp3 | 14-Apr-2007 03:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | antimonate.mp3 | 14-Apr-2007 03:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | antimitotic.mp3 | 14-Apr-2007 03:02 | 11K | |
![[SND]](/icons/sound2.gif) | antimicrobial.mp3 | 14-Apr-2007 03:02 | 11K | |
![[SND]](/icons/sound2.gif) | antimetabolite.mp3 | 14-Apr-2007 03:02 | 12K | |
![[SND]](/icons/sound2.gif) | antimerism.mp3 | 14-Apr-2007 03:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | antimere.mp3 | 14-Apr-2007 03:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | antimensium.mp3 | 14-Apr-2007 03:02 | 17K | |
![[SND]](/icons/sound2.gif) | antimension.mp3 | 14-Apr-2007 03:02 | 17K | |
![[SND]](/icons/sound2.gif) | antimatter.mp3 | 14-Apr-2007 03:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | antimasque.mp3 | 14-Apr-2007 03:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | antimasker.mp3 | 14-Apr-2007 03:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | antimanic.mp3 | 14-Apr-2007 03:02 | 17K | |
![[SND]](/icons/sound2.gif) | antimalarial.mp3 | 14-Apr-2007 03:02 | 11K | |
![[SND]](/icons/sound2.gif) | antimagnetic.mp3 | 14-Apr-2007 03:02 | 11K | |
![[SND]](/icons/sound2.gif) | antimachus.mp3 | 14-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | antimacassar.mp3 | 14-Apr-2007 03:01 | 10K | |
![[SND]](/icons/sound2.gif) | antilogy.mp3 | 14-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | antilogistically.mp3 | 14-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | antilogism.mp3 | 14-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | antilogarithm.mp3 | 14-Apr-2007 03:01 | 12K | |
![[SND]](/icons/sound2.gif) | antilog.mp3 | 14-Apr-2007 03:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | antilock.mp3 | 14-Apr-2007 03:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | antilochus.mp3 | 14-Apr-2007 03:01 | 17K | |
![[SND]](/icons/sound2.gif) | antilife.mp3 | 14-Apr-2007 03:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | antileukemic.mp3 | 14-Apr-2007 03:00 | 10K | |
![[SND]](/icons/sound2.gif) | antilegomena.mp3 | 14-Apr-2007 03:00 | 17K | |
![[SND]](/icons/sound2.gif) | antikythera.mp3 | 14-Apr-2007 03:00 | 17K | |
![[SND]](/icons/sound2.gif) | antiid.mp3 | 14-Apr-2007 03:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | antihypertensive.mp3 | 14-Apr-2007 03:00 | 12K | |
![[SND]](/icons/sound2.gif) | antihuman.mp3 | 14-Apr-2007 03:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | antihormone.mp3 | 14-Apr-2007 03:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | antihistaminic.mp3 | 14-Apr-2007 03:00 | 11K | |
![[SND]](/icons/sound2.gif) | antihistamine.mp3 | 14-Apr-2007 02:59 | 11K | |
![[SND]](/icons/sound2.gif) | antiheroine.mp3 | 14-Apr-2007 02:59 | 11K | |
![[SND]](/icons/sound2.gif) | antiheroic.mp3 | 14-Apr-2007 02:59 | 11K | |
![[SND]](/icons/sound2.gif) | antihero.mp3 | 14-Apr-2007 02:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | antihemophilic factor.mp3 | 14-Apr-2007 02:59 | 14K | |
![[SND]](/icons/sound2.gif) | antigravity.mp3 | 14-Apr-2007 02:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | antigorite.mp3 | 14-Apr-2007 02:59 | 17K | |
![[SND]](/icons/sound2.gif) | antigonusi.mp3 | 14-Apr-2007 02:59 | 17K | |
![[SND]](/icons/sound2.gif) | antigodlin.mp3 | 14-Apr-2007 02:59 | 17K | |
![[SND]](/icons/sound2.gif) | antiglobulin.mp3 | 14-Apr-2007 02:59 | 11K | |
![[SND]](/icons/sound2.gif) | antigenicity.mp3 | 14-Apr-2007 02:59 | 11K | |
![[SND]](/icons/sound2.gif) | antigenically.mp3 | 14-Apr-2007 02:59 | 10K | |
![[SND]](/icons/sound2.gif) | antigenic.mp3 | 14-Apr-2007 02:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | antigen.mp3 | 14-Apr-2007 02:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | antigen-presenting cell.mp3 | 14-Apr-2007 02:59 | 13K | |
![[SND]](/icons/sound2.gif) | antifungal.mp3 | 14-Apr-2007 02:59 | 10K | |
![[SND]](/icons/sound2.gif) | antifreeze.mp3 | 14-Apr-2007 02:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | antifouling.mp3 | 14-Apr-2007 02:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | antifoggant.mp3 | 14-Apr-2007 02:59 | 17K | |
![[SND]](/icons/sound2.gif) | antifluoridationist.mp3 | 14-Apr-2007 02:59 | 14K | |
![[SND]](/icons/sound2.gif) | antifertility.mp3 | 14-Apr-2007 02:58 | 11K | |
![[SND]](/icons/sound2.gif) | antiferromagnetism.mp3 | 14-Apr-2007 02:58 | 15K | |
![[SND]](/icons/sound2.gif) | antiferromagnetically.mp3 | 14-Apr-2007 02:58 | 14K | |
![[SND]](/icons/sound2.gif) | antiferromagnetic.mp3 | 14-Apr-2007 02:58 | 13K | |
![[SND]](/icons/sound2.gif) | antiferromagnet.mp3 | 14-Apr-2007 02:58 | 13K | |
![[SND]](/icons/sound2.gif) | antifeedant.mp3 | 14-Apr-2007 02:58 | 17K | |
![[SND]](/icons/sound2.gif) | antifebrin.mp3 | 14-Apr-2007 02:58 | 17K | |
![[SND]](/icons/sound2.gif) | antietam.mp3 | 14-Apr-2007 02:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | antielectron.mp3 | 14-Apr-2007 02:58 | 11K | |
![[SND]](/icons/sound2.gif) | antidumping.mp3 | 14-Apr-2007 02:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | antidrug.mp3 | 14-Apr-2007 02:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | antidromically.mp3 | 14-Apr-2007 02:58 | 10K | |
![[SND]](/icons/sound2.gif) | antidromic.mp3 | 14-Apr-2007 02:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | antidotically.mp3 | 14-Apr-2007 02:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | antidote.mp3 | 14-Apr-2007 02:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | antidotally.mp3 | 14-Apr-2007 02:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | antidotal.mp3 | 14-Apr-2007 02:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | antidiuretic hormone.mp3 | 14-Apr-2007 02:58 | 17K | |
![[SND]](/icons/sound2.gif) | antiderivative.mp3 | 14-Apr-2007 02:58 | 11K | |
![[SND]](/icons/sound2.gif) | antidepressant.mp3 | 14-Apr-2007 02:58 | 10K | |
![[SND]](/icons/sound2.gif) | antidemocratic.mp3 | 14-Apr-2007 02:58 | 11K | |
![[SND]](/icons/sound2.gif) | anticyclonic.mp3 | 14-Apr-2007 02:58 | 11K | |
![[SND]](/icons/sound2.gif) | anticyclone.mp3 | 14-Apr-2007 02:57 | 11K | |
![[SND]](/icons/sound2.gif) | anticum.mp3 | 14-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | anticosti.mp3 | 14-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | anticorona.mp3 | 14-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | anticonvulsive.mp3 | 14-Apr-2007 02:57 | 11K | |
![[SND]](/icons/sound2.gif) | anticonvulsant.mp3 | 14-Apr-2007 02:57 | 11K | |
![[SND]](/icons/sound2.gif) | anticompetitive.mp3 | 14-Apr-2007 02:57 | 12K | |
![[SND]](/icons/sound2.gif) | anticodon.mp3 | 14-Apr-2007 02:57 | 11K | |
![[SND]](/icons/sound2.gif) | anticoagulant.mp3 | 14-Apr-2007 02:57 | 11K | |
![[SND]](/icons/sound2.gif) | anticly.mp3 | 14-Apr-2007 02:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | anticlockwise.mp3 | 14-Apr-2007 02:57 | 12K | |
![[SND]](/icons/sound2.gif) | anticlinorium.mp3 | 14-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | anticline.mp3 | 14-Apr-2007 02:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | anticlinal.mp3 | 14-Apr-2007 02:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | anticlimax.mp3 | 14-Apr-2007 02:57 | 12K | |
![[SND]](/icons/sound2.gif) | anticlimactically.mp3 | 14-Apr-2007 02:57 | 13K | |
![[SND]](/icons/sound2.gif) | anticlimactical.mp3 | 14-Apr-2007 02:57 | 12K | |
![[SND]](/icons/sound2.gif) | anticlimactic.mp3 | 14-Apr-2007 02:57 | 10K | |
![[SND]](/icons/sound2.gif) | anticlericalism.mp3 | 14-Apr-2007 02:57 | 13K | |
![[SND]](/icons/sound2.gif) | anticlerical.mp3 | 14-Apr-2007 02:57 | 11K | |
![[SND]](/icons/sound2.gif) | anticipatory.mp3 | 14-Apr-2007 02:57 | 9.6K | |
![[SND]](/icons/sound2.gif) | anticipatorily.mp3 | 14-Apr-2007 02:57 | 17K | |
![[SND]](/icons/sound2.gif) | anticipator.mp3 | 14-Apr-2007 02:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | anticipatively.mp3 | 14-Apr-2007 02:56 | 17K | |
![[SND]](/icons/sound2.gif) | anticipative.mp3 | 14-Apr-2007 02:56 | 17K | |
![[SND]](/icons/sound2.gif) | anticipation.mp3 | 14-Apr-2007 02:56 | 10K | |
![[SND]](/icons/sound2.gif) | anticipate.mp3 | 14-Apr-2007 02:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | anticipatable.mp3 | 14-Apr-2007 02:56 | 9.8K | |
![[SND]](/icons/sound2.gif) | anticipant.mp3 | 14-Apr-2007 02:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | antichthon.mp3 | 14-Apr-2007 02:56 | 17K | |
![[SND]](/icons/sound2.gif) | antichristianly.mp3 | 14-Apr-2007 02:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | anticholinesterase.mp3 | 14-Apr-2007 02:56 | 16K | |
![[SND]](/icons/sound2.gif) | anticholinergic.mp3 | 14-Apr-2007 02:56 | 13K | |
![[SND]](/icons/sound2.gif) | antichoicer.mp3 | 14-Apr-2007 02:56 | 11K | |
![[SND]](/icons/sound2.gif) | antichoice.mp3 | 14-Apr-2007 02:56 | 11K | |
![[SND]](/icons/sound2.gif) | antichloristic.mp3 | 14-Apr-2007 02:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | antichlor.mp3 | 14-Apr-2007 02:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | anticcally.mp3 | 14-Apr-2007 02:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | anticancer.mp3 | 14-Apr-2007 02:56 | 10K | |
![[SND]](/icons/sound2.gif) | antically.mp3 | 14-Apr-2007 02:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | antic.mp3 | 14-Apr-2007 02:56 | 5.5K | |
![[SND]](/icons/sound2.gif) | antibusing.mp3 | 14-Apr-2007 02:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | antibusiness.mp3 | 14-Apr-2007 02:56 | 10K | |
![[SND]](/icons/sound2.gif) | antibonding.mp3 | 14-Apr-2007 02:56 | 10K | |
![[SND]](/icons/sound2.gif) | antibody.mp3 | 14-Apr-2007 02:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | antiblastic.mp3 | 14-Apr-2007 02:56 | 17K | |
![[SND]](/icons/sound2.gif) | antiblack.mp3 | 14-Apr-2007 02:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | antibiotically.mp3 | 14-Apr-2007 02:55 | 11K | |
![[SND]](/icons/sound2.gif) | antibiotic.mp3 | 14-Apr-2007 02:55 | 10K | |
![[SND]](/icons/sound2.gif) | antibiosis.mp3 | 14-Apr-2007 02:55 | 11K | |
![[SND]](/icons/sound2.gif) | antiballistic missile.mp3 | 14-Apr-2007 02:55 | 15K | |
![[SND]](/icons/sound2.gif) | antiarrhythmic.mp3 | 14-Apr-2007 02:55 | 12K | |
![[SND]](/icons/sound2.gif) | antiar.mp3 | 14-Apr-2007 02:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | antianxiety.mp3 | 14-Apr-2007 02:55 | 13K | |
![[SND]](/icons/sound2.gif) | antiamericanism.mp3 | 14-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | antiamerican.mp3 | 14-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | antiaircraft.mp3 | 14-Apr-2007 02:55 | 11K | |
![[SND]](/icons/sound2.gif) | antiair.mp3 | 14-Apr-2007 02:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | antiabortionist.mp3 | 14-Apr-2007 02:55 | 14K | |
![[SND]](/icons/sound2.gif) | antiabortion.mp3 | 14-Apr-2007 02:55 | 11K | |
![[SND]](/icons/sound2.gif) | anti.mp3 | 14-Apr-2007 02:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | anti-utopian.mp3 | 14-Apr-2007 03:08 | 12K | |
![[SND]](/icons/sound2.gif) | anti-utopia.mp3 | 14-Apr-2007 03:08 | 11K | |
![[SND]](/icons/sound2.gif) | anti-roll bar.mp3 | 14-Apr-2007 03:06 | 14K | |
![[SND]](/icons/sound2.gif) | anti-intellectualism.mp3 | 14-Apr-2007 03:00 | 15K | |
![[SND]](/icons/sound2.gif) | anti-intellectual.mp3 | 14-Apr-2007 03:00 | 11K | |
![[SND]](/icons/sound2.gif) | anti-inflammatory.mp3 | 14-Apr-2007 03:00 | 13K | |
![[SND]](/icons/sound2.gif) | anti-idiotypic.mp3 | 14-Apr-2007 03:00 | 13K | |
![[SND]](/icons/sound2.gif) | anti-idiotype.mp3 | 14-Apr-2007 03:00 | 12K | |
![[SND]](/icons/sound2.gif) | anti-federalist.mp3 | 14-Apr-2007 02:58 | 13K | |
![[SND]](/icons/sound2.gif) | anti-art.mp3 | 14-Apr-2007 02:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | anti-Semitism.mp3 | 14-Apr-2007 03:06 | 13K | |
![[SND]](/icons/sound2.gif) | anti-Semitic.mp3 | 14-Apr-2007 03:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | anti-Semite.mp3 | 14-Apr-2007 03:06 | 10K | |
![[SND]](/icons/sound2.gif) | anti-Americanism.mp3 | 14-Apr-2007 02:55 | 14K | |
![[SND]](/icons/sound2.gif) | anti-American.mp3 | 14-Apr-2007 02:55 | 12K | |
![[SND]](/icons/sound2.gif) | anti-.mp3 | 14-Apr-2007 02:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | anthurium.mp3 | 14-Apr-2007 02:55 | 11K | |
![[SND]](/icons/sound2.gif) | anthropozoology.mp3 | 14-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | anthropotomy.mp3 | 14-Apr-2007 02:55 | 17K | |
![[SND]](/icons/sound2.gif) | anthroposphere.mp3 | 14-Apr-2007 02:55 | 45K | |
![[SND]](/icons/sound2.gif) | anthroposophy.mp3 | 14-Apr-2007 02:55 | 11K | |
![[SND]](/icons/sound2.gif) | anthroposophist.mp3 | 14-Apr-2007 02:54 | 12K | |
![[SND]](/icons/sound2.gif) | anthroposcopy.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthropophagy.mp3 | 14-Apr-2007 02:54 | 11K | |
![[SND]](/icons/sound2.gif) | anthropophagus.mp3 | 14-Apr-2007 02:54 | 11K | |
![[SND]](/icons/sound2.gif) | anthropophagously.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthropophagous.mp3 | 14-Apr-2007 02:54 | 11K | |
![[SND]](/icons/sound2.gif) | anthropophagite.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthropophagi.mp3 | 14-Apr-2007 02:54 | 12K | |
![[SND]](/icons/sound2.gif) | anthropopathy.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthropopathism.mp3 | 14-Apr-2007 02:54 | 13K | |
![[SND]](/icons/sound2.gif) | anthropopathic.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthroponymy.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthroponymic.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthroponym.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthroponomy.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthroponomist.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthropomorphously.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthropomorphous.mp3 | 14-Apr-2007 02:54 | 17K | |
![[SND]](/icons/sound2.gif) | anthropomorphize.mp3 | 14-Apr-2007 02:54 | 13K | |
![[SND]](/icons/sound2.gif) | anthropomorphization.mp3 | 14-Apr-2007 02:54 | 14K | |
![[SND]](/icons/sound2.gif) | anthropomorphist.mp3 | 14-Apr-2007 02:54 | 12K | |
![[SND]](/icons/sound2.gif) | anthropomorphism.mp3 | 14-Apr-2007 02:54 | 13K | |
![[SND]](/icons/sound2.gif) | anthropomorphically.mp3 | 14-Apr-2007 02:54 | 13K | |
![[SND]](/icons/sound2.gif) | anthropomorphic.mp3 | 14-Apr-2007 02:54 | 10K | |
![[SND]](/icons/sound2.gif) | anthropomorph.mp3 | 14-Apr-2007 02:53 | 11K | |
![[SND]](/icons/sound2.gif) | anthropometry.mp3 | 14-Apr-2007 02:53 | 11K | |
![[SND]](/icons/sound2.gif) | anthropometrist.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropometric.mp3 | 14-Apr-2007 02:53 | 11K | |
![[SND]](/icons/sound2.gif) | anthropometer.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropology.mp3 | 14-Apr-2007 02:53 | 11K | |
![[SND]](/icons/sound2.gif) | anthropologist.mp3 | 14-Apr-2007 02:53 | 12K | |
![[SND]](/icons/sound2.gif) | anthropologically.mp3 | 14-Apr-2007 02:53 | 12K | |
![[SND]](/icons/sound2.gif) | anthropological.mp3 | 14-Apr-2007 02:53 | 12K | |
![[SND]](/icons/sound2.gif) | anthropologic.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropolatry.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropolatric.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropoidal.mp3 | 14-Apr-2007 02:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | anthropoid.mp3 | 14-Apr-2007 02:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | anthropography.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropographic.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropogenically.mp3 | 14-Apr-2007 02:53 | 11K | |
![[SND]](/icons/sound2.gif) | anthropogenic.mp3 | 14-Apr-2007 02:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | anthropocentrism.mp3 | 14-Apr-2007 02:53 | 14K | |
![[SND]](/icons/sound2.gif) | anthropocentricity.mp3 | 14-Apr-2007 02:53 | 16K | |
![[SND]](/icons/sound2.gif) | anthropocentrically.mp3 | 14-Apr-2007 02:53 | 11K | |
![[SND]](/icons/sound2.gif) | anthropocentric.mp3 | 14-Apr-2007 02:53 | 13K | |
![[SND]](/icons/sound2.gif) | anthropo.mp3 | 14-Apr-2007 02:53 | 17K | |
![[SND]](/icons/sound2.gif) | anthropical.mp3 | 14-Apr-2007 02:53 | 10K | |
![[SND]](/icons/sound2.gif) | anthropic.mp3 | 14-Apr-2007 02:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | anthro.mp3 | 14-Apr-2007 02:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | anthrax.mp3 | 14-Apr-2007 02:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | anthraquinone.mp3 | 14-Apr-2007 02:52 | 11K | |
![[SND]](/icons/sound2.gif) | anthranilicacid.mp3 | 14-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | anthranilic acid.mp3 | 14-Apr-2007 02:52 | 14K | |
![[SND]](/icons/sound2.gif) | anthranilate.mp3 | 14-Apr-2007 02:52 | 10K | |
![[SND]](/icons/sound2.gif) | anthracotic.mp3 | 14-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | anthracosis.mp3 | 14-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | anthracoid.mp3 | 14-Apr-2007 02:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | anthraco.mp3 | 14-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | anthracnose.mp3 | 14-Apr-2007 02:52 | 11K | |
![[SND]](/icons/sound2.gif) | anthracitous.mp3 | 14-Apr-2007 02:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | anthracitic.mp3 | 14-Apr-2007 02:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | anthracite.mp3 | 14-Apr-2007 02:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | anthracene.mp3 | 14-Apr-2007 02:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | anthrac.mp3 | 14-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | anthozoan.mp3 | 14-Apr-2007 02:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | anthous.mp3 | 14-Apr-2007 02:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | anthotaxy.mp3 | 14-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | anthophyllitic.mp3 | 14-Apr-2007 02:52 | 17K | |
![[SND]](/icons/sound2.gif) | anthophyllite.mp3 | 14-Apr-2007 02:52 | 10K | |
![[SND]](/icons/sound2.gif) | anthophore.mp3 | 14-Apr-2007 02:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | anthophilous.mp3 | 14-Apr-2007 02:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | anthophagy.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | anthophagous.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | anthonyofpadua.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | anthology.mp3 | 14-Apr-2007 02:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | anthologizer.mp3 | 14-Apr-2007 02:51 | 11K | |
![[SND]](/icons/sound2.gif) | anthologize.mp3 | 14-Apr-2007 02:51 | 11K | |
![[SND]](/icons/sound2.gif) | anthologist.mp3 | 14-Apr-2007 02:51 | 10K | |
![[SND]](/icons/sound2.gif) | anthologically.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | anthological.mp3 | 14-Apr-2007 02:51 | 10K | |
![[SND]](/icons/sound2.gif) | anthodium.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | anthocyanin.mp3 | 14-Apr-2007 02:51 | 11K | |
![[SND]](/icons/sound2.gif) | anthocarpous.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | antho.mp3 | 14-Apr-2007 02:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | anthill.mp3 | 14-Apr-2007 02:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | anthesteriac.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | anthesteria.mp3 | 14-Apr-2007 02:51 | 17K | |
![[SND]](/icons/sound2.gif) | anthesis.mp3 | 14-Apr-2007 02:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | antherozoid.mp3 | 14-Apr-2007 02:51 | 45K | |
![[SND]](/icons/sound2.gif) | antherless.mp3 | 14-Apr-2007 02:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | antheridium.mp3 | 14-Apr-2007 02:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | antheridial.mp3 | 14-Apr-2007 02:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | antheridia.mp3 | 14-Apr-2007 02:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | antheral.mp3 | 14-Apr-2007 02:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | anther.mp3 | 14-Apr-2007 02:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | anthemion.mp3 | 14-Apr-2007 02:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | anthemic.mp3 | 14-Apr-2007 02:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | anthemia.mp3 | 14-Apr-2007 02:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | anthema.mp3 | 14-Apr-2007 02:50 | 36K | |
![[SND]](/icons/sound2.gif) | anthem.mp3 | 14-Apr-2007 02:50 | 5.5K | |
![[SND]](/icons/sound2.gif) | anthelmintic.mp3 | 14-Apr-2007 02:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | anthelix.mp3 | 14-Apr-2007 02:50 | 17K | |
![[SND]](/icons/sound2.gif) | anthelion.mp3 | 14-Apr-2007 02:50 | 36K | |
![[SND]](/icons/sound2.gif) | anthelicarc.mp3 | 14-Apr-2007 02:50 | 45K | |
![[SND]](/icons/sound2.gif) | antheil.mp3 | 14-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | anthea.mp3 | 14-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | anth.mp3 | 14-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | antevert.mp3 | 14-Apr-2007 02:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | anterus.mp3 | 14-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | anteros.mp3 | 14-Apr-2007 02:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | anteroom.mp3 | 14-Apr-2007 02:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | antero.mp3 | 14-Apr-2007 02:50 | 17K | |
![[SND]](/icons/sound2.gif) | anteriorly.mp3 | 14-Apr-2007 02:50 | 17K | |
![[SND]](/icons/sound2.gif) | anterior.mp3 | 14-Apr-2007 02:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | antepenultimate.mp3 | 14-Apr-2007 02:50 | 10K | |
![[SND]](/icons/sound2.gif) | antepenultima.mp3 | 14-Apr-2007 02:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | antepenult.mp3 | 14-Apr-2007 02:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | antependium.mp3 | 14-Apr-2007 02:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | antependia.mp3 | 14-Apr-2007 02:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | antepast.mp3 | 14-Apr-2007 02:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | antepartum.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | anteosaur.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antenuptial.mp3 | 14-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | antennule.mp3 | 14-Apr-2007 02:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | antennulary.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antennular.mp3 | 14-Apr-2007 02:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | antennifer.mp3 | 14-Apr-2007 02:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | antennate.mp3 | 14-Apr-2007 02:49 | 36K | |
![[SND]](/icons/sound2.gif) | antennary.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antennapedia.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antennalgland.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antennal.mp3 | 14-Apr-2007 02:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | antennae.mp3 | 14-Apr-2007 02:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | antenna.mp3 | 14-Apr-2007 02:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | antenatally.mp3 | 14-Apr-2007 02:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | antenatal.mp3 | 14-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | antemundane.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antemortem.mp3 | 14-Apr-2007 02:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | antemetic.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antemeridiem.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | ante meridiem.mp3 | 14-Apr-2007 02:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | antemeridian.mp3 | 14-Apr-2007 02:49 | 17K | |
![[SND]](/icons/sound2.gif) | antelopine.mp3 | 14-Apr-2007 02:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | antelope.mp3 | 14-Apr-2007 02:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | anteflexion.mp3 | 14-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | antefixes.mp3 | 14-Apr-2007 02:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | antefixal.mp3 | 14-Apr-2007 02:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | antefixae.mp3 | 14-Apr-2007 02:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | antefix.mp3 | 14-Apr-2007 02:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | antediluvian.mp3 | 14-Apr-2007 02:48 | 10K | |
![[SND]](/icons/sound2.gif) | antedate.mp3 | 14-Apr-2007 02:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | antechristum.mp3 | 14-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | antechapel.mp3 | 14-Apr-2007 02:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | antechamber.mp3 | 14-Apr-2007 02:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | antecessor.mp3 | 14-Apr-2007 02:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | antecedently.mp3 | 14-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | antecedent.mp3 | 14-Apr-2007 02:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | antecedency.mp3 | 14-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | antecedence.mp3 | 14-Apr-2007 02:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | antecede.mp3 | 14-Apr-2007 02:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | antebellum.mp3 | 14-Apr-2007 02:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | anteater.mp3 | 14-Apr-2007 02:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | ante.mp3 | 14-Apr-2007 02:48 | 5.0K | |
![[SND]](/icons/sound2.gif) | ante-post.mp3 | 14-Apr-2007 02:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | antbear.mp3 | 14-Apr-2007 02:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | antatrophic.mp3 | 14-Apr-2007 02:48 | 45K | |
![[SND]](/icons/sound2.gif) | antasthmatic.mp3 | 14-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | antarthritic.mp3 | 14-Apr-2007 02:48 | 17K | |
![[SND]](/icons/sound2.gif) | antaranga.mp3 | 14-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | antara.mp3 | 14-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | antaphrodisiac.mp3 | 14-Apr-2007 02:47 | 18K | |
![[SND]](/icons/sound2.gif) | antapex.mp3 | 14-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | antanaclasis.mp3 | 14-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | antalkaline.mp3 | 14-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | antalkali.mp3 | 14-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | antakiya.mp3 | 14-Apr-2007 02:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | antagonize.mp3 | 14-Apr-2007 02:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | antagonization.mp3 | 14-Apr-2007 02:47 | 17K | |
![[SND]](/icons/sound2.gif) | antagonistically.mp3 | 14-Apr-2007 02:47 | 11K | |
![[SND]](/icons/sound2.gif) | antagonistic.mp3 | 14-Apr-2007 02:47 | 9.8K | |
![[SND]](/icons/sound2.gif) | antagonist.mp3 | 14-Apr-2007 02:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | antagonism.mp3 | 14-Apr-2007 02:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | antaeus.mp3 | 14-Apr-2007 02:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | antae.mp3 | 14-Apr-2007 02:47 | 5.0K | |
![[SND]](/icons/sound2.gif) | antacid.mp3 | 14-Apr-2007 02:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | antabuse.mp3 | 14-Apr-2007 02:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | anta.mp3 | 14-Apr-2007 02:46 | 4.5K | |
![[SND]](/icons/sound2.gif) | ant.mp3 | 14-Apr-2007 02:46 | 3.9K | |
![[SND]](/icons/sound2.gif) | answerphone.mp3 | 14-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | answerless.mp3 | 14-Apr-2007 02:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | answering.mp3 | 14-Apr-2007 02:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | answerer.mp3 | 14-Apr-2007 02:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | answerably.mp3 | 14-Apr-2007 02:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | answerable.mp3 | 14-Apr-2007 02:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | answerability.mp3 | 14-Apr-2007 02:46 | 11K | |
![[SND]](/icons/sound2.gif) | answer.mp3 | 14-Apr-2007 02:46 | 5.4K | |
![[SND]](/icons/sound2.gif) | anstoss.mp3 | 14-Apr-2007 02:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | anson.mp3 | 14-Apr-2007 02:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | ansgarius.mp3 | 14-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | ansgar.mp3 | 14-Apr-2007 02:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | ansett.mp3 | 14-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | ansermet.mp3 | 14-Apr-2007 02:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | anserine.mp3 | 14-Apr-2007 02:46 | 36K | |
![[SND]](/icons/sound2.gif) | anschluss.mp3 | 14-Apr-2007 02:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | anschauung.mp3 | 14-Apr-2007 02:46 | 17K | |
![[SND]](/icons/sound2.gif) | ansate.mp3 | 14-Apr-2007 02:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | ansarian.mp3 | 14-Apr-2007 02:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | ansar.mp3 | 14-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | ansafone.mp3 | 14-Apr-2007 02:45 | 17K | |
![[SND]](/icons/sound2.gif) | ansa.mp3 | 14-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | anqing.mp3 | 14-Apr-2007 02:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | anoxic.mp3 | 14-Apr-2007 02:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | anoxia.mp3 | 14-Apr-2007 02:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | anoxemic.mp3 | 14-Apr-2007 02:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | anoxemia.mp3 | 14-Apr-2007 02:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | anoxaemic.mp3 | 14-Apr-2007 02:45 | 17K | |
![[SND]](/icons/sound2.gif) | anovulatory.mp3 | 14-Apr-2007 02:45 | 11K | |
![[SND]](/icons/sound2.gif) | anovulation.mp3 | 14-Apr-2007 02:45 | 45K | |
![[SND]](/icons/sound2.gif) | anovulant.mp3 | 14-Apr-2007 02:45 | 45K | |
![[SND]](/icons/sound2.gif) | anourous.mp3 | 14-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | another.mp3 | 14-Apr-2007 02:45 | 5.4K | |
![[SND]](/icons/sound2.gif) | another-guess.mp3 | 14-Apr-2007 02:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | anosmic.mp3 | 14-Apr-2007 02:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | anosmia.mp3 | 14-Apr-2007 02:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | anoscope.mp3 | 14-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | anorthositic.mp3 | 14-Apr-2007 02:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | anorthosite.mp3 | 14-Apr-2007 02:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | anorthopia.mp3 | 14-Apr-2007 02:45 | 17K | |
![[SND]](/icons/sound2.gif) | anorthoclase.mp3 | 14-Apr-2007 02:45 | 36K | |
![[SND]](/icons/sound2.gif) | anorthitic.mp3 | 14-Apr-2007 02:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | anorthite.mp3 | 14-Apr-2007 02:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | anorthic.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anorgastic.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anorgasmic.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anorgasmia.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anorexigenic.mp3 | 14-Apr-2007 02:44 | 11K | |
![[SND]](/icons/sound2.gif) | anorexic.mp3 | 14-Apr-2007 02:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | anorexiant.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anorexianervosa.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anorexia nervosa.mp3 | 14-Apr-2007 02:44 | 14K | |
![[SND]](/icons/sound2.gif) | anorexia.mp3 | 14-Apr-2007 02:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | anoretic.mp3 | 14-Apr-2007 02:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | anorectic.mp3 | 14-Apr-2007 02:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | anorectal.mp3 | 14-Apr-2007 02:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | anorchous.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anorak.mp3 | 14-Apr-2007 02:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | anopisthographically.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anopisthograph.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anopia.mp3 | 14-Apr-2007 02:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | anopheline.mp3 | 14-Apr-2007 02:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | anopheles.mp3 | 14-Apr-2007 02:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | anoopsia.mp3 | 14-Apr-2007 02:44 | 17K | |
![[SND]](/icons/sound2.gif) | anonymously.mp3 | 14-Apr-2007 02:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | anonymous.mp3 | 14-Apr-2007 02:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | anonymity.mp3 | 14-Apr-2007 02:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | anonym.mp3 | 14-Apr-2007 02:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | anonychia.mp3 | 14-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | anonaceous.mp3 | 14-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | anona.mp3 | 14-Apr-2007 02:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | anon.mp3 | 14-Apr-2007 02:43 | 5.7K | |
![[SND]](/icons/sound2.gif) | anomy.mp3 | 14-Apr-2007 02:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | anomo.mp3 | 14-Apr-2007 02:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | anomite.mp3 | 14-Apr-2007 02:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | anomie.mp3 | 14-Apr-2007 02:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | anomic.mp3 | 14-Apr-2007 02:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | anomia.mp3 | 14-Apr-2007 02:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | anomaly.mp3 | 14-Apr-2007 02:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | anomalure.mp3 | 14-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | anomalousness.mp3 | 14-Apr-2007 02:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | anomalous.mp3 | 14-Apr-2007 02:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | anomalistically.mp3 | 14-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | anomalistic.mp3 | 14-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | anomalism.mp3 | 14-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | anolyte.mp3 | 14-Apr-2007 02:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | anole.mp3 | 14-Apr-2007 02:43 | 5.4K | |
![[SND]](/icons/sound2.gif) | anointment.mp3 | 14-Apr-2007 02:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | anointer.mp3 | 14-Apr-2007 02:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | anoint.mp3 | 14-Apr-2007 02:43 | 5.4K | |
![[SND]](/icons/sound2.gif) | anoia.mp3 | 14-Apr-2007 02:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | anoetic.mp3 | 14-Apr-2007 02:43 | 17K | |
![[SND]](/icons/sound2.gif) | anoestrus.mp3 | 14-Apr-2007 02:43 | 36K | |
![[SND]](/icons/sound2.gif) | anoestrous.mp3 | 14-Apr-2007 02:42 | 36K | |
![[SND]](/icons/sound2.gif) | anoesis.mp3 | 14-Apr-2007 02:42 | 17K | |
![[SND]](/icons/sound2.gif) | anodynin.mp3 | 14-Apr-2007 02:42 | 17K | |
![[SND]](/icons/sound2.gif) | anodynic.mp3 | 14-Apr-2007 02:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | anodyne.mp3 | 14-Apr-2007 02:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | anodontia.mp3 | 14-Apr-2007 02:42 | 17K | |
![[SND]](/icons/sound2.gif) | anodizer.mp3 | 14-Apr-2007 02:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | anodize.mp3 | 14-Apr-2007 02:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | anodization.mp3 | 14-Apr-2007 02:42 | 10K | |
![[SND]](/icons/sound2.gif) | anodically.mp3 | 14-Apr-2007 02:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | anodic.mp3 | 14-Apr-2007 02:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | anode.mp3 | 14-Apr-2007 02:42 | 5.5K | |
![[SND]](/icons/sound2.gif) | anodally.mp3 | 14-Apr-2007 02:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | anodal.mp3 | 14-Apr-2007 02:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | anoa.mp3 | 14-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | ano.mp3 | 14-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | annwfn.mp3 | 14-Apr-2007 02:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | annusmirabilis.mp3 | 14-Apr-2007 02:42 | 17K | |
![[SND]](/icons/sound2.gif) | annus mirabilis.mp3 | 14-Apr-2007 02:42 | 12K | |
![[SND]](/icons/sound2.gif) | annushorribilis.mp3 | 14-Apr-2007 02:42 | 17K | |
![[SND]](/icons/sound2.gif) | annunciatory.mp3 | 14-Apr-2007 02:42 | 10K | |
![[SND]](/icons/sound2.gif) | annunciator.mp3 | 14-Apr-2007 02:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | annunciative.mp3 | 14-Apr-2007 02:42 | 17K | |
![[SND]](/icons/sound2.gif) | annunciate.mp3 | 14-Apr-2007 02:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | annum.mp3 | 14-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | annulus.mp3 | 14-Apr-2007 02:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | annulose.mp3 | 14-Apr-2007 02:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | annulment.mp3 | 14-Apr-2007 02:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | annullable.mp3 | 14-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | annuli.mp3 | 14-Apr-2007 02:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | annulet.mp3 | 14-Apr-2007 02:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | annulation.mp3 | 14-Apr-2007 02:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | annulate.mp3 | 14-Apr-2007 02:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | annularly.mp3 | 14-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | annular.mp3 | 14-Apr-2007 02:41 | 6.3K | |
![[SND]](/icons/sound2.gif) | annul.mp3 | 14-Apr-2007 02:41 | 5.4K | |
![[SND]](/icons/sound2.gif) | annuity.mp3 | 14-Apr-2007 02:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | annuitcoeptis.mp3 | 14-Apr-2007 02:41 | 17K | |
![[SND]](/icons/sound2.gif) | annuit coeptis.mp3 | 14-Apr-2007 02:41 | 14K | |
![[SND]](/icons/sound2.gif) | annuitant.mp3 | 14-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | annually.mp3 | 14-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | annualize.mp3 | 14-Apr-2007 02:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | annual.mp3 | 14-Apr-2007 02:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | annoyingness.mp3 | 14-Apr-2007 02:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | annoyingly.mp3 | 14-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | annoying.mp3 | 14-Apr-2007 02:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | annoyer.mp3 | 14-Apr-2007 02:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | annoyed.mp3 | 14-Apr-2007 02:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | annoyance.mp3 | 14-Apr-2007 02:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | annoy.mp3 | 14-Apr-2007 02:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | annourbisconditae.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | anno urbis conditae.mp3 | 14-Apr-2007 02:40 | 16K | |
![[SND]](/icons/sound2.gif) | announcer.mp3 | 14-Apr-2007 02:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | announcement.mp3 | 14-Apr-2007 02:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | announceable.mp3 | 14-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | announce.mp3 | 14-Apr-2007 02:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | annotinous.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | annotator.mp3 | 14-Apr-2007 02:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | annotative.mp3 | 14-Apr-2007 02:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | annotation.mp3 | 14-Apr-2007 02:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | annotated.mp3 | 14-Apr-2007 02:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | annotate.mp3 | 14-Apr-2007 02:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | annoregni.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | annonaceous.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | annona.mp3 | 14-Apr-2007 02:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | annomundi.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | anno mundi.mp3 | 14-Apr-2007 02:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | annohejirae.mp3 | 14-Apr-2007 02:40 | 36K | |
![[SND]](/icons/sound2.gif) | anno hegirae.mp3 | 14-Apr-2007 02:40 | 10K | |
![[SND]](/icons/sound2.gif) | annodomini.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | annoaetatissuae.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | anno aetatis suae.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | anno Domini.mp3 | 14-Apr-2007 02:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | annmargret.mp3 | 14-Apr-2007 02:40 | 17K | |
![[SND]](/icons/sound2.gif) | anniversary.mp3 | 14-Apr-2007 02:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | annish.mp3 | 14-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | annimirabiles.mp3 | 14-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | anni mirabiles.mp3 | 14-Apr-2007 02:39 | 12K | |
![[SND]](/icons/sound2.gif) | annihilatory.mp3 | 14-Apr-2007 02:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | annihilator.mp3 | 14-Apr-2007 02:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | annihilationism.mp3 | 14-Apr-2007 02:39 | 27K | |
![[SND]](/icons/sound2.gif) | annihilation.mp3 | 14-Apr-2007 02:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | annihilated.mp3 | 14-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | annihilate.mp3 | 14-Apr-2007 02:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | annihilable.mp3 | 14-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | annihilability.mp3 | 14-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | annieoakley.mp3 | 14-Apr-2007 02:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | annie.mp3 | 14-Apr-2007 02:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | annicut.mp3 | 14-Apr-2007 02:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | annexe.mp3 | 14-Apr-2007 02:39 | 6.1K | |
![[SND]](/icons/sound2.gif) | annexationist.mp3 | 14-Apr-2007 02:39 | 11K | |
![[SND]](/icons/sound2.gif) | annexationism.mp3 | 14-Apr-2007 02:39 | 17K | |
![[SND]](/icons/sound2.gif) | annexational.mp3 | 14-Apr-2007 02:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | annexation.mp3 | 14-Apr-2007 02:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | annexable.mp3 | 14-Apr-2007 02:39 | 36K | |
![[SND]](/icons/sound2.gif) | annex.mp3 | 14-Apr-2007 02:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | annette.mp3 | 14-Apr-2007 02:39 | 36K | |
![[SND]](/icons/sound2.gif) | annensky.mp3 | 14-Apr-2007 02:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | annelidan.mp3 | 14-Apr-2007 02:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | annelida.mp3 | 14-Apr-2007 02:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | annelid.mp3 | 14-Apr-2007 02:38 | 5.5K | |
![[SND]](/icons/sound2.gif) | annedebeaujeu.mp3 | 14-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | annectent.mp3 | 14-Apr-2007 02:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | anneboleyn.mp3 | 14-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | annealer.mp3 | 14-Apr-2007 02:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | anneal.mp3 | 14-Apr-2007 02:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | annatto.mp3 | 14-Apr-2007 02:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | annatol.mp3 | 14-Apr-2007 02:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | annates.mp3 | 14-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | annarbor.mp3 | 14-Apr-2007 02:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | annamaria.mp3 | 14-Apr-2007 02:38 | 17K | |
![[SND]](/icons/sound2.gif) | annals.mp3 | 14-Apr-2007 02:38 | 5.2K | |
![[SND]](/icons/sound2.gif) | annalistically.mp3 | 14-Apr-2007 02:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | annalistic.mp3 | 14-Apr-2007 02:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | annalist.mp3 | 14-Apr-2007 02:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | annal.mp3 | 14-Apr-2007 02:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | annajaf.mp3 | 14-Apr-2007 02:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | annaivanovna.mp3 | 14-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | annafud.mp3 | 14-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | annabergite.mp3 | 14-Apr-2007 02:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | annabellee.mp3 | 14-Apr-2007 02:37 | 17K | |
![[SND]](/icons/sound2.gif) | annabel.mp3 | 14-Apr-2007 02:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | anna.mp3 | 14-Apr-2007 02:37 | 3.9K | |
![[SND]](/icons/sound2.gif) | ann.mp3 | 14-Apr-2007 02:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | anlaut.mp3 | 14-Apr-2007 02:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | anlages.mp3 | 14-Apr-2007 02:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | anlagen.mp3 | 14-Apr-2007 02:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | anlage.mp3 | 14-Apr-2007 02:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | anlace.mp3 | 14-Apr-2007 02:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | ankylotic.mp3 | 14-Apr-2007 02:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | ankylostomiasis.mp3 | 14-Apr-2007 02:37 | 13K | |
![[SND]](/icons/sound2.gif) | ankylosis.mp3 | 14-Apr-2007 02:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | ankyloses.mp3 | 14-Apr-2007 02:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | ankylose.mp3 | 14-Apr-2007 02:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | ankylosaurus.mp3 | 14-Apr-2007 02:37 | 10K | |
![[SND]](/icons/sound2.gif) | ankylosaur.mp3 | 14-Apr-2007 02:36 | 9.3K | |
![[SND]](/icons/sound2.gif) | ankyloglossia.mp3 | 14-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | ankylo.mp3 | 14-Apr-2007 02:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | ankus.mp3 | 14-Apr-2007 02:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | anklung.mp3 | 14-Apr-2007 02:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | anklet.mp3 | 14-Apr-2007 02:36 | 5.5K | |
![[SND]](/icons/sound2.gif) | anklebone.mp3 | 14-Apr-2007 02:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | ankle.mp3 | 14-Apr-2007 02:36 | 4.6K | |
![[SND]](/icons/sound2.gif) | ankh.mp3 | 14-Apr-2007 02:36 | 3.9K | |
![[SND]](/icons/sound2.gif) | ankerite.mp3 | 14-Apr-2007 02:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | anker.mp3 | 14-Apr-2007 02:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | ankaratramountains.mp3 | 14-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | anka.mp3 | 14-Apr-2007 02:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | anita.mp3 | 14-Apr-2007 02:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | anisylacetate.mp3 | 14-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | anisotropy.mp3 | 14-Apr-2007 02:36 | 10K | |
![[SND]](/icons/sound2.gif) | anisotropism.mp3 | 14-Apr-2007 02:36 | 12K | |
![[SND]](/icons/sound2.gif) | anisotropically.mp3 | 14-Apr-2007 02:36 | 11K | |
![[SND]](/icons/sound2.gif) | anisotropic.mp3 | 14-Apr-2007 02:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | anisopteran.mp3 | 14-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | anisophylly.mp3 | 14-Apr-2007 02:36 | 17K | |
![[SND]](/icons/sound2.gif) | anisophyllous.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisomycin.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisometropic.mp3 | 14-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | anisometropia.mp3 | 14-Apr-2007 02:35 | 12K | |
![[SND]](/icons/sound2.gif) | anisometric.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisomerous.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisole.mp3 | 14-Apr-2007 02:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | anisogamy.mp3 | 14-Apr-2007 02:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | anisogamous.mp3 | 14-Apr-2007 02:35 | 10K | |
![[SND]](/icons/sound2.gif) | anisogametic.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisogamete.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisodactylous.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisocoria.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisocarpic.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | aniso.mp3 | 14-Apr-2007 02:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | anisicalcohol.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisic.mp3 | 14-Apr-2007 02:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | anisette.mp3 | 14-Apr-2007 02:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | aniseikonic.mp3 | 14-Apr-2007 02:35 | 10K | |
![[SND]](/icons/sound2.gif) | aniseikonia.mp3 | 14-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | aniseed.mp3 | 14-Apr-2007 02:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | anise.mp3 | 14-Apr-2007 02:35 | 5.5K | |
![[SND]](/icons/sound2.gif) | anisaldehyde.mp3 | 14-Apr-2007 02:35 | 17K | |
![[SND]](/icons/sound2.gif) | anisakis.mp3 | 14-Apr-2007 02:34 | 17K | |
![[SND]](/icons/sound2.gif) | anisakid.mp3 | 14-Apr-2007 02:34 | 17K | |
![[SND]](/icons/sound2.gif) | anisakiasis.mp3 | 14-Apr-2007 02:34 | 18K | |
![[SND]](/icons/sound2.gif) | anis.mp3 | 14-Apr-2007 02:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | anionically.mp3 | 14-Apr-2007 02:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | anionic.mp3 | 14-Apr-2007 02:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | anion.mp3 | 14-Apr-2007 02:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | animus.mp3 | 14-Apr-2007 02:34 | 6.3K | |
![[SND]](/icons/sound2.gif) | animosity.mp3 | 14-Apr-2007 02:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | animistic.mp3 | 14-Apr-2007 02:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | animist.mp3 | 14-Apr-2007 02:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | animisopibusqueparati.mp3 | 14-Apr-2007 02:34 | 27K | |
![[SND]](/icons/sound2.gif) | animis opibusque parati.mp3 | 14-Apr-2007 02:34 | 23K | |
![[SND]](/icons/sound2.gif) | animism.mp3 | 14-Apr-2007 02:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | anime.mp3 | 14-Apr-2007 02:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | animatronics.mp3 | 14-Apr-2007 02:34 | 11K | |
![[SND]](/icons/sound2.gif) | animatronically.mp3 | 14-Apr-2007 02:34 | 14K | |
![[SND]](/icons/sound2.gif) | animatronic.mp3 | 14-Apr-2007 02:34 | 11K | |
![[SND]](/icons/sound2.gif) | animator.mp3 | 14-Apr-2007 02:34 | 6.3K | |
![[SND]](/icons/sound2.gif) | animato.mp3 | 14-Apr-2007 02:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | animatism.mp3 | 14-Apr-2007 02:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | animation.mp3 | 14-Apr-2007 02:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | animatingly.mp3 | 14-Apr-2007 02:34 | 27K | |
![[SND]](/icons/sound2.gif) | animatic.mp3 | 14-Apr-2007 02:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | animatedly.mp3 | 14-Apr-2007 02:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | animated.mp3 | 14-Apr-2007 02:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | animate.mp3 | 14-Apr-2007 02:33 | 5.2K | |
![[SND]](/icons/sound2.gif) | animamundi.mp3 | 14-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | animally.mp3 | 14-Apr-2007 02:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | animallike.mp3 | 14-Apr-2007 02:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | animalize.mp3 | 14-Apr-2007 02:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | animalization.mp3 | 14-Apr-2007 02:33 | 10K | |
![[SND]](/icons/sound2.gif) | animality.mp3 | 14-Apr-2007 02:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | animalistic.mp3 | 14-Apr-2007 02:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | animalist.mp3 | 14-Apr-2007 02:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | animalism.mp3 | 14-Apr-2007 02:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | animalier.mp3 | 14-Apr-2007 02:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | animalia.mp3 | 14-Apr-2007 02:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | animalculum.mp3 | 14-Apr-2007 02:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | animalculous.mp3 | 14-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | animalculist.mp3 | 14-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | animalculism.mp3 | 14-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | animalcule.mp3 | 14-Apr-2007 02:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | animalcula.mp3 | 14-Apr-2007 02:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | animalbipesimplume.mp3 | 14-Apr-2007 02:33 | 27K | |
![[SND]](/icons/sound2.gif) | animal bipes implume.mp3 | 14-Apr-2007 02:33 | 18K | |
![[SND]](/icons/sound2.gif) | animal.mp3 | 14-Apr-2007 02:33 | 5.2K | |
![[SND]](/icons/sound2.gif) | animadverter.mp3 | 14-Apr-2007 02:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | animadvert.mp3 | 14-Apr-2007 02:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | animadversional.mp3 | 14-Apr-2007 02:33 | 17K | |
![[SND]](/icons/sound2.gif) | animadversion.mp3 | 14-Apr-2007 02:33 | 11K | |
![[SND]](/icons/sound2.gif) | anima.mp3 | 14-Apr-2007 02:32 | 5.2K | |
![[SND]](/icons/sound2.gif) | anility.mp3 | 14-Apr-2007 02:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | anilingus.mp3 | 14-Apr-2007 02:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | aniline.mp3 | 14-Apr-2007 02:32 | 5.5K | |
![[SND]](/icons/sound2.gif) | anilinctus.mp3 | 14-Apr-2007 02:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | anilidic.mp3 | 14-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | anilide.mp3 | 14-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | anile.mp3 | 14-Apr-2007 02:32 | 5.5K | |
![[SND]](/icons/sound2.gif) | anil.mp3 | 14-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | anik.mp3 | 14-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | anigh.mp3 | 14-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | anicut.mp3 | 14-Apr-2007 02:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | aniconism.mp3 | 14-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | aniconic.mp3 | 14-Apr-2007 02:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | anicetus.mp3 | 14-Apr-2007 02:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | anicca.mp3 | 14-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | anianiau.mp3 | 14-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | aniakchakcrater.mp3 | 14-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | ani.mp3 | 14-Apr-2007 02:32 | 5.7K | |
![[SND]](/icons/sound2.gif) | anhydrous.mp3 | 14-Apr-2007 02:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | anhydro.mp3 | 14-Apr-2007 02:32 | 17K | |
![[SND]](/icons/sound2.gif) | anhydrite.mp3 | 14-Apr-2007 02:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | anhydride.mp3 | 14-Apr-2007 02:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | anhydremic.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | anhydremia.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | anhydr.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | anhui.mp3 | 14-Apr-2007 02:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | anhinga.mp3 | 14-Apr-2007 02:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | anhidrotic.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | anhidrosis.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | anheuserbusch.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | anhedral.mp3 | 14-Apr-2007 02:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | anhedonic.mp3 | 14-Apr-2007 02:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | anhedonia.mp3 | 14-Apr-2007 02:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | anharmonic.mp3 | 14-Apr-2007 02:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | angwantibo.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | angusti.mp3 | 14-Apr-2007 02:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | angustate.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | angusog.mp3 | 14-Apr-2007 02:31 | 17K | |
![[SND]](/icons/sound2.gif) | angulous.mp3 | 14-Apr-2007 02:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | angulosity.mp3 | 14-Apr-2007 02:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | angulation.mp3 | 14-Apr-2007 02:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | angulateness.mp3 | 14-Apr-2007 02:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | angulate.mp3 | 14-Apr-2007 02:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | angularness.mp3 | 14-Apr-2007 02:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | angularity.mp3 | 14-Apr-2007 02:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | angular.mp3 | 14-Apr-2007 02:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | anguisinherba.mp3 | 14-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | anguis in herba.mp3 | 14-Apr-2007 02:30 | 13K | |
![[SND]](/icons/sound2.gif) | anguished.mp3 | 14-Apr-2007 02:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | anguish.mp3 | 14-Apr-2007 02:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | anguine.mp3 | 14-Apr-2007 02:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | anguilliform.mp3 | 14-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | anguiform.mp3 | 14-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | anguier.mp3 | 14-Apr-2007 02:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | angstrom.mp3 | 14-Apr-2007 02:30 | 6.3K | |
![[SND]](/icons/sound2.gif) | angst.mp3 | 14-Apr-2007 02:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | angry.mp3 | 14-Apr-2007 02:30 | 5.5K | |
![[SND]](/icons/sound2.gif) | angriness.mp3 | 14-Apr-2007 02:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | angrily.mp3 | 14-Apr-2007 02:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | angrboda.mp3 | 14-Apr-2007 02:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | angramainyu.mp3 | 14-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | angradoheroismo.mp3 | 14-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | angosturabark.mp3 | 14-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | angostura.mp3 | 14-Apr-2007 02:30 | 17K | |
![[SND]](/icons/sound2.gif) | angora.mp3 | 14-Apr-2007 02:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | angor.mp3 | 14-Apr-2007 02:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | angon.mp3 | 14-Apr-2007 02:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | angolese.mp3 | 14-Apr-2007 02:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | angma.mp3 | 14-Apr-2007 02:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | anglophone.mp3 | 14-Apr-2007 02:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | anglophilism.mp3 | 14-Apr-2007 02:29 | 17K | |
![[SND]](/icons/sound2.gif) | anglomaniacal.mp3 | 14-Apr-2007 02:29 | 17K | |
![[SND]](/icons/sound2.gif) | anglistics.mp3 | 14-Apr-2007 02:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | angling.mp3 | 14-Apr-2007 02:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | anglify.mp3 | 14-Apr-2007 02:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | anglification.mp3 | 14-Apr-2007 02:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | anglicize.mp3 | 14-Apr-2007 02:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | anglicization.mp3 | 14-Apr-2007 02:28 | 11K | |
![[SND]](/icons/sound2.gif) | anglicism.mp3 | 14-Apr-2007 02:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | anglice.mp3 | 14-Apr-2007 02:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | anglicanly.mp3 | 14-Apr-2007 02:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | anglic.mp3 | 14-Apr-2007 02:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | angleworm.mp3 | 14-Apr-2007 02:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | anglesite.mp3 | 14-Apr-2007 02:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | anglesey.mp3 | 14-Apr-2007 02:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | anglerfish.mp3 | 14-Apr-2007 02:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | angler.mp3 | 14-Apr-2007 02:28 | 5.4K | |
![[SND]](/icons/sound2.gif) | anglepoiselamp.mp3 | 14-Apr-2007 02:28 | 17K | |
![[SND]](/icons/sound2.gif) | anglepod.mp3 | 14-Apr-2007 02:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | angleoflead.mp3 | 14-Apr-2007 02:28 | 17K | |
![[SND]](/icons/sound2.gif) | angledozer.mp3 | 14-Apr-2007 02:28 | 17K | |
![[SND]](/icons/sound2.gif) | angled.mp3 | 14-Apr-2007 02:27 | 5.7K | |
![[SND]](/icons/sound2.gif) | angle.mp3 | 14-Apr-2007 02:27 | 5.2K | |
![[SND]](/icons/sound2.gif) | anglaise.mp3 | 14-Apr-2007 02:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | angkorwat.mp3 | 14-Apr-2007 02:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | angkorthom.mp3 | 14-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | angiya.mp3 | 14-Apr-2007 02:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | angiotribe.mp3 | 14-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | angiotensinase.mp3 | 14-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | angiotensin.mp3 | 14-Apr-2007 02:27 | 11K | |
![[SND]](/icons/sound2.gif) | angiospermous.mp3 | 14-Apr-2007 02:27 | 11K | |
![[SND]](/icons/sound2.gif) | angiosperm.mp3 | 14-Apr-2007 02:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | angioplasty.mp3 | 14-Apr-2007 02:27 | 11K | |
![[SND]](/icons/sound2.gif) | angiopathy.mp3 | 14-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | angiomatous.mp3 | 14-Apr-2007 02:27 | 10K | |
![[SND]](/icons/sound2.gif) | angioma.mp3 | 14-Apr-2007 02:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | angiology.mp3 | 14-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | angiography.mp3 | 14-Apr-2007 02:27 | 10K | |
![[SND]](/icons/sound2.gif) | angiographically.mp3 | 14-Apr-2007 02:27 | 12K | |
![[SND]](/icons/sound2.gif) | angiographic.mp3 | 14-Apr-2007 02:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | angiogram.mp3 | 14-Apr-2007 02:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | angiogenin.mp3 | 14-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | angiogenic.mp3 | 14-Apr-2007 02:27 | 9.3K | |
![[SND]](/icons/sound2.gif) | angiogenesis.mp3 | 14-Apr-2007 02:27 | 12K | |
![[SND]](/icons/sound2.gif) | angiocarpous.mp3 | 14-Apr-2007 02:27 | 17K | |
![[SND]](/icons/sound2.gif) | angiocarp.mp3 | 14-Apr-2007 02:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | angiocardiography.mp3 | 14-Apr-2007 02:26 | 16K | |
![[SND]](/icons/sound2.gif) | angiocardiographic.mp3 | 14-Apr-2007 02:26 | 14K | |
![[SND]](/icons/sound2.gif) | angioblastic.mp3 | 14-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | angioblast.mp3 | 14-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | angio.mp3 | 14-Apr-2007 02:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | anginapectoris.mp3 | 14-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | angina pectoris.mp3 | 14-Apr-2007 02:26 | 13K | |
![[SND]](/icons/sound2.gif) | anginal.mp3 | 14-Apr-2007 02:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | angina.mp3 | 14-Apr-2007 02:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | angiitis.mp3 | 14-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | angie.mp3 | 14-Apr-2007 02:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | angi.mp3 | 14-Apr-2007 02:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | angerona.mp3 | 14-Apr-2007 02:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | angerly.mp3 | 14-Apr-2007 02:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | angerless.mp3 | 14-Apr-2007 02:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | angering.mp3 | 14-Apr-2007 02:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | anger.mp3 | 14-Apr-2007 02:26 | 5.2K | |
![[SND]](/icons/sound2.gif) | angelussilesius.mp3 | 14-Apr-2007 02:26 | 17K | |
![[SND]](/icons/sound2.gif) | angelology.mp3 | 14-Apr-2007 02:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | angelologist.mp3 | 14-Apr-2007 02:26 | 11K | |
![[SND]](/icons/sound2.gif) | angelolatry.mp3 | 14-Apr-2007 02:25 | 17K | |
![[SND]](/icons/sound2.gif) | angelo.mp3 | 14-Apr-2007 02:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | angelique.mp3 | 14-Apr-2007 02:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | angelino.mp3 | 14-Apr-2007 02:25 | 17K | |
![[SND]](/icons/sound2.gif) | angelina.mp3 | 14-Apr-2007 02:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | angelican.mp3 | 14-Apr-2007 02:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | angelicalness.mp3 | 14-Apr-2007 02:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | angelically.mp3 | 14-Apr-2007 02:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | angelical.mp3 | 14-Apr-2007 02:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | angelica.mp3 | 14-Apr-2007 02:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | angelic.mp3 | 14-Apr-2007 02:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | angelfish.mp3 | 14-Apr-2007 02:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | angeles.mp3 | 14-Apr-2007 02:25 | 17K | |
![[SND]](/icons/sound2.gif) | angelamerici.mp3 | 14-Apr-2007 02:25 | 17K | |
![[SND]](/icons/sound2.gif) | angela.mp3 | 14-Apr-2007 02:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | angel.mp3 | 14-Apr-2007 02:25 | 5.2K | |
![[SND]](/icons/sound2.gif) | angel-hair pasta.mp3 | 14-Apr-2007 02:25 | 13K | |
![[SND]](/icons/sound2.gif) | angashore.mp3 | 14-Apr-2007 02:25 | 17K | |
![[SND]](/icons/sound2.gif) | angary.mp3 | 14-Apr-2007 02:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | angakok.mp3 | 14-Apr-2007 02:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | anga.mp3 | 14-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | anfractuous.mp3 | 14-Apr-2007 02:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | anfractuosity.mp3 | 14-Apr-2007 02:24 | 11K | |
![[SND]](/icons/sound2.gif) | anfinsen.mp3 | 14-Apr-2007 02:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | anfieldroad.mp3 | 14-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | anew.mp3 | 14-Apr-2007 02:24 | 5.2K | |
![[SND]](/icons/sound2.gif) | aneurysmal.mp3 | 14-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | aneurysm.mp3 | 14-Apr-2007 02:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | aneurismally.mp3 | 14-Apr-2007 02:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | aneurism.mp3 | 14-Apr-2007 02:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | aneurin.mp3 | 14-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | aneuric.mp3 | 14-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | aneuria.mp3 | 14-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | aneuploidy.mp3 | 14-Apr-2007 02:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | aneuploid.mp3 | 14-Apr-2007 02:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | aneuch.mp3 | 14-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | aneto.mp3 | 14-Apr-2007 02:24 | 17K | |
![[SND]](/icons/sound2.gif) | anethole.mp3 | 14-Apr-2007 02:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | anestrus.mp3 | 14-Apr-2007 02:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | anestrous.mp3 | 14-Apr-2007 02:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | anesthetize.mp3 | 14-Apr-2007 02:24 | 10K | |
![[SND]](/icons/sound2.gif) | anesthetization.mp3 | 14-Apr-2007 02:23 | 17K | |
![[SND]](/icons/sound2.gif) | anesthetist.mp3 | 14-Apr-2007 02:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | anesthetically.mp3 | 14-Apr-2007 02:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | anesthetic.mp3 | 14-Apr-2007 02:23 | 7.3K | |
![[SND]](/icons/sound2.gif) | anesthesiology.mp3 | 14-Apr-2007 02:23 | 12K | |
![[SND]](/icons/sound2.gif) | anesthesiologist.mp3 | 14-Apr-2007 02:23 | 14K | |
![[SND]](/icons/sound2.gif) | anesthesimeter.mp3 | 14-Apr-2007 02:23 | 17K | |
![[SND]](/icons/sound2.gif) | anesthesia.mp3 | 14-Apr-2007 02:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | anes.mp3 | 14-Apr-2007 02:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | aneroid.mp3 | 14-Apr-2007 02:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | anergy.mp3 | 14-Apr-2007 02:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | anergic.mp3 | 14-Apr-2007 02:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | anepigraphic.mp3 | 14-Apr-2007 02:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | anent.mp3 | 14-Apr-2007 02:23 | 5.4K | |
![[SND]](/icons/sound2.gif) | anenst.mp3 | 14-Apr-2007 02:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | anencephaly.mp3 | 14-Apr-2007 02:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | anencephalous.mp3 | 14-Apr-2007 02:23 | 17K | |
![[SND]](/icons/sound2.gif) | anencephalic.mp3 | 14-Apr-2007 02:23 | 10K | |
![[SND]](/icons/sound2.gif) | anemotropism.mp3 | 14-Apr-2007 02:23 | 17K | |
![[SND]](/icons/sound2.gif) | anemotropic.mp3 | 14-Apr-2007 02:23 | 17K | |
![[SND]](/icons/sound2.gif) | anemotaxis.mp3 | 14-Apr-2007 02:23 | 17K | |
![[SND]](/icons/sound2.gif) | anemosis.mp3 | 14-Apr-2007 02:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | anemoscope.mp3 | 14-Apr-2007 02:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | anemophily.mp3 | 14-Apr-2007 02:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | anemophilous.mp3 | 14-Apr-2007 02:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | anemone.mp3 | 14-Apr-2007 02:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | anemometry.mp3 | 14-Apr-2007 02:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | anemometrically.mp3 | 14-Apr-2007 02:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | anemometer.mp3 | 14-Apr-2007 02:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | anemology.mp3 | 14-Apr-2007 02:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | anemological.mp3 | 14-Apr-2007 02:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | anemography.mp3 | 14-Apr-2007 02:22 | 17K | |
![[SND]](/icons/sound2.gif) | anemographically.mp3 | 14-Apr-2007 02:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | anemograph.mp3 | 14-Apr-2007 02:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | anemogram.mp3 | 14-Apr-2007 02:22 | 17K | |
![[SND]](/icons/sound2.gif) | anemochorous.mp3 | 14-Apr-2007 02:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | anemochore.mp3 | 14-Apr-2007 02:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | anemo.mp3 | 14-Apr-2007 02:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | anemically.mp3 | 14-Apr-2007 02:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | anemic.mp3 | 14-Apr-2007 02:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | anemia.mp3 | 14-Apr-2007 02:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | anelectric.mp3 | 14-Apr-2007 02:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | anele.mp3 | 14-Apr-2007 02:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | anelasticity.mp3 | 14-Apr-2007 02:22 | 10K | |
![[SND]](/icons/sound2.gif) | anelastic.mp3 | 14-Apr-2007 02:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | anelace.mp3 | 14-Apr-2007 02:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | aneirin.mp3 | 14-Apr-2007 02:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | anectine.mp3 | 14-Apr-2007 02:22 | 17K | |
![[SND]](/icons/sound2.gif) | anechoic.mp3 | 14-Apr-2007 02:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | anecdysis.mp3 | 14-Apr-2007 02:22 | 17K | |
![[SND]](/icons/sound2.gif) | anecdotist.mp3 | 14-Apr-2007 02:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | anecdotically.mp3 | 14-Apr-2007 02:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | anecdotical.mp3 | 14-Apr-2007 02:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | anecdotic.mp3 | 14-Apr-2007 02:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | anecdote.mp3 | 14-Apr-2007 02:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | anecdotally.mp3 | 14-Apr-2007 02:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | anecdotalist.mp3 | 14-Apr-2007 02:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | anecdotalism.mp3 | 14-Apr-2007 02:21 | 10K | |
![[SND]](/icons/sound2.gif) | anecdotal.mp3 | 14-Apr-2007 02:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | anecdotage.mp3 | 14-Apr-2007 02:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | anecdota.mp3 | 14-Apr-2007 02:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | anear.mp3 | 14-Apr-2007 02:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | ane.mp3 | 14-Apr-2007 02:21 | 4.6K | |
![[SND]](/icons/sound2.gif) | andycapp.mp3 | 14-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | andy.mp3 | 14-Apr-2007 02:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | andvari.mp3 | 14-Apr-2007 02:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | and so on.mp3 | 14-Apr-2007 02:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | and so forth.mp3 | 14-Apr-2007 02:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | andry.mp3 | 14-Apr-2007 02:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | androus.mp3 | 14-Apr-2007 02:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | androuetducerceau.mp3 | 14-Apr-2007 02:21 | 18K | |
![[SND]](/icons/sound2.gif) | androsterone.mp3 | 14-Apr-2007 02:21 | 10K | |
![[SND]](/icons/sound2.gif) | androstenedione.mp3 | 14-Apr-2007 02:21 | 12K | |
![[SND]](/icons/sound2.gif) | androspore.mp3 | 14-Apr-2007 02:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | androsace.mp3 | 14-Apr-2007 02:21 | 17K | |
![[SND]](/icons/sound2.gif) | androphore.mp3 | 14-Apr-2007 02:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | androphobia.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | andron.mp3 | 14-Apr-2007 02:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | andromeda.mp3 | 14-Apr-2007 02:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | andrology.mp3 | 14-Apr-2007 02:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | andrologist.mp3 | 14-Apr-2007 02:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | android.mp3 | 14-Apr-2007 02:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | androgyny.mp3 | 14-Apr-2007 02:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | androgynous.mp3 | 14-Apr-2007 02:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | androgynophore.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | androgyne.mp3 | 14-Apr-2007 02:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | androgeus.mp3 | 14-Apr-2007 02:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | androgenize.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | androgenization.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | androgenic.mp3 | 14-Apr-2007 02:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | androgenetic.mp3 | 14-Apr-2007 02:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | androgenesis.mp3 | 14-Apr-2007 02:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | androgen.mp3 | 14-Apr-2007 02:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | androecium.mp3 | 14-Apr-2007 02:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | androecial.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | androecia.mp3 | 14-Apr-2007 02:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | androdioecism.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | androdioecious.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | androcratic.mp3 | 14-Apr-2007 02:20 | 17K | |
![[SND]](/icons/sound2.gif) | androcracy.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | androconium.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | androclinium.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | androcentrist.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | androcentrism.mp3 | 14-Apr-2007 02:19 | 11K | |
![[SND]](/icons/sound2.gif) | androcentric.mp3 | 14-Apr-2007 02:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | andro.mp3 | 14-Apr-2007 02:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | andriette.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | andrewes.mp3 | 14-Apr-2007 02:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | andrew.mp3 | 14-Apr-2007 02:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | andretti.mp3 | 14-Apr-2007 02:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | andrei.mp3 | 14-Apr-2007 02:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | andreas.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | andreanofislands.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | andreadelsarto.mp3 | 14-Apr-2007 02:19 | 17K | |
![[SND]](/icons/sound2.gif) | andrea.mp3 | 14-Apr-2007 02:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | andragogy.mp3 | 14-Apr-2007 02:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | andradite.mp3 | 14-Apr-2007 02:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | andradaesilva.mp3 | 14-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | andr.mp3 | 14-Apr-2007 02:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | andouillette.mp3 | 14-Apr-2007 02:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | andouille.mp3 | 14-Apr-2007 02:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | andor.mp3 | 14-Apr-2007 02:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | andong.mp3 | 14-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | andiron.mp3 | 14-Apr-2007 02:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | andikithira.mp3 | 14-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | andie.mp3 | 14-Apr-2007 02:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | andiamo.mp3 | 14-Apr-2007 02:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | andhrapradesh.mp3 | 14-Apr-2007 02:18 | 17K | |
![[SND]](/icons/sound2.gif) | andesitic.mp3 | 14-Apr-2007 02:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | andesite.mp3 | 14-Apr-2007 02:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | andesine.mp3 | 14-Apr-2007 02:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | andersonville.mp3 | 14-Apr-2007 02:17 | 17K | |
![[SND]](/icons/sound2.gif) | andersonfabrydisease.mp3 | 14-Apr-2007 02:17 | 27K | |
![[SND]](/icons/sound2.gif) | andcircuit.mp3 | 14-Apr-2007 02:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | andantino.mp3 | 14-Apr-2007 02:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | andante.mp3 | 14-Apr-2007 02:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | andamento.mp3 | 14-Apr-2007 02:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | andamanandnicobarislands.mp3 | 14-Apr-2007 02:17 | 27K | |
![[SND]](/icons/sound2.gif) | andaman.mp3 | 14-Apr-2007 02:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | andalusite.mp3 | 14-Apr-2007 02:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | and.mp3 | 14-Apr-2007 02:17 | 4.8K | |
![[SND]](/icons/sound2.gif) | and+so+forth.mp3 | 14-Apr-2007 02:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | ancylostomiasis.mp3 | 14-Apr-2007 02:16 | 14K | |
![[SND]](/icons/sound2.gif) | ancylostomiases.mp3 | 14-Apr-2007 02:16 | 14K | |
![[SND]](/icons/sound2.gif) | ancylo.mp3 | 14-Apr-2007 02:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | ancy.mp3 | 14-Apr-2007 02:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | ancusmarcius.mp3 | 14-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | ancress.mp3 | 14-Apr-2007 02:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | ancreneriwlethe.mp3 | 14-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | ancre.mp3 | 14-Apr-2007 02:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | anconoid.mp3 | 14-Apr-2007 02:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | ancon.mp3 | 14-Apr-2007 02:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | ancipital.mp3 | 14-Apr-2007 02:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | ancillary.mp3 | 14-Apr-2007 02:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | ancillae.mp3 | 14-Apr-2007 02:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | ancilla.mp3 | 14-Apr-2007 02:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | ancile.mp3 | 14-Apr-2007 02:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | ancientry.mp3 | 14-Apr-2007 02:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | ancientmysticorderrosaecrucis.mp3 | 14-Apr-2007 02:16 | 27K | |
![[SND]](/icons/sound2.gif) | ancient.mp3 | 14-Apr-2007 02:16 | 5.2K | |
![[SND]](/icons/sound2.gif) | ancienregime.mp3 | 14-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | ancien regime.mp3 | 14-Apr-2007 02:15 | 13K | |
![[SND]](/icons/sound2.gif) | anciennenoblesse.mp3 | 14-Apr-2007 02:16 | 17K | |
![[SND]](/icons/sound2.gif) | ancienne noblesse.mp3 | 14-Apr-2007 02:16 | 15K | |
![[SND]](/icons/sound2.gif) | anchylotic.mp3 | 14-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | anchylostomiasis.mp3 | 14-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | anchylosis.mp3 | 14-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | anchylose.mp3 | 14-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | anchylo.mp3 | 14-Apr-2007 02:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | anchyl.mp3 | 14-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | anchusin.mp3 | 14-Apr-2007 02:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | anchusa.mp3 | 14-Apr-2007 02:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | anchovy.mp3 | 14-Apr-2007 02:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | anchovetta.mp3 | 14-Apr-2007 02:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | anchoveta.mp3 | 14-Apr-2007 02:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | anchory.mp3 | 14-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | anchorwoman.mp3 | 14-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | anchorperson.mp3 | 14-Apr-2007 02:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | anchorpeople.mp3 | 14-Apr-2007 02:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | anchorman.mp3 | 14-Apr-2007 02:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | anchorlike.mp3 | 14-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | anchorless.mp3 | 14-Apr-2007 02:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | anchoritism.mp3 | 14-Apr-2007 02:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | anchoritically.mp3 | 14-Apr-2007 02:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | anchoritic.mp3 | 14-Apr-2007 02:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | anchorite.mp3 | 14-Apr-2007 02:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | anchoring.mp3 | 14-Apr-2007 02:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | anchorette.mp3 | 14-Apr-2007 02:15 | 17K | |
![[SND]](/icons/sound2.gif) | anchoretism.mp3 | 14-Apr-2007 02:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | anchoretic.mp3 | 14-Apr-2007 02:14 | 17K | |
![[SND]](/icons/sound2.gif) | anchoret.mp3 | 14-Apr-2007 02:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | anchoress.mp3 | 14-Apr-2007 02:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | anchored.mp3 | 14-Apr-2007 02:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | anchorage.mp3 | 14-Apr-2007 02:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | anchor.mp3 | 14-Apr-2007 02:14 | 5.0K | |
![[SND]](/icons/sound2.gif) | ancho.mp3 | 14-Apr-2007 02:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | anchithere.mp3 | 14-Apr-2007 02:14 | 17K | |
![[SND]](/icons/sound2.gif) | anching.mp3 | 14-Apr-2007 02:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | ancestry.mp3 | 14-Apr-2007 02:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | ancestress.mp3 | 14-Apr-2007 02:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | ancestrally.mp3 | 14-Apr-2007 02:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | ancestral.mp3 | 14-Apr-2007 02:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | ancestor.mp3 | 14-Apr-2007 02:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | ance.mp3 | 14-Apr-2007 02:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | ancaeus.mp3 | 14-Apr-2007 02:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | anbury.mp3 | 14-Apr-2007 02:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | anba.mp3 | 14-Apr-2007 02:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | anaximenes.mp3 | 14-Apr-2007 02:14 | 17K | |
![[SND]](/icons/sound2.gif) | anax.mp3 | 14-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | anatto.mp3 | 14-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | anatta.mp3 | 14-Apr-2007 02:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | anatropous.mp3 | 14-Apr-2007 02:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | anatriptic.mp3 | 14-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | anatripsis.mp3 | 14-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | anatoxin.mp3 | 14-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | anatomy.mp3 | 14-Apr-2007 02:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | anatomizer.mp3 | 14-Apr-2007 02:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | anatomize.mp3 | 14-Apr-2007 02:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | anatomist.mp3 | 14-Apr-2007 02:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | anatomico.mp3 | 14-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | anatomically.mp3 | 14-Apr-2007 02:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | anatomical.mp3 | 14-Apr-2007 02:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | anatomic.mp3 | 14-Apr-2007 02:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | anatol.mp3 | 14-Apr-2007 02:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | anatman.mp3 | 14-Apr-2007 02:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | anatine.mp3 | 14-Apr-2007 02:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | anathematizer.mp3 | 14-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | anathematize.mp3 | 14-Apr-2007 02:13 | 10K | |
![[SND]](/icons/sound2.gif) | anathematically.mp3 | 14-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | anathematic.mp3 | 14-Apr-2007 02:13 | 17K | |
![[SND]](/icons/sound2.gif) | anathema.mp3 | 14-Apr-2007 02:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | anatexis.mp3 | 14-Apr-2007 02:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | anatase.mp3 | 14-Apr-2007 02:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | anatabine.mp3 | 14-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | anastylosis.mp3 | 14-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | anastrophe.mp3 | 14-Apr-2007 02:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | anastomotic.mp3 | 14-Apr-2007 02:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | anastomosis.mp3 | 14-Apr-2007 02:12 | 11K | |
![[SND]](/icons/sound2.gif) | anastomoses.mp3 | 14-Apr-2007 02:12 | 11K | |
![[SND]](/icons/sound2.gif) | anastomose.mp3 | 14-Apr-2007 02:12 | 9.3K | |
![[SND]](/icons/sound2.gif) | anastigmatic.mp3 | 14-Apr-2007 02:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | anastigmat.mp3 | 14-Apr-2007 02:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | anastatic.mp3 | 14-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | anastasiusi.mp3 | 14-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | anastasis.mp3 | 14-Apr-2007 02:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | anastasia.mp3 | 14-Apr-2007 02:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | anaspid.mp3 | 14-Apr-2007 02:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | anaseism.mp3 | 14-Apr-2007 02:12 | 17K | |
![[SND]](/icons/sound2.gif) | anasarcous.mp3 | 14-Apr-2007 02:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | anasarca.mp3 | 14-Apr-2007 02:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | anarthrousness.mp3 | 14-Apr-2007 02:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | anarthrous.mp3 | 14-Apr-2007 02:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | anarthric.mp3 | 14-Apr-2007 02:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | anarthria.mp3 | 14-Apr-2007 02:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | anarchy.mp3 | 14-Apr-2007 02:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | anarchosyndicalist.mp3 | 14-Apr-2007 02:11 | 17K | |
![[SND]](/icons/sound2.gif) | anarchosyndicalism.mp3 | 14-Apr-2007 02:11 | 17K | |
![[SND]](/icons/sound2.gif) | anarcho.mp3 | 14-Apr-2007 02:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | anarcho-syndicalist.mp3 | 14-Apr-2007 02:11 | 14K | |
![[SND]](/icons/sound2.gif) | anarcho-syndicalism.mp3 | 14-Apr-2007 02:11 | 14K | |
![[SND]](/icons/sound2.gif) | anarchistic.mp3 | 14-Apr-2007 02:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | anarchist.mp3 | 14-Apr-2007 02:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | anarchism.mp3 | 14-Apr-2007 02:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | anarchically.mp3 | 14-Apr-2007 02:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | anarchical.mp3 | 14-Apr-2007 02:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | anarchic.mp3 | 14-Apr-2007 02:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | anarch.mp3 | 14-Apr-2007 02:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | anapurna.mp3 | 14-Apr-2007 02:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | anaptyxis.mp3 | 14-Apr-2007 02:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | anaptyctical.mp3 | 14-Apr-2007 02:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | anaptotic.mp3 | 14-Apr-2007 02:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | anapsid.mp3 | 14-Apr-2007 02:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | anapophysis.mp3 | 14-Apr-2007 02:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | anapophysial.mp3 | 14-Apr-2007 02:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | anaplasty.mp3 | 14-Apr-2007 02:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | anaplastic.mp3 | 14-Apr-2007 02:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | anaplasmosis.mp3 | 14-Apr-2007 02:11 | 11K | |
![[SND]](/icons/sound2.gif) | anaplasmoses.mp3 | 14-Apr-2007 02:11 | 11K | |
![[SND]](/icons/sound2.gif) | anaplasia.mp3 | 14-Apr-2007 02:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | anaphylaxis.mp3 | 14-Apr-2007 02:11 | 10K | |
![[SND]](/icons/sound2.gif) | anaphylaxes.mp3 | 14-Apr-2007 02:10 | 10K | |
![[SND]](/icons/sound2.gif) | anaphylactoid.mp3 | 14-Apr-2007 02:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | anaphylactically.mp3 | 14-Apr-2007 02:10 | 10K | |
![[SND]](/icons/sound2.gif) | anaphylactic.mp3 | 14-Apr-2007 02:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | anaphrodisiac.mp3 | 14-Apr-2007 02:10 | 12K | |
![[SND]](/icons/sound2.gif) | anaphrodisia.mp3 | 14-Apr-2007 02:10 | 17K | |
![[SND]](/icons/sound2.gif) | anaphorically.mp3 | 14-Apr-2007 02:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | anaphoric.mp3 | 14-Apr-2007 02:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | anaphoresis.mp3 | 14-Apr-2007 02:10 | 17K | |
![[SND]](/icons/sound2.gif) | anaphoral.mp3 | 14-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | anaphora.mp3 | 14-Apr-2007 02:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | anaphor.mp3 | 14-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | anaphasic.mp3 | 14-Apr-2007 02:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | anaphase.mp3 | 14-Apr-2007 02:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | anapestic.mp3 | 14-Apr-2007 02:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | anapest.mp3 | 14-Apr-2007 02:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | anapaestically.mp3 | 14-Apr-2007 02:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | ananym.mp3 | 14-Apr-2007 02:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | ananthous.mp3 | 14-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | ananke.mp3 | 14-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | anankasticpersonality.mp3 | 14-Apr-2007 02:10 | 18K | |
![[SND]](/icons/sound2.gif) | anandrous.mp3 | 14-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | anandamide.mp3 | 14-Apr-2007 02:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | ananda.mp3 | 14-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | ananas.mp3 | 14-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | anamorphosis.mp3 | 14-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | anamorphoscope.mp3 | 14-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | anamorphism.mp3 | 14-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | anamorphic.mp3 | 14-Apr-2007 02:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | anamniotic.mp3 | 14-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | anamniote.mp3 | 14-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | anamnestically.mp3 | 14-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | anamnestic.mp3 | 14-Apr-2007 02:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | anamnesis.mp3 | 14-Apr-2007 02:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | anamneses.mp3 | 14-Apr-2007 02:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | anammelech.mp3 | 14-Apr-2007 02:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | anambra.mp3 | 14-Apr-2007 02:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | anam.mp3 | 14-Apr-2007 02:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | analyzer.mp3 | 14-Apr-2007 02:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | analyzedrhyme.mp3 | 14-Apr-2007 02:09 | 17K | |
![[SND]](/icons/sound2.gif) | analyze.mp3 | 14-Apr-2007 02:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | analyzation.mp3 | 14-Apr-2007 02:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | analyzable.mp3 | 14-Apr-2007 02:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | analyzability.mp3 | 14-Apr-2007 02:09 | 9.8K | |
![[SND]](/icons/sound2.gif) | analytique.mp3 | 14-Apr-2007 02:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | analytics.mp3 | 14-Apr-2007 02:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | analyticity.mp3 | 14-Apr-2007 02:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | analytically.mp3 | 14-Apr-2007 02:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | analytical.mp3 | 14-Apr-2007 02:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | analytic.mp3 | 14-Apr-2007 02:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | analyte.mp3 | 14-Apr-2007 02:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | analyst.mp3 | 14-Apr-2007 02:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | analysis situs.mp3 | 14-Apr-2007 02:08 | 12K | |
![[SND]](/icons/sound2.gif) | analysis.mp3 | 14-Apr-2007 02:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | analyses.mp3 | 14-Apr-2007 02:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | analyse.mp3 | 14-Apr-2007 02:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | analysand.mp3 | 14-Apr-2007 02:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | analphabetism.mp3 | 14-Apr-2007 02:08 | 11K | |
![[SND]](/icons/sound2.gif) | analphabetically.mp3 | 14-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | analphabetic.mp3 | 14-Apr-2007 02:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | analphabet.mp3 | 14-Apr-2007 02:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | analogy.mp3 | 14-Apr-2007 02:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | analogue.mp3 | 14-Apr-2007 02:08 | 5.7K | |
![[SND]](/icons/sound2.gif) | analogousness.mp3 | 14-Apr-2007 02:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | analogous.mp3 | 14-Apr-2007 02:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | analogize.mp3 | 14-Apr-2007 02:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | analogistic.mp3 | 14-Apr-2007 02:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | analogist.mp3 | 14-Apr-2007 02:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | analogism.mp3 | 14-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | analogion.mp3 | 14-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | analogicalness.mp3 | 14-Apr-2007 02:08 | 17K | |
![[SND]](/icons/sound2.gif) | analogically.mp3 | 14-Apr-2007 02:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | analogical.mp3 | 14-Apr-2007 02:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | analogic.mp3 | 14-Apr-2007 02:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | analog.mp3 | 14-Apr-2007 02:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | anally.mp3 | 14-Apr-2007 02:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | anality.mp3 | 14-Apr-2007 02:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | analingus.mp3 | 14-Apr-2007 02:07 | 17K | |
![[SND]](/icons/sound2.gif) | analinguist.mp3 | 14-Apr-2007 02:07 | 17K | |
![[SND]](/icons/sound2.gif) | analgesic.mp3 | 14-Apr-2007 02:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | analgesia.mp3 | 14-Apr-2007 02:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | analeptic.mp3 | 14-Apr-2007 02:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | analemmatic.mp3 | 14-Apr-2007 02:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | analemma.mp3 | 14-Apr-2007 02:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | analects.mp3 | 14-Apr-2007 02:07 | 6.4K | |
![[SND]](/icons/sound2.gif) | analectic.mp3 | 14-Apr-2007 02:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | analecta.mp3 | 14-Apr-2007 02:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | analcite.mp3 | 14-Apr-2007 02:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | analcime.mp3 | 14-Apr-2007 02:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | anal.mp3 | 14-Apr-2007 02:07 | 4.1K | |
![[SND]](/icons/sound2.gif) | anal-retentive.mp3 | 14-Apr-2007 02:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | anakim.mp3 | 14-Apr-2007 02:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | anagrammatize.mp3 | 14-Apr-2007 02:07 | 10K | |
![[SND]](/icons/sound2.gif) | anagrammatization.mp3 | 14-Apr-2007 02:07 | 12K | |
![[SND]](/icons/sound2.gif) | anagrammatist.mp3 | 14-Apr-2007 02:07 | 17K | |
![[SND]](/icons/sound2.gif) | anagrammatically.mp3 | 14-Apr-2007 02:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | anagrammatical.mp3 | 14-Apr-2007 02:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | anagrammatic.mp3 | 14-Apr-2007 02:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | anagram.mp3 | 14-Apr-2007 02:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | anagogy.mp3 | 14-Apr-2007 02:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | anagogically.mp3 | 14-Apr-2007 02:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | anagogical.mp3 | 14-Apr-2007 02:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | anagogic.mp3 | 14-Apr-2007 02:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | anagoge.mp3 | 14-Apr-2007 02:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | anagnorisis.mp3 | 14-Apr-2007 02:06 | 11K | |
![[SND]](/icons/sound2.gif) | anagnorises.mp3 | 14-Apr-2007 02:06 | 12K | |
![[SND]](/icons/sound2.gif) | anaglypta.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaglyphy.mp3 | 14-Apr-2007 02:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | anaglyphoscope.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaglyphic.mp3 | 14-Apr-2007 02:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | anaglyph.mp3 | 14-Apr-2007 02:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | anagenetical.mp3 | 14-Apr-2007 02:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | anagenesis.mp3 | 14-Apr-2007 02:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | anaesthetize.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaesthetization.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaesthetist.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaesthetics.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaesthesiology.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaesthesiologist.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaesthesia.mp3 | 14-Apr-2007 02:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | anaerobium.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaerobiotically.mp3 | 14-Apr-2007 02:06 | 17K | |
![[SND]](/icons/sound2.gif) | anaerobiosis.mp3 | 14-Apr-2007 02:06 | 11K | |
![[SND]](/icons/sound2.gif) | anaerobioses.mp3 | 14-Apr-2007 02:05 | 11K | |
![[SND]](/icons/sound2.gif) | anaerobiont.mp3 | 14-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | anaerobically.mp3 | 14-Apr-2007 02:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | anaerobic.mp3 | 14-Apr-2007 02:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | anaerobe.mp3 | 14-Apr-2007 02:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | anaemic.mp3 | 14-Apr-2007 02:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | anaemia.mp3 | 14-Apr-2007 02:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | anadyomene.mp3 | 14-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | anadromous.mp3 | 14-Apr-2007 02:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | anadiplosis.mp3 | 14-Apr-2007 02:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | anadiploses.mp3 | 14-Apr-2007 02:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | anadin.mp3 | 14-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | anadenia.mp3 | 14-Apr-2007 02:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | anadem.mp3 | 14-Apr-2007 02:05 | 5.9K | |
![[SND]](/icons/sound2.gif) | anadamabread.mp3 | 14-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | anadama bread.mp3 | 14-Apr-2007 02:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | anacusis.mp3 | 14-Apr-2007 02:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | anacusic.mp3 | 14-Apr-2007 02:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | anacrustically.mp3 | 14-Apr-2007 02:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | anacrusis.mp3 | 14-Apr-2007 02:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | anacruses.mp3 | 14-Apr-2007 02:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | anacrogynous.mp3 | 14-Apr-2007 02:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | anacreontically.mp3 | 14-Apr-2007 02:05 | 17K | |
![[SND]](/icons/sound2.gif) | anacreontic.mp3 | 14-Apr-2007 02:05 | 10K | |
![[SND]](/icons/sound2.gif) | anacoustic.mp3 | 14-Apr-2007 02:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | anaconda.mp3 | 14-Apr-2007 02:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | anacoluthon.mp3 | 14-Apr-2007 02:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | anacoluthically.mp3 | 14-Apr-2007 02:04 | 9.8K | |
![[SND]](/icons/sound2.gif) | anacoluthic.mp3 | 14-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | anacoluthia.mp3 | 14-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | anacolutha.mp3 | 14-Apr-2007 02:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | anacoenosis.mp3 | 14-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | anaclitic.mp3 | 14-Apr-2007 02:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | anaclisis.mp3 | 14-Apr-2007 02:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | anaclinal.mp3 | 14-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | anacletus.mp3 | 14-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | anaclastic.mp3 | 14-Apr-2007 02:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | anacin.mp3 | 14-Apr-2007 02:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | anacidity.mp3 | 14-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | anachronously.mp3 | 14-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | anachronous.mp3 | 14-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | anachronistically.mp3 | 14-Apr-2007 02:04 | 10K | |
![[SND]](/icons/sound2.gif) | anachronistic.mp3 | 14-Apr-2007 02:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | anachronism.mp3 | 14-Apr-2007 02:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | anachronically.mp3 | 14-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | anachronic.mp3 | 14-Apr-2007 02:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | anachorism.mp3 | 14-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | anacharis.mp3 | 14-Apr-2007 02:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | anacardiaceous.mp3 | 14-Apr-2007 02:04 | 17K | |
![[SND]](/icons/sound2.gif) | anacanthous.mp3 | 14-Apr-2007 02:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | anabranch.mp3 | 14-Apr-2007 02:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | anabolitic.mp3 | 14-Apr-2007 02:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | anabolite.mp3 | 14-Apr-2007 02:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | anabolism.mp3 | 14-Apr-2007 02:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | anabolicsteroid.mp3 | 14-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | anabolic.mp3 | 14-Apr-2007 02:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | anableps.mp3 | 14-Apr-2007 02:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | anabiotic.mp3 | 14-Apr-2007 02:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | anabiosis.mp3 | 14-Apr-2007 02:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | anabatic.mp3 | 14-Apr-2007 02:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | anabasis.mp3 | 14-Apr-2007 02:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | anabasine.mp3 | 14-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | anabases.mp3 | 14-Apr-2007 02:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | anabas.mp3 | 14-Apr-2007 02:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | anabaptistically.mp3 | 14-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | anabaptism.mp3 | 14-Apr-2007 02:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | anabantid.mp3 | 14-Apr-2007 02:03 | 17K | |
![[SND]](/icons/sound2.gif) | anabaena.mp3 | 14-Apr-2007 02:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | ana.mp3 | 14-Apr-2007 02:03 | 4.3K | |
![[SND]](/icons/sound2.gif) | an.mp3 | 14-Apr-2007 02:03 | 4.6K | |
![[SND]](/icons/sound2.gif) | an'.mp3 | 14-Apr-2007 02:03 | 4.8K | |
![[SND]](/icons/sound2.gif) | amyxorrhea.mp3 | 14-Apr-2007 02:02 | 17K | |
![[SND]](/icons/sound2.gif) | amyotrophiclateralsclerosis.mp3 | 14-Apr-2007 02:02 | 27K | |
![[SND]](/icons/sound2.gif) | amyotrophic lateral sclerosis.mp3 | 14-Apr-2007 02:02 | 20K | |
![[SND]](/icons/sound2.gif) | amyotonia.mp3 | 14-Apr-2007 02:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | amylum.mp3 | 14-Apr-2007 02:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | amylose.mp3 | 14-Apr-2007 02:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | amylopsin.mp3 | 14-Apr-2007 02:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | amyloplast.mp3 | 14-Apr-2007 02:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | amylopectin.mp3 | 14-Apr-2007 02:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | amylolytic.mp3 | 14-Apr-2007 02:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | amylolysis.mp3 | 14-Apr-2007 02:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | amyloidosis.mp3 | 14-Apr-2007 02:02 | 10K | |
![[SND]](/icons/sound2.gif) | amyloid.mp3 | 14-Apr-2007 02:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | amylogen.mp3 | 14-Apr-2007 02:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | amylo.mp3 | 14-Apr-2007 02:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | amylene.mp3 | 14-Apr-2007 02:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | amylase.mp3 | 14-Apr-2007 02:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | amylaceous.mp3 | 14-Apr-2007 02:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | amyl.mp3 | 14-Apr-2007 02:02 | 3.9K | |
![[SND]](/icons/sound2.gif) | amygdule.mp3 | 14-Apr-2007 02:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | amygdalotomy.mp3 | 14-Apr-2007 02:02 | 17K | |
![[SND]](/icons/sound2.gif) | amygdaloidal.mp3 | 14-Apr-2007 02:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | amygdaloid.mp3 | 14-Apr-2007 02:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | amygdaline.mp3 | 14-Apr-2007 02:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | amygdalin.mp3 | 14-Apr-2007 02:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | amygdaliform.mp3 | 14-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | amygdalic.mp3 | 14-Apr-2007 02:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | amygdale.mp3 | 14-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | amygdalate.mp3 | 14-Apr-2007 02:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | amygdalae.mp3 | 14-Apr-2007 02:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | amygdalaceous.mp3 | 14-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | amygdala.mp3 | 14-Apr-2007 02:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | amyelous.mp3 | 14-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | amyelia.mp3 | 14-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | amyatonic.mp3 | 14-Apr-2007 02:01 | 17K | |
![[SND]](/icons/sound2.gif) | amy.mp3 | 14-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | amvets.mp3 | 14-Apr-2007 02:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | amusiveness.mp3 | 14-Apr-2007 02:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | amusive.mp3 | 14-Apr-2007 02:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | amusingness.mp3 | 14-Apr-2007 02:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | amusingly.mp3 | 14-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | amusing.mp3 | 14-Apr-2007 02:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | amusia.mp3 | 14-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | amuser.mp3 | 14-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | amusement.mp3 | 14-Apr-2007 02:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | amusedly.mp3 | 14-Apr-2007 02:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | amused.mp3 | 14-Apr-2007 02:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | amuse.mp3 | 14-Apr-2007 02:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | amuse-bouche.mp3 | 14-Apr-2007 02:01 | 12K | |
![[SND]](/icons/sound2.gif) | amurca.mp3 | 14-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | amun.mp3 | 14-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | amulius.mp3 | 14-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | amulet.mp3 | 14-Apr-2007 02:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | amugis.mp3 | 14-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | amudarya.mp3 | 14-Apr-2007 02:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | amud.mp3 | 14-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | amuck.mp3 | 14-Apr-2007 02:00 | 4.6K | |
![[SND]](/icons/sound2.gif) | amu.mp3 | 14-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | amtrak.mp3 | 14-Apr-2007 02:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | amtrack.mp3 | 14-Apr-2007 02:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | amtrac.mp3 | 14-Apr-2007 02:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | amt.mp3 | 14-Apr-2007 02:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | amster.mp3 | 14-Apr-2007 02:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | amscray.mp3 | 14-Apr-2007 02:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | amscram.mp3 | 14-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | amrobank.mp3 | 14-Apr-2007 02:00 | 17K | |
![[SND]](/icons/sound2.gif) | amrita.mp3 | 14-Apr-2007 01:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | amrinone.mp3 | 14-Apr-2007 01:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | amri.mp3 | 14-Apr-2007 01:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | amratian.mp3 | 14-Apr-2007 01:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | amram.mp3 | 14-Apr-2007 01:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | amputee.mp3 | 14-Apr-2007 01:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | amputative.mp3 | 14-Apr-2007 01:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | amputation.mp3 | 14-Apr-2007 01:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | amputate.mp3 | 14-Apr-2007 01:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | ampullula.mp3 | 14-Apr-2007 01:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | ampullary.mp3 | 14-Apr-2007 01:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | ampullaoflorenzini.mp3 | 14-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | ampulla of Lorenzini.mp3 | 14-Apr-2007 01:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | ampullae.mp3 | 14-Apr-2007 01:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | ampullaceous.mp3 | 14-Apr-2007 01:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | ampulla.mp3 | 14-Apr-2007 01:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | ampule.mp3 | 14-Apr-2007 01:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | amply.mp3 | 14-Apr-2007 01:59 | 5.2K | |
![[SND]](/icons/sound2.gif) | amplitude.mp3 | 14-Apr-2007 01:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | amplify.mp3 | 14-Apr-2007 01:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | amplifier.mp3 | 14-Apr-2007 01:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | amplificatory.mp3 | 14-Apr-2007 01:59 | 17K | |
![[SND]](/icons/sound2.gif) | amplification.mp3 | 14-Apr-2007 01:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | amplifiable.mp3 | 14-Apr-2007 01:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | amplidyne.mp3 | 14-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | ampliative.mp3 | 14-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | ampliation.mp3 | 14-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | ampliate.mp3 | 14-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | amplexus.mp3 | 14-Apr-2007 01:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | amplexifoliate.mp3 | 14-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | amplexicaul.mp3 | 14-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | amplest.mp3 | 14-Apr-2007 01:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | ampler.mp3 | 14-Apr-2007 01:58 | 5.0K | |
![[SND]](/icons/sound2.gif) | ampleness.mp3 | 14-Apr-2007 01:58 | 6.8K | |
![[SND]](/icons/sound2.gif) | ample.mp3 | 14-Apr-2007 01:58 | 4.1K | |
![[SND]](/icons/sound2.gif) | ampicillin.mp3 | 14-Apr-2007 01:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | amphotericin B.mp3 | 14-Apr-2007 01:58 | 13K | |
![[SND]](/icons/sound2.gif) | amphotericin.mp3 | 14-Apr-2007 01:58 | 17K | |
![[SND]](/icons/sound2.gif) | amphoteric.mp3 | 14-Apr-2007 01:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | amphoriskos.mp3 | 14-Apr-2007 01:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphoricity.mp3 | 14-Apr-2007 01:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | amphoric.mp3 | 14-Apr-2007 01:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | amphoral.mp3 | 14-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | amphorae.mp3 | 14-Apr-2007 01:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | amphora.mp3 | 14-Apr-2007 01:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | ampholytic.mp3 | 14-Apr-2007 01:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | ampholyte.mp3 | 14-Apr-2007 01:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | amphogeny.mp3 | 14-Apr-2007 01:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphogenic.mp3 | 14-Apr-2007 01:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphiuma.mp3 | 14-Apr-2007 01:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | amphitropous.mp3 | 14-Apr-2007 01:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | amphitrite.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphitrichate.mp3 | 14-Apr-2007 01:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | amphithyron.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphithyra.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphithuron.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphithemis.mp3 | 14-Apr-2007 01:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphithecium.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphithecial.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphitheatrically.mp3 | 14-Apr-2007 01:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | amphitheatrical.mp3 | 14-Apr-2007 01:57 | 11K | |
![[SND]](/icons/sound2.gif) | amphitheatric.mp3 | 14-Apr-2007 01:57 | 10K | |
![[SND]](/icons/sound2.gif) | amphitheater.mp3 | 14-Apr-2007 01:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | amphithalamus.mp3 | 14-Apr-2007 01:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | amphistylar.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphiscians.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphisbaenous.mp3 | 14-Apr-2007 01:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | amphisbaenic.mp3 | 14-Apr-2007 01:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | amphisbaena.mp3 | 14-Apr-2007 01:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | amphiprotic.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphiprostyle.mp3 | 14-Apr-2007 01:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | amphiprostylar.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphipodous.mp3 | 14-Apr-2007 01:57 | 17K | |
![[SND]](/icons/sound2.gif) | amphipod.mp3 | 14-Apr-2007 01:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | amphiploidy.mp3 | 14-Apr-2007 01:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | amphiploid.mp3 | 14-Apr-2007 01:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | amphiphilic.mp3 | 14-Apr-2007 01:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | amphiphile.mp3 | 14-Apr-2007 01:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | amphipathic.mp3 | 14-Apr-2007 01:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | amphioxus.mp3 | 14-Apr-2007 01:56 | 9.6K | |
![[SND]](/icons/sound2.gif) | amphioxi.mp3 | 14-Apr-2007 01:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | amphimixis.mp3 | 14-Apr-2007 01:56 | 9.3K | |
![[SND]](/icons/sound2.gif) | amphimixes.mp3 | 14-Apr-2007 01:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | amphimictically.mp3 | 14-Apr-2007 01:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphimacer.mp3 | 14-Apr-2007 01:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | amphilochus.mp3 | 14-Apr-2007 01:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphikaryotic.mp3 | 14-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | amphikaryon.mp3 | 14-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | amphigouri.mp3 | 14-Apr-2007 01:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | amphigory.mp3 | 14-Apr-2007 01:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | amphigoric.mp3 | 14-Apr-2007 01:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | amphigenously.mp3 | 14-Apr-2007 01:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphigenous.mp3 | 14-Apr-2007 01:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphigamous.mp3 | 14-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | amphidromicpoint.mp3 | 14-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | amphidromia.mp3 | 14-Apr-2007 01:56 | 17K | |
![[SND]](/icons/sound2.gif) | amphidiploidy.mp3 | 14-Apr-2007 01:55 | 10K | |
![[SND]](/icons/sound2.gif) | amphidiploid.mp3 | 14-Apr-2007 01:55 | 10K | |
![[SND]](/icons/sound2.gif) | amphictyony.mp3 | 14-Apr-2007 01:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | amphictyonic.mp3 | 14-Apr-2007 01:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | amphictyon.mp3 | 14-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | amphichroic.mp3 | 14-Apr-2007 01:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphicelous.mp3 | 14-Apr-2007 01:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | amphicarpous.mp3 | 14-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | amphibrachic.mp3 | 14-Apr-2007 01:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | amphibrach.mp3 | 14-Apr-2007 01:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | amphiboly.mp3 | 14-Apr-2007 01:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | amphibolous.mp3 | 14-Apr-2007 01:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | amphibology.mp3 | 14-Apr-2007 01:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | amphibologically.mp3 | 14-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | amphibolitic.mp3 | 14-Apr-2007 01:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphibolite.mp3 | 14-Apr-2007 01:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | amphibolic.mp3 | 14-Apr-2007 01:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphibole.mp3 | 14-Apr-2007 01:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | amphibiousness.mp3 | 14-Apr-2007 01:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | amphibious.mp3 | 14-Apr-2007 01:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | amphibiotic.mp3 | 14-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | amphibiology.mp3 | 14-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | amphibian.mp3 | 14-Apr-2007 01:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | amphibia.mp3 | 14-Apr-2007 01:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | amphiaster.mp3 | 14-Apr-2007 01:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | amphiarthrosis.mp3 | 14-Apr-2007 01:55 | 17K | |
![[SND]](/icons/sound2.gif) | amphiarthrodial.mp3 | 14-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | amphiaraus.mp3 | 14-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | amphi.mp3 | 14-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | amphetamine.mp3 | 14-Apr-2007 01:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | ampex.mp3 | 14-Apr-2007 01:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | ampersand.mp3 | 14-Apr-2007 01:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | amperometric.mp3 | 14-Apr-2007 01:54 | 11K | |
![[SND]](/icons/sound2.gif) | amperian.mp3 | 14-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | ampereslaw.mp3 | 14-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | ampere.mp3 | 14-Apr-2007 01:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | amperage.mp3 | 14-Apr-2007 01:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | amper.mp3 | 14-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | ampelos.mp3 | 14-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | ampelopsis.mp3 | 14-Apr-2007 01:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | amped.mp3 | 14-Apr-2007 01:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | amoxicillin.mp3 | 14-Apr-2007 01:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | amove.mp3 | 14-Apr-2007 01:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | amourpropre.mp3 | 14-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | amour propre.mp3 | 14-Apr-2007 01:54 | 11K | |
![[SND]](/icons/sound2.gif) | amourette.mp3 | 14-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | amour.mp3 | 14-Apr-2007 01:54 | 5.7K | |
![[SND]](/icons/sound2.gif) | amount.mp3 | 14-Apr-2007 01:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | amotivational.mp3 | 14-Apr-2007 01:54 | 17K | |
![[SND]](/icons/sound2.gif) | amotion.mp3 | 14-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | amosite.mp3 | 14-Apr-2007 01:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | amory.mp3 | 14-Apr-2007 01:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | amorvincitomnia.mp3 | 14-Apr-2007 01:53 | 27K | |
![[SND]](/icons/sound2.gif) | amor vincit omnia.mp3 | 14-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | amortizement.mp3 | 14-Apr-2007 01:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | amortize.mp3 | 14-Apr-2007 01:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | amortization.mp3 | 14-Apr-2007 01:53 | 9.8K | |
![[SND]](/icons/sound2.gif) | amortizable.mp3 | 14-Apr-2007 01:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | amort.mp3 | 14-Apr-2007 01:53 | 5.4K | |
![[SND]](/icons/sound2.gif) | amorphousness.mp3 | 14-Apr-2007 01:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | amorphous.mp3 | 14-Apr-2007 01:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | amorphism.mp3 | 14-Apr-2007 01:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | amorpatriae.mp3 | 14-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | amor patriae.mp3 | 14-Apr-2007 01:52 | 13K | |
![[SND]](/icons/sound2.gif) | amorous.mp3 | 14-Apr-2007 01:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | amoroso.mp3 | 14-Apr-2007 01:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | amorosity.mp3 | 14-Apr-2007 01:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | amoristic.mp3 | 14-Apr-2007 01:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | amorist.mp3 | 14-Apr-2007 01:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | amorino.mp3 | 14-Apr-2007 01:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | amoretto.mp3 | 14-Apr-2007 01:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | amoretti.mp3 | 14-Apr-2007 01:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | amorce.mp3 | 14-Apr-2007 01:53 | 17K | |
![[SND]](/icons/sound2.gif) | amorally.mp3 | 14-Apr-2007 01:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | amorality.mp3 | 14-Apr-2007 01:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | amoralism.mp3 | 14-Apr-2007 01:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | amoral.mp3 | 14-Apr-2007 01:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | amora.mp3 | 14-Apr-2007 01:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | amor.mp3 | 14-Apr-2007 01:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | amontillado.mp3 | 14-Apr-2007 01:52 | 10K | |
![[SND]](/icons/sound2.gif) | amonra.mp3 | 14-Apr-2007 01:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | amongst.mp3 | 14-Apr-2007 01:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | among.mp3 | 14-Apr-2007 01:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | amon.mp3 | 14-Apr-2007 01:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | amole.mp3 | 14-Apr-2007 01:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | amok.mp3 | 14-Apr-2007 01:52 | 4.6K | |
![[SND]](/icons/sound2.gif) | amoeboidism.mp3 | 14-Apr-2007 01:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | amoeboid.mp3 | 14-Apr-2007 01:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | amoebocyte.mp3 | 14-Apr-2007 01:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | amoebiform.mp3 | 14-Apr-2007 01:52 | 17K | |
![[SND]](/icons/sound2.gif) | amoebic.mp3 | 14-Apr-2007 01:52 | 5.7K | |
![[SND]](/icons/sound2.gif) | amoebiasis.mp3 | 14-Apr-2007 01:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | amoebaean.mp3 | 14-Apr-2007 01:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | amoebae.mp3 | 14-Apr-2007 01:52 | 5.7K | |
![[SND]](/icons/sound2.gif) | amoeba.mp3 | 14-Apr-2007 01:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | amoco.mp3 | 14-Apr-2007 01:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | amobarbital.mp3 | 14-Apr-2007 01:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | amnt.mp3 | 14-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | amniotic.mp3 | 14-Apr-2007 01:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | amniote.mp3 | 14-Apr-2007 01:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | amnioscopy.mp3 | 14-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | amnioscope.mp3 | 14-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | amnion.mp3 | 14-Apr-2007 01:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | amniography.mp3 | 14-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | amniocentesis.mp3 | 14-Apr-2007 01:51 | 13K | |
![[SND]](/icons/sound2.gif) | amniocenteses.mp3 | 14-Apr-2007 01:51 | 13K | |
![[SND]](/icons/sound2.gif) | amnio.mp3 | 14-Apr-2007 01:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | amnia.mp3 | 14-Apr-2007 01:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | amnesty.mp3 | 14-Apr-2007 01:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | amnestic.mp3 | 14-Apr-2007 01:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | amnesic.mp3 | 14-Apr-2007 01:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | amnesiac.mp3 | 14-Apr-2007 01:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | amnesia.mp3 | 14-Apr-2007 01:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | amn't.mp3 | 14-Apr-2007 01:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | ammunition.mp3 | 14-Apr-2007 01:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | ammophilous.mp3 | 14-Apr-2007 01:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | ammonotelism.mp3 | 14-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | ammonotelic.mp3 | 14-Apr-2007 01:51 | 17K | |
![[SND]](/icons/sound2.gif) | ammonolyze.mp3 | 14-Apr-2007 01:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | ammonolysis.mp3 | 14-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | ammonolitic.mp3 | 14-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | ammonoid.mp3 | 14-Apr-2007 01:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | ammono.mp3 | 14-Apr-2007 01:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | ammoniumpurpurate.mp3 | 14-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | ammonium.mp3 | 14-Apr-2007 01:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | ammonitoid.mp3 | 14-Apr-2007 01:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | ammonitish.mp3 | 14-Apr-2007 01:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | ammonitic.mp3 | 14-Apr-2007 01:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | ammonite.mp3 | 14-Apr-2007 01:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | ammonio.mp3 | 14-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | ammonify.mp3 | 14-Apr-2007 01:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | ammonifier.mp3 | 14-Apr-2007 01:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | ammonification.mp3 | 14-Apr-2007 01:50 | 10K | |
![[SND]](/icons/sound2.gif) | ammonical.mp3 | 14-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | ammonic.mp3 | 14-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | ammoniation.mp3 | 14-Apr-2007 01:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | ammoniate.mp3 | 14-Apr-2007 01:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | ammoniacal.mp3 | 14-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | ammoniac.mp3 | 14-Apr-2007 01:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | ammonia.mp3 | 14-Apr-2007 01:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | ammoni.mp3 | 14-Apr-2007 01:50 | 17K | |
![[SND]](/icons/sound2.gif) | ammonation.mp3 | 14-Apr-2007 01:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | ammonate.mp3 | 14-Apr-2007 01:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | ammoinal.mp3 | 14-Apr-2007 01:49 | 17K | |
![[SND]](/icons/sound2.gif) | ammocete.mp3 | 14-Apr-2007 01:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | ammo.mp3 | 14-Apr-2007 01:49 | 4.8K | |
![[SND]](/icons/sound2.gif) | ammishaddai.mp3 | 14-Apr-2007 01:49 | 17K | |
![[SND]](/icons/sound2.gif) | ammino.mp3 | 14-Apr-2007 01:49 | 27K | |
![[SND]](/icons/sound2.gif) | ammine.mp3 | 14-Apr-2007 01:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | ammianus.mp3 | 14-Apr-2007 01:49 | 17K | |
![[SND]](/icons/sound2.gif) | ammeter.mp3 | 14-Apr-2007 01:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | amityville.mp3 | 14-Apr-2007 01:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | amity.mp3 | 14-Apr-2007 01:49 | 5.5K | |
![[SND]](/icons/sound2.gif) | amittai.mp3 | 14-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | amitrole.mp3 | 14-Apr-2007 01:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | amitriptyline.mp3 | 14-Apr-2007 01:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | amitotically.mp3 | 14-Apr-2007 01:49 | 9.5K | |
![[SND]](/icons/sound2.gif) | amitotic.mp3 | 14-Apr-2007 01:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | amitosis.mp3 | 14-Apr-2007 01:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | amitate.mp3 | 14-Apr-2007 01:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | amitabha.mp3 | 14-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | amiss.mp3 | 14-Apr-2007 01:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | amirate.mp3 | 14-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | amir.mp3 | 14-Apr-2007 01:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | amiodarone.mp3 | 14-Apr-2007 01:48 | 17K | |
![[SND]](/icons/sound2.gif) | aminotransferase.mp3 | 14-Apr-2007 01:48 | 13K | |
![[SND]](/icons/sound2.gif) | aminosalicylic acid.mp3 | 14-Apr-2007 01:48 | 14K | |
![[SND]](/icons/sound2.gif) | aminopyrine.mp3 | 14-Apr-2007 01:48 | 11K | |
![[SND]](/icons/sound2.gif) | aminopterin.mp3 | 14-Apr-2007 01:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | aminoplast.mp3 | 14-Apr-2007 01:48 | 17K | |
![[SND]](/icons/sound2.gif) | aminophylline.mp3 | 14-Apr-2007 01:48 | 10K | |
![[SND]](/icons/sound2.gif) | aminopeptidase.mp3 | 14-Apr-2007 01:48 | 13K | |
![[SND]](/icons/sound2.gif) | aminoglutethimide.mp3 | 14-Apr-2007 01:48 | 17K | |
![[SND]](/icons/sound2.gif) | aminobenzoic acid.mp3 | 14-Apr-2007 01:48 | 14K | |
![[SND]](/icons/sound2.gif) | aminoaciduria.mp3 | 14-Apr-2007 01:48 | 13K | |
![[SND]](/icons/sound2.gif) | amino.mp3 | 14-Apr-2007 01:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | aminity.mp3 | 14-Apr-2007 01:48 | 27K | |
![[SND]](/icons/sound2.gif) | amine.mp3 | 14-Apr-2007 01:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | amination.mp3 | 14-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | aminate.mp3 | 14-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | aminase.mp3 | 14-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | aminah.mp3 | 14-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | amin.mp3 | 14-Apr-2007 01:48 | 17K | |
![[SND]](/icons/sound2.gif) | amimia.mp3 | 14-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | amiloride.mp3 | 14-Apr-2007 01:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | amikacin.mp3 | 14-Apr-2007 01:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | amigo.mp3 | 14-Apr-2007 01:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | amiga.mp3 | 14-Apr-2007 01:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | amies.mp3 | 14-Apr-2007 01:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | amie.mp3 | 14-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | amidst.mp3 | 14-Apr-2007 01:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | amidships.mp3 | 14-Apr-2007 01:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | amidone.mp3 | 14-Apr-2007 01:47 | 17K | |
![[SND]](/icons/sound2.gif) | amidol.mp3 | 14-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | amidogen.mp3 | 14-Apr-2007 01:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | amido.mp3 | 14-Apr-2007 01:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | amidinohydrazone.mp3 | 14-Apr-2007 01:47 | 17K | |
![[SND]](/icons/sound2.gif) | amidine.mp3 | 14-Apr-2007 01:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | amidin.mp3 | 14-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | amidic.mp3 | 14-Apr-2007 01:47 | 27K | |
![[SND]](/icons/sound2.gif) | ami de cour.mp3 | 14-Apr-2007 01:46 | 9.5K | |
![[SND]](/icons/sound2.gif) | amide.mp3 | 14-Apr-2007 01:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | amidation.mp3 | 14-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | amidate.mp3 | 14-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | amidase.mp3 | 14-Apr-2007 01:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | amidah.mp3 | 14-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | amida.mp3 | 14-Apr-2007 01:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | amid.mp3 | 14-Apr-2007 01:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | amicususqueadaras.mp3 | 14-Apr-2007 01:47 | 18K | |
![[SND]](/icons/sound2.gif) | amicus usque ad aras.mp3 | 14-Apr-2007 01:47 | 19K | |
![[SND]](/icons/sound2.gif) | amicushumanigeneris.mp3 | 14-Apr-2007 01:47 | 18K | |
![[SND]](/icons/sound2.gif) | amicus humani generis.mp3 | 14-Apr-2007 01:46 | 19K | |
![[SND]](/icons/sound2.gif) | amicuscuriae.mp3 | 14-Apr-2007 01:47 | 17K | |
![[SND]](/icons/sound2.gif) | amicus curiae.mp3 | 14-Apr-2007 01:46 | 12K | |
![[SND]](/icons/sound2.gif) | amicus.mp3 | 14-Apr-2007 01:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | amiciprism.mp3 | 14-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | amici.mp3 | 14-Apr-2007 01:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | amice.mp3 | 14-Apr-2007 01:46 | 5.5K | |
![[SND]](/icons/sound2.gif) | amicably.mp3 | 14-Apr-2007 01:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | amicableness.mp3 | 14-Apr-2007 01:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | amicable.mp3 | 14-Apr-2007 01:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | amicability.mp3 | 14-Apr-2007 01:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | amic.mp3 | 14-Apr-2007 01:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | amianthus.mp3 | 14-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | amianthoidal.mp3 | 14-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | amiably.mp3 | 14-Apr-2007 01:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | amiableness.mp3 | 14-Apr-2007 01:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | amiable.mp3 | 14-Apr-2007 01:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | amiability.mp3 | 14-Apr-2007 01:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | ami.mp3 | 14-Apr-2007 01:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | amfortas.mp3 | 14-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | amfm.mp3 | 14-Apr-2007 01:46 | 17K | |
![[SND]](/icons/sound2.gif) | amex.mp3 | 14-Apr-2007 01:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | ametropic.mp3 | 14-Apr-2007 01:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | ametropia.mp3 | 14-Apr-2007 01:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | amethystlike.mp3 | 14-Apr-2007 01:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | amethystine.mp3 | 14-Apr-2007 01:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | amethyst.mp3 | 14-Apr-2007 01:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | amethopterin.mp3 | 14-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | ametabolic.mp3 | 14-Apr-2007 01:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | ameshaspenta.mp3 | 14-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | amesace.mp3 | 14-Apr-2007 01:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | ameryiceshelf.mp3 | 14-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | a merveille.mp3 | 13-Apr-2007 22:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | ameroenglish.mp3 | 14-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | ameritech.mp3 | 14-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | ameristic.mp3 | 14-Apr-2007 01:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | amerism.mp3 | 14-Apr-2007 01:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | ameripass.mp3 | 14-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | amerindic.mp3 | 14-Apr-2007 01:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | amerika.mp3 | 14-Apr-2007 01:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | amerigovespucci.mp3 | 14-Apr-2007 01:45 | 17K | |
![[SND]](/icons/sound2.gif) | americium.mp3 | 14-Apr-2007 01:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | americanophobia.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americanophobe.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americanology.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americanologist.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americanological.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americanoid.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americano.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americanizer.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | americanistic.mp3 | 14-Apr-2007 01:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | amerenglish.mp3 | 14-Apr-2007 01:44 | 17K | |
![[SND]](/icons/sound2.gif) | amerciable.mp3 | 14-Apr-2007 01:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | amercer.mp3 | 14-Apr-2007 01:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | amercement.mp3 | 14-Apr-2007 01:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | amerce.mp3 | 14-Apr-2007 01:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | amentiferous.mp3 | 14-Apr-2007 01:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | amentia.mp3 | 14-Apr-2007 01:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | amentaceous.mp3 | 14-Apr-2007 01:43 | 17K | |
![[SND]](/icons/sound2.gif) | ament.mp3 | 14-Apr-2007 01:43 | 5.2K | |
![[SND]](/icons/sound2.gif) | amensalism.mp3 | 14-Apr-2007 01:43 | 17K | |
![[SND]](/icons/sound2.gif) | amensaetthoro.mp3 | 14-Apr-2007 01:43 | 17K | |
![[SND]](/icons/sound2.gif) | amenra.mp3 | 14-Apr-2007 01:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | amenorrhoeic.mp3 | 14-Apr-2007 01:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | amenorrheic.mp3 | 14-Apr-2007 01:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | amenorrhea.mp3 | 14-Apr-2007 01:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | amenity.mp3 | 14-Apr-2007 01:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | amenhotepiii.mp3 | 14-Apr-2007 01:43 | 17K | |
![[SND]](/icons/sound2.gif) | amends.mp3 | 14-Apr-2007 01:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | amendment.mp3 | 14-Apr-2007 01:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | amender.mp3 | 14-Apr-2007 01:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | amendehonorable.mp3 | 14-Apr-2007 01:43 | 17K | |
![[SND]](/icons/sound2.gif) | amendatory.mp3 | 14-Apr-2007 01:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | amendable.mp3 | 14-Apr-2007 01:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | amend.mp3 | 14-Apr-2007 01:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | amen corner.mp3 | 14-Apr-2007 01:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | amenably.mp3 | 14-Apr-2007 01:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | amenable.mp3 | 14-Apr-2007 01:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | amenability.mp3 | 14-Apr-2007 01:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | amen.mp3 | 14-Apr-2007 01:43 | 5.7K | |
![[SND]](/icons/sound2.gif) | amelogenesis.mp3 | 14-Apr-2007 01:42 | 17K | |
![[SND]](/icons/sound2.gif) | ameloblastic.mp3 | 14-Apr-2007 01:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | ameloblast.mp3 | 14-Apr-2007 01:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | amelioratory.mp3 | 14-Apr-2007 01:42 | 11K | |
![[SND]](/icons/sound2.gif) | ameliorator.mp3 | 14-Apr-2007 01:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | ameliorative.mp3 | 14-Apr-2007 01:42 | 11K | |
![[SND]](/icons/sound2.gif) | amelioration.mp3 | 14-Apr-2007 01:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | ameliorate.mp3 | 14-Apr-2007 01:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | ameliasedley.mp3 | 14-Apr-2007 01:42 | 17K | |
![[SND]](/icons/sound2.gif) | amelia.mp3 | 14-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | ameiotic.mp3 | 14-Apr-2007 01:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | ameiosis.mp3 | 14-Apr-2007 01:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | ameerate.mp3 | 14-Apr-2007 01:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | ameer.mp3 | 14-Apr-2007 01:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | amedas.mp3 | 14-Apr-2007 01:42 | 17K | |
![[SND]](/icons/sound2.gif) | amedamnee.mp3 | 14-Apr-2007 01:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | ameche.mp3 | 14-Apr-2007 01:42 | 17K | |
![[SND]](/icons/sound2.gif) | ameboidism.mp3 | 14-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | ameboid.mp3 | 14-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | amebocyte.mp3 | 14-Apr-2007 01:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | amebic dysentery.mp3 | 14-Apr-2007 01:42 | 13K | |
![[SND]](/icons/sound2.gif) | amebic.mp3 | 14-Apr-2007 01:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | amebiasis.mp3 | 14-Apr-2007 01:42 | 11K | |
![[SND]](/icons/sound2.gif) | amebiases.mp3 | 14-Apr-2007 01:42 | 11K | |
![[SND]](/icons/sound2.gif) | amebalike.mp3 | 14-Apr-2007 01:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | ameba.mp3 | 14-Apr-2007 01:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | ambystomid.mp3 | 14-Apr-2007 01:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambushment.mp3 | 14-Apr-2007 01:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | ambusher.mp3 | 14-Apr-2007 01:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | ambush.mp3 | 14-Apr-2007 01:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | ambuscado.mp3 | 14-Apr-2007 01:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | ambuscader.mp3 | 14-Apr-2007 01:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | ambuscade.mp3 | 14-Apr-2007 01:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | ambulette.mp3 | 14-Apr-2007 01:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | ambulatory.mp3 | 14-Apr-2007 01:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | ambulatorily.mp3 | 14-Apr-2007 01:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | ambulator.mp3 | 14-Apr-2007 01:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambulation.mp3 | 14-Apr-2007 01:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | ambulate.mp3 | 14-Apr-2007 01:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | ambulante.mp3 | 14-Apr-2007 01:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambulant.mp3 | 14-Apr-2007 01:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | ambulance.mp3 | 14-Apr-2007 01:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | ambulacrum.mp3 | 14-Apr-2007 01:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | ambulacral.mp3 | 14-Apr-2007 01:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | ambulacra.mp3 | 14-Apr-2007 01:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | ambsace.mp3 | 14-Apr-2007 01:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | ambry.mp3 | 14-Apr-2007 01:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | ambrotype.mp3 | 14-Apr-2007 01:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | ambrosially.mp3 | 14-Apr-2007 01:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | ambrosial.mp3 | 14-Apr-2007 01:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | ambrosia.mp3 | 14-Apr-2007 01:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | ambrosechannel.mp3 | 14-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | ambroid.mp3 | 14-Apr-2007 01:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | ambridge.mp3 | 14-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | ambrettolide.mp3 | 14-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | ambretteseed.mp3 | 14-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | amboyna.mp3 | 14-Apr-2007 01:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | amboise.mp3 | 14-Apr-2007 01:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | amboceptor.mp3 | 14-Apr-2007 01:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | ambo.mp3 | 14-Apr-2007 01:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | amblypod.mp3 | 14-Apr-2007 01:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | amblyoscope.mp3 | 14-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | amblyopic.mp3 | 14-Apr-2007 01:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | amblyopia.mp3 | 14-Apr-2007 01:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | amblygonite.mp3 | 14-Apr-2007 01:40 | 17K | |
![[SND]](/icons/sound2.gif) | amblingly.mp3 | 14-Apr-2007 01:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | ambling.mp3 | 14-Apr-2007 01:39 | 6.1K | |
![[SND]](/icons/sound2.gif) | ambler.mp3 | 14-Apr-2007 01:39 | 5.4K | |
![[SND]](/icons/sound2.gif) | amble.mp3 | 14-Apr-2007 01:39 | 4.5K | |
![[SND]](/icons/sound2.gif) | ambivert.mp3 | 14-Apr-2007 01:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | ambiversion.mp3 | 14-Apr-2007 01:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | ambivalently.mp3 | 14-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | ambivalent.mp3 | 14-Apr-2007 01:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | ambivalence.mp3 | 14-Apr-2007 01:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | ambitiousness.mp3 | 14-Apr-2007 01:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambitious.mp3 | 14-Apr-2007 01:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambitionlessly.mp3 | 14-Apr-2007 01:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | ambitionless.mp3 | 14-Apr-2007 01:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | ambition.mp3 | 14-Apr-2007 01:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | ambit.mp3 | 14-Apr-2007 01:39 | 5.4K | |
![[SND]](/icons/sound2.gif) | ambisonics.mp3 | 14-Apr-2007 01:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambisonic.mp3 | 14-Apr-2007 01:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambish.mp3 | 14-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | ambisexuality.mp3 | 14-Apr-2007 01:39 | 11K | |
![[SND]](/icons/sound2.gif) | ambisexual.mp3 | 14-Apr-2007 01:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | ambisextrous.mp3 | 14-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | ambiophony.mp3 | 14-Apr-2007 01:39 | 17K | |
![[SND]](/icons/sound2.gif) | ambiguousness.mp3 | 14-Apr-2007 01:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambiguous.mp3 | 14-Apr-2007 01:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | ambiguity.mp3 | 14-Apr-2007 01:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | ambiente.mp3 | 14-Apr-2007 01:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | ambient.mp3 | 14-Apr-2007 01:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | ambience.mp3 | 14-Apr-2007 01:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | ambidextrousness.mp3 | 14-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | ambidextrous.mp3 | 14-Apr-2007 01:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | ambidextral.mp3 | 14-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | ambidexterity.mp3 | 14-Apr-2007 01:38 | 11K | |
![[SND]](/icons/sound2.gif) | ambidexter.mp3 | 14-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | ambidentate.mp3 | 14-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | ambiance.mp3 | 14-Apr-2007 01:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | ambi.mp3 | 14-Apr-2007 01:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | amberous.mp3 | 14-Apr-2007 01:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | amberoid.mp3 | 14-Apr-2007 01:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | amberlite.mp3 | 14-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | amberjack.mp3 | 14-Apr-2007 01:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | amberite.mp3 | 14-Apr-2007 01:38 | 17K | |
![[SND]](/icons/sound2.gif) | amberina.mp3 | 14-Apr-2007 01:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | ambergris.mp3 | 14-Apr-2007 01:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | amber.mp3 | 14-Apr-2007 01:38 | 5.2K | |
![[SND]](/icons/sound2.gif) | ambeer.mp3 | 14-Apr-2007 01:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | ambedkar.mp3 | 14-Apr-2007 01:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | ambatch.mp3 | 14-Apr-2007 01:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | ambassadress.mp3 | 14-Apr-2007 01:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambassadorship.mp3 | 14-Apr-2007 01:38 | 10K | |
![[SND]](/icons/sound2.gif) | ambassadorially.mp3 | 14-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | ambassadorial.mp3 | 14-Apr-2007 01:37 | 11K | |
![[SND]](/icons/sound2.gif) | ambassador.mp3 | 14-Apr-2007 01:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | ambary.mp3 | 14-Apr-2007 01:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | ambarvalia.mp3 | 14-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | ambarella.mp3 | 14-Apr-2007 01:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | ambala.mp3 | 14-Apr-2007 01:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | ambagiousness.mp3 | 14-Apr-2007 01:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambagious.mp3 | 14-Apr-2007 01:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | ambages.mp3 | 14-Apr-2007 01:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | ambage.mp3 | 14-Apr-2007 01:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | amba.mp3 | 14-Apr-2007 01:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | amazonstone.mp3 | 14-Apr-2007 01:37 | 9.6K | |
![[SND]](/icons/sound2.gif) | amazonite.mp3 | 14-Apr-2007 01:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | amazonis.mp3 | 14-Apr-2007 01:37 | 17K | |
![[SND]](/icons/sound2.gif) | amazingness.mp3 | 14-Apr-2007 01:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | amazingly.mp3 | 14-Apr-2007 01:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | amazing.mp3 | 14-Apr-2007 01:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | amaziah.mp3 | 14-Apr-2007 01:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | amazement.mp3 | 14-Apr-2007 01:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | amazedness.mp3 | 14-Apr-2007 01:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | amazedly.mp3 | 14-Apr-2007 01:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | amazed.mp3 | 14-Apr-2007 01:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | amaze.mp3 | 14-Apr-2007 01:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | a maximis ad minima.mp3 | 13-Apr-2007 22:31 | 18K | |
![[SND]](/icons/sound2.gif) | amaut.mp3 | 14-Apr-2007 01:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | amaurotic.mp3 | 14-Apr-2007 01:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | amaurosis.mp3 | 14-Apr-2007 01:36 | 10K | |
![[SND]](/icons/sound2.gif) | amauroses.mp3 | 14-Apr-2007 01:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | amatungula.mp3 | 14-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | amatory.mp3 | 14-Apr-2007 01:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | amatorially.mp3 | 14-Apr-2007 01:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | amatol.mp3 | 14-Apr-2007 01:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | amativeness.mp3 | 14-Apr-2007 01:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | amative.mp3 | 14-Apr-2007 01:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | amathi.mp3 | 14-Apr-2007 01:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | amateurism.mp3 | 14-Apr-2007 01:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | amateurishness.mp3 | 14-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | amateurish.mp3 | 14-Apr-2007 01:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | amateur.mp3 | 14-Apr-2007 01:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | amate.mp3 | 14-Apr-2007 01:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | amassment.mp3 | 14-Apr-2007 01:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | amass.mp3 | 14-Apr-2007 01:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | amasias.mp3 | 14-Apr-2007 01:36 | 17K | |
![[SND]](/icons/sound2.gif) | amasi.mp3 | 14-Apr-2007 01:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | amasa.mp3 | 14-Apr-2007 01:35 | 27K | |
![[SND]](/icons/sound2.gif) | amaryllis.mp3 | 14-Apr-2007 01:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | amaryllidaceous.mp3 | 14-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | amarone.mp3 | 14-Apr-2007 01:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | amarna.mp3 | 14-Apr-2007 01:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | amargoso.mp3 | 14-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | amaretto.mp3 | 14-Apr-2007 01:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | amaretti.mp3 | 14-Apr-2007 01:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | amarelle.mp3 | 14-Apr-2007 01:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | amaranthine.mp3 | 14-Apr-2007 01:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | amaranthaceous.mp3 | 14-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | amaranth.mp3 | 14-Apr-2007 01:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | amapola.mp3 | 14-Apr-2007 01:35 | 17K | |
![[SND]](/icons/sound2.gif) | amanuensis.mp3 | 14-Apr-2007 01:35 | 10K | |
![[SND]](/icons/sound2.gif) | amanuenses.mp3 | 14-Apr-2007 01:35 | 11K | |
![[SND]](/icons/sound2.gif) | amantadine.mp3 | 14-Apr-2007 01:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | amanitin.mp3 | 14-Apr-2007 01:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | amanite.mp3 | 14-Apr-2007 01:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | amanita.mp3 | 14-Apr-2007 01:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | amandine.mp3 | 14-Apr-2007 01:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | amanda.mp3 | 14-Apr-2007 01:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | amanachurchsociety.mp3 | 14-Apr-2007 01:35 | 18K | |
![[SND]](/icons/sound2.gif) | aman.mp3 | 14-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | amalthaea.mp3 | 14-Apr-2007 01:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | amalia.mp3 | 14-Apr-2007 01:34 | 27K | |
![[SND]](/icons/sound2.gif) | amalgamator.mp3 | 14-Apr-2007 01:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | amalgamation.mp3 | 14-Apr-2007 01:34 | 11K | |
![[SND]](/icons/sound2.gif) | amalgamate.mp3 | 14-Apr-2007 01:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | amalgam.mp3 | 14-Apr-2007 01:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | amalek.mp3 | 14-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | amalaka.mp3 | 14-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | amal.mp3 | 14-Apr-2007 01:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | amakihi.mp3 | 14-Apr-2007 01:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | amain.mp3 | 14-Apr-2007 01:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | amah.mp3 | 14-Apr-2007 01:34 | 5.4K | |
![[SND]](/icons/sound2.gif) | amadou.mp3 | 14-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | amadorguerrero.mp3 | 14-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | amado.mp3 | 14-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | amadis.mp3 | 14-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | amadeus.mp3 | 14-Apr-2007 01:34 | 17K | |
![[SND]](/icons/sound2.gif) | amadavat.mp3 | 14-Apr-2007 01:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | amadan.mp3 | 14-Apr-2007 01:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | amabelle.mp3 | 14-Apr-2007 01:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | ama.mp3 | 14-Apr-2007 01:33 | 5.4K | |
![[SND]](/icons/sound2.gif) | am.mp3 | 14-Apr-2007 01:33 | 5.2K | |
![[SND]](/icons/sound2.gif) | alzheimersdisease.mp3 | 14-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | alyssum.mp3 | 14-Apr-2007 01:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | alyson.mp3 | 14-Apr-2007 01:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | alyo.mp3 | 14-Apr-2007 01:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | alyce.mp3 | 14-Apr-2007 01:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | alyattes.mp3 | 14-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | alwyn.mp3 | 14-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | alwite.mp3 | 14-Apr-2007 01:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | alwin.mp3 | 14-Apr-2007 01:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | always.mp3 | 14-Apr-2007 01:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | alway.mp3 | 14-Apr-2007 01:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | alvira.mp3 | 14-Apr-2007 01:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | alvine.mp3 | 14-Apr-2007 01:33 | 27K | |
![[SND]](/icons/sound2.gif) | alveopalatal.mp3 | 14-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | alveolus.mp3 | 14-Apr-2007 01:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | alveolo.mp3 | 14-Apr-2007 01:33 | 17K | |
![[SND]](/icons/sound2.gif) | alveoli.mp3 | 14-Apr-2007 01:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | alveole.mp3 | 14-Apr-2007 01:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | alveolation.mp3 | 14-Apr-2007 01:32 | 27K | |
![[SND]](/icons/sound2.gif) | alveolate.mp3 | 14-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | alveolarly.mp3 | 14-Apr-2007 01:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | alveolar.mp3 | 14-Apr-2007 01:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | alveola.mp3 | 14-Apr-2007 01:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | alveol.mp3 | 14-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | alveated.mp3 | 14-Apr-2007 01:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | alvarezquintero.mp3 | 14-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | alvarez de Toledo.mp3 | 14-Apr-2007 01:32 | 16K | |
![[SND]](/icons/sound2.gif) | alvarado.mp3 | 14-Apr-2007 01:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | alvar.mp3 | 14-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | alva.mp3 | 14-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | aluzza.mp3 | 14-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | alutaceous.mp3 | 14-Apr-2007 01:32 | 17K | |
![[SND]](/icons/sound2.gif) | alure.mp3 | 14-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | alunogen.mp3 | 14-Apr-2007 01:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | alunite.mp3 | 14-Apr-2007 01:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | alundum.mp3 | 14-Apr-2007 01:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | alumroot.mp3 | 14-Apr-2007 01:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | alumnus.mp3 | 14-Apr-2007 01:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | alumni.mp3 | 14-Apr-2007 01:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | alumnae.mp3 | 14-Apr-2007 01:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | alumna.mp3 | 14-Apr-2007 01:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | aluminumglycinate.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | aluminum.mp3 | 14-Apr-2007 01:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | aluminous.mp3 | 14-Apr-2007 01:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | aluminothermy.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | aluminosity.mp3 | 14-Apr-2007 01:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | aluminosilicate.mp3 | 14-Apr-2007 01:31 | 11K | |
![[SND]](/icons/sound2.gif) | aluminography.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | aluminographic.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | alumino.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | aluminize.mp3 | 14-Apr-2007 01:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | aluminization.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | aluminium.mp3 | 14-Apr-2007 01:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | aluminite.mp3 | 14-Apr-2007 01:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | aluminiferous.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | aluminic.mp3 | 14-Apr-2007 01:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | aluminate.mp3 | 14-Apr-2007 01:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | alumina.mp3 | 14-Apr-2007 01:31 | 5.9K | |
![[SND]](/icons/sound2.gif) | alumin.mp3 | 14-Apr-2007 01:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | alumdum.mp3 | 14-Apr-2007 01:31 | 17K | |
![[SND]](/icons/sound2.gif) | alum.mp3 | 14-Apr-2007 01:31 | 4.8K | |
![[SND]](/icons/sound2.gif) | alular.mp3 | 14-Apr-2007 01:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | alulae.mp3 | 14-Apr-2007 01:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | alula.mp3 | 14-Apr-2007 01:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | aludel.mp3 | 14-Apr-2007 01:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | alubayyid.mp3 | 14-Apr-2007 01:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | altruistically.mp3 | 14-Apr-2007 01:30 | 10K | |
![[SND]](/icons/sound2.gif) | altruistic.mp3 | 14-Apr-2007 01:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | altruist.mp3 | 14-Apr-2007 01:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | altruism.mp3 | 14-Apr-2007 01:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | altricial.mp3 | 14-Apr-2007 01:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | altrices.mp3 | 14-Apr-2007 01:30 | 17K | |
![[SND]](/icons/sound2.gif) | altostratus.mp3 | 14-Apr-2007 01:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | altostrati.mp3 | 14-Apr-2007 01:30 | 10K | |
![[SND]](/icons/sound2.gif) | altona.mp3 | 14-Apr-2007 01:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | altoist.mp3 | 14-Apr-2007 01:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | altogetherness.mp3 | 14-Apr-2007 01:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | altogether.mp3 | 14-Apr-2007 01:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | altocumulus.mp3 | 14-Apr-2007 01:29 | 10K | |
![[SND]](/icons/sound2.gif) | altocumuli.mp3 | 14-Apr-2007 01:29 | 11K | |
![[SND]](/icons/sound2.gif) | alto.mp3 | 14-Apr-2007 01:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | alto-rilievo.mp3 | 14-Apr-2007 01:30 | 11K | |
![[SND]](/icons/sound2.gif) | alto-rilievi.mp3 | 14-Apr-2007 01:30 | 12K | |
![[SND]](/icons/sound2.gif) | alto-relievo.mp3 | 14-Apr-2007 01:30 | 11K | |
![[SND]](/icons/sound2.gif) | altmark.mp3 | 14-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | altitudinous.mp3 | 14-Apr-2007 01:29 | 10K | |
![[SND]](/icons/sound2.gif) | altitudinal.mp3 | 14-Apr-2007 01:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | altitude.mp3 | 14-Apr-2007 01:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | altissimo.mp3 | 14-Apr-2007 01:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | altiplano.mp3 | 14-Apr-2007 01:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | altiplane.mp3 | 14-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | altimetry.mp3 | 14-Apr-2007 01:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | altimetrically.mp3 | 14-Apr-2007 01:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | altimeter.mp3 | 14-Apr-2007 01:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | altigraph.mp3 | 14-Apr-2007 01:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | alti.mp3 | 14-Apr-2007 01:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | althusser.mp3 | 14-Apr-2007 01:29 | 17K | |
![[SND]](/icons/sound2.gif) | although.mp3 | 14-Apr-2007 01:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | althorn.mp3 | 14-Apr-2007 01:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | altho.mp3 | 14-Apr-2007 01:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | althing.mp3 | 14-Apr-2007 01:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | althea.mp3 | 14-Apr-2007 01:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | althaea.mp3 | 14-Apr-2007 01:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | altgeld.mp3 | 14-Apr-2007 01:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | alternator.mp3 | 14-Apr-2007 01:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | alternativity.mp3 | 14-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | alternative.mp3 | 14-Apr-2007 01:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | alternation.mp3 | 14-Apr-2007 01:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | alternatingly.mp3 | 14-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | alternating.mp3 | 14-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | alternateness.mp3 | 14-Apr-2007 01:28 | 27K | |
![[SND]](/icons/sound2.gif) | alternately.mp3 | 14-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | alternate.mp3 | 14-Apr-2007 01:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | alternant.mp3 | 14-Apr-2007 01:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | altern.mp3 | 14-Apr-2007 01:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | alterity.mp3 | 14-Apr-2007 01:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | altering.mp3 | 14-Apr-2007 01:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | alteridem.mp3 | 14-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | alter idem.mp3 | 14-Apr-2007 01:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | alterer.mp3 | 14-Apr-2007 01:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | alterego.mp3 | 14-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | alter ego.mp3 | 14-Apr-2007 01:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | altered.mp3 | 14-Apr-2007 01:28 | 17K | |
![[SND]](/icons/sound2.gif) | altercation.mp3 | 14-Apr-2007 01:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | altercate.mp3 | 14-Apr-2007 01:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | alterative.mp3 | 14-Apr-2007 01:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | alteration.mp3 | 14-Apr-2007 01:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | alterant.mp3 | 14-Apr-2007 01:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | alterably.mp3 | 14-Apr-2007 01:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | alterable.mp3 | 14-Apr-2007 01:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | alterability.mp3 | 14-Apr-2007 01:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | alter Christus.mp3 | 14-Apr-2007 01:27 | 11K | |
![[SND]](/icons/sound2.gif) | alter.mp3 | 14-Apr-2007 01:27 | 5.2K | |
![[SND]](/icons/sound2.gif) | altepinakothek.mp3 | 14-Apr-2007 01:27 | 17K | |
![[SND]](/icons/sound2.gif) | alte.mp3 | 14-Apr-2007 01:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | altdorfer.mp3 | 14-Apr-2007 01:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | altazimuth.mp3 | 14-Apr-2007 01:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | altay.mp3 | 14-Apr-2007 01:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | altarpiece.mp3 | 14-Apr-2007 01:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | altarage.mp3 | 14-Apr-2007 01:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | altar.mp3 | 14-Apr-2007 01:27 | 5.4K | |
![[SND]](/icons/sound2.gif) | altadena.mp3 | 14-Apr-2007 01:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | alt.mp3 | 14-Apr-2007 01:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | alt-rocker.mp3 | 14-Apr-2007 01:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | alt-rock.mp3 | 14-Apr-2007 01:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | alstroemeria.mp3 | 14-Apr-2007 01:26 | 11K | |
![[SND]](/icons/sound2.gif) | alston.mp3 | 14-Apr-2007 01:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | alsop.mp3 | 14-Apr-2007 01:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | also.mp3 | 14-Apr-2007 01:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | also-ran.mp3 | 14-Apr-2007 01:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | alsirat.mp3 | 14-Apr-2007 01:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | alsikeclover.mp3 | 14-Apr-2007 01:26 | 36K | |
![[SND]](/icons/sound2.gif) | alsike clover.mp3 | 14-Apr-2007 01:26 | 10K | |
![[SND]](/icons/sound2.gif) | alright.mp3 | 14-Apr-2007 01:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | already.mp3 | 14-Apr-2007 01:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | alprostadil.mp3 | 14-Apr-2007 01:26 | 10K | |
![[SND]](/icons/sound2.gif) | alprazolam.mp3 | 14-Apr-2007 01:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | alport.mp3 | 14-Apr-2007 01:26 | 17K | |
![[SND]](/icons/sound2.gif) | alpo.mp3 | 14-Apr-2007 01:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | alpinist.mp3 | 14-Apr-2007 01:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | alpinism.mp3 | 14-Apr-2007 01:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | alpinely.mp3 | 14-Apr-2007 01:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | alpine.mp3 | 14-Apr-2007 01:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | alphosis.mp3 | 14-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | alphos.mp3 | 14-Apr-2007 01:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | alphorn.mp3 | 14-Apr-2007 01:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | alphonsus.mp3 | 14-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | alphonso.mp3 | 14-Apr-2007 01:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | alphitomancy.mp3 | 14-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | alphanumerics.mp3 | 14-Apr-2007 01:25 | 11K | |
![[SND]](/icons/sound2.gif) | alphanumerically.mp3 | 14-Apr-2007 01:25 | 11K | |
![[SND]](/icons/sound2.gif) | alphanumerical.mp3 | 14-Apr-2007 01:25 | 11K | |
![[SND]](/icons/sound2.gif) | alphanumeric.mp3 | 14-Apr-2007 01:25 | 9.5K | |
![[SND]](/icons/sound2.gif) | alphametic.mp3 | 14-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | alphameric.mp3 | 14-Apr-2007 01:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | alphahypophamine.mp3 | 14-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | alphabetizer.mp3 | 14-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | alphabetize.mp3 | 14-Apr-2007 01:25 | 9.1K | |
![[SND]](/icons/sound2.gif) | alphabetization.mp3 | 14-Apr-2007 01:25 | 11K | |
![[SND]](/icons/sound2.gif) | alphabetism.mp3 | 14-Apr-2007 01:25 | 17K | |
![[SND]](/icons/sound2.gif) | alphabetically.mp3 | 14-Apr-2007 01:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | alphabetical.mp3 | 14-Apr-2007 01:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | alphabetic.mp3 | 14-Apr-2007 01:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | alphabet.mp3 | 14-Apr-2007 01:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | alpha.mp3 | 14-Apr-2007 01:24 | 5.2K | |
![[SND]](/icons/sound2.gif) | alpha-tocopherol.mp3 | 14-Apr-2007 01:25 | 13K | |
![[SND]](/icons/sound2.gif) | alpha-receptor.mp3 | 14-Apr-2007 01:25 | 10K | |
![[SND]](/icons/sound2.gif) | alpha-helix.mp3 | 14-Apr-2007 01:25 | 11K | |
![[SND]](/icons/sound2.gif) | alpha-helical.mp3 | 14-Apr-2007 01:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | alpha-fetoprotein.mp3 | 14-Apr-2007 01:25 | 15K | |
![[SND]](/icons/sound2.gif) | alpha-adrenergic.mp3 | 14-Apr-2007 01:24 | 12K | |
![[SND]](/icons/sound2.gif) | alpestrine.mp3 | 14-Apr-2007 01:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | alpesmaritimes.mp3 | 14-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | alpesdehauteprovence.mp3 | 14-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | alpert.mp3 | 14-Apr-2007 01:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | alpenstock.mp3 | 14-Apr-2007 01:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | alpenhorn.mp3 | 14-Apr-2007 01:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | alpenglow.mp3 | 14-Apr-2007 01:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | alpargata.mp3 | 14-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | alpaca.mp3 | 14-Apr-2007 01:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | alp.mp3 | 14-Apr-2007 01:24 | 4.1K | |
![[SND]](/icons/sound2.gif) | aloysius.mp3 | 14-Apr-2007 01:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | aloys.mp3 | 14-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | alow.mp3 | 14-Apr-2007 01:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | aloud.mp3 | 14-Apr-2007 01:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | alouatte.mp3 | 14-Apr-2007 01:24 | 17K | |
![[SND]](/icons/sound2.gif) | alorange.mp3 | 14-Apr-2007 01:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | alopecic.mp3 | 14-Apr-2007 01:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | alopeciaareata.mp3 | 14-Apr-2007 01:23 | 17K | |
![[SND]](/icons/sound2.gif) | alopecia.mp3 | 14-Apr-2007 01:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | aloofness.mp3 | 14-Apr-2007 01:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | aloof.mp3 | 14-Apr-2007 01:23 | 6.1K | |
![[SND]](/icons/sound2.gif) | alonso.mp3 | 14-Apr-2007 01:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | alongside.mp3 | 14-Apr-2007 01:23 | 10K | |
![[SND]](/icons/sound2.gif) | alongshore.mp3 | 14-Apr-2007 01:23 | 10K | |
![[SND]](/icons/sound2.gif) | along.mp3 | 14-Apr-2007 01:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | aloneness.mp3 | 14-Apr-2007 01:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | alone.mp3 | 14-Apr-2007 01:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | aloin.mp3 | 14-Apr-2007 01:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | alohaoe.mp3 | 14-Apr-2007 01:23 | 17K | |
![[SND]](/icons/sound2.gif) | aloha oe.mp3 | 14-Apr-2007 01:23 | 10K | |
![[SND]](/icons/sound2.gif) | aloha.mp3 | 14-Apr-2007 01:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | alogically.mp3 | 14-Apr-2007 01:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | alogical.mp3 | 14-Apr-2007 01:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | alogia.mp3 | 14-Apr-2007 01:23 | 27K | |
![[SND]](/icons/sound2.gif) | alogi.mp3 | 14-Apr-2007 01:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | aloft.mp3 | 14-Apr-2007 01:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | aloevera.mp3 | 14-Apr-2007 01:23 | 27K | |
![[SND]](/icons/sound2.gif) | aloe vera.mp3 | 14-Apr-2007 01:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | aloetic.mp3 | 14-Apr-2007 01:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | aloeswood.mp3 | 14-Apr-2007 01:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | aloe.mp3 | 14-Apr-2007 01:23 | 5.2K | |
![[SND]](/icons/sound2.gif) | alodium.mp3 | 14-Apr-2007 01:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | alodially.mp3 | 14-Apr-2007 01:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | alobeid.mp3 | 14-Apr-2007 01:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | aloadae.mp3 | 14-Apr-2007 01:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | alnico.mp3 | 14-Apr-2007 01:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | almug.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almuce.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almucantar.mp3 | 14-Apr-2007 01:22 | 17K | |
![[SND]](/icons/sound2.gif) | almsman.mp3 | 14-Apr-2007 01:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | almshouse.mp3 | 14-Apr-2007 01:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | almsgiving.mp3 | 14-Apr-2007 01:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | almsgiver.mp3 | 14-Apr-2007 01:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | alms.mp3 | 14-Apr-2007 01:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | almous.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almost.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almoravid.mp3 | 14-Apr-2007 01:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | almonry.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almoner.mp3 | 14-Apr-2007 01:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | almondy.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almond.mp3 | 14-Apr-2007 01:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | almond-eyed.mp3 | 14-Apr-2007 01:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | almon.mp3 | 14-Apr-2007 01:22 | 27K | |
![[SND]](/icons/sound2.gif) | almohad.mp3 | 14-Apr-2007 01:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | almirah.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almique.mp3 | 14-Apr-2007 01:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | almighty.mp3 | 14-Apr-2007 01:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | almightiness.mp3 | 14-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | almetyevsk.mp3 | 14-Apr-2007 01:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | almery.mp3 | 14-Apr-2007 01:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | almerian.mp3 | 14-Apr-2007 01:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | almemar.mp3 | 14-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | almeida.mp3 | 14-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | alme.mp3 | 14-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | almayersfolly.mp3 | 14-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | almatadema.mp3 | 14-Apr-2007 01:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | almarj.mp3 | 14-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | almandite.mp3 | 14-Apr-2007 01:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | almandine.mp3 | 14-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | almanamah.mp3 | 14-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | almanachdegotha.mp3 | 14-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | almanac.mp3 | 14-Apr-2007 01:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | almamater.mp3 | 14-Apr-2007 01:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | alma mater.mp3 | 14-Apr-2007 01:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | almah.mp3 | 14-Apr-2007 01:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | almagest.mp3 | 14-Apr-2007 01:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | almada.mp3 | 14-Apr-2007 01:21 | 17K | |
![[SND]](/icons/sound2.gif) | almaata.mp3 | 14-Apr-2007 01:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | allypally.mp3 | 14-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | allyou.mp3 | 14-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | allylthiourea.mp3 | 14-Apr-2007 01:20 | 17K | |
![[SND]](/icons/sound2.gif) | allylic.mp3 | 14-Apr-2007 01:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | allyl.mp3 | 14-Apr-2007 01:20 | 4.8K | |
![[SND]](/icons/sound2.gif) | ally.mp3 | 14-Apr-2007 01:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | alluvium.mp3 | 14-Apr-2007 01:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | alluvion.mp3 | 14-Apr-2007 01:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | alluvial.mp3 | 14-Apr-2007 01:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | alluvia.mp3 | 14-Apr-2007 01:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | allusiveness.mp3 | 14-Apr-2007 01:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | allusive.mp3 | 14-Apr-2007 01:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | allusion.mp3 | 14-Apr-2007 01:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | allus.mp3 | 14-Apr-2007 01:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | alluringness.mp3 | 14-Apr-2007 01:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | alluring.mp3 | 14-Apr-2007 01:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | allurer.mp3 | 14-Apr-2007 01:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | allurement.mp3 | 14-Apr-2007 01:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | allure.mp3 | 14-Apr-2007 01:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | allude.mp3 | 14-Apr-2007 01:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | allspice.mp3 | 14-Apr-2007 01:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | allsbay.mp3 | 14-Apr-2007 01:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | allozyme.mp3 | 14-Apr-2007 01:19 | 17K | |
![[SND]](/icons/sound2.gif) | alloy.mp3 | 14-Apr-2007 01:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | alloxan.mp3 | 14-Apr-2007 01:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | allowedly.mp3 | 14-Apr-2007 01:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | allowed.mp3 | 14-Apr-2007 01:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | alloway.mp3 | 14-Apr-2007 01:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | allowance.mp3 | 14-Apr-2007 01:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | allowably.mp3 | 14-Apr-2007 01:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | allowable.mp3 | 14-Apr-2007 01:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | allow.mp3 | 14-Apr-2007 01:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | allover.mp3 | 14-Apr-2007 01:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | allotypy.mp3 | 14-Apr-2007 01:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | allotypically.mp3 | 14-Apr-2007 01:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | allotypic.mp3 | 14-Apr-2007 01:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | allotype.mp3 | 14-Apr-2007 01:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | allotter.mp3 | 14-Apr-2007 01:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | allottee.mp3 | 14-Apr-2007 01:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | allottava.mp3 | 14-Apr-2007 01:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | allotropy.mp3 | 14-Apr-2007 01:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | allotropicity.mp3 | 14-Apr-2007 01:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | allotropic.mp3 | 14-Apr-2007 01:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | allotrope.mp3 | 14-Apr-2007 01:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | allotriomorphic.mp3 | 14-Apr-2007 01:18 | 17K | |
![[SND]](/icons/sound2.gif) | allotment.mp3 | 14-Apr-2007 01:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | allotetraploidy.mp3 | 14-Apr-2007 01:18 | 10K | |
![[SND]](/icons/sound2.gif) | allotetraploid.mp3 | 14-Apr-2007 01:18 | 10K | |
![[SND]](/icons/sound2.gif) | allot.mp3 | 14-Apr-2007 01:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | allostery.mp3 | 14-Apr-2007 01:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | allosterically.mp3 | 14-Apr-2007 01:18 | 11K | |
![[SND]](/icons/sound2.gif) | allosteric.mp3 | 14-Apr-2007 01:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | allosaurus.mp3 | 14-Apr-2007 01:18 | 10K | |
![[SND]](/icons/sound2.gif) | allosaur.mp3 | 14-Apr-2007 01:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | allopurinol.mp3 | 14-Apr-2007 01:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | allopolyploidy.mp3 | 14-Apr-2007 01:18 | 10K | |
![[SND]](/icons/sound2.gif) | allopolyploid.mp3 | 14-Apr-2007 01:18 | 10K | |
![[SND]](/icons/sound2.gif) | alloplasty.mp3 | 14-Apr-2007 01:18 | 17K | |
![[SND]](/icons/sound2.gif) | alloplasmic.mp3 | 14-Apr-2007 01:18 | 17K | |
![[SND]](/icons/sound2.gif) | alloplasm.mp3 | 14-Apr-2007 01:18 | 17K | |
![[SND]](/icons/sound2.gif) | allophylian.mp3 | 14-Apr-2007 01:18 | 17K | |
![[SND]](/icons/sound2.gif) | allophonic.mp3 | 14-Apr-2007 01:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | allophone.mp3 | 14-Apr-2007 01:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | allophane.mp3 | 14-Apr-2007 01:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | allophanamide.mp3 | 14-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | allopatry.mp3 | 14-Apr-2007 01:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | allopatrically.mp3 | 14-Apr-2007 01:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | allopatric.mp3 | 14-Apr-2007 01:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | allopathy.mp3 | 14-Apr-2007 01:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | allopathically.mp3 | 14-Apr-2007 01:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | allopathic.mp3 | 14-Apr-2007 01:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | allopath.mp3 | 14-Apr-2007 01:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | allonymously.mp3 | 14-Apr-2007 01:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | allonym.mp3 | 14-Apr-2007 01:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | allonge.mp3 | 14-Apr-2007 01:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | allomorphite.mp3 | 14-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | allomorphism.mp3 | 14-Apr-2007 01:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | allomorphic.mp3 | 14-Apr-2007 01:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | allomorph.mp3 | 14-Apr-2007 01:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | allomone.mp3 | 14-Apr-2007 01:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | allometry.mp3 | 14-Apr-2007 01:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | allometric.mp3 | 14-Apr-2007 01:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | allomerize.mp3 | 14-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | allomerization.mp3 | 14-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | allomerism.mp3 | 14-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | allomeric.mp3 | 14-Apr-2007 01:17 | 17K | |
![[SND]](/icons/sound2.gif) | alloiometric.mp3 | 14-Apr-2007 01:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | allographic.mp3 | 14-Apr-2007 01:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | allograph.mp3 | 14-Apr-2007 01:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | allograft.mp3 | 14-Apr-2007 01:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | allogenically.mp3 | 14-Apr-2007 01:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | allogenic.mp3 | 14-Apr-2007 01:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | allogeneically.mp3 | 14-Apr-2007 01:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | allogeneic.mp3 | 14-Apr-2007 01:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | allogamy.mp3 | 14-Apr-2007 01:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | allogamous.mp3 | 14-Apr-2007 01:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | allodium.mp3 | 14-Apr-2007 01:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | allodially.mp3 | 14-Apr-2007 01:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | allodial.mp3 | 14-Apr-2007 01:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | allocution.mp3 | 14-Apr-2007 01:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | allochthonous.mp3 | 14-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | allochthon.mp3 | 14-Apr-2007 01:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | allochroic.mp3 | 14-Apr-2007 01:16 | 17K | |
![[SND]](/icons/sound2.gif) | allocher.mp3 | 14-Apr-2007 01:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | allocator.mp3 | 14-Apr-2007 01:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | allocation.mp3 | 14-Apr-2007 01:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | allocate.mp3 | 14-Apr-2007 01:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | allocatable.mp3 | 14-Apr-2007 01:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | allocable.mp3 | 14-Apr-2007 01:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | alloantigen.mp3 | 14-Apr-2007 01:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | alloantibody.mp3 | 14-Apr-2007 01:16 | 10K | |
![[SND]](/icons/sound2.gif) | allo.mp3 | 14-Apr-2007 01:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | allness.mp3 | 14-Apr-2007 01:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | allium.mp3 | 14-Apr-2007 01:15 | 5.5K | |
![[SND]](/icons/sound2.gif) | alliterator.mp3 | 14-Apr-2007 01:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | alliterativeness.mp3 | 14-Apr-2007 01:15 | 27K | |
![[SND]](/icons/sound2.gif) | alliterative.mp3 | 14-Apr-2007 01:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | alliteration.mp3 | 14-Apr-2007 01:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | alliterate.mp3 | 14-Apr-2007 01:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | allison.mp3 | 14-Apr-2007 01:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | allision.mp3 | 14-Apr-2007 01:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | allingham.mp3 | 14-Apr-2007 01:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | alligator.mp3 | 14-Apr-2007 01:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | alligation.mp3 | 14-Apr-2007 01:15 | 17K | |
![[SND]](/icons/sound2.gif) | alligate.mp3 | 14-Apr-2007 01:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | allies.mp3 | 14-Apr-2007 01:15 | 27K | |
![[SND]](/icons/sound2.gif) | allied.mp3 | 14-Apr-2007 01:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | allicin.mp3 | 14-Apr-2007 01:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | alliance.mp3 | 14-Apr-2007 01:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | alliaceous.mp3 | 14-Apr-2007 01:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | alliable.mp3 | 14-Apr-2007 01:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | allhallowtide.mp3 | 14-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | allhallowmas.mp3 | 14-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | all get-out.mp3 | 14-Apr-2007 01:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | alleyway.mp3 | 14-Apr-2007 01:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | alleyoop.mp3 | 14-Apr-2007 01:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | alleynian.mp3 | 14-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | alleyn.mp3 | 14-Apr-2007 01:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | alley.mp3 | 14-Apr-2007 01:14 | 4.5K | |
![[SND]](/icons/sound2.gif) | alley-oop.mp3 | 14-Apr-2007 01:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | alleviator.mp3 | 14-Apr-2007 01:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | alleviative.mp3 | 14-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | alleviation.mp3 | 14-Apr-2007 01:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | alleviate.mp3 | 14-Apr-2007 01:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | alleviant.mp3 | 14-Apr-2007 01:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | allethrin.mp3 | 14-Apr-2007 01:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | allergy.mp3 | 14-Apr-2007 01:14 | 5.7K | |
![[SND]](/icons/sound2.gif) | allergology.mp3 | 14-Apr-2007 01:14 | 17K | |
![[SND]](/icons/sound2.gif) | allergist.mp3 | 14-Apr-2007 01:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | allergic.mp3 | 14-Apr-2007 01:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | allergenicity.mp3 | 14-Apr-2007 01:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | allergenic.mp3 | 14-Apr-2007 01:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | allergen.mp3 | 14-Apr-2007 01:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | allerest.mp3 | 14-Apr-2007 01:13 | 17K | |
![[SND]](/icons/sound2.gif) | alleppey.mp3 | 14-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | allendemeteorite.mp3 | 14-Apr-2007 01:13 | 17K | |
![[SND]](/icons/sound2.gif) | allendegossens.mp3 | 14-Apr-2007 01:13 | 17K | |
![[SND]](/icons/sound2.gif) | allemontite.mp3 | 14-Apr-2007 01:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | allemande.mp3 | 14-Apr-2007 01:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | alleluiatic.mp3 | 14-Apr-2007 01:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | alleluia.mp3 | 14-Apr-2007 01:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | allelopathy.mp3 | 14-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | allelopathic.mp3 | 14-Apr-2007 01:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | allelomorphism.mp3 | 14-Apr-2007 01:13 | 9.6K | |
![[SND]](/icons/sound2.gif) | allelomorphic.mp3 | 14-Apr-2007 01:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | allelomorph.mp3 | 14-Apr-2007 01:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | allelism.mp3 | 14-Apr-2007 01:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | allelic.mp3 | 14-Apr-2007 01:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | allele.mp3 | 14-Apr-2007 01:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | allegro.mp3 | 14-Apr-2007 01:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | allegri.mp3 | 14-Apr-2007 01:12 | 17K | |
![[SND]](/icons/sound2.gif) | allegretto.mp3 | 14-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | allegory.mp3 | 14-Apr-2007 01:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | allegorizer.mp3 | 14-Apr-2007 01:12 | 17K | |
![[SND]](/icons/sound2.gif) | allegorize.mp3 | 14-Apr-2007 01:12 | 11K | |
![[SND]](/icons/sound2.gif) | allegorization.mp3 | 14-Apr-2007 01:12 | 10K | |
![[SND]](/icons/sound2.gif) | allegoristic.mp3 | 14-Apr-2007 01:12 | 17K | |
![[SND]](/icons/sound2.gif) | allegorist.mp3 | 14-Apr-2007 01:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | allegorism.mp3 | 14-Apr-2007 01:12 | 17K | |
![[SND]](/icons/sound2.gif) | allegoricalness.mp3 | 14-Apr-2007 01:12 | 11K | |
![[SND]](/icons/sound2.gif) | allegorically.mp3 | 14-Apr-2007 01:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | allegorical.mp3 | 14-Apr-2007 01:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | allegiant.mp3 | 14-Apr-2007 01:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | allegiance.mp3 | 14-Apr-2007 01:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | alleghanian.mp3 | 14-Apr-2007 01:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | alleger.mp3 | 14-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | allegedly.mp3 | 14-Apr-2007 01:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | alleged.mp3 | 14-Apr-2007 01:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | allege.mp3 | 14-Apr-2007 01:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | allegation.mp3 | 14-Apr-2007 01:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | alleesamee.mp3 | 14-Apr-2007 01:12 | 17K | |
![[SND]](/icons/sound2.gif) | allee.mp3 | 14-Apr-2007 01:11 | 6.3K | |
![[SND]](/icons/sound2.gif) | allecret.mp3 | 14-Apr-2007 01:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | alldayer.mp3 | 14-Apr-2007 01:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | allayer.mp3 | 14-Apr-2007 01:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | allay.mp3 | 14-Apr-2007 01:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | allavostrasalute.mp3 | 14-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | allative.mp3 | 14-Apr-2007 01:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | allatectomy.mp3 | 14-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | allat.mp3 | 14-Apr-2007 01:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | allargando.mp3 | 14-Apr-2007 01:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | allaprima.mp3 | 14-Apr-2007 01:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | allantois.mp3 | 14-Apr-2007 01:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | allantoin.mp3 | 14-Apr-2007 01:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | allantoides.mp3 | 14-Apr-2007 01:11 | 10K | |
![[SND]](/icons/sound2.gif) | allantoid.mp3 | 14-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | allantoic.mp3 | 14-Apr-2007 01:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | allantica.mp3 | 14-Apr-2007 01:11 | 17K | |
![[SND]](/icons/sound2.gif) | allanitic.mp3 | 14-Apr-2007 01:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | allanite.mp3 | 14-Apr-2007 01:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | allanadale.mp3 | 14-Apr-2007 01:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | allan.mp3 | 14-Apr-2007 01:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | allamarcia.mp3 | 14-Apr-2007 01:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | allamanda.mp3 | 14-Apr-2007 01:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | allacappella.mp3 | 14-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | allabreve.mp3 | 14-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | alla breve.mp3 | 14-Apr-2007 01:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | all.mp3 | 14-Apr-2007 01:10 | 4.6K | |
![[SND]](/icons/sound2.gif) | all-time.mp3 | 14-Apr-2007 01:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | all-star.mp3 | 14-Apr-2007 01:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | all-rounder.mp3 | 14-Apr-2007 01:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | all-round.mp3 | 14-Apr-2007 01:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | all-purpose.mp3 | 14-Apr-2007 01:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | all-powerful.mp3 | 14-Apr-2007 01:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | all-out.mp3 | 14-Apr-2007 01:19 | 5.9K | |
![[SND]](/icons/sound2.gif) | all-or-nothing.mp3 | 14-Apr-2007 01:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | all-or-none.mp3 | 14-Apr-2007 01:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | all-nighter.mp3 | 14-Apr-2007 01:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | all-night.mp3 | 14-Apr-2007 01:15 | 6.3K | |
![[SND]](/icons/sound2.gif) | all-inclusive.mp3 | 14-Apr-2007 01:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | all-in.mp3 | 14-Apr-2007 01:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | all-important.mp3 | 14-Apr-2007 01:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | all-fired.mp3 | 14-Apr-2007 01:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | all-embracing.mp3 | 14-Apr-2007 01:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | all-day.mp3 | 14-Apr-2007 01:11 | 6.3K | |
![[SND]](/icons/sound2.gif) | all-around.mp3 | 14-Apr-2007 01:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | all-American.mp3 | 14-Apr-2007 01:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | all' ottava.mp3 | 14-Apr-2007 01:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | alkyne.mp3 | 14-Apr-2007 01:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | alkylic.mp3 | 14-Apr-2007 01:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | alkylation.mp3 | 14-Apr-2007 01:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | alkylate.mp3 | 14-Apr-2007 01:10 | 5.7K | |
![[SND]](/icons/sound2.gif) | alkyl.mp3 | 14-Apr-2007 01:10 | 5.2K | |
![[SND]](/icons/sound2.gif) | alkyd.mp3 | 14-Apr-2007 01:10 | 5.0K | |
![[SND]](/icons/sound2.gif) | alky.mp3 | 14-Apr-2007 01:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | alkufa.mp3 | 14-Apr-2007 01:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | alkoxylgroup.mp3 | 14-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | alkoxyl.mp3 | 14-Apr-2007 01:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | alkoxy.mp3 | 14-Apr-2007 01:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | alkoxide.mp3 | 14-Apr-2007 01:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | alkoranic.mp3 | 14-Apr-2007 01:10 | 36K | |
![[SND]](/icons/sound2.gif) | alkoran.mp3 | 14-Apr-2007 01:10 | 36K | |
![[SND]](/icons/sound2.gif) | alkmene.mp3 | 14-Apr-2007 01:10 | 17K | |
![[SND]](/icons/sound2.gif) | alkine.mp3 | 14-Apr-2007 01:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | alkied.mp3 | 14-Apr-2007 01:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | alkie.mp3 | 14-Apr-2007 01:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | alki.mp3 | 14-Apr-2007 01:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | alkestis.mp3 | 14-Apr-2007 01:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | alkermes.mp3 | 14-Apr-2007 01:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | alkene.mp3 | 14-Apr-2007 01:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | alkekengi.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkaseltzer.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkaptonuria.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkapton.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkannin.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkanna.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkanethiol.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkanet.mp3 | 14-Apr-2007 01:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | alkane.mp3 | 14-Apr-2007 01:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | alkalotic.mp3 | 14-Apr-2007 01:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | alkalosis.mp3 | 14-Apr-2007 01:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | alkaloidal.mp3 | 14-Apr-2007 01:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | alkaloid.mp3 | 14-Apr-2007 01:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | alkalizer.mp3 | 14-Apr-2007 01:09 | 17K | |
![[SND]](/icons/sound2.gif) | alkalize.mp3 | 14-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | alkalinize.mp3 | 14-Apr-2007 01:08 | 11K | |
![[SND]](/icons/sound2.gif) | alkalinization.mp3 | 14-Apr-2007 01:08 | 12K | |
![[SND]](/icons/sound2.gif) | alkalinity.mp3 | 14-Apr-2007 01:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | alkaline.mp3 | 14-Apr-2007 01:08 | 5.9K | |
![[SND]](/icons/sound2.gif) | alkalimetry.mp3 | 14-Apr-2007 01:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | alkalimeter.mp3 | 14-Apr-2007 01:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | alkalify.mp3 | 14-Apr-2007 01:08 | 27K | |
![[SND]](/icons/sound2.gif) | alkalifiable.mp3 | 14-Apr-2007 01:08 | 27K | |
![[SND]](/icons/sound2.gif) | alkalic.mp3 | 14-Apr-2007 01:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | alkali.mp3 | 14-Apr-2007 01:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | alkalescent.mp3 | 14-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | alkalescency.mp3 | 14-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | alkalemia.mp3 | 14-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | alkahestical.mp3 | 14-Apr-2007 01:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | alkahestic.mp3 | 14-Apr-2007 01:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | alkahest.mp3 | 14-Apr-2007 01:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | alizarin.mp3 | 14-Apr-2007 01:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | aliyah.mp3 | 14-Apr-2007 01:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | aliya.mp3 | 14-Apr-2007 01:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | aliveness.mp3 | 14-Apr-2007 01:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | alive.mp3 | 14-Apr-2007 01:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | aliunde.mp3 | 14-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | aliturgical.mp3 | 14-Apr-2007 01:08 | 17K | |
![[SND]](/icons/sound2.gif) | aliterate.mp3 | 14-Apr-2007 01:07 | 5.5K | |
![[SND]](/icons/sound2.gif) | aliteracy.mp3 | 14-Apr-2007 01:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | alitalia.mp3 | 14-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | alit.mp3 | 14-Apr-2007 01:07 | 4.6K | |
![[SND]](/icons/sound2.gif) | alisvolatpropriis.mp3 | 14-Apr-2007 01:07 | 18K | |
![[SND]](/icons/sound2.gif) | alis volat propriis.mp3 | 14-Apr-2007 01:07 | 21K | |
![[SND]](/icons/sound2.gif) | alister.mp3 | 14-Apr-2007 01:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | alist.mp3 | 14-Apr-2007 01:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | alissa.mp3 | 14-Apr-2007 01:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | alison.mp3 | 14-Apr-2007 01:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | aliskandariyah.mp3 | 14-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | alis.mp3 | 14-Apr-2007 01:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | aliquot.mp3 | 14-Apr-2007 01:07 | 6.3K | |
![[SND]](/icons/sound2.gif) | aliquant.mp3 | 14-Apr-2007 01:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | aliquando bonus dormitat Homerus.mp3 | 14-Apr-2007 01:07 | 26K | |
![[SND]](/icons/sound2.gif) | alipterion.mp3 | 14-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | aliphatic.mp3 | 14-Apr-2007 01:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | aliped.mp3 | 14-Apr-2007 01:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | alipasha.mp3 | 14-Apr-2007 01:07 | 17K | |
![[SND]](/icons/sound2.gif) | alioth.mp3 | 14-Apr-2007 01:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | alinotum.mp3 | 14-Apr-2007 01:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | aliner.mp3 | 14-Apr-2007 01:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | alinement.mp3 | 14-Apr-2007 01:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | aline.mp3 | 14-Apr-2007 01:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | alimproviste.mp3 | 14-Apr-2007 01:06 | 18K | |
![[SND]](/icons/sound2.gif) | alimony.mp3 | 14-Apr-2007 01:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | alimonize.mp3 | 14-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | alimonied.mp3 | 14-Apr-2007 01:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | alimentotherapy.mp3 | 14-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | alimentativeness.mp3 | 14-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | alimentative.mp3 | 14-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | alimentation.mp3 | 14-Apr-2007 01:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | alimentary.mp3 | 14-Apr-2007 01:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | alimentally.mp3 | 14-Apr-2007 01:06 | 27K | |
![[SND]](/icons/sound2.gif) | aliment.mp3 | 14-Apr-2007 01:06 | 5.5K | |
![[SND]](/icons/sound2.gif) | alikeness.mp3 | 14-Apr-2007 01:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | alike.mp3 | 14-Apr-2007 01:06 | 5.2K | |
![[SND]](/icons/sound2.gif) | aligote.mp3 | 14-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | alignment.mp3 | 14-Apr-2007 01:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | aligner.mp3 | 14-Apr-2007 01:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | align.mp3 | 14-Apr-2007 01:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | alight.mp3 | 14-Apr-2007 01:06 | 5.4K | |
![[SND]](/icons/sound2.gif) | aliform.mp3 | 14-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | alif.mp3 | 14-Apr-2007 01:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aliesterase.mp3 | 14-Apr-2007 01:06 | 17K | |
![[SND]](/icons/sound2.gif) | alienor.mp3 | 14-Apr-2007 01:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | alienness.mp3 | 14-Apr-2007 01:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | alienist.mp3 | 14-Apr-2007 01:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | alienism.mp3 | 14-Apr-2007 01:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | alienijuris.mp3 | 14-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | alienigeneris.mp3 | 14-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | alienee.mp3 | 14-Apr-2007 01:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | alienator.mp3 | 14-Apr-2007 01:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | alienative.mp3 | 14-Apr-2007 01:05 | 17K | |
![[SND]](/icons/sound2.gif) | alienation.mp3 | 14-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | alienate.mp3 | 14-Apr-2007 01:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | alienage.mp3 | 14-Apr-2007 01:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | alienable.mp3 | 14-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | alienability.mp3 | 14-Apr-2007 01:05 | 10K | |
![[SND]](/icons/sound2.gif) | alien.mp3 | 14-Apr-2007 01:05 | 5.7K | |
![[SND]](/icons/sound2.gif) | alidade.mp3 | 14-Apr-2007 01:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | alicyclic.mp3 | 14-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | alick.mp3 | 14-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | alicia.mp3 | 14-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | alible.mp3 | 14-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | alibility.mp3 | 14-Apr-2007 01:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | alibi.mp3 | 14-Apr-2007 01:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | alibaba.mp3 | 14-Apr-2007 01:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | aliasing.mp3 | 14-Apr-2007 01:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | aliasdictus.mp3 | 14-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | alias.mp3 | 14-Apr-2007 01:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | alhufuf.mp3 | 14-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | alhillah.mp3 | 14-Apr-2007 01:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | alhambresque.mp3 | 14-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | alhajj.mp3 | 14-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | algy.mp3 | 14-Apr-2007 01:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | algum.mp3 | 14-Apr-2007 01:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | alguacil.mp3 | 14-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | algraphy.mp3 | 14-Apr-2007 01:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | algraphic.mp3 | 14-Apr-2007 01:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | algous.mp3 | 14-Apr-2007 01:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | algormortis.mp3 | 14-Apr-2007 01:04 | 17K | |
![[SND]](/icons/sound2.gif) | algorithmically.mp3 | 14-Apr-2007 01:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | algorithmic.mp3 | 14-Apr-2007 01:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | algorithm.mp3 | 14-Apr-2007 01:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | algorismic.mp3 | 14-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | algorism.mp3 | 14-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | algor.mp3 | 14-Apr-2007 01:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | algophobia.mp3 | 14-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | algophagous.mp3 | 14-Apr-2007 01:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | algometry.mp3 | 14-Apr-2007 01:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | algometer.mp3 | 14-Apr-2007 01:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | algology.mp3 | 14-Apr-2007 01:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | algologist.mp3 | 14-Apr-2007 01:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | algological.mp3 | 14-Apr-2007 01:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | algolagnist.mp3 | 14-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | algolagniac.mp3 | 14-Apr-2007 01:03 | 10K | |
![[SND]](/icons/sound2.gif) | algolagnia.mp3 | 14-Apr-2007 01:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | algoid.mp3 | 14-Apr-2007 01:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | algo.mp3 | 14-Apr-2007 01:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | alginicacid.mp3 | 14-Apr-2007 01:03 | 17K | |
![[SND]](/icons/sound2.gif) | alginic acid.mp3 | 14-Apr-2007 01:03 | 10K | |
![[SND]](/icons/sound2.gif) | alginate.mp3 | 14-Apr-2007 01:02 | 6.1K | |
![[SND]](/icons/sound2.gif) | algin.mp3 | 14-Apr-2007 01:02 | 6.3K | |
![[SND]](/icons/sound2.gif) | algie.mp3 | 14-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | algidness.mp3 | 14-Apr-2007 01:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | algid.mp3 | 14-Apr-2007 01:02 | 5.4K | |
![[SND]](/icons/sound2.gif) | algicide.mp3 | 14-Apr-2007 01:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | algicidal.mp3 | 14-Apr-2007 01:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | algia.mp3 | 14-Apr-2007 01:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | alghazzali.mp3 | 14-Apr-2007 01:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | algetic.mp3 | 14-Apr-2007 01:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | algesimeter.mp3 | 14-Apr-2007 01:02 | 17K | |
![[SND]](/icons/sound2.gif) | algesic.mp3 | 14-Apr-2007 01:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | algesia.mp3 | 14-Apr-2007 01:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | algernon.mp3 | 14-Apr-2007 01:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | algerita.mp3 | 14-Apr-2007 01:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | algerienne.mp3 | 14-Apr-2007 01:02 | 17K | |
![[SND]](/icons/sound2.gif) | algebraist.mp3 | 14-Apr-2007 01:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | algebraicly.mp3 | 14-Apr-2007 01:02 | 17K | |
![[SND]](/icons/sound2.gif) | algebraically.mp3 | 14-Apr-2007 01:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | algebraic.mp3 | 14-Apr-2007 01:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | algebra.mp3 | 14-Apr-2007 01:01 | 6.1K | |
![[SND]](/icons/sound2.gif) | algazel.mp3 | 14-Apr-2007 01:01 | 17K | |
![[SND]](/icons/sound2.gif) | algatron.mp3 | 14-Apr-2007 01:01 | 17K | |
![[SND]](/icons/sound2.gif) | algate.mp3 | 14-Apr-2007 01:01 | 17K | |
![[SND]](/icons/sound2.gif) | algarrobo.mp3 | 14-Apr-2007 01:01 | 10K | |
![[SND]](/icons/sound2.gif) | algarroba.mp3 | 14-Apr-2007 01:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | algarothpowder.mp3 | 14-Apr-2007 01:01 | 17K | |
![[SND]](/icons/sound2.gif) | algaroba.mp3 | 14-Apr-2007 01:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | algar.mp3 | 14-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | algal.mp3 | 14-Apr-2007 01:01 | 4.8K | |
![[SND]](/icons/sound2.gif) | algaecide.mp3 | 14-Apr-2007 01:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | algae.mp3 | 14-Apr-2007 01:01 | 5.0K | |
![[SND]](/icons/sound2.gif) | alga.mp3 | 14-Apr-2007 01:01 | 5.9K | |
![[SND]](/icons/sound2.gif) | alg.mp3 | 14-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | alfvenwave.mp3 | 14-Apr-2007 01:01 | 17K | |
![[SND]](/icons/sound2.gif) | alfven.mp3 | 14-Apr-2007 01:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | alfustat.mp3 | 14-Apr-2007 01:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | alfur.mp3 | 14-Apr-2007 01:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | alfric.mp3 | 14-Apr-2007 01:01 | 5.9K | |
![[SND]](/icons/sound2.gif) | alfresco.mp3 | 14-Apr-2007 01:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | alfred.mp3 | 14-Apr-2007 01:01 | 5.7K | |
![[SND]](/icons/sound2.gif) | alforja.mp3 | 14-Apr-2007 01:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | alfonsoi.mp3 | 14-Apr-2007 01:01 | 27K | |
![[SND]](/icons/sound2.gif) | alfisol.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alfine.mp3 | 14-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | alfilaria.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alfie.mp3 | 14-Apr-2007 01:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | alfheim.mp3 | 14-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | alfgarnett.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alfatah.mp3 | 14-Apr-2007 01:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | alfaromeo.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alfaro.mp3 | 14-Apr-2007 01:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | alfarabi.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alfalfa.mp3 | 14-Apr-2007 01:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | alf.mp3 | 14-Apr-2007 01:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | alexiusi.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alexithymic.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alexithymia.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alexisnikolayevich.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alexismikhailovich.mp3 | 14-Apr-2007 01:00 | 17K | |
![[SND]](/icons/sound2.gif) | alexis.mp3 | 14-Apr-2007 00:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | alexipharmic.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexinic.mp3 | 14-Apr-2007 00:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | alexin.mp3 | 14-Apr-2007 00:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | alexicacus.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexia.mp3 | 14-Apr-2007 00:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | alexbow.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexandroupolis.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexandros.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexandrite.mp3 | 14-Apr-2007 00:59 | 10K | |
![[SND]](/icons/sound2.gif) | alexandrinus.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexandrine.mp3 | 14-Apr-2007 00:59 | 11K | |
![[SND]](/icons/sound2.gif) | alexandrina.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexandrafeodorovna.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexandra.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexanderson.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexanderseverus.mp3 | 14-Apr-2007 00:59 | 18K | |
![[SND]](/icons/sound2.gif) | alexanders.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexandernevski.mp3 | 14-Apr-2007 00:59 | 17K | |
![[SND]](/icons/sound2.gif) | alexa.mp3 | 14-Apr-2007 00:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | alex.mp3 | 14-Apr-2007 00:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | alewives.mp3 | 14-Apr-2007 00:58 | 11K | |
![[SND]](/icons/sound2.gif) | alewife.mp3 | 14-Apr-2007 00:58 | 6.8K | |
![[SND]](/icons/sound2.gif) | alevin.mp3 | 14-Apr-2007 00:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | aleutian.mp3 | 14-Apr-2007 00:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | aleus.mp3 | 14-Apr-2007 00:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | aleuronic.mp3 | 14-Apr-2007 00:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | aleurone.mp3 | 14-Apr-2007 00:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | aleuronat.mp3 | 14-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | aleuromancy.mp3 | 14-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | aleukia.mp3 | 14-Apr-2007 00:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | aleukemia.mp3 | 14-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | aletuvee.mp3 | 14-Apr-2007 00:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | alette.mp3 | 14-Apr-2007 00:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | alethiology.mp3 | 14-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | alethiologist.mp3 | 14-Apr-2007 00:58 | 17K | |
![[SND]](/icons/sound2.gif) | alethic.mp3 | 14-Apr-2007 00:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | alethia.mp3 | 14-Apr-2007 00:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | alethea.mp3 | 14-Apr-2007 00:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | alesund.mp3 | 14-Apr-2007 00:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | alessandri.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | alessandra.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | alesia.mp3 | 14-Apr-2007 00:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | ales.mp3 | 14-Apr-2007 00:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | alertness.mp3 | 14-Apr-2007 00:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | alert.mp3 | 14-Apr-2007 00:57 | 5.0K | |
![[SND]](/icons/sound2.gif) | alerion.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | alerce.mp3 | 14-Apr-2007 00:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | alephbet.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | aleph.mp3 | 14-Apr-2007 00:57 | 5.7K | |
![[SND]](/icons/sound2.gif) | aleph-null.mp3 | 14-Apr-2007 00:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | alene.mp3 | 14-Apr-2007 00:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | alencon.mp3 | 14-Apr-2007 00:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | alembication.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | alembicated.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | alembic.mp3 | 14-Apr-2007 00:57 | 6.4K | |
![[SND]](/icons/sound2.gif) | alembertd.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | alemanni.mp3 | 14-Apr-2007 00:57 | 17K | |
![[SND]](/icons/sound2.gif) | aleksei.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | aleksandropol.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | aleksandrafyodorovna.mp3 | 14-Apr-2007 00:56 | 27K | |
![[SND]](/icons/sound2.gif) | alekhine.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | aleichemshalom.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | alehouse.mp3 | 14-Apr-2007 00:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | alegria.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | alegar.mp3 | 14-Apr-2007 00:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | alee.mp3 | 14-Apr-2007 00:56 | 5.9K | |
![[SND]](/icons/sound2.gif) | alectryomancy.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | alecto.mp3 | 14-Apr-2007 00:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | alecost.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | aleconner.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | alecithal.mp3 | 14-Apr-2007 00:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | alec.mp3 | 14-Apr-2007 00:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | aleatory.mp3 | 14-Apr-2007 00:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | aleatorism.mp3 | 14-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | aleatoric.mp3 | 14-Apr-2007 00:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | aleardi.mp3 | 14-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | aleak.mp3 | 14-Apr-2007 00:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | aleajactaest.mp3 | 14-Apr-2007 00:55 | 27K | |
![[SND]](/icons/sound2.gif) | alea jacta est.mp3 | 14-Apr-2007 00:55 | 16K | |
![[SND]](/icons/sound2.gif) | alea.mp3 | 14-Apr-2007 00:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | ale.mp3 | 14-Apr-2007 00:55 | 4.6K | |
![[SND]](/icons/sound2.gif) | aldwin.mp3 | 14-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | aldusmanutius.mp3 | 14-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | aldrin.mp3 | 14-Apr-2007 00:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | aldridge.mp3 | 14-Apr-2007 00:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | aldoxime.mp3 | 14-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | aldosteronism.mp3 | 14-Apr-2007 00:55 | 12K | |
![[SND]](/icons/sound2.gif) | aldosterone.mp3 | 14-Apr-2007 00:55 | 11K | |
![[SND]](/icons/sound2.gif) | aldose.mp3 | 14-Apr-2007 00:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | aldomet.mp3 | 14-Apr-2007 00:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | aldolization.mp3 | 14-Apr-2007 00:55 | 12K | |
![[SND]](/icons/sound2.gif) | aldolase.mp3 | 14-Apr-2007 00:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | aldol.mp3 | 14-Apr-2007 00:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | aldohexose.mp3 | 14-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | aldis.mp3 | 14-Apr-2007 00:55 | 17K | |
![[SND]](/icons/sound2.gif) | aldington.mp3 | 14-Apr-2007 00:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | aldine.mp3 | 14-Apr-2007 00:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | aldicarb.mp3 | 14-Apr-2007 00:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | alderwoman.mp3 | 14-Apr-2007 00:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | alderperson.mp3 | 14-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | aldermaston.mp3 | 14-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | aldermanry.mp3 | 14-Apr-2007 00:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | aldermanic.mp3 | 14-Apr-2007 00:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | aldermancy.mp3 | 14-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | alderman.mp3 | 14-Apr-2007 00:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | alder.mp3 | 14-Apr-2007 00:54 | 5.2K | |
![[SND]](/icons/sound2.gif) | aldente.mp3 | 14-Apr-2007 00:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | al dente.mp3 | 14-Apr-2007 00:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | aldehydic.mp3 | 14-Apr-2007 00:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | aldehyde.mp3 | 14-Apr-2007 00:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | aldeburgh.mp3 | 14-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | aldabraislands.mp3 | 14-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | alcyoneus.mp3 | 14-Apr-2007 00:54 | 17K | |
![[SND]](/icons/sound2.gif) | alcyonarian.mp3 | 14-Apr-2007 00:54 | 12K | |
![[SND]](/icons/sound2.gif) | alcoved.mp3 | 14-Apr-2007 00:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | alcove.mp3 | 14-Apr-2007 00:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | alcoranist.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoranic.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcor.mp3 | 14-Apr-2007 00:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | alcometer.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholytic.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholysis.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholometry.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholometrical.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholometer.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholize.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholization.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholist.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholism.mp3 | 14-Apr-2007 00:53 | 10K | |
![[SND]](/icons/sound2.gif) | alcoholicity.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoholically.mp3 | 14-Apr-2007 00:53 | 10K | |
![[SND]](/icons/sound2.gif) | alcoholic.mp3 | 14-Apr-2007 00:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | alcoholate.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcohol.mp3 | 14-Apr-2007 00:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | alcock.mp3 | 14-Apr-2007 00:53 | 17K | |
![[SND]](/icons/sound2.gif) | alcoa.mp3 | 14-Apr-2007 00:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | alco.mp3 | 14-Apr-2007 00:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | alcmanicverse.mp3 | 14-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | alcman.mp3 | 14-Apr-2007 00:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | alcmaeon.mp3 | 14-Apr-2007 00:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | alcithoe.mp3 | 14-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | alcinous.mp3 | 14-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | alcides.mp3 | 14-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | alcid.mp3 | 14-Apr-2007 00:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | alcibiadean.mp3 | 14-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | alchuine.mp3 | 14-Apr-2007 00:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | alcheringa.mp3 | 14-Apr-2007 00:52 | 17K | |
![[SND]](/icons/sound2.gif) | alchemy.mp3 | 14-Apr-2007 00:52 | 5.4K | |
![[SND]](/icons/sound2.gif) | alchemize.mp3 | 14-Apr-2007 00:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | alchemistical.mp3 | 14-Apr-2007 00:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | alchemistic.mp3 | 14-Apr-2007 00:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | alchemist.mp3 | 14-Apr-2007 00:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | alchemically.mp3 | 14-Apr-2007 00:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | alchemical.mp3 | 14-Apr-2007 00:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | alchemic.mp3 | 14-Apr-2007 00:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | alcazar.mp3 | 14-Apr-2007 00:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | alcayde.mp3 | 14-Apr-2007 00:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | alcanhighway.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | alcaligenes.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | alcalde.mp3 | 14-Apr-2007 00:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | alcaide.mp3 | 14-Apr-2007 00:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | alcaic.mp3 | 14-Apr-2007 00:51 | 6.6K | |
![[SND]](/icons/sound2.gif) | alcahest.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | alcade.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | albuterol.mp3 | 14-Apr-2007 00:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | alburnum.mp3 | 14-Apr-2007 00:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | alburnous.mp3 | 14-Apr-2007 00:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | albumose.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | albuminuric.mp3 | 14-Apr-2007 00:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | albuminuria.mp3 | 14-Apr-2007 00:51 | 11K | |
![[SND]](/icons/sound2.gif) | albuminous.mp3 | 14-Apr-2007 00:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | albuminoidal.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | albuminoid.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | albuminize.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | albuminate.mp3 | 14-Apr-2007 00:51 | 17K | |
![[SND]](/icons/sound2.gif) | albumin.mp3 | 14-Apr-2007 00:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | albumenizer.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albumenize.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albumen.mp3 | 14-Apr-2007 00:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | albumblatt.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | album.mp3 | 14-Apr-2007 00:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | albukhari.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albugineous.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albuginea.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albronze.mp3 | 14-Apr-2007 00:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | albrecht.mp3 | 14-Apr-2007 00:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | alborg.mp3 | 14-Apr-2007 00:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | alborak.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albondigas.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albomycin.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albizzia.mp3 | 14-Apr-2007 00:50 | 27K | |
![[SND]](/icons/sound2.gif) | albizucampos.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albitic.mp3 | 14-Apr-2007 00:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | albite.mp3 | 14-Apr-2007 00:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | albiroid.mp3 | 14-Apr-2007 00:50 | 17K | |
![[SND]](/icons/sound2.gif) | albinus.mp3 | 14-Apr-2007 00:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | albinotic.mp3 | 14-Apr-2007 00:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | albino.mp3 | 14-Apr-2007 00:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | albinistic.mp3 | 14-Apr-2007 00:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | albinism.mp3 | 14-Apr-2007 00:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | albin.mp3 | 14-Apr-2007 00:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | albescent.mp3 | 14-Apr-2007 00:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | albescence.mp3 | 14-Apr-2007 00:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | albertusmagnus.mp3 | 14-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | alberto.mp3 | 14-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | albertnyanza.mp3 | 14-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | albertite.mp3 | 14-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | albertist.mp3 | 14-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | albertine.mp3 | 14-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | albertibass.mp3 | 14-Apr-2007 00:49 | 17K | |
![[SND]](/icons/sound2.gif) | alberti.mp3 | 14-Apr-2007 00:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | albert.mp3 | 14-Apr-2007 00:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | alberoni.mp3 | 14-Apr-2007 00:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | alberich.mp3 | 14-Apr-2007 00:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | albergue.mp3 | 14-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | albergo.mp3 | 14-Apr-2007 00:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | albeit.mp3 | 14-Apr-2007 00:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | albedometer.mp3 | 14-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | albedo.mp3 | 14-Apr-2007 00:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | albay.mp3 | 14-Apr-2007 00:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | albattani.mp3 | 14-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | albatross.mp3 | 14-Apr-2007 00:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | albategnius.mp3 | 14-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | albata.mp3 | 14-Apr-2007 00:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | albarium.mp3 | 14-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | albarello.mp3 | 14-Apr-2007 00:48 | 17K | |
![[SND]](/icons/sound2.gif) | albanization.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | albanese.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | alban.mp3 | 14-Apr-2007 00:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | albamycin.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | albalonga.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | albacore.mp3 | 14-Apr-2007 00:47 | 6.8K | |
![[SND]](/icons/sound2.gif) | alba.mp3 | 14-Apr-2007 00:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | alb.mp3 | 14-Apr-2007 00:47 | 4.6K | |
![[SND]](/icons/sound2.gif) | alazingara.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | alaviennoise.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | alavapeur.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | alava.mp3 | 14-Apr-2007 00:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | alateen.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | alate.mp3 | 14-Apr-2007 00:47 | 5.4K | |
![[SND]](/icons/sound2.gif) | alastrim.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | alastor.mp3 | 14-Apr-2007 00:47 | 17K | |
![[SND]](/icons/sound2.gif) | alastair.mp3 | 14-Apr-2007 00:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | alashari.mp3 | 14-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | alas.mp3 | 14-Apr-2007 00:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | alary.mp3 | 14-Apr-2007 00:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | alarusse.mp3 | 14-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | a la russe.mp3 | 13-Apr-2007 22:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | alarum.mp3 | 14-Apr-2007 00:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | alarmist.mp3 | 14-Apr-2007 00:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | alarmism.mp3 | 14-Apr-2007 00:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | alarmingly.mp3 | 14-Apr-2007 00:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | alarming.mp3 | 14-Apr-2007 00:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | alarmedly.mp3 | 14-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | alarmed.mp3 | 14-Apr-2007 00:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | alarmable.mp3 | 14-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | alarm.mp3 | 14-Apr-2007 00:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | alarigueur.mp3 | 14-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | alarcon.mp3 | 14-Apr-2007 00:46 | 17K | |
![[SND]](/icons/sound2.gif) | alar.mp3 | 14-Apr-2007 00:46 | 4.8K | |
![[SND]](/icons/sound2.gif) | alapage.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | a la page.mp3 | 13-Apr-2007 22:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | alapa.mp3 | 14-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | alap.mp3 | 14-Apr-2007 00:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | alaouite.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alanyl.mp3 | 14-Apr-2007 00:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | alantstarch.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alanon.mp3 | 14-Apr-2007 00:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | alannah.mp3 | 14-Apr-2007 00:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | alanine.mp3 | 14-Apr-2007 00:45 | 6.1K | |
![[SND]](/icons/sound2.gif) | alani.mp3 | 14-Apr-2007 00:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | alanglaise.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alandislands.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | aland.mp3 | 14-Apr-2007 00:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | alancienne.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alanbrooke.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alanadale.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alan.mp3 | 14-Apr-2007 00:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | alamort.mp3 | 14-Apr-2007 00:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | alamode.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | a la mode.mp3 | 13-Apr-2007 22:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | alamo.mp3 | 14-Apr-2007 00:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | alamiqui.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alamine.mp3 | 14-Apr-2007 00:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | alamericaine.mp3 | 14-Apr-2007 00:45 | 17K | |
![[SND]](/icons/sound2.gif) | alamein.mp3 | 14-Apr-2007 00:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | alameda.mp3 | 14-Apr-2007 00:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | alamannic.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alamanni.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alaman.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alalia.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alalcomeneus.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alalcomenean.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alala.mp3 | 14-Apr-2007 00:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | alaking.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | a la king.mp3 | 13-Apr-2007 22:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | alajuela.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alainfournier.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alain.mp3 | 14-Apr-2007 00:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | alaimountains.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | a la grecque.mp3 | 13-Apr-2007 22:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | alagoz.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alagez.mp3 | 14-Apr-2007 00:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | alafrancaise.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | a la francaise.mp3 | 13-Apr-2007 22:31 | 11K | |
![[SND]](/icons/sound2.gif) | alafghani.mp3 | 14-Apr-2007 00:44 | 17K | |
![[SND]](/icons/sound2.gif) | alae.mp3 | 14-Apr-2007 00:44 | 5.4K | |
![[SND]](/icons/sound2.gif) | aladag.mp3 | 14-Apr-2007 00:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | alacrity.mp3 | 14-Apr-2007 00:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | alacritous.mp3 | 14-Apr-2007 00:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | alack.mp3 | 14-Apr-2007 00:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | alachlor.mp3 | 14-Apr-2007 00:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | alacarte.mp3 | 14-Apr-2007 00:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | a la carte.mp3 | 13-Apr-2007 22:31 | 6.6K | |
![[SND]](/icons/sound2.gif) | alabroche.mp3 | 14-Apr-2007 00:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | alabonneheure.mp3 | 14-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | a la bonne heure.mp3 | 13-Apr-2007 22:31 | 9.3K | |
![[SND]](/icons/sound2.gif) | a la belle etoile.mp3 | 13-Apr-2007 22:31 | 11K | |
![[SND]](/icons/sound2.gif) | alabastrum.mp3 | 14-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | alabastron.mp3 | 14-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | alabastrine.mp3 | 14-Apr-2007 00:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | alabastos.mp3 | 14-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | alabaster.mp3 | 14-Apr-2007 00:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | alabandon.mp3 | 14-Apr-2007 00:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | alabandite.mp3 | 14-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | alabamine.mp3 | 14-Apr-2007 00:43 | 17K | |
![[SND]](/icons/sound2.gif) | ala.mp3 | 14-Apr-2007 00:43 | 5.2K | |
![[SND]](/icons/sound2.gif) | a la.mp3 | 13-Apr-2007 22:31 | 5.2K | |
![[SND]](/icons/sound2.gif) | al.mp3 | 14-Apr-2007 00:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | al-ki.mp3 | 14-Apr-2007 01:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | a l'improviste.mp3 | 13-Apr-2007 22:31 | 11K | |
![[SND]](/icons/sound2.gif) | a l'anglaise.mp3 | 13-Apr-2007 22:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | a l'americaine.mp3 | 13-Apr-2007 22:31 | 10K | |
![[SND]](/icons/sound2.gif) | a l'abandon.mp3 | 13-Apr-2007 22:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | akvavit.mp3 | 14-Apr-2007 00:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | akureyri.mp3 | 14-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | akure.mp3 | 14-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | akule.mp3 | 14-Apr-2007 00:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | akubra.mp3 | 14-Apr-2007 00:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | akuaku.mp3 | 14-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | aku.mp3 | 14-Apr-2007 00:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | aktyubinsk.mp3 | 14-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | aktograph.mp3 | 14-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | aksum.mp3 | 14-Apr-2007 00:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | akrotiri.mp3 | 14-Apr-2007 00:42 | 17K | |
![[SND]](/icons/sound2.gif) | akroter.mp3 | 14-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | akratic.mp3 | 14-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | akrasia.mp3 | 14-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | akmolinsk.mp3 | 14-Apr-2007 00:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | akkra.mp3 | 14-Apr-2007 00:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | akinetic.mp3 | 14-Apr-2007 00:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | akinete.mp3 | 14-Apr-2007 00:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | akinesia.mp3 | 14-Apr-2007 00:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | akin.mp3 | 14-Apr-2007 00:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | akimiskiisland.mp3 | 14-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | akimbo.mp3 | 14-Apr-2007 00:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | akil.mp3 | 14-Apr-2007 00:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | akibabenjoseph.mp3 | 14-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | akiapolaau.mp3 | 14-Apr-2007 00:41 | 17K | |
![[SND]](/icons/sound2.gif) | akhnaton.mp3 | 14-Apr-2007 00:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | akhmatova.mp3 | 14-Apr-2007 00:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | akhetaton.mp3 | 14-Apr-2007 00:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | akhenaten.mp3 | 14-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | akhara.mp3 | 14-Apr-2007 00:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | akhaia.mp3 | 14-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | akh.mp3 | 14-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | aketon.mp3 | 14-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | akenial.mp3 | 14-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | akene.mp3 | 14-Apr-2007 00:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | akempis.mp3 | 14-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | akeldama.mp3 | 14-Apr-2007 00:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | akela.mp3 | 14-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | akee.mp3 | 14-Apr-2007 00:40 | 5.0K | |
![[SND]](/icons/sound2.gif) | akebi.mp3 | 14-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | akeake.mp3 | 14-Apr-2007 00:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | ake.mp3 | 14-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | akathisia.mp3 | 14-Apr-2007 00:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | akasha.mp3 | 14-Apr-2007 00:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | akarnania.mp3 | 14-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | akamai.mp3 | 14-Apr-2007 00:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | akala.mp3 | 14-Apr-2007 00:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | akademi.mp3 | 14-Apr-2007 00:40 | 17K | |
![[SND]](/icons/sound2.gif) | akaba.mp3 | 14-Apr-2007 00:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ak.mp3 | 14-Apr-2007 00:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ajutage.mp3 | 14-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | ajumble.mp3 | 14-Apr-2007 00:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | ajuga.mp3 | 14-Apr-2007 00:39 | 5.5K | |
![[SND]](/icons/sound2.gif) | ajour.mp3 | 14-Apr-2007 00:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | ajodhya.mp3 | 14-Apr-2007 00:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | ajmermerwara.mp3 | 14-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | ajivika.mp3 | 14-Apr-2007 00:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | ajiva.mp3 | 14-Apr-2007 00:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ajee.mp3 | 14-Apr-2007 00:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ajar.mp3 | 14-Apr-2007 00:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | aixlesbains.mp3 | 14-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | aixlachapelle.mp3 | 14-Apr-2007 00:39 | 17K | |
![[SND]](/icons/sound2.gif) | aixenprovence.mp3 | 14-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | aiuslocutius.mp3 | 14-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | aitolia.mp3 | 14-Apr-2007 00:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | aitken.mp3 | 14-Apr-2007 00:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | aitchless.mp3 | 14-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | aitchbone.mp3 | 14-Apr-2007 00:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | aitch.mp3 | 14-Apr-2007 00:38 | 4.5K | |
![[SND]](/icons/sound2.gif) | ait.mp3 | 14-Apr-2007 00:38 | 3.2K | |
![[SND]](/icons/sound2.gif) | aisleway.mp3 | 14-Apr-2007 00:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | aisled.mp3 | 14-Apr-2007 00:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | aisle.mp3 | 14-Apr-2007 00:38 | 4.1K | |
![[SND]](/icons/sound2.gif) | aishah.mp3 | 14-Apr-2007 00:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | aisha.mp3 | 14-Apr-2007 00:38 | 27K | |
![[SND]](/icons/sound2.gif) | airydisc.mp3 | 14-Apr-2007 00:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | airy.mp3 | 14-Apr-2007 00:38 | 4.6K | |
![[SND]](/icons/sound2.gif) | airy-fairy.mp3 | 14-Apr-2007 00:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | airworthy.mp3 | 14-Apr-2007 00:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | airway.mp3 | 14-Apr-2007 00:38 | 5.5K | |
![[SND]](/icons/sound2.gif) | airwaves.mp3 | 14-Apr-2007 00:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | airwave.mp3 | 14-Apr-2007 00:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | airvarie.mp3 | 14-Apr-2007 00:38 | 17K | |
![[SND]](/icons/sound2.gif) | airtime.mp3 | 14-Apr-2007 00:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | airtight.mp3 | 14-Apr-2007 00:37 | 5.5K | |
![[SND]](/icons/sound2.gif) | airth.mp3 | 14-Apr-2007 00:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | airtel.mp3 | 14-Apr-2007 00:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | airt.mp3 | 14-Apr-2007 00:37 | 4.5K | |
![[SND]](/icons/sound2.gif) | airstrip.mp3 | 14-Apr-2007 00:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | airstream.mp3 | 14-Apr-2007 00:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | airspeed.mp3 | 14-Apr-2007 00:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | airspace.mp3 | 14-Apr-2007 00:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | airsick.mp3 | 14-Apr-2007 00:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | airship.mp3 | 14-Apr-2007 00:37 | 4.5K | |
![[SND]](/icons/sound2.gif) | airscrew.mp3 | 14-Apr-2007 00:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | airscape.mp3 | 14-Apr-2007 00:37 | 17K | |
![[SND]](/icons/sound2.gif) | airpower.mp3 | 14-Apr-2007 00:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | airpost.mp3 | 14-Apr-2007 00:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | airport.mp3 | 14-Apr-2007 00:37 | 5.5K | |
![[SND]](/icons/sound2.gif) | airplay.mp3 | 14-Apr-2007 00:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | airplane.mp3 | 14-Apr-2007 00:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | airpark.mp3 | 14-Apr-2007 00:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | airmobile.mp3 | 14-Apr-2007 00:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | airmanship.mp3 | 14-Apr-2007 00:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | airman.mp3 | 14-Apr-2007 00:37 | 5.2K | |
![[SND]](/icons/sound2.gif) | airmail.mp3 | 14-Apr-2007 00:37 | 5.7K | |
![[SND]](/icons/sound2.gif) | airmada.mp3 | 14-Apr-2007 00:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | airliner.mp3 | 14-Apr-2007 00:37 | 6.1K | |
![[SND]](/icons/sound2.gif) | airline.mp3 | 14-Apr-2007 00:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | airlike.mp3 | 14-Apr-2007 00:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | airlift.mp3 | 14-Apr-2007 00:36 | 5.5K | |
![[SND]](/icons/sound2.gif) | airlessness.mp3 | 14-Apr-2007 00:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | airless.mp3 | 14-Apr-2007 00:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | airish.mp3 | 14-Apr-2007 00:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | airing.mp3 | 14-Apr-2007 00:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | airiness.mp3 | 14-Apr-2007 00:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | airily.mp3 | 14-Apr-2007 00:36 | 5.7K | |
![[SND]](/icons/sound2.gif) | airhole.mp3 | 14-Apr-2007 00:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | airheaded.mp3 | 14-Apr-2007 00:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | airhead.mp3 | 14-Apr-2007 00:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | airglow.mp3 | 14-Apr-2007 00:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | airfreight.mp3 | 14-Apr-2007 00:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | airframe.mp3 | 14-Apr-2007 00:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | airfoil.mp3 | 14-Apr-2007 00:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | airflow.mp3 | 14-Apr-2007 00:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | airfield.mp3 | 14-Apr-2007 00:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | airfare.mp3 | 14-Apr-2007 00:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | airer.mp3 | 14-Apr-2007 00:36 | 5.4K | |
![[SND]](/icons/sound2.gif) | airedale.mp3 | 14-Apr-2007 00:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | airdrop.mp3 | 14-Apr-2007 00:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | airdrome.mp3 | 14-Apr-2007 00:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | airdate.mp3 | 14-Apr-2007 00:35 | 5.7K | |
![[SND]](/icons/sound2.gif) | aircrewman.mp3 | 14-Apr-2007 00:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | aircrew.mp3 | 14-Apr-2007 00:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | aircraftman.mp3 | 14-Apr-2007 00:35 | 17K | |
![[SND]](/icons/sound2.gif) | aircraft.mp3 | 14-Apr-2007 00:35 | 6.8K | |
![[SND]](/icons/sound2.gif) | aircav.mp3 | 14-Apr-2007 00:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | airbus.mp3 | 14-Apr-2007 00:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | airburst.mp3 | 14-Apr-2007 00:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | airbrush.mp3 | 14-Apr-2007 00:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | airbrasive.mp3 | 14-Apr-2007 00:35 | 17K | |
![[SND]](/icons/sound2.gif) | airborne.mp3 | 14-Apr-2007 00:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | airboat.mp3 | 14-Apr-2007 00:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | airattache.mp3 | 14-Apr-2007 00:35 | 17K | |
![[SND]](/icons/sound2.gif) | air.mp3 | 14-Apr-2007 00:35 | 4.6K | |
![[SND]](/icons/sound2.gif) | air-to-air.mp3 | 14-Apr-2007 00:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | air-minded.mp3 | 14-Apr-2007 00:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | air-dry.mp3 | 14-Apr-2007 00:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | air-droppable.mp3 | 14-Apr-2007 00:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | air-conditioning.mp3 | 14-Apr-2007 00:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | air-condition.mp3 | 14-Apr-2007 00:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | air-breathing.mp3 | 14-Apr-2007 00:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | aiora.mp3 | 14-Apr-2007 00:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | aioli.mp3 | 14-Apr-2007 00:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | aintree.mp3 | 14-Apr-2007 00:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | aint.mp3 | 14-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | aino.mp3 | 14-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | ainhum.mp3 | 14-Apr-2007 00:34 | 17K | |
![[SND]](/icons/sound2.gif) | ainee.mp3 | 14-Apr-2007 00:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | aine.mp3 | 14-Apr-2007 00:34 | 5.7K | |
![[SND]](/icons/sound2.gif) | ain.mp3 | 14-Apr-2007 00:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | ain't.mp3 | 14-Apr-2007 00:35 | 4.8K | |
![[SND]](/icons/sound2.gif) | aimlessness.mp3 | 14-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | aimless.mp3 | 14-Apr-2007 00:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | aimfully.mp3 | 14-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | aimee.mp3 | 14-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | aimak.mp3 | 14-Apr-2007 00:34 | 27K | |
![[SND]](/icons/sound2.gif) | aim.mp3 | 14-Apr-2007 00:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | ailurophobic.mp3 | 14-Apr-2007 00:34 | 17K | |
![[SND]](/icons/sound2.gif) | ailurophobia.mp3 | 14-Apr-2007 00:34 | 17K | |
![[SND]](/icons/sound2.gif) | ailurophobe.mp3 | 14-Apr-2007 00:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | ailurophilic.mp3 | 14-Apr-2007 00:34 | 17K | |
![[SND]](/icons/sound2.gif) | ailurophilia.mp3 | 14-Apr-2007 00:34 | 17K | |
![[SND]](/icons/sound2.gif) | ailurophile.mp3 | 14-Apr-2007 00:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | ailment.mp3 | 14-Apr-2007 00:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | ailing.mp3 | 14-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | ailette.mp3 | 14-Apr-2007 00:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | aileron.mp3 | 14-Apr-2007 00:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | aileen.mp3 | 14-Apr-2007 00:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | ailanthus.mp3 | 14-Apr-2007 00:33 | 9.6K | |
![[SND]](/icons/sound2.gif) | ailanthic.mp3 | 14-Apr-2007 00:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | ail.mp3 | 14-Apr-2007 00:33 | 5.7K | |
![[SND]](/icons/sound2.gif) | aikona.mp3 | 14-Apr-2007 00:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | aikido.mp3 | 14-Apr-2007 00:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | aiguilletted.mp3 | 14-Apr-2007 00:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | aiguillette.mp3 | 14-Apr-2007 00:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | aiguille.mp3 | 14-Apr-2007 00:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | aigrette.mp3 | 14-Apr-2007 00:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | aiglet.mp3 | 14-Apr-2007 00:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | aie.mp3 | 14-Apr-2007 00:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | aids.mp3 | 14-Apr-2007 00:33 | 6.3K | |
![[SND]](/icons/sound2.gif) | aidos.mp3 | 14-Apr-2007 00:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | aidman.mp3 | 14-Apr-2007 00:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | aidless.mp3 | 14-Apr-2007 00:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | aides-de-camp.mp3 | 14-Apr-2007 00:33 | 10K | |
![[SND]](/icons/sound2.gif) | aidememoire.mp3 | 14-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | aidedecamp.mp3 | 14-Apr-2007 00:33 | 17K | |
![[SND]](/icons/sound2.gif) | aide.mp3 | 14-Apr-2007 00:33 | 5.7K | |
![[SND]](/icons/sound2.gif) | aide-toi, le ciel t'aidera.mp3 | 14-Apr-2007 00:33 | 18K | |
![[SND]](/icons/sound2.gif) | aide-memoire.mp3 | 14-Apr-2007 00:33 | 10K | |
![[SND]](/icons/sound2.gif) | aide-de-camp.mp3 | 14-Apr-2007 00:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | aiddecamp.mp3 | 14-Apr-2007 00:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | aidant.mp3 | 14-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | aidance.mp3 | 14-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | aidan.mp3 | 14-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | aida.mp3 | 14-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | aid.mp3 | 14-Apr-2007 00:32 | 5.5K | |
![[SND]](/icons/sound2.gif) | aiblins.mp3 | 14-Apr-2007 00:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | ai.mp3 | 14-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahuzzath.mp3 | 14-Apr-2007 00:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | ahuramazda.mp3 | 14-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | ahura.mp3 | 14-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahungered.mp3 | 14-Apr-2007 00:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | ahunavarya.mp3 | 14-Apr-2007 00:32 | 17K | |
![[SND]](/icons/sound2.gif) | ahull.mp3 | 14-Apr-2007 00:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | a huis clos.mp3 | 13-Apr-2007 22:31 | 10K | |
![[SND]](/icons/sound2.gif) | ahu.mp3 | 14-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahtna.mp3 | 14-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahoy.mp3 | 14-Apr-2007 00:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | ahorse.mp3 | 14-Apr-2007 00:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | ahom.mp3 | 14-Apr-2007 00:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | aholt.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | aholic.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahold.mp3 | 14-Apr-2007 00:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | ahnfeltsseaweed.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahmosei.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahmednagar.mp3 | 14-Apr-2007 00:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | ahmedabad.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahmadiya.mp3 | 14-Apr-2007 00:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | ahmadi.mp3 | 14-Apr-2007 00:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahkio.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahithophel.mp3 | 14-Apr-2007 00:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | ahistoricity.mp3 | 14-Apr-2007 00:31 | 11K | |
![[SND]](/icons/sound2.gif) | ahistoricism.mp3 | 14-Apr-2007 00:31 | 13K | |
![[SND]](/icons/sound2.gif) | ahistorically.mp3 | 14-Apr-2007 00:31 | 12K | |
![[SND]](/icons/sound2.gif) | ahistorical.mp3 | 14-Apr-2007 00:31 | 11K | |
![[SND]](/icons/sound2.gif) | ahistoric.mp3 | 14-Apr-2007 00:31 | 9.6K | |
![[SND]](/icons/sound2.gif) | ahishar.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahira.mp3 | 14-Apr-2007 00:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | ahir.mp3 | 14-Apr-2007 00:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahimsa.mp3 | 14-Apr-2007 00:31 | 9.6K | |
![[SND]](/icons/sound2.gif) | ahimelech.mp3 | 14-Apr-2007 00:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | ahimaaz.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahiezer.mp3 | 14-Apr-2007 00:31 | 17K | |
![[SND]](/icons/sound2.gif) | ahidjo.mp3 | 14-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahi.mp3 | 14-Apr-2007 00:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | ahh.mp3 | 14-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | ahermatypic.mp3 | 14-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | ahermatype.mp3 | 14-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | ahemeral.mp3 | 14-Apr-2007 00:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | ahem.mp3 | 14-Apr-2007 00:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | aheap.mp3 | 14-Apr-2007 00:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | ahead.mp3 | 14-Apr-2007 00:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | ahchoo.mp3 | 14-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | ahaziah.mp3 | 14-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | ahaz.mp3 | 14-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | ahautevoix.mp3 | 14-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | ahasuerus.mp3 | 14-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | ahankara.mp3 | 14-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | ahadhaam.mp3 | 14-Apr-2007 00:30 | 17K | |
![[SND]](/icons/sound2.gif) | ahab.mp3 | 14-Apr-2007 00:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | aha.mp3 | 14-Apr-2007 00:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | ah.mp3 | 14-Apr-2007 00:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | agustini.mp3 | 14-Apr-2007 00:30 | 27K | |
![[SND]](/icons/sound2.gif) | agura.mp3 | 14-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | agung.mp3 | 14-Apr-2007 00:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | agulhas.mp3 | 14-Apr-2007 00:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | aguishly.mp3 | 14-Apr-2007 00:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | aguish.mp3 | 14-Apr-2007 00:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | aguelike.mp3 | 14-Apr-2007 00:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | ague.mp3 | 14-Apr-2007 00:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | aguardiente.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | agua.mp3 | 14-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | agrypnotic.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | aground.mp3 | 14-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | agrotera.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | agrostology.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | agrostologist.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | agrostography.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | agrostographical.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | agrostemma.mp3 | 14-Apr-2007 00:29 | 17K | |
![[SND]](/icons/sound2.gif) | agronomy.mp3 | 14-Apr-2007 00:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | agronomist.mp3 | 14-Apr-2007 00:29 | 9.8K | |
![[SND]](/icons/sound2.gif) | agronomically.mp3 | 14-Apr-2007 00:29 | 10K | |
![[SND]](/icons/sound2.gif) | agronomic.mp3 | 14-Apr-2007 00:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | agronome.mp3 | 14-Apr-2007 00:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | agromania.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agrology.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agrological.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agrogorod.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agroforestry.mp3 | 14-Apr-2007 00:28 | 12K | |
![[SND]](/icons/sound2.gif) | agroforester.mp3 | 14-Apr-2007 00:28 | 11K | |
![[SND]](/icons/sound2.gif) | agroecology.mp3 | 14-Apr-2007 00:28 | 12K | |
![[SND]](/icons/sound2.gif) | agrochemical.mp3 | 14-Apr-2007 00:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | agro.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agro-industrial.mp3 | 14-Apr-2007 00:28 | 11K | |
![[SND]](/icons/sound2.gif) | agrius.mp3 | 14-Apr-2007 00:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | agriope.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agriology.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agriologist.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agrin.mp3 | 14-Apr-2007 00:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | agrimony.mp3 | 14-Apr-2007 00:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | agriculturist.mp3 | 14-Apr-2007 00:28 | 11K | |
![[SND]](/icons/sound2.gif) | agriculture.mp3 | 14-Apr-2007 00:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | agriculturally.mp3 | 14-Apr-2007 00:28 | 17K | |
![[SND]](/icons/sound2.gif) | agriculturalist.mp3 | 14-Apr-2007 00:28 | 12K | |
![[SND]](/icons/sound2.gif) | agricultural.mp3 | 14-Apr-2007 00:28 | 10K | |
![[SND]](/icons/sound2.gif) | agrichemical.mp3 | 14-Apr-2007 00:27 | 10K | |
![[SND]](/icons/sound2.gif) | agribusinessman.mp3 | 14-Apr-2007 00:27 | 11K | |
![[SND]](/icons/sound2.gif) | agribusiness.mp3 | 14-Apr-2007 00:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | agri.mp3 | 14-Apr-2007 00:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | agrestic.mp3 | 14-Apr-2007 00:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | agrestal.mp3 | 14-Apr-2007 00:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | agrement.mp3 | 14-Apr-2007 00:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | agrege.mp3 | 14-Apr-2007 00:27 | 17K | |
![[SND]](/icons/sound2.gif) | agreement.mp3 | 14-Apr-2007 00:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | agreeingly.mp3 | 14-Apr-2007 00:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | agreed.mp3 | 14-Apr-2007 00:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | agreeably.mp3 | 14-Apr-2007 00:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | agreeableness.mp3 | 14-Apr-2007 00:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | agreeable.mp3 | 14-Apr-2007 00:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | agreeability.mp3 | 14-Apr-2007 00:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | agree.mp3 | 14-Apr-2007 00:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | agreation.mp3 | 14-Apr-2007 00:27 | 17K | |
![[SND]](/icons/sound2.gif) | agravic.mp3 | 14-Apr-2007 00:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | agrarianly.mp3 | 14-Apr-2007 00:27 | 17K | |
![[SND]](/icons/sound2.gif) | agrarianism.mp3 | 14-Apr-2007 00:27 | 11K | |
![[SND]](/icons/sound2.gif) | agrarian.mp3 | 14-Apr-2007 00:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | agraphic.mp3 | 14-Apr-2007 00:27 | 17K | |
![[SND]](/icons/sound2.gif) | agraphia.mp3 | 14-Apr-2007 00:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | agrapha.mp3 | 14-Apr-2007 00:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | agranulocytosis.mp3 | 14-Apr-2007 00:26 | 16K | |
![[SND]](/icons/sound2.gif) | agranulocytoses.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agranulocyte.mp3 | 14-Apr-2007 00:26 | 13K | |
![[SND]](/icons/sound2.gif) | agrandsfrais.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | a grands frais.mp3 | 13-Apr-2007 22:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | agrammatism.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agram.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agraffe.mp3 | 14-Apr-2007 00:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | agrafe.mp3 | 14-Apr-2007 00:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | agraeus.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agouti.mp3 | 14-Apr-2007 00:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | agouta.mp3 | 14-Apr-2007 00:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | agouara.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agorot.mp3 | 14-Apr-2007 00:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | agoraphobic.mp3 | 14-Apr-2007 00:26 | 9.5K | |
![[SND]](/icons/sound2.gif) | agoraphobia.mp3 | 14-Apr-2007 00:26 | 10K | |
![[SND]](/icons/sound2.gif) | agoraphobe.mp3 | 14-Apr-2007 00:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | agorae.mp3 | 14-Apr-2007 00:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | agora.mp3 | 14-Apr-2007 00:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | agony.mp3 | 14-Apr-2007 00:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | agonizingly.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agonizing.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agonizedly.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agonized.mp3 | 14-Apr-2007 00:26 | 17K | |
![[SND]](/icons/sound2.gif) | agonize.mp3 | 14-Apr-2007 00:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | agonistically.mp3 | 14-Apr-2007 00:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | agonistic.mp3 | 14-Apr-2007 00:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | agonist.mp3 | 14-Apr-2007 00:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | agonic.mp3 | 14-Apr-2007 00:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | agone.mp3 | 14-Apr-2007 00:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | agonal.mp3 | 14-Apr-2007 00:25 | 5.5K | |
![[SND]](/icons/sound2.gif) | agon.mp3 | 14-Apr-2007 00:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | agoing.mp3 | 14-Apr-2007 00:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | agogue.mp3 | 14-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | agogo.mp3 | 14-Apr-2007 00:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | agogics.mp3 | 14-Apr-2007 00:25 | 27K | |
![[SND]](/icons/sound2.gif) | agogic.mp3 | 14-Apr-2007 00:25 | 27K | |
![[SND]](/icons/sound2.gif) | agog.mp3 | 14-Apr-2007 00:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | ago.mp3 | 14-Apr-2007 00:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | agnusdei.mp3 | 14-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | agnuscastus.mp3 | 14-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | agnosticism.mp3 | 14-Apr-2007 00:25 | 11K | |
![[SND]](/icons/sound2.gif) | agnostically.mp3 | 14-Apr-2007 00:25 | 17K | |
![[SND]](/icons/sound2.gif) | agnostic.mp3 | 14-Apr-2007 00:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | agnosic.mp3 | 14-Apr-2007 00:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | agnosia.mp3 | 14-Apr-2007 00:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | agnominal.mp3 | 14-Apr-2007 00:24 | 17K | |
![[SND]](/icons/sound2.gif) | agnomina.mp3 | 14-Apr-2007 00:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | agnomen.mp3 | 14-Apr-2007 00:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | agnolotti.mp3 | 14-Apr-2007 00:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | agnize.mp3 | 14-Apr-2007 00:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | agni.mp3 | 14-Apr-2007 00:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | agnel.mp3 | 14-Apr-2007 00:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | agnation.mp3 | 14-Apr-2007 00:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | agnatically.mp3 | 14-Apr-2007 00:24 | 17K | |
![[SND]](/icons/sound2.gif) | agnatic.mp3 | 14-Apr-2007 00:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | agnathous.mp3 | 14-Apr-2007 00:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | agnathan.mp3 | 14-Apr-2007 00:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | agnatha.mp3 | 14-Apr-2007 00:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | agnate.mp3 | 14-Apr-2007 00:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | agnail.mp3 | 14-Apr-2007 00:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | agminate.mp3 | 14-Apr-2007 00:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | agma.mp3 | 14-Apr-2007 00:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | aglycone.mp3 | 14-Apr-2007 00:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | aglycon.mp3 | 14-Apr-2007 00:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | aglucon.mp3 | 14-Apr-2007 00:24 | 17K | |
![[SND]](/icons/sound2.gif) | aglu.mp3 | 14-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | aglow.mp3 | 14-Apr-2007 00:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | aglossia.mp3 | 14-Apr-2007 00:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | aglossate.mp3 | 14-Apr-2007 00:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | aglomerular.mp3 | 14-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | aglitter.mp3 | 14-Apr-2007 00:23 | 6.3K | |
![[SND]](/icons/sound2.gif) | aglisten.mp3 | 14-Apr-2007 00:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | aglipayan.mp3 | 14-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | aglint.mp3 | 14-Apr-2007 00:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | aglimmer.mp3 | 14-Apr-2007 00:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | agley.mp3 | 14-Apr-2007 00:23 | 5.7K | |
![[SND]](/icons/sound2.gif) | aglet.mp3 | 14-Apr-2007 00:23 | 5.5K | |
![[SND]](/icons/sound2.gif) | agleam.mp3 | 14-Apr-2007 00:23 | 7.0K | |
![[SND]](/icons/sound2.gif) | aglare.mp3 | 14-Apr-2007 00:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | aglaophonofthasos.mp3 | 14-Apr-2007 00:23 | 18K | |
![[SND]](/icons/sound2.gif) | agitprop.mp3 | 14-Apr-2007 00:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | agitpop.mp3 | 14-Apr-2007 00:23 | 17K | |
![[SND]](/icons/sound2.gif) | agitatorial.mp3 | 14-Apr-2007 00:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | agitator.mp3 | 14-Apr-2007 00:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | agitato.mp3 | 14-Apr-2007 00:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | agitative.mp3 | 14-Apr-2007 00:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | agitational.mp3 | 14-Apr-2007 00:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | agitation.mp3 | 14-Apr-2007 00:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | agitatedly.mp3 | 14-Apr-2007 00:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | agitated.mp3 | 14-Apr-2007 00:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | agitate.mp3 | 14-Apr-2007 00:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | agita.mp3 | 14-Apr-2007 00:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | agistor.mp3 | 14-Apr-2007 00:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | agistment.mp3 | 14-Apr-2007 00:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | agist.mp3 | 14-Apr-2007 00:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | agism.mp3 | 14-Apr-2007 00:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | agiotage.mp3 | 14-Apr-2007 00:22 | 17K | |
![[SND]](/icons/sound2.gif) | agio.mp3 | 14-Apr-2007 00:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | aginner.mp3 | 14-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | aging.mp3 | 14-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | agin.mp3 | 14-Apr-2007 00:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | agility.mp3 | 14-Apr-2007 00:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | agileness.mp3 | 14-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | agilely.mp3 | 14-Apr-2007 00:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | agile.mp3 | 14-Apr-2007 00:22 | 5.2K | |
![[SND]](/icons/sound2.gif) | agilawood.mp3 | 14-Apr-2007 00:22 | 17K | |
![[SND]](/icons/sound2.gif) | aghast.mp3 | 14-Apr-2007 00:22 | 7.3K | |
![[SND]](/icons/sound2.gif) | aghan.mp3 | 14-Apr-2007 00:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | agha.mp3 | 14-Apr-2007 00:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | aggro.mp3 | 14-Apr-2007 00:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | aggrievement.mp3 | 14-Apr-2007 00:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | aggrievedness.mp3 | 14-Apr-2007 00:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | aggrievedly.mp3 | 14-Apr-2007 00:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | aggrieved.mp3 | 14-Apr-2007 00:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | aggrieve.mp3 | 14-Apr-2007 00:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | aggressor.mp3 | 14-Apr-2007 00:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | aggressivity.mp3 | 14-Apr-2007 00:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | aggressive.mp3 | 14-Apr-2007 00:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | aggression.mp3 | 14-Apr-2007 00:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | aggress.mp3 | 14-Apr-2007 00:21 | 6.4K | |
![[SND]](/icons/sound2.gif) | aggregometer.mp3 | 14-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | aggregatively.mp3 | 14-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | aggregative.mp3 | 14-Apr-2007 00:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | aggregational.mp3 | 14-Apr-2007 00:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | aggregation.mp3 | 14-Apr-2007 00:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | aggregateness.mp3 | 14-Apr-2007 00:21 | 27K | |
![[SND]](/icons/sound2.gif) | aggregate.mp3 | 14-Apr-2007 00:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | aggravator.mp3 | 14-Apr-2007 00:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | aggravation.mp3 | 14-Apr-2007 00:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | aggravatingly.mp3 | 14-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | aggravating.mp3 | 14-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | aggravated.mp3 | 14-Apr-2007 00:21 | 17K | |
![[SND]](/icons/sound2.gif) | aggravate.mp3 | 14-Apr-2007 00:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | aggrandizer.mp3 | 14-Apr-2007 00:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | aggrandizement.mp3 | 14-Apr-2007 00:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | aggrandize.mp3 | 14-Apr-2007 00:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | aggrade.mp3 | 14-Apr-2007 00:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | aggradational.mp3 | 14-Apr-2007 00:21 | 11K | |
![[SND]](/icons/sound2.gif) | aggradation.mp3 | 14-Apr-2007 00:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | agglutinogenic.mp3 | 14-Apr-2007 00:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | agglutinogen.mp3 | 14-Apr-2007 00:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | agglutinin.mp3 | 14-Apr-2007 00:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | agglutinative.mp3 | 14-Apr-2007 00:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | agglutination.mp3 | 14-Apr-2007 00:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | agglutinate.mp3 | 14-Apr-2007 00:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | agglutinant.mp3 | 14-Apr-2007 00:20 | 17K | |
![[SND]](/icons/sound2.gif) | agglutinable.mp3 | 14-Apr-2007 00:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | agglutinability.mp3 | 14-Apr-2007 00:20 | 11K | |
![[SND]](/icons/sound2.gif) | agglomerator.mp3 | 14-Apr-2007 00:20 | 27K | |
![[SND]](/icons/sound2.gif) | agglomerative.mp3 | 14-Apr-2007 00:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | agglomeration.mp3 | 14-Apr-2007 00:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | agglomerate.mp3 | 14-Apr-2007 00:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | aggiornamento.mp3 | 14-Apr-2007 00:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | aggie.mp3 | 14-Apr-2007 00:20 | 5.0K | |
![[SND]](/icons/sound2.gif) | agger.mp3 | 14-Apr-2007 00:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | agfay.mp3 | 14-Apr-2007 00:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | agfa.mp3 | 14-Apr-2007 00:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | ageusic.mp3 | 14-Apr-2007 00:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | ageusia.mp3 | 14-Apr-2007 00:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | agesilausii.mp3 | 14-Apr-2007 00:20 | 27K | |
![[SND]](/icons/sound2.gif) | agerpress.mp3 | 14-Apr-2007 00:19 | 17K | |
![[SND]](/icons/sound2.gif) | ageratum.mp3 | 14-Apr-2007 00:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | ager.mp3 | 14-Apr-2007 00:19 | 5.0K | |
![[SND]](/icons/sound2.gif) | age quod agis.mp3 | 14-Apr-2007 00:18 | 15K | |
![[SND]](/icons/sound2.gif) | agents provocateurs.mp3 | 14-Apr-2007 00:19 | 15K | |
![[SND]](/icons/sound2.gif) | agentry.mp3 | 14-Apr-2007 00:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | agentprovocateur.mp3 | 14-Apr-2007 00:19 | 17K | |
![[SND]](/icons/sound2.gif) | agent provocateur.mp3 | 14-Apr-2007 00:19 | 15K | |
![[SND]](/icons/sound2.gif) | agentive.mp3 | 14-Apr-2007 00:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | agentival.mp3 | 14-Apr-2007 00:19 | 17K | |
![[SND]](/icons/sound2.gif) | agenting.mp3 | 14-Apr-2007 00:19 | 6.8K | |
![[SND]](/icons/sound2.gif) | agential.mp3 | 14-Apr-2007 00:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | agent.mp3 | 14-Apr-2007 00:19 | 5.2K | |
![[SND]](/icons/sound2.gif) | agenor.mp3 | 14-Apr-2007 00:19 | 17K | |
![[SND]](/icons/sound2.gif) | agenize.mp3 | 14-Apr-2007 00:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | agenetic.mp3 | 14-Apr-2007 00:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | agenesis.mp3 | 14-Apr-2007 00:19 | 9.6K | |
![[SND]](/icons/sound2.gif) | agene.mp3 | 14-Apr-2007 00:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | agendum.mp3 | 14-Apr-2007 00:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | agendaless.mp3 | 14-Apr-2007 00:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | agenda.mp3 | 14-Apr-2007 00:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | agency.mp3 | 14-Apr-2007 00:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | agencefrancepress.mp3 | 14-Apr-2007 00:19 | 27K | |
![[SND]](/icons/sound2.gif) | agenbiteofinwit.mp3 | 14-Apr-2007 00:18 | 17K | |
![[SND]](/icons/sound2.gif) | agena.mp3 | 14-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | agelong.mp3 | 14-Apr-2007 00:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | agelessness.mp3 | 14-Apr-2007 00:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | ageless.mp3 | 14-Apr-2007 00:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | ageism.mp3 | 14-Apr-2007 00:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | ageing.mp3 | 14-Apr-2007 00:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | agedness.mp3 | 14-Apr-2007 00:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | aged.mp3 | 14-Apr-2007 00:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | age.mp3 | 14-Apr-2007 00:18 | 5.0K | |
![[SND]](/icons/sound2.gif) | age-old.mp3 | 14-Apr-2007 00:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | age-mate.mp3 | 14-Apr-2007 00:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | age-group.mp3 | 14-Apr-2007 00:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | agba.mp3 | 14-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | agaze.mp3 | 14-Apr-2007 00:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | agave.mp3 | 14-Apr-2007 00:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | agauche.mp3 | 14-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | a gauche.mp3 | 13-Apr-2007 22:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | agatoid.mp3 | 14-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | agathon.mp3 | 14-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | agathodemon.mp3 | 14-Apr-2007 00:18 | 17K | |
![[SND]](/icons/sound2.gif) | agatho.mp3 | 14-Apr-2007 00:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | agatha.mp3 | 14-Apr-2007 00:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | agate.mp3 | 14-Apr-2007 00:17 | 4.6K | |
![[SND]](/icons/sound2.gif) | agata.mp3 | 14-Apr-2007 00:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | agastya.mp3 | 14-Apr-2007 00:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | agarose.mp3 | 14-Apr-2007 00:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | agarita.mp3 | 14-Apr-2007 00:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | agaricus.mp3 | 14-Apr-2007 00:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | agaricin.mp3 | 14-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | agaricaceous.mp3 | 14-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | agaric.mp3 | 14-Apr-2007 00:17 | 6.1K | |
![[SND]](/icons/sound2.gif) | agar.mp3 | 14-Apr-2007 00:17 | 5.0K | |
![[SND]](/icons/sound2.gif) | agar-agar.mp3 | 14-Apr-2007 00:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | agapetus.mp3 | 14-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | agapemonite.mp3 | 14-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | agapemone.mp3 | 14-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | agape.mp3 | 14-Apr-2007 00:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | agapanthus.mp3 | 14-Apr-2007 00:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | aganippe.mp3 | 14-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | agamy.mp3 | 14-Apr-2007 00:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | agamous.mp3 | 14-Apr-2007 00:17 | 17K | |
![[SND]](/icons/sound2.gif) | agamospermy.mp3 | 14-Apr-2007 00:17 | 10K | |
![[SND]](/icons/sound2.gif) | agamont.mp3 | 14-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | agamogony.mp3 | 14-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | agamo.mp3 | 14-Apr-2007 00:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | agammaglobulinemic.mp3 | 14-Apr-2007 00:16 | 14K | |
![[SND]](/icons/sound2.gif) | agammaglobulinemia.mp3 | 14-Apr-2007 00:16 | 16K | |
![[SND]](/icons/sound2.gif) | agamid.mp3 | 14-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | agamically.mp3 | 14-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | agamic.mp3 | 14-Apr-2007 00:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | agami.mp3 | 14-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | agamete.mp3 | 14-Apr-2007 00:16 | 27K | |
![[SND]](/icons/sound2.gif) | agama.mp3 | 14-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | agam.mp3 | 14-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | agalloch.mp3 | 14-Apr-2007 00:16 | 18K | |
![[SND]](/icons/sound2.gif) | agalite.mp3 | 14-Apr-2007 00:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | agalactia.mp3 | 14-Apr-2007 00:16 | 17K | |
![[SND]](/icons/sound2.gif) | agal.mp3 | 14-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | agakhan.mp3 | 14-Apr-2007 00:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | against.mp3 | 14-Apr-2007 00:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | again.mp3 | 14-Apr-2007 00:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | agag.mp3 | 14-Apr-2007 00:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | agabus.mp3 | 14-Apr-2007 00:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | aga.mp3 | 14-Apr-2007 00:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | aftosa.mp3 | 14-Apr-2007 00:15 | 36K | |
![[SND]](/icons/sound2.gif) | afton.mp3 | 14-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | afto.mp3 | 14-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | aftmost.mp3 | 14-Apr-2007 00:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | afterworld.mp3 | 14-Apr-2007 00:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | afterword.mp3 | 14-Apr-2007 00:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | afterwards.mp3 | 14-Apr-2007 00:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | afterward.mp3 | 14-Apr-2007 00:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | aftertime.mp3 | 14-Apr-2007 00:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | afterthought.mp3 | 14-Apr-2007 00:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | aftertaste.mp3 | 14-Apr-2007 00:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | aftershock.mp3 | 14-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | aftershave.mp3 | 14-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | afters.mp3 | 14-Apr-2007 00:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | afterpiece.mp3 | 14-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | afternoons.mp3 | 14-Apr-2007 00:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | afternooner.mp3 | 14-Apr-2007 00:15 | 17K | |
![[SND]](/icons/sound2.gif) | afternoon.mp3 | 14-Apr-2007 00:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | aftermost.mp3 | 14-Apr-2007 00:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | aftermath.mp3 | 14-Apr-2007 00:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | aftermarket.mp3 | 14-Apr-2007 00:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | afterlife.mp3 | 14-Apr-2007 00:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | afterimage.mp3 | 14-Apr-2007 00:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | afterguard.mp3 | 14-Apr-2007 00:14 | 9.3K | |
![[SND]](/icons/sound2.gif) | afterglow.mp3 | 14-Apr-2007 00:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | aftereffect.mp3 | 14-Apr-2007 00:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | afterdeck.mp3 | 14-Apr-2007 00:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | afterclap.mp3 | 14-Apr-2007 00:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | aftercare.mp3 | 14-Apr-2007 00:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | afterburner.mp3 | 14-Apr-2007 00:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | afterbirth.mp3 | 14-Apr-2007 00:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | after.mp3 | 14-Apr-2007 00:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | after-tax.mp3 | 14-Apr-2007 00:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | after-hours.mp3 | 14-Apr-2007 00:14 | 10K | |
![[SND]](/icons/sound2.gif) | aft.mp3 | 14-Apr-2007 00:14 | 4.6K | |
![[SND]](/icons/sound2.gif) | afrormosia.mp3 | 14-Apr-2007 00:14 | 36K | |
![[SND]](/icons/sound2.gif) | afrophile.mp3 | 14-Apr-2007 00:14 | 17K | |
![[SND]](/icons/sound2.gif) | afropavo.mp3 | 14-Apr-2007 00:14 | 17K | |
![[SND]](/icons/sound2.gif) | afroism.mp3 | 14-Apr-2007 00:14 | 17K | |
![[SND]](/icons/sound2.gif) | afrit.mp3 | 14-Apr-2007 00:13 | 7.3K | |
![[SND]](/icons/sound2.gif) | afrin.mp3 | 14-Apr-2007 00:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | afrikanerize.mp3 | 14-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | afrikanerization.mp3 | 14-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | afrikanerism.mp3 | 14-Apr-2007 00:13 | 45K | |
![[SND]](/icons/sound2.gif) | afrikakorps.mp3 | 14-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | afridi.mp3 | 14-Apr-2007 00:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | africanthropus.mp3 | 14-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | africanity.mp3 | 14-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | africaner.mp3 | 14-Apr-2007 00:13 | 17K | |
![[SND]](/icons/sound2.gif) | afric.mp3 | 14-Apr-2007 00:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | afresh.mp3 | 14-Apr-2007 00:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | afreet.mp3 | 14-Apr-2007 00:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | afrasian.mp3 | 14-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | afrasia.mp3 | 14-Apr-2007 00:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | aframerican.mp3 | 14-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | afraid.mp3 | 14-Apr-2007 00:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | afr.mp3 | 14-Apr-2007 00:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | afoul of.mp3 | 14-Apr-2007 00:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | afoul.mp3 | 14-Apr-2007 00:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | afortiori.mp3 | 14-Apr-2007 00:12 | 17K | |
![[SND]](/icons/sound2.gif) | a fortiori.mp3 | 13-Apr-2007 22:30 | 11K | |
![[SND]](/icons/sound2.gif) | aforethought.mp3 | 14-Apr-2007 00:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | aforesaid.mp3 | 14-Apr-2007 00:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | aforementioned.mp3 | 14-Apr-2007 00:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | afore.mp3 | 14-Apr-2007 00:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | afoot.mp3 | 14-Apr-2007 00:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | afond.mp3 | 14-Apr-2007 00:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | afocal.mp3 | 14-Apr-2007 00:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | afnor.mp3 | 14-Apr-2007 00:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | aflutter.mp3 | 14-Apr-2007 00:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | afloat.mp3 | 14-Apr-2007 00:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | aflatoxin.mp3 | 14-Apr-2007 00:11 | 10K | |
![[SND]](/icons/sound2.gif) | aflame.mp3 | 14-Apr-2007 00:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | afire.mp3 | 14-Apr-2007 00:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | afikomen.mp3 | 14-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | afield.mp3 | 14-Apr-2007 00:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | aficionado.mp3 | 14-Apr-2007 00:11 | 10K | |
![[SND]](/icons/sound2.gif) | aficionada.mp3 | 14-Apr-2007 00:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | afghanistanism.mp3 | 14-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | afgay.mp3 | 14-Apr-2007 00:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | affusion.mp3 | 14-Apr-2007 00:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | affrontiveness.mp3 | 14-Apr-2007 00:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | affrontive.mp3 | 14-Apr-2007 00:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | affrontingly.mp3 | 14-Apr-2007 00:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | affront.mp3 | 14-Apr-2007 00:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | affright.mp3 | 14-Apr-2007 00:11 | 6.3K | |
![[SND]](/icons/sound2.gif) | affricative.mp3 | 14-Apr-2007 00:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | affrication.mp3 | 14-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | affricate.mp3 | 14-Apr-2007 00:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | affreightment.mp3 | 14-Apr-2007 00:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | affreight.mp3 | 14-Apr-2007 00:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | affrayer.mp3 | 14-Apr-2007 00:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | affray.mp3 | 14-Apr-2007 00:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | affranchisement.mp3 | 14-Apr-2007 00:11 | 17K | |
![[SND]](/icons/sound2.gif) | affranchise.mp3 | 14-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | afforestment.mp3 | 14-Apr-2007 00:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | afforestation.mp3 | 14-Apr-2007 00:10 | 11K | |
![[SND]](/icons/sound2.gif) | afforest.mp3 | 14-Apr-2007 00:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | affordably.mp3 | 14-Apr-2007 00:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | affordable.mp3 | 14-Apr-2007 00:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | affordability.mp3 | 14-Apr-2007 00:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | afford.mp3 | 14-Apr-2007 00:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | afforcement.mp3 | 14-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | afforce.mp3 | 14-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | afflux.mp3 | 14-Apr-2007 00:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | affluenza.mp3 | 14-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | affluently.mp3 | 14-Apr-2007 00:10 | 36K | |
![[SND]](/icons/sound2.gif) | affluent.mp3 | 14-Apr-2007 00:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | affluency.mp3 | 14-Apr-2007 00:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | affluence.mp3 | 14-Apr-2007 00:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | afflictively.mp3 | 14-Apr-2007 00:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | afflictive.mp3 | 14-Apr-2007 00:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | afflictionless.mp3 | 14-Apr-2007 00:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | affliction.mp3 | 14-Apr-2007 00:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | afflicting.mp3 | 14-Apr-2007 00:10 | 17K | |
![[SND]](/icons/sound2.gif) | afflicter.mp3 | 14-Apr-2007 00:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | afflict.mp3 | 14-Apr-2007 00:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | afflatus.mp3 | 14-Apr-2007 00:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | afflated.mp3 | 14-Apr-2007 00:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | affixture.mp3 | 14-Apr-2007 00:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | affixment.mp3 | 14-Apr-2007 00:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | affixial.mp3 | 14-Apr-2007 00:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | affixation.mp3 | 14-Apr-2007 00:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | affixal.mp3 | 14-Apr-2007 00:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | affixable.mp3 | 14-Apr-2007 00:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | affix.mp3 | 14-Apr-2007 00:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | affirmingly.mp3 | 14-Apr-2007 00:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | affirmatory.mp3 | 14-Apr-2007 00:09 | 17K | |
![[SND]](/icons/sound2.gif) | affirmatively.mp3 | 14-Apr-2007 00:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | affirmative.mp3 | 14-Apr-2007 00:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | affirmation.mp3 | 14-Apr-2007 00:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | affirmant.mp3 | 14-Apr-2007 00:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | affirmance.mp3 | 14-Apr-2007 00:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | affirmably.mp3 | 14-Apr-2007 00:09 | 17K | |
![[SND]](/icons/sound2.gif) | affirmable.mp3 | 14-Apr-2007 00:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | affirm.mp3 | 14-Apr-2007 00:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | affinity.mp3 | 14-Apr-2007 00:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | affinitive.mp3 | 14-Apr-2007 00:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | affinely.mp3 | 14-Apr-2007 00:09 | 36K | |
![[SND]](/icons/sound2.gif) | affined.mp3 | 14-Apr-2007 00:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | affine.mp3 | 14-Apr-2007 00:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | affinal.mp3 | 14-Apr-2007 00:09 | 36K | |
![[SND]](/icons/sound2.gif) | affiliativedrive.mp3 | 14-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | affiliative.mp3 | 14-Apr-2007 00:08 | 36K | |
![[SND]](/icons/sound2.gif) | affiliation.mp3 | 14-Apr-2007 00:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | affiliated.mp3 | 14-Apr-2007 00:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | affiliate.mp3 | 14-Apr-2007 00:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | affiliable.mp3 | 14-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | affidavit.mp3 | 14-Apr-2007 00:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | afficionado.mp3 | 14-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | affiche.mp3 | 14-Apr-2007 00:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | affiant.mp3 | 14-Apr-2007 00:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | affianced.mp3 | 14-Apr-2007 00:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | affiance.mp3 | 14-Apr-2007 00:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | affettuoso.mp3 | 14-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | afferently.mp3 | 14-Apr-2007 00:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | afferent.mp3 | 14-Apr-2007 00:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | affenpinscher.mp3 | 14-Apr-2007 00:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | affectual.mp3 | 14-Apr-2007 00:08 | 17K | |
![[SND]](/icons/sound2.gif) | affectlessness.mp3 | 14-Apr-2007 00:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | affectless.mp3 | 14-Apr-2007 00:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | affectivity.mp3 | 14-Apr-2007 00:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | affective.mp3 | 14-Apr-2007 00:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | affectionless.mp3 | 14-Apr-2007 00:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | affectioned.mp3 | 14-Apr-2007 00:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | affectionateness.mp3 | 14-Apr-2007 00:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | affectionately.mp3 | 14-Apr-2007 00:07 | 17K | |
![[SND]](/icons/sound2.gif) | affectionate.mp3 | 14-Apr-2007 00:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | affectionally.mp3 | 14-Apr-2007 00:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | affectional.mp3 | 14-Apr-2007 00:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | affection.mp3 | 14-Apr-2007 00:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | affectingly.mp3 | 14-Apr-2007 00:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | affecting.mp3 | 14-Apr-2007 00:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | affecter.mp3 | 14-Apr-2007 00:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | affectedness.mp3 | 14-Apr-2007 00:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | affected.mp3 | 14-Apr-2007 00:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | affectation.mp3 | 14-Apr-2007 00:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | affectable.mp3 | 14-Apr-2007 00:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | affectability.mp3 | 14-Apr-2007 00:07 | 9.6K | |
![[SND]](/icons/sound2.gif) | affect.mp3 | 14-Apr-2007 00:07 | 6.3K | |
![[SND]](/icons/sound2.gif) | affairedhonneur.mp3 | 14-Apr-2007 00:07 | 17K | |
![[SND]](/icons/sound2.gif) | affairedecoeur.mp3 | 14-Apr-2007 00:07 | 17K | |
![[SND]](/icons/sound2.gif) | affairedamour.mp3 | 14-Apr-2007 00:07 | 17K | |
![[SND]](/icons/sound2.gif) | affair.mp3 | 14-Apr-2007 00:07 | 10K | |
![[SND]](/icons/sound2.gif) | affably.mp3 | 14-Apr-2007 00:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | affable.mp3 | 14-Apr-2007 00:07 | 5.7K | |
![[SND]](/icons/sound2.gif) | affability.mp3 | 14-Apr-2007 00:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | aff.mp3 | 14-Apr-2007 00:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | afebrile.mp3 | 14-Apr-2007 00:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | afeared.mp3 | 14-Apr-2007 00:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | afeard.mp3 | 14-Apr-2007 00:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | afarsandissas.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | afar.mp3 | 14-Apr-2007 00:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | af.mp3 | 14-Apr-2007 00:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aetolus.mp3 | 14-Apr-2007 00:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aetna.mp3 | 14-Apr-2007 00:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aetiology.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | aetiologist.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | aethon.mp3 | 14-Apr-2007 00:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aetheric.mp3 | 14-Apr-2007 00:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aether.mp3 | 14-Apr-2007 00:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aethelstan.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | aetheling.mp3 | 14-Apr-2007 00:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | aethelbert.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | aethalium.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | aetatissuae.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | aetatis.mp3 | 14-Apr-2007 00:06 | 17K | |
![[SND]](/icons/sound2.gif) | aet.mp3 | 14-Apr-2007 00:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | aestivation.mp3 | 14-Apr-2007 00:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | aestivate.mp3 | 14-Apr-2007 00:06 | 6.6K | |
![[SND]](/icons/sound2.gif) | aestival.mp3 | 14-Apr-2007 00:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | aesthophysiology.mp3 | 14-Apr-2007 00:05 | 18K | |
![[SND]](/icons/sound2.gif) | aesthetics.mp3 | 14-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | aestheticize.mp3 | 14-Apr-2007 00:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | aestheticism.mp3 | 14-Apr-2007 00:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | aestheticienne.mp3 | 14-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | aesthetician.mp3 | 14-Apr-2007 00:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | aesthetically.mp3 | 14-Apr-2007 00:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | aesthetical.mp3 | 14-Apr-2007 00:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | aesthetic.mp3 | 14-Apr-2007 00:05 | 6.3K | |
![[SND]](/icons/sound2.gif) | aesthete.mp3 | 14-Apr-2007 00:05 | 5.9K | |
![[SND]](/icons/sound2.gif) | aesthesia.mp3 | 14-Apr-2007 00:05 | 45K | |
![[SND]](/icons/sound2.gif) | aesculin.mp3 | 14-Apr-2007 00:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | aesculapius.mp3 | 14-Apr-2007 00:05 | 17K | |
![[SND]](/icons/sound2.gif) | aesc.mp3 | 14-Apr-2007 00:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | aes.mp3 | 14-Apr-2007 00:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | aery.mp3 | 14-Apr-2007 00:05 | 5.2K | |
![[SND]](/icons/sound2.gif) | aerugo.mp3 | 14-Apr-2007 00:05 | 36K | |
![[SND]](/icons/sound2.gif) | aeruginous.mp3 | 14-Apr-2007 00:04 | 36K | |
![[SND]](/icons/sound2.gif) | aertex.mp3 | 14-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | aerotropism.mp3 | 14-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | aerotropic.mp3 | 14-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | aerotitismedia.mp3 | 14-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | aerothermodynamics.mp3 | 14-Apr-2007 00:04 | 14K | |
![[SND]](/icons/sound2.gif) | aerothermodynamic.mp3 | 14-Apr-2007 00:04 | 14K | |
![[SND]](/icons/sound2.gif) | aerostatics.mp3 | 14-Apr-2007 00:04 | 10K | |
![[SND]](/icons/sound2.gif) | aerostat.mp3 | 14-Apr-2007 00:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | aerospatiale.mp3 | 14-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | aerospace.mp3 | 14-Apr-2007 00:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | aerosolize.mp3 | 14-Apr-2007 00:04 | 11K | |
![[SND]](/icons/sound2.gif) | aerosolization.mp3 | 14-Apr-2007 00:04 | 11K | |
![[SND]](/icons/sound2.gif) | aerosol.mp3 | 14-Apr-2007 00:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | aeroscepsy.mp3 | 14-Apr-2007 00:04 | 17K | |
![[SND]](/icons/sound2.gif) | aeroponics.mp3 | 14-Apr-2007 00:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | aeroplane.mp3 | 14-Apr-2007 00:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | aerophyte.mp3 | 14-Apr-2007 00:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | aerophore.mp3 | 14-Apr-2007 00:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | aerophobic.mp3 | 14-Apr-2007 00:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | aerophobia.mp3 | 14-Apr-2007 00:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | aerophobe.mp3 | 14-Apr-2007 00:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | aerophagist.mp3 | 14-Apr-2007 00:04 | 45K | |
![[SND]](/icons/sound2.gif) | aerophagia.mp3 | 14-Apr-2007 00:04 | 45K | |
![[SND]](/icons/sound2.gif) | aerope.mp3 | 14-Apr-2007 00:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | aeropause.mp3 | 14-Apr-2007 00:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | aeronomy.mp3 | 14-Apr-2007 00:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | aeronomist.mp3 | 14-Apr-2007 00:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | aeronomic.mp3 | 14-Apr-2007 00:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | aeronomer.mp3 | 14-Apr-2007 00:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | aeronautics.mp3 | 14-Apr-2007 00:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | aeronautically.mp3 | 14-Apr-2007 00:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | aeronautical.mp3 | 14-Apr-2007 00:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | aeronautic.mp3 | 14-Apr-2007 00:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | aeronaut.mp3 | 14-Apr-2007 00:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | aeromexico.mp3 | 14-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | aerometry.mp3 | 14-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | aerometric.mp3 | 14-Apr-2007 00:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | aerometer.mp3 | 14-Apr-2007 00:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | aeromedicine.mp3 | 14-Apr-2007 00:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | aeromedical.mp3 | 14-Apr-2007 00:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | aeromechanics.mp3 | 14-Apr-2007 00:03 | 10K | |
![[SND]](/icons/sound2.gif) | aeromantic.mp3 | 14-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | aeromancy.mp3 | 14-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | aeromagnetic.mp3 | 14-Apr-2007 00:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | aerology.mp3 | 14-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | aerologist.mp3 | 14-Apr-2007 00:03 | 17K | |
![[SND]](/icons/sound2.gif) | aerolitic.mp3 | 14-Apr-2007 00:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | aerolite.mp3 | 14-Apr-2007 00:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | aerolineasargentinas.mp3 | 14-Apr-2007 00:02 | 27K | |
![[SND]](/icons/sound2.gif) | aerography.mp3 | 14-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | aerographical.mp3 | 14-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | aerographer.mp3 | 14-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | aerographer's mate.mp3 | 14-Apr-2007 00:02 | 11K | |
![[SND]](/icons/sound2.gif) | aerograph.mp3 | 14-Apr-2007 00:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | aerogramme.mp3 | 14-Apr-2007 00:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | aerogram.mp3 | 14-Apr-2007 00:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | aerogenically.mp3 | 14-Apr-2007 00:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | aerogenic.mp3 | 14-Apr-2007 00:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | aerofoil.mp3 | 14-Apr-2007 00:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | aeroflotsovietairlines.mp3 | 14-Apr-2007 00:02 | 27K | |
![[SND]](/icons/sound2.gif) | aeroembolism.mp3 | 14-Apr-2007 00:02 | 10K | |
![[SND]](/icons/sound2.gif) | aeroelasticity.mp3 | 14-Apr-2007 00:02 | 14K | |
![[SND]](/icons/sound2.gif) | aeroelastic.mp3 | 14-Apr-2007 00:02 | 11K | |
![[SND]](/icons/sound2.gif) | aerodyne.mp3 | 14-Apr-2007 00:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | aerodynamics.mp3 | 14-Apr-2007 00:02 | 11K | |
![[SND]](/icons/sound2.gif) | aerodynamicist.mp3 | 14-Apr-2007 00:02 | 13K | |
![[SND]](/icons/sound2.gif) | aerodynamically.mp3 | 14-Apr-2007 00:02 | 11K | |
![[SND]](/icons/sound2.gif) | aerodynamical.mp3 | 14-Apr-2007 00:02 | 10K | |
![[SND]](/icons/sound2.gif) | aerodynamic.mp3 | 14-Apr-2007 00:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | aerodrome.mp3 | 14-Apr-2007 00:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | aerodontalgia.mp3 | 14-Apr-2007 00:02 | 45K | |
![[SND]](/icons/sound2.gif) | aerodonetics.mp3 | 14-Apr-2007 00:02 | 17K | |
![[SND]](/icons/sound2.gif) | aerobrake.mp3 | 14-Apr-2007 00:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | aerobium.mp3 | 14-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | aerobiotically.mp3 | 14-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | aerobiosis.mp3 | 14-Apr-2007 00:01 | 10K | |
![[SND]](/icons/sound2.gif) | aerobioses.mp3 | 14-Apr-2007 00:01 | 11K | |
![[SND]](/icons/sound2.gif) | aerobiology.mp3 | 14-Apr-2007 00:01 | 11K | |
![[SND]](/icons/sound2.gif) | aerobiological.mp3 | 14-Apr-2007 00:01 | 11K | |
![[SND]](/icons/sound2.gif) | aerobics.mp3 | 14-Apr-2007 00:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | aerobicize.mp3 | 14-Apr-2007 00:01 | 12K | |
![[SND]](/icons/sound2.gif) | aerobically.mp3 | 14-Apr-2007 00:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | aerobic.mp3 | 14-Apr-2007 00:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | aerobee.mp3 | 14-Apr-2007 00:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | aerobe.mp3 | 14-Apr-2007 00:01 | 5.9K | |
![[SND]](/icons/sound2.gif) | aerobatics.mp3 | 14-Apr-2007 00:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | aerobatic.mp3 | 14-Apr-2007 00:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | aerobat.mp3 | 14-Apr-2007 00:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | aerobacter.mp3 | 14-Apr-2007 00:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | aero.mp3 | 14-Apr-2007 00:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | aerlingus.mp3 | 14-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | aerily.mp3 | 14-Apr-2007 00:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | aerify.mp3 | 14-Apr-2007 00:01 | 36K | |
![[SND]](/icons/sound2.gif) | aeriform.mp3 | 14-Apr-2007 00:01 | 36K | |
![[SND]](/icons/sound2.gif) | aerification.mp3 | 14-Apr-2007 00:01 | 17K | |
![[SND]](/icons/sound2.gif) | aeriferous.mp3 | 14-Apr-2007 00:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | aerie.mp3 | 14-Apr-2007 00:00 | 5.0K | |
![[SND]](/icons/sound2.gif) | aerialness.mp3 | 14-Apr-2007 00:00 | 36K | |
![[SND]](/icons/sound2.gif) | aerially.mp3 | 14-Apr-2007 00:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | aeriality.mp3 | 14-Apr-2007 00:00 | 17K | |
![[SND]](/icons/sound2.gif) | aerialist.mp3 | 14-Apr-2007 00:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | aerial.mp3 | 14-Apr-2007 00:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | aeria.mp3 | 14-Apr-2007 00:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | aeri.mp3 | 14-Apr-2007 00:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | aereperennius.mp3 | 14-Apr-2007 00:00 | 17K | |
![[SND]](/icons/sound2.gif) | aere perennius.mp3 | 14-Apr-2007 00:00 | 13K | |
![[SND]](/icons/sound2.gif) | aerenchyma.mp3 | 14-Apr-2007 00:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | aerator.mp3 | 14-Apr-2007 00:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | aeration.mp3 | 14-Apr-2007 00:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | aerated.mp3 | 14-Apr-2007 00:00 | 17K | |
![[SND]](/icons/sound2.gif) | aerate.mp3 | 14-Apr-2007 00:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | aerarium.mp3 | 14-Apr-2007 00:00 | 17K | |
![[SND]](/icons/sound2.gif) | aerarian.mp3 | 14-Apr-2007 00:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | aer.mp3 | 14-Apr-2007 00:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | aequorin.mp3 | 14-Apr-2007 00:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | aequoanimo.mp3 | 14-Apr-2007 00:00 | 17K | |
![[SND]](/icons/sound2.gif) | aequo animo.mp3 | 14-Apr-2007 00:00 | 11K | |
![[SND]](/icons/sound2.gif) | aequam servare mentem.mp3 | 14-Apr-2007 00:00 | 21K | |
![[SND]](/icons/sound2.gif) | aepyornis.mp3 | 14-Apr-2007 00:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | aeonic.mp3 | 14-Apr-2007 00:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | aeonian.mp3 | 14-Apr-2007 00:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | aeon.mp3 | 13-Apr-2007 23:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | aeolotropism.mp3 | 13-Apr-2007 23:59 | 45K | |
![[SND]](/icons/sound2.gif) | aeolotropic.mp3 | 13-Apr-2007 23:59 | 45K | |
![[SND]](/icons/sound2.gif) | aeolipile.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aeolian.mp3 | 13-Apr-2007 23:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | aengus.mp3 | 13-Apr-2007 23:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | aeneous.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aeneid.mp3 | 13-Apr-2007 23:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | aeneassilvius.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aena.mp3 | 13-Apr-2007 23:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | aemia.mp3 | 13-Apr-2007 23:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | aelurophobic.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aelurophobia.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aelurophobe.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aelurophilic.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aelurophilia.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aelurophile.mp3 | 13-Apr-2007 23:59 | 17K | |
![[SND]](/icons/sound2.gif) | aelfric.mp3 | 13-Apr-2007 23:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | aegyptus.mp3 | 13-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | aegyptopithecus.mp3 | 13-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | aegrotat.mp3 | 13-Apr-2007 23:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | aegri somnia.mp3 | 13-Apr-2007 23:58 | 12K | |
![[SND]](/icons/sound2.gif) | aegium.mp3 | 13-Apr-2007 23:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | aegis.mp3 | 13-Apr-2007 23:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | aegirite.mp3 | 13-Apr-2007 23:58 | 36K | |
![[SND]](/icons/sound2.gif) | aegeus.mp3 | 13-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | aeger.mp3 | 13-Apr-2007 23:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | aegates.mp3 | 13-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | aegadianislands.mp3 | 13-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | aeetes.mp3 | 13-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | aedon.mp3 | 13-Apr-2007 23:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | aedoeagus.mp3 | 13-Apr-2007 23:58 | 17K | |
![[SND]](/icons/sound2.gif) | aedine.mp3 | 13-Apr-2007 23:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | aedilitian.mp3 | 13-Apr-2007 23:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | aedile.mp3 | 13-Apr-2007 23:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | aedicule.mp3 | 13-Apr-2007 23:57 | 45K | |
![[SND]](/icons/sound2.gif) | aedicula.mp3 | 13-Apr-2007 23:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | aedes.mp3 | 13-Apr-2007 23:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | aedeagus.mp3 | 13-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | aedeagal.mp3 | 13-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | aecium.mp3 | 13-Apr-2007 23:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | aeciospore.mp3 | 13-Apr-2007 23:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | aecidium.mp3 | 13-Apr-2007 23:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | aecial.mp3 | 13-Apr-2007 23:57 | 6.6K | |
![[SND]](/icons/sound2.gif) | aecia.mp3 | 13-Apr-2007 23:57 | 5.9K | |
![[SND]](/icons/sound2.gif) | aechmea.mp3 | 13-Apr-2007 23:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | aean.mp3 | 13-Apr-2007 23:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | aeaea.mp3 | 13-Apr-2007 23:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | aeacides.mp3 | 13-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | aea.mp3 | 13-Apr-2007 23:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | ae.mp3 | 13-Apr-2007 23:57 | 4.5K | |
![[SND]](/icons/sound2.gif) | adzukibean.mp3 | 13-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | adzuki.mp3 | 13-Apr-2007 23:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | adzharistan.mp3 | 13-Apr-2007 23:57 | 17K | |
![[SND]](/icons/sound2.gif) | adze.mp3 | 13-Apr-2007 23:57 | 5.5K | |
![[SND]](/icons/sound2.gif) | adz.mp3 | 13-Apr-2007 23:56 | 5.5K | |
![[SND]](/icons/sound2.gif) | adytum.mp3 | 13-Apr-2007 23:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | adyta.mp3 | 13-Apr-2007 23:56 | 5.5K | |
![[SND]](/icons/sound2.gif) | adynamic.mp3 | 13-Apr-2007 23:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | adynamia.mp3 | 13-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | adyge.mp3 | 13-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | advowson.mp3 | 13-Apr-2007 23:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | advocatusdiaboli.mp3 | 13-Apr-2007 23:56 | 27K | |
![[SND]](/icons/sound2.gif) | advocatory.mp3 | 13-Apr-2007 23:56 | 45K | |
![[SND]](/icons/sound2.gif) | advocator.mp3 | 13-Apr-2007 23:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | advocative.mp3 | 13-Apr-2007 23:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | advocation.mp3 | 13-Apr-2007 23:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | advocate.mp3 | 13-Apr-2007 23:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | advocacy.mp3 | 13-Apr-2007 23:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | advocaat.mp3 | 13-Apr-2007 23:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | advivum.mp3 | 13-Apr-2007 23:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | ad vivum.mp3 | 13-Apr-2007 23:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | advitam.mp3 | 13-Apr-2007 23:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | advisory.mp3 | 13-Apr-2007 23:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | advisorily.mp3 | 13-Apr-2007 23:56 | 17K | |
![[SND]](/icons/sound2.gif) | advisor.mp3 | 13-Apr-2007 23:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | advisership.mp3 | 13-Apr-2007 23:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | adviser.mp3 | 13-Apr-2007 23:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | advisement.mp3 | 13-Apr-2007 23:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | advisee.mp3 | 13-Apr-2007 23:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | advisedly.mp3 | 13-Apr-2007 23:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | advised.mp3 | 13-Apr-2007 23:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | advise.mp3 | 13-Apr-2007 23:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | advisably.mp3 | 13-Apr-2007 23:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | advisableness.mp3 | 13-Apr-2007 23:55 | 11K | |
![[SND]](/icons/sound2.gif) | advisable.mp3 | 13-Apr-2007 23:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | advisability.mp3 | 13-Apr-2007 23:55 | 10K | |
![[SND]](/icons/sound2.gif) | advil.mp3 | 13-Apr-2007 23:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | advid.mp3 | 13-Apr-2007 23:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | advice.mp3 | 13-Apr-2007 23:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | advertorial.mp3 | 13-Apr-2007 23:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | advertising.mp3 | 13-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | advertiser.mp3 | 13-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | advertisement.mp3 | 13-Apr-2007 23:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | advertise.mp3 | 13-Apr-2007 23:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | advertisable.mp3 | 13-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | advertique.mp3 | 13-Apr-2007 23:55 | 17K | |
![[SND]](/icons/sound2.gif) | advertently.mp3 | 13-Apr-2007 23:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | advertent.mp3 | 13-Apr-2007 23:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | advertency.mp3 | 13-Apr-2007 23:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | advertence.mp3 | 13-Apr-2007 23:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | advert.mp3 | 13-Apr-2007 23:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | adversity.mp3 | 13-Apr-2007 23:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | adverseness.mp3 | 13-Apr-2007 23:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | adverse.mp3 | 13-Apr-2007 23:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | adversatively.mp3 | 13-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | adversative.mp3 | 13-Apr-2007 23:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | adversaryism.mp3 | 13-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | adversary.mp3 | 13-Apr-2007 23:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | adversariness.mp3 | 13-Apr-2007 23:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | adversarial.mp3 | 13-Apr-2007 23:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | adversaria.mp3 | 13-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | adverbum.mp3 | 13-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | ad verbum.mp3 | 13-Apr-2007 23:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | adverbless.mp3 | 13-Apr-2007 23:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | adverbially.mp3 | 13-Apr-2007 23:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | adverbial.mp3 | 13-Apr-2007 23:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | adverb.mp3 | 13-Apr-2007 23:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | adventurousness.mp3 | 13-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | adventurous.mp3 | 13-Apr-2007 23:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | adventuristic.mp3 | 13-Apr-2007 23:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | adventurist.mp3 | 13-Apr-2007 23:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | adventurism.mp3 | 13-Apr-2007 23:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | adventuring.mp3 | 13-Apr-2007 23:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | adventuress.mp3 | 13-Apr-2007 23:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | adventuresomeness.mp3 | 13-Apr-2007 23:54 | 17K | |
![[SND]](/icons/sound2.gif) | adventuresome.mp3 | 13-Apr-2007 23:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | adventurer.mp3 | 13-Apr-2007 23:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | adventureful.mp3 | 13-Apr-2007 23:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | adventure.mp3 | 13-Apr-2007 23:54 | 7.3K | |
![[SND]](/icons/sound2.gif) | adventively.mp3 | 13-Apr-2007 23:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | adventive.mp3 | 13-Apr-2007 23:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | adventitiousness.mp3 | 13-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | adventitious.mp3 | 13-Apr-2007 23:53 | 10K | |
![[SND]](/icons/sound2.gif) | adventitial.mp3 | 13-Apr-2007 23:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | adventitia.mp3 | 13-Apr-2007 23:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | advent.mp3 | 13-Apr-2007 23:53 | 6.1K | |
![[SND]](/icons/sound2.gif) | advective.mp3 | 13-Apr-2007 23:53 | 7.3K | |
![[SND]](/icons/sound2.gif) | advection.mp3 | 13-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | advect.mp3 | 13-Apr-2007 23:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | advantageousness.mp3 | 13-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | advantageous.mp3 | 13-Apr-2007 23:53 | 11K | |
![[SND]](/icons/sound2.gif) | advantaged.mp3 | 13-Apr-2007 23:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | advantage.mp3 | 13-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | advancingly.mp3 | 13-Apr-2007 23:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | advancer.mp3 | 13-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | advancement.mp3 | 13-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | advanced.mp3 | 13-Apr-2007 23:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | advance.mp3 | 13-Apr-2007 23:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | advalorem.mp3 | 13-Apr-2007 23:53 | 17K | |
![[SND]](/icons/sound2.gif) | ad valorem.mp3 | 13-Apr-2007 23:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | advaita.mp3 | 13-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | aduwa.mp3 | 13-Apr-2007 23:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | adutrumqueparatus.mp3 | 13-Apr-2007 23:52 | 18K | |
![[SND]](/icons/sound2.gif) | ad utrumque paratus.mp3 | 13-Apr-2007 23:30 | 17K | |
![[SND]](/icons/sound2.gif) | adust.mp3 | 13-Apr-2007 23:52 | 6.6K | |
![[SND]](/icons/sound2.gif) | adurol.mp3 | 13-Apr-2007 23:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | ad unguem.mp3 | 13-Apr-2007 23:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | aduncity.mp3 | 13-Apr-2007 23:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | aduncate.mp3 | 13-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | adunc.mp3 | 13-Apr-2007 23:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | adumbratively.mp3 | 13-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | adumbrative.mp3 | 13-Apr-2007 23:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | adumbration.mp3 | 13-Apr-2007 23:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | adumbrate.mp3 | 13-Apr-2007 23:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | adumbral.mp3 | 13-Apr-2007 23:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | adultress.mp3 | 13-Apr-2007 23:52 | 9.3K | |
![[SND]](/icons/sound2.gif) | adultness.mp3 | 13-Apr-2007 23:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | adultly.mp3 | 13-Apr-2007 23:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | adultlike.mp3 | 13-Apr-2007 23:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | adultism.mp3 | 13-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | adultify.mp3 | 13-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | adulthood.mp3 | 13-Apr-2007 23:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | adultery.mp3 | 13-Apr-2007 23:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | adulterously.mp3 | 13-Apr-2007 23:52 | 17K | |
![[SND]](/icons/sound2.gif) | adulterous.mp3 | 13-Apr-2007 23:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | adulterine.mp3 | 13-Apr-2007 23:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | adulteress.mp3 | 13-Apr-2007 23:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | adulterer.mp3 | 13-Apr-2007 23:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | adulterator.mp3 | 13-Apr-2007 23:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | adulteration.mp3 | 13-Apr-2007 23:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | adulterated.mp3 | 13-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | adulterate.mp3 | 13-Apr-2007 23:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | adulterant.mp3 | 13-Apr-2007 23:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | adult.mp3 | 13-Apr-2007 23:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | adult-onset diabetes.mp3 | 13-Apr-2007 23:52 | 13K | |
![[SND]](/icons/sound2.gif) | adullamite.mp3 | 13-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | adulatory.mp3 | 13-Apr-2007 23:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | adulator.mp3 | 13-Apr-2007 23:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | adulation.mp3 | 13-Apr-2007 23:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | adulate.mp3 | 13-Apr-2007 23:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | adularia.mp3 | 13-Apr-2007 23:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | adularescent.mp3 | 13-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | adularescence.mp3 | 13-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | adue.mp3 | 13-Apr-2007 23:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | adsum.mp3 | 13-Apr-2007 23:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | adsukibean.mp3 | 13-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | adsorptively.mp3 | 13-Apr-2007 23:51 | 17K | |
![[SND]](/icons/sound2.gif) | adsorptive.mp3 | 13-Apr-2007 23:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | adsorption.mp3 | 13-Apr-2007 23:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | adsorber.mp3 | 13-Apr-2007 23:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | adsorbent.mp3 | 13-Apr-2007 23:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | adsorbate.mp3 | 13-Apr-2007 23:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | adsorbable.mp3 | 13-Apr-2007 23:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | adsorbability.mp3 | 13-Apr-2007 23:51 | 27K | |
![[SND]](/icons/sound2.gif) | adsorb.mp3 | 13-Apr-2007 23:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | adsmith.mp3 | 13-Apr-2007 23:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | adscription.mp3 | 13-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | adscript.mp3 | 13-Apr-2007 23:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | adscititiously.mp3 | 13-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | adscititious.mp3 | 13-Apr-2007 23:50 | 10K | |
![[SND]](/icons/sound2.gif) | adroop.mp3 | 13-Apr-2007 23:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | adroitness.mp3 | 13-Apr-2007 23:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | adroite.mp3 | 13-Apr-2007 23:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | a droite.mp3 | 13-Apr-2007 22:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | adroit.mp3 | 13-Apr-2007 23:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | adrift.mp3 | 13-Apr-2007 23:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | adrienne.mp3 | 13-Apr-2007 23:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | adriatic.mp3 | 13-Apr-2007 23:50 | 45K | |
![[SND]](/icons/sound2.gif) | adrianopolis.mp3 | 13-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | adriamycin.mp3 | 13-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | adret.mp3 | 13-Apr-2007 23:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | adrenolytic.mp3 | 13-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | adrenoleukodystrophy.mp3 | 13-Apr-2007 23:50 | 15K | |
![[SND]](/icons/sound2.gif) | adrenodoxin.mp3 | 13-Apr-2007 23:50 | 17K | |
![[SND]](/icons/sound2.gif) | adrenocorticotropin.mp3 | 13-Apr-2007 23:50 | 16K | |
![[SND]](/icons/sound2.gif) | adrenocorticotropic.mp3 | 13-Apr-2007 23:50 | 16K | |
![[SND]](/icons/sound2.gif) | adrenocorticotrophin.mp3 | 13-Apr-2007 23:50 | 16K | |
![[SND]](/icons/sound2.gif) | adrenocorticotrophic.mp3 | 13-Apr-2007 23:49 | 16K | |
![[SND]](/icons/sound2.gif) | adrenocorticosteroid.mp3 | 13-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | adrenocortical.mp3 | 13-Apr-2007 23:49 | 11K | |
![[SND]](/icons/sound2.gif) | adrenochrome.mp3 | 13-Apr-2007 23:49 | 11K | |
![[SND]](/icons/sound2.gif) | adreno.mp3 | 13-Apr-2007 23:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | adrenin.mp3 | 13-Apr-2007 23:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | adrenergically.mp3 | 13-Apr-2007 23:49 | 10K | |
![[SND]](/icons/sound2.gif) | adrenergic.mp3 | 13-Apr-2007 23:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | adrenally.mp3 | 13-Apr-2007 23:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | adrenalized.mp3 | 13-Apr-2007 23:49 | 11K | |
![[SND]](/icons/sound2.gif) | adrenalize.mp3 | 13-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | adrenaline.mp3 | 13-Apr-2007 23:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | adrenalectomy.mp3 | 13-Apr-2007 23:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | adrenalectomized.mp3 | 13-Apr-2007 23:49 | 12K | |
![[SND]](/icons/sound2.gif) | adrenal.mp3 | 13-Apr-2007 23:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | adren.mp3 | 13-Apr-2007 23:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | adrem.mp3 | 13-Apr-2007 23:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | ad rem.mp3 | 13-Apr-2007 23:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | adreferendum.mp3 | 13-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | ad referendum.mp3 | 13-Apr-2007 23:30 | 12K | |
![[SND]](/icons/sound2.gif) | adrastus.mp3 | 13-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | adrastea.mp3 | 13-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | adrammelech.mp3 | 13-Apr-2007 23:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | adquem.mp3 | 13-Apr-2007 23:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | adpersonam.mp3 | 13-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | adpatres.mp3 | 13-Apr-2007 23:49 | 17K | |
![[SND]](/icons/sound2.gif) | ad patres.mp3 | 13-Apr-2007 23:30 | 11K | |
![[SND]](/icons/sound2.gif) | adoze.mp3 | 13-Apr-2007 23:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | adown.mp3 | 13-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | adowa.mp3 | 13-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | adoula.mp3 | 13-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | adorno.mp3 | 13-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | adornment.mp3 | 13-Apr-2007 23:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | adorningly.mp3 | 13-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | adorn.mp3 | 13-Apr-2007 23:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | adoringly.mp3 | 13-Apr-2007 23:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | adore.mp3 | 13-Apr-2007 23:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | adoration.mp3 | 13-Apr-2007 23:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | adorally.mp3 | 13-Apr-2007 23:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | adoral.mp3 | 13-Apr-2007 23:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | adorably.mp3 | 13-Apr-2007 23:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | adorableness.mp3 | 13-Apr-2007 23:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | adorable.mp3 | 13-Apr-2007 23:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | adorability.mp3 | 13-Apr-2007 23:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | adoptively.mp3 | 13-Apr-2007 23:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | adoptive.mp3 | 13-Apr-2007 23:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | adoptionist.mp3 | 13-Apr-2007 23:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | adoptionism.mp3 | 13-Apr-2007 23:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | adoptional.mp3 | 13-Apr-2007 23:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | adoption.mp3 | 13-Apr-2007 23:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | adoptianism.mp3 | 13-Apr-2007 23:47 | 9.8K | |
![[SND]](/icons/sound2.gif) | adopter.mp3 | 13-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | adoptee.mp3 | 13-Apr-2007 23:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | adopted.mp3 | 13-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | adoptable.mp3 | 13-Apr-2007 23:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | adoptability.mp3 | 13-Apr-2007 23:47 | 9.5K | |
![[SND]](/icons/sound2.gif) | adopt.mp3 | 13-Apr-2007 23:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | adonolam.mp3 | 13-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | adonize.mp3 | 13-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | adonijah.mp3 | 13-Apr-2007 23:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | adonic.mp3 | 13-Apr-2007 23:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | adonais.mp3 | 13-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | adolf.mp3 | 13-Apr-2007 23:47 | 36K | |
![[SND]](/icons/sound2.gif) | adolescently.mp3 | 13-Apr-2007 23:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | adolescent.mp3 | 13-Apr-2007 23:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | adolescence.mp3 | 13-Apr-2007 23:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | adolesce.mp3 | 13-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | adoekiti.mp3 | 13-Apr-2007 23:47 | 17K | |
![[SND]](/icons/sound2.gif) | adobo.mp3 | 13-Apr-2007 23:47 | 6.3K | |
![[SND]](/icons/sound2.gif) | adobelike.mp3 | 13-Apr-2007 23:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | adobe.mp3 | 13-Apr-2007 23:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | ado.mp3 | 13-Apr-2007 23:47 | 5.4K | |
![[SND]](/icons/sound2.gif) | adnoun.mp3 | 13-Apr-2007 23:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | adnominal.mp3 | 13-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | adnexal.mp3 | 13-Apr-2007 23:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | adnexa.mp3 | 13-Apr-2007 23:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | adnauseam.mp3 | 13-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | ad nauseam.mp3 | 13-Apr-2007 23:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | adnation.mp3 | 13-Apr-2007 23:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | adnate.mp3 | 13-Apr-2007 23:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | adnah.mp3 | 13-Apr-2007 23:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | admonitory.mp3 | 13-Apr-2007 23:46 | 9.5K | |
![[SND]](/icons/sound2.gif) | admonitorily.mp3 | 13-Apr-2007 23:46 | 12K | |
![[SND]](/icons/sound2.gif) | admonitorial.mp3 | 13-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | admonitor.mp3 | 13-Apr-2007 23:46 | 17K | |
![[SND]](/icons/sound2.gif) | admonition.mp3 | 13-Apr-2007 23:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | admonishment.mp3 | 13-Apr-2007 23:46 | 9.5K | |
![[SND]](/icons/sound2.gif) | admonishingly.mp3 | 13-Apr-2007 23:46 | 10K | |
![[SND]](/icons/sound2.gif) | admonish.mp3 | 13-Apr-2007 23:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | admixture.mp3 | 13-Apr-2007 23:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | admix.mp3 | 13-Apr-2007 23:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | admitter.mp3 | 13-Apr-2007 23:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | admittee.mp3 | 13-Apr-2007 23:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | admittedly.mp3 | 13-Apr-2007 23:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | admitted.mp3 | 13-Apr-2007 23:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | admittance.mp3 | 13-Apr-2007 23:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | admit.mp3 | 13-Apr-2007 23:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | admissive.mp3 | 13-Apr-2007 23:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | admission.mp3 | 13-Apr-2007 23:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | admissibleness.mp3 | 13-Apr-2007 23:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | admissible.mp3 | 13-Apr-2007 23:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | admissibility.mp3 | 13-Apr-2007 23:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | admiringly.mp3 | 13-Apr-2007 23:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | admiring.mp3 | 13-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | admirer.mp3 | 13-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | admire.mp3 | 13-Apr-2007 23:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | admiratively.mp3 | 13-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | admirative.mp3 | 13-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | admiration.mp3 | 13-Apr-2007 23:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | admiralty.mp3 | 13-Apr-2007 23:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | admiralship.mp3 | 13-Apr-2007 23:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | admiralbenbow.mp3 | 13-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | admiral.mp3 | 13-Apr-2007 23:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | admirably.mp3 | 13-Apr-2007 23:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | admirableness.mp3 | 13-Apr-2007 23:45 | 10K | |
![[SND]](/icons/sound2.gif) | admirable.mp3 | 13-Apr-2007 23:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | admirability.mp3 | 13-Apr-2007 23:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | administratrix.mp3 | 13-Apr-2007 23:45 | 11K | |
![[SND]](/icons/sound2.gif) | administratrices.mp3 | 13-Apr-2007 23:45 | 13K | |
![[SND]](/icons/sound2.gif) | administratorship.mp3 | 13-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | administrator.mp3 | 13-Apr-2007 23:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | administratively.mp3 | 13-Apr-2007 23:45 | 17K | |
![[SND]](/icons/sound2.gif) | administrative.mp3 | 13-Apr-2007 23:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | administrational.mp3 | 13-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | administration.mp3 | 13-Apr-2007 23:44 | 11K | |
![[SND]](/icons/sound2.gif) | administrate.mp3 | 13-Apr-2007 23:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | administrant.mp3 | 13-Apr-2007 23:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | administrable.mp3 | 13-Apr-2007 23:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | administering.mp3 | 13-Apr-2007 23:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | administerial.mp3 | 13-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | administer.mp3 | 13-Apr-2007 23:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | adminicular.mp3 | 13-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | adminicle.mp3 | 13-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | admin.mp3 | 13-Apr-2007 23:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | admete.mp3 | 13-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | admeasurer.mp3 | 13-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | admeasurement.mp3 | 13-Apr-2007 23:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | admeasure.mp3 | 13-Apr-2007 23:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | admass.mp3 | 13-Apr-2007 23:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | adman.mp3 | 13-Apr-2007 23:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | admajoremdeigloriam.mp3 | 13-Apr-2007 23:44 | 27K | |
![[SND]](/icons/sound2.gif) | ad majorem Dei gloriam.mp3 | 13-Apr-2007 23:30 | 21K | |
![[SND]](/icons/sound2.gif) | admah.mp3 | 13-Apr-2007 23:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | adlitteram.mp3 | 13-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | adlitem.mp3 | 13-Apr-2007 23:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | adlibitum.mp3 | 13-Apr-2007 23:44 | 17K | |
![[SND]](/icons/sound2.gif) | ad libitum.mp3 | 13-Apr-2007 23:30 | 11K | |
![[SND]](/icons/sound2.gif) | adlibber.mp3 | 13-Apr-2007 23:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | adlib.mp3 | 13-Apr-2007 23:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | adless.mp3 | 13-Apr-2007 23:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | adlai.mp3 | 13-Apr-2007 23:43 | 36K | |
![[SND]](/icons/sound2.gif) | adkalendasgraecas.mp3 | 13-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | ad kalendas Graecas.mp3 | 13-Apr-2007 23:30 | 16K | |
![[SND]](/icons/sound2.gif) | adjuvant.mp3 | 13-Apr-2007 23:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | adjutant.mp3 | 13-Apr-2007 23:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | adjutancy.mp3 | 13-Apr-2007 23:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | adjutage.mp3 | 13-Apr-2007 23:43 | 17K | |
![[SND]](/icons/sound2.gif) | adjustor.mp3 | 13-Apr-2007 23:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | adjustmental.mp3 | 13-Apr-2007 23:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | adjustment.mp3 | 13-Apr-2007 23:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | adjustive.mp3 | 13-Apr-2007 23:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | adjuster.mp3 | 13-Apr-2007 23:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | adjusted.mp3 | 13-Apr-2007 23:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | adjustably.mp3 | 13-Apr-2007 23:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | adjustable.mp3 | 13-Apr-2007 23:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | adjustability.mp3 | 13-Apr-2007 23:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | adjust.mp3 | 13-Apr-2007 23:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | adjuror.mp3 | 13-Apr-2007 23:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | adjure.mp3 | 13-Apr-2007 23:43 | 5.9K | |
![[SND]](/icons/sound2.gif) | adjuratory.mp3 | 13-Apr-2007 23:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | adjuration.mp3 | 13-Apr-2007 23:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | adjunctly.mp3 | 13-Apr-2007 23:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | adjunctively.mp3 | 13-Apr-2007 23:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | adjunctive.mp3 | 13-Apr-2007 23:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | adjunction.mp3 | 13-Apr-2007 23:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | adjunct.mp3 | 13-Apr-2007 23:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | adjugate.mp3 | 13-Apr-2007 23:42 | 36K | |
![[SND]](/icons/sound2.gif) | adjudicatory.mp3 | 13-Apr-2007 23:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | adjudicator.mp3 | 13-Apr-2007 23:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | adjudicative.mp3 | 13-Apr-2007 23:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | adjudication.mp3 | 13-Apr-2007 23:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | adjudicate.mp3 | 13-Apr-2007 23:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | adjudicataire.mp3 | 13-Apr-2007 23:42 | 17K | |
![[SND]](/icons/sound2.gif) | adjudgment.mp3 | 13-Apr-2007 23:42 | 17K | |
![[SND]](/icons/sound2.gif) | adjudge.mp3 | 13-Apr-2007 23:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | adjournment.mp3 | 13-Apr-2007 23:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | adjourn.mp3 | 13-Apr-2007 23:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | adjoint.mp3 | 13-Apr-2007 23:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | adjoining.mp3 | 13-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | adjoin.mp3 | 13-Apr-2007 23:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | adjectively.mp3 | 13-Apr-2007 23:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | adjective.mp3 | 13-Apr-2007 23:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | adjectivally.mp3 | 13-Apr-2007 23:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | adjectival.mp3 | 13-Apr-2007 23:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | adject.mp3 | 13-Apr-2007 23:42 | 17K | |
![[SND]](/icons/sound2.gif) | adjacently.mp3 | 13-Apr-2007 23:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | adjacent.mp3 | 13-Apr-2007 23:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | adjacency.mp3 | 13-Apr-2007 23:41 | 9.3K | |
![[SND]](/icons/sound2.gif) | adiz.mp3 | 13-Apr-2007 23:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | adivasi.mp3 | 13-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | aditya.mp3 | 13-Apr-2007 23:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | adit.mp3 | 13-Apr-2007 23:41 | 4.5K | |
![[SND]](/icons/sound2.gif) | adirondack.mp3 | 13-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | adipsin.mp3 | 13-Apr-2007 23:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | adipsia.mp3 | 13-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | adiposity.mp3 | 13-Apr-2007 23:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | adiposis.mp3 | 13-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | adipose.mp3 | 13-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | adipopexic.mp3 | 13-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | adipopexia.mp3 | 13-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | adipokinetichormone.mp3 | 13-Apr-2007 23:41 | 27K | |
![[SND]](/icons/sound2.gif) | adipocyte.mp3 | 13-Apr-2007 23:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | adipocerous.mp3 | 13-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | adipocerite.mp3 | 13-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | adipocere.mp3 | 13-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | adipo.mp3 | 13-Apr-2007 23:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | adipicacid.mp3 | 13-Apr-2007 23:41 | 17K | |
![[SND]](/icons/sound2.gif) | adipic acid.mp3 | 13-Apr-2007 23:41 | 10K | |
![[SND]](/icons/sound2.gif) | adipate.mp3 | 13-Apr-2007 23:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | adip.mp3 | 13-Apr-2007 23:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | adiosmuchachos.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adios.mp3 | 13-Apr-2007 23:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | adinterim.mp3 | 13-Apr-2007 23:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | ad interim.mp3 | 13-Apr-2007 23:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | adinitium.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adinfinitum.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | ad infinitum.mp3 | 13-Apr-2007 23:30 | 10K | |
![[SND]](/icons/sound2.gif) | adigranth.mp3 | 13-Apr-2007 23:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | adighe.mp3 | 13-Apr-2007 23:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | adieux.mp3 | 13-Apr-2007 23:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | adieus.mp3 | 13-Apr-2007 23:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | adieu.mp3 | 13-Apr-2007 23:40 | 5.2K | |
![[SND]](/icons/sound2.gif) | adient.mp3 | 13-Apr-2007 23:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | adie.mp3 | 13-Apr-2007 23:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | adidas.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiathermanous.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiathermancy.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiaphorous.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiaphoristic.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiaphorism.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiaphoretic.mp3 | 13-Apr-2007 23:40 | 36K | |
![[SND]](/icons/sound2.gif) | adiaphoresis.mp3 | 13-Apr-2007 23:40 | 45K | |
![[SND]](/icons/sound2.gif) | adiantum.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiadochokinesia.mp3 | 13-Apr-2007 23:40 | 17K | |
![[SND]](/icons/sound2.gif) | adiactinic.mp3 | 13-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | adiabatically.mp3 | 13-Apr-2007 23:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | adiabatic.mp3 | 13-Apr-2007 23:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | adiabat.mp3 | 13-Apr-2007 23:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | adhominem.mp3 | 13-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | ad hominem.mp3 | 13-Apr-2007 23:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | adhocracy.mp3 | 13-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | adhocness.mp3 | 13-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | adhockery.mp3 | 13-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | adhoc.mp3 | 13-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ad hoc.mp3 | 13-Apr-2007 23:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | adhibition.mp3 | 13-Apr-2007 23:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | adhibit.mp3 | 13-Apr-2007 23:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | adhesiveness.mp3 | 13-Apr-2007 23:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | adhesive.mp3 | 13-Apr-2007 23:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | adhesive-bound.mp3 | 13-Apr-2007 23:39 | 10K | |
![[SND]](/icons/sound2.gif) | adhesional.mp3 | 13-Apr-2007 23:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | adhesion.mp3 | 13-Apr-2007 23:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | adherer.mp3 | 13-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | adherently.mp3 | 13-Apr-2007 23:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | adherent.mp3 | 13-Apr-2007 23:39 | 6.6K | |
![[SND]](/icons/sound2.gif) | adherend.mp3 | 13-Apr-2007 23:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | adherence.mp3 | 13-Apr-2007 23:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | adhere.mp3 | 13-Apr-2007 23:39 | 6.1K | |
![[SND]](/icons/sound2.gif) | adgloriam.mp3 | 13-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | adfreeze.mp3 | 13-Apr-2007 23:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | adfinem.mp3 | 13-Apr-2007 23:39 | 17K | |
![[SND]](/icons/sound2.gif) | ad feminam.mp3 | 13-Apr-2007 23:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | adextremum.mp3 | 13-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | ad extremum.mp3 | 13-Apr-2007 23:30 | 10K | |
![[SND]](/icons/sound2.gif) | adeux.mp3 | 13-Apr-2007 23:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | a deux.mp3 | 13-Apr-2007 22:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | adeundemgradum.mp3 | 13-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | ad eundem gradum.mp3 | 13-Apr-2007 23:30 | 12K | |
![[SND]](/icons/sound2.gif) | ad eundem.mp3 | 13-Apr-2007 23:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | adestefideles.mp3 | 13-Apr-2007 23:38 | 18K | |
![[SND]](/icons/sound2.gif) | adessive.mp3 | 13-Apr-2007 23:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | ades.mp3 | 13-Apr-2007 23:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | adequateness.mp3 | 13-Apr-2007 23:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | adequate.mp3 | 13-Apr-2007 23:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | adequacy.mp3 | 13-Apr-2007 23:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | adeptness.mp3 | 13-Apr-2007 23:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | adeptly.mp3 | 13-Apr-2007 23:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | adept.mp3 | 13-Apr-2007 23:38 | 5.7K | |
![[SND]](/icons/sound2.gif) | adephagia.mp3 | 13-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | adeodatus.mp3 | 13-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | adenylicacid.mp3 | 13-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | adenylic acid.mp3 | 13-Apr-2007 23:38 | 11K | |
![[SND]](/icons/sound2.gif) | adenyl cyclase.mp3 | 13-Apr-2007 23:38 | 13K | |
![[SND]](/icons/sound2.gif) | adenylatecyclase.mp3 | 13-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | adenylate cyclase.mp3 | 13-Apr-2007 23:38 | 14K | |
![[SND]](/icons/sound2.gif) | adenyl.mp3 | 13-Apr-2007 23:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | adenovirus.mp3 | 13-Apr-2007 23:38 | 11K | |
![[SND]](/icons/sound2.gif) | adenoviral.mp3 | 13-Apr-2007 23:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | adenosylmethionine.mp3 | 13-Apr-2007 23:38 | 27K | |
![[SND]](/icons/sound2.gif) | adenosis.mp3 | 13-Apr-2007 23:38 | 17K | |
![[SND]](/icons/sound2.gif) | adenosine triphosphate.mp3 | 13-Apr-2007 23:37 | 16K | |
![[SND]](/icons/sound2.gif) | adenosine triphosphatase.mp3 | 13-Apr-2007 23:37 | 18K | |
![[SND]](/icons/sound2.gif) | adenosine monophosphate.mp3 | 13-Apr-2007 23:37 | 16K | |
![[SND]](/icons/sound2.gif) | adenosine 3a,5a-monophosphate.mp3 | 13-Apr-2007 23:37 | 21K | |
![[SND]](/icons/sound2.gif) | adenosine.mp3 | 13-Apr-2007 23:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | adenose.mp3 | 13-Apr-2007 23:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | adenopathy.mp3 | 13-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | adenomatous.mp3 | 13-Apr-2007 23:37 | 10K | |
![[SND]](/icons/sound2.gif) | adenomatoid.mp3 | 13-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | adenomata.mp3 | 13-Apr-2007 23:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | adenoma.mp3 | 13-Apr-2007 23:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | adenology.mp3 | 13-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | adenological.mp3 | 13-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | adenoiditis.mp3 | 13-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | adenoidectomy.mp3 | 13-Apr-2007 23:37 | 17K | |
![[SND]](/icons/sound2.gif) | adenoidally.mp3 | 13-Apr-2007 23:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | adenoidal.mp3 | 13-Apr-2007 23:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | adenoid.mp3 | 13-Apr-2007 23:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | adenohypophysis.mp3 | 13-Apr-2007 23:37 | 14K | |
![[SND]](/icons/sound2.gif) | adenohypophysial.mp3 | 13-Apr-2007 23:37 | 14K | |
![[SND]](/icons/sound2.gif) | adenohypophyses.mp3 | 13-Apr-2007 23:37 | 14K | |
![[SND]](/icons/sound2.gif) | adenohypophyseal.mp3 | 13-Apr-2007 23:37 | 15K | |
![[SND]](/icons/sound2.gif) | adenocarcinomatous.mp3 | 13-Apr-2007 23:37 | 15K | |
![[SND]](/icons/sound2.gif) | adenocarcinoma.mp3 | 13-Apr-2007 23:37 | 13K | |
![[SND]](/icons/sound2.gif) | adenoacanthoma.mp3 | 13-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | adeno.mp3 | 13-Apr-2007 23:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | adenitis.mp3 | 13-Apr-2007 23:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | adenine.mp3 | 13-Apr-2007 23:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | adenese.mp3 | 13-Apr-2007 23:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | adenectomy.mp3 | 13-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | adenalgia.mp3 | 13-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | ademption.mp3 | 13-Apr-2007 23:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | adelphous.mp3 | 13-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | adeline.mp3 | 13-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | adeliepenguin.mp3 | 13-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | adeliecoast.mp3 | 13-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | adelgid.mp3 | 13-Apr-2007 23:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | adele.mp3 | 13-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | adelantado.mp3 | 13-Apr-2007 23:36 | 17K | |
![[SND]](/icons/sound2.gif) | adeem.mp3 | 13-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | addy.mp3 | 13-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | adductor.mp3 | 13-Apr-2007 23:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | adductive.mp3 | 13-Apr-2007 23:36 | 36K | |
![[SND]](/icons/sound2.gif) | adduction.mp3 | 13-Apr-2007 23:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | adduct.mp3 | 13-Apr-2007 23:35 | 5.7K | |
![[SND]](/icons/sound2.gif) | adducer.mp3 | 13-Apr-2007 23:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | adducent.mp3 | 13-Apr-2007 23:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | adduce.mp3 | 13-Apr-2007 23:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | addressor.mp3 | 13-Apr-2007 23:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | addressograph.mp3 | 13-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | addressing.mp3 | 13-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | addresser.mp3 | 13-Apr-2007 23:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | addressee.mp3 | 13-Apr-2007 23:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | addressable.mp3 | 13-Apr-2007 23:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | addressability.mp3 | 13-Apr-2007 23:35 | 10K | |
![[SND]](/icons/sound2.gif) | address.mp3 | 13-Apr-2007 23:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | addra.mp3 | 13-Apr-2007 23:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | addorsed.mp3 | 13-Apr-2007 23:35 | 17K | |
![[SND]](/icons/sound2.gif) | addling.mp3 | 13-Apr-2007 23:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | addlepated.mp3 | 13-Apr-2007 23:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | addle.mp3 | 13-Apr-2007 23:35 | 4.5K | |
![[SND]](/icons/sound2.gif) | additur.mp3 | 13-Apr-2007 23:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | additory.mp3 | 13-Apr-2007 23:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | additivity.mp3 | 13-Apr-2007 23:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | additively.mp3 | 13-Apr-2007 23:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | additive.mp3 | 13-Apr-2007 23:35 | 5.9K | |
![[SND]](/icons/sound2.gif) | additionally.mp3 | 13-Apr-2007 23:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | additional.mp3 | 13-Apr-2007 23:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | addition.mp3 | 13-Apr-2007 23:34 | 6.4K | |
![[SND]](/icons/sound2.gif) | additamentary.mp3 | 13-Apr-2007 23:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | additament.mp3 | 13-Apr-2007 23:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | addisababa.mp3 | 13-Apr-2007 23:34 | 17K | |
![[SND]](/icons/sound2.gif) | addio.mp3 | 13-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | addington.mp3 | 13-Apr-2007 23:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | adding.mp3 | 13-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | addie.mp3 | 13-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | addictiveness.mp3 | 13-Apr-2007 23:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | addictive.mp3 | 13-Apr-2007 23:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | addiction.mp3 | 13-Apr-2007 23:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | addictedness.mp3 | 13-Apr-2007 23:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | addicted.mp3 | 13-Apr-2007 23:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | addict.mp3 | 13-Apr-2007 23:34 | 5.7K | |
![[SND]](/icons/sound2.gif) | addible.mp3 | 13-Apr-2007 23:34 | 5.4K | |
![[SND]](/icons/sound2.gif) | adder.mp3 | 13-Apr-2007 23:34 | 4.5K | |
![[SND]](/icons/sound2.gif) | adder's-tongue.mp3 | 13-Apr-2007 23:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | addendum.mp3 | 13-Apr-2007 23:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | addenda.mp3 | 13-Apr-2007 23:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | addend.mp3 | 13-Apr-2007 23:34 | 5.4K | |
![[SND]](/icons/sound2.gif) | addedly.mp3 | 13-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | addax.mp3 | 13-Apr-2007 23:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | addamnum.mp3 | 13-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | add.mp3 | 13-Apr-2007 23:33 | 5.0K | |
![[SND]](/icons/sound2.gif) | add-on.mp3 | 13-Apr-2007 23:35 | 6.1K | |
![[SND]](/icons/sound2.gif) | add-in.mp3 | 13-Apr-2007 23:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | adcockantenna.mp3 | 13-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | adcaptandumvulgus.mp3 | 13-Apr-2007 23:33 | 27K | |
![[SND]](/icons/sound2.gif) | adazzle.mp3 | 13-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | adaxial.mp3 | 13-Apr-2007 23:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | adatom.mp3 | 13-Apr-2007 23:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | adat.mp3 | 13-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | adastraperaspera.mp3 | 13-Apr-2007 23:33 | 27K | |
![[SND]](/icons/sound2.gif) | ad astra per aspera.mp3 | 13-Apr-2007 23:30 | 16K | |
![[SND]](/icons/sound2.gif) | adas.mp3 | 13-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | adarsheni.mp3 | 13-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | adarbitrium.mp3 | 13-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | ad arbitrium.mp3 | 13-Apr-2007 23:30 | 11K | |
![[SND]](/icons/sound2.gif) | adapts.mp3 | 13-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | adaptor.mp3 | 13-Apr-2007 23:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | adaptometer.mp3 | 13-Apr-2007 23:33 | 17K | |
![[SND]](/icons/sound2.gif) | adaptivity.mp3 | 13-Apr-2007 23:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | adaptive.mp3 | 13-Apr-2007 23:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | adaption.mp3 | 13-Apr-2007 23:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | adapter.mp3 | 13-Apr-2007 23:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | adaptedness.mp3 | 13-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | adaptationist.mp3 | 13-Apr-2007 23:32 | 12K | |
![[SND]](/icons/sound2.gif) | adaptationally.mp3 | 13-Apr-2007 23:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | adaptational.mp3 | 13-Apr-2007 23:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | adaptation.mp3 | 13-Apr-2007 23:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | adaptably.mp3 | 13-Apr-2007 23:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | adaptable.mp3 | 13-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | adaptability.mp3 | 13-Apr-2007 23:32 | 9.8K | |
![[SND]](/icons/sound2.gif) | adapt.mp3 | 13-Apr-2007 23:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | adangle.mp3 | 13-Apr-2007 23:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | adamson.mp3 | 13-Apr-2007 23:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | adamski.mp3 | 13-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | adamsite.mp3 | 13-Apr-2007 23:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | adamitical.mp3 | 13-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | adamite.mp3 | 13-Apr-2007 23:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | adamically.mp3 | 13-Apr-2007 23:32 | 36K | |
![[SND]](/icons/sound2.gif) | adamesque.mp3 | 13-Apr-2007 23:32 | 17K | |
![[SND]](/icons/sound2.gif) | adamdelahalle.mp3 | 13-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | adamawa.mp3 | 13-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | adamantly.mp3 | 13-Apr-2007 23:31 | 36K | |
![[SND]](/icons/sound2.gif) | adamantine.mp3 | 13-Apr-2007 23:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | adamantane.mp3 | 13-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | adamant.mp3 | 13-Apr-2007 23:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | adamancy.mp3 | 13-Apr-2007 23:31 | 11K | |
![[SND]](/icons/sound2.gif) | adamance.mp3 | 13-Apr-2007 23:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | adama.mp3 | 13-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | adam-and-eve.mp3 | 13-Apr-2007 23:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | adaline.mp3 | 13-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | adair.mp3 | 13-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | adah.mp3 | 13-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | adagio.mp3 | 13-Apr-2007 23:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | adagietto.mp3 | 13-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | adage.mp3 | 13-Apr-2007 23:31 | 5.2K | |
![[SND]](/icons/sound2.gif) | adad.mp3 | 13-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | adactylous.mp3 | 13-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | adabsurdum.mp3 | 13-Apr-2007 23:31 | 17K | |
![[SND]](/icons/sound2.gif) | adabazar.mp3 | 13-Apr-2007 23:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | ad.mp3 | 13-Apr-2007 23:31 | 4.8K | |
![[SND]](/icons/sound2.gif) | ad-lib.mp3 | 13-Apr-2007 23:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | acyloin.mp3 | 13-Apr-2007 23:30 | 36K | |
![[SND]](/icons/sound2.gif) | acylation.mp3 | 13-Apr-2007 23:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | acylate.mp3 | 13-Apr-2007 23:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | acyl.mp3 | 13-Apr-2007 23:29 | 5.4K | |
![[SND]](/icons/sound2.gif) | acyclovir.mp3 | 13-Apr-2007 23:29 | 9.6K | |
![[SND]](/icons/sound2.gif) | acyclic.mp3 | 13-Apr-2007 23:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | acy.mp3 | 13-Apr-2007 23:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | acv.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acutilingual.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acutest.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acuteness.mp3 | 13-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | acute.mp3 | 13-Apr-2007 23:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | acutance.mp3 | 13-Apr-2007 23:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | acushla.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acusector.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acusection.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acus.mp3 | 13-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | acura.mp3 | 13-Apr-2007 23:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | acupuncturist.mp3 | 13-Apr-2007 23:29 | 11K | |
![[SND]](/icons/sound2.gif) | acupuncture.mp3 | 13-Apr-2007 23:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | acupunctural.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acupressurist.mp3 | 13-Apr-2007 23:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | acupressure.mp3 | 13-Apr-2007 23:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | acuminous.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acumination.mp3 | 13-Apr-2007 23:29 | 17K | |
![[SND]](/icons/sound2.gif) | acuminate.mp3 | 13-Apr-2007 23:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | acumen.mp3 | 13-Apr-2007 23:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | aculeus.mp3 | 13-Apr-2007 23:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | aculeate.mp3 | 13-Apr-2007 23:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | acuity.mp3 | 13-Apr-2007 23:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | acuate.mp3 | 13-Apr-2007 23:28 | 36K | |
![[SND]](/icons/sound2.gif) | actuator.mp3 | 13-Apr-2007 23:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | actuation.mp3 | 13-Apr-2007 23:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | actuate.mp3 | 13-Apr-2007 23:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | actuary.mp3 | 13-Apr-2007 23:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | actuarially.mp3 | 13-Apr-2007 23:28 | 10K | |
![[SND]](/icons/sound2.gif) | actuarial.mp3 | 13-Apr-2007 23:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | actualness.mp3 | 13-Apr-2007 23:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | actually.mp3 | 13-Apr-2007 23:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | actualize.mp3 | 13-Apr-2007 23:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | actualization.mp3 | 13-Apr-2007 23:28 | 12K | |
![[SND]](/icons/sound2.gif) | actuality.mp3 | 13-Apr-2007 23:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | actualite.mp3 | 13-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | actualistic.mp3 | 13-Apr-2007 23:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | actualism.mp3 | 13-Apr-2007 23:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | actual.mp3 | 13-Apr-2007 23:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | actressy.mp3 | 13-Apr-2007 23:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | actress.mp3 | 13-Apr-2007 23:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | actorly.mp3 | 13-Apr-2007 23:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | actorish.mp3 | 13-Apr-2007 23:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | actoridae.mp3 | 13-Apr-2007 23:28 | 17K | |
![[SND]](/icons/sound2.gif) | actor.mp3 | 13-Apr-2007 23:27 | 5.0K | |
![[SND]](/icons/sound2.gif) | actomyosin.mp3 | 13-Apr-2007 23:27 | 9.8K | |
![[SND]](/icons/sound2.gif) | actograph.mp3 | 13-Apr-2007 23:27 | 17K | |
![[SND]](/icons/sound2.gif) | acto.mp3 | 13-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | activize.mp3 | 13-Apr-2007 23:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | activization.mp3 | 13-Apr-2007 23:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | activity.mp3 | 13-Apr-2007 23:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | activistic.mp3 | 13-Apr-2007 23:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | activist.mp3 | 13-Apr-2007 23:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | activism.mp3 | 13-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | activewear.mp3 | 13-Apr-2007 23:27 | 9.6K | |
![[SND]](/icons/sound2.gif) | activeness.mp3 | 13-Apr-2007 23:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | active.mp3 | 13-Apr-2007 23:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | active-matrix.mp3 | 13-Apr-2007 23:27 | 12K | |
![[SND]](/icons/sound2.gif) | activator.mp3 | 13-Apr-2007 23:27 | 7.5K | |
![[SND]](/icons/sound2.gif) | activation.mp3 | 13-Apr-2007 23:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | activated.mp3 | 13-Apr-2007 23:27 | 17K | |
![[SND]](/icons/sound2.gif) | activate.mp3 | 13-Apr-2007 23:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | activasetpa.mp3 | 13-Apr-2007 23:27 | 27K | |
![[SND]](/icons/sound2.gif) | actionless.mp3 | 13-Apr-2007 23:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | actionist.mp3 | 13-Apr-2007 23:27 | 17K | |
![[SND]](/icons/sound2.gif) | actioner.mp3 | 13-Apr-2007 23:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | actional.mp3 | 13-Apr-2007 23:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | actionably.mp3 | 13-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | actionable.mp3 | 13-Apr-2007 23:26 | 7.5K | |
![[SND]](/icons/sound2.gif) | action.mp3 | 13-Apr-2007 23:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | actinozoan.mp3 | 13-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | actinopterygian.mp3 | 13-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | actinopod.mp3 | 13-Apr-2007 23:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | actinon.mp3 | 13-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | actinomycotic.mp3 | 13-Apr-2007 23:26 | 11K | |
![[SND]](/icons/sound2.gif) | actinomycosis.mp3 | 13-Apr-2007 23:26 | 13K | |
![[SND]](/icons/sound2.gif) | actinomycin.mp3 | 13-Apr-2007 23:26 | 10K | |
![[SND]](/icons/sound2.gif) | actinomycetous.mp3 | 13-Apr-2007 23:26 | 36K | |
![[SND]](/icons/sound2.gif) | actinomycete.mp3 | 13-Apr-2007 23:26 | 12K | |
![[SND]](/icons/sound2.gif) | actinomycetal.mp3 | 13-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | actinomyces.mp3 | 13-Apr-2007 23:26 | 11K | |
![[SND]](/icons/sound2.gif) | actinomorphy.mp3 | 13-Apr-2007 23:26 | 12K | |
![[SND]](/icons/sound2.gif) | actinomorphic.mp3 | 13-Apr-2007 23:26 | 11K | |
![[SND]](/icons/sound2.gif) | actinometry.mp3 | 13-Apr-2007 23:26 | 9.8K | |
![[SND]](/icons/sound2.gif) | actinometrical.mp3 | 13-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | actinometric.mp3 | 13-Apr-2007 23:26 | 10K | |
![[SND]](/icons/sound2.gif) | actinometer.mp3 | 13-Apr-2007 23:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | actinomere.mp3 | 13-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | actinology.mp3 | 13-Apr-2007 23:26 | 17K | |
![[SND]](/icons/sound2.gif) | actinolitic.mp3 | 13-Apr-2007 23:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | actinolite.mp3 | 13-Apr-2007 23:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | actinoid.mp3 | 13-Apr-2007 23:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | actinography.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actinographic.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actinograph.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actinogram.mp3 | 13-Apr-2007 23:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | actinodrome.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actinobacillotic.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actinobacillosis.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actino.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actinium.mp3 | 13-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | actinism.mp3 | 13-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | actinin.mp3 | 13-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | actiniform.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actinide.mp3 | 13-Apr-2007 23:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | actinically.mp3 | 13-Apr-2007 23:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | actinic.mp3 | 13-Apr-2007 23:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | actinian.mp3 | 13-Apr-2007 23:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | actinia.mp3 | 13-Apr-2007 23:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | acting.mp3 | 13-Apr-2007 23:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | actinally.mp3 | 13-Apr-2007 23:25 | 27K | |
![[SND]](/icons/sound2.gif) | actinal.mp3 | 13-Apr-2007 23:25 | 27K | |
![[SND]](/icons/sound2.gif) | actin.mp3 | 13-Apr-2007 23:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | actigraph.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actifed.mp3 | 13-Apr-2007 23:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | actiangames.mp3 | 13-Apr-2007 23:25 | 17K | |
![[SND]](/icons/sound2.gif) | actian.mp3 | 13-Apr-2007 23:24 | 36K | |
![[SND]](/icons/sound2.gif) | acte gratuit.mp3 | 13-Apr-2007 23:24 | 12K | |
![[SND]](/icons/sound2.gif) | actcom.mp3 | 13-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | actasanctorum.mp3 | 13-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | actant.mp3 | 13-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | actable.mp3 | 13-Apr-2007 23:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | actability.mp3 | 13-Apr-2007 23:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | acta.mp3 | 13-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | act.mp3 | 13-Apr-2007 23:24 | 4.5K | |
![[SND]](/icons/sound2.gif) | acrylyl.mp3 | 13-Apr-2007 23:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | acrylonitrile.mp3 | 13-Apr-2007 23:24 | 11K | |
![[SND]](/icons/sound2.gif) | acrylic.mp3 | 13-Apr-2007 23:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | acrylate.mp3 | 13-Apr-2007 23:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | acrylamide.mp3 | 13-Apr-2007 23:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | acrylaldehyde.mp3 | 13-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | acrux.mp3 | 13-Apr-2007 23:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrotism.mp3 | 13-Apr-2007 23:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | acrotic.mp3 | 13-Apr-2007 23:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | acroterium.mp3 | 13-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | acroterion.mp3 | 13-Apr-2007 23:24 | 45K | |
![[SND]](/icons/sound2.gif) | acroterial.mp3 | 13-Apr-2007 23:24 | 17K | |
![[SND]](/icons/sound2.gif) | acrostically.mp3 | 13-Apr-2007 23:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | acrostical.mp3 | 13-Apr-2007 23:23 | 9.1K | |
![[SND]](/icons/sound2.gif) | acrostic.mp3 | 13-Apr-2007 23:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | acrost.mp3 | 13-Apr-2007 23:23 | 17K | |
![[SND]](/icons/sound2.gif) | across.mp3 | 13-Apr-2007 23:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | acrosporous.mp3 | 13-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | acrospore.mp3 | 13-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | acrospire.mp3 | 13-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | acrosome.mp3 | 13-Apr-2007 23:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | acrosomal.mp3 | 13-Apr-2007 23:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | acrosin.mp3 | 13-Apr-2007 23:23 | 17K | |
![[SND]](/icons/sound2.gif) | acropolitan.mp3 | 13-Apr-2007 23:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | acropolis.mp3 | 13-Apr-2007 23:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | acrophony.mp3 | 13-Apr-2007 23:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrophonetically.mp3 | 13-Apr-2007 23:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrophobic.mp3 | 13-Apr-2007 23:23 | 10K | |
![[SND]](/icons/sound2.gif) | acrophobia.mp3 | 13-Apr-2007 23:23 | 10K | |
![[SND]](/icons/sound2.gif) | acrophobe.mp3 | 13-Apr-2007 23:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | acropetally.mp3 | 13-Apr-2007 23:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | acropetal.mp3 | 13-Apr-2007 23:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | acropathy.mp3 | 13-Apr-2007 23:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | acronymize.mp3 | 13-Apr-2007 23:23 | 17K | |
![[SND]](/icons/sound2.gif) | acronymically.mp3 | 13-Apr-2007 23:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | acronymic.mp3 | 13-Apr-2007 23:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | acronym.mp3 | 13-Apr-2007 23:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | acronically.mp3 | 13-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | acronical.mp3 | 13-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | acronal.mp3 | 13-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | acron.mp3 | 13-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | acromion.mp3 | 13-Apr-2007 23:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | acromioclavicular.mp3 | 13-Apr-2007 23:22 | 18K | |
![[SND]](/icons/sound2.gif) | acromicria.mp3 | 13-Apr-2007 23:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | acromial.mp3 | 13-Apr-2007 23:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | acromegaly.mp3 | 13-Apr-2007 23:22 | 9.8K | |
![[SND]](/icons/sound2.gif) | acromegalic.mp3 | 13-Apr-2007 23:22 | 9.5K | |
![[SND]](/icons/sound2.gif) | acrology.mp3 | 13-Apr-2007 23:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | acrologically.mp3 | 13-Apr-2007 23:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | acrolithic.mp3 | 13-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | acrolith.mp3 | 13-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | acrolein.mp3 | 13-Apr-2007 23:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrolectal.mp3 | 13-Apr-2007 23:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrolect.mp3 | 13-Apr-2007 23:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | acrogynous.mp3 | 13-Apr-2007 23:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrogenously.mp3 | 13-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | acrogen.mp3 | 13-Apr-2007 23:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | acrodynia.mp3 | 13-Apr-2007 23:22 | 17K | |
![[SND]](/icons/sound2.gif) | acrodontism.mp3 | 13-Apr-2007 23:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrodont.mp3 | 13-Apr-2007 23:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrocorinth.mp3 | 13-Apr-2007 23:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | acrocephaly.mp3 | 13-Apr-2007 23:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | acrocephalous.mp3 | 13-Apr-2007 23:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | acrocentric.mp3 | 13-Apr-2007 23:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | acrocarpous.mp3 | 13-Apr-2007 23:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | acrobatics.mp3 | 13-Apr-2007 23:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | acrobatically.mp3 | 13-Apr-2007 23:21 | 10K | |
![[SND]](/icons/sound2.gif) | acrobatic.mp3 | 13-Apr-2007 23:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | acrobat.mp3 | 13-Apr-2007 23:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | acro.mp3 | 13-Apr-2007 23:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | acritical.mp3 | 13-Apr-2007 23:21 | 17K | |
![[SND]](/icons/sound2.gif) | acritarchous.mp3 | 13-Apr-2007 23:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | acritarch.mp3 | 13-Apr-2007 23:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | acrimony.mp3 | 13-Apr-2007 23:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrimoniously.mp3 | 13-Apr-2007 23:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | acrimonious.mp3 | 13-Apr-2007 23:21 | 11K | |
![[SND]](/icons/sound2.gif) | acrilan.mp3 | 13-Apr-2007 23:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | acriflavine.mp3 | 13-Apr-2007 23:21 | 9.6K | |
![[SND]](/icons/sound2.gif) | acridly.mp3 | 13-Apr-2007 23:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | acridity.mp3 | 13-Apr-2007 23:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | acridine.mp3 | 13-Apr-2007 23:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | acridid.mp3 | 13-Apr-2007 23:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | acrid.mp3 | 13-Apr-2007 23:21 | 5.4K | |
![[SND]](/icons/sound2.gif) | acred.mp3 | 13-Apr-2007 23:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | acreage.mp3 | 13-Apr-2007 23:21 | 6.8K | |
![[SND]](/icons/sound2.gif) | acre.mp3 | 13-Apr-2007 23:21 | 4.8K | |
![[SND]](/icons/sound2.gif) | acre-inch.mp3 | 13-Apr-2007 23:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | acre-foot.mp3 | 13-Apr-2007 23:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | acrawl.mp3 | 13-Apr-2007 23:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | acrasin.mp3 | 13-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | acraldehyde.mp3 | 13-Apr-2007 23:20 | 17K | |
![[SND]](/icons/sound2.gif) | acr.mp3 | 13-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | acquitter.mp3 | 13-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | acquittance.mp3 | 13-Apr-2007 23:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | acquittal.mp3 | 13-Apr-2007 23:20 | 5.9K | |
![[SND]](/icons/sound2.gif) | acquit.mp3 | 13-Apr-2007 23:20 | 5.2K | |
![[SND]](/icons/sound2.gif) | acquisitor.mp3 | 13-Apr-2007 23:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | acquisitiveness.mp3 | 13-Apr-2007 23:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | acquisitive.mp3 | 13-Apr-2007 23:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | acquisitional.mp3 | 13-Apr-2007 23:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | acquisition.mp3 | 13-Apr-2007 23:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | acquirer.mp3 | 13-Apr-2007 23:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | acquirement.mp3 | 13-Apr-2007 23:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | acquiree.mp3 | 13-Apr-2007 23:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | acquired.mp3 | 13-Apr-2007 23:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | acquire.mp3 | 13-Apr-2007 23:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | acquirable.mp3 | 13-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | acquiescingly.mp3 | 13-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | acquiescently.mp3 | 13-Apr-2007 23:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | acquiescent.mp3 | 13-Apr-2007 23:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | acquiescence.mp3 | 13-Apr-2007 23:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | acquiesce.mp3 | 13-Apr-2007 23:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | acquest.mp3 | 13-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | acquaintedness.mp3 | 13-Apr-2007 23:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | acquainted.mp3 | 13-Apr-2007 23:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | acquaintanceship.mp3 | 13-Apr-2007 23:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | acquaintance.mp3 | 13-Apr-2007 23:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | acquaint.mp3 | 13-Apr-2007 23:19 | 5.5K | |
![[SND]](/icons/sound2.gif) | acquaalta.mp3 | 13-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | acousto.mp3 | 13-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | acoustimeter.mp3 | 13-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | acoustics.mp3 | 13-Apr-2007 23:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | acoustician.mp3 | 13-Apr-2007 23:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | acoustically.mp3 | 13-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | acoustical.mp3 | 13-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | acoustic.mp3 | 13-Apr-2007 23:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | acousma.mp3 | 13-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | a coup sur.mp3 | 13-Apr-2007 22:30 | 9.3K | |
![[SND]](/icons/sound2.gif) | acoumeter.mp3 | 13-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | acouchi.mp3 | 13-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | acouasm.mp3 | 13-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | acotyledonous.mp3 | 13-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | acotyledon.mp3 | 13-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | acorned.mp3 | 13-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | acorn.mp3 | 13-Apr-2007 23:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | aconitine.mp3 | 13-Apr-2007 23:19 | 17K | |
![[SND]](/icons/sound2.gif) | aconitic.mp3 | 13-Apr-2007 23:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | aconite.mp3 | 13-Apr-2007 23:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | acompte.mp3 | 13-Apr-2007 23:18 | 17K | |
![[SND]](/icons/sound2.gif) | a compte.mp3 | 13-Apr-2007 22:30 | 6.1K | |
![[SND]](/icons/sound2.gif) | acoma.mp3 | 13-Apr-2007 23:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | acolyte.mp3 | 13-Apr-2007 23:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | acold.mp3 | 13-Apr-2007 23:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | acol.mp3 | 13-Apr-2007 23:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | acoenaesthesia.mp3 | 13-Apr-2007 23:18 | 17K | |
![[SND]](/icons/sound2.gif) | acoelous.mp3 | 13-Apr-2007 23:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | acoelomate.mp3 | 13-Apr-2007 23:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | acock.mp3 | 13-Apr-2007 23:18 | 5.5K | |
![[SND]](/icons/sound2.gif) | acoasm.mp3 | 13-Apr-2007 23:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | acnode.mp3 | 13-Apr-2007 23:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | acnodal.mp3 | 13-Apr-2007 23:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | acnemia.mp3 | 13-Apr-2007 23:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | acnegenic.mp3 | 13-Apr-2007 23:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | acned.mp3 | 13-Apr-2007 23:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | acne.mp3 | 13-Apr-2007 23:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | acmite.mp3 | 13-Apr-2007 23:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | acmesthesia.mp3 | 13-Apr-2007 23:18 | 17K | |
![[SND]](/icons/sound2.gif) | acmeism.mp3 | 13-Apr-2007 23:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | acme.mp3 | 13-Apr-2007 23:18 | 5.2K | |
![[SND]](/icons/sound2.gif) | acmatic.mp3 | 13-Apr-2007 23:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | aclutter.mp3 | 13-Apr-2007 23:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | aclinicline.mp3 | 13-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | acleistocardia.mp3 | 13-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | acle.mp3 | 13-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | acky.mp3 | 13-Apr-2007 23:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | ackton.mp3 | 13-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | acknowledgment.mp3 | 13-Apr-2007 23:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | acknowledger.mp3 | 13-Apr-2007 23:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | acknowledgement.mp3 | 13-Apr-2007 23:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | acknowledgedly.mp3 | 13-Apr-2007 23:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | acknowledged.mp3 | 13-Apr-2007 23:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | acknowledge.mp3 | 13-Apr-2007 23:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | ackey.mp3 | 13-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | ackermaracker.mp3 | 13-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | acker.mp3 | 13-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | ackemma.mp3 | 13-Apr-2007 23:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | ackee.mp3 | 13-Apr-2007 23:17 | 5.0K | |
![[SND]](/icons/sound2.gif) | ackamaraka.mp3 | 13-Apr-2007 23:17 | 17K | |
![[SND]](/icons/sound2.gif) | ackack.mp3 | 13-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | ack.mp3 | 13-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | ack-ack.mp3 | 13-Apr-2007 23:17 | 5.9K | |
![[SND]](/icons/sound2.gif) | acity.mp3 | 13-Apr-2007 23:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | acis.mp3 | 13-Apr-2007 23:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | acious.mp3 | 13-Apr-2007 23:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | acinus.mp3 | 13-Apr-2007 23:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | acinous.mp3 | 13-Apr-2007 23:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | aciniform.mp3 | 13-Apr-2007 23:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | acinic.mp3 | 13-Apr-2007 23:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | acini.mp3 | 13-Apr-2007 23:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | acinarious.mp3 | 13-Apr-2007 23:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | acinar.mp3 | 13-Apr-2007 23:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | acinaciform.mp3 | 13-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | acinaceous.mp3 | 13-Apr-2007 23:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | aciform.mp3 | 13-Apr-2007 23:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | acieration.mp3 | 13-Apr-2007 23:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | acierate.mp3 | 13-Apr-2007 23:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | acierage.mp3 | 13-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | acidy.mp3 | 13-Apr-2007 23:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | aciduric.mp3 | 13-Apr-2007 23:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | aciduria.mp3 | 13-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | acidulous.mp3 | 13-Apr-2007 23:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | acidulent.mp3 | 13-Apr-2007 23:16 | 7.5K | |
![[SND]](/icons/sound2.gif) | acidulation.mp3 | 13-Apr-2007 23:16 | 9.8K | |
![[SND]](/icons/sound2.gif) | acidulate.mp3 | 13-Apr-2007 23:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | acidulant.mp3 | 13-Apr-2007 23:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | acidotic.mp3 | 13-Apr-2007 23:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | acidosis.mp3 | 13-Apr-2007 23:16 | 10K | |
![[SND]](/icons/sound2.gif) | acidophilusmilk.mp3 | 13-Apr-2007 23:16 | 17K | |
![[SND]](/icons/sound2.gif) | acidophilus.mp3 | 13-Apr-2007 23:15 | 12K | |
![[SND]](/icons/sound2.gif) | acidophilic.mp3 | 13-Apr-2007 23:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | acidophile.mp3 | 13-Apr-2007 23:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | acidophil.mp3 | 13-Apr-2007 23:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | acidometer.mp3 | 13-Apr-2007 23:15 | 17K | |
![[SND]](/icons/sound2.gif) | acidolysis.mp3 | 13-Apr-2007 23:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | acidogenic.mp3 | 13-Apr-2007 23:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | acidness.mp3 | 13-Apr-2007 23:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | acidize.mp3 | 13-Apr-2007 23:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | acidization.mp3 | 13-Apr-2007 23:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | acidity.mp3 | 13-Apr-2007 23:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | acidimetry.mp3 | 13-Apr-2007 23:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | acidimetrically.mp3 | 13-Apr-2007 23:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | acidimeter.mp3 | 13-Apr-2007 23:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | acidify.mp3 | 13-Apr-2007 23:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | acidifier.mp3 | 13-Apr-2007 23:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | acidification.mp3 | 13-Apr-2007 23:15 | 12K | |
![[SND]](/icons/sound2.gif) | acidiferous.mp3 | 13-Apr-2007 23:15 | 17K | |
![[SND]](/icons/sound2.gif) | acidic.mp3 | 13-Apr-2007 23:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | acidhead.mp3 | 13-Apr-2007 23:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | acidanthera.mp3 | 13-Apr-2007 23:15 | 17K | |
![[SND]](/icons/sound2.gif) | acid.mp3 | 13-Apr-2007 23:15 | 5.5K | |
![[SND]](/icons/sound2.gif) | acid-washed.mp3 | 13-Apr-2007 23:16 | 10K | |
![[SND]](/icons/sound2.gif) | acid-wash.mp3 | 13-Apr-2007 23:16 | 10K | |
![[SND]](/icons/sound2.gif) | acid-fast.mp3 | 13-Apr-2007 23:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | aciculum.mp3 | 13-Apr-2007 23:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | aciculate.mp3 | 13-Apr-2007 23:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | acicularly.mp3 | 13-Apr-2007 23:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | acicular.mp3 | 13-Apr-2007 23:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | acicula.mp3 | 13-Apr-2007 23:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | achyfi.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achy.mp3 | 13-Apr-2007 23:14 | 4.8K | |
![[SND]](/icons/sound2.gif) | achtung.mp3 | 13-Apr-2007 23:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | achsah.mp3 | 13-Apr-2007 23:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | achromycin.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromobacter.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromic.mp3 | 13-Apr-2007 23:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | achromatous.mp3 | 13-Apr-2007 23:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | achromatopsia.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromatophilia.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromatophil.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromatize.mp3 | 13-Apr-2007 23:14 | 10K | |
![[SND]](/icons/sound2.gif) | achromatization.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromatism.mp3 | 13-Apr-2007 23:14 | 10K | |
![[SND]](/icons/sound2.gif) | achromatin.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromaticity.mp3 | 13-Apr-2007 23:14 | 17K | |
![[SND]](/icons/sound2.gif) | achromatically.mp3 | 13-Apr-2007 23:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | achromatic.mp3 | 13-Apr-2007 23:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | achromate.mp3 | 13-Apr-2007 23:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | achromat.mp3 | 13-Apr-2007 23:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | achroite.mp3 | 13-Apr-2007 23:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | achordate.mp3 | 13-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | achoo.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | achondroplastic.mp3 | 13-Apr-2007 23:13 | 12K | |
![[SND]](/icons/sound2.gif) | achondroplasia.mp3 | 13-Apr-2007 23:13 | 11K | |
![[SND]](/icons/sound2.gif) | achondritic.mp3 | 13-Apr-2007 23:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | achondrite.mp3 | 13-Apr-2007 23:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | acholuric.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | acholuria.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | acholous.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | acholia.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | acholi.mp3 | 13-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | achlorophyllous.mp3 | 13-Apr-2007 23:13 | 17K | |
![[SND]](/icons/sound2.gif) | achlorhydric.mp3 | 13-Apr-2007 23:13 | 9.5K | |
![[SND]](/icons/sound2.gif) | achlorhydria.mp3 | 13-Apr-2007 23:13 | 11K | |
![[SND]](/icons/sound2.gif) | achlamydeous.mp3 | 13-Apr-2007 23:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | achlamydate.mp3 | 13-Apr-2007 23:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | achkan.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | achitophel.mp3 | 13-Apr-2007 23:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | achish.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | achiral.mp3 | 13-Apr-2007 23:13 | 7.1K | |
![[SND]](/icons/sound2.gif) | achiote.mp3 | 13-Apr-2007 23:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | achingly.mp3 | 13-Apr-2007 23:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | aching.mp3 | 13-Apr-2007 23:13 | 5.4K | |
![[SND]](/icons/sound2.gif) | achiness.mp3 | 13-Apr-2007 23:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | achinese.mp3 | 13-Apr-2007 23:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | achimenes.mp3 | 13-Apr-2007 23:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | achillean.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | achillea.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | achilary.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | achiever.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | achievement.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | achieve.mp3 | 13-Apr-2007 23:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | achievable.mp3 | 13-Apr-2007 23:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | acheval.mp3 | 13-Apr-2007 23:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | a cheval.mp3 | 13-Apr-2007 22:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | achernar.mp3 | 13-Apr-2007 23:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | achenese.mp3 | 13-Apr-2007 23:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | achene.mp3 | 13-Apr-2007 23:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | acheilary.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | achebe.mp3 | 13-Apr-2007 23:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | ache.mp3 | 13-Apr-2007 23:12 | 3.8K | |
![[SND]](/icons/sound2.gif) | achaz.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | acharnement.mp3 | 13-Apr-2007 23:12 | 17K | |
![[SND]](/icons/sound2.gif) | achan.mp3 | 13-Apr-2007 23:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | achalasia.mp3 | 13-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | achaemenes.mp3 | 13-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | achad.mp3 | 13-Apr-2007 23:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | achab.mp3 | 13-Apr-2007 23:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | ach.mp3 | 13-Apr-2007 23:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | aceydeucy.mp3 | 13-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | acey-deucy.mp3 | 13-Apr-2007 23:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | acey-deucey.mp3 | 13-Apr-2007 23:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | acetylsalicylic acid.mp3 | 13-Apr-2007 23:11 | 18K | |
![[SND]](/icons/sound2.gif) | acetylsalicylate.mp3 | 13-Apr-2007 23:11 | 14K | |
![[SND]](/icons/sound2.gif) | acetylizer.mp3 | 13-Apr-2007 23:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | acetylize.mp3 | 13-Apr-2007 23:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | acetylide.mp3 | 13-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | acetylic.mp3 | 13-Apr-2007 23:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | acetylenic.mp3 | 13-Apr-2007 23:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | acetylene.mp3 | 13-Apr-2007 23:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | acetylcholinesterase.mp3 | 13-Apr-2007 23:11 | 16K | |
![[SND]](/icons/sound2.gif) | acetylcholine.mp3 | 13-Apr-2007 23:11 | 11K | |
![[SND]](/icons/sound2.gif) | acetylative.mp3 | 13-Apr-2007 23:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | acetylation.mp3 | 13-Apr-2007 23:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | acetylate.mp3 | 13-Apr-2007 23:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | acetyl CoA.mp3 | 13-Apr-2007 23:10 | 12K | |
![[SND]](/icons/sound2.gif) | acetyl.mp3 | 13-Apr-2007 23:10 | 6.1K | |
![[SND]](/icons/sound2.gif) | acetum.mp3 | 13-Apr-2007 23:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | acetous.mp3 | 13-Apr-2007 23:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | acetophenone.mp3 | 13-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | acetophenetidin.mp3 | 13-Apr-2007 23:10 | 13K | |
![[SND]](/icons/sound2.gif) | acetonuria.mp3 | 13-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | acetonitrile.mp3 | 13-Apr-2007 23:10 | 10K | |
![[SND]](/icons/sound2.gif) | acetonic.mp3 | 13-Apr-2007 23:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | acetonemia.mp3 | 13-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | acetone.mp3 | 13-Apr-2007 23:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | acetometry.mp3 | 13-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | acetometer.mp3 | 13-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | acetoin.mp3 | 13-Apr-2007 23:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | acetohexamide.mp3 | 13-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | acetobacter.mp3 | 13-Apr-2007 23:10 | 17K | |
![[SND]](/icons/sound2.gif) | acetoacetic acid.mp3 | 13-Apr-2007 23:10 | 15K | |
![[SND]](/icons/sound2.gif) | aceto.mp3 | 13-Apr-2007 23:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | acetin.mp3 | 13-Apr-2007 23:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | acetimetry.mp3 | 13-Apr-2007 23:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | acetimeter.mp3 | 13-Apr-2007 23:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | acetify.mp3 | 13-Apr-2007 23:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | acetifier.mp3 | 13-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | acetification.mp3 | 13-Apr-2007 23:09 | 11K | |
![[SND]](/icons/sound2.gif) | acetic acid.mp3 | 13-Apr-2007 23:09 | 10K | |
![[SND]](/icons/sound2.gif) | acetic.mp3 | 13-Apr-2007 23:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | acetic+acid.mp3 | 13-Apr-2007 23:09 | 10K | |
![[SND]](/icons/sound2.gif) | acetazolamide.mp3 | 13-Apr-2007 23:09 | 11K | |
![[SND]](/icons/sound2.gif) | acetation.mp3 | 13-Apr-2007 23:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | acetated.mp3 | 13-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | acetate.mp3 | 13-Apr-2007 23:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | acetarious.mp3 | 13-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | acetanisidine.mp3 | 13-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | acetanilide.mp3 | 13-Apr-2007 23:09 | 10K | |
![[SND]](/icons/sound2.gif) | acetanilid.mp3 | 13-Apr-2007 23:09 | 10K | |
![[SND]](/icons/sound2.gif) | acetaminophen.mp3 | 13-Apr-2007 23:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | acetamide.mp3 | 13-Apr-2007 23:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | acetaldol.mp3 | 13-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | acetaldehyde.mp3 | 13-Apr-2007 23:09 | 11K | |
![[SND]](/icons/sound2.gif) | acetal.mp3 | 13-Apr-2007 23:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | acetabulum.mp3 | 13-Apr-2007 23:09 | 10K | |
![[SND]](/icons/sound2.gif) | acetabuloplasty.mp3 | 13-Apr-2007 23:09 | 27K | |
![[SND]](/icons/sound2.gif) | acetabuliform.mp3 | 13-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | acetabularia.mp3 | 13-Apr-2007 23:09 | 17K | |
![[SND]](/icons/sound2.gif) | acetabular.mp3 | 13-Apr-2007 23:09 | 10K | |
![[SND]](/icons/sound2.gif) | acetabula.mp3 | 13-Apr-2007 23:09 | 10K | |
![[SND]](/icons/sound2.gif) | acet.mp3 | 13-Apr-2007 23:08 | 17K | |
![[SND]](/icons/sound2.gif) | acesulfame-K.mp3 | 13-Apr-2007 23:08 | 14K | |
![[SND]](/icons/sound2.gif) | acesodyne.mp3 | 13-Apr-2007 23:08 | 17K | |
![[SND]](/icons/sound2.gif) | acescent.mp3 | 13-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | acescency.mp3 | 13-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | aces.mp3 | 13-Apr-2007 23:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | acervulus.mp3 | 13-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | acervately.mp3 | 13-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | acervate.mp3 | 13-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | acerous.mp3 | 13-Apr-2007 23:08 | 17K | |
![[SND]](/icons/sound2.gif) | acerose.mp3 | 13-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | acerola.mp3 | 13-Apr-2007 23:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | acerbity.mp3 | 13-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | acerbically.mp3 | 13-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | acerbic.mp3 | 13-Apr-2007 23:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | acerbate.mp3 | 13-Apr-2007 23:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | acerb.mp3 | 13-Apr-2007 23:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | acerate.mp3 | 13-Apr-2007 23:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | aceramic.mp3 | 13-Apr-2007 23:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | acer.mp3 | 13-Apr-2007 23:08 | 17K | |
![[SND]](/icons/sound2.gif) | acequia.mp3 | 13-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | acephate.mp3 | 13-Apr-2007 23:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | acephalous.mp3 | 13-Apr-2007 23:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | acephalan.mp3 | 13-Apr-2007 23:08 | 17K | |
![[SND]](/icons/sound2.gif) | aceous.mp3 | 13-Apr-2007 23:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | acentric.mp3 | 13-Apr-2007 23:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | acenesthesia.mp3 | 13-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | acellular.mp3 | 13-Apr-2007 23:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | acedia.mp3 | 13-Apr-2007 23:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | aced.mp3 | 13-Apr-2007 23:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | acebutolol.mp3 | 13-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | aceae.mp3 | 13-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | acea.mp3 | 13-Apr-2007 23:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | ace.mp3 | 13-Apr-2007 23:07 | 4.8K | |
![[SND]](/icons/sound2.gif) | acdc.mp3 | 13-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | accutron.mp3 | 13-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | accutane.mp3 | 13-Apr-2007 23:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | accustomedness.mp3 | 13-Apr-2007 23:07 | 9.3K | |
![[SND]](/icons/sound2.gif) | accustomed.mp3 | 13-Apr-2007 23:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | accustomation.mp3 | 13-Apr-2007 23:07 | 10K | |
![[SND]](/icons/sound2.gif) | accustom.mp3 | 13-Apr-2007 23:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | accusingly.mp3 | 13-Apr-2007 23:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | accusing.mp3 | 13-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | accuser.mp3 | 13-Apr-2007 23:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | accused.mp3 | 13-Apr-2007 23:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | accuse.mp3 | 13-Apr-2007 23:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | accusatory.mp3 | 13-Apr-2007 23:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | accusatorially.mp3 | 13-Apr-2007 23:07 | 17K | |
![[SND]](/icons/sound2.gif) | accusatorial.mp3 | 13-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | accusatively.mp3 | 13-Apr-2007 23:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | accusative.mp3 | 13-Apr-2007 23:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | accusatival.mp3 | 13-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | accusation.mp3 | 13-Apr-2007 23:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | accusal.mp3 | 13-Apr-2007 23:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | accusably.mp3 | 13-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | accusable.mp3 | 13-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | accurst.mp3 | 13-Apr-2007 23:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | accursedness.mp3 | 13-Apr-2007 23:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | accursedly.mp3 | 13-Apr-2007 23:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | accursed.mp3 | 13-Apr-2007 23:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | accurize.mp3 | 13-Apr-2007 23:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | accurateness.mp3 | 13-Apr-2007 23:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | accurately.mp3 | 13-Apr-2007 23:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | accurate.mp3 | 13-Apr-2007 23:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | accuracy.mp3 | 13-Apr-2007 23:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | accumulator.mp3 | 13-Apr-2007 23:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | accumulativeness.mp3 | 13-Apr-2007 23:06 | 17K | |
![[SND]](/icons/sound2.gif) | accumulative.mp3 | 13-Apr-2007 23:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | accumulation.mp3 | 13-Apr-2007 23:06 | 11K | |
![[SND]](/icons/sound2.gif) | accumulate.mp3 | 13-Apr-2007 23:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | accumulable.mp3 | 13-Apr-2007 23:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | accumbent.mp3 | 13-Apr-2007 23:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | accumbency.mp3 | 13-Apr-2007 23:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | acculturize.mp3 | 13-Apr-2007 23:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | acculturative.mp3 | 13-Apr-2007 23:05 | 10K | |
![[SND]](/icons/sound2.gif) | acculturational.mp3 | 13-Apr-2007 23:05 | 12K | |
![[SND]](/icons/sound2.gif) | acculturation.mp3 | 13-Apr-2007 23:05 | 10K | |
![[SND]](/icons/sound2.gif) | acculturate.mp3 | 13-Apr-2007 23:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | accruement.mp3 | 13-Apr-2007 23:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | accrue.mp3 | 13-Apr-2007 23:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | accrual.mp3 | 13-Apr-2007 23:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | accruable.mp3 | 13-Apr-2007 23:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | accroidesgum.mp3 | 13-Apr-2007 23:05 | 17K | |
![[SND]](/icons/sound2.gif) | accroachment.mp3 | 13-Apr-2007 23:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | accroach.mp3 | 13-Apr-2007 23:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | accretive.mp3 | 13-Apr-2007 23:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | accretionary.mp3 | 13-Apr-2007 23:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | accretion.mp3 | 13-Apr-2007 23:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | accrete.mp3 | 13-Apr-2007 23:05 | 5.7K | |
![[SND]](/icons/sound2.gif) | accrescent.mp3 | 13-Apr-2007 23:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | accrescence.mp3 | 13-Apr-2007 23:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | accreditment.mp3 | 13-Apr-2007 23:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | accredited.mp3 | 13-Apr-2007 23:05 | 8.8K | |
![[SND]](/icons/sound2.gif) | accreditation.mp3 | 13-Apr-2007 23:05 | 10K | |
![[SND]](/icons/sound2.gif) | accreditable.mp3 | 13-Apr-2007 23:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | accredit.mp3 | 13-Apr-2007 23:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | accoutrement.mp3 | 13-Apr-2007 23:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | accoutre.mp3 | 13-Apr-2007 23:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | accouterment.mp3 | 13-Apr-2007 23:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | accoutering.mp3 | 13-Apr-2007 23:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | accouter.mp3 | 13-Apr-2007 23:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | accouplement.mp3 | 13-Apr-2007 23:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | accounting.mp3 | 13-Apr-2007 23:04 | 6.8K | |
![[SND]](/icons/sound2.gif) | accountantship.mp3 | 13-Apr-2007 23:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | accountant.mp3 | 13-Apr-2007 23:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | accountancy.mp3 | 13-Apr-2007 23:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | accountably.mp3 | 13-Apr-2007 23:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | accountableness.mp3 | 13-Apr-2007 23:04 | 10K | |
![[SND]](/icons/sound2.gif) | accountable.mp3 | 13-Apr-2007 23:04 | 7.7K | |
![[SND]](/icons/sound2.gif) | accountability.mp3 | 13-Apr-2007 23:04 | 11K | |
![[SND]](/icons/sound2.gif) | account.mp3 | 13-Apr-2007 23:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | accoucheuse.mp3 | 13-Apr-2007 23:04 | 17K | |
![[SND]](/icons/sound2.gif) | accoucheur.mp3 | 13-Apr-2007 23:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | accouchement.mp3 | 13-Apr-2007 23:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | accouche.mp3 | 13-Apr-2007 23:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | accosted.mp3 | 13-Apr-2007 23:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | accostable.mp3 | 13-Apr-2007 23:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | accost.mp3 | 13-Apr-2007 23:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | accordionist.mp3 | 13-Apr-2007 23:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | accordion.mp3 | 13-Apr-2007 23:04 | 7.1K | |
![[SND]](/icons/sound2.gif) | accordingly.mp3 | 13-Apr-2007 23:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | according.mp3 | 13-Apr-2007 23:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | accorder.mp3 | 13-Apr-2007 23:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | accordatura.mp3 | 13-Apr-2007 23:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | accordantly.mp3 | 13-Apr-2007 23:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | accordant.mp3 | 13-Apr-2007 23:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | accordance.mp3 | 13-Apr-2007 23:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | accord.mp3 | 13-Apr-2007 23:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | accompt.mp3 | 13-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | accomplishment.mp3 | 13-Apr-2007 23:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | accomplisher.mp3 | 13-Apr-2007 23:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | accomplished.mp3 | 13-Apr-2007 23:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | accomplishable.mp3 | 13-Apr-2007 23:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | accomplish.mp3 | 13-Apr-2007 23:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | accomplice.mp3 | 13-Apr-2007 23:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | accompanyist.mp3 | 13-Apr-2007 23:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | accompanying.mp3 | 13-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | accompany.mp3 | 13-Apr-2007 23:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | accompanist.mp3 | 13-Apr-2007 23:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | accompanimental.mp3 | 13-Apr-2007 23:03 | 10K | |
![[SND]](/icons/sound2.gif) | accompaniment.mp3 | 13-Apr-2007 23:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | accompanier.mp3 | 13-Apr-2007 23:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | accommodator.mp3 | 13-Apr-2007 23:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | accommodativeness.mp3 | 13-Apr-2007 23:03 | 17K | |
![[SND]](/icons/sound2.gif) | accommodative.mp3 | 13-Apr-2007 23:03 | 9.8K | |
![[SND]](/icons/sound2.gif) | accommodationist.mp3 | 13-Apr-2007 23:03 | 11K | |
![[SND]](/icons/sound2.gif) | accommodationism.mp3 | 13-Apr-2007 23:03 | 13K | |
![[SND]](/icons/sound2.gif) | accommodational.mp3 | 13-Apr-2007 23:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | accommodation.mp3 | 13-Apr-2007 23:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | accommodatingly.mp3 | 13-Apr-2007 23:02 | 10K | |
![[SND]](/icons/sound2.gif) | accommodating.mp3 | 13-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | accommodate.mp3 | 13-Apr-2007 23:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | accommodable.mp3 | 13-Apr-2007 23:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | accolated.mp3 | 13-Apr-2007 23:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | accoladed.mp3 | 13-Apr-2007 23:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | accolade.mp3 | 13-Apr-2007 23:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | acclivous.mp3 | 13-Apr-2007 23:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | acclivity.mp3 | 13-Apr-2007 23:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | acclimatizer.mp3 | 13-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | acclimatize.mp3 | 13-Apr-2007 23:02 | 10K | |
![[SND]](/icons/sound2.gif) | acclimatization.mp3 | 13-Apr-2007 23:02 | 12K | |
![[SND]](/icons/sound2.gif) | acclimation.mp3 | 13-Apr-2007 23:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | acclimate.mp3 | 13-Apr-2007 23:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | acclimatable.mp3 | 13-Apr-2007 23:02 | 27K | |
![[SND]](/icons/sound2.gif) | acclamatory.mp3 | 13-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | acclamation.mp3 | 13-Apr-2007 23:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | acclaimer.mp3 | 13-Apr-2007 23:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | acclaim.mp3 | 13-Apr-2007 23:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | accius.mp3 | 13-Apr-2007 23:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | accipitrine.mp3 | 13-Apr-2007 23:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | accipitral.mp3 | 13-Apr-2007 23:02 | 17K | |
![[SND]](/icons/sound2.gif) | accipiter.mp3 | 13-Apr-2007 23:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | accidie.mp3 | 13-Apr-2007 23:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | accidently.mp3 | 13-Apr-2007 23:01 | 9.8K | |
![[SND]](/icons/sound2.gif) | accidented.mp3 | 13-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | accidentalness.mp3 | 13-Apr-2007 23:01 | 10K | |
![[SND]](/icons/sound2.gif) | accidentally.mp3 | 13-Apr-2007 23:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | accidentality.mp3 | 13-Apr-2007 23:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | accidentalist.mp3 | 13-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | accidentalism.mp3 | 13-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | accidental.mp3 | 13-Apr-2007 23:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | accident.mp3 | 13-Apr-2007 23:01 | 6.4K | |
![[SND]](/icons/sound2.gif) | accidence.mp3 | 13-Apr-2007 23:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | acciaccatura.mp3 | 13-Apr-2007 23:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | accessory.mp3 | 13-Apr-2007 23:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | accessorize.mp3 | 13-Apr-2007 23:01 | 10K | |
![[SND]](/icons/sound2.gif) | accessorius.mp3 | 13-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | accessoriness.mp3 | 13-Apr-2007 23:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | accessorial.mp3 | 13-Apr-2007 23:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | accessit.mp3 | 13-Apr-2007 23:01 | 17K | |
![[SND]](/icons/sound2.gif) | accessional.mp3 | 13-Apr-2007 23:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | accession.mp3 | 13-Apr-2007 23:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | accessibly.mp3 | 13-Apr-2007 23:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | accessibleness.mp3 | 13-Apr-2007 23:01 | 11K | |
![[SND]](/icons/sound2.gif) | accessible.mp3 | 13-Apr-2007 23:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | accessibility.mp3 | 13-Apr-2007 23:01 | 10K | |
![[SND]](/icons/sound2.gif) | accessary.mp3 | 13-Apr-2007 23:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | accessariness.mp3 | 13-Apr-2007 23:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | access.mp3 | 13-Apr-2007 23:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | acceptor.mp3 | 13-Apr-2007 23:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | acceptive.mp3 | 13-Apr-2007 23:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | acceptingness.mp3 | 13-Apr-2007 23:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | acceptingly.mp3 | 13-Apr-2007 23:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | accepting.mp3 | 13-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | accepter.mp3 | 13-Apr-2007 23:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | acceptee.mp3 | 13-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | acceptedly.mp3 | 13-Apr-2007 23:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | accepted.mp3 | 13-Apr-2007 23:00 | 8.8K | |
![[SND]](/icons/sound2.gif) | acceptation.mp3 | 13-Apr-2007 23:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | acceptant.mp3 | 13-Apr-2007 23:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | acceptancy.mp3 | 13-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | acceptance.mp3 | 13-Apr-2007 23:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | acceptably.mp3 | 13-Apr-2007 23:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | acceptableness.mp3 | 13-Apr-2007 23:00 | 10K | |
![[SND]](/icons/sound2.gif) | acceptable.mp3 | 13-Apr-2007 23:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | acceptability.mp3 | 13-Apr-2007 23:00 | 10K | |
![[SND]](/icons/sound2.gif) | accept.mp3 | 13-Apr-2007 23:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | accentuator.mp3 | 13-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | accentuation.mp3 | 13-Apr-2007 23:00 | 11K | |
![[SND]](/icons/sound2.gif) | accentuate.mp3 | 13-Apr-2007 23:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | accentually.mp3 | 13-Apr-2007 23:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | accentualist.mp3 | 13-Apr-2007 23:00 | 17K | |
![[SND]](/icons/sound2.gif) | accentual.mp3 | 13-Apr-2007 22:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | accentuable.mp3 | 13-Apr-2007 22:59 | 27K | |
![[SND]](/icons/sound2.gif) | accentor.mp3 | 13-Apr-2007 22:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | accentology.mp3 | 13-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | accentless.mp3 | 13-Apr-2007 22:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | accent.mp3 | 13-Apr-2007 22:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | accelerometer.mp3 | 13-Apr-2007 22:59 | 9.5K | |
![[SND]](/icons/sound2.gif) | accelerograph.mp3 | 13-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | accelerogram.mp3 | 13-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | accelerator.mp3 | 13-Apr-2007 22:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | accelerative.mp3 | 13-Apr-2007 22:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | accelerationist.mp3 | 13-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | acceleration.mp3 | 13-Apr-2007 22:59 | 10K | |
![[SND]](/icons/sound2.gif) | acceleratingly.mp3 | 13-Apr-2007 22:59 | 11K | |
![[SND]](/icons/sound2.gif) | acceleratedly.mp3 | 13-Apr-2007 22:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | accelerate.mp3 | 13-Apr-2007 22:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | accelerant.mp3 | 13-Apr-2007 22:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | accelerando.mp3 | 13-Apr-2007 22:59 | 11K | |
![[SND]](/icons/sound2.gif) | acceder.mp3 | 13-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | accede.mp3 | 13-Apr-2007 22:59 | 6.8K | |
![[SND]](/icons/sound2.gif) | accalarentia.mp3 | 13-Apr-2007 22:59 | 17K | |
![[SND]](/icons/sound2.gif) | acausality.mp3 | 13-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | acausal.mp3 | 13-Apr-2007 22:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | acaulescent.mp3 | 13-Apr-2007 22:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | acaulescence.mp3 | 13-Apr-2007 22:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | acaudal.mp3 | 13-Apr-2007 22:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | acataleptic.mp3 | 13-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | acatalepsy.mp3 | 13-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | acatalectic.mp3 | 13-Apr-2007 22:58 | 10K | |
![[SND]](/icons/sound2.gif) | acas.mp3 | 13-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | acarus.mp3 | 13-Apr-2007 22:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | acarpous.mp3 | 13-Apr-2007 22:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | acarpelous.mp3 | 13-Apr-2007 22:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | acarophobia.mp3 | 13-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | acarology.mp3 | 13-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | acarologist.mp3 | 13-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | acaroid.mp3 | 13-Apr-2007 22:58 | 8.0K | |
![[SND]](/icons/sound2.gif) | acarine.mp3 | 13-Apr-2007 22:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | acarid.mp3 | 13-Apr-2007 22:58 | 5.7K | |
![[SND]](/icons/sound2.gif) | acaricide.mp3 | 13-Apr-2007 22:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | acaricidal.mp3 | 13-Apr-2007 22:58 | 10K | |
![[SND]](/icons/sound2.gif) | acariasis.mp3 | 13-Apr-2007 22:58 | 11K | |
![[SND]](/icons/sound2.gif) | acarian.mp3 | 13-Apr-2007 22:58 | 17K | |
![[SND]](/icons/sound2.gif) | acari.mp3 | 13-Apr-2007 22:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | acardiac.mp3 | 13-Apr-2007 22:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | acardia.mp3 | 13-Apr-2007 22:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | acapsular.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acapriccio.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acappella.mp3 | 13-Apr-2007 22:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | a cappella.mp3 | 13-Apr-2007 22:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | acapnial.mp3 | 13-Apr-2007 22:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | acapnia.mp3 | 13-Apr-2007 22:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | a capella.mp3 | 13-Apr-2007 22:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | acanthus.mp3 | 13-Apr-2007 22:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | acanthous.mp3 | 13-Apr-2007 22:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | acanthopterygian.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthoma.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthoid.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthodian.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthocytosis.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthocyte.mp3 | 13-Apr-2007 22:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | acanthocephalan.mp3 | 13-Apr-2007 22:57 | 12K | |
![[SND]](/icons/sound2.gif) | acantho.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthite.mp3 | 13-Apr-2007 22:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | acanthine.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthi.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthaster.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acanthaceous.mp3 | 13-Apr-2007 22:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | acaleph.mp3 | 13-Apr-2007 22:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | acalculia.mp3 | 13-Apr-2007 22:57 | 17K | |
![[SND]](/icons/sound2.gif) | acal.mp3 | 13-Apr-2007 22:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | acajou.mp3 | 13-Apr-2007 22:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | academy.mp3 | 13-Apr-2007 22:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | academus.mp3 | 13-Apr-2007 22:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | academize.mp3 | 13-Apr-2007 22:56 | 17K | |
![[SND]](/icons/sound2.gif) | academism.mp3 | 13-Apr-2007 22:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | academiefrancaise.mp3 | 13-Apr-2007 22:56 | 17K | |
![[SND]](/icons/sound2.gif) | academicize.mp3 | 13-Apr-2007 22:56 | 17K | |
![[SND]](/icons/sound2.gif) | academicism.mp3 | 13-Apr-2007 22:56 | 10K | |
![[SND]](/icons/sound2.gif) | academician.mp3 | 13-Apr-2007 22:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | academically.mp3 | 13-Apr-2007 22:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | academical.mp3 | 13-Apr-2007 22:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | academic.mp3 | 13-Apr-2007 22:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | academia.mp3 | 13-Apr-2007 22:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | academese.mp3 | 13-Apr-2007 22:56 | 17K | |
![[SND]](/icons/sound2.gif) | academe.mp3 | 13-Apr-2007 22:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | acacia.mp3 | 13-Apr-2007 22:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | ac.mp3 | 13-Apr-2007 22:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | abzyme.mp3 | 13-Apr-2007 22:56 | 17K | |
![[SND]](/icons/sound2.gif) | abyssal.mp3 | 13-Apr-2007 22:55 | 5.7K | |
![[SND]](/icons/sound2.gif) | abyss.mp3 | 13-Apr-2007 22:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | abysmally.mp3 | 13-Apr-2007 22:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | abysmal.mp3 | 13-Apr-2007 22:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | abysm.mp3 | 13-Apr-2007 22:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | abye.mp3 | 13-Apr-2007 22:55 | 5.7K | |
![[SND]](/icons/sound2.gif) | aby.mp3 | 13-Apr-2007 22:55 | 5.7K | |
![[SND]](/icons/sound2.gif) | abwehr.mp3 | 13-Apr-2007 22:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | abwatt.mp3 | 13-Apr-2007 22:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | abvolt.mp3 | 13-Apr-2007 22:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | abuzz.mp3 | 13-Apr-2007 22:55 | 6.3K | |
![[SND]](/icons/sound2.gif) | abutting.mp3 | 13-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | abutter.mp3 | 13-Apr-2007 22:55 | 5.4K | |
![[SND]](/icons/sound2.gif) | abuttals.mp3 | 13-Apr-2007 22:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | abuttal.mp3 | 13-Apr-2007 22:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | abutment.mp3 | 13-Apr-2007 22:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | abutilon.mp3 | 13-Apr-2007 22:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | abut.mp3 | 13-Apr-2007 22:55 | 5.4K | |
![[SND]](/icons/sound2.gif) | abususnontollitusum.mp3 | 13-Apr-2007 22:55 | 27K | |
![[SND]](/icons/sound2.gif) | abusus non tollit usum.mp3 | 13-Apr-2007 22:55 | 21K | |
![[SND]](/icons/sound2.gif) | abusiveness.mp3 | 13-Apr-2007 22:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | abusive.mp3 | 13-Apr-2007 22:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | abusimbel.mp3 | 13-Apr-2007 22:55 | 17K | |
![[SND]](/icons/sound2.gif) | abuser.mp3 | 13-Apr-2007 22:55 | 27K | |
![[SND]](/icons/sound2.gif) | abuse.mp3 | 13-Apr-2007 22:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | abusage.mp3 | 13-Apr-2007 22:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | abusable.mp3 | 13-Apr-2007 22:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | abury.mp3 | 13-Apr-2007 22:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | aburbecondita.mp3 | 13-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | ab urbe condita.mp3 | 13-Apr-2007 22:33 | 16K | |
![[SND]](/icons/sound2.gif) | abunodisceomnes.mp3 | 13-Apr-2007 22:54 | 27K | |
![[SND]](/icons/sound2.gif) | ab uno disce omnes.mp3 | 13-Apr-2007 22:33 | 19K | |
![[SND]](/icons/sound2.gif) | abundantly.mp3 | 13-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | abundant.mp3 | 13-Apr-2007 22:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | abundance.mp3 | 13-Apr-2007 22:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | abuna.mp3 | 13-Apr-2007 22:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | abulic.mp3 | 13-Apr-2007 22:54 | 6.1K | |
![[SND]](/icons/sound2.gif) | abulia.mp3 | 13-Apr-2007 22:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | abukir.mp3 | 13-Apr-2007 22:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | abuilding.mp3 | 13-Apr-2007 22:54 | 6.6K | |
![[SND]](/icons/sound2.gif) | abuhanifah.mp3 | 13-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | abudhabi.mp3 | 13-Apr-2007 22:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | abubble.mp3 | 13-Apr-2007 22:54 | 5.4K | |
![[SND]](/icons/sound2.gif) | abubakr.mp3 | 13-Apr-2007 22:54 | 17K | |
![[SND]](/icons/sound2.gif) | abtsystem.mp3 | 13-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | abta.mp3 | 13-Apr-2007 22:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | absyrtus.mp3 | 13-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | absurdness.mp3 | 13-Apr-2007 22:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | absurdity.mp3 | 13-Apr-2007 22:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | absurdist.mp3 | 13-Apr-2007 22:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | absurdism.mp3 | 13-Apr-2007 22:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | absurd.mp3 | 13-Apr-2007 22:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | abstrusity.mp3 | 13-Apr-2007 22:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | abstruseness.mp3 | 13-Apr-2007 22:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | abstruse.mp3 | 13-Apr-2007 22:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | abstriction.mp3 | 13-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | abstrict.mp3 | 13-Apr-2007 22:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | abstractness.mp3 | 13-Apr-2007 22:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | abstractly.mp3 | 13-Apr-2007 22:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | abstractiveness.mp3 | 13-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | abstractive.mp3 | 13-Apr-2007 22:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | abstractionist.mp3 | 13-Apr-2007 22:53 | 10K | |
![[SND]](/icons/sound2.gif) | abstractionism.mp3 | 13-Apr-2007 22:53 | 11K | |
![[SND]](/icons/sound2.gif) | abstractional.mp3 | 13-Apr-2007 22:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | abstraction.mp3 | 13-Apr-2007 22:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | abstracter.mp3 | 13-Apr-2007 22:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | abstractedness.mp3 | 13-Apr-2007 22:53 | 17K | |
![[SND]](/icons/sound2.gif) | abstracted.mp3 | 13-Apr-2007 22:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | abstractable.mp3 | 13-Apr-2007 22:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | abstract.mp3 | 13-Apr-2007 22:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | abstinently.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | abstinent.mp3 | 13-Apr-2007 22:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | abstinence.mp3 | 13-Apr-2007 22:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | abstersiveness.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | abstersive.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | abstergent.mp3 | 13-Apr-2007 22:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | absterge.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | abstentious.mp3 | 13-Apr-2007 22:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | abstentionist.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | abstentionism.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | abstention.mp3 | 13-Apr-2007 22:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | abstemiousness.mp3 | 13-Apr-2007 22:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | abstemious.mp3 | 13-Apr-2007 22:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | abstainer.mp3 | 13-Apr-2007 22:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | abstain.mp3 | 13-Apr-2007 22:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | absquatulation.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | absquatulate.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | absotively.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | absorptivity.mp3 | 13-Apr-2007 22:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | absorptiveness.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | absorptive.mp3 | 13-Apr-2007 22:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | absorption.mp3 | 13-Apr-2007 22:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | absorptiometry.mp3 | 13-Apr-2007 22:52 | 11K | |
![[SND]](/icons/sound2.gif) | absorptiometric.mp3 | 13-Apr-2007 22:52 | 17K | |
![[SND]](/icons/sound2.gif) | absorptiometer.mp3 | 13-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | absorptance.mp3 | 13-Apr-2007 22:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | absorbingly.mp3 | 13-Apr-2007 22:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | absorbing.mp3 | 13-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | absorber.mp3 | 13-Apr-2007 22:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | absorbent.mp3 | 13-Apr-2007 22:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | absorbency.mp3 | 13-Apr-2007 22:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | absorbefacient.mp3 | 13-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | absorbedness.mp3 | 13-Apr-2007 22:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | absorbed.mp3 | 13-Apr-2007 22:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | absorbant.mp3 | 13-Apr-2007 22:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | absorbance.mp3 | 13-Apr-2007 22:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | absorbable.mp3 | 13-Apr-2007 22:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | absorbability.mp3 | 13-Apr-2007 22:51 | 11K | |
![[SND]](/icons/sound2.gif) | absorb.mp3 | 13-Apr-2007 22:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | absonant.mp3 | 13-Apr-2007 22:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | absolver.mp3 | 13-Apr-2007 22:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | absolve.mp3 | 13-Apr-2007 22:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | absolutory.mp3 | 13-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | absolutize.mp3 | 13-Apr-2007 22:51 | 11K | |
![[SND]](/icons/sound2.gif) | absolutization.mp3 | 13-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | absolutive.mp3 | 13-Apr-2007 22:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | absolutistically.mp3 | 13-Apr-2007 22:51 | 17K | |
![[SND]](/icons/sound2.gif) | absolutistic.mp3 | 13-Apr-2007 22:51 | 11K | |
![[SND]](/icons/sound2.gif) | absolutist.mp3 | 13-Apr-2007 22:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | absolutism.mp3 | 13-Apr-2007 22:50 | 10K | |
![[SND]](/icons/sound2.gif) | absolution.mp3 | 13-Apr-2007 22:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | absoluteness.mp3 | 13-Apr-2007 22:50 | 27K | |
![[SND]](/icons/sound2.gif) | absolutely.mp3 | 13-Apr-2007 22:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | absolute.mp3 | 13-Apr-2007 22:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | absofuckinglutely.mp3 | 13-Apr-2007 22:50 | 17K | |
![[SND]](/icons/sound2.gif) | absobloodylutely.mp3 | 13-Apr-2007 22:50 | 17K | |
![[SND]](/icons/sound2.gif) | absit invidia.mp3 | 13-Apr-2007 22:50 | 14K | |
![[SND]](/icons/sound2.gif) | absinthism.mp3 | 13-Apr-2007 22:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | absinthin.mp3 | 13-Apr-2007 22:50 | 17K | |
![[SND]](/icons/sound2.gif) | absinthe.mp3 | 13-Apr-2007 22:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | absinth.mp3 | 13-Apr-2007 22:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | absentness.mp3 | 13-Apr-2007 22:50 | 27K | |
![[SND]](/icons/sound2.gif) | absentminded.mp3 | 13-Apr-2007 22:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | absently.mp3 | 13-Apr-2007 22:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | absentereo.mp3 | 13-Apr-2007 22:50 | 17K | |
![[SND]](/icons/sound2.gif) | absenteeism.mp3 | 13-Apr-2007 22:50 | 11K | |
![[SND]](/icons/sound2.gif) | absentee.mp3 | 13-Apr-2007 22:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | absent.mp3 | 13-Apr-2007 22:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | absence.mp3 | 13-Apr-2007 22:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | abseil.mp3 | 13-Apr-2007 22:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | absconder.mp3 | 13-Apr-2007 22:50 | 8.6K | |
![[SND]](/icons/sound2.gif) | abscondence.mp3 | 13-Apr-2007 22:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | abscondee.mp3 | 13-Apr-2007 22:50 | 17K | |
![[SND]](/icons/sound2.gif) | abscond.mp3 | 13-Apr-2007 22:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | abscission.mp3 | 13-Apr-2007 22:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | abscissae.mp3 | 13-Apr-2007 22:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | abscissa.mp3 | 13-Apr-2007 22:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | abscisin.mp3 | 13-Apr-2007 22:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | abscisicacid.mp3 | 13-Apr-2007 22:49 | 17K | |
![[SND]](/icons/sound2.gif) | abscisic acid.mp3 | 13-Apr-2007 22:49 | 12K | |
![[SND]](/icons/sound2.gif) | abscise.mp3 | 13-Apr-2007 22:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | abscind.mp3 | 13-Apr-2007 22:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | abscesses.mp3 | 13-Apr-2007 22:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | abscessed.mp3 | 13-Apr-2007 22:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | abscess.mp3 | 13-Apr-2007 22:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | abscam.mp3 | 13-Apr-2007 22:49 | 17K | |
![[SND]](/icons/sound2.gif) | absarokarange.mp3 | 13-Apr-2007 22:49 | 17K | |
![[SND]](/icons/sound2.gif) | absalom.mp3 | 13-Apr-2007 22:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | abruzzo.mp3 | 13-Apr-2007 22:49 | 17K | |
![[SND]](/icons/sound2.gif) | abruptness.mp3 | 13-Apr-2007 22:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | abruptly.mp3 | 13-Apr-2007 22:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | abruption.mp3 | 13-Apr-2007 22:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | abrupt.mp3 | 13-Apr-2007 22:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | abrogator.mp3 | 13-Apr-2007 22:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | abrogation.mp3 | 13-Apr-2007 22:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | abrogate.mp3 | 13-Apr-2007 22:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | abrocome.mp3 | 13-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | abroad.mp3 | 13-Apr-2007 22:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | abroach.mp3 | 13-Apr-2007 22:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | abristle.mp3 | 13-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | abrim.mp3 | 13-Apr-2007 22:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | abridgment.mp3 | 13-Apr-2007 22:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | abridger.mp3 | 13-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | abridgement.mp3 | 13-Apr-2007 22:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | abridge.mp3 | 13-Apr-2007 22:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | abricotine.mp3 | 13-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | abri.mp3 | 13-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | abreast.mp3 | 13-Apr-2007 22:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | abreactive.mp3 | 13-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | abreaction.mp3 | 13-Apr-2007 22:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | abreact.mp3 | 13-Apr-2007 22:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | abrazo.mp3 | 13-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | abraxas.mp3 | 13-Apr-2007 22:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | a bras ouverts.mp3 | 13-Apr-2007 22:30 | 11K | |
![[SND]](/icons/sound2.gif) | abrasiveness.mp3 | 13-Apr-2007 22:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | abrasive.mp3 | 13-Apr-2007 22:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | abrasion.mp3 | 13-Apr-2007 22:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | abraser.mp3 | 13-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | abranchiate.mp3 | 13-Apr-2007 22:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | abram.mp3 | 13-Apr-2007 22:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | abrahamman.mp3 | 13-Apr-2007 22:48 | 17K | |
![[SND]](/icons/sound2.gif) | abrader.mp3 | 13-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | abrade.mp3 | 13-Apr-2007 22:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | abradant.mp3 | 13-Apr-2007 22:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | abradable.mp3 | 13-Apr-2007 22:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | abrachia.mp3 | 13-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | abracadabra.mp3 | 13-Apr-2007 22:47 | 10K | |
![[SND]](/icons/sound2.gif) | ab ovo usque ad mala.mp3 | 13-Apr-2007 22:33 | 20K | |
![[SND]](/icons/sound2.gif) | abovo.mp3 | 13-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | ab ovo.mp3 | 13-Apr-2007 22:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | aboveground.mp3 | 13-Apr-2007 22:47 | 10K | |
![[SND]](/icons/sound2.gif) | aboveboard.mp3 | 13-Apr-2007 22:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | above.mp3 | 13-Apr-2007 22:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | aboutface.mp3 | 13-Apr-2007 22:47 | 27K | |
![[SND]](/icons/sound2.gif) | about.mp3 | 13-Apr-2007 22:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | about-turn.mp3 | 13-Apr-2007 22:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | about-face.mp3 | 13-Apr-2007 22:47 | 10K | |
![[SND]](/icons/sound2.gif) | aboundingly.mp3 | 13-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | abound.mp3 | 13-Apr-2007 22:47 | 6.6K | |
![[SND]](/icons/sound2.gif) | aboulic.mp3 | 13-Apr-2007 22:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | aboulia.mp3 | 13-Apr-2007 22:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | aboukir.mp3 | 13-Apr-2007 22:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | abought.mp3 | 13-Apr-2007 22:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | aboudikro.mp3 | 13-Apr-2007 22:47 | 17K | |
![[SND]](/icons/sound2.gif) | a bouche ouverte.mp3 | 13-Apr-2007 22:30 | 11K | |
![[SND]](/icons/sound2.gif) | abortus.mp3 | 13-Apr-2007 22:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | abortiveness.mp3 | 13-Apr-2007 22:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | abortive.mp3 | 13-Apr-2007 22:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | abortionist.mp3 | 13-Apr-2007 22:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | abortional.mp3 | 13-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | abortion.mp3 | 13-Apr-2007 22:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | abortifacient.mp3 | 13-Apr-2007 22:46 | 10K | |
![[SND]](/icons/sound2.gif) | aborticide.mp3 | 13-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | abort.mp3 | 13-Apr-2007 22:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | aborning.mp3 | 13-Apr-2007 22:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | aborigine.mp3 | 13-Apr-2007 22:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | aboriginally.mp3 | 13-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | aboriginal.mp3 | 13-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | aborally.mp3 | 13-Apr-2007 22:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | aboral.mp3 | 13-Apr-2007 22:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | aboon.mp3 | 13-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | abonnement.mp3 | 13-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | abonne.mp3 | 13-Apr-2007 22:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | abonmarche.mp3 | 13-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | abondance.mp3 | 13-Apr-2007 22:46 | 17K | |
![[SND]](/icons/sound2.gif) | a bon chat, bon rat.mp3 | 13-Apr-2007 22:30 | 15K | |
![[SND]](/icons/sound2.gif) | abominator.mp3 | 13-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | abomination.mp3 | 13-Apr-2007 22:46 | 9.3K | |
![[SND]](/icons/sound2.gif) | abominate.mp3 | 13-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | abominably.mp3 | 13-Apr-2007 22:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | abominable snowman.mp3 | 13-Apr-2007 22:46 | 16K | |
![[SND]](/icons/sound2.gif) | abominable.mp3 | 13-Apr-2007 22:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | abomasus.mp3 | 13-Apr-2007 22:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | abomasum.mp3 | 13-Apr-2007 22:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | abomasal.mp3 | 13-Apr-2007 22:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | abomasa.mp3 | 13-Apr-2007 22:45 | 10K | |
![[SND]](/icons/sound2.gif) | abolla.mp3 | 13-Apr-2007 22:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | abolitionize.mp3 | 13-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | abolitionist.mp3 | 13-Apr-2007 22:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | abolitionism.mp3 | 13-Apr-2007 22:45 | 10K | |
![[SND]](/icons/sound2.gif) | abolitionary.mp3 | 13-Apr-2007 22:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | abolition.mp3 | 13-Apr-2007 22:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | abolishment.mp3 | 13-Apr-2007 22:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | abolishable.mp3 | 13-Apr-2007 22:45 | 9.8K | |
![[SND]](/icons/sound2.gif) | abolish.mp3 | 13-Apr-2007 22:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | aboil.mp3 | 13-Apr-2007 22:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | aboideau.mp3 | 13-Apr-2007 22:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | abohm.mp3 | 13-Apr-2007 22:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | abode.mp3 | 13-Apr-2007 22:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | aboardage.mp3 | 13-Apr-2007 22:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | aboard.mp3 | 13-Apr-2007 22:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | abo.mp3 | 13-Apr-2007 22:45 | 5.7K | |
![[SND]](/icons/sound2.gif) | abnormity.mp3 | 13-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | abnormalness.mp3 | 13-Apr-2007 22:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | abnormally.mp3 | 13-Apr-2007 22:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | abnormalize.mp3 | 13-Apr-2007 22:45 | 17K | |
![[SND]](/icons/sound2.gif) | abnormalization.mp3 | 13-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | abnormality.mp3 | 13-Apr-2007 22:44 | 11K | |
![[SND]](/icons/sound2.gif) | abnormal.mp3 | 13-Apr-2007 22:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | abneylevel.mp3 | 13-Apr-2007 22:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | abner.mp3 | 13-Apr-2007 22:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | abnegator.mp3 | 13-Apr-2007 22:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | abnegation.mp3 | 13-Apr-2007 22:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | abnegate.mp3 | 13-Apr-2007 22:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | abmho.mp3 | 13-Apr-2007 22:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | ably.mp3 | 13-Apr-2007 22:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | ablutionary.mp3 | 13-Apr-2007 22:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | ablution.mp3 | 13-Apr-2007 22:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | abluted.mp3 | 13-Apr-2007 22:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | ablute.mp3 | 13-Apr-2007 22:44 | 17K | |
![[SND]](/icons/sound2.gif) | ablush.mp3 | 13-Apr-2007 22:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | abluent.mp3 | 13-Apr-2007 22:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | abloom.mp3 | 13-Apr-2007 22:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | ablins.mp3 | 13-Apr-2007 22:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | ablest.mp3 | 13-Apr-2007 22:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | abler.mp3 | 13-Apr-2007 22:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | ableist.mp3 | 13-Apr-2007 22:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | ableism.mp3 | 13-Apr-2007 22:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | ablegate.mp3 | 13-Apr-2007 22:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | abled.mp3 | 13-Apr-2007 22:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | able.mp3 | 13-Apr-2007 22:43 | 4.5K | |
![[SND]](/icons/sound2.gif) | able-bodied.mp3 | 13-Apr-2007 22:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | ablaze.mp3 | 13-Apr-2007 22:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | ablaut.mp3 | 13-Apr-2007 22:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | ablator.mp3 | 13-Apr-2007 22:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | ablatively.mp3 | 13-Apr-2007 22:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | ablativeabsolute.mp3 | 13-Apr-2007 22:43 | 18K | |
![[SND]](/icons/sound2.gif) | ablative absolute.mp3 | 13-Apr-2007 22:43 | 14K | |
![[SND]](/icons/sound2.gif) | ablative.mp3 | 13-Apr-2007 22:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | ablatival.mp3 | 13-Apr-2007 22:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | ablation.mp3 | 13-Apr-2007 22:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | ablate.mp3 | 13-Apr-2007 22:43 | 5.9K | |
![[SND]](/icons/sound2.gif) | ablastin.mp3 | 13-Apr-2007 22:43 | 17K | |
![[SND]](/icons/sound2.gif) | ablare.mp3 | 13-Apr-2007 22:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | ablanc.mp3 | 13-Apr-2007 22:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | ablactation.mp3 | 13-Apr-2007 22:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | ablactate.mp3 | 13-Apr-2007 22:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | abjurer.mp3 | 13-Apr-2007 22:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | abjure.mp3 | 13-Apr-2007 22:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | abjuration.mp3 | 13-Apr-2007 22:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | abjunction.mp3 | 13-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | abjectness.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | abjectly.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | abjective.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | abjection.mp3 | 13-Apr-2007 22:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | abjectedness.mp3 | 13-Apr-2007 22:42 | 27K | |
![[SND]](/icons/sound2.gif) | abject.mp3 | 13-Apr-2007 22:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | abitur.mp3 | 13-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | abishag.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | abirritative.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | abirritate.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | abirritant.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | abiotrophy.mp3 | 13-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | abiotrophic.mp3 | 13-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | abiotically.mp3 | 13-Apr-2007 22:42 | 11K | |
![[SND]](/icons/sound2.gif) | abiotic.mp3 | 13-Apr-2007 22:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | abiosis.mp3 | 13-Apr-2007 22:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | abiological.mp3 | 13-Apr-2007 22:42 | 12K | |
![[SND]](/icons/sound2.gif) | abiogenist.mp3 | 13-Apr-2007 22:42 | 13K | |
![[SND]](/icons/sound2.gif) | abiogenically.mp3 | 13-Apr-2007 22:42 | 12K | |
![[SND]](/icons/sound2.gif) | abiogenic.mp3 | 13-Apr-2007 22:42 | 10K | |
![[SND]](/icons/sound2.gif) | abiogenesis.mp3 | 13-Apr-2007 22:42 | 13K | |
![[SND]](/icons/sound2.gif) | abintra.mp3 | 13-Apr-2007 22:42 | 17K | |
![[SND]](/icons/sound2.gif) | abinoam.mp3 | 13-Apr-2007 22:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | abinitio.mp3 | 13-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | ab initio.mp3 | 13-Apr-2007 22:33 | 9.5K | |
![[SND]](/icons/sound2.gif) | abingdon.mp3 | 13-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | ab incunabulis.mp3 | 13-Apr-2007 22:33 | 15K | |
![[SND]](/icons/sound2.gif) | abimelech.mp3 | 13-Apr-2007 22:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | ability.mp3 | 13-Apr-2007 22:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | abihu.mp3 | 13-Apr-2007 22:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | abigail.mp3 | 13-Apr-2007 22:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | abieticacid.mp3 | 13-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | abietate.mp3 | 13-Apr-2007 22:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | abientot.mp3 | 13-Apr-2007 22:41 | 17K | |
![[SND]](/icons/sound2.gif) | a bientot.mp3 | 13-Apr-2007 22:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | abient.mp3 | 13-Apr-2007 22:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | abie.mp3 | 13-Apr-2007 22:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | abidingness.mp3 | 13-Apr-2007 22:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | abiding.mp3 | 13-Apr-2007 22:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | abider.mp3 | 13-Apr-2007 22:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | abide.mp3 | 13-Apr-2007 22:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | abidance.mp3 | 13-Apr-2007 22:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | abiathar.mp3 | 13-Apr-2007 22:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | abhorrer.mp3 | 13-Apr-2007 22:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | abhorrently.mp3 | 13-Apr-2007 22:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | abhorrent.mp3 | 13-Apr-2007 22:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | abhorrence.mp3 | 13-Apr-2007 22:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | abhor.mp3 | 13-Apr-2007 22:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | abhominable.mp3 | 13-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | abhidhammapitaka.mp3 | 13-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | abhenry.mp3 | 13-Apr-2007 22:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | abgrenzung.mp3 | 13-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | abfarad.mp3 | 13-Apr-2007 22:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | abeyant.mp3 | 13-Apr-2007 22:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | abeyance.mp3 | 13-Apr-2007 22:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | abextra.mp3 | 13-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | abeunt studia in mores.mp3 | 13-Apr-2007 22:40 | 20K | |
![[SND]](/icons/sound2.gif) | abettor.mp3 | 13-Apr-2007 22:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | abetter.mp3 | 13-Apr-2007 22:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | abettal.mp3 | 13-Apr-2007 22:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | abetment.mp3 | 13-Apr-2007 22:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | abetalipoproteinemia.mp3 | 13-Apr-2007 22:40 | 18K | |
![[SND]](/icons/sound2.gif) | abet.mp3 | 13-Apr-2007 22:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | abessive.mp3 | 13-Apr-2007 22:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | abesse.mp3 | 13-Apr-2007 22:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | aberrational.mp3 | 13-Apr-2007 22:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | aberration.mp3 | 13-Apr-2007 22:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | aberrated.mp3 | 13-Apr-2007 22:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | aberrate.mp3 | 13-Apr-2007 22:40 | 17K | |
![[SND]](/icons/sound2.gif) | aberrantly.mp3 | 13-Apr-2007 22:40 | 27K | |
![[SND]](/icons/sound2.gif) | aberrant.mp3 | 13-Apr-2007 22:39 | 6.8K | |
![[SND]](/icons/sound2.gif) | aberrancy.mp3 | 13-Apr-2007 22:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | aberrance.mp3 | 13-Apr-2007 22:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | abernethy.mp3 | 13-Apr-2007 22:39 | 17K | |
![[SND]](/icons/sound2.gif) | aberdevine.mp3 | 13-Apr-2007 22:39 | 17K | |
![[SND]](/icons/sound2.gif) | abercrombie.mp3 | 13-Apr-2007 22:39 | 17K | |
![[SND]](/icons/sound2.gif) | abeokuta.mp3 | 13-Apr-2007 22:39 | 17K | |
![[SND]](/icons/sound2.gif) | abend.mp3 | 13-Apr-2007 22:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | abelmosk.mp3 | 13-Apr-2007 22:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | abelmeholah.mp3 | 13-Apr-2007 22:39 | 17K | |
![[SND]](/icons/sound2.gif) | abelian.mp3 | 13-Apr-2007 22:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | abelia.mp3 | 13-Apr-2007 22:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | abele.mp3 | 13-Apr-2007 22:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | abegging.mp3 | 13-Apr-2007 22:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | abednego.mp3 | 13-Apr-2007 22:39 | 17K | |
![[SND]](/icons/sound2.gif) | abed.mp3 | 13-Apr-2007 22:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | abecedary.mp3 | 13-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | abecedarium.mp3 | 13-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | abecedarian.mp3 | 13-Apr-2007 22:38 | 11K | |
![[SND]](/icons/sound2.gif) | abebe.mp3 | 13-Apr-2007 22:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | abeam.mp3 | 13-Apr-2007 22:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | abe.mp3 | 13-Apr-2007 22:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | abdulrahman.mp3 | 13-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | abdulmejidi.mp3 | 13-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | abdulhamidii.mp3 | 13-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | abductor.mp3 | 13-Apr-2007 22:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | abduction.mp3 | 13-Apr-2007 22:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | abductee.mp3 | 13-Apr-2007 22:38 | 11K | |
![[SND]](/icons/sound2.gif) | abduct.mp3 | 13-Apr-2007 22:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | abducent nerve.mp3 | 13-Apr-2007 22:38 | 10K | |
![[SND]](/icons/sound2.gif) | abducent.mp3 | 13-Apr-2007 22:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | abducens nerve.mp3 | 13-Apr-2007 22:38 | 12K | |
![[SND]](/icons/sound2.gif) | abducens.mp3 | 13-Apr-2007 22:38 | 17K | |
![[SND]](/icons/sound2.gif) | abduce.mp3 | 13-Apr-2007 22:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | abdon.mp3 | 13-Apr-2007 22:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | abdominous.mp3 | 13-Apr-2007 22:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | abdominoplasty.mp3 | 13-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | abdomino.mp3 | 13-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | abdominally.mp3 | 13-Apr-2007 22:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | abdominal.mp3 | 13-Apr-2007 22:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | abdomen.mp3 | 13-Apr-2007 22:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | abdicator.mp3 | 13-Apr-2007 22:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | abdication.mp3 | 13-Apr-2007 22:37 | 9.3K | |
![[SND]](/icons/sound2.gif) | abdicate.mp3 | 13-Apr-2007 22:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | abdicant.mp3 | 13-Apr-2007 22:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | abdicable.mp3 | 13-Apr-2007 22:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | abderrahmankhan.mp3 | 13-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | abderhalden.mp3 | 13-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | abdelkrim.mp3 | 13-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | abdabs.mp3 | 13-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | abcoulomb.mp3 | 13-Apr-2007 22:37 | 17K | |
![[SND]](/icons/sound2.gif) | abby.mp3 | 13-Apr-2007 22:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | abbreviatory.mp3 | 13-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | abbreviator.mp3 | 13-Apr-2007 22:36 | 9.3K | |
![[SND]](/icons/sound2.gif) | abbreviation.mp3 | 13-Apr-2007 22:36 | 10K | |
![[SND]](/icons/sound2.gif) | abbreviated.mp3 | 13-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | abbreviate.mp3 | 13-Apr-2007 22:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | abboud.mp3 | 13-Apr-2007 22:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | abbotship.mp3 | 13-Apr-2007 22:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | abbot.mp3 | 13-Apr-2007 22:36 | 4.8K | |
![[SND]](/icons/sound2.gif) | abbie.mp3 | 13-Apr-2007 22:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | abbey.mp3 | 13-Apr-2007 22:36 | 4.3K | |
![[SND]](/icons/sound2.gif) | abbess.mp3 | 13-Apr-2007 22:36 | 5.5K | |
![[SND]](/icons/sound2.gif) | abbecondenser.mp3 | 13-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | abbe.mp3 | 13-Apr-2007 22:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | abbatial.mp3 | 13-Apr-2007 22:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | abbado.mp3 | 13-Apr-2007 22:36 | 17K | |
![[SND]](/icons/sound2.gif) | abbadabba.mp3 | 13-Apr-2007 22:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | abbacy.mp3 | 13-Apr-2007 22:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | abba.mp3 | 13-Apr-2007 22:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | abb.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | abaxial.mp3 | 13-Apr-2007 22:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | abattoir.mp3 | 13-Apr-2007 22:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | abattage.mp3 | 13-Apr-2007 22:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | abator.mp3 | 13-Apr-2007 22:35 | 17K | |
![[SND]](/icons/sound2.gif) | abatjour.mp3 | 13-Apr-2007 22:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | abatises.mp3 | 13-Apr-2007 22:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | abatised.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | abatis.mp3 | 13-Apr-2007 22:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | abatic.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | abater.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | abatement.mp3 | 13-Apr-2007 22:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | abate.mp3 | 13-Apr-2007 22:35 | 5.5K | |
![[SND]](/icons/sound2.gif) | abask.mp3 | 13-Apr-2007 22:35 | 17K | |
![[SND]](/icons/sound2.gif) | abasia.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | abashment.mp3 | 13-Apr-2007 22:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | abashedness.mp3 | 13-Apr-2007 22:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | abashed.mp3 | 13-Apr-2007 22:35 | 8.0K | |
![[SND]](/icons/sound2.gif) | abash.mp3 | 13-Apr-2007 22:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | abaser.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | abasement.mp3 | 13-Apr-2007 22:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | abased.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | abase.mp3 | 13-Apr-2007 22:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | abas.mp3 | 13-Apr-2007 22:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | a bas.mp3 | 13-Apr-2007 22:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | abaptiston.mp3 | 13-Apr-2007 22:35 | 17K | |
![[SND]](/icons/sound2.gif) | abangan.mp3 | 13-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | abandonment.mp3 | 13-Apr-2007 22:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | abandonee.mp3 | 13-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | abandonedly.mp3 | 13-Apr-2007 22:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | abandoned.mp3 | 13-Apr-2007 22:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | abandon.mp3 | 13-Apr-2007 22:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | abampere.mp3 | 13-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | abamp.mp3 | 13-Apr-2007 22:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | abalone.mp3 | 13-Apr-2007 22:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | abailard.mp3 | 13-Apr-2007 22:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | abaht.mp3 | 13-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | abagtha.mp3 | 13-Apr-2007 22:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | abaft.mp3 | 13-Apr-2007 22:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | abaeterno.mp3 | 13-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | abaddon.mp3 | 13-Apr-2007 22:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | abacus.mp3 | 13-Apr-2007 22:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | abaculus.mp3 | 13-Apr-2007 22:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | abactinally.mp3 | 13-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | abactinal.mp3 | 13-Apr-2007 22:34 | 17K | |
![[SND]](/icons/sound2.gif) | abacterial.mp3 | 13-Apr-2007 22:34 | 11K | |
![[SND]](/icons/sound2.gif) | aback.mp3 | 13-Apr-2007 22:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | abacist.mp3 | 13-Apr-2007 22:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | abaciscus.mp3 | 13-Apr-2007 22:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | abaci.mp3 | 13-Apr-2007 22:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | abaca.mp3 | 13-Apr-2007 22:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | abac.mp3 | 13-Apr-2007 22:33 | 17K | |
![[SND]](/icons/sound2.gif) | aba.mp3 | 13-Apr-2007 22:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | ab.mp3 | 13-Apr-2007 22:33 | 4.8K | |
![[SND]](/icons/sound2.gif) | aasvogel.mp3 | 13-Apr-2007 22:33 | 17K | |
![[SND]](/icons/sound2.gif) | aaronitic.mp3 | 13-Apr-2007 22:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | aaronite.mp3 | 13-Apr-2007 22:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | aaronical.mp3 | 13-Apr-2007 22:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | aardwolves.mp3 | 13-Apr-2007 22:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | aardwolf.mp3 | 13-Apr-2007 22:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | aardvark.mp3 | 13-Apr-2007 22:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | aalto.mp3 | 13-Apr-2007 22:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | aalii.mp3 | 13-Apr-2007 22:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | aalesund.mp3 | 13-Apr-2007 22:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | aak.mp3 | 13-Apr-2007 22:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | aah.mp3 | 13-Apr-2007 22:32 | 4.8K | |
![[SND]](/icons/sound2.gif) | aa.mp3 | 13-Apr-2007 22:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | a.mp3 | 13-Apr-2007 22:32 | 4.3K | |
![[SND]](/icons/sound2.gif) | a-go-go.mp3 | 14-Apr-2007 00:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | Arena, Point.mp3 | 14-Apr-2007 03:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | Aremorica.mp3 | 14-Apr-2007 03:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | Arelate.mp3 | 14-Apr-2007 03:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | Arelas.mp3 | 14-Apr-2007 03:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | Arecibo.mp3 | 14-Apr-2007 03:56 | 10K | |
![[SND]](/icons/sound2.gif) | Ards.mp3 | 14-Apr-2007 03:56 | 6.3K | |
![[SND]](/icons/sound2.gif) | Ardmore.mp3 | 14-Apr-2007 03:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | Ardennes.mp3 | 14-Apr-2007 03:56 | 7.5K | |
![[SND]](/icons/sound2.gif) | Arden.mp3 | 14-Apr-2007 03:55 | 5.9K | |
![[SND]](/icons/sound2.gif) | Ardebil.mp3 | 14-Apr-2007 03:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | Arcueil.mp3 | 14-Apr-2007 03:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | Arcturus.mp3 | 14-Apr-2007 03:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | Arcot.mp3 | 14-Apr-2007 03:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | Arcos de la Frontera.mp3 | 14-Apr-2007 03:54 | 18K | |
![[SND]](/icons/sound2.gif) | Archipielago de Colon.mp3 | 14-Apr-2007 03:53 | 20K | |
![[SND]](/icons/sound2.gif) | Archipenko.mp3 | 14-Apr-2007 03:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | Archimedes.mp3 | 14-Apr-2007 03:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | Archimedes' screw.mp3 | 14-Apr-2007 03:52 | 11K | |
![[SND]](/icons/sound2.gif) | Archimedean.mp3 | 14-Apr-2007 03:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | Arches National Park.mp3 | 14-Apr-2007 03:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | Archeozoic.mp3 | 14-Apr-2007 03:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | Archean.mp3 | 14-Apr-2007 03:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | Archaeozoic.mp3 | 14-Apr-2007 03:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | Arcady.mp3 | 14-Apr-2007 03:47 | 5.2K | |
![[SND]](/icons/sound2.gif) | Arcades ambo.mp3 | 14-Apr-2007 03:47 | 13K | |
![[SND]](/icons/sound2.gif) | Arbuthnot.mp3 | 14-Apr-2007 03:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | Arbus.mp3 | 14-Apr-2007 03:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | Arbuckle Mountains.mp3 | 14-Apr-2007 03:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | Arbon.mp3 | 14-Apr-2007 03:45 | 6.6K | |
![[SND]](/icons/sound2.gif) | Arber.mp3 | 14-Apr-2007 03:44 | 5.5K | |
![[SND]](/icons/sound2.gif) | Araxes.mp3 | 14-Apr-2007 03:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | Arawakan.mp3 | 14-Apr-2007 03:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | Arawak.mp3 | 14-Apr-2007 03:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | Aravalli Range.mp3 | 14-Apr-2007 03:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | Araucanian.mp3 | 14-Apr-2007 03:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | Araucan.mp3 | 14-Apr-2007 03:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | Aras.mp3 | 14-Apr-2007 03:44 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ararat.mp3 | 14-Apr-2007 03:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | Arapahoe.mp3 | 14-Apr-2007 03:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | Arapaho.mp3 | 14-Apr-2007 03:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | Aransas Bay.mp3 | 14-Apr-2007 03:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | Aran Islands.mp3 | 14-Apr-2007 03:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | Aramaic.mp3 | 14-Apr-2007 03:43 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aramaean.mp3 | 14-Apr-2007 03:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | Aram.mp3 | 14-Apr-2007 03:43 | 5.9K | |
![[SND]](/icons/sound2.gif) | Aral Sea.mp3 | 14-Apr-2007 03:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | Araks.mp3 | 14-Apr-2007 03:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Arakan.mp3 | 14-Apr-2007 03:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | Araguaya.mp3 | 14-Apr-2007 03:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | Aragonese.mp3 | 14-Apr-2007 03:42 | 11K | |
![[SND]](/icons/sound2.gif) | Aragon.mp3 | 14-Apr-2007 03:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | Arafura Sea.mp3 | 14-Apr-2007 03:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | Arad.mp3 | 14-Apr-2007 03:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Aracaju.mp3 | 14-Apr-2007 03:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | Araby.mp3 | 14-Apr-2007 03:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | Arabize.mp3 | 14-Apr-2007 03:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | Arabization.mp3 | 14-Apr-2007 03:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | Arabist.mp3 | 14-Apr-2007 03:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | Arabism.mp3 | 14-Apr-2007 03:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | Arabic.mp3 | 14-Apr-2007 03:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | Arabian Peninsula.mp3 | 14-Apr-2007 03:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | Arabian.mp3 | 14-Apr-2007 03:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | Arabia.mp3 | 14-Apr-2007 03:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | Arab.mp3 | 14-Apr-2007 03:40 | 4.5K | |
![[SND]](/icons/sound2.gif) | Aquitanian.mp3 | 14-Apr-2007 03:39 | 10K | |
![[SND]](/icons/sound2.gif) | Aquitania.mp3 | 14-Apr-2007 03:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | Aquitaine.mp3 | 14-Apr-2007 03:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | Aquino.mp3 | 14-Apr-2007 03:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | Aquila.mp3 | 14-Apr-2007 03:39 | 6.1K | |
![[SND]](/icons/sound2.gif) | Aquidneck Island.mp3 | 14-Apr-2007 03:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | Aquarius.mp3 | 14-Apr-2007 03:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | Aquarian.mp3 | 14-Apr-2007 03:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | Aqua-Lung.mp3 | 14-Apr-2007 03:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | Aqaba.mp3 | 14-Apr-2007 03:37 | 5.4K | |
![[SND]](/icons/sound2.gif) | Apurimac.mp3 | 14-Apr-2007 03:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | Apure.mp3 | 14-Apr-2007 03:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | Apulian.mp3 | 14-Apr-2007 03:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | Apulia.mp3 | 14-Apr-2007 03:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | Apuleius.mp3 | 14-Apr-2007 03:36 | 9.3K | |
![[SND]](/icons/sound2.gif) | Apsheron.mp3 | 14-Apr-2007 03:35 | 9.6K | |
![[SND]](/icons/sound2.gif) | April.mp3 | 14-Apr-2007 03:35 | 5.4K | |
![[SND]](/icons/sound2.gif) | Apra Harbor.mp3 | 14-Apr-2007 03:34 | 6.3K | |
![[SND]](/icons/sound2.gif) | Appleton.mp3 | 14-Apr-2007 03:30 | 6.4K | |
![[SND]](/icons/sound2.gif) | Appian Way.mp3 | 14-Apr-2007 03:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | Appenzell.mp3 | 14-Apr-2007 03:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | Appalachian Mountains.mp3 | 14-Apr-2007 03:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | Appalachian.mp3 | 14-Apr-2007 03:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | Appalachia.mp3 | 14-Apr-2007 03:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | Apopka.mp3 | 14-Apr-2007 03:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | Apollyon.mp3 | 14-Apr-2007 03:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | Apollonius.mp3 | 14-Apr-2007 03:22 | 10K | |
![[SND]](/icons/sound2.gif) | Apollonian.mp3 | 14-Apr-2007 03:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | Apollo.mp3 | 14-Apr-2007 03:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | Apollinian.mp3 | 14-Apr-2007 03:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | Apollinaire.mp3 | 14-Apr-2007 03:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | Apo, Mount.mp3 | 14-Apr-2007 03:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | Apis.mp3 | 14-Apr-2007 03:19 | 6.3K | |
![[SND]](/icons/sound2.gif) | Apia.mp3 | 14-Apr-2007 03:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | Aphrodite.mp3 | 14-Apr-2007 03:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Apgar score.mp3 | 14-Apr-2007 03:16 | 12K | |
![[SND]](/icons/sound2.gif) | Apennines.mp3 | 14-Apr-2007 03:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | Apennine.mp3 | 14-Apr-2007 03:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | Apelles.mp3 | 14-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | Apeldoorn.mp3 | 14-Apr-2007 03:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | Apaporis.mp3 | 14-Apr-2007 03:14 | 10K | |
![[SND]](/icons/sound2.gif) | Apalachicola.mp3 | 14-Apr-2007 03:14 | 12K | |
![[SND]](/icons/sound2.gif) | Apaches.mp3 | 14-Apr-2007 03:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | Apachean.mp3 | 14-Apr-2007 03:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | Apache Junction.mp3 | 14-Apr-2007 03:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | Aosta.mp3 | 14-Apr-2007 03:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | Aorangi.mp3 | 14-Apr-2007 03:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aomori.mp3 | 14-Apr-2007 03:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | Aomen.mp3 | 14-Apr-2007 03:12 | 14K | |
![[SND]](/icons/sound2.gif) | Anzio.mp3 | 14-Apr-2007 03:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | Anzac.mp3 | 14-Apr-2007 03:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | Anyang.mp3 | 14-Apr-2007 03:11 | 9.8K | |
![[SND]](/icons/sound2.gif) | Anvers.mp3 | 14-Apr-2007 03:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | Anuradhapura.mp3 | 14-Apr-2007 03:10 | 11K | |
![[SND]](/icons/sound2.gif) | Anubis.mp3 | 14-Apr-2007 03:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | Antwerpen.mp3 | 14-Apr-2007 03:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | Antwerp.mp3 | 14-Apr-2007 03:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | Antung.mp3 | 14-Apr-2007 03:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | Antsiranana.mp3 | 14-Apr-2007 03:10 | 11K | |
![[SND]](/icons/sound2.gif) | Antrim.mp3 | 14-Apr-2007 03:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | Antony.mp3 | 14-Apr-2007 03:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | Antonius.mp3 | 14-Apr-2007 03:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | Antoninus Pius.mp3 | 14-Apr-2007 03:09 | 15K | |
![[SND]](/icons/sound2.gif) | Antoninus.mp3 | 14-Apr-2007 03:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | Antonian.mp3 | 14-Apr-2007 03:09 | 9.3K | |
![[SND]](/icons/sound2.gif) | Antonescu.mp3 | 14-Apr-2007 03:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | Antofagasta.mp3 | 14-Apr-2007 03:08 | 14K | |
![[SND]](/icons/sound2.gif) | Antisthenes.mp3 | 14-Apr-2007 03:07 | 12K | |
![[SND]](/icons/sound2.gif) | Antisana.mp3 | 14-Apr-2007 03:06 | 10K | |
![[SND]](/icons/sound2.gif) | Antipater.mp3 | 14-Apr-2007 03:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | Antiochus.mp3 | 14-Apr-2007 03:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | Antiochian.mp3 | 14-Apr-2007 03:04 | 10K | |
![[SND]](/icons/sound2.gif) | Antiochene.mp3 | 14-Apr-2007 03:04 | 12K | |
![[SND]](/icons/sound2.gif) | Antioch.mp3 | 14-Apr-2007 03:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Antilles.mp3 | 14-Apr-2007 03:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | Antillean.mp3 | 14-Apr-2007 03:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | Antiguan.mp3 | 14-Apr-2007 02:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | Antigua.mp3 | 14-Apr-2007 02:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | Antigonus I.mp3 | 14-Apr-2007 02:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | Antigone.mp3 | 14-Apr-2007 02:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | Antietam Creek.mp3 | 14-Apr-2007 02:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Anticosti Island.mp3 | 14-Apr-2007 02:57 | 8.8K | |
![[SND]](/icons/sound2.gif) | Antichrist.mp3 | 14-Apr-2007 02:56 | 10K | |
![[SND]](/icons/sound2.gif) | Antibes.mp3 | 14-Apr-2007 02:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | Anti-Lebanon.mp3 | 14-Apr-2007 03:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | Anthony.mp3 | 14-Apr-2007 02:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | Antares.mp3 | 14-Apr-2007 02:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | Antarctica.mp3 | 14-Apr-2007 02:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | Antarctic.mp3 | 14-Apr-2007 02:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | Antananarivo.mp3 | 14-Apr-2007 02:47 | 15K | |
![[SND]](/icons/sound2.gif) | Antalya.mp3 | 14-Apr-2007 02:47 | 9.5K | |
![[SND]](/icons/sound2.gif) | Antall.mp3 | 14-Apr-2007 02:47 | 7.3K | |
![[SND]](/icons/sound2.gif) | Antakya.mp3 | 14-Apr-2007 02:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | Antakiyah.mp3 | 14-Apr-2007 02:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Antaean.mp3 | 14-Apr-2007 02:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | Anshan.mp3 | 14-Apr-2007 02:46 | 11K | |
![[SND]](/icons/sound2.gif) | Anselm.mp3 | 14-Apr-2007 02:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Anouilh.mp3 | 14-Apr-2007 02:45 | 6.4K | |
![[SND]](/icons/sound2.gif) | Annunciation.mp3 | 14-Apr-2007 02:42 | 10K | |
![[SND]](/icons/sound2.gif) | Anniston.mp3 | 14-Apr-2007 02:39 | 7.7K | |
![[SND]](/icons/sound2.gif) | Annie Oakley.mp3 | 14-Apr-2007 02:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | Anne of Cleves.mp3 | 14-Apr-2007 02:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | Annecy.mp3 | 14-Apr-2007 02:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | Anne.mp3 | 14-Apr-2007 02:38 | 5.0K | |
![[SND]](/icons/sound2.gif) | Annapurna.mp3 | 14-Apr-2007 02:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | Annapolis.mp3 | 14-Apr-2007 02:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | Annan.mp3 | 14-Apr-2007 02:38 | 6.8K | |
![[SND]](/icons/sound2.gif) | Annamite.mp3 | 14-Apr-2007 02:38 | 5.9K | |
![[SND]](/icons/sound2.gif) | Annamese.mp3 | 14-Apr-2007 02:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | Annam.mp3 | 14-Apr-2007 02:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | Annaba.mp3 | 14-Apr-2007 02:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | Anna Ivanovna.mp3 | 14-Apr-2007 02:37 | 11K | |
![[SND]](/icons/sound2.gif) | Ann Arbor.mp3 | 14-Apr-2007 02:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ann, Cape.mp3 | 14-Apr-2007 02:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | Anking.mp3 | 14-Apr-2007 02:36 | 11K | |
![[SND]](/icons/sound2.gif) | Ankeny.mp3 | 14-Apr-2007 02:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | Ankara.mp3 | 14-Apr-2007 02:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | Anjou.mp3 | 14-Apr-2007 02:36 | 7.5K | |
![[SND]](/icons/sound2.gif) | Anishinabeg.mp3 | 14-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | Anishinabe.mp3 | 14-Apr-2007 02:35 | 11K | |
![[SND]](/icons/sound2.gif) | Aniakchak Crater.mp3 | 14-Apr-2007 02:32 | 11K | |
![[SND]](/icons/sound2.gif) | Anhwei.mp3 | 14-Apr-2007 02:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | Anhalt.mp3 | 14-Apr-2007 02:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | Angus.mp3 | 14-Apr-2007 02:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | Anguillan.mp3 | 14-Apr-2007 02:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anguilla.mp3 | 14-Apr-2007 02:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | Angoumois.mp3 | 14-Apr-2007 02:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | Angouleme.mp3 | 14-Apr-2007 02:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | Angolan.mp3 | 14-Apr-2007 02:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | Angola.mp3 | 14-Apr-2007 02:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anglophobic.mp3 | 14-Apr-2007 02:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Anglophobia.mp3 | 14-Apr-2007 02:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | Anglophobe.mp3 | 14-Apr-2007 02:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | Anglophilic.mp3 | 14-Apr-2007 02:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | Anglophiliac.mp3 | 14-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | Anglophilia.mp3 | 14-Apr-2007 02:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anglophile.mp3 | 14-Apr-2007 02:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anglophil.mp3 | 14-Apr-2007 02:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | Anglomania.mp3 | 14-Apr-2007 02:29 | 9.8K | |
![[SND]](/icons/sound2.gif) | Anglocentric.mp3 | 14-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | Anglo.mp3 | 14-Apr-2007 02:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | Anglo-Saxon.mp3 | 14-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | Anglo-Norman.mp3 | 14-Apr-2007 02:29 | 9.6K | |
![[SND]](/icons/sound2.gif) | Anglo-French.mp3 | 14-Apr-2007 02:29 | 10K | |
![[SND]](/icons/sound2.gif) | Anglo-Catholicism.mp3 | 14-Apr-2007 02:29 | 14K | |
![[SND]](/icons/sound2.gif) | Anglo-Catholic.mp3 | 14-Apr-2007 02:29 | 11K | |
![[SND]](/icons/sound2.gif) | Anglo-American.mp3 | 14-Apr-2007 02:29 | 12K | |
![[SND]](/icons/sound2.gif) | Anglist.mp3 | 14-Apr-2007 02:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | Anglicist.mp3 | 14-Apr-2007 02:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anglicanism.mp3 | 14-Apr-2007 02:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | Anglican.mp3 | 14-Apr-2007 02:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | Anglian.mp3 | 14-Apr-2007 02:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | Anglia.mp3 | 14-Apr-2007 02:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | Anglesea.mp3 | 14-Apr-2007 02:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | Angkor.mp3 | 14-Apr-2007 02:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | Angevin.mp3 | 14-Apr-2007 02:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | Angers.mp3 | 14-Apr-2007 02:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | Angelus.mp3 | 14-Apr-2007 02:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | Angelou.mp3 | 14-Apr-2007 02:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | Angell.mp3 | 14-Apr-2007 02:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | Angelico.mp3 | 14-Apr-2007 02:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | Angeleno.mp3 | 14-Apr-2007 02:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | Angela Merici.mp3 | 14-Apr-2007 02:25 | 11K | |
![[SND]](/icons/sound2.gif) | Angel Falls.mp3 | 14-Apr-2007 02:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | Angarsk.mp3 | 14-Apr-2007 02:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | Angara.mp3 | 14-Apr-2007 02:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | Aneto, Pico de.mp3 | 14-Apr-2007 02:24 | 14K | |
![[SND]](/icons/sound2.gif) | Androscoggin.mp3 | 14-Apr-2007 02:21 | 11K | |
![[SND]](/icons/sound2.gif) | Andros.mp3 | 14-Apr-2007 02:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | Andropov.mp3 | 14-Apr-2007 02:21 | 9.5K | |
![[SND]](/icons/sound2.gif) | Andromache.mp3 | 14-Apr-2007 02:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | Androcles.mp3 | 14-Apr-2007 02:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | Andric.mp3 | 14-Apr-2007 02:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | Andria.mp3 | 14-Apr-2007 02:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | Andreyev.mp3 | 14-Apr-2007 02:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | Andrews.mp3 | 14-Apr-2007 02:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | Andreotti.mp3 | 14-Apr-2007 02:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | Andreanof Islands.mp3 | 14-Apr-2007 02:19 | 10K | |
![[SND]](/icons/sound2.gif) | Andrea del Sarto.mp3 | 14-Apr-2007 02:19 | 14K | |
![[SND]](/icons/sound2.gif) | Andre.mp3 | 14-Apr-2007 02:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | Andrassy.mp3 | 14-Apr-2007 02:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | Andover.mp3 | 14-Apr-2007 02:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | Andorran.mp3 | 14-Apr-2007 02:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | Andorra.mp3 | 14-Apr-2007 02:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | Andizhan.mp3 | 14-Apr-2007 02:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | Andine.mp3 | 14-Apr-2007 02:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | Andijon.mp3 | 14-Apr-2007 02:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | Andhra Pradesh.mp3 | 14-Apr-2007 02:18 | 12K | |
![[SND]](/icons/sound2.gif) | Andes.mp3 | 14-Apr-2007 02:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | Anderson.mp3 | 14-Apr-2007 02:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | Andersen.mp3 | 14-Apr-2007 02:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | Anders.mp3 | 14-Apr-2007 02:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | Andermatt.mp3 | 14-Apr-2007 02:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anderlecht.mp3 | 14-Apr-2007 02:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | Andean condor.mp3 | 14-Apr-2007 02:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | Andean.mp3 | 14-Apr-2007 02:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | Andamanese.mp3 | 14-Apr-2007 02:17 | 11K | |
![[SND]](/icons/sound2.gif) | Andaman and Nicobar.mp3 | 14-Apr-2007 02:17 | 12K | |
![[SND]](/icons/sound2.gif) | Andalusian.mp3 | 14-Apr-2007 02:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | Andalusia.mp3 | 14-Apr-2007 02:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | Andalucia.mp3 | 14-Apr-2007 02:17 | 11K | |
![[SND]](/icons/sound2.gif) | Ancyra.mp3 | 14-Apr-2007 02:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ancona.mp3 | 14-Apr-2007 02:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | Ancohuma.mp3 | 14-Apr-2007 02:16 | 9.5K | |
![[SND]](/icons/sound2.gif) | Anchises.mp3 | 14-Apr-2007 02:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | Anaximandrian.mp3 | 14-Apr-2007 02:14 | 11K | |
![[SND]](/icons/sound2.gif) | Anaximander.mp3 | 14-Apr-2007 02:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | Anaxagorean.mp3 | 14-Apr-2007 02:14 | 11K | |
![[SND]](/icons/sound2.gif) | Anaxagoras.mp3 | 14-Apr-2007 02:14 | 11K | |
![[SND]](/icons/sound2.gif) | Anatolian.mp3 | 14-Apr-2007 02:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anatolia.mp3 | 14-Apr-2007 02:13 | 9.5K | |
![[SND]](/icons/sound2.gif) | Anasco.mp3 | 14-Apr-2007 02:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | Anasazi.mp3 | 14-Apr-2007 02:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ananias.mp3 | 14-Apr-2007 02:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | Anahuac.mp3 | 14-Apr-2007 02:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | Anaheim.mp3 | 14-Apr-2007 02:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | Anadyr.mp3 | 14-Apr-2007 02:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Anacreon.mp3 | 14-Apr-2007 02:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Anabaptist.mp3 | 14-Apr-2007 02:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | An Nhon.mp3 | 14-Apr-2007 02:03 | 10K | |
![[SND]](/icons/sound2.gif) | An Najaf.mp3 | 14-Apr-2007 02:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | An Nafad.mp3 | 14-Apr-2007 02:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | An-ch'ing.mp3 | 14-Apr-2007 02:14 | 11K | |
![[SND]](/icons/sound2.gif) | Amytal.mp3 | 14-Apr-2007 02:02 | 5.9K | |
![[SND]](/icons/sound2.gif) | Amvrakikos Kolpos.mp3 | 14-Apr-2007 02:01 | 16K | |
![[SND]](/icons/sound2.gif) | Amur.mp3 | 14-Apr-2007 02:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | Amundsen Gulf.mp3 | 14-Apr-2007 02:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | Amundsen.mp3 | 14-Apr-2007 02:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | Amu Dar'ya.mp3 | 14-Apr-2007 02:00 | 9.3K | |
![[SND]](/icons/sound2.gif) | Amsterdammer.mp3 | 14-Apr-2007 02:00 | 10K | |
![[SND]](/icons/sound2.gif) | Amsterdam.mp3 | 14-Apr-2007 02:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | Amritsar.mp3 | 14-Apr-2007 02:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | Amravati.mp3 | 14-Apr-2007 01:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | Amraoti.mp3 | 14-Apr-2007 01:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | Amphitryon.mp3 | 14-Apr-2007 01:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | Amphion.mp3 | 14-Apr-2007 01:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | Amoy.mp3 | 14-Apr-2007 01:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | Amos.mp3 | 14-Apr-2007 01:53 | 5.4K | |
![[SND]](/icons/sound2.gif) | Amorite.mp3 | 14-Apr-2007 01:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | Amorgos.mp3 | 14-Apr-2007 01:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | Amo.mp3 | 14-Apr-2007 01:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | Amne Machin.mp3 | 14-Apr-2007 01:51 | 12K | |
![[SND]](/icons/sound2.gif) | Ammon.mp3 | 14-Apr-2007 01:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | Amman.mp3 | 14-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | Amish.mp3 | 14-Apr-2007 01:49 | 5.2K | |
![[SND]](/icons/sound2.gif) | Amis.mp3 | 14-Apr-2007 01:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | Amirante Islands.mp3 | 14-Apr-2007 01:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | Amindivi Islands.mp3 | 14-Apr-2007 01:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | Amiens.mp3 | 14-Apr-2007 01:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | Amherst.mp3 | 14-Apr-2007 01:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | Amharic.mp3 | 14-Apr-2007 01:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | Amhara.mp3 | 14-Apr-2007 01:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | Amga.mp3 | 14-Apr-2007 01:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | Ames test.mp3 | 14-Apr-2007 01:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ameslan.mp3 | 14-Apr-2007 01:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ames.mp3 | 14-Apr-2007 01:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | Amersfoort.mp3 | 14-Apr-2007 01:45 | 10K | |
![[SND]](/icons/sound2.gif) | Amerindian.mp3 | 14-Apr-2007 01:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | Amerind.mp3 | 14-Apr-2007 01:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | Americanness.mp3 | 14-Apr-2007 01:44 | 10K | |
![[SND]](/icons/sound2.gif) | Americanize.mp3 | 14-Apr-2007 01:44 | 10K | |
![[SND]](/icons/sound2.gif) | Americanization.mp3 | 14-Apr-2007 01:44 | 11K | |
![[SND]](/icons/sound2.gif) | Americanist.mp3 | 14-Apr-2007 01:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | Americanism.mp3 | 14-Apr-2007 01:44 | 9.5K | |
![[SND]](/icons/sound2.gif) | Americanese.mp3 | 14-Apr-2007 01:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | Americana.mp3 | 14-Apr-2007 01:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | American.mp3 | 14-Apr-2007 01:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | America.mp3 | 14-Apr-2007 01:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Amerasian.mp3 | 14-Apr-2007 01:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | Amenophis.mp3 | 14-Apr-2007 01:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | Amenhotep.mp3 | 14-Apr-2007 01:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | Amchitka.mp3 | 14-Apr-2007 01:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | Ambrosian.mp3 | 14-Apr-2007 01:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ambrose.mp3 | 14-Apr-2007 01:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ambracian Gulf.mp3 | 14-Apr-2007 01:40 | 8.8K | |
![[SND]](/icons/sound2.gif) | Ambonese.mp3 | 14-Apr-2007 01:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ambon.mp3 | 14-Apr-2007 01:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | Amboinese.mp3 | 14-Apr-2007 01:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | Amboina.mp3 | 14-Apr-2007 01:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | Ambato.mp3 | 14-Apr-2007 01:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | Amazonian.mp3 | 14-Apr-2007 01:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | Amazonia.mp3 | 14-Apr-2007 01:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | Amazonas.mp3 | 14-Apr-2007 01:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | Amazon.mp3 | 14-Apr-2007 01:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | Amati.mp3 | 14-Apr-2007 01:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | Amarilloan.mp3 | 14-Apr-2007 01:35 | 10K | |
![[SND]](/icons/sound2.gif) | Amarillo.mp3 | 14-Apr-2007 01:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | Amapa.mp3 | 14-Apr-2007 01:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | Amami.mp3 | 14-Apr-2007 01:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | Amalfian.mp3 | 14-Apr-2007 01:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | Amalfi.mp3 | 14-Apr-2007 01:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | Amalekite.mp3 | 14-Apr-2007 01:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | Amagasaki.mp3 | 14-Apr-2007 01:34 | 12K | |
![[SND]](/icons/sound2.gif) | Amadora.mp3 | 14-Apr-2007 01:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | Alzheimer's disease.mp3 | 14-Apr-2007 01:33 | 13K | |
![[SND]](/icons/sound2.gif) | Alyce clover.mp3 | 14-Apr-2007 01:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | Alvin.mp3 | 14-Apr-2007 01:33 | 6.6K | |
![[SND]](/icons/sound2.gif) | Alvarez Quintero.mp3 | 14-Apr-2007 01:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | Alvarez.mp3 | 14-Apr-2007 01:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | Alvarado, de.mp3 | 14-Apr-2007 01:32 | 10K | |
![[SND]](/icons/sound2.gif) | Altyn.mp3 | 14-Apr-2007 01:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Altrincham.mp3 | 14-Apr-2007 01:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | Altorf.mp3 | 14-Apr-2007 01:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | Altoona.mp3 | 14-Apr-2007 01:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | Alton.mp3 | 14-Apr-2007 01:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | Alto Parana.mp3 | 14-Apr-2007 01:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | Alto Adige.mp3 | 14-Apr-2007 01:29 | 12K | |
![[SND]](/icons/sound2.gif) | Altman.mp3 | 14-Apr-2007 01:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | Altenburg.mp3 | 14-Apr-2007 01:27 | 11K | |
![[SND]](/icons/sound2.gif) | Altdorf.mp3 | 14-Apr-2007 01:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Altamonte Springs.mp3 | 14-Apr-2007 01:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | Altamira.mp3 | 14-Apr-2007 01:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | Altamaha.mp3 | 14-Apr-2007 01:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | Altair.mp3 | 14-Apr-2007 01:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | Altaic.mp3 | 14-Apr-2007 01:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | Altai.mp3 | 14-Apr-2007 01:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | Alta California.mp3 | 14-Apr-2007 01:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | Alsek.mp3 | 14-Apr-2007 01:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | Alsatian.mp3 | 14-Apr-2007 01:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | Alsatia.mp3 | 14-Apr-2007 01:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | Alsace.mp3 | 14-Apr-2007 01:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | Alsace-Lorraine.mp3 | 14-Apr-2007 01:26 | 14K | |
![[SND]](/icons/sound2.gif) | Alps.mp3 | 14-Apr-2007 01:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | Alpheus.mp3 | 14-Apr-2007 01:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | Alpharetta.mp3 | 14-Apr-2007 01:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | Alost.mp3 | 14-Apr-2007 01:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | Alor Setar.mp3 | 14-Apr-2007 01:24 | 13K | |
![[SND]](/icons/sound2.gif) | Alor.mp3 | 14-Apr-2007 01:24 | 6.4K | |
![[SND]](/icons/sound2.gif) | Almeria.mp3 | 14-Apr-2007 01:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | Almelo.mp3 | 14-Apr-2007 01:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | Almaty.mp3 | 14-Apr-2007 01:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | Almaden.mp3 | 14-Apr-2007 01:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | Alma.mp3 | 14-Apr-2007 01:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | Alma-Tadema.mp3 | 14-Apr-2007 01:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | Alma-Ata.mp3 | 14-Apr-2007 01:21 | 12K | |
![[SND]](/icons/sound2.gif) | Allston.mp3 | 14-Apr-2007 01:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | Allier.mp3 | 14-Apr-2007 01:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | Allhallows.mp3 | 14-Apr-2007 01:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | Alleyne.mp3 | 14-Apr-2007 01:14 | 5.4K | |
![[SND]](/icons/sound2.gif) | Allen wrench.mp3 | 14-Apr-2007 01:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | Allentown.mp3 | 14-Apr-2007 01:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | Allenstein.mp3 | 14-Apr-2007 01:13 | 10K | |
![[SND]](/icons/sound2.gif) | Allende Gossens.mp3 | 14-Apr-2007 01:13 | 14K | |
![[SND]](/icons/sound2.gif) | Allenby.mp3 | 14-Apr-2007 01:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | Allen.mp3 | 14-Apr-2007 01:13 | 5.4K | |
![[SND]](/icons/sound2.gif) | Allegheny spurge.mp3 | 14-Apr-2007 01:12 | 13K | |
![[SND]](/icons/sound2.gif) | Allegheny.mp3 | 14-Apr-2007 01:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Alleghenian.mp3 | 14-Apr-2007 01:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | Allais.mp3 | 14-Apr-2007 01:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | Allahabad.mp3 | 14-Apr-2007 01:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | Allah.mp3 | 14-Apr-2007 01:10 | 4.5K | |
![[SND]](/icons/sound2.gif) | Alkmaar.mp3 | 14-Apr-2007 01:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aligarh.mp3 | 14-Apr-2007 01:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | Alice.mp3 | 14-Apr-2007 01:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | Alice-in-Wonderland.mp3 | 14-Apr-2007 01:05 | 11K | |
![[SND]](/icons/sound2.gif) | Alicante.mp3 | 14-Apr-2007 01:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | Alibates Flint Quarries National Monument.mp3 | 14-Apr-2007 01:04 | 10K | |
![[SND]](/icons/sound2.gif) | Ali Pasa.mp3 | 14-Apr-2007 01:04 | 5.2K | |
![[SND]](/icons/sound2.gif) | Ali Baba.mp3 | 14-Apr-2007 01:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | Ali.mp3 | 14-Apr-2007 01:04 | 5.5K | |
![[SND]](/icons/sound2.gif) | Alhambra.mp3 | 14-Apr-2007 01:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | Algren.mp3 | 14-Apr-2007 01:04 | 5.7K | |
![[SND]](/icons/sound2.gif) | Algonquin.mp3 | 14-Apr-2007 01:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | Algonquian.mp3 | 14-Apr-2007 01:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | Algonkin.mp3 | 14-Apr-2007 01:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | Algonkian.mp3 | 14-Apr-2007 01:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | Algol.mp3 | 14-Apr-2007 01:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | Algoa Bay.mp3 | 14-Apr-2007 01:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | Algiers.mp3 | 14-Apr-2007 01:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | Algerine.mp3 | 14-Apr-2007 01:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | Algerian.mp3 | 14-Apr-2007 01:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | Algeria.mp3 | 14-Apr-2007 01:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | Alger.mp3 | 14-Apr-2007 01:02 | 5.7K | |
![[SND]](/icons/sound2.gif) | Algeciras.mp3 | 14-Apr-2007 01:02 | 11K | |
![[SND]](/icons/sound2.gif) | Algarve.mp3 | 14-Apr-2007 01:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | Alfonso XIII.mp3 | 14-Apr-2007 01:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | Alfold.mp3 | 14-Apr-2007 01:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | Alfios.mp3 | 14-Apr-2007 01:00 | 9.6K | |
![[SND]](/icons/sound2.gif) | Alfieri.mp3 | 14-Apr-2007 01:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | Alferov.mp3 | 14-Apr-2007 01:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | Alfa.mp3 | 14-Apr-2007 01:00 | 5.2K | |
![[SND]](/icons/sound2.gif) | Alexius I Comnenus.mp3 | 14-Apr-2007 01:00 | 15K | |
![[SND]](/icons/sound2.gif) | Alexis Petrovich.mp3 | 14-Apr-2007 00:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | Alexis I Mikhaylovich.mp3 | 14-Apr-2007 00:59 | 15K | |
![[SND]](/icons/sound2.gif) | Alexandrian.mp3 | 14-Apr-2007 00:59 | 11K | |
![[SND]](/icons/sound2.gif) | Alexandria.mp3 | 14-Apr-2007 00:59 | 10K | |
![[SND]](/icons/sound2.gif) | Alexandretta.mp3 | 14-Apr-2007 00:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | Alexander Severus.mp3 | 14-Apr-2007 00:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | Alexander Nevsky.mp3 | 14-Apr-2007 00:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | Alexander Archipelago.mp3 | 14-Apr-2007 00:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | Alexander.mp3 | 14-Apr-2007 00:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | Aleutian Islands.mp3 | 14-Apr-2007 00:58 | 7.5K | |
![[SND]](/icons/sound2.gif) | Aleut.mp3 | 14-Apr-2007 00:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | Alessandria.mp3 | 14-Apr-2007 00:57 | 11K | |
![[SND]](/icons/sound2.gif) | Aleppo.mp3 | 14-Apr-2007 00:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | Aleppine.mp3 | 14-Apr-2007 00:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | Alembert, d'.mp3 | 14-Apr-2007 00:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | Alemannic.mp3 | 14-Apr-2007 00:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | Aleman Valdes.mp3 | 14-Apr-2007 00:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | Aleman.mp3 | 14-Apr-2007 00:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aleksandrovsk.mp3 | 14-Apr-2007 00:56 | 10K | |
![[SND]](/icons/sound2.gif) | Aleksandrovsk-Grushevski.mp3 | 14-Apr-2007 00:56 | 19K | |
![[SND]](/icons/sound2.gif) | Aleksandr.mp3 | 14-Apr-2007 00:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | Aleksandar Obrenovic.mp3 | 14-Apr-2007 00:56 | 17K | |
![[SND]](/icons/sound2.gif) | Aleixandre.mp3 | 14-Apr-2007 00:56 | 10K | |
![[SND]](/icons/sound2.gif) | Aleichem.mp3 | 14-Apr-2007 00:56 | 12K | |
![[SND]](/icons/sound2.gif) | Aldrich.mp3 | 14-Apr-2007 00:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | Aldershot.mp3 | 14-Apr-2007 00:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | Alderney.mp3 | 14-Apr-2007 00:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | Alden.mp3 | 14-Apr-2007 00:54 | 5.9K | |
![[SND]](/icons/sound2.gif) | Aldebaran.mp3 | 14-Apr-2007 00:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | Aldan.mp3 | 14-Apr-2007 00:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aldabra.mp3 | 14-Apr-2007 00:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | Alda.mp3 | 14-Apr-2007 00:54 | 5.5K | |
![[SND]](/icons/sound2.gif) | Alcyone.mp3 | 14-Apr-2007 00:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | Alcuin.mp3 | 14-Apr-2007 00:53 | 5.7K | |
![[SND]](/icons/sound2.gif) | Alcott.mp3 | 14-Apr-2007 00:53 | 5.4K | |
![[SND]](/icons/sound2.gif) | Alcoran.mp3 | 14-Apr-2007 00:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | Alcmene.mp3 | 14-Apr-2007 00:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | Alcibiades.mp3 | 14-Apr-2007 00:52 | 12K | |
![[SND]](/icons/sound2.gif) | Alcestis.mp3 | 14-Apr-2007 00:52 | 10K | |
![[SND]](/icons/sound2.gif) | Alcatraz.mp3 | 14-Apr-2007 00:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | Alcamo.mp3 | 14-Apr-2007 00:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Alcaeus.mp3 | 14-Apr-2007 00:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | Albuquerquean.mp3 | 14-Apr-2007 00:51 | 11K | |
![[SND]](/icons/sound2.gif) | Albuquerque.mp3 | 14-Apr-2007 00:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | Albuquerque, de.mp3 | 14-Apr-2007 00:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | Albucasis.mp3 | 14-Apr-2007 00:50 | 11K | |
![[SND]](/icons/sound2.gif) | Albright.mp3 | 14-Apr-2007 00:50 | 7.1K | |
![[SND]](/icons/sound2.gif) | Alboin.mp3 | 14-Apr-2007 00:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | Albion.mp3 | 14-Apr-2007 00:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | Albinoni.mp3 | 14-Apr-2007 00:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | Albigensianism.mp3 | 14-Apr-2007 00:49 | 11K | |
![[SND]](/icons/sound2.gif) | Albigensian.mp3 | 14-Apr-2007 00:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | Albigenses.mp3 | 14-Apr-2007 00:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | Albi.mp3 | 14-Apr-2007 00:49 | 6.6K | |
![[SND]](/icons/sound2.gif) | Albertville.mp3 | 14-Apr-2007 00:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | Albertus Magnus.mp3 | 14-Apr-2007 00:49 | 14K | |
![[SND]](/icons/sound2.gif) | Albertan.mp3 | 14-Apr-2007 00:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | Alberta.mp3 | 14-Apr-2007 00:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | Albert I.mp3 | 14-Apr-2007 00:48 | 5.4K | |
![[SND]](/icons/sound2.gif) | Albert, Lake.mp3 | 14-Apr-2007 00:48 | 6.3K | |
![[SND]](/icons/sound2.gif) | Albers.mp3 | 14-Apr-2007 00:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | Albeniz.mp3 | 14-Apr-2007 00:48 | 8.9K | |
![[SND]](/icons/sound2.gif) | Albemarle Sound.mp3 | 14-Apr-2007 00:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | Albee.mp3 | 14-Apr-2007 00:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | Albany.mp3 | 14-Apr-2007 00:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | Albanus Mons.mp3 | 14-Apr-2007 00:48 | 12K | |
![[SND]](/icons/sound2.gif) | Albanus Lacus.mp3 | 14-Apr-2007 00:48 | 13K | |
![[SND]](/icons/sound2.gif) | Albano, Lake.mp3 | 14-Apr-2007 00:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | Albanian.mp3 | 14-Apr-2007 00:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | Albania.mp3 | 14-Apr-2007 00:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | Alban Hills.mp3 | 14-Apr-2007 00:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | Albacete.mp3 | 14-Apr-2007 00:47 | 9.8K | |
![[SND]](/icons/sound2.gif) | Alba Longa.mp3 | 14-Apr-2007 00:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | Alawite.mp3 | 14-Apr-2007 00:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | Alawi.mp3 | 14-Apr-2007 00:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | Alava, Cape.mp3 | 14-Apr-2007 00:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | Alaska time.mp3 | 14-Apr-2007 00:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | Alaskan malamute.mp3 | 14-Apr-2007 00:46 | 12K | |
![[SND]](/icons/sound2.gif) | Alaskan.mp3 | 14-Apr-2007 00:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Alaska.mp3 | 14-Apr-2007 00:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | Alasehir.mp3 | 14-Apr-2007 00:46 | 11K | |
![[SND]](/icons/sound2.gif) | Alaric.mp3 | 14-Apr-2007 00:46 | 5.7K | |
![[SND]](/icons/sound2.gif) | Alarcon, de.mp3 | 14-Apr-2007 00:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | Alania.mp3 | 14-Apr-2007 00:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | Alamogordo.mp3 | 14-Apr-2007 00:45 | 11K | |
![[SND]](/icons/sound2.gif) | Alai.mp3 | 14-Apr-2007 00:44 | 7.3K | |
![[SND]](/icons/sound2.gif) | Alagoas.mp3 | 14-Apr-2007 00:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | Aladdin.mp3 | 14-Apr-2007 00:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | Alabamian.mp3 | 14-Apr-2007 00:43 | 10K | |
![[SND]](/icons/sound2.gif) | Alabaman.mp3 | 14-Apr-2007 00:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | Alabama.mp3 | 14-Apr-2007 00:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ala Tau.mp3 | 14-Apr-2007 00:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | Al Mukha.mp3 | 14-Apr-2007 00:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | Al Mukalla.mp3 | 14-Apr-2007 00:43 | 11K | |
![[SND]](/icons/sound2.gif) | Al Minya.mp3 | 14-Apr-2007 00:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | Al Mansurah.mp3 | 14-Apr-2007 00:43 | 9.5K | |
![[SND]](/icons/sound2.gif) | Al Kut.mp3 | 14-Apr-2007 00:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | Al Kufrah.mp3 | 14-Apr-2007 00:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | Al Khums.mp3 | 14-Apr-2007 00:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Al Jizah.mp3 | 14-Apr-2007 00:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | Al Jazirah.mp3 | 14-Apr-2007 00:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | Al Hufuf.mp3 | 14-Apr-2007 00:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | Al Hudaydah.mp3 | 14-Apr-2007 00:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | Al Hijaz.mp3 | 14-Apr-2007 00:42 | 10K | |
![[SND]](/icons/sound2.gif) | Al Fujayrah.mp3 | 14-Apr-2007 00:42 | 9.8K | |
![[SND]](/icons/sound2.gif) | Al Fayyam.mp3 | 14-Apr-2007 00:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | Al Biqa'.mp3 | 14-Apr-2007 00:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Al-Hasa.mp3 | 14-Apr-2007 01:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | Al-Basrah.mp3 | 14-Apr-2007 00:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | Al-'Aqabah.mp3 | 14-Apr-2007 00:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | Al 'Ama.rah.mp3 | 14-Apr-2007 00:42 | 10K | |
![[SND]](/icons/sound2.gif) | Akyab.mp3 | 14-Apr-2007 00:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | Akti.mp3 | 14-Apr-2007 00:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Akron.mp3 | 14-Apr-2007 00:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | Akkerman.mp3 | 14-Apr-2007 00:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | Akkadian.mp3 | 14-Apr-2007 00:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | Akkad.mp3 | 14-Apr-2007 00:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | Akita.mp3 | 14-Apr-2007 00:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | Akihito.mp3 | 14-Apr-2007 00:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | Akhisar.mp3 | 14-Apr-2007 00:41 | 10K | |
![[SND]](/icons/sound2.gif) | Akhenaton.mp3 | 14-Apr-2007 00:41 | 7.7K | |
![[SND]](/icons/sound2.gif) | Akheloos.mp3 | 14-Apr-2007 00:40 | 11K | |
![[SND]](/icons/sound2.gif) | Akerlof.mp3 | 14-Apr-2007 00:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | Akenside.mp3 | 14-Apr-2007 00:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | Akbar.mp3 | 14-Apr-2007 00:40 | 5.4K | |
![[SND]](/icons/sound2.gif) | Akan.mp3 | 14-Apr-2007 00:40 | 6.3K | |
![[SND]](/icons/sound2.gif) | Ajmer.mp3 | 14-Apr-2007 00:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | Ajax.mp3 | 14-Apr-2007 00:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | Ajaria.mp3 | 14-Apr-2007 00:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ajanta.mp3 | 14-Apr-2007 00:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | Ajaccio.mp3 | 14-Apr-2007 00:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | Aiyina.mp3 | 14-Apr-2007 00:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aix.mp3 | 14-Apr-2007 00:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | Aix-les-Bains.mp3 | 14-Apr-2007 00:39 | 9.3K | |
![[SND]](/icons/sound2.gif) | Aix-la-Chapelle.mp3 | 14-Apr-2007 00:39 | 12K | |
![[SND]](/icons/sound2.gif) | Aix-en-Provence.mp3 | 14-Apr-2007 00:39 | 14K | |
![[SND]](/icons/sound2.gif) | Aisne.mp3 | 14-Apr-2007 00:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | Airedale terrier.mp3 | 14-Apr-2007 00:36 | 10K | |
![[SND]](/icons/sound2.gif) | Aire.mp3 | 14-Apr-2007 00:36 | 6.1K | |
![[SND]](/icons/sound2.gif) | Airdrie.mp3 | 14-Apr-2007 00:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ainu.mp3 | 14-Apr-2007 00:35 | 5.4K | |
![[SND]](/icons/sound2.gif) | Aintab.mp3 | 14-Apr-2007 00:35 | 7.3K | |
![[SND]](/icons/sound2.gif) | Ainsworth.mp3 | 14-Apr-2007 00:34 | 6.8K | |
![[SND]](/icons/sound2.gif) | Ailsa Craig.mp3 | 14-Apr-2007 00:34 | 10K | |
![[SND]](/icons/sound2.gif) | Ailey.mp3 | 14-Apr-2007 00:34 | 5.4K | |
![[SND]](/icons/sound2.gif) | Aiken.mp3 | 14-Apr-2007 00:33 | 5.0K | |
![[SND]](/icons/sound2.gif) | Aibonito.mp3 | 14-Apr-2007 00:32 | 9.1K | |
![[SND]](/icons/sound2.gif) | Aias.mp3 | 14-Apr-2007 00:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | Ahwaz.mp3 | 14-Apr-2007 00:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | Ahvenanmaa.mp3 | 14-Apr-2007 00:32 | 11K | |
![[SND]](/icons/sound2.gif) | Ahvaz.mp3 | 14-Apr-2007 00:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ahura Mazda.mp3 | 14-Apr-2007 00:32 | 10K | |
![[SND]](/icons/sound2.gif) | Ahriman.mp3 | 14-Apr-2007 00:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | A horizon.mp3 | 13-Apr-2007 22:31 | 10K | |
![[SND]](/icons/sound2.gif) | Ahmed III.mp3 | 14-Apr-2007 00:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | Ahmadabad.mp3 | 14-Apr-2007 00:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | Ahern.mp3 | 14-Apr-2007 00:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | Ahaggar Mountains.mp3 | 14-Apr-2007 00:30 | 7.5K | |
![[SND]](/icons/sound2.gif) | Agulhas, Cape.mp3 | 14-Apr-2007 00:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aguinaldo.mp3 | 14-Apr-2007 00:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | Aguascalientes.mp3 | 14-Apr-2007 00:29 | 15K | |
![[SND]](/icons/sound2.gif) | Aguas Buenas.mp3 | 14-Apr-2007 00:29 | 11K | |
![[SND]](/icons/sound2.gif) | Aguadilla.mp3 | 14-Apr-2007 00:29 | 10K | |
![[SND]](/icons/sound2.gif) | Aguada.mp3 | 14-Apr-2007 00:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | Agrippina.mp3 | 14-Apr-2007 00:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | Agrippa.mp3 | 14-Apr-2007 00:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | Agrigentum.mp3 | 14-Apr-2007 00:28 | 9.5K | |
![[SND]](/icons/sound2.gif) | Agrigento.mp3 | 14-Apr-2007 00:28 | 11K | |
![[SND]](/icons/sound2.gif) | Agricola.mp3 | 14-Apr-2007 00:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | Agri Dagi.mp3 | 14-Apr-2007 00:27 | 11K | |
![[SND]](/icons/sound2.gif) | Agra.mp3 | 14-Apr-2007 00:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | Agnus Dei.mp3 | 14-Apr-2007 00:25 | 12K | |
![[SND]](/icons/sound2.gif) | Agnon.mp3 | 14-Apr-2007 00:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | Agno.mp3 | 14-Apr-2007 00:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | Agnew.mp3 | 14-Apr-2007 00:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | Agnes.mp3 | 14-Apr-2007 00:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | Agnean.mp3 | 14-Apr-2007 00:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | Aglaia.mp3 | 14-Apr-2007 00:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | Agincourt.mp3 | 14-Apr-2007 00:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | Aghrim.mp3 | 14-Apr-2007 00:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | Aggeus.mp3 | 14-Apr-2007 00:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | Aggadot.mp3 | 14-Apr-2007 00:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | Aggadah.mp3 | 14-Apr-2007 00:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | Agesilaus II.mp3 | 14-Apr-2007 00:19 | 11K | |
![[SND]](/icons/sound2.gif) | Agenois.mp3 | 14-Apr-2007 00:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Agenais.mp3 | 14-Apr-2007 00:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | Agee.mp3 | 14-Apr-2007 00:18 | 5.2K | |
![[SND]](/icons/sound2.gif) | Agawam.mp3 | 14-Apr-2007 00:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | Agathocles.mp3 | 14-Apr-2007 00:18 | 9.8K | |
![[SND]](/icons/sound2.gif) | Agate Fossil Beds National Monument.mp3 | 14-Apr-2007 00:17 | 5.5K | |
![[SND]](/icons/sound2.gif) | Agassiz.mp3 | 14-Apr-2007 00:17 | 6.4K | |
![[SND]](/icons/sound2.gif) | Agartala.mp3 | 14-Apr-2007 00:17 | 9.6K | |
![[SND]](/icons/sound2.gif) | Agana.mp3 | 14-Apr-2007 00:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | Agamemnon.mp3 | 14-Apr-2007 00:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | Agadir.mp3 | 14-Apr-2007 00:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | Agade.mp3 | 14-Apr-2007 00:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | Aga Khan III.mp3 | 14-Apr-2007 00:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | Ag.mp3 | 14-Apr-2007 00:15 | 4.8K | |
![[SND]](/icons/sound2.gif) | Afyonkarahisar.mp3 | 14-Apr-2007 00:15 | 20K | |
![[SND]](/icons/sound2.gif) | Afyon.mp3 | 14-Apr-2007 00:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | Afroed.mp3 | 14-Apr-2007 00:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | Afrocentrist.mp3 | 14-Apr-2007 00:14 | 13K | |
![[SND]](/icons/sound2.gif) | Afrocentrism.mp3 | 14-Apr-2007 00:14 | 11K | |
![[SND]](/icons/sound2.gif) | Afrocentricity.mp3 | 14-Apr-2007 00:14 | 11K | |
![[SND]](/icons/sound2.gif) | Afrocentric.mp3 | 14-Apr-2007 00:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | Afro.mp3 | 14-Apr-2007 00:13 | 5.4K | |
![[SND]](/icons/sound2.gif) | Afro-Asiatic.mp3 | 14-Apr-2007 00:14 | 11K | |
![[SND]](/icons/sound2.gif) | Afro-American.mp3 | 14-Apr-2007 00:14 | 12K | |
![[SND]](/icons/sound2.gif) | Afrikanerdom.mp3 | 14-Apr-2007 00:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | Afrikaner.mp3 | 14-Apr-2007 00:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | Afrikander.mp3 | 14-Apr-2007 00:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | Afrikaans.mp3 | 14-Apr-2007 00:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | Africanness.mp3 | 14-Apr-2007 00:13 | 9.5K | |
![[SND]](/icons/sound2.gif) | Africanize.mp3 | 14-Apr-2007 00:13 | 9.3K | |
![[SND]](/icons/sound2.gif) | Africanization.mp3 | 14-Apr-2007 00:13 | 11K | |
![[SND]](/icons/sound2.gif) | Africanist.mp3 | 14-Apr-2007 00:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | Africanism.mp3 | 14-Apr-2007 00:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | Africander.mp3 | 14-Apr-2007 00:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | Africana.mp3 | 14-Apr-2007 00:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | African.mp3 | 14-Apr-2007 00:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | African-American.mp3 | 14-Apr-2007 00:13 | 12K | |
![[SND]](/icons/sound2.gif) | Africa.mp3 | 14-Apr-2007 00:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | Afonso.mp3 | 14-Apr-2007 00:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | Afognak.mp3 | 14-Apr-2007 00:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | Afghanistan.mp3 | 14-Apr-2007 00:11 | 12K | |
![[SND]](/icons/sound2.gif) | Afghani.mp3 | 14-Apr-2007 00:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | Afghan.mp3 | 14-Apr-2007 00:11 | 6.3K | |
![[SND]](/icons/sound2.gif) | Aetolian.mp3 | 14-Apr-2007 00:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | Aetolia.mp3 | 14-Apr-2007 00:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | Aethelred.mp3 | 14-Apr-2007 00:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | Aethelberht.mp3 | 14-Apr-2007 00:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | Aesopic.mp3 | 14-Apr-2007 00:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | Aesopian.mp3 | 14-Apr-2007 00:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | Aesop.mp3 | 14-Apr-2007 00:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | Aesir.mp3 | 14-Apr-2007 00:05 | 5.7K | |
![[SND]](/icons/sound2.gif) | Aesculapian.mp3 | 14-Apr-2007 00:05 | 10K | |
![[SND]](/icons/sound2.gif) | Aeschylus.mp3 | 14-Apr-2007 00:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | Aeschylean.mp3 | 14-Apr-2007 00:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | Aeschines.mp3 | 14-Apr-2007 00:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Aeolus.mp3 | 13-Apr-2007 23:59 | 6.6K | |
![[SND]](/icons/sound2.gif) | Aeolis.mp3 | 13-Apr-2007 23:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aeolic.mp3 | 13-Apr-2007 23:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | Aeolia.mp3 | 13-Apr-2007 23:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | Aeneolithic.mp3 | 13-Apr-2007 23:59 | 11K | |
![[SND]](/icons/sound2.gif) | Aeneas.mp3 | 13-Apr-2007 23:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aemilia.mp3 | 13-Apr-2007 23:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aegospotamos.mp3 | 13-Apr-2007 23:58 | 11K | |
![[SND]](/icons/sound2.gif) | Aegospotami.mp3 | 13-Apr-2007 23:58 | 12K | |
![[SND]](/icons/sound2.gif) | Aegisthus.mp3 | 13-Apr-2007 23:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | Aeginetan.mp3 | 13-Apr-2007 23:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | Aegina.mp3 | 13-Apr-2007 23:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | Aegean Islands.mp3 | 13-Apr-2007 23:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | Aegean.mp3 | 13-Apr-2007 23:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | Aegates Islands.mp3 | 13-Apr-2007 23:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | Aedilberct.mp3 | 13-Apr-2007 23:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | Aeacus.mp3 | 13-Apr-2007 23:57 | 7.0K | |
![[SND]](/icons/sound2.gif) | Adzharian.mp3 | 13-Apr-2007 23:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | Adzhar.mp3 | 13-Apr-2007 23:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | Adygeya.mp3 | 13-Apr-2007 23:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | Adwa.mp3 | 13-Apr-2007 23:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | Adventist.mp3 | 13-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | Adventism.mp3 | 13-Apr-2007 23:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | Advent Bay.mp3 | 13-Apr-2007 23:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | Adriatic Sea.mp3 | 13-Apr-2007 23:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | Adrianople.mp3 | 13-Apr-2007 23:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | Adrian.mp3 | 13-Apr-2007 23:50 | 6.8K | |
![[SND]](/icons/sound2.gif) | Adrenalin.mp3 | 13-Apr-2007 23:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | Adour.mp3 | 13-Apr-2007 23:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | Adonis.mp3 | 13-Apr-2007 23:47 | 7.1K | |
![[SND]](/icons/sound2.gif) | Adonai.mp3 | 13-Apr-2007 23:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | Admiralty Inlet.mp3 | 13-Apr-2007 23:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | Admetus.mp3 | 13-Apr-2007 23:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Adlerian.mp3 | 13-Apr-2007 23:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | Adler.mp3 | 13-Apr-2007 23:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | Adirondack chair.mp3 | 13-Apr-2007 23:41 | 10K | |
![[SND]](/icons/sound2.gif) | Adirondack Mountains.mp3 | 13-Apr-2007 23:41 | 9.5K | |
![[SND]](/icons/sound2.gif) | Adige.mp3 | 13-Apr-2007 23:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | Adenauer.mp3 | 13-Apr-2007 23:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aden.mp3 | 13-Apr-2007 23:36 | 6.4K | |
![[SND]](/icons/sound2.gif) | Adelie penguin.mp3 | 13-Apr-2007 23:36 | 11K | |
![[SND]](/icons/sound2.gif) | Adelaide.mp3 | 13-Apr-2007 23:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ade.mp3 | 13-Apr-2007 23:36 | 5.2K | |
![[SND]](/icons/sound2.gif) | Addisonian.mp3 | 13-Apr-2007 23:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | Addison.mp3 | 13-Apr-2007 23:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | Addison's disease.mp3 | 13-Apr-2007 23:34 | 13K | |
![[SND]](/icons/sound2.gif) | Addis Ababa.mp3 | 13-Apr-2007 23:34 | 12K | |
![[SND]](/icons/sound2.gif) | Addams.mp3 | 13-Apr-2007 23:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | Adar Sheni.mp3 | 13-Apr-2007 23:33 | 11K | |
![[SND]](/icons/sound2.gif) | Adar Rishon.mp3 | 13-Apr-2007 23:33 | 12K | |
![[SND]](/icons/sound2.gif) | Adar.mp3 | 13-Apr-2007 23:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | Adapazari.mp3 | 13-Apr-2007 23:32 | 10K | |
![[SND]](/icons/sound2.gif) | Adana.mp3 | 13-Apr-2007 23:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | Adams.mp3 | 13-Apr-2007 23:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | Adams, Mount.mp3 | 13-Apr-2007 23:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | Adamical.mp3 | 13-Apr-2007 23:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | Adamic.mp3 | 13-Apr-2007 23:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | Adam.mp3 | 13-Apr-2007 23:31 | 5.0K | |
![[SND]](/icons/sound2.gif) | Adam's Bridge.mp3 | 13-Apr-2007 23:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | Adalia.mp3 | 13-Apr-2007 23:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | Adak.mp3 | 13-Apr-2007 23:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | Ada.mp3 | 13-Apr-2007 23:31 | 4.5K | |
![[SND]](/icons/sound2.gif) | Ad Dammam.mp3 | 13-Apr-2007 23:30 | 11K | |
![[SND]](/icons/sound2.gif) | Acts.mp3 | 13-Apr-2007 23:28 | 5.4K | |
![[SND]](/icons/sound2.gif) | Acton.mp3 | 13-Apr-2007 23:27 | 5.7K | |
![[SND]](/icons/sound2.gif) | Actium.mp3 | 13-Apr-2007 23:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Acte.mp3 | 13-Apr-2007 23:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | Actaeon.mp3 | 13-Apr-2007 23:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | Acragas.mp3 | 13-Apr-2007 23:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | Acores.mp3 | 13-Apr-2007 23:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | Aconcagua.mp3 | 13-Apr-2007 23:18 | 11K | |
![[SND]](/icons/sound2.gif) | Acoka.mp3 | 13-Apr-2007 23:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | Achray, Loch.mp3 | 13-Apr-2007 23:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | Achilles.mp3 | 13-Apr-2007 23:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | Achill.mp3 | 13-Apr-2007 23:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | Acheulian.mp3 | 13-Apr-2007 23:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | Acheulean.mp3 | 13-Apr-2007 23:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | Acheson.mp3 | 13-Apr-2007 23:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | Acheron.mp3 | 13-Apr-2007 23:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | Achelous.mp3 | 13-Apr-2007 23:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | Achates.mp3 | 13-Apr-2007 23:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | Achaian.mp3 | 13-Apr-2007 23:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | Achaia.mp3 | 13-Apr-2007 23:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | Achaemenidae.mp3 | 13-Apr-2007 23:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | Achaemenid.mp3 | 13-Apr-2007 23:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | Achaemenian.mp3 | 13-Apr-2007 23:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | Achaean.mp3 | 13-Apr-2007 23:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | Achaea.mp3 | 13-Apr-2007 23:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | Aceldama.mp3 | 13-Apr-2007 23:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | Accrington.mp3 | 13-Apr-2007 23:05 | 9.3K | |
![[SND]](/icons/sound2.gif) | Accra.mp3 | 13-Apr-2007 23:05 | 5.9K | |
![[SND]](/icons/sound2.gif) | Accho.mp3 | 13-Apr-2007 23:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | Accadian.mp3 | 13-Apr-2007 22:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | Accad.mp3 | 13-Apr-2007 22:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | Acarnanian.mp3 | 13-Apr-2007 22:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | Acarnania.mp3 | 13-Apr-2007 22:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | Acapulco de Juarez.mp3 | 13-Apr-2007 22:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | Acapulco.mp3 | 13-Apr-2007 22:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | Acadie.mp3 | 13-Apr-2007 22:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | Acadian.mp3 | 13-Apr-2007 22:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | Acadia.mp3 | 13-Apr-2007 22:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | Abzug.mp3 | 13-Apr-2007 22:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | Abyssinian.mp3 | 13-Apr-2007 22:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | Abyssinia.mp3 | 13-Apr-2007 22:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | Abyla.mp3 | 13-Apr-2007 22:55 | 5.7K | |
![[SND]](/icons/sound2.gif) | Abydos.mp3 | 13-Apr-2007 22:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | Abumeron.mp3 | 13-Apr-2007 22:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | Abul Kasim.mp3 | 13-Apr-2007 22:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | Abuja.mp3 | 13-Apr-2007 22:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | Abu Simbel.mp3 | 13-Apr-2007 22:54 | 10K | |
![[SND]](/icons/sound2.gif) | Abu Qir.mp3 | 13-Apr-2007 22:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | Abu Dhabi.mp3 | 13-Apr-2007 22:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | Absecon Inlet.mp3 | 13-Apr-2007 22:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | Absaroka Range.mp3 | 13-Apr-2007 22:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | Abruzzi.mp3 | 13-Apr-2007 22:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | Abraham.mp3 | 13-Apr-2007 22:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | Abomey.mp3 | 13-Apr-2007 22:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | Abnaki.mp3 | 13-Apr-2007 22:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Abkhazian.mp3 | 13-Apr-2007 22:43 | 10K | |
![[SND]](/icons/sound2.gif) | Abkhazia.mp3 | 13-Apr-2007 22:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | Abkhas.mp3 | 13-Apr-2007 22:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | Abitibi.mp3 | 13-Apr-2007 22:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | Abington.mp3 | 13-Apr-2007 22:41 | 6.6K | |
![[SND]](/icons/sound2.gif) | Abilene.mp3 | 13-Apr-2007 22:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | Abidjan.mp3 | 13-Apr-2007 22:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | Abib.mp3 | 13-Apr-2007 22:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aberystwyth.mp3 | 13-Apr-2007 22:40 | 10K | |
![[SND]](/icons/sound2.gif) | Abernathy.mp3 | 13-Apr-2007 22:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aberdonian.mp3 | 13-Apr-2007 22:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | Aberdeenshire.mp3 | 13-Apr-2007 22:39 | 12K | |
![[SND]](/icons/sound2.gif) | Aberdeen Angus.mp3 | 13-Apr-2007 22:39 | 13K | |
![[SND]](/icons/sound2.gif) | Aberdeen.mp3 | 13-Apr-2007 22:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | Aberdare.mp3 | 13-Apr-2007 22:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | Abercromby.mp3 | 13-Apr-2007 22:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | Abenaki.mp3 | 13-Apr-2007 22:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | Abelard.mp3 | 13-Apr-2007 22:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | Abel.mp3 | 13-Apr-2007 22:39 | 4.5K | |
![[SND]](/icons/sound2.gif) | Abdulmecid I.mp3 | 13-Apr-2007 22:38 | 11K | |
![[SND]](/icons/sound2.gif) | Abdullah I.mp3 | 13-Apr-2007 22:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | Abdulhamad II.mp3 | 13-Apr-2007 22:38 | 10K | |
![[SND]](/icons/sound2.gif) | Abdulaziz.mp3 | 13-Apr-2007 22:38 | 12K | |
![[SND]](/icons/sound2.gif) | Abdias.mp3 | 13-Apr-2007 22:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | Abdelkader.mp3 | 13-Apr-2007 22:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | Abd al-Qa.dir.mp3 | 13-Apr-2007 22:37 | 9.5K | |
![[SND]](/icons/sound2.gif) | Abbott.mp3 | 13-Apr-2007 22:36 | 4.6K | |
![[SND]](/icons/sound2.gif) | Abbotsford.mp3 | 13-Apr-2007 22:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | Abbevillian.mp3 | 13-Apr-2007 22:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | Abbeville.mp3 | 13-Apr-2007 22:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | Abbasid.mp3 | 13-Apr-2007 22:36 | 6.6K | |
![[SND]](/icons/sound2.gif) | Abbai.mp3 | 13-Apr-2007 22:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | Abakan.mp3 | 13-Apr-2007 22:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | Abadan.mp3 | 13-Apr-2007 22:34 | 9.5K | |
![[SND]](/icons/sound2.gif) | Abaco.mp3 | 13-Apr-2007 22:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aba Bakr.mp3 | 13-Apr-2007 22:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | Aaronic.mp3 | 13-Apr-2007 22:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | Aaron.mp3 | 13-Apr-2007 22:33 | 5.5K | |
![[SND]](/icons/sound2.gif) | Aarhus.mp3 | 13-Apr-2007 22:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | Aargau.mp3 | 13-Apr-2007 22:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | Aare.mp3 | 13-Apr-2007 22:33 | 5.4K | |
![[SND]](/icons/sound2.gif) | Aarau.mp3 | 13-Apr-2007 22:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | Aar.mp3 | 13-Apr-2007 22:32 | 5.9K | |
![[SND]](/icons/sound2.gif) | Aalst.mp3 | 13-Apr-2007 22:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | Aalborg.mp3 | 13-Apr-2007 22:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | Aaiun, El.mp3 | 13-Apr-2007 22:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | Aaien, El.mp3 | 13-Apr-2007 22:32 | 9.5K | |
![[SND]](/icons/sound2.gif) | Aachen.mp3 | 13-Apr-2007 22:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | APL.mp3 | 14-Apr-2007 03:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | APC.mp3 | 14-Apr-2007 03:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | AMP.mp3 | 14-Apr-2007 01:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | AK-47.mp3 | 14-Apr-2007 00:39 | 12K | |
![[SND]](/icons/sound2.gif) | ADP.mp3 | 13-Apr-2007 23:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | ACTH.mp3 | 13-Apr-2007 23:24 | 11K | |
![[SND]](/icons/sound2.gif) | ACL.mp3 | 13-Apr-2007 23:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | ACE inhibitor.mp3 | 13-Apr-2007 23:07 | 13K | |
![[SND]](/icons/sound2.gif) | ABS.mp3 | 13-Apr-2007 22:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | ABO system.mp3 | 13-Apr-2007 22:45 | 12K | |
![[SND]](/icons/sound2.gif) | ABO blood group.mp3 | 13-Apr-2007 22:45 | 14K | |
![[SND]](/icons/sound2.gif) | ABMs.mp3 | 13-Apr-2007 22:44 | 9.3K | |
![[SND]](/icons/sound2.gif) | ABM.mp3 | 13-Apr-2007 22:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | ABD.mp3 | 13-Apr-2007 22:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | ABCs.mp3 | 13-Apr-2007 22:37 | 10K | |
![[SND]](/icons/sound2.gif) | ABC.mp3 | 13-Apr-2007 22:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | A1.mp3 | 13-Apr-2007 22:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | A-ni-ma-ch'ing.mp3 | 14-Apr-2007 02:32 | 13K | |
![[SND]](/icons/sound2.gif) | A-list.mp3 | 14-Apr-2007 01:07 | 5.7K | |
![[SND]](/icons/sound2.gif) | A-line.mp3 | 14-Apr-2007 01:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | A-frame.mp3 | 14-Apr-2007 00:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | A-bomb.mp3 | 13-Apr-2007 22:46 | 6.6K | |
![[SND]](/icons/sound2.gif) | A-OK.mp3 | 14-Apr-2007 03:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | A'nyemaqen.mp3 | 14-Apr-2007 03:11 | 13K | |
|