![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | Rzeszow.mp3 | 20-Apr-2007 14:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | ryvita.mp3 | 20-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | Ryukyuan.mp3 | 20-Apr-2007 14:31 | 11K | |
![[SND]](/icons/sound2.gif) | ryukyu.mp3 | 20-Apr-2007 14:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | Ryukyu Islands.mp3 | 20-Apr-2007 14:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | ryswick.mp3 | 20-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | ryotwari.mp3 | 20-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | ryot.mp3 | 20-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | rynok.mp3 | 20-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | rynd.mp3 | 20-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | ryle.mp3 | 20-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | rykiel.mp3 | 20-Apr-2007 14:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | ryeland.mp3 | 20-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | ryegrass.mp3 | 20-Apr-2007 14:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | rye.mp3 | 20-Apr-2007 14:31 | 5.2K | |
![[SND]](/icons/sound2.gif) | Rydz-Smigly.mp3 | 20-Apr-2007 14:31 | 11K | |
![[SND]](/icons/sound2.gif) | rydercup.mp3 | 20-Apr-2007 14:31 | 17K | |
![[SND]](/icons/sound2.gif) | Ryder.mp3 | 20-Apr-2007 14:31 | 5.5K | |
![[SND]](/icons/sound2.gif) | rydberg.mp3 | 20-Apr-2007 14:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | rydal.mp3 | 20-Apr-2007 14:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rybnik.mp3 | 20-Apr-2007 14:30 | 5.9K | |
![[SND]](/icons/sound2.gif) | Rybinsk.mp3 | 20-Apr-2007 14:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ryazan'.mp3 | 20-Apr-2007 14:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | ryazan.mp3 | 20-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | Ryan.mp3 | 20-Apr-2007 14:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | ryal.mp3 | 20-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | rya.mp3 | 20-Apr-2007 14:30 | 5.0K | |
![[SND]](/icons/sound2.gif) | ry.mp3 | 20-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rx.mp3 | 20-Apr-2007 14:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rwandese.mp3 | 20-Apr-2007 14:30 | 10K | |
![[SND]](/icons/sound2.gif) | Rwandan.mp3 | 20-Apr-2007 14:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rwanda.mp3 | 20-Apr-2007 14:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | R-value.mp3 | 20-Apr-2007 14:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | RV.mp3 | 20-Apr-2007 14:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | Ruzicka.mp3 | 20-Apr-2007 14:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | ruyter.mp3 | 20-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ruysdael.mp3 | 20-Apr-2007 14:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | ruylopez.mp3 | 20-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | rux.mp3 | 20-Apr-2007 14:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ruwenzori.mp3 | 20-Apr-2007 14:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | ruvuma.mp3 | 20-Apr-2007 14:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | ruvokale.mp3 | 20-Apr-2007 14:30 | 17K | |
![[SND]](/icons/sound2.gif) | rutty.mp3 | 20-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruttish.mp3 | 20-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | rutter.mp3 | 20-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | rutted.mp3 | 20-Apr-2007 14:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | rutledge.mp3 | 20-Apr-2007 14:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rutlandshire.mp3 | 20-Apr-2007 14:29 | 9.8K | |
![[SND]](/icons/sound2.gif) | Rutland.mp3 | 20-Apr-2007 14:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | rutin.mp3 | 20-Apr-2007 14:29 | 5.2K | |
![[SND]](/icons/sound2.gif) | rutile.mp3 | 20-Apr-2007 14:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | rutilated.mp3 | 20-Apr-2007 14:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | rutilant.mp3 | 20-Apr-2007 14:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | ruthless.mp3 | 20-Apr-2007 14:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ruthian.mp3 | 20-Apr-2007 14:29 | 6.6K | |
![[SND]](/icons/sound2.gif) | ruthfully.mp3 | 20-Apr-2007 14:29 | 7.0K | |
![[SND]](/icons/sound2.gif) | ruthful.mp3 | 20-Apr-2007 14:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | rutherfordium.mp3 | 20-Apr-2007 14:29 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rutherford.mp3 | 20-Apr-2007 14:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | ruthenium.mp3 | 20-Apr-2007 14:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | ruthenious.mp3 | 20-Apr-2007 14:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | ruthenic.mp3 | 20-Apr-2007 14:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ruthenian.mp3 | 20-Apr-2007 14:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | ruthenia.mp3 | 20-Apr-2007 14:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Ruthene.mp3 | 20-Apr-2007 14:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | ruth.mp3 | 20-Apr-2007 14:29 | 4.8K | |
![[SND]](/icons/sound2.gif) | rutgers.mp3 | 20-Apr-2007 14:29 | 17K | |
![[SND]](/icons/sound2.gif) | rutaceous.mp3 | 20-Apr-2007 14:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | rutabaga.mp3 | 20-Apr-2007 14:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | rut.mp3 | 20-Apr-2007 14:29 | 4.3K | |
![[SND]](/icons/sound2.gif) | rusty.mp3 | 20-Apr-2007 14:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | rustre.mp3 | 20-Apr-2007 14:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | rustproof.mp3 | 20-Apr-2007 14:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | ruston.mp3 | 20-Apr-2007 14:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | rustling.mp3 | 20-Apr-2007 14:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | rustless.mp3 | 20-Apr-2007 14:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | rustler.mp3 | 20-Apr-2007 14:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | rustle.mp3 | 20-Apr-2007 14:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | rustiness.mp3 | 20-Apr-2007 14:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rustin.mp3 | 20-Apr-2007 14:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | rustily.mp3 | 20-Apr-2007 14:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | rusticity.mp3 | 20-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | rusticator.mp3 | 20-Apr-2007 14:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | rustication.mp3 | 20-Apr-2007 14:28 | 9.6K | |
![[SND]](/icons/sound2.gif) | rusticating.mp3 | 20-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | rusticate.mp3 | 20-Apr-2007 14:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | rustically.mp3 | 20-Apr-2007 14:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | rustical.mp3 | 20-Apr-2007 14:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | rustic.mp3 | 20-Apr-2007 14:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | rustavi.mp3 | 20-Apr-2007 14:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | rust.mp3 | 20-Apr-2007 14:28 | 5.5K | |
![[SND]](/icons/sound2.gif) | russwurm.mp3 | 20-Apr-2007 14:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | russula.mp3 | 20-Apr-2007 14:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | russophobe.mp3 | 20-Apr-2007 14:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | russophile.mp3 | 20-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | Russo-.mp3 | 20-Apr-2007 14:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | russo.mp3 | 20-Apr-2007 14:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | russniak.mp3 | 20-Apr-2007 14:28 | 17K | |
![[SND]](/icons/sound2.gif) | Russky.mp3 | 20-Apr-2007 14:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | Russki.mp3 | 20-Apr-2007 14:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | Russify.mp3 | 20-Apr-2007 14:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | Russification.mp3 | 20-Apr-2007 14:28 | 11K | |
![[SND]](/icons/sound2.gif) | Russianness.mp3 | 20-Apr-2007 14:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | Russianize.mp3 | 20-Apr-2007 14:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | Russianization.mp3 | 20-Apr-2007 14:27 | 10K | |
![[SND]](/icons/sound2.gif) | Russian.mp3 | 20-Apr-2007 14:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | Russia.mp3 | 20-Apr-2007 14:27 | 5.7K | |
![[SND]](/icons/sound2.gif) | Russia leather.mp3 | 20-Apr-2007 14:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | russetting.mp3 | 20-Apr-2007 14:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | russeting.mp3 | 20-Apr-2007 14:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | russet.mp3 | 20-Apr-2007 14:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | Russellville.mp3 | 20-Apr-2007 14:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | russellite.mp3 | 20-Apr-2007 14:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | Russell.mp3 | 20-Apr-2007 14:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | Russell Cave National Monument.mp3 | 20-Apr-2007 14:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | russboroughhouse.mp3 | 20-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | Russ.mp3 | 20-Apr-2007 14:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | Ruskinian.mp3 | 20-Apr-2007 14:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | Ruskin.mp3 | 20-Apr-2007 14:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | Ruska.mp3 | 20-Apr-2007 14:27 | 5.7K | |
![[SND]](/icons/sound2.gif) | rusk.mp3 | 20-Apr-2007 14:27 | 5.9K | |
![[SND]](/icons/sound2.gif) | rusinurbe.mp3 | 20-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | rusineantler.mp3 | 20-Apr-2007 14:27 | 17K | |
![[SND]](/icons/sound2.gif) | rushy.mp3 | 20-Apr-2007 14:27 | 5.7K | |
![[SND]](/icons/sound2.gif) | rushmore.mp3 | 20-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rushmore, Mount.mp3 | 20-Apr-2007 14:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | rushlight.mp3 | 20-Apr-2007 14:27 | 8.0K | |
![[SND]](/icons/sound2.gif) | rushing.mp3 | 20-Apr-2007 14:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | rusher.mp3 | 20-Apr-2007 14:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | rushen.mp3 | 20-Apr-2007 14:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | rushee.mp3 | 20-Apr-2007 14:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | Rushdie.mp3 | 20-Apr-2007 14:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | rush.mp3 | 20-Apr-2007 14:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | rusedeguerre.mp3 | 20-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | ruse.mp3 | 20-Apr-2007 14:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | ruse de guerre.mp3 | 20-Apr-2007 14:26 | 12K | |
![[SND]](/icons/sound2.gif) | Ruschuk.mp3 | 20-Apr-2007 14:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | rusa.mp3 | 20-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | rus in urbe.mp3 | 20-Apr-2007 14:26 | 10K | |
![[SND]](/icons/sound2.gif) | ruru.mp3 | 20-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | rurp.mp3 | 20-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ruritanian.mp3 | 20-Apr-2007 14:26 | 9.1K | |
![[SND]](/icons/sound2.gif) | ruritania.mp3 | 20-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | Ruritan.mp3 | 20-Apr-2007 14:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | rurik.mp3 | 20-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruridecanal.mp3 | 20-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | rurban.mp3 | 20-Apr-2007 14:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | rurally.mp3 | 20-Apr-2007 14:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | ruralize.mp3 | 20-Apr-2007 14:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | rurality.mp3 | 20-Apr-2007 14:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | ruralist.mp3 | 20-Apr-2007 14:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | ruralism.mp3 | 20-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | rural.mp3 | 20-Apr-2007 14:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | rupturing.mp3 | 20-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | rupture.mp3 | 20-Apr-2007 14:26 | 6.1K | |
![[SND]](/icons/sound2.gif) | ruppie.mp3 | 20-Apr-2007 14:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | rupicolous.mp3 | 20-Apr-2007 14:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | rupiah.mp3 | 20-Apr-2007 14:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | rupestrine.mp3 | 20-Apr-2007 14:26 | 17K | |
![[SND]](/icons/sound2.gif) | Rupert.mp3 | 20-Apr-2007 14:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | rupee.mp3 | 20-Apr-2007 14:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | Runyonesque.mp3 | 20-Apr-2007 14:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | Runyon.mp3 | 20-Apr-2007 14:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | runway.mp3 | 20-Apr-2007 14:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | run-up.mp3 | 20-Apr-2007 14:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | runty.mp3 | 20-Apr-2007 14:25 | 5.0K | |
![[SND]](/icons/sound2.gif) | runtish.mp3 | 20-Apr-2007 14:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | runtiness.mp3 | 20-Apr-2007 14:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | run-through.mp3 | 20-Apr-2007 14:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | runt.mp3 | 20-Apr-2007 14:25 | 5.0K | |
![[SND]](/icons/sound2.gif) | run-over.mp3 | 20-Apr-2007 14:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | runover.mp3 | 20-Apr-2007 14:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | run-on.mp3 | 20-Apr-2007 14:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | run-of-the-mine.mp3 | 20-Apr-2007 14:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | run-of-the-mill.mp3 | 20-Apr-2007 14:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | run-of-paper.mp3 | 20-Apr-2007 14:25 | 9.3K | |
![[SND]](/icons/sound2.gif) | run-of-mine.mp3 | 20-Apr-2007 14:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | runoff.mp3 | 20-Apr-2007 14:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | Runnymede.mp3 | 20-Apr-2007 14:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | runny.mp3 | 20-Apr-2007 14:25 | 5.2K | |
![[SND]](/icons/sound2.gif) | running.mp3 | 20-Apr-2007 14:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | runner-up.mp3 | 20-Apr-2007 14:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | runners-up.mp3 | 20-Apr-2007 14:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | runner.mp3 | 20-Apr-2007 14:25 | 5.2K | |
![[SND]](/icons/sound2.gif) | runnel.mp3 | 20-Apr-2007 14:25 | 4.8K | |
![[SND]](/icons/sound2.gif) | runnable.mp3 | 20-Apr-2007 14:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | runlet.mp3 | 20-Apr-2007 14:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | runless.mp3 | 20-Apr-2007 14:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | runkle.mp3 | 20-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | run-in.mp3 | 20-Apr-2007 14:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | runic.mp3 | 20-Apr-2007 14:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | rungekuttamethod.mp3 | 20-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | rung.mp3 | 20-Apr-2007 14:24 | 5.9K | |
![[SND]](/icons/sound2.gif) | runesmith.mp3 | 20-Apr-2007 14:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | runed.mp3 | 20-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | Runeberg.mp3 | 20-Apr-2007 14:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | rune.mp3 | 20-Apr-2007 14:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | Rundstedt.mp3 | 20-Apr-2007 14:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | run-down.mp3 | 20-Apr-2007 14:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | rundown.mp3 | 20-Apr-2007 14:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | rundlet.mp3 | 20-Apr-2007 14:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | rundle.mp3 | 20-Apr-2007 14:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | rundi.mp3 | 20-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | rundale.mp3 | 20-Apr-2007 14:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | runcinate.mp3 | 20-Apr-2007 14:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | Runcie.mp3 | 20-Apr-2007 14:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | runciblespoon.mp3 | 20-Apr-2007 14:24 | 17K | |
![[SND]](/icons/sound2.gif) | runcible spoon.mp3 | 20-Apr-2007 14:24 | 12K | |
![[SND]](/icons/sound2.gif) | runback.mp3 | 20-Apr-2007 14:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | runaway.mp3 | 20-Apr-2007 14:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | runaround.mp3 | 20-Apr-2007 14:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | runagate.mp3 | 20-Apr-2007 14:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | runabout.mp3 | 20-Apr-2007 14:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | run.mp3 | 20-Apr-2007 14:24 | 5.4K | |
![[SND]](/icons/sound2.gif) | Rumsfeld.mp3 | 20-Apr-2007 14:24 | 11K | |
![[SND]](/icons/sound2.gif) | rum-running.mp3 | 20-Apr-2007 14:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | rumrunner.mp3 | 20-Apr-2007 14:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | rumpy.mp3 | 20-Apr-2007 14:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | rumpus.mp3 | 20-Apr-2007 14:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | rumpranger.mp3 | 20-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | rumpo.mp3 | 20-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | rumply.mp3 | 20-Apr-2007 14:23 | 6.1K | |
![[SND]](/icons/sound2.gif) | rumpling.mp3 | 20-Apr-2007 14:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | rumpless.mp3 | 20-Apr-2007 14:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | rumple.mp3 | 20-Apr-2007 14:23 | 5.7K | |
![[SND]](/icons/sound2.gif) | rumpie.mp3 | 20-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | rumpf.mp3 | 20-Apr-2007 14:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | rumpelstiltskin.mp3 | 20-Apr-2007 14:23 | 17K | |
![[SND]](/icons/sound2.gif) | rump.mp3 | 20-Apr-2007 14:23 | 4.8K | |
![[SND]](/icons/sound2.gif) | rumour.mp3 | 20-Apr-2007 14:23 | 5.5K | |
![[SND]](/icons/sound2.gif) | rumormongering.mp3 | 20-Apr-2007 14:23 | 10K | |
![[SND]](/icons/sound2.gif) | rumormonger.mp3 | 20-Apr-2007 14:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | rumor.mp3 | 20-Apr-2007 14:23 | 6.1K | |
![[SND]](/icons/sound2.gif) | rummy.mp3 | 20-Apr-2007 14:23 | 5.2K | |
![[SND]](/icons/sound2.gif) | rummidge.mp3 | 20-Apr-2007 14:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | rummer.mp3 | 20-Apr-2007 14:23 | 5.2K | |
![[SND]](/icons/sound2.gif) | rummed.mp3 | 20-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | rummage.mp3 | 20-Apr-2007 14:23 | 5.7K | |
![[SND]](/icons/sound2.gif) | ruminator.mp3 | 20-Apr-2007 14:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruminative.mp3 | 20-Apr-2007 14:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | rumination.mp3 | 20-Apr-2007 14:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | ruminate.mp3 | 20-Apr-2007 14:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | ruminant.mp3 | 20-Apr-2007 14:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | ruminal.mp3 | 20-Apr-2007 14:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | rumina.mp3 | 20-Apr-2007 14:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | rumford.mp3 | 20-Apr-2007 14:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | rumen.mp3 | 20-Apr-2007 14:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | Rumelia.mp3 | 20-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | rumdum.mp3 | 20-Apr-2007 14:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | rumbustious.mp3 | 20-Apr-2007 14:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | rumbustical.mp3 | 20-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | rumbly.mp3 | 20-Apr-2007 14:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | rumbling.mp3 | 20-Apr-2007 14:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | rumbler.mp3 | 20-Apr-2007 14:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | rumble.mp3 | 20-Apr-2007 14:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | rumba.mp3 | 20-Apr-2007 14:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | rumansh.mp3 | 20-Apr-2007 14:22 | 17K | |
![[SND]](/icons/sound2.gif) | rumanite.mp3 | 20-Apr-2007 14:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rumanian.mp3 | 20-Apr-2007 14:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rumania.mp3 | 20-Apr-2007 14:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | rumal.mp3 | 20-Apr-2007 14:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | rumaki.mp3 | 20-Apr-2007 14:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | rum.mp3 | 20-Apr-2007 14:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | ruly.mp3 | 20-Apr-2007 14:22 | 5.9K | |
![[SND]](/icons/sound2.gif) | rulley.mp3 | 20-Apr-2007 14:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruling.mp3 | 20-Apr-2007 14:22 | 6.4K | |
![[SND]](/icons/sound2.gif) | rulership.mp3 | 20-Apr-2007 14:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | ruler.mp3 | 20-Apr-2007 14:22 | 5.4K | |
![[SND]](/icons/sound2.gif) | ruleless.mp3 | 20-Apr-2007 14:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | rule.mp3 | 20-Apr-2007 14:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | rulable.mp3 | 20-Apr-2007 14:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | rukeyser.mp3 | 20-Apr-2007 14:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ruislip Northwood.mp3 | 20-Apr-2007 14:21 | 15K | |
![[SND]](/icons/sound2.gif) | ruisdael.mp3 | 20-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | ruinous.mp3 | 20-Apr-2007 14:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | ruined.mp3 | 20-Apr-2007 14:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | ruination.mp3 | 20-Apr-2007 14:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | ruinate.mp3 | 20-Apr-2007 14:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | ruin.mp3 | 20-Apr-2007 14:21 | 5.7K | |
![[SND]](/icons/sound2.gif) | Ruhr.mp3 | 20-Apr-2007 14:21 | 5.7K | |
![[SND]](/icons/sound2.gif) | ruhmkorffcoil.mp3 | 20-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | rugulose.mp3 | 20-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | rugula.mp3 | 20-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | rugous.mp3 | 20-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | rugosity.mp3 | 20-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | rugose.mp3 | 20-Apr-2007 14:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | rugosarose.mp3 | 20-Apr-2007 14:21 | 17K | |
![[SND]](/icons/sound2.gif) | rugosa rose.mp3 | 20-Apr-2007 14:21 | 12K | |
![[SND]](/icons/sound2.gif) | rugola.mp3 | 20-Apr-2007 14:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | rugging.mp3 | 20-Apr-2007 14:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | rugger.mp3 | 20-Apr-2007 14:21 | 5.7K | |
![[SND]](/icons/sound2.gif) | ruggedize.mp3 | 20-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | ruggedization.mp3 | 20-Apr-2007 14:21 | 10K | |
![[SND]](/icons/sound2.gif) | rugged.mp3 | 20-Apr-2007 14:21 | 5.5K | |
![[SND]](/icons/sound2.gif) | Rugen.mp3 | 20-Apr-2007 14:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | rugby.mp3 | 20-Apr-2007 14:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | rugbeian.mp3 | 20-Apr-2007 14:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | rugate.mp3 | 20-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | rugalach.mp3 | 20-Apr-2007 14:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | rugae.mp3 | 20-Apr-2007 14:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | ruga.mp3 | 20-Apr-2007 14:20 | 5.7K | |
![[SND]](/icons/sound2.gif) | rug.mp3 | 20-Apr-2007 14:20 | 5.0K | |
![[SND]](/icons/sound2.gif) | rufus.mp3 | 20-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | rufterhood.mp3 | 20-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | rufous.mp3 | 20-Apr-2007 14:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | rufiyaa.mp3 | 20-Apr-2007 14:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | Rufisque.mp3 | 20-Apr-2007 14:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | ruffly.mp3 | 20-Apr-2007 14:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | ruffling.mp3 | 20-Apr-2007 14:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | ruffler.mp3 | 20-Apr-2007 14:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | ruffled.mp3 | 20-Apr-2007 14:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | ruffle.mp3 | 20-Apr-2007 14:20 | 5.7K | |
![[SND]](/icons/sound2.gif) | ruffiniscorpuscle.mp3 | 20-Apr-2007 14:20 | 17K | |
![[SND]](/icons/sound2.gif) | ruffianly.mp3 | 20-Apr-2007 14:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | ruffianism.mp3 | 20-Apr-2007 14:20 | 9.1K | |
![[SND]](/icons/sound2.gif) | ruffian.mp3 | 20-Apr-2007 14:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | ruffed.mp3 | 20-Apr-2007 14:20 | 5.2K | |
![[SND]](/icons/sound2.gif) | ruffe.mp3 | 20-Apr-2007 14:20 | 5.2K | |
![[SND]](/icons/sound2.gif) | ruff.mp3 | 20-Apr-2007 14:20 | 5.2K | |
![[SND]](/icons/sound2.gif) | rufescent.mp3 | 20-Apr-2007 14:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | rufen.mp3 | 20-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruf.mp3 | 20-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruefully.mp3 | 20-Apr-2007 14:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | rueful.mp3 | 20-Apr-2007 14:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | rue.mp3 | 20-Apr-2007 14:20 | 4.8K | |
![[SND]](/icons/sound2.gif) | rudyard.mp3 | 20-Apr-2007 14:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | rudy.mp3 | 20-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | rudra.mp3 | 20-Apr-2007 14:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | rudolph.mp3 | 20-Apr-2007 14:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | rudolfi.mp3 | 20-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | Rudolf.mp3 | 20-Apr-2007 14:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | rudny.mp3 | 20-Apr-2007 14:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | rudish.mp3 | 20-Apr-2007 14:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | rudin.mp3 | 20-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | rudimentary.mp3 | 20-Apr-2007 14:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | rudimentariness.mp3 | 20-Apr-2007 14:19 | 11K | |
![[SND]](/icons/sound2.gif) | rudimentarily.mp3 | 20-Apr-2007 14:19 | 11K | |
![[SND]](/icons/sound2.gif) | rudimental.mp3 | 20-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | rudiment.mp3 | 20-Apr-2007 14:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | rudie.mp3 | 20-Apr-2007 14:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | rudesheimer.mp3 | 20-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | rudesby.mp3 | 20-Apr-2007 14:19 | 17K | |
![[SND]](/icons/sound2.gif) | ruderal.mp3 | 20-Apr-2007 14:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | rude.mp3 | 20-Apr-2007 14:19 | 5.5K | |
![[SND]](/icons/sound2.gif) | ruddy.mp3 | 20-Apr-2007 14:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | ruddock.mp3 | 20-Apr-2007 14:19 | 5.5K | |
![[SND]](/icons/sound2.gif) | ruddling.mp3 | 20-Apr-2007 14:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | ruddleman.mp3 | 20-Apr-2007 14:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | ruddle.mp3 | 20-Apr-2007 14:19 | 4.8K | |
![[SND]](/icons/sound2.gif) | ruddiness.mp3 | 20-Apr-2007 14:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | ruddily.mp3 | 20-Apr-2007 14:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | ruddevator.mp3 | 20-Apr-2007 14:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | rudderpost.mp3 | 20-Apr-2007 14:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | rudderless.mp3 | 20-Apr-2007 14:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | rudder.mp3 | 20-Apr-2007 14:19 | 5.2K | |
![[SND]](/icons/sound2.gif) | rudd.mp3 | 20-Apr-2007 14:19 | 5.2K | |
![[SND]](/icons/sound2.gif) | rudbeckia.mp3 | 20-Apr-2007 14:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | rudaslska.mp3 | 20-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | rudaceous.mp3 | 20-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | Ruda Slaska.mp3 | 20-Apr-2007 14:18 | 12K | |
![[SND]](/icons/sound2.gif) | rucus.mp3 | 20-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | ructious.mp3 | 20-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | ruction.mp3 | 20-Apr-2007 14:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | ruckus.mp3 | 20-Apr-2007 14:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | rucksack.mp3 | 20-Apr-2007 14:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | ruckle.mp3 | 20-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruck.mp3 | 20-Apr-2007 14:18 | 4.1K | |
![[SND]](/icons/sound2.gif) | ruching.mp3 | 20-Apr-2007 14:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | ruched.mp3 | 20-Apr-2007 14:18 | 5.7K | |
![[SND]](/icons/sound2.gif) | ruche.mp3 | 20-Apr-2007 14:18 | 5.2K | |
![[SND]](/icons/sound2.gif) | ruby-throated hummingbird.mp3 | 20-Apr-2007 14:18 | 15K | |
![[SND]](/icons/sound2.gif) | rubythroat.mp3 | 20-Apr-2007 14:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | ruby.mp3 | 20-Apr-2007 14:18 | 5.5K | |
![[SND]](/icons/sound2.gif) | rubus.mp3 | 20-Apr-2007 14:18 | 6.4K | |
![[SND]](/icons/sound2.gif) | ruburbia.mp3 | 20-Apr-2007 14:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | ruburbanite.mp3 | 20-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | ruburb.mp3 | 20-Apr-2007 14:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | rubtsovsk.mp3 | 20-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | rubrumlily.mp3 | 20-Apr-2007 14:18 | 17K | |
![[SND]](/icons/sound2.gif) | rubrician.mp3 | 20-Apr-2007 14:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | rubricator.mp3 | 20-Apr-2007 14:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubrication.mp3 | 20-Apr-2007 14:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | rubricate.mp3 | 20-Apr-2007 14:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | rubrically.mp3 | 20-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubrical.mp3 | 20-Apr-2007 14:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | rubric.mp3 | 20-Apr-2007 14:17 | 6.1K | |
![[SND]](/icons/sound2.gif) | rubredoxin.mp3 | 20-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | rubout.mp3 | 20-Apr-2007 14:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | rub-off.mp3 | 20-Apr-2007 14:17 | 7.0K | |
![[SND]](/icons/sound2.gif) | rublyov.mp3 | 20-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | ruble.mp3 | 20-Apr-2007 14:17 | 5.9K | |
![[SND]](/icons/sound2.gif) | rubious.mp3 | 20-Apr-2007 14:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | Rubinstein.mp3 | 20-Apr-2007 14:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | rubikcube.mp3 | 20-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | rubiginous.mp3 | 20-Apr-2007 14:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | rubify.mp3 | 20-Apr-2007 14:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | rubied.mp3 | 20-Apr-2007 14:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | rubidium.mp3 | 20-Apr-2007 14:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | rubicundity.mp3 | 20-Apr-2007 14:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | rubicund.mp3 | 20-Apr-2007 14:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | Rubicon.mp3 | 20-Apr-2007 14:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | rubicelle.mp3 | 20-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | rubiaceous.mp3 | 20-Apr-2007 14:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | rubescent.mp3 | 20-Apr-2007 14:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | rubeosis.mp3 | 20-Apr-2007 14:17 | 17K | |
![[SND]](/icons/sound2.gif) | rubeola.mp3 | 20-Apr-2007 14:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rubensian.mp3 | 20-Apr-2007 14:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rubens.mp3 | 20-Apr-2007 14:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rubenesque.mp3 | 20-Apr-2007 14:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | ruben.mp3 | 20-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubellite.mp3 | 20-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubella.mp3 | 20-Apr-2007 14:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | rubefy.mp3 | 20-Apr-2007 14:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | rubefaction.mp3 | 20-Apr-2007 14:16 | 17K | |
![[SND]](/icons/sound2.gif) | rubefacient.mp3 | 20-Apr-2007 14:16 | 9.3K | |
![[SND]](/icons/sound2.gif) | rubeba.mp3 | 20-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rube.mp3 | 20-Apr-2007 14:16 | 5.2K | |
![[SND]](/icons/sound2.gif) | Rube Goldbergian.mp3 | 20-Apr-2007 14:16 | 12K | |
![[SND]](/icons/sound2.gif) | Rube Goldberg.mp3 | 20-Apr-2007 14:16 | 11K | |
![[SND]](/icons/sound2.gif) | rubdown.mp3 | 20-Apr-2007 14:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | rubby.mp3 | 20-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubbra.mp3 | 20-Apr-2007 14:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | rubboard.mp3 | 20-Apr-2007 14:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | rubbly.mp3 | 20-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubbling.mp3 | 20-Apr-2007 14:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | rubblework.mp3 | 20-Apr-2007 14:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | rubblehead.mp3 | 20-Apr-2007 14:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | rubble.mp3 | 20-Apr-2007 14:16 | 5.0K | |
![[SND]](/icons/sound2.gif) | rubbity.mp3 | 20-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubbishy.mp3 | 20-Apr-2007 14:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | rubbishing.mp3 | 20-Apr-2007 14:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | rubbish.mp3 | 20-Apr-2007 14:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | rubbing.mp3 | 20-Apr-2007 14:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | rubbidy.mp3 | 20-Apr-2007 14:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rubbia.mp3 | 20-Apr-2007 14:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | rubbery.mp3 | 20-Apr-2007 14:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | rubbernecker.mp3 | 20-Apr-2007 14:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | rubberneck.mp3 | 20-Apr-2007 14:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | rubbermandisease.mp3 | 20-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | rubberlike.mp3 | 20-Apr-2007 14:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | rubberized.mp3 | 20-Apr-2007 14:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | rubberize.mp3 | 20-Apr-2007 14:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | rubber-chicken.mp3 | 20-Apr-2007 14:15 | 9.3K | |
![[SND]](/icons/sound2.gif) | rubber.mp3 | 20-Apr-2007 14:15 | 5.5K | |
![[SND]](/icons/sound2.gif) | rubbage.mp3 | 20-Apr-2007 14:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubbaboo.mp3 | 20-Apr-2007 14:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | rubato.mp3 | 20-Apr-2007 14:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | rubasse.mp3 | 20-Apr-2007 14:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rubashka.mp3 | 20-Apr-2007 14:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | rubarthsdisease.mp3 | 20-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | rubalkhali.mp3 | 20-Apr-2007 14:15 | 27K | |
![[SND]](/icons/sound2.gif) | rubaiyatstanza.mp3 | 20-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | rubaiyat.mp3 | 20-Apr-2007 14:15 | 17K | |
![[SND]](/icons/sound2.gif) | Rubaiyat stanza.mp3 | 20-Apr-2007 14:15 | 13K | |
![[SND]](/icons/sound2.gif) | rubadub.mp3 | 20-Apr-2007 14:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | rubaboo.mp3 | 20-Apr-2007 14:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | rub.mp3 | 20-Apr-2007 14:15 | 5.2K | |
![[SND]](/icons/sound2.gif) | Rub' al-Khali.mp3 | 20-Apr-2007 14:15 | 11K | |
![[SND]](/icons/sound2.gif) | Ruapehu, Mount.mp3 | 20-Apr-2007 14:15 | 11K | |
![[SND]](/icons/sound2.gif) | Ruanda-Urundi.mp3 | 20-Apr-2007 14:15 | 14K | |
![[SND]](/icons/sound2.gif) | ruanda.mp3 | 20-Apr-2007 14:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | ruana.mp3 | 20-Apr-2007 14:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | RU-486.mp3 | 20-Apr-2007 14:15 | 16K | |
![[SND]](/icons/sound2.gif) | rtol.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rt.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | RSVP.mp3 | 20-Apr-2007 14:14 | 11K | |
![[SND]](/icons/sound2.gif) | RS.mp3 | 20-Apr-2007 14:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | rrrr.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rrroom.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rRNA.mp3 | 20-Apr-2007 14:14 | 11K | |
![[SND]](/icons/sound2.gif) | rrlyraestar.mp3 | 20-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | rrhoea.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rrhiza.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rrhexis.mp3 | 20-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | rrhea.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rrhaphy.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rrhagia.mp3 | 20-Apr-2007 14:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | RPV.mp3 | 20-Apr-2007 14:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | RPG.mp3 | 20-Apr-2007 14:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | rozzer.mp3 | 20-Apr-2007 14:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | rozener.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rozellerule.mp3 | 20-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | roystoncrow.mp3 | 20-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | royster.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | Royce.mp3 | 20-Apr-2007 14:14 | 6.4K | |
![[SND]](/icons/sound2.gif) | royalty.mp3 | 20-Apr-2007 14:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | royalmews.mp3 | 20-Apr-2007 14:14 | 17K | |
![[SND]](/icons/sound2.gif) | royally.mp3 | 20-Apr-2007 14:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | royall.mp3 | 20-Apr-2007 14:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | royalist.mp3 | 20-Apr-2007 14:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | royalism.mp3 | 20-Apr-2007 14:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | royale.mp3 | 20-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | royal.mp3 | 20-Apr-2007 14:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | Royal Tunbridge Wells.mp3 | 20-Apr-2007 14:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | Roy.mp3 | 20-Apr-2007 14:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | roxy.mp3 | 20-Apr-2007 14:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | roxburywaxwork.mp3 | 20-Apr-2007 14:13 | 18K | |
![[SND]](/icons/sound2.gif) | Roxburghshire.mp3 | 20-Apr-2007 14:13 | 12K | |
![[SND]](/icons/sound2.gif) | Roxburgh.mp3 | 20-Apr-2007 14:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | roxas.mp3 | 20-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | Roxas y Acuna.mp3 | 20-Apr-2007 14:13 | 14K | |
![[SND]](/icons/sound2.gif) | roxane.mp3 | 20-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | roxana.mp3 | 20-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | rowvector.mp3 | 20-Apr-2007 14:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | rowtonhouse.mp3 | 20-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | rowth.mp3 | 20-Apr-2007 14:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | rowte.mp3 | 20-Apr-2007 14:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | rowr.mp3 | 20-Apr-2007 14:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | rowntree.mp3 | 20-Apr-2007 14:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | rowlock.mp3 | 20-Apr-2007 14:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | Rowling.mp3 | 20-Apr-2007 14:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | Rowley.mp3 | 20-Apr-2007 14:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rowlett.mp3 | 20-Apr-2007 14:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rowlandson.mp3 | 20-Apr-2007 14:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rowland.mp3 | 20-Apr-2007 14:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | rowingmachine.mp3 | 20-Apr-2007 14:13 | 17K | |
![[SND]](/icons/sound2.gif) | rowingboat.mp3 | 20-Apr-2007 14:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | rowing.mp3 | 20-Apr-2007 14:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | rowhouse.mp3 | 20-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | rowes.mp3 | 20-Apr-2007 14:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | rower.mp3 | 20-Apr-2007 14:12 | 5.7K | |
![[SND]](/icons/sound2.gif) | rowena.mp3 | 20-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | rowen.mp3 | 20-Apr-2007 14:12 | 6.6K | |
![[SND]](/icons/sound2.gif) | rowel.mp3 | 20-Apr-2007 14:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | Rowe.mp3 | 20-Apr-2007 14:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | rowdyism.mp3 | 20-Apr-2007 14:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | rowdyish.mp3 | 20-Apr-2007 14:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | rowdydow.mp3 | 20-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | rowdy.mp3 | 20-Apr-2007 14:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | rowdow.mp3 | 20-Apr-2007 14:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | rowdiness.mp3 | 20-Apr-2007 14:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | rowdily.mp3 | 20-Apr-2007 14:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | rowcrop.mp3 | 20-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | rowboat.mp3 | 20-Apr-2007 14:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | rowanberry.mp3 | 20-Apr-2007 14:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | rowan.mp3 | 20-Apr-2007 14:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | row.mp3 | 20-Apr-2007 14:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | row house.mp3 | 20-Apr-2007 14:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | rovuma.mp3 | 20-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | rovno.mp3 | 20-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | roving.mp3 | 20-Apr-2007 14:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | rover.mp3 | 20-Apr-2007 14:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | roven.mp3 | 20-Apr-2007 14:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | rove.mp3 | 20-Apr-2007 14:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | rovaniemi.mp3 | 20-Apr-2007 14:12 | 17K | |
![[SND]](/icons/sound2.gif) | rov.mp3 | 20-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rouyn-Noranda.mp3 | 20-Apr-2007 14:11 | 13K | |
![[SND]](/icons/sound2.gif) | rouyn.mp3 | 20-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | roux.mp3 | 20-Apr-2007 14:11 | 5.2K | |
![[SND]](/icons/sound2.gif) | routinize.mp3 | 20-Apr-2007 14:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | routinization.mp3 | 20-Apr-2007 14:11 | 11K | |
![[SND]](/icons/sound2.gif) | routinism.mp3 | 20-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | routinier.mp3 | 20-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | routing.mp3 | 20-Apr-2007 14:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | routinely.mp3 | 20-Apr-2007 14:11 | 17K | |
![[SND]](/icons/sound2.gif) | routineer.mp3 | 20-Apr-2007 14:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | routine.mp3 | 20-Apr-2007 14:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | routh.mp3 | 20-Apr-2007 14:11 | 5.5K | |
![[SND]](/icons/sound2.gif) | routeway.mp3 | 20-Apr-2007 14:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | routerpatch.mp3 | 20-Apr-2007 14:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | router.mp3 | 20-Apr-2007 14:11 | 5.7K | |
![[SND]](/icons/sound2.gif) | routeman.mp3 | 20-Apr-2007 14:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | routegoingperformance.mp3 | 20-Apr-2007 14:11 | 18K | |
![[SND]](/icons/sound2.gif) | route.mp3 | 20-Apr-2007 14:11 | 5.0K | |
![[SND]](/icons/sound2.gif) | rout.mp3 | 20-Apr-2007 14:11 | 5.2K | |
![[SND]](/icons/sound2.gif) | rouster.mp3 | 20-Apr-2007 14:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | roustabout.mp3 | 20-Apr-2007 14:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | roust.mp3 | 20-Apr-2007 14:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | Roussillon.mp3 | 20-Apr-2007 14:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rousseauistic.mp3 | 20-Apr-2007 14:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | Rousseauist.mp3 | 20-Apr-2007 14:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rousseauism.mp3 | 20-Apr-2007 14:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | Rousseauian.mp3 | 20-Apr-2007 14:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | Rousseauesque.mp3 | 20-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rousseau.mp3 | 20-Apr-2007 14:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | rousing.mp3 | 20-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | rousie.mp3 | 20-Apr-2007 14:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | rouser.mp3 | 20-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | rousement.mp3 | 20-Apr-2007 14:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | rouseabout.mp3 | 20-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | rouse.mp3 | 20-Apr-2007 14:10 | 5.9K | |
![[SND]](/icons/sound2.gif) | Rous.mp3 | 20-Apr-2007 14:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rous sarcoma.mp3 | 20-Apr-2007 14:10 | 11K | |
![[SND]](/icons/sound2.gif) | roupy.mp3 | 20-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | roup.mp3 | 20-Apr-2007 14:10 | 5.2K | |
![[SND]](/icons/sound2.gif) | roundworm.mp3 | 20-Apr-2007 14:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | roundwood.mp3 | 20-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | roundup.mp3 | 20-Apr-2007 14:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | round-trip.mp3 | 20-Apr-2007 14:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | roundsman.mp3 | 20-Apr-2007 14:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | round-shouldered.mp3 | 20-Apr-2007 14:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | round-robin.mp3 | 20-Apr-2007 14:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | roundness.mp3 | 20-Apr-2007 14:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | roundly.mp3 | 20-Apr-2007 14:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | roundlet.mp3 | 20-Apr-2007 14:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | roundish.mp3 | 20-Apr-2007 14:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | rounding.mp3 | 20-Apr-2007 14:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | roundhouse.mp3 | 20-Apr-2007 14:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | roundheaded.mp3 | 20-Apr-2007 14:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Roundhead.mp3 | 20-Apr-2007 14:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | rounder.mp3 | 20-Apr-2007 14:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | roundelay.mp3 | 20-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | roundel.mp3 | 20-Apr-2007 14:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | rounded.mp3 | 20-Apr-2007 14:09 | 6.1K | |
![[SND]](/icons/sound2.gif) | roundball.mp3 | 20-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | roundabout.mp3 | 20-Apr-2007 14:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | round.mp3 | 20-Apr-2007 14:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | round table.mp3 | 20-Apr-2007 14:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | roumelia.mp3 | 20-Apr-2007 14:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | Roumanian.mp3 | 20-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | roumania.mp3 | 20-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | roulette.mp3 | 20-Apr-2007 14:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | roulers.mp3 | 20-Apr-2007 14:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | rouleaux.mp3 | 20-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | rouleau.mp3 | 20-Apr-2007 14:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | roulade.mp3 | 20-Apr-2007 14:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | rouille.mp3 | 20-Apr-2007 14:09 | 5.7K | |
![[SND]](/icons/sound2.gif) | roughshod.mp3 | 20-Apr-2007 14:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | roughrider.mp3 | 20-Apr-2007 14:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | roughness.mp3 | 20-Apr-2007 14:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | roughneck.mp3 | 20-Apr-2007 14:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | roughly.mp3 | 20-Apr-2007 14:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | roughleg.mp3 | 20-Apr-2007 14:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | roughish.mp3 | 20-Apr-2007 14:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | roughing.mp3 | 20-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | roughie.mp3 | 20-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | roughhouse.mp3 | 20-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | rough-hewn.mp3 | 20-Apr-2007 14:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | rough-hew.mp3 | 20-Apr-2007 14:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | rougher.mp3 | 20-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | roughening.mp3 | 20-Apr-2007 14:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | roughen.mp3 | 20-Apr-2007 14:08 | 5.5K | |
![[SND]](/icons/sound2.gif) | rough-edged.mp3 | 20-Apr-2007 14:08 | 10K | |
![[SND]](/icons/sound2.gif) | rough-dry.mp3 | 20-Apr-2007 14:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | roughcast.mp3 | 20-Apr-2007 14:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | rough-and-tumble.mp3 | 20-Apr-2007 14:08 | 9.3K | |
![[SND]](/icons/sound2.gif) | rough-and-ready.mp3 | 20-Apr-2007 14:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | roughage.mp3 | 20-Apr-2007 14:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | rough.mp3 | 20-Apr-2007 14:08 | 4.6K | |
![[SND]](/icons/sound2.gif) | rougetdelisle.mp3 | 20-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | Rouget de Lisle.mp3 | 20-Apr-2007 14:08 | 11K | |
![[SND]](/icons/sound2.gif) | rougeetnoir.mp3 | 20-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | rougecroix.mp3 | 20-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | rouge.mp3 | 20-Apr-2007 14:08 | 6.1K | |
![[SND]](/icons/sound2.gif) | rougail.mp3 | 20-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rouen.mp3 | 20-Apr-2007 14:08 | 5.4K | |
![[SND]](/icons/sound2.gif) | roue.mp3 | 20-Apr-2007 14:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | roucou.mp3 | 20-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | rouche.mp3 | 20-Apr-2007 14:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | rouble.mp3 | 20-Apr-2007 14:08 | 5.9K | |
![[SND]](/icons/sound2.gif) | Roubaix.mp3 | 20-Apr-2007 14:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rouault.mp3 | 20-Apr-2007 14:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | roturier.mp3 | 20-Apr-2007 14:08 | 9.3K | |
![[SND]](/icons/sound2.gif) | rotundness.mp3 | 20-Apr-2007 14:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | rotundly.mp3 | 20-Apr-2007 14:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | rotundity.mp3 | 20-Apr-2007 14:08 | 9.1K | |
![[SND]](/icons/sound2.gif) | rotundate.mp3 | 20-Apr-2007 14:08 | 17K | |
![[SND]](/icons/sound2.gif) | rotunda.mp3 | 20-Apr-2007 14:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | rotund.mp3 | 20-Apr-2007 14:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rotuma.mp3 | 20-Apr-2007 14:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | rotula.mp3 | 20-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | rottweiler.mp3 | 20-Apr-2007 14:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rotterdammer.mp3 | 20-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rotterdam.mp3 | 20-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | rotter.mp3 | 20-Apr-2007 14:07 | 5.4K | |
![[SND]](/icons/sound2.gif) | rottenstone.mp3 | 20-Apr-2007 14:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | rottenrow.mp3 | 20-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | rottenness.mp3 | 20-Apr-2007 14:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | rotten.mp3 | 20-Apr-2007 14:07 | 6.1K | |
![[SND]](/icons/sound2.gif) | rotte.mp3 | 20-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | rotsy.mp3 | 20-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | rotovator.mp3 | 20-Apr-2007 14:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | rotovate.mp3 | 20-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | rototiller.mp3 | 20-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | rototill.mp3 | 20-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rotorua.mp3 | 20-Apr-2007 14:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | rotorooter.mp3 | 20-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | rotorcraft.mp3 | 20-Apr-2007 14:07 | 9.8K | |
![[SND]](/icons/sound2.gif) | rotor.mp3 | 20-Apr-2007 14:07 | 5.4K | |
![[SND]](/icons/sound2.gif) | roton.mp3 | 20-Apr-2007 14:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | rotogravure.mp3 | 20-Apr-2007 14:07 | 10K | |
![[SND]](/icons/sound2.gif) | rotodyne.mp3 | 20-Apr-2007 14:07 | 17K | |
![[SND]](/icons/sound2.gif) | rotochute.mp3 | 20-Apr-2007 14:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | roto.mp3 | 20-Apr-2007 14:07 | 5.9K | |
![[SND]](/icons/sound2.gif) | rotl.mp3 | 20-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | rotisserie.mp3 | 20-Apr-2007 14:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | rotiform.mp3 | 20-Apr-2007 14:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | rotifera.mp3 | 20-Apr-2007 14:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | rotifer.mp3 | 20-Apr-2007 14:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | roti.mp3 | 20-Apr-2007 14:06 | 5.4K | |
![[SND]](/icons/sound2.gif) | Rothschild.mp3 | 20-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | rothmans.mp3 | 20-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | Rothko.mp3 | 20-Apr-2007 14:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rothesay.mp3 | 20-Apr-2007 14:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | rothermere.mp3 | 20-Apr-2007 14:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rotherham.mp3 | 20-Apr-2007 14:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | Roth.mp3 | 20-Apr-2007 14:06 | 5.2K | |
![[SND]](/icons/sound2.gif) | rotgut.mp3 | 20-Apr-2007 14:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | rotenone.mp3 | 20-Apr-2007 14:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | rote.mp3 | 20-Apr-2007 14:06 | 5.2K | |
![[SND]](/icons/sound2.gif) | rotcorps.mp3 | 20-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | rotchy.mp3 | 20-Apr-2007 14:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | rotc.mp3 | 20-Apr-2007 14:06 | 27K | |
![[SND]](/icons/sound2.gif) | Rotblat.mp3 | 20-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | rotavirus.mp3 | 20-Apr-2007 14:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | rotavator.mp3 | 20-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | rotatory.mp3 | 20-Apr-2007 14:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | rotatores.mp3 | 20-Apr-2007 14:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | rotator.mp3 | 20-Apr-2007 14:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | rotative.mp3 | 20-Apr-2007 14:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | rotationofaxes.mp3 | 20-Apr-2007 14:06 | 17K | |
![[SND]](/icons/sound2.gif) | rotational.mp3 | 20-Apr-2007 14:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | rotation.mp3 | 20-Apr-2007 14:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | rotate.mp3 | 20-Apr-2007 14:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | rotatable.mp3 | 20-Apr-2007 14:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | rotary.mp3 | 20-Apr-2007 14:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | Rotarian.mp3 | 20-Apr-2007 14:05 | 9.1K | |
![[SND]](/icons/sound2.gif) | rotaplane.mp3 | 20-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | rotameter.mp3 | 20-Apr-2007 14:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | rotacy.mp3 | 20-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | rotachute.mp3 | 20-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | rota.mp3 | 20-Apr-2007 14:05 | 5.4K | |
![[SND]](/icons/sound2.gif) | rot.mp3 | 20-Apr-2007 14:05 | 5.7K | |
![[SND]](/icons/sound2.gif) | rosy.mp3 | 20-Apr-2007 14:05 | 5.9K | |
![[SND]](/icons/sound2.gif) | roswitha.mp3 | 20-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | Roswell.mp3 | 20-Apr-2007 14:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | rosulate.mp3 | 20-Apr-2007 14:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | rostrum.mp3 | 20-Apr-2007 14:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | rostropovich.mp3 | 20-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | rostrocarinate.mp3 | 20-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | rostrate.mp3 | 20-Apr-2007 14:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | rostrally.mp3 | 20-Apr-2007 14:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | rostral.mp3 | 20-Apr-2007 14:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | rostra.mp3 | 20-Apr-2007 14:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | rostow.mp3 | 20-Apr-2007 14:05 | 17K | |
![[SND]](/icons/sound2.gif) | Rostov-on-Don.mp3 | 20-Apr-2007 14:05 | 13K | |
![[SND]](/icons/sound2.gif) | Rostov-na-Donu.mp3 | 20-Apr-2007 14:05 | 13K | |
![[SND]](/icons/sound2.gif) | rostov.mp3 | 20-Apr-2007 14:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rostock.mp3 | 20-Apr-2007 14:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | roster.mp3 | 20-Apr-2007 14:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | rostellum.mp3 | 20-Apr-2007 14:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | rostellate.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | rostellar.mp3 | 20-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rostand.mp3 | 20-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | rosssgoose.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | rossoantico.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | Rossiya.mp3 | 20-Apr-2007 14:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rossinian.mp3 | 20-Apr-2007 14:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rossini.mp3 | 20-Apr-2007 14:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | rossignol.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | Rossi.mp3 | 20-Apr-2007 14:04 | 5.7K | |
![[SND]](/icons/sound2.gif) | Rossetti.mp3 | 20-Apr-2007 14:04 | 6.4K | |
![[SND]](/icons/sound2.gif) | rosser.mp3 | 20-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | rossellini.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | rosselcurrent.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | rossby.mp3 | 20-Apr-2007 14:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | rossandcromarty.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | ross.mp3 | 20-Apr-2007 14:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | Ross and Cromarty.mp3 | 20-Apr-2007 14:04 | 13K | |
![[SND]](/icons/sound2.gif) | rospa.mp3 | 20-Apr-2007 14:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | rosolio.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | roslyn.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | roskilde.mp3 | 20-Apr-2007 14:04 | 17K | |
![[SND]](/icons/sound2.gif) | rosita.mp3 | 20-Apr-2007 14:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | rosinweed.mp3 | 20-Apr-2007 14:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | rosinous.mp3 | 20-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | rosining.mp3 | 20-Apr-2007 14:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | rosiner.mp3 | 20-Apr-2007 14:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | rosinante.mp3 | 20-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | rosina.mp3 | 20-Apr-2007 14:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | rosin.mp3 | 20-Apr-2007 14:03 | 6.3K | |
![[SND]](/icons/sound2.gif) | rosily.mp3 | 20-Apr-2007 14:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | rosie.mp3 | 20-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rosicrucianism.mp3 | 20-Apr-2007 14:03 | 12K | |
![[SND]](/icons/sound2.gif) | Rosicrucian.mp3 | 20-Apr-2007 14:03 | 10K | |
![[SND]](/icons/sound2.gif) | roshhodesh.mp3 | 20-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | roshhashanah.mp3 | 20-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | Rosh Hashanah.mp3 | 20-Apr-2007 14:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | rosewood.mp3 | 20-Apr-2007 14:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | rosewater.mp3 | 20-Apr-2007 14:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | rosewall.mp3 | 20-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | Roseville.mp3 | 20-Apr-2007 14:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | rosetted.mp3 | 20-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | rosette.mp3 | 20-Apr-2007 14:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rosetta.mp3 | 20-Apr-2007 14:03 | 7.0K | |
![[SND]](/icons/sound2.gif) | Rosetta stone.mp3 | 20-Apr-2007 14:03 | 12K | |
![[SND]](/icons/sound2.gif) | roset.mp3 | 20-Apr-2007 14:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | rosery.mp3 | 20-Apr-2007 14:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | roseolar.mp3 | 20-Apr-2007 14:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | roseolainfantum.mp3 | 20-Apr-2007 14:03 | 17K | |
![[SND]](/icons/sound2.gif) | roseola.mp3 | 20-Apr-2007 14:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | roseola infantum.mp3 | 20-Apr-2007 14:03 | 16K | |
![[SND]](/icons/sound2.gif) | Rosenwald.mp3 | 20-Apr-2007 14:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | rosenkaavlierder.mp3 | 20-Apr-2007 14:02 | 17K | |
![[SND]](/icons/sound2.gif) | Rosenberg.mp3 | 20-Apr-2007 14:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rosemead.mp3 | 20-Apr-2007 14:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | rosemary.mp3 | 20-Apr-2007 14:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | rosemarie.mp3 | 20-Apr-2007 14:02 | 17K | |
![[SND]](/icons/sound2.gif) | rosemaling.mp3 | 20-Apr-2007 14:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | Roselle.mp3 | 20-Apr-2007 14:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | rosella.mp3 | 20-Apr-2007 14:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | roselike.mp3 | 20-Apr-2007 14:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | rosefish.mp3 | 20-Apr-2007 14:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | rosed.mp3 | 20-Apr-2007 14:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rosecrans.mp3 | 20-Apr-2007 14:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | rose-colored.mp3 | 20-Apr-2007 14:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | rosebush.mp3 | 20-Apr-2007 14:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | rosebud.mp3 | 20-Apr-2007 14:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | rose-breasted grosbeak.mp3 | 20-Apr-2007 14:02 | 16K | |
![[SND]](/icons/sound2.gif) | Rosebery.mp3 | 20-Apr-2007 14:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | rosebay.mp3 | 20-Apr-2007 14:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | Roseau.mp3 | 20-Apr-2007 14:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | roseate.mp3 | 20-Apr-2007 14:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | roseanna.mp3 | 20-Apr-2007 14:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | rose.mp3 | 20-Apr-2007 14:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | Rose, Mount.mp3 | 20-Apr-2007 14:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | rose of Sharon.mp3 | 20-Apr-2007 14:02 | 11K | |
![[SND]](/icons/sound2.gif) | rose of Jericho.mp3 | 20-Apr-2007 14:02 | 13K | |
![[SND]](/icons/sound2.gif) | Roscommon.mp3 | 20-Apr-2007 14:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | roscoelite.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | roscoe.mp3 | 20-Apr-2007 14:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | roscius.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | roscian.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | rosay.mp3 | 20-Apr-2007 14:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | rosasolis.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | rosary.mp3 | 20-Apr-2007 14:01 | 7.3K | |
![[SND]](/icons/sound2.gif) | rosarium.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | Rosario.mp3 | 20-Apr-2007 14:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | rosarian.mp3 | 20-Apr-2007 14:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | rosanne.mp3 | 20-Apr-2007 14:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | rosaniline.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | rosamund.mp3 | 20-Apr-2007 14:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | rosaline.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | rosalind.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | rosalie.mp3 | 20-Apr-2007 14:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | rosaceous.mp3 | 20-Apr-2007 14:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | rosacea.mp3 | 20-Apr-2007 14:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | rosace.mp3 | 20-Apr-2007 14:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | rosabel.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | Rosa.mp3 | 20-Apr-2007 14:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rosa, Monte.mp3 | 20-Apr-2007 14:01 | 11K | |
![[SND]](/icons/sound2.gif) | roryomore.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | rory.mp3 | 20-Apr-2007 14:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | rorty.mp3 | 20-Apr-2007 14:01 | 17K | |
![[SND]](/icons/sound2.gif) | rort.mp3 | 20-Apr-2007 14:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rorschach.mp3 | 20-Apr-2007 14:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | rorsat.mp3 | 20-Apr-2007 14:00 | 17K | |
![[SND]](/icons/sound2.gif) | rorqual.mp3 | 20-Apr-2007 14:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | roroship.mp3 | 20-Apr-2007 14:00 | 17K | |
![[SND]](/icons/sound2.gif) | Ro-Ro.mp3 | 20-Apr-2007 14:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | roro.mp3 | 20-Apr-2007 14:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | roral.mp3 | 20-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | Roraima.mp3 | 20-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | roquette.mp3 | 20-Apr-2007 14:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | roquet.mp3 | 20-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | roquelaure.mp3 | 20-Apr-2007 14:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | Roquefort.mp3 | 20-Apr-2007 14:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | roque.mp3 | 20-Apr-2007 14:00 | 4.1K | |
![[SND]](/icons/sound2.gif) | ropy.mp3 | 20-Apr-2007 14:00 | 5.7K | |
![[SND]](/icons/sound2.gif) | roping.mp3 | 20-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | ropey.mp3 | 20-Apr-2007 14:00 | 5.7K | |
![[SND]](/icons/sound2.gif) | ropeway.mp3 | 20-Apr-2007 14:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | ropewalker.mp3 | 20-Apr-2007 14:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | ropewalk.mp3 | 20-Apr-2007 14:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | ropery.mp3 | 20-Apr-2007 14:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | roper.mp3 | 20-Apr-2007 14:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | ropemanship.mp3 | 20-Apr-2007 14:00 | 17K | |
![[SND]](/icons/sound2.gif) | ropelike.mp3 | 20-Apr-2007 14:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | ropedancing.mp3 | 20-Apr-2007 14:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | ropedancer.mp3 | 20-Apr-2007 14:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | ropeable.mp3 | 20-Apr-2007 14:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | rope.mp3 | 20-Apr-2007 14:00 | 4.6K | |
![[SND]](/icons/sound2.gif) | ropable.mp3 | 20-Apr-2007 14:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | roove.mp3 | 20-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | rootytoottoot.mp3 | 20-Apr-2007 13:59 | 17K | |
![[SND]](/icons/sound2.gif) | rootytoot.mp3 | 20-Apr-2007 13:59 | 17K | |
![[SND]](/icons/sound2.gif) | rooty.mp3 | 20-Apr-2007 13:59 | 5.7K | |
![[SND]](/icons/sound2.gif) | rootsy.mp3 | 20-Apr-2007 13:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | rootstock.mp3 | 20-Apr-2007 13:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | rootsblower.mp3 | 20-Apr-2007 13:59 | 17K | |
![[SND]](/icons/sound2.gif) | rootling.mp3 | 20-Apr-2007 13:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | rootlike.mp3 | 20-Apr-2007 13:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | rootlet.mp3 | 20-Apr-2007 13:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | rootless.mp3 | 20-Apr-2007 13:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | rootle.mp3 | 20-Apr-2007 13:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | rootintootin.mp3 | 20-Apr-2007 13:59 | 17K | |
![[SND]](/icons/sound2.gif) | rooti.mp3 | 20-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | roothold.mp3 | 20-Apr-2007 13:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | rooter.mp3 | 20-Apr-2007 13:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | rooted.mp3 | 20-Apr-2007 13:59 | 5.4K | |
![[SND]](/icons/sound2.gif) | root-bound.mp3 | 20-Apr-2007 13:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | root-ball.mp3 | 20-Apr-2007 13:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | rootage.mp3 | 20-Apr-2007 13:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | root.mp3 | 20-Apr-2007 13:59 | 5.4K | |
![[SND]](/icons/sound2.gif) | rooster.mp3 | 20-Apr-2007 13:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | roost.mp3 | 20-Apr-2007 13:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | roosian.mp3 | 20-Apr-2007 13:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rooseveltian.mp3 | 20-Apr-2007 13:59 | 9.1K | |
![[SND]](/icons/sound2.gif) | Roosevelt.mp3 | 20-Apr-2007 13:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | roose.mp3 | 20-Apr-2007 13:59 | 6.3K | |
![[SND]](/icons/sound2.gif) | roorback.mp3 | 20-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | roopy.mp3 | 20-Apr-2007 13:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | roop.mp3 | 20-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | rooney.mp3 | 20-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | roomy.mp3 | 20-Apr-2007 13:58 | 5.5K | |
![[SND]](/icons/sound2.gif) | roommate.mp3 | 20-Apr-2007 13:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | rooming-in.mp3 | 20-Apr-2007 13:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | rooming house.mp3 | 20-Apr-2007 13:58 | 11K | |
![[SND]](/icons/sound2.gif) | roomie.mp3 | 20-Apr-2007 13:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | roomful.mp3 | 20-Apr-2007 13:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | roomette.mp3 | 20-Apr-2007 13:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | roomer.mp3 | 20-Apr-2007 13:58 | 5.4K | |
![[SND]](/icons/sound2.gif) | roomed.mp3 | 20-Apr-2007 13:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | room.mp3 | 20-Apr-2007 13:58 | 6.4K | |
![[SND]](/icons/sound2.gif) | rooky.mp3 | 20-Apr-2007 13:58 | 5.7K | |
![[SND]](/icons/sound2.gif) | rookie.mp3 | 20-Apr-2007 13:58 | 5.7K | |
![[SND]](/icons/sound2.gif) | rookery.mp3 | 20-Apr-2007 13:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | rook.mp3 | 20-Apr-2007 13:58 | 4.6K | |
![[SND]](/icons/sound2.gif) | rooinek.mp3 | 20-Apr-2007 13:58 | 17K | |
![[SND]](/icons/sound2.gif) | rooikat.mp3 | 20-Apr-2007 13:58 | 17K | |
![[SND]](/icons/sound2.gif) | rooftree.mp3 | 20-Apr-2007 13:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | rooftop.mp3 | 20-Apr-2007 13:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | roofs.mp3 | 20-Apr-2007 13:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | roofline.mp3 | 20-Apr-2007 13:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | rooflike.mp3 | 20-Apr-2007 13:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | roofless.mp3 | 20-Apr-2007 13:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | roofing.mp3 | 20-Apr-2007 13:58 | 7.0K | |
![[SND]](/icons/sound2.gif) | roofie.mp3 | 20-Apr-2007 13:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | roofer.mp3 | 20-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | roofed.mp3 | 20-Apr-2007 13:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | roofage.mp3 | 20-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | roof.mp3 | 20-Apr-2007 13:57 | 5.2K | |
![[SND]](/icons/sound2.gif) | roodepoortmaraisburg.mp3 | 20-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | Roodepoort.mp3 | 20-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | rood.mp3 | 20-Apr-2007 13:57 | 6.1K | |
![[SND]](/icons/sound2.gif) | roo.mp3 | 20-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | ronyon.mp3 | 20-Apr-2007 13:57 | 6.3K | |
![[SND]](/icons/sound2.gif) | rontgeno.mp3 | 20-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | rontgen.mp3 | 20-Apr-2007 13:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | ronstadt.mp3 | 20-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | ronson.mp3 | 20-Apr-2007 13:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ronsard.mp3 | 20-Apr-2007 13:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | ronrico.mp3 | 20-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | ronquil.mp3 | 20-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | ronnie.mp3 | 20-Apr-2007 13:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | ronnel.mp3 | 20-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | ronneiceshelf.mp3 | 20-Apr-2007 13:57 | 17K | |
![[SND]](/icons/sound2.gif) | ronne.mp3 | 20-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ronne Ice Shelf.mp3 | 20-Apr-2007 13:57 | 5.7K | |
![[SND]](/icons/sound2.gif) | ronk.mp3 | 20-Apr-2007 13:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | ronion.mp3 | 20-Apr-2007 13:57 | 8.2K | |
![[SND]](/icons/sound2.gif) | rongorongo.mp3 | 20-Apr-2007 13:56 | 17K | |
![[SND]](/icons/sound2.gif) | rongo.mp3 | 20-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | ronggeng.mp3 | 20-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | rongeur.mp3 | 20-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rongerik.mp3 | 20-Apr-2007 13:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | rong.mp3 | 20-Apr-2007 13:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | roneo.mp3 | 20-Apr-2007 13:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | rone.mp3 | 20-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | rondure.mp3 | 20-Apr-2007 13:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rondonia.mp3 | 20-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | rondo.mp3 | 20-Apr-2007 13:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | rondino.mp3 | 20-Apr-2007 13:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | rondelle.mp3 | 20-Apr-2007 13:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | rondelet.mp3 | 20-Apr-2007 13:56 | 8.0K | |
![[SND]](/icons/sound2.gif) | rondel.mp3 | 20-Apr-2007 13:56 | 6.4K | |
![[SND]](/icons/sound2.gif) | rondeaux.mp3 | 20-Apr-2007 13:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | rondeauredouble.mp3 | 20-Apr-2007 13:56 | 18K | |
![[SND]](/icons/sound2.gif) | rondeau.mp3 | 20-Apr-2007 13:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | ronde.mp3 | 20-Apr-2007 13:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | ronddejambe.mp3 | 20-Apr-2007 13:56 | 17K | |
![[SND]](/icons/sound2.gif) | rondavel.mp3 | 20-Apr-2007 13:56 | 17K | |
![[SND]](/icons/sound2.gif) | ronco.mp3 | 20-Apr-2007 13:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | ronchie.mp3 | 20-Apr-2007 13:56 | 17K | |
![[SND]](/icons/sound2.gif) | Roncevaux.mp3 | 20-Apr-2007 13:55 | 7.5K | |
![[SND]](/icons/sound2.gif) | Roncesvalles.mp3 | 20-Apr-2007 13:55 | 12K | |
![[SND]](/icons/sound2.gif) | ronan.mp3 | 20-Apr-2007 13:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | ronald.mp3 | 20-Apr-2007 13:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | Romulus.mp3 | 20-Apr-2007 13:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | rompish.mp3 | 20-Apr-2007 13:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | romper.mp3 | 20-Apr-2007 13:55 | 5.9K | |
![[SND]](/icons/sound2.gif) | romp.mp3 | 20-Apr-2007 13:55 | 5.4K | |
![[SND]](/icons/sound2.gif) | romola.mp3 | 20-Apr-2007 13:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | romneya.mp3 | 20-Apr-2007 13:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | Romney.mp3 | 20-Apr-2007 13:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | Rommel.mp3 | 20-Apr-2007 13:55 | 5.7K | |
![[SND]](/icons/sound2.gif) | rommany.mp3 | 20-Apr-2007 13:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Romish.mp3 | 20-Apr-2007 13:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | Romford.mp3 | 20-Apr-2007 13:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | romeward.mp3 | 20-Apr-2007 13:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Romeo.mp3 | 20-Apr-2007 13:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | romeldale.mp3 | 20-Apr-2007 13:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rome.mp3 | 20-Apr-2007 13:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rome, Duchy of.mp3 | 20-Apr-2007 13:55 | 11K | |
![[SND]](/icons/sound2.gif) | Rome Beauty.mp3 | 20-Apr-2007 13:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | Romblon.mp3 | 20-Apr-2007 13:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | Romberg.mp3 | 20-Apr-2007 13:55 | 7.3K | |
![[SND]](/icons/sound2.gif) | romaunt.mp3 | 20-Apr-2007 13:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | romanza.mp3 | 20-Apr-2007 13:55 | 17K | |
![[SND]](/icons/sound2.gif) | Romany.mp3 | 20-Apr-2007 13:55 | 6.4K | |
![[SND]](/icons/sound2.gif) | romanticize.mp3 | 20-Apr-2007 13:55 | 11K | |
![[SND]](/icons/sound2.gif) | romanticization.mp3 | 20-Apr-2007 13:54 | 13K | |
![[SND]](/icons/sound2.gif) | romanticist.mp3 | 20-Apr-2007 13:54 | 11K | |
![[SND]](/icons/sound2.gif) | romanticism.mp3 | 20-Apr-2007 13:54 | 10K | |
![[SND]](/icons/sound2.gif) | romantically.mp3 | 20-Apr-2007 13:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | romantic.mp3 | 20-Apr-2007 13:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Romansh.mp3 | 20-Apr-2007 13:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | romans-fleuves.mp3 | 20-Apr-2007 13:54 | 11K | |
![[SND]](/icons/sound2.gif) | Romansch.mp3 | 20-Apr-2007 13:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | Romans.mp3 | 20-Apr-2007 13:54 | 6.4K | |
![[SND]](/icons/sound2.gif) | romans a clef.mp3 | 20-Apr-2007 13:54 | 11K | |
![[SND]](/icons/sound2.gif) | romanov.mp3 | 20-Apr-2007 13:54 | 17K | |
![[SND]](/icons/sound2.gif) | Romanoff.mp3 | 20-Apr-2007 13:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | Romano.mp3 | 20-Apr-2007 13:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | romanize.mp3 | 20-Apr-2007 13:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | romanization.mp3 | 20-Apr-2007 13:54 | 10K | |
![[SND]](/icons/sound2.gif) | Romanistic.mp3 | 20-Apr-2007 13:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | Romanist.mp3 | 20-Apr-2007 13:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | Romanism.mp3 | 20-Apr-2007 13:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | romanish.mp3 | 20-Apr-2007 13:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | Romanic.mp3 | 20-Apr-2007 13:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | Romanian.mp3 | 20-Apr-2007 13:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | Romania.mp3 | 20-Apr-2007 13:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | romani.mp3 | 20-Apr-2007 13:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | roman-fleuve.mp3 | 20-Apr-2007 13:54 | 11K | |
![[SND]](/icons/sound2.gif) | romanfleuve.mp3 | 20-Apr-2007 13:54 | 17K | |
![[SND]](/icons/sound2.gif) | Romanesque.mp3 | 20-Apr-2007 13:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | romanes.mp3 | 20-Apr-2007 13:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | romancist.mp3 | 20-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | romancer.mp3 | 20-Apr-2007 13:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | romance.mp3 | 20-Apr-2007 13:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | romanaclef.mp3 | 20-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | Roman.mp3 | 20-Apr-2007 13:53 | 6.3K | |
![[SND]](/icons/sound2.gif) | roman a clef.mp3 | 20-Apr-2007 13:53 | 11K | |
![[SND]](/icons/sound2.gif) | Romains.mp3 | 20-Apr-2007 13:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | romaine.mp3 | 20-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | romain.mp3 | 20-Apr-2007 13:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | romaika.mp3 | 20-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | Romaic.mp3 | 20-Apr-2007 13:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | Romagna.mp3 | 20-Apr-2007 13:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | Roma.mp3 | 20-Apr-2007 13:53 | 5.7K | |
![[SND]](/icons/sound2.gif) | Rom.mp3 | 20-Apr-2007 13:53 | 5.9K | |
![[SND]](/icons/sound2.gif) | roly-poly.mp3 | 20-Apr-2007 13:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | rolypoly.mp3 | 20-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | Rolvaag.mp3 | 20-Apr-2007 13:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | rolph.mp3 | 20-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | rolodex.mp3 | 20-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | rolltop desk.mp3 | 20-Apr-2007 13:53 | 12K | |
![[SND]](/icons/sound2.gif) | rollsroyce.mp3 | 20-Apr-2007 13:53 | 17K | |
![[SND]](/icons/sound2.gif) | rolls.mp3 | 20-Apr-2007 13:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | rollover.mp3 | 20-Apr-2007 13:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | rollout.mp3 | 20-Apr-2007 13:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | roll-off.mp3 | 20-Apr-2007 13:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | rollocking.mp3 | 20-Apr-2007 13:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | rollock.mp3 | 20-Apr-2007 13:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | rollo.mp3 | 20-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | roll-necked.mp3 | 20-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | roll-neck.mp3 | 20-Apr-2007 13:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | rollmop.mp3 | 20-Apr-2007 13:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | rollins.mp3 | 20-Apr-2007 13:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | rolling.mp3 | 20-Apr-2007 13:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | rollicksome.mp3 | 20-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | rollicking.mp3 | 20-Apr-2007 13:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | rollick.mp3 | 20-Apr-2007 13:52 | 5.9K | |
![[SND]](/icons/sound2.gif) | rolliche.mp3 | 20-Apr-2007 13:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | rolley.mp3 | 20-Apr-2007 13:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | rollestheorem.mp3 | 20-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | Rolle's theorem.mp3 | 20-Apr-2007 13:52 | 11K | |
![[SND]](/icons/sound2.gif) | rollerdrome.mp3 | 20-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | roller-coaster.mp3 | 20-Apr-2007 13:52 | 10K | |
![[SND]](/icons/sound2.gif) | Rollerblade.mp3 | 20-Apr-2007 13:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | roller.mp3 | 20-Apr-2007 13:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | roller coaster.mp3 | 20-Apr-2007 13:52 | 10K | |
![[SND]](/icons/sound2.gif) | rollback.mp3 | 20-Apr-2007 13:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | rollatini.mp3 | 20-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | Rolland.mp3 | 20-Apr-2007 13:52 | 7.1K | |
![[SND]](/icons/sound2.gif) | rolla.mp3 | 20-Apr-2007 13:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | roll.mp3 | 20-Apr-2007 13:52 | 5.5K | |
![[SND]](/icons/sound2.gif) | rolfkraki.mp3 | 20-Apr-2007 13:52 | 17K | |
![[SND]](/icons/sound2.gif) | Rolfing.mp3 | 20-Apr-2007 13:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | rolfer.mp3 | 20-Apr-2007 13:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rolfe.mp3 | 20-Apr-2007 13:51 | 4.8K | |
![[SND]](/icons/sound2.gif) | rolf.mp3 | 20-Apr-2007 13:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | rolex.mp3 | 20-Apr-2007 13:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | role-play.mp3 | 20-Apr-2007 13:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | role.mp3 | 20-Apr-2007 13:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | Roland.mp3 | 20-Apr-2007 13:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | rolamite.mp3 | 20-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | rolaids.mp3 | 20-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | Rokossovsky.mp3 | 20-Apr-2007 13:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | roke.mp3 | 20-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | rok.mp3 | 20-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | rojak.mp3 | 20-Apr-2007 13:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | roisterous.mp3 | 20-Apr-2007 13:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | roistering.mp3 | 20-Apr-2007 13:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | roisterer.mp3 | 20-Apr-2007 13:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | roister.mp3 | 20-Apr-2007 13:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | roily.mp3 | 20-Apr-2007 13:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | roil.mp3 | 20-Apr-2007 13:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | roifaineant.mp3 | 20-Apr-2007 13:51 | 17K | |
![[SND]](/icons/sound2.gif) | Rohrer.mp3 | 20-Apr-2007 13:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | Rohnert Park.mp3 | 20-Apr-2007 13:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | rohmer.mp3 | 20-Apr-2007 13:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | rohm.mp3 | 20-Apr-2007 13:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rohilkhand.mp3 | 20-Apr-2007 13:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | Roh Tae Woo.mp3 | 20-Apr-2007 13:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | Roh Moo Hyun.mp3 | 20-Apr-2007 13:51 | 11K | |
![[SND]](/icons/sound2.gif) | roguish.mp3 | 20-Apr-2007 13:50 | 7.3K | |
![[SND]](/icons/sound2.gif) | roguery.mp3 | 20-Apr-2007 13:50 | 6.6K | |
![[SND]](/icons/sound2.gif) | rogue.mp3 | 20-Apr-2007 13:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | rognon.mp3 | 20-Apr-2007 13:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | roggendorf.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | Roget.mp3 | 20-Apr-2007 13:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rogers.mp3 | 20-Apr-2007 13:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | rogernomics.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | rogerducasse.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | roger.mp3 | 20-Apr-2007 13:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | rogatory.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | rogation.mp3 | 20-Apr-2007 13:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | rogallo.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | Roethke.mp3 | 20-Apr-2007 13:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | roesler.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | Roerich.mp3 | 20-Apr-2007 13:50 | 5.4K | |
![[SND]](/icons/sound2.gif) | roentgenoparent.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | roentgenopaque.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | roentgenometer.mp3 | 20-Apr-2007 13:50 | 17K | |
![[SND]](/icons/sound2.gif) | roentgenology.mp3 | 20-Apr-2007 13:50 | 10K | |
![[SND]](/icons/sound2.gif) | roentgenologist.mp3 | 20-Apr-2007 13:49 | 11K | |
![[SND]](/icons/sound2.gif) | roentgenologically.mp3 | 20-Apr-2007 13:49 | 12K | |
![[SND]](/icons/sound2.gif) | roentgenological.mp3 | 20-Apr-2007 13:49 | 12K | |
![[SND]](/icons/sound2.gif) | roentgenologic.mp3 | 20-Apr-2007 13:49 | 11K | |
![[SND]](/icons/sound2.gif) | roentgenography.mp3 | 20-Apr-2007 13:49 | 11K | |
![[SND]](/icons/sound2.gif) | roentgenographically.mp3 | 20-Apr-2007 13:49 | 12K | |
![[SND]](/icons/sound2.gif) | roentgenographic.mp3 | 20-Apr-2007 13:49 | 11K | |
![[SND]](/icons/sound2.gif) | roentgenogram.mp3 | 20-Apr-2007 13:49 | 10K | |
![[SND]](/icons/sound2.gif) | roentgeno.mp3 | 20-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | roentgenize.mp3 | 20-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | roentgen.mp3 | 20-Apr-2007 13:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | roemer.mp3 | 20-Apr-2007 13:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | roeg.mp3 | 20-Apr-2007 13:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | roedean.mp3 | 20-Apr-2007 13:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | roebuck.mp3 | 20-Apr-2007 13:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | Roebling.mp3 | 20-Apr-2007 13:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | roe.mp3 | 20-Apr-2007 13:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | rods.mp3 | 20-Apr-2007 13:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rodrigues.mp3 | 20-Apr-2007 13:49 | 9.3K | |
![[SND]](/icons/sound2.gif) | rodrigo.mp3 | 20-Apr-2007 13:49 | 17K | |
![[SND]](/icons/sound2.gif) | rodomontade.mp3 | 20-Apr-2007 13:49 | 10K | |
![[SND]](/icons/sound2.gif) | rodolph.mp3 | 20-Apr-2007 13:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rodney.mp3 | 20-Apr-2007 13:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | rodman.mp3 | 20-Apr-2007 13:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | rodlike.mp3 | 20-Apr-2007 13:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | rodlet.mp3 | 20-Apr-2007 13:48 | 17K | |
![[SND]](/icons/sound2.gif) | rodless.mp3 | 20-Apr-2007 13:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rodinesque.mp3 | 20-Apr-2007 13:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rodin.mp3 | 20-Apr-2007 13:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | rodi.mp3 | 20-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rodhos.mp3 | 20-Apr-2007 13:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | rodham.mp3 | 20-Apr-2007 13:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rodgers.mp3 | 20-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | rodger.mp3 | 20-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | rodez.mp3 | 20-Apr-2007 13:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | roderick.mp3 | 20-Apr-2007 13:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | roderic.mp3 | 20-Apr-2007 13:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | rodeo.mp3 | 20-Apr-2007 13:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | rodenticide.mp3 | 20-Apr-2007 13:48 | 10K | |
![[SND]](/icons/sound2.gif) | rodentia.mp3 | 20-Apr-2007 13:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | rodent.mp3 | 20-Apr-2007 13:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | rode.mp3 | 20-Apr-2007 13:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | roddick.mp3 | 20-Apr-2007 13:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | rodder.mp3 | 20-Apr-2007 13:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | rodded.mp3 | 20-Apr-2007 13:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | rodchenko.mp3 | 20-Apr-2007 13:48 | 17K | |
![[SND]](/icons/sound2.gif) | Rodbell.mp3 | 20-Apr-2007 13:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | rod.mp3 | 20-Apr-2007 13:47 | 5.2K | |
![[SND]](/icons/sound2.gif) | rococo.mp3 | 20-Apr-2007 13:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | rocky.mp3 | 20-Apr-2007 13:47 | 5.9K | |
![[SND]](/icons/sound2.gif) | Rocky Mount.mp3 | 20-Apr-2007 13:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | Rockwellian.mp3 | 20-Apr-2007 13:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | Rockwell.mp3 | 20-Apr-2007 13:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | rockweed.mp3 | 20-Apr-2007 13:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rockville.mp3 | 20-Apr-2007 13:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | rockumentary.mp3 | 20-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | rocksy.mp3 | 20-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | rockshaft.mp3 | 20-Apr-2007 13:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | rockscape.mp3 | 20-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | rocks.mp3 | 20-Apr-2007 13:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | rockrose.mp3 | 20-Apr-2007 13:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | rock-ribbed.mp3 | 20-Apr-2007 13:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | rockoon.mp3 | 20-Apr-2007 13:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | rocknroll.mp3 | 20-Apr-2007 13:47 | 17K | |
![[SND]](/icons/sound2.gif) | Rockne.mp3 | 20-Apr-2007 13:47 | 6.1K | |
![[SND]](/icons/sound2.gif) | rockling.mp3 | 20-Apr-2007 13:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | Rocklin.mp3 | 20-Apr-2007 13:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | rocklike.mp3 | 20-Apr-2007 13:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | rocklet.mp3 | 20-Apr-2007 13:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rockingham.mp3 | 20-Apr-2007 13:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | rocking.mp3 | 20-Apr-2007 13:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | rockiness.mp3 | 20-Apr-2007 13:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rockies.mp3 | 20-Apr-2007 13:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | rockhounding.mp3 | 20-Apr-2007 13:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | rockhopper.mp3 | 20-Apr-2007 13:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rockhampton.mp3 | 20-Apr-2007 13:46 | 9.6K | |
![[SND]](/icons/sound2.gif) | Rockford.mp3 | 20-Apr-2007 13:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | rockfish.mp3 | 20-Apr-2007 13:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | rockfest.mp3 | 20-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | rockfall.mp3 | 20-Apr-2007 13:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | rockeye.mp3 | 20-Apr-2007 13:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | rockettes.mp3 | 20-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | rocketry.mp3 | 20-Apr-2007 13:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | rocketeer.mp3 | 20-Apr-2007 13:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | rocket.mp3 | 20-Apr-2007 13:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | rockery.mp3 | 20-Apr-2007 13:46 | 7.1K | |
![[SND]](/icons/sound2.gif) | rocker.mp3 | 20-Apr-2007 13:46 | 6.1K | |
![[SND]](/icons/sound2.gif) | Rockefeller.mp3 | 20-Apr-2007 13:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | rockbound.mp3 | 20-Apr-2007 13:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | rockbass.mp3 | 20-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | rockaway.mp3 | 20-Apr-2007 13:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rockall.mp3 | 20-Apr-2007 13:46 | 7.3K | |
![[SND]](/icons/sound2.gif) | rockaby.mp3 | 20-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | rockabilly.mp3 | 20-Apr-2007 13:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | rock.mp3 | 20-Apr-2007 13:46 | 5.2K | |
![[SND]](/icons/sound2.gif) | rocinante.mp3 | 20-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | rochet.mp3 | 20-Apr-2007 13:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | Rochester.mp3 | 20-Apr-2007 13:46 | 8.2K | |
![[SND]](/icons/sound2.gif) | roches moutonnees.mp3 | 20-Apr-2007 13:46 | 13K | |
![[SND]](/icons/sound2.gif) | Rochers du Calvados.mp3 | 20-Apr-2007 13:46 | 17K | |
![[SND]](/icons/sound2.gif) | rochemoutonnee.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | rochelle.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | Rochelle salt.mp3 | 20-Apr-2007 13:45 | 11K | |
![[SND]](/icons/sound2.gif) | rochelimit.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | Rochefort-sur-Mer.mp3 | 20-Apr-2007 13:45 | 16K | |
![[SND]](/icons/sound2.gif) | Rochefort.mp3 | 20-Apr-2007 13:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | rochealum.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | roche moutonnee.mp3 | 20-Apr-2007 13:45 | 11K | |
![[SND]](/icons/sound2.gif) | Roche limit.mp3 | 20-Apr-2007 13:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rochdale.mp3 | 20-Apr-2007 13:45 | 8.9K | |
![[SND]](/icons/sound2.gif) | rochas.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | Rochambeau.mp3 | 20-Apr-2007 13:45 | 8.8K | |
![[SND]](/icons/sound2.gif) | rocard.mp3 | 20-Apr-2007 13:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | rocambole.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | rocaille.mp3 | 20-Apr-2007 13:45 | 7.0K | |
![[SND]](/icons/sound2.gif) | roca.mp3 | 20-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | Roca, Cape.mp3 | 20-Apr-2007 13:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | roc.mp3 | 20-Apr-2007 13:45 | 4.8K | |
![[SND]](/icons/sound2.gif) | robustness.mp3 | 20-Apr-2007 13:45 | 9.6K | |
![[SND]](/icons/sound2.gif) | robustious.mp3 | 20-Apr-2007 13:45 | 9.5K | |
![[SND]](/icons/sound2.gif) | robustacoffee.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | robusta.mp3 | 20-Apr-2007 13:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | robust.mp3 | 20-Apr-2007 13:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | roburite.mp3 | 20-Apr-2007 13:45 | 17K | |
![[SND]](/icons/sound2.gif) | robug.mp3 | 20-Apr-2007 13:45 | 8.4K | |
![[SND]](/icons/sound2.gif) | robuck.mp3 | 20-Apr-2007 13:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | robson.mp3 | 20-Apr-2007 13:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | Robson, Mount.mp3 | 20-Apr-2007 13:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | robroy.mp3 | 20-Apr-2007 13:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | robotomorphic.mp3 | 20-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | robotize.mp3 | 20-Apr-2007 13:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | robotization.mp3 | 20-Apr-2007 13:44 | 12K | |
![[SND]](/icons/sound2.gif) | robotism.mp3 | 20-Apr-2007 13:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | robotics.mp3 | 20-Apr-2007 13:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | roboticist.mp3 | 20-Apr-2007 13:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | robotically.mp3 | 20-Apr-2007 13:44 | 9.1K | |
![[SND]](/icons/sound2.gif) | robotic.mp3 | 20-Apr-2007 13:44 | 7.7K | |
![[SND]](/icons/sound2.gif) | robotesque.mp3 | 20-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | robot.mp3 | 20-Apr-2007 13:44 | 7.0K | |
![[SND]](/icons/sound2.gif) | roborant.mp3 | 20-Apr-2007 13:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | robomb.mp3 | 20-Apr-2007 13:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | robodoc.mp3 | 20-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | robocop.mp3 | 20-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | roboam.mp3 | 20-Apr-2007 13:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | robo.mp3 | 20-Apr-2007 13:44 | 8.0K | |
![[SND]](/icons/sound2.gif) | roble.mp3 | 20-Apr-2007 13:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | robinsoncrusoe.mp3 | 20-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | Robinson.mp3 | 20-Apr-2007 13:44 | 7.5K | |
![[SND]](/icons/sound2.gif) | Robinson projection.mp3 | 20-Apr-2007 13:44 | 14K | |
![[SND]](/icons/sound2.gif) | Robinson Crusoe.mp3 | 20-Apr-2007 13:44 | 13K | |
![[SND]](/icons/sound2.gif) | robinia.mp3 | 20-Apr-2007 13:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | robinhood.mp3 | 20-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | robingoodfellow.mp3 | 20-Apr-2007 13:44 | 17K | |
![[SND]](/icons/sound2.gif) | robin.mp3 | 20-Apr-2007 13:43 | 5.7K | |
![[SND]](/icons/sound2.gif) | robin redbreast.mp3 | 20-Apr-2007 13:43 | 12K | |
![[SND]](/icons/sound2.gif) | Robin Hood.mp3 | 20-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | Robin Goodfellow.mp3 | 20-Apr-2007 13:43 | 12K | |
![[SND]](/icons/sound2.gif) | robey.mp3 | 20-Apr-2007 13:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | Robespierre.mp3 | 20-Apr-2007 13:43 | 8.4K | |
![[SND]](/icons/sound2.gif) | Robeson.mp3 | 20-Apr-2007 13:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | robes de chambre.mp3 | 20-Apr-2007 13:43 | 11K | |
![[SND]](/icons/sound2.gif) | Robertson.mp3 | 20-Apr-2007 13:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | Roberts.mp3 | 20-Apr-2007 13:43 | 6.8K | |
![[SND]](/icons/sound2.gif) | Roberts, Point.mp3 | 20-Apr-2007 13:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | roberto.mp3 | 20-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | roberta.mp3 | 20-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | Robert.mp3 | 20-Apr-2007 13:43 | 5.7K | |
![[SND]](/icons/sound2.gif) | Robert I.mp3 | 20-Apr-2007 13:43 | 5.7K | |
![[SND]](/icons/sound2.gif) | Robert Guiscard.mp3 | 20-Apr-2007 13:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | robedechambre.mp3 | 20-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | robe.mp3 | 20-Apr-2007 13:43 | 5.5K | |
![[SND]](/icons/sound2.gif) | robe de chambre.mp3 | 20-Apr-2007 13:43 | 10K | |
![[SND]](/icons/sound2.gif) | Robbins.mp3 | 20-Apr-2007 13:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | robbin.mp3 | 20-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | robbia.mp3 | 20-Apr-2007 13:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | robbery.mp3 | 20-Apr-2007 13:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | robber.mp3 | 20-Apr-2007 13:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | robbenisland.mp3 | 20-Apr-2007 13:43 | 17K | |
![[SND]](/icons/sound2.gif) | Robbe-Grillet.mp3 | 20-Apr-2007 13:43 | 11K | |
![[SND]](/icons/sound2.gif) | robbegrillet.mp3 | 20-Apr-2007 13:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | roband.mp3 | 20-Apr-2007 13:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | robalo.mp3 | 20-Apr-2007 13:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | rob.mp3 | 20-Apr-2007 13:42 | 5.5K | |
![[SND]](/icons/sound2.gif) | Rob Roy.mp3 | 20-Apr-2007 13:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | roasting.mp3 | 20-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | roasting ear.mp3 | 20-Apr-2007 13:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | roaster.mp3 | 20-Apr-2007 13:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | roasted.mp3 | 20-Apr-2007 13:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | roast.mp3 | 20-Apr-2007 13:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | roaring.mp3 | 20-Apr-2007 13:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | roarer.mp3 | 20-Apr-2007 13:42 | 6.4K | |
![[SND]](/icons/sound2.gif) | roar.mp3 | 20-Apr-2007 13:42 | 5.2K | |
![[SND]](/icons/sound2.gif) | Roanoke.mp3 | 20-Apr-2007 13:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | roan.mp3 | 20-Apr-2007 13:42 | 6.6K | |
![[SND]](/icons/sound2.gif) | roam.mp3 | 20-Apr-2007 13:42 | 5.9K | |
![[SND]](/icons/sound2.gif) | roady.mp3 | 20-Apr-2007 13:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | roadworthy.mp3 | 20-Apr-2007 13:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | roadwork.mp3 | 20-Apr-2007 13:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | roadway.mp3 | 20-Apr-2007 13:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | roadtown.mp3 | 20-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | roadster.mp3 | 20-Apr-2007 13:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | roadstead.mp3 | 20-Apr-2007 13:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | roadside.mp3 | 20-Apr-2007 13:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | roadrunner.mp3 | 20-Apr-2007 13:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | roadrailer.mp3 | 20-Apr-2007 13:42 | 17K | |
![[SND]](/icons/sound2.gif) | roadman.mp3 | 20-Apr-2007 13:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | roadless.mp3 | 20-Apr-2007 13:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | road-killed.mp3 | 20-Apr-2007 13:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | roadkill.mp3 | 20-Apr-2007 13:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | roadie.mp3 | 20-Apr-2007 13:41 | 5.7K | |
![[SND]](/icons/sound2.gif) | roadhouse.mp3 | 20-Apr-2007 13:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | roadholding.mp3 | 20-Apr-2007 13:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | roadeo.mp3 | 20-Apr-2007 13:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | roadblock.mp3 | 20-Apr-2007 13:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | roadbed.mp3 | 20-Apr-2007 13:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | roadable.mp3 | 20-Apr-2007 13:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | roadability.mp3 | 20-Apr-2007 13:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | road.mp3 | 20-Apr-2007 13:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | roached.mp3 | 20-Apr-2007 13:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | roach.mp3 | 20-Apr-2007 13:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | RNase.mp3 | 20-Apr-2007 13:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | RNAase.mp3 | 20-Apr-2007 13:41 | 11K | |
![[SND]](/icons/sound2.gif) | RNA.mp3 | 20-Apr-2007 13:41 | 8.0K | |
![[SND]](/icons/sound2.gif) | RN.mp3 | 20-Apr-2007 13:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | rless.mp3 | 20-Apr-2007 13:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rjukan.mp3 | 20-Apr-2007 13:41 | 9.1K | |
![[SND]](/icons/sound2.gif) | Rizzio.mp3 | 20-Apr-2007 13:41 | 7.0K | |
![[SND]](/icons/sound2.gif) | rizzar.mp3 | 20-Apr-2007 13:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | rizla.mp3 | 20-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | Rizal.mp3 | 20-Apr-2007 13:41 | 7.3K | |
![[SND]](/icons/sound2.gif) | rizaiyeh.mp3 | 20-Apr-2007 13:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | riz.mp3 | 20-Apr-2007 13:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | riyal.mp3 | 20-Apr-2007 13:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | Riyadh.mp3 | 20-Apr-2007 13:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | rixdollar.mp3 | 20-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | rivulus.mp3 | 20-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | rivulose.mp3 | 20-Apr-2007 13:41 | 17K | |
![[SND]](/icons/sound2.gif) | rivulet.mp3 | 20-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | riving.mp3 | 20-Apr-2007 13:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | riviereduloup.mp3 | 20-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | riviere.mp3 | 20-Apr-2007 13:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | riviera.mp3 | 20-Apr-2007 13:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | rivetingly.mp3 | 20-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | riveting.mp3 | 20-Apr-2007 13:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | riveter.mp3 | 20-Apr-2007 13:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | rivet.mp3 | 20-Apr-2007 13:40 | 5.5K | |
![[SND]](/icons/sound2.gif) | riverweed.mp3 | 20-Apr-2007 13:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | riverwards.mp3 | 20-Apr-2007 13:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | riverward.mp3 | 20-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | riverview.mp3 | 20-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | Riverton.mp3 | 20-Apr-2007 13:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | riverside.mp3 | 20-Apr-2007 13:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | riverscape.mp3 | 20-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | Rivers.mp3 | 20-Apr-2007 13:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | riverine.mp3 | 20-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | riverfront.mp3 | 20-Apr-2007 13:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | rivered.mp3 | 20-Apr-2007 13:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | riverboat.mp3 | 20-Apr-2007 13:40 | 8.0K | |
![[SND]](/icons/sound2.gif) | riverbed.mp3 | 20-Apr-2007 13:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | riverbank.mp3 | 20-Apr-2007 13:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | riverain.mp3 | 20-Apr-2007 13:40 | 17K | |
![[SND]](/icons/sound2.gif) | Rivera.mp3 | 20-Apr-2007 13:40 | 6.6K | |
![[SND]](/icons/sound2.gif) | river.mp3 | 20-Apr-2007 13:40 | 5.9K | |
![[SND]](/icons/sound2.gif) | River Plate.mp3 | 20-Apr-2007 13:40 | 4.8K | |
![[SND]](/icons/sound2.gif) | riven.mp3 | 20-Apr-2007 13:39 | 5.5K | |
![[SND]](/icons/sound2.gif) | rivel.mp3 | 20-Apr-2007 13:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | rivegauche.mp3 | 20-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | rived.mp3 | 20-Apr-2007 13:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | rive.mp3 | 20-Apr-2007 13:39 | 6.4K | |
![[SND]](/icons/sound2.gif) | rivalry.mp3 | 20-Apr-2007 13:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | rivalrous.mp3 | 20-Apr-2007 13:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | rivalling.mp3 | 20-Apr-2007 13:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | rival.mp3 | 20-Apr-2007 13:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | rivage.mp3 | 20-Apr-2007 13:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | ritzy.mp3 | 20-Apr-2007 13:39 | 6.1K | |
![[SND]](/icons/sound2.gif) | ritzcombinationprinciple.mp3 | 20-Apr-2007 13:39 | 27K | |
![[SND]](/icons/sound2.gif) | ritz.mp3 | 20-Apr-2007 13:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | ritualize.mp3 | 20-Apr-2007 13:39 | 9.1K | |
![[SND]](/icons/sound2.gif) | ritualization.mp3 | 20-Apr-2007 13:39 | 11K | |
![[SND]](/icons/sound2.gif) | ritualistically.mp3 | 20-Apr-2007 13:39 | 11K | |
![[SND]](/icons/sound2.gif) | ritualistic.mp3 | 20-Apr-2007 13:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | ritualist.mp3 | 20-Apr-2007 13:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | ritualism.mp3 | 20-Apr-2007 13:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | ritual.mp3 | 20-Apr-2007 13:39 | 6.3K | |
![[SND]](/icons/sound2.gif) | ritter.mp3 | 20-Apr-2007 13:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ritschlian.mp3 | 20-Apr-2007 13:39 | 17K | |
![[SND]](/icons/sound2.gif) | rits.mp3 | 20-Apr-2007 13:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | ritornello.mp3 | 20-Apr-2007 13:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | ritornelli.mp3 | 20-Apr-2007 13:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | ritonavir.mp3 | 20-Apr-2007 13:39 | 11K | |
![[SND]](/icons/sound2.gif) | rithe.mp3 | 20-Apr-2007 13:39 | 7.9K | |
![[SND]](/icons/sound2.gif) | ritenuto.mp3 | 20-Apr-2007 13:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | ritedepassage.mp3 | 20-Apr-2007 13:38 | 17K | |
![[SND]](/icons/sound2.gif) | rite.mp3 | 20-Apr-2007 13:38 | 5.2K | |
![[SND]](/icons/sound2.gif) | ritardando.mp3 | 20-Apr-2007 13:38 | 10K | |
![[SND]](/icons/sound2.gif) | ritard.mp3 | 20-Apr-2007 13:38 | 6.4K | |
![[SND]](/icons/sound2.gif) | Ritalin.mp3 | 20-Apr-2007 13:38 | 6.1K | |
![[SND]](/icons/sound2.gif) | rita.mp3 | 20-Apr-2007 13:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | rit.mp3 | 20-Apr-2007 13:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | risussardonicus.mp3 | 20-Apr-2007 13:38 | 18K | |
![[SND]](/icons/sound2.gif) | ristocetin.mp3 | 20-Apr-2007 13:38 | 17K | |
![[SND]](/icons/sound2.gif) | rissole.mp3 | 20-Apr-2007 13:38 | 17K | |
![[SND]](/icons/sound2.gif) | riss.mp3 | 20-Apr-2007 13:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | risque.mp3 | 20-Apr-2007 13:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | risperidone.mp3 | 20-Apr-2007 13:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | risotto.mp3 | 20-Apr-2007 13:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | risorgimento.mp3 | 20-Apr-2007 13:38 | 11K | |
![[SND]](/icons/sound2.gif) | risky.mp3 | 20-Apr-2007 13:38 | 5.5K | |
![[SND]](/icons/sound2.gif) | riskless.mp3 | 20-Apr-2007 13:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | risk.mp3 | 20-Apr-2007 13:38 | 5.5K | |
![[SND]](/icons/sound2.gif) | rising.mp3 | 20-Apr-2007 13:38 | 7.3K | |
![[SND]](/icons/sound2.gif) | risibly.mp3 | 20-Apr-2007 13:38 | 7.1K | |
![[SND]](/icons/sound2.gif) | risibles.mp3 | 20-Apr-2007 13:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | risible.mp3 | 20-Apr-2007 13:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | risibility.mp3 | 20-Apr-2007 13:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | rishi.mp3 | 20-Apr-2007 13:38 | 7.9K | |
![[SND]](/icons/sound2.gif) | riser.mp3 | 20-Apr-2007 13:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | risen.mp3 | 20-Apr-2007 13:37 | 5.5K | |
![[SND]](/icons/sound2.gif) | rise.mp3 | 20-Apr-2007 13:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | risdeveau.mp3 | 20-Apr-2007 13:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | risc.mp3 | 20-Apr-2007 13:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | ripvanwinkle.mp3 | 20-Apr-2007 13:37 | 17K | |
![[SND]](/icons/sound2.gif) | Ripuarian.mp3 | 20-Apr-2007 13:37 | 10K | |
![[SND]](/icons/sound2.gif) | riptide.mp3 | 20-Apr-2007 13:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | ripstop.mp3 | 20-Apr-2007 13:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | ripsnorting.mp3 | 20-Apr-2007 13:37 | 9.1K | |
![[SND]](/icons/sound2.gif) | ripsnorter.mp3 | 20-Apr-2007 13:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | ripsnort.mp3 | 20-Apr-2007 13:37 | 17K | |
![[SND]](/icons/sound2.gif) | ripsaw.mp3 | 20-Apr-2007 13:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | riproarious.mp3 | 20-Apr-2007 13:37 | 17K | |
![[SND]](/icons/sound2.gif) | rip-roaring.mp3 | 20-Apr-2007 13:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | riprap.mp3 | 20-Apr-2007 13:37 | 6.6K | |
![[SND]](/icons/sound2.gif) | rippy.mp3 | 20-Apr-2007 13:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | ripply.mp3 | 20-Apr-2007 13:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | rippling.mp3 | 20-Apr-2007 13:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | ripplet.mp3 | 20-Apr-2007 13:37 | 8.8K | |
![[SND]](/icons/sound2.gif) | rippler.mp3 | 20-Apr-2007 13:37 | 6.4K | |
![[SND]](/icons/sound2.gif) | ripple-marked.mp3 | 20-Apr-2007 13:37 | 8.2K | |
![[SND]](/icons/sound2.gif) | ripple.mp3 | 20-Apr-2007 13:37 | 5.0K | |
![[SND]](/icons/sound2.gif) | ripping.mp3 | 20-Apr-2007 13:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | ripper.mp3 | 20-Apr-2007 13:37 | 5.5K | |
![[SND]](/icons/sound2.gif) | ripped.mp3 | 20-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | riposte.mp3 | 20-Apr-2007 13:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | ripon.mp3 | 20-Apr-2007 13:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ripon Falls.mp3 | 20-Apr-2007 13:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | ripography.mp3 | 20-Apr-2007 13:37 | 17K | |
![[SND]](/icons/sound2.gif) | rip-off.mp3 | 20-Apr-2007 13:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | Ripley.mp3 | 20-Apr-2007 13:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | ripieno.mp3 | 20-Apr-2007 13:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | ripieni.mp3 | 20-Apr-2007 13:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | ripidolite.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | ripening.mp3 | 20-Apr-2007 13:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | ripener.mp3 | 20-Apr-2007 13:36 | 7.0K | |
![[SND]](/icons/sound2.gif) | ripen.mp3 | 20-Apr-2007 13:36 | 5.9K | |
![[SND]](/icons/sound2.gif) | ripe.mp3 | 20-Apr-2007 13:36 | 5.0K | |
![[SND]](/icons/sound2.gif) | riparian.mp3 | 20-Apr-2007 13:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | ripandtear.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | rip.mp3 | 20-Apr-2007 13:36 | 4.5K | |
![[SND]](/icons/sound2.gif) | Rip van Winkle.mp3 | 20-Apr-2007 13:36 | 10K | |
![[SND]](/icons/sound2.gif) | Riouw.mp3 | 20-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | riotous.mp3 | 20-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | riotintozin.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | riot.mp3 | 20-Apr-2007 13:36 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rios.mp3 | 20-Apr-2007 13:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | riopelle.mp3 | 20-Apr-2007 13:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | rionstrait.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | rionegro.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | riomuni.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | riom.mp3 | 20-Apr-2007 13:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | rioja.mp3 | 20-Apr-2007 13:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | riograndedosul.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | riograndedonorte.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | riogrande.mp3 | 20-Apr-2007 13:36 | 17K | |
![[SND]](/icons/sound2.gif) | riogallegos.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riodeoro.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riodelaplata.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riodejaneiro.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riodaduvida.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riocuarto.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riobravo.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riobranco.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | riobamba.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | rioazul.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | Rio.mp3 | 20-Apr-2007 13:35 | 7.0K | |
![[SND]](/icons/sound2.gif) | Rio Rancho.mp3 | 20-Apr-2007 13:35 | 10K | |
![[SND]](/icons/sound2.gif) | Rio Piedras.mp3 | 20-Apr-2007 13:35 | 11K | |
![[SND]](/icons/sound2.gif) | Rio Muni.mp3 | 20-Apr-2007 13:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rio Grande.mp3 | 20-Apr-2007 13:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rio Grande do Sul.mp3 | 20-Apr-2007 13:35 | 15K | |
![[SND]](/icons/sound2.gif) | Rio Grande do Norte.mp3 | 20-Apr-2007 13:35 | 16K | |
![[SND]](/icons/sound2.gif) | Rio Grande de Cagayan.mp3 | 20-Apr-2007 13:35 | 20K | |
![[SND]](/icons/sound2.gif) | Rio de Oro.mp3 | 20-Apr-2007 13:35 | 12K | |
![[SND]](/icons/sound2.gif) | Rio de Janeiro.mp3 | 20-Apr-2007 13:35 | 14K | |
![[SND]](/icons/sound2.gif) | Rio Bravo.mp3 | 20-Apr-2007 13:35 | 10K | |
![[SND]](/icons/sound2.gif) | Rio Branco.mp3 | 20-Apr-2007 13:35 | 11K | |
![[SND]](/icons/sound2.gif) | rintintin.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | rinsing.mp3 | 20-Apr-2007 13:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | rinse.mp3 | 20-Apr-2007 13:35 | 5.7K | |
![[SND]](/icons/sound2.gif) | rinnotama.mp3 | 20-Apr-2007 13:35 | 17K | |
![[SND]](/icons/sound2.gif) | rinkytink.mp3 | 20-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | rinky-dink.mp3 | 20-Apr-2007 13:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | rinkydink.mp3 | 20-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | rinktumditty.mp3 | 20-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | rinkhals.mp3 | 20-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | rink.mp3 | 20-Apr-2007 13:34 | 4.8K | |
![[SND]](/icons/sound2.gif) | ringworm.mp3 | 20-Apr-2007 13:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | ringtoss.mp3 | 20-Apr-2007 13:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | ringtaw.mp3 | 20-Apr-2007 13:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | ring-tailed.mp3 | 20-Apr-2007 13:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | ringtail.mp3 | 20-Apr-2007 13:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | ringstraked.mp3 | 20-Apr-2007 13:34 | 10K | |
![[SND]](/icons/sound2.gif) | ringster.mp3 | 20-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | ringside.mp3 | 20-Apr-2007 13:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | ring-porous.mp3 | 20-Apr-2007 13:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | ringporous.mp3 | 20-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | ringofthenibelung.mp3 | 20-Apr-2007 13:34 | 17K | |
![[SND]](/icons/sound2.gif) | ringo.mp3 | 20-Apr-2007 13:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | ring-necked.mp3 | 20-Apr-2007 13:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | ring-neck.mp3 | 20-Apr-2007 13:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | ringneck.mp3 | 20-Apr-2007 13:34 | 7.0K | |
![[SND]](/icons/sound2.gif) | ringmaster.mp3 | 20-Apr-2007 13:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | ringling.mp3 | 20-Apr-2007 13:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | ringlike.mp3 | 20-Apr-2007 13:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | ringlet.mp3 | 20-Apr-2007 13:34 | 6.1K | |
![[SND]](/icons/sound2.gif) | ringleader.mp3 | 20-Apr-2007 13:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | ringingly.mp3 | 20-Apr-2007 13:34 | 7.5K | |
![[SND]](/icons/sound2.gif) | ringing.mp3 | 20-Apr-2007 13:33 | 5.9K | |
![[SND]](/icons/sound2.gif) | ringhals.mp3 | 20-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | ringgit.mp3 | 20-Apr-2007 13:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | ringerssolution.mp3 | 20-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | Ringer's solution.mp3 | 20-Apr-2007 13:33 | 11K | |
![[SND]](/icons/sound2.gif) | ringer.mp3 | 20-Apr-2007 13:33 | 5.7K | |
![[SND]](/icons/sound2.gif) | ringent.mp3 | 20-Apr-2007 13:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | ringed.mp3 | 20-Apr-2007 13:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | ringdove.mp3 | 20-Apr-2007 13:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | ringding.mp3 | 20-Apr-2007 13:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | ringdangdo.mp3 | 20-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | ringbone.mp3 | 20-Apr-2007 13:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | ringbolt.mp3 | 20-Apr-2007 13:33 | 7.3K | |
![[SND]](/icons/sound2.gif) | ringbark.mp3 | 20-Apr-2007 13:33 | 7.0K | |
![[SND]](/icons/sound2.gif) | ring-around-the-rosy.mp3 | 20-Apr-2007 13:33 | 13K | |
![[SND]](/icons/sound2.gif) | ringaroundtherosey.mp3 | 20-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | ring-around-a-rosy.mp3 | 20-Apr-2007 13:33 | 13K | |
![[SND]](/icons/sound2.gif) | ring-a-lievo.mp3 | 20-Apr-2007 13:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | ringalievio.mp3 | 20-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | ring-a-levio.mp3 | 20-Apr-2007 13:33 | 10K | |
![[SND]](/icons/sound2.gif) | ringading.mp3 | 20-Apr-2007 13:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | ring.mp3 | 20-Apr-2007 13:33 | 6.4K | |
![[SND]](/icons/sound2.gif) | rinforzando.mp3 | 20-Apr-2007 13:33 | 17K | |
![[SND]](/icons/sound2.gif) | rinehart.mp3 | 20-Apr-2007 13:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | rinderpest.mp3 | 20-Apr-2007 13:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | rinded.mp3 | 20-Apr-2007 13:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | rind.mp3 | 20-Apr-2007 13:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | rinctum.mp3 | 20-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | rinceau.mp3 | 20-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | rina.mp3 | 20-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | rimy.mp3 | 20-Apr-2007 13:32 | 5.9K | |
![[SND]](/icons/sound2.gif) | rimu.mp3 | 20-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rimsky-Korsakov.mp3 | 20-Apr-2007 13:32 | 12K | |
![[SND]](/icons/sound2.gif) | rimskykorsakov.mp3 | 20-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | rimrock.mp3 | 20-Apr-2007 13:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | rimple.mp3 | 20-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rimouski.mp3 | 20-Apr-2007 13:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | rimose.mp3 | 20-Apr-2007 13:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | rimmon.mp3 | 20-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | rimmed.mp3 | 20-Apr-2007 13:32 | 6.1K | |
![[SND]](/icons/sound2.gif) | rimless.mp3 | 20-Apr-2007 13:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | rimland.mp3 | 20-Apr-2007 13:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rimini.mp3 | 20-Apr-2007 13:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | rimfire.mp3 | 20-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | rimesuffisante.mp3 | 20-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | rimester.mp3 | 20-Apr-2007 13:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | rimeriche.mp3 | 20-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | rime.mp3 | 20-Apr-2007 13:32 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rimbaud.mp3 | 20-Apr-2007 13:32 | 7.5K | |
![[SND]](/icons/sound2.gif) | rimaye.mp3 | 20-Apr-2007 13:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | rimadonna.mp3 | 20-Apr-2007 13:32 | 17K | |
![[SND]](/icons/sound2.gif) | Rimac.mp3 | 20-Apr-2007 13:32 | 7.0K | |
![[SND]](/icons/sound2.gif) | rima.mp3 | 20-Apr-2007 13:32 | 7.9K | |
![[SND]](/icons/sound2.gif) | rim.mp3 | 20-Apr-2007 13:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | rilling.mp3 | 20-Apr-2007 13:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | rillettes.mp3 | 20-Apr-2007 13:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | rillet.mp3 | 20-Apr-2007 13:31 | 5.5K | |
![[SND]](/icons/sound2.gif) | rille.mp3 | 20-Apr-2007 13:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | rill.mp3 | 20-Apr-2007 13:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | Rilke.mp3 | 20-Apr-2007 13:31 | 5.4K | |
![[SND]](/icons/sound2.gif) | rilievo.mp3 | 20-Apr-2007 13:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | riley.mp3 | 20-Apr-2007 13:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | rile.mp3 | 20-Apr-2007 13:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | Riksmal.mp3 | 20-Apr-2007 13:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | Riksmaal.mp3 | 20-Apr-2007 13:31 | 7.7K | |
![[SND]](/icons/sound2.gif) | riksdag.mp3 | 20-Apr-2007 13:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | rikkitikkitavi.mp3 | 20-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | rikisha.mp3 | 20-Apr-2007 13:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rijswijk.mp3 | 20-Apr-2007 13:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | rijsttafel.mp3 | 20-Apr-2007 13:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rijn.mp3 | 20-Apr-2007 13:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | rijksmuseum.mp3 | 20-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | rijksdaalder.mp3 | 20-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | rijeka.mp3 | 20-Apr-2007 13:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | Riis.mp3 | 20-Apr-2007 13:31 | 5.7K | |
![[SND]](/icons/sound2.gif) | rigveda.mp3 | 20-Apr-2007 13:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | rigsdaler.mp3 | 20-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | rigsdag.mp3 | 20-Apr-2007 13:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | rigorous.mp3 | 20-Apr-2007 13:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | rigormortis.mp3 | 20-Apr-2007 13:31 | 17K | |
![[SND]](/icons/sound2.gif) | rigoristic.mp3 | 20-Apr-2007 13:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | rigorist.mp3 | 20-Apr-2007 13:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | rigorism.mp3 | 20-Apr-2007 13:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | rigor.mp3 | 20-Apr-2007 13:30 | 5.4K | |
![[SND]](/icons/sound2.gif) | rigor mortis.mp3 | 20-Apr-2007 13:30 | 11K | |
![[SND]](/icons/sound2.gif) | rigoletto.mp3 | 20-Apr-2007 13:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | rigolet.mp3 | 20-Apr-2007 13:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | rigmatick.mp3 | 20-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | rigmarole.mp3 | 20-Apr-2007 13:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | rigman.mp3 | 20-Apr-2007 13:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | rigilkentaurus.mp3 | 20-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | rigidize.mp3 | 20-Apr-2007 13:30 | 8.8K | |
![[SND]](/icons/sound2.gif) | rigidity.mp3 | 20-Apr-2007 13:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | rigidify.mp3 | 20-Apr-2007 13:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | rigidification.mp3 | 20-Apr-2007 13:30 | 12K | |
![[SND]](/icons/sound2.gif) | rigid.mp3 | 20-Apr-2007 13:30 | 5.4K | |
![[SND]](/icons/sound2.gif) | rigi.mp3 | 20-Apr-2007 13:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | rightyo.mp3 | 20-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | righty.mp3 | 20-Apr-2007 13:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | right-winger.mp3 | 20-Apr-2007 13:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | right-wing.mp3 | 20-Apr-2007 13:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | rightward.mp3 | 20-Apr-2007 13:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | right-to-lifer.mp3 | 20-Apr-2007 13:30 | 11K | |
![[SND]](/icons/sound2.gif) | right-to-life.mp3 | 20-Apr-2007 13:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | righttochoose.mp3 | 20-Apr-2007 13:30 | 17K | |
![[SND]](/icons/sound2.gif) | rightsize.mp3 | 20-Apr-2007 13:30 | 9.6K | |
![[SND]](/icons/sound2.gif) | rights.mp3 | 20-Apr-2007 13:30 | 8.6K | |
![[SND]](/icons/sound2.gif) | right-of-way.mp3 | 20-Apr-2007 13:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | righto.mp3 | 20-Apr-2007 13:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | rightness.mp3 | 20-Apr-2007 13:29 | 8.8K | |
![[SND]](/icons/sound2.gif) | rightmost.mp3 | 20-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | right-minded.mp3 | 20-Apr-2007 13:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | rightly.mp3 | 20-Apr-2007 13:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | rightless.mp3 | 20-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | rightist.mp3 | 20-Apr-2007 13:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | rightism.mp3 | 20-Apr-2007 13:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | rightish.mp3 | 20-Apr-2007 13:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | rightio.mp3 | 20-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | right-hander.mp3 | 20-Apr-2007 13:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | right-handed.mp3 | 20-Apr-2007 13:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | right-hand.mp3 | 20-Apr-2007 13:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | rightfully.mp3 | 20-Apr-2007 13:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | rightful.mp3 | 20-Apr-2007 13:29 | 6.4K | |
![[SND]](/icons/sound2.gif) | righter.mp3 | 20-Apr-2007 13:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | righteousness.mp3 | 20-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | righteous.mp3 | 20-Apr-2007 13:29 | 6.8K | |
![[SND]](/icons/sound2.gif) | righten.mp3 | 20-Apr-2007 13:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | right-brained.mp3 | 20-Apr-2007 13:29 | 14K | |
![[SND]](/icons/sound2.gif) | right-angled.mp3 | 20-Apr-2007 13:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | right-angle.mp3 | 20-Apr-2007 13:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | rightable.mp3 | 20-Apr-2007 13:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | right.mp3 | 20-Apr-2007 13:29 | 5.2K | |
![[SND]](/icons/sound2.gif) | riggsdisease.mp3 | 20-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | rigging.mp3 | 20-Apr-2007 13:29 | 5.9K | |
![[SND]](/icons/sound2.gif) | rigger.mp3 | 20-Apr-2007 13:29 | 5.5K | |
![[SND]](/icons/sound2.gif) | rigelkentaurus.mp3 | 20-Apr-2007 13:29 | 17K | |
![[SND]](/icons/sound2.gif) | Rigel.mp3 | 20-Apr-2007 13:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | rigaudon.mp3 | 20-Apr-2007 13:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | rigatoni.mp3 | 20-Apr-2007 13:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | rigamarole.mp3 | 20-Apr-2007 13:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | rigadoon.mp3 | 20-Apr-2007 13:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | Riga.mp3 | 20-Apr-2007 13:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | rig.mp3 | 20-Apr-2007 13:28 | 4.8K | |
![[SND]](/icons/sound2.gif) | riftvalleyfever.mp3 | 20-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | rift.mp3 | 20-Apr-2007 13:28 | 5.4K | |
![[SND]](/icons/sound2.gif) | rifling.mp3 | 20-Apr-2007 13:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | riflery.mp3 | 20-Apr-2007 13:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | rifler.mp3 | 20-Apr-2007 13:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | rifleman.mp3 | 20-Apr-2007 13:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | riflebird.mp3 | 20-Apr-2007 13:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | rifle.mp3 | 20-Apr-2007 13:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | riffraff.mp3 | 20-Apr-2007 13:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | riffling.mp3 | 20-Apr-2007 13:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | riffler.mp3 | 20-Apr-2007 13:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | riffle.mp3 | 20-Apr-2007 13:28 | 5.5K | |
![[SND]](/icons/sound2.gif) | riffed.mp3 | 20-Apr-2007 13:28 | 8.6K | |
![[SND]](/icons/sound2.gif) | riff.mp3 | 20-Apr-2007 13:28 | 5.2K | |
![[SND]](/icons/sound2.gif) | rife.mp3 | 20-Apr-2007 13:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | rifamycin.mp3 | 20-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | rifampin.mp3 | 20-Apr-2007 13:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | rifampicin.mp3 | 20-Apr-2007 13:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | rifaiya.mp3 | 20-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | rifacimento.mp3 | 20-Apr-2007 13:28 | 17K | |
![[SND]](/icons/sound2.gif) | rif.mp3 | 20-Apr-2007 13:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | riever.mp3 | 20-Apr-2007 13:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | rievaulxabbey.mp3 | 20-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | rietveld.mp3 | 20-Apr-2007 13:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | rieszspace.mp3 | 20-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | Riesman.mp3 | 20-Apr-2007 13:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | Riesling.mp3 | 20-Apr-2007 13:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | Rienzo.mp3 | 20-Apr-2007 13:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | rienzi.mp3 | 20-Apr-2007 13:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | riennevaplus.mp3 | 20-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | riempie.mp3 | 20-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | riemannstieltjesintegral.mp3 | 20-Apr-2007 13:27 | 27K | |
![[SND]](/icons/sound2.gif) | riemanniangeometry.mp3 | 20-Apr-2007 13:27 | 18K | |
![[SND]](/icons/sound2.gif) | Riemannian.mp3 | 20-Apr-2007 13:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | Riemannian geometry.mp3 | 20-Apr-2007 13:27 | 15K | |
![[SND]](/icons/sound2.gif) | Riemann.mp3 | 20-Apr-2007 13:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | Riemann integral.mp3 | 20-Apr-2007 13:27 | 12K | |
![[SND]](/icons/sound2.gif) | riel.mp3 | 20-Apr-2007 13:27 | 6.6K | |
![[SND]](/icons/sound2.gif) | Rieka.mp3 | 20-Apr-2007 13:27 | 7.0K | |
![[SND]](/icons/sound2.gif) | riefenstahl.mp3 | 20-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | riebeckite.mp3 | 20-Apr-2007 13:27 | 17K | |
![[SND]](/icons/sound2.gif) | rie.mp3 | 20-Apr-2007 13:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | ridotto.mp3 | 20-Apr-2007 13:27 | 7.3K | |
![[SND]](/icons/sound2.gif) | ridley.mp3 | 20-Apr-2007 13:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | riding.mp3 | 20-Apr-2007 13:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | ridiculous.mp3 | 20-Apr-2007 13:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | Riding Mountain National Park.mp3 | 20-Apr-2007 13:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | ridicule.mp3 | 20-Apr-2007 13:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | ridic.mp3 | 20-Apr-2007 13:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | ridgy.mp3 | 20-Apr-2007 13:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | ridgling.mp3 | 20-Apr-2007 13:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | Ridgewood.mp3 | 20-Apr-2007 13:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | ridgeways.mp3 | 20-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | ridgeway.mp3 | 20-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | ridgetop.mp3 | 20-Apr-2007 13:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | ridgepole.mp3 | 20-Apr-2007 13:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | ridgeling.mp3 | 20-Apr-2007 13:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | ridgeline.mp3 | 20-Apr-2007 13:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ridgefield.mp3 | 20-Apr-2007 13:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | ridged.mp3 | 20-Apr-2007 13:26 | 6.1K | |
![[SND]](/icons/sound2.gif) | Ridgecrest.mp3 | 20-Apr-2007 13:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | ridge.mp3 | 20-Apr-2007 13:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | ridership.mp3 | 20-Apr-2007 13:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | riderless.mp3 | 20-Apr-2007 13:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | rider.mp3 | 20-Apr-2007 13:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | rident.mp3 | 20-Apr-2007 13:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rideau Canal.mp3 | 20-Apr-2007 13:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | rideable.mp3 | 20-Apr-2007 13:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | ride.mp3 | 20-Apr-2007 13:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | riddling.mp3 | 20-Apr-2007 13:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | riddler.mp3 | 20-Apr-2007 13:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | riddle.mp3 | 20-Apr-2007 13:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | ridden.mp3 | 20-Apr-2007 13:26 | 5.4K | |
![[SND]](/icons/sound2.gif) | riddance.mp3 | 20-Apr-2007 13:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | ridaura.mp3 | 20-Apr-2007 13:26 | 17K | |
![[SND]](/icons/sound2.gif) | ridable.mp3 | 20-Apr-2007 13:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | rid.mp3 | 20-Apr-2007 13:25 | 5.5K | |
![[SND]](/icons/sound2.gif) | rictus.mp3 | 20-Apr-2007 13:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | rictalbristle.mp3 | 20-Apr-2007 13:25 | 17K | |
![[SND]](/icons/sound2.gif) | rictal.mp3 | 20-Apr-2007 13:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | ricrac.mp3 | 20-Apr-2007 13:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | ricotta.mp3 | 20-Apr-2007 13:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | ricoeur.mp3 | 20-Apr-2007 13:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | ricochetting.mp3 | 20-Apr-2007 13:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | ricochetted.mp3 | 20-Apr-2007 13:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | ricocheting.mp3 | 20-Apr-2007 13:25 | 9.8K | |
![[SND]](/icons/sound2.gif) | ricocheted.mp3 | 20-Apr-2007 13:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | ricochet.mp3 | 20-Apr-2007 13:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | rickytick.mp3 | 20-Apr-2007 13:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | ricky.mp3 | 20-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | rickshaw.mp3 | 20-Apr-2007 13:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | ricksha.mp3 | 20-Apr-2007 13:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | rickrack.mp3 | 20-Apr-2007 13:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | Rickover.mp3 | 20-Apr-2007 13:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | rickle.mp3 | 20-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | rickey.mp3 | 20-Apr-2007 13:25 | 5.9K | |
![[SND]](/icons/sound2.gif) | rickety.mp3 | 20-Apr-2007 13:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | rickettsial.mp3 | 20-Apr-2007 13:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | rickettsiae.mp3 | 20-Apr-2007 13:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | rickettsia.mp3 | 20-Apr-2007 13:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | rickets.mp3 | 20-Apr-2007 13:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | ricker.mp3 | 20-Apr-2007 13:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rickenbacker.mp3 | 20-Apr-2007 13:25 | 8.0K | |
![[SND]](/icons/sound2.gif) | rick.mp3 | 20-Apr-2007 13:25 | 4.5K | |
![[SND]](/icons/sound2.gif) | ricinus.mp3 | 20-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | ricinolein.mp3 | 20-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | ricinoleic.mp3 | 20-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | ricinoleic acid.mp3 | 20-Apr-2007 13:24 | 14K | |
![[SND]](/icons/sound2.gif) | ricin.mp3 | 20-Apr-2007 13:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | Ricimer.mp3 | 20-Apr-2007 13:24 | 6.8K | |
![[SND]](/icons/sound2.gif) | richweed.mp3 | 20-Apr-2007 13:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | richthofen.mp3 | 20-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | Richter.mp3 | 20-Apr-2007 13:24 | 5.7K | |
![[SND]](/icons/sound2.gif) | Richter scale.mp3 | 20-Apr-2007 13:24 | 10K | |
![[SND]](/icons/sound2.gif) | Richmonder.mp3 | 20-Apr-2007 13:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | Richmond.mp3 | 20-Apr-2007 13:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | richly.mp3 | 20-Apr-2007 13:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | Richler.mp3 | 20-Apr-2007 13:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | Richland.mp3 | 20-Apr-2007 13:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | richie.mp3 | 20-Apr-2007 13:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | Richfield.mp3 | 20-Apr-2007 13:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | Richet.mp3 | 20-Apr-2007 13:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | riches.mp3 | 20-Apr-2007 13:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | richening.mp3 | 20-Apr-2007 13:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | richen.mp3 | 20-Apr-2007 13:24 | 5.9K | |
![[SND]](/icons/sound2.gif) | Richelieu.mp3 | 20-Apr-2007 13:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | Richardson.mp3 | 20-Apr-2007 13:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | richards.mp3 | 20-Apr-2007 13:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | richardroe.mp3 | 20-Apr-2007 13:24 | 17K | |
![[SND]](/icons/sound2.gif) | Richard Roe.mp3 | 20-Apr-2007 13:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | Richard.mp3 | 20-Apr-2007 13:24 | 5.4K | |
![[SND]](/icons/sound2.gif) | rich.mp3 | 20-Apr-2007 13:24 | 5.5K | |
![[SND]](/icons/sound2.gif) | ricey.mp3 | 20-Apr-2007 13:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | ricercari.mp3 | 20-Apr-2007 13:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | ricercare.mp3 | 20-Apr-2007 13:23 | 9.6K | |
![[SND]](/icons/sound2.gif) | ricercar.mp3 | 20-Apr-2007 13:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | ricer.mp3 | 20-Apr-2007 13:23 | 5.5K | |
![[SND]](/icons/sound2.gif) | ricekrispies.mp3 | 20-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | ricebird.mp3 | 20-Apr-2007 13:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | ricearoni.mp3 | 20-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | rice.mp3 | 20-Apr-2007 13:23 | 6.1K | |
![[SND]](/icons/sound2.gif) | Riccio.mp3 | 20-Apr-2007 13:23 | 7.1K | |
![[SND]](/icons/sound2.gif) | ricci.mp3 | 20-Apr-2007 13:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | riccatiequation.mp3 | 20-Apr-2007 13:23 | 17K | |
![[SND]](/icons/sound2.gif) | Ricardo.mp3 | 20-Apr-2007 13:23 | 7.3K | |
![[SND]](/icons/sound2.gif) | ricardiantheoryofrent.mp3 | 20-Apr-2007 13:23 | 27K | |
![[SND]](/icons/sound2.gif) | ricard.mp3 | 20-Apr-2007 13:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | ribwort.mp3 | 20-Apr-2007 13:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | ribozyme.mp3 | 20-Apr-2007 13:23 | 8.8K | |
![[SND]](/icons/sound2.gif) | ribozo.mp3 | 20-Apr-2007 13:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | ribosome.mp3 | 20-Apr-2007 13:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | ribosomalrna.mp3 | 20-Apr-2007 13:23 | 27K | |
![[SND]](/icons/sound2.gif) | ribosomal.mp3 | 20-Apr-2007 13:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | riboso.mp3 | 20-Apr-2007 13:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | ribose.mp3 | 20-Apr-2007 13:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | ribonucleotide.mp3 | 20-Apr-2007 13:23 | 13K | |
![[SND]](/icons/sound2.gif) | ribonucleoside.mp3 | 20-Apr-2007 13:23 | 12K | |
![[SND]](/icons/sound2.gif) | ribonucleoprotein.mp3 | 20-Apr-2007 13:23 | 15K | |
![[SND]](/icons/sound2.gif) | ribonucleic acid.mp3 | 20-Apr-2007 13:23 | 15K | |
![[SND]](/icons/sound2.gif) | ribonuclease.mp3 | 20-Apr-2007 13:22 | 11K | |
![[SND]](/icons/sound2.gif) | riboflavin.mp3 | 20-Apr-2007 13:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | ribo.mp3 | 20-Apr-2007 13:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | riblet.mp3 | 20-Apr-2007 13:22 | 5.5K | |
![[SND]](/icons/sound2.gif) | ribless.mp3 | 20-Apr-2007 13:22 | 17K | |
![[SND]](/icons/sound2.gif) | ribgrass.mp3 | 20-Apr-2007 13:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | ribes.mp3 | 20-Apr-2007 13:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | Ribera.mp3 | 20-Apr-2007 13:22 | 6.3K | |
![[SND]](/icons/sound2.gif) | ribena.mp3 | 20-Apr-2007 13:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | ribeiraopreto.mp3 | 20-Apr-2007 13:22 | 17K | |
![[SND]](/icons/sound2.gif) | Ribeirao Preto.mp3 | 20-Apr-2007 13:22 | 13K | |
![[SND]](/icons/sound2.gif) | ribby.mp3 | 20-Apr-2007 13:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | ribbonlike.mp3 | 20-Apr-2007 13:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | ribbonfish.mp3 | 20-Apr-2007 13:22 | 9.6K | |
![[SND]](/icons/sound2.gif) | ribboned.mp3 | 20-Apr-2007 13:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | ribbon.mp3 | 20-Apr-2007 13:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | ribblerabble.mp3 | 20-Apr-2007 13:22 | 17K | |
![[SND]](/icons/sound2.gif) | ribble.mp3 | 20-Apr-2007 13:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | ribbing.mp3 | 20-Apr-2007 13:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ribbentrop.mp3 | 20-Apr-2007 13:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | ribbed.mp3 | 20-Apr-2007 13:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | ribband.mp3 | 20-Apr-2007 13:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | ribavirin.mp3 | 20-Apr-2007 13:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | ribat.mp3 | 20-Apr-2007 13:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | riband.mp3 | 20-Apr-2007 13:22 | 6.1K | |
![[SND]](/icons/sound2.gif) | ribaldry.mp3 | 20-Apr-2007 13:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | ribald.mp3 | 20-Apr-2007 13:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | rib.mp3 | 20-Apr-2007 13:22 | 5.2K | |
![[SND]](/icons/sound2.gif) | riata.mp3 | 20-Apr-2007 13:21 | 6.4K | |
![[SND]](/icons/sound2.gif) | riantly.mp3 | 20-Apr-2007 13:21 | 7.3K | |
![[SND]](/icons/sound2.gif) | riant.mp3 | 20-Apr-2007 13:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | rialto.mp3 | 20-Apr-2007 13:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | rialomani.mp3 | 20-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | rial.mp3 | 20-Apr-2007 13:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | riah.mp3 | 20-Apr-2007 13:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | ria.mp3 | 20-Apr-2007 13:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhyton.mp3 | 20-Apr-2007 13:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | rhytidome.mp3 | 20-Apr-2007 13:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | rhytidectomy.mp3 | 20-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | rhythmize.mp3 | 20-Apr-2007 13:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | rhythmization.mp3 | 20-Apr-2007 13:21 | 9.8K | |
![[SND]](/icons/sound2.gif) | rhythmist.mp3 | 20-Apr-2007 13:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | rhythmics.mp3 | 20-Apr-2007 13:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhythmicity.mp3 | 20-Apr-2007 13:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhythmically.mp3 | 20-Apr-2007 13:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | rhythmical.mp3 | 20-Apr-2007 13:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | rhythmic.mp3 | 20-Apr-2007 13:21 | 6.3K | |
![[SND]](/icons/sound2.gif) | rhythm.mp3 | 20-Apr-2007 13:21 | 5.4K | |
![[SND]](/icons/sound2.gif) | rhyta.mp3 | 20-Apr-2007 13:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhys.mp3 | 20-Apr-2007 13:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhyolitic.mp3 | 20-Apr-2007 13:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | rhyolite.mp3 | 20-Apr-2007 13:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhynchophore.mp3 | 20-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | rhynchocephalian.mp3 | 20-Apr-2007 13:21 | 13K | |
![[SND]](/icons/sound2.gif) | rhymist.mp3 | 20-Apr-2007 13:21 | 17K | |
![[SND]](/icons/sound2.gif) | rhymester.mp3 | 20-Apr-2007 13:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | rhymer.mp3 | 20-Apr-2007 13:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhyme.mp3 | 20-Apr-2007 13:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | rhyme royal.mp3 | 20-Apr-2007 13:20 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rhyl.mp3 | 20-Apr-2007 13:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | rhyacolite.mp3 | 20-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | rhus.mp3 | 20-Apr-2007 13:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | rhumbs.mp3 | 20-Apr-2007 13:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | rhumbatron.mp3 | 20-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | rhumba.mp3 | 20-Apr-2007 13:20 | 5.5K | |
![[SND]](/icons/sound2.gif) | rhumb.mp3 | 20-Apr-2007 13:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | rhum.mp3 | 20-Apr-2007 13:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhubarb.mp3 | 20-Apr-2007 13:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rh-positive.mp3 | 20-Apr-2007 13:20 | 11K | |
![[SND]](/icons/sound2.gif) | rhotic.mp3 | 20-Apr-2007 13:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhotacize.mp3 | 20-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | rhotacism.mp3 | 20-Apr-2007 13:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhopalidbug.mp3 | 20-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | rhonealpes.mp3 | 20-Apr-2007 13:20 | 17K | |
![[SND]](/icons/sound2.gif) | Rhone.mp3 | 20-Apr-2007 13:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rhondda.mp3 | 20-Apr-2007 13:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | rhonda.mp3 | 20-Apr-2007 13:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rhondda Cynon Taff.mp3 | 20-Apr-2007 13:20 | 10K | |
![[SND]](/icons/sound2.gif) | rhonchus.mp3 | 20-Apr-2007 13:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | rhonchi.mp3 | 20-Apr-2007 13:20 | 6.8K | |
![[SND]](/icons/sound2.gif) | rhombus.mp3 | 20-Apr-2007 13:20 | 7.1K | |
![[SND]](/icons/sound2.gif) | rhombs.mp3 | 20-Apr-2007 13:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | rhomboideus.mp3 | 20-Apr-2007 13:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | rhomboidei.mp3 | 20-Apr-2007 13:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | rhomboidal.mp3 | 20-Apr-2007 13:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhomboid.mp3 | 20-Apr-2007 13:19 | 7.7K | |
![[SND]](/icons/sound2.gif) | rhombohedron.mp3 | 20-Apr-2007 13:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | rhombohedral.mp3 | 20-Apr-2007 13:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | rhombohedra.mp3 | 20-Apr-2007 13:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | rhombo.mp3 | 20-Apr-2007 13:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhombic.mp3 | 20-Apr-2007 13:19 | 6.1K | |
![[SND]](/icons/sound2.gif) | rhombi.mp3 | 20-Apr-2007 13:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | rhombencephalon.mp3 | 20-Apr-2007 13:19 | 12K | |
![[SND]](/icons/sound2.gif) | rhomb.mp3 | 20-Apr-2007 13:19 | 5.5K | |
![[SND]](/icons/sound2.gif) | rhoecus.mp3 | 20-Apr-2007 13:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhoea.mp3 | 20-Apr-2007 13:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhodus.mp3 | 20-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | rhodos.mp3 | 20-Apr-2007 13:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhodora.mp3 | 20-Apr-2007 13:19 | 7.0K | |
![[SND]](/icons/sound2.gif) | rhodopsin.mp3 | 20-Apr-2007 13:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhodoplast.mp3 | 20-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | Rhodope.mp3 | 20-Apr-2007 13:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | rhodonite.mp3 | 20-Apr-2007 13:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | rhodomontade.mp3 | 20-Apr-2007 13:19 | 10K | |
![[SND]](/icons/sound2.gif) | rhodolite.mp3 | 20-Apr-2007 13:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | rhododendron.mp3 | 20-Apr-2007 13:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | rhodochrosite.mp3 | 20-Apr-2007 13:19 | 10K | |
![[SND]](/icons/sound2.gif) | rhodo.mp3 | 20-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | rhodium.mp3 | 20-Apr-2007 13:19 | 6.3K | |
![[SND]](/icons/sound2.gif) | rhodinal.mp3 | 20-Apr-2007 13:19 | 17K | |
![[SND]](/icons/sound2.gif) | rhodic.mp3 | 20-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rhodian.mp3 | 20-Apr-2007 13:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | rhodesoid.mp3 | 20-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | rhodesianman.mp3 | 20-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | Rhodesian.mp3 | 20-Apr-2007 13:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rhodesian ridgeback.mp3 | 20-Apr-2007 13:18 | 13K | |
![[SND]](/icons/sound2.gif) | Rhodesian man.mp3 | 20-Apr-2007 13:18 | 12K | |
![[SND]](/icons/sound2.gif) | Rhodesia.mp3 | 20-Apr-2007 13:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rhodes.mp3 | 20-Apr-2007 13:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | Rhodes scholar.mp3 | 20-Apr-2007 13:18 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rhodes grass.mp3 | 20-Apr-2007 13:18 | 11K | |
![[SND]](/icons/sound2.gif) | rhodeisland.mp3 | 20-Apr-2007 13:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhode.mp3 | 20-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rhode Island.mp3 | 20-Apr-2007 13:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | rhodamine.mp3 | 20-Apr-2007 13:18 | 7.1K | |
![[SND]](/icons/sound2.gif) | rhoda.mp3 | 20-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhod.mp3 | 20-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | rho.mp3 | 20-Apr-2007 13:18 | 5.7K | |
![[SND]](/icons/sound2.gif) | Rh-negative.mp3 | 20-Apr-2007 13:18 | 10K | |
![[SND]](/icons/sound2.gif) | rhizotomy.mp3 | 20-Apr-2007 13:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhizosphere.mp3 | 20-Apr-2007 13:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | rhizopus.mp3 | 20-Apr-2007 13:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | rhizopod.mp3 | 20-Apr-2007 13:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | rhizoplane.mp3 | 20-Apr-2007 13:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhizophagous.mp3 | 20-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | rhizomorphous.mp3 | 20-Apr-2007 13:18 | 17K | |
![[SND]](/icons/sound2.gif) | rhizomorph.mp3 | 20-Apr-2007 13:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhizomic.mp3 | 20-Apr-2007 13:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhizome.mp3 | 20-Apr-2007 13:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | rhizomatous.mp3 | 20-Apr-2007 13:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | rhizoma.mp3 | 20-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhizoidal.mp3 | 20-Apr-2007 13:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | rhizoid.mp3 | 20-Apr-2007 13:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | rhizoctonia.mp3 | 20-Apr-2007 13:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | rhizocephalan.mp3 | 20-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | rhizocarpous.mp3 | 20-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | rhizobium.mp3 | 20-Apr-2007 13:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | rhizobial.mp3 | 20-Apr-2007 13:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhizobia.mp3 | 20-Apr-2007 13:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | rhizo.mp3 | 20-Apr-2007 13:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhizic.mp3 | 20-Apr-2007 13:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhizanthous.mp3 | 20-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | rhiza.mp3 | 20-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhiz.mp3 | 20-Apr-2007 13:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhinovirus.mp3 | 20-Apr-2007 13:17 | 10K | |
![[SND]](/icons/sound2.gif) | rhinosporidium.mp3 | 20-Apr-2007 13:17 | 17K | |
![[SND]](/icons/sound2.gif) | rhinoscopy.mp3 | 20-Apr-2007 13:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhinorrhea.mp3 | 20-Apr-2007 13:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhinoplasty.mp3 | 20-Apr-2007 13:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | rhinology.mp3 | 20-Apr-2007 13:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhinoceros.mp3 | 20-Apr-2007 13:17 | 9.8K | |
![[SND]](/icons/sound2.gif) | rhinoceri.mp3 | 20-Apr-2007 13:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | rhino.mp3 | 20-Apr-2007 13:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | rhinitis.mp3 | 20-Apr-2007 13:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | rhinestoned.mp3 | 20-Apr-2007 13:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | rhinestone.mp3 | 20-Apr-2007 13:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhinencephalon.mp3 | 20-Apr-2007 13:16 | 11K | |
![[SND]](/icons/sound2.gif) | rhinencephalic.mp3 | 20-Apr-2007 13:16 | 11K | |
![[SND]](/icons/sound2.gif) | Rhinelander.mp3 | 20-Apr-2007 13:16 | 9.8K | |
![[SND]](/icons/sound2.gif) | Rhineland.mp3 | 20-Apr-2007 13:16 | 9.8K | |
![[SND]](/icons/sound2.gif) | rhinegravebreeches.mp3 | 20-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | Rhine.mp3 | 20-Apr-2007 13:16 | 7.1K | |
![[SND]](/icons/sound2.gif) | Rhine wine.mp3 | 20-Apr-2007 13:16 | 10K | |
![[SND]](/icons/sound2.gif) | rhinal.mp3 | 20-Apr-2007 13:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | Rhin.mp3 | 20-Apr-2007 13:16 | 4.8K | |
![[SND]](/icons/sound2.gif) | rhigolene.mp3 | 20-Apr-2007 13:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhiannon.mp3 | 20-Apr-2007 13:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rheydt.mp3 | 20-Apr-2007 13:16 | 6.3K | |
![[SND]](/icons/sound2.gif) | rhexis.mp3 | 20-Apr-2007 13:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | rheumy.mp3 | 20-Apr-2007 13:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | rheumatology.mp3 | 20-Apr-2007 13:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | rheumatologist.mp3 | 20-Apr-2007 13:16 | 11K | |
![[SND]](/icons/sound2.gif) | rheumatological.mp3 | 20-Apr-2007 13:16 | 11K | |
![[SND]](/icons/sound2.gif) | rheumatologic.mp3 | 20-Apr-2007 13:16 | 10K | |
![[SND]](/icons/sound2.gif) | rheumatoid.mp3 | 20-Apr-2007 13:16 | 8.4K | |
![[SND]](/icons/sound2.gif) | rheumatiz.mp3 | 20-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | rheumatism.mp3 | 20-Apr-2007 13:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | rheumaticky.mp3 | 20-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | rheumatically.mp3 | 20-Apr-2007 13:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | rheumatic.mp3 | 20-Apr-2007 13:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | rheum.mp3 | 20-Apr-2007 13:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | rhettbutler.mp3 | 20-Apr-2007 13:16 | 17K | |
![[SND]](/icons/sound2.gif) | rhetorician.mp3 | 20-Apr-2007 13:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | rhetorically.mp3 | 20-Apr-2007 13:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | rhetorical.mp3 | 20-Apr-2007 13:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | rhetoric.mp3 | 20-Apr-2007 13:15 | 5.9K | |
![[SND]](/icons/sound2.gif) | rhetor.mp3 | 20-Apr-2007 13:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | rhetic.mp3 | 20-Apr-2007 13:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhetian.mp3 | 20-Apr-2007 13:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhesusfactor.mp3 | 20-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | rhesus.mp3 | 20-Apr-2007 13:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | rhesus monkey.mp3 | 20-Apr-2007 13:15 | 10K | |
![[SND]](/icons/sound2.gif) | rheotropism.mp3 | 20-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | rheotron.mp3 | 20-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | rheotaxis.mp3 | 20-Apr-2007 13:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | rheostatic.mp3 | 20-Apr-2007 13:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | rheostat.mp3 | 20-Apr-2007 13:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | rheophilic.mp3 | 20-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | rheopexy.mp3 | 20-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | rheomorphism.mp3 | 20-Apr-2007 13:15 | 17K | |
![[SND]](/icons/sound2.gif) | rheometer.mp3 | 20-Apr-2007 13:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | rheology.mp3 | 20-Apr-2007 13:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | rheologist.mp3 | 20-Apr-2007 13:15 | 9.5K | |
![[SND]](/icons/sound2.gif) | rheologically.mp3 | 20-Apr-2007 13:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | rheological.mp3 | 20-Apr-2007 13:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | rheologic.mp3 | 20-Apr-2007 13:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | rheo.mp3 | 20-Apr-2007 13:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhenium.mp3 | 20-Apr-2007 13:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | Rhenish.mp3 | 20-Apr-2007 13:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | rhenic.mp3 | 20-Apr-2007 13:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhemishversion.mp3 | 20-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | rhemish.mp3 | 20-Apr-2007 13:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | rheme.mp3 | 20-Apr-2007 13:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhematic.mp3 | 20-Apr-2007 13:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | Rheinland-Pfalz.mp3 | 20-Apr-2007 13:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | rheinlandpfalz.mp3 | 20-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | Rheinland.mp3 | 20-Apr-2007 13:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | rheinhessen.mp3 | 20-Apr-2007 13:14 | 8.4K | |
![[SND]](/icons/sound2.gif) | rheingolddas.mp3 | 20-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | rheingau.mp3 | 20-Apr-2007 13:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rhein.mp3 | 20-Apr-2007 13:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | rheimsdouaybible.mp3 | 20-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | Rheims.mp3 | 20-Apr-2007 13:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rhegium.mp3 | 20-Apr-2007 13:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rhee.mp3 | 20-Apr-2007 13:14 | 5.0K | |
![[SND]](/icons/sound2.gif) | rheda.mp3 | 20-Apr-2007 13:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhebok.mp3 | 20-Apr-2007 13:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | rheasilvia.mp3 | 20-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | rhea.mp3 | 20-Apr-2007 13:14 | 5.2K | |
![[SND]](/icons/sound2.gif) | rhe.mp3 | 20-Apr-2007 13:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhdisease.mp3 | 20-Apr-2007 13:14 | 17K | |
![[SND]](/icons/sound2.gif) | rhathymia.mp3 | 20-Apr-2007 13:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhatany.mp3 | 20-Apr-2007 13:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhapsody.mp3 | 20-Apr-2007 13:14 | 7.1K | |
![[SND]](/icons/sound2.gif) | rhapsodize.mp3 | 20-Apr-2007 13:14 | 10K | |
![[SND]](/icons/sound2.gif) | rhapsodist.mp3 | 20-Apr-2007 13:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhapsodically.mp3 | 20-Apr-2007 13:14 | 9.6K | |
![[SND]](/icons/sound2.gif) | rhapsodical.mp3 | 20-Apr-2007 13:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | rhapsodic.mp3 | 20-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhapsode.mp3 | 20-Apr-2007 13:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | rhaphe.mp3 | 20-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhamphotheca.mp3 | 20-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | rhamnus.mp3 | 20-Apr-2007 13:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | rhamnose.mp3 | 20-Apr-2007 13:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | rhamnaceous.mp3 | 20-Apr-2007 13:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | rhamadhan.mp3 | 20-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | rhagia.mp3 | 20-Apr-2007 13:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rhagae.mp3 | 20-Apr-2007 13:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rhaeto-Romanic.mp3 | 20-Apr-2007 13:13 | 9.6K | |
![[SND]](/icons/sound2.gif) | rhaetoromanic.mp3 | 20-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | Rhaeto-Romance.mp3 | 20-Apr-2007 13:13 | 11K | |
![[SND]](/icons/sound2.gif) | rhaetic.mp3 | 20-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | Rhaetian.mp3 | 20-Apr-2007 13:13 | 6.8K | |
![[SND]](/icons/sound2.gif) | rhaetia.mp3 | 20-Apr-2007 13:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | rhadamanthys.mp3 | 20-Apr-2007 13:13 | 17K | |
![[SND]](/icons/sound2.gif) | Rhadamanthus.mp3 | 20-Apr-2007 13:13 | 10K | |
![[SND]](/icons/sound2.gif) | rhadamanthine.mp3 | 20-Apr-2007 13:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | rhachis.mp3 | 20-Apr-2007 13:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | rhabdovirus.mp3 | 20-Apr-2007 13:13 | 11K | |
![[SND]](/icons/sound2.gif) | rhabdomyosarcoma.mp3 | 20-Apr-2007 13:13 | 16K | |
![[SND]](/icons/sound2.gif) | rhabdomyolysis.mp3 | 20-Apr-2007 13:13 | 14K | |
![[SND]](/icons/sound2.gif) | rhabdomere.mp3 | 20-Apr-2007 13:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhabdome.mp3 | 20-Apr-2007 13:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | rhabdomancy.mp3 | 20-Apr-2007 13:13 | 9.1K | |
![[SND]](/icons/sound2.gif) | rhabdomancer.mp3 | 20-Apr-2007 13:12 | 9.8K | |
![[SND]](/icons/sound2.gif) | rhabdom.mp3 | 20-Apr-2007 13:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | rhabdocoele.mp3 | 20-Apr-2007 13:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | rhabdo.mp3 | 20-Apr-2007 13:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rh.mp3 | 20-Apr-2007 13:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rh factor.mp3 | 20-Apr-2007 13:12 | 11K | |
![[SND]](/icons/sound2.gif) | rezone.mp3 | 20-Apr-2007 13:12 | 27K | |
![[SND]](/icons/sound2.gif) | rezdechaussee.mp3 | 20-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | rezaiyeh.mp3 | 20-Apr-2007 13:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | Reza.'a.yeh.mp3 | 20-Apr-2007 13:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | Reza Shah Pahlavi.mp3 | 20-Apr-2007 13:12 | 15K | |
![[SND]](/icons/sound2.gif) | Reynosa.mp3 | 20-Apr-2007 13:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Reynoldsburg.mp3 | 20-Apr-2007 13:12 | 10K | |
![[SND]](/icons/sound2.gif) | Reynolds number.mp3 | 20-Apr-2007 13:12 | 11K | |
![[SND]](/icons/sound2.gif) | Reynolds.mp3 | 20-Apr-2007 13:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | reynold.mp3 | 20-Apr-2007 13:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Reynaud.mp3 | 20-Apr-2007 13:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | reynard.mp3 | 20-Apr-2007 13:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | Reymont.mp3 | 20-Apr-2007 13:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | Reykjavik.mp3 | 20-Apr-2007 13:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | reyessyndrome.mp3 | 20-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | Reyes, Point.mp3 | 20-Apr-2007 13:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | Reye's syndrome.mp3 | 20-Apr-2007 13:12 | 13K | |
![[SND]](/icons/sound2.gif) | rey.mp3 | 20-Apr-2007 13:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rexroth.mp3 | 20-Apr-2007 13:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | rexist.mp3 | 20-Apr-2007 13:12 | 17K | |
![[SND]](/icons/sound2.gif) | rexine.mp3 | 20-Apr-2007 13:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | rex.mp3 | 20-Apr-2007 13:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | rewrote.mp3 | 20-Apr-2007 13:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | rewritten.mp3 | 20-Apr-2007 13:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | rewriting.mp3 | 20-Apr-2007 13:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | rewriteman.mp3 | 20-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | rewrite.mp3 | 20-Apr-2007 13:11 | 5.9K | |
![[SND]](/icons/sound2.gif) | rewrite rule.mp3 | 20-Apr-2007 13:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | rewrite man.mp3 | 20-Apr-2007 13:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | rewound.mp3 | 20-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | reworkedwool.mp3 | 20-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | rework.mp3 | 20-Apr-2007 13:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | reword.mp3 | 20-Apr-2007 13:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | rewoken.mp3 | 20-Apr-2007 13:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | rewoke.mp3 | 20-Apr-2007 13:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | rewind.mp3 | 20-Apr-2007 13:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | rewin.mp3 | 20-Apr-2007 13:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | rewarewa.mp3 | 20-Apr-2007 13:11 | 17K | |
![[SND]](/icons/sound2.gif) | rewarding.mp3 | 20-Apr-2007 13:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | rewardable.mp3 | 20-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | reward.mp3 | 20-Apr-2007 13:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | rewaken.mp3 | 20-Apr-2007 13:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | rewake.mp3 | 20-Apr-2007 13:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | revulsive.mp3 | 20-Apr-2007 13:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | revulsion.mp3 | 20-Apr-2007 13:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | revulsed.mp3 | 20-Apr-2007 13:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | revulsant.mp3 | 20-Apr-2007 13:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | revue.mp3 | 20-Apr-2007 13:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | revolving.mp3 | 20-Apr-2007 13:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | revolver.mp3 | 20-Apr-2007 13:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | revolve.mp3 | 20-Apr-2007 13:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | revolvable.mp3 | 20-Apr-2007 13:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | revolutionize.mp3 | 20-Apr-2007 13:10 | 11K | |
![[SND]](/icons/sound2.gif) | revolutionist.mp3 | 20-Apr-2007 13:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | revolutionary.mp3 | 20-Apr-2007 13:10 | 10K | |
![[SND]](/icons/sound2.gif) | revolutionariness.mp3 | 20-Apr-2007 13:10 | 13K | |
![[SND]](/icons/sound2.gif) | revolutionarily.mp3 | 20-Apr-2007 13:10 | 12K | |
![[SND]](/icons/sound2.gif) | revolution.mp3 | 20-Apr-2007 13:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | revolute.mp3 | 20-Apr-2007 13:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | revolting.mp3 | 20-Apr-2007 13:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | revolt.mp3 | 20-Apr-2007 13:10 | 6.6K | |
![[SND]](/icons/sound2.gif) | revoke.mp3 | 20-Apr-2007 13:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | revokable.mp3 | 20-Apr-2007 13:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | revocation.mp3 | 20-Apr-2007 13:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | revocable.mp3 | 20-Apr-2007 13:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | revlon.mp3 | 20-Apr-2007 13:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | revivor.mp3 | 20-Apr-2007 13:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | reviviscent.mp3 | 20-Apr-2007 13:10 | 9.6K | |
![[SND]](/icons/sound2.gif) | reviviscence.mp3 | 20-Apr-2007 13:10 | 10K | |
![[SND]](/icons/sound2.gif) | revivify.mp3 | 20-Apr-2007 13:10 | 9.5K | |
![[SND]](/icons/sound2.gif) | revivification.mp3 | 20-Apr-2007 13:10 | 11K | |
![[SND]](/icons/sound2.gif) | reviver.mp3 | 20-Apr-2007 13:10 | 17K | |
![[SND]](/icons/sound2.gif) | revive.mp3 | 20-Apr-2007 13:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | revivalistic.mp3 | 20-Apr-2007 13:10 | 10K | |
![[SND]](/icons/sound2.gif) | revivalist.mp3 | 20-Apr-2007 13:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | revivalism.mp3 | 20-Apr-2007 13:10 | 9.8K | |
![[SND]](/icons/sound2.gif) | revival.mp3 | 20-Apr-2007 13:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | revivable.mp3 | 20-Apr-2007 13:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | revitalize.mp3 | 20-Apr-2007 13:09 | 11K | |
![[SND]](/icons/sound2.gif) | revitalization.mp3 | 20-Apr-2007 13:09 | 11K | |
![[SND]](/icons/sound2.gif) | revisory.mp3 | 20-Apr-2007 13:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | revisor.mp3 | 20-Apr-2007 13:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | revisit.mp3 | 20-Apr-2007 13:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | revisionist.mp3 | 20-Apr-2007 13:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | revisionism.mp3 | 20-Apr-2007 13:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | revisionary.mp3 | 20-Apr-2007 13:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | revision.mp3 | 20-Apr-2007 13:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | revise.mp3 | 20-Apr-2007 13:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | revisal.mp3 | 20-Apr-2007 13:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | revisable.mp3 | 20-Apr-2007 13:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | Revillagigedo.mp3 | 20-Apr-2007 13:09 | 14K | |
![[SND]](/icons/sound2.gif) | Revillagigedo Island.mp3 | 20-Apr-2007 13:09 | 12K | |
![[SND]](/icons/sound2.gif) | revilement.mp3 | 20-Apr-2007 13:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | revile.mp3 | 20-Apr-2007 13:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | reviewer.mp3 | 20-Apr-2007 13:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | reviewal.mp3 | 20-Apr-2007 13:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | reviewable.mp3 | 20-Apr-2007 13:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | review.mp3 | 20-Apr-2007 13:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | revetment.mp3 | 20-Apr-2007 13:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | revet.mp3 | 20-Apr-2007 13:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | revest.mp3 | 20-Apr-2007 13:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | revery.mp3 | 20-Apr-2007 13:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | revertible.mp3 | 20-Apr-2007 13:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | reverter.mp3 | 20-Apr-2007 13:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | revertase.mp3 | 20-Apr-2007 13:09 | 17K | |
![[SND]](/icons/sound2.gif) | revertant.mp3 | 20-Apr-2007 13:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | revert.mp3 | 20-Apr-2007 13:08 | 5.9K | |
![[SND]](/icons/sound2.gif) | reverso.mp3 | 20-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | reversionist.mp3 | 20-Apr-2007 13:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | reversioner.mp3 | 20-Apr-2007 13:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | reversionary.mp3 | 20-Apr-2007 13:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | reversional.mp3 | 20-Apr-2007 13:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | reversion.mp3 | 20-Apr-2007 13:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | reversibly.mp3 | 20-Apr-2007 13:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | reversible.mp3 | 20-Apr-2007 13:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | reversibility.mp3 | 20-Apr-2007 13:08 | 11K | |
![[SND]](/icons/sound2.gif) | reversi.mp3 | 20-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | reverser.mp3 | 20-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | reversely.mp3 | 20-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | reversed.mp3 | 20-Apr-2007 13:08 | 17K | |
![[SND]](/icons/sound2.gif) | reverse.mp3 | 20-Apr-2007 13:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | reverse transcriptase.mp3 | 20-Apr-2007 13:08 | 15K | |
![[SND]](/icons/sound2.gif) | reversal.mp3 | 20-Apr-2007 13:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | revers.mp3 | 20-Apr-2007 13:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | reverie.mp3 | 20-Apr-2007 13:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | reverentially.mp3 | 20-Apr-2007 13:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | reverential.mp3 | 20-Apr-2007 13:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | reverent.mp3 | 20-Apr-2007 13:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | reverend.mp3 | 20-Apr-2007 13:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | reverence.mp3 | 20-Apr-2007 13:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | revere.mp3 | 20-Apr-2007 13:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | reverberatory.mp3 | 20-Apr-2007 13:08 | 10K | |
![[SND]](/icons/sound2.gif) | reverberator.mp3 | 20-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | reverberative.mp3 | 20-Apr-2007 13:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | reverberation.mp3 | 20-Apr-2007 13:07 | 10K | |
![[SND]](/icons/sound2.gif) | reverberate.mp3 | 20-Apr-2007 13:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | reverberant.mp3 | 20-Apr-2007 13:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | reverb.mp3 | 20-Apr-2007 13:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | revenuer.mp3 | 20-Apr-2007 13:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | revenue.mp3 | 20-Apr-2007 13:07 | 7.0K | |
![[SND]](/icons/sound2.gif) | revenonsanosmoutons.mp3 | 20-Apr-2007 13:07 | 27K | |
![[SND]](/icons/sound2.gif) | revenons a nos moutons.mp3 | 20-Apr-2007 13:07 | 15K | |
![[SND]](/icons/sound2.gif) | revengefully.mp3 | 20-Apr-2007 13:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | revengeful.mp3 | 20-Apr-2007 13:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | revenge.mp3 | 20-Apr-2007 13:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | revendication.mp3 | 20-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | revendicate.mp3 | 20-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | revenant.mp3 | 20-Apr-2007 13:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | revels.mp3 | 20-Apr-2007 13:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | revelry.mp3 | 20-Apr-2007 13:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | revelrout.mp3 | 20-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | revelling.mp3 | 20-Apr-2007 13:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | reveller.mp3 | 20-Apr-2007 13:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | reveler.mp3 | 20-Apr-2007 13:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | revelatory.mp3 | 20-Apr-2007 13:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | revelator.mp3 | 20-Apr-2007 13:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | Revelations.mp3 | 20-Apr-2007 13:07 | 11K | |
![[SND]](/icons/sound2.gif) | revelationist.mp3 | 20-Apr-2007 13:07 | 17K | |
![[SND]](/icons/sound2.gif) | revelation.mp3 | 20-Apr-2007 13:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | Revel.mp3 | 20-Apr-2007 13:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | reveille.mp3 | 20-Apr-2007 13:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | revegetation.mp3 | 20-Apr-2007 13:06 | 10K | |
![[SND]](/icons/sound2.gif) | revegetate.mp3 | 20-Apr-2007 13:06 | 9.1K | |
![[SND]](/icons/sound2.gif) | revealment.mp3 | 20-Apr-2007 13:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | revealing.mp3 | 20-Apr-2007 13:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | revealable.mp3 | 20-Apr-2007 13:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | reveal.mp3 | 20-Apr-2007 13:06 | 7.0K | |
![[SND]](/icons/sound2.gif) | revco.mp3 | 20-Apr-2007 13:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | revascularization.mp3 | 20-Apr-2007 13:06 | 13K | |
![[SND]](/icons/sound2.gif) | revanchist.mp3 | 20-Apr-2007 13:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | revanchism.mp3 | 20-Apr-2007 13:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | revanche.mp3 | 20-Apr-2007 13:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | revamp.mp3 | 20-Apr-2007 13:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | revalue.mp3 | 20-Apr-2007 13:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | revaluation.mp3 | 20-Apr-2007 13:06 | 11K | |
![[SND]](/icons/sound2.gif) | revaluate.mp3 | 20-Apr-2007 13:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | reval.mp3 | 20-Apr-2007 13:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | rev.mp3 | 20-Apr-2007 13:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | Reutlingen.mp3 | 20-Apr-2007 13:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | Reuther.mp3 | 20-Apr-2007 13:06 | 6.3K | |
![[SND]](/icons/sound2.gif) | reuters.mp3 | 20-Apr-2007 13:06 | 8.4K | |
![[SND]](/icons/sound2.gif) | Reuter.mp3 | 20-Apr-2007 13:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | reused.mp3 | 20-Apr-2007 13:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | reuse.mp3 | 20-Apr-2007 13:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | reusable.mp3 | 20-Apr-2007 13:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | reusability.mp3 | 20-Apr-2007 13:06 | 10K | |
![[SND]](/icons/sound2.gif) | reus.mp3 | 20-Apr-2007 13:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | reuptake.mp3 | 20-Apr-2007 13:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | reunite.mp3 | 20-Apr-2007 13:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | re-up.mp3 | 20-Apr-2007 13:05 | 6.3K | |
![[SND]](/icons/sound2.gif) | reunionistic.mp3 | 20-Apr-2007 13:05 | 9.8K | |
![[SND]](/icons/sound2.gif) | reunionist.mp3 | 20-Apr-2007 13:05 | 9.5K | |
![[SND]](/icons/sound2.gif) | reunion.mp3 | 20-Apr-2007 13:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | Reuchlin.mp3 | 20-Apr-2007 13:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | reubenite.mp3 | 20-Apr-2007 13:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | Reuben.mp3 | 20-Apr-2007 13:05 | 5.9K | |
![[SND]](/icons/sound2.gif) | retzina.mp3 | 20-Apr-2007 13:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | Retz.mp3 | 20-Apr-2007 13:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | retuse.mp3 | 20-Apr-2007 13:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | returnless.mp3 | 20-Apr-2007 13:05 | 17K | |
![[SND]](/icons/sound2.gif) | returnik.mp3 | 20-Apr-2007 13:05 | 17K | |
![[SND]](/icons/sound2.gif) | returner.mp3 | 20-Apr-2007 13:05 | 17K | |
![[SND]](/icons/sound2.gif) | returnee.mp3 | 20-Apr-2007 13:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | returned.mp3 | 20-Apr-2007 13:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | returnable.mp3 | 20-Apr-2007 13:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | return.mp3 | 20-Apr-2007 13:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | rettery.mp3 | 20-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | rette.mp3 | 20-Apr-2007 13:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | retsina.mp3 | 20-Apr-2007 13:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | retrusion.mp3 | 20-Apr-2007 13:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | retrude.mp3 | 20-Apr-2007 13:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | retrovirus.mp3 | 20-Apr-2007 13:05 | 11K | |
![[SND]](/icons/sound2.gif) | retrovirology.mp3 | 20-Apr-2007 13:05 | 13K | |
![[SND]](/icons/sound2.gif) | retrovirologist.mp3 | 20-Apr-2007 13:04 | 13K | |
![[SND]](/icons/sound2.gif) | retroviral.mp3 | 20-Apr-2007 13:04 | 10K | |
![[SND]](/icons/sound2.gif) | retrovir.mp3 | 20-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | retroverted.mp3 | 20-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | retroversion.mp3 | 20-Apr-2007 13:04 | 10K | |
![[SND]](/icons/sound2.gif) | retrousse.mp3 | 20-Apr-2007 13:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | retroussage.mp3 | 20-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | retrosternal.mp3 | 20-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | retrospective.mp3 | 20-Apr-2007 13:04 | 11K | |
![[SND]](/icons/sound2.gif) | retrospection.mp3 | 20-Apr-2007 13:04 | 9.8K | |
![[SND]](/icons/sound2.gif) | retrospect.mp3 | 20-Apr-2007 13:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | retrorse.mp3 | 20-Apr-2007 13:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | retro-rocket.mp3 | 20-Apr-2007 13:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | retroreflector.mp3 | 20-Apr-2007 13:04 | 11K | |
![[SND]](/icons/sound2.gif) | retroreflective.mp3 | 20-Apr-2007 13:04 | 13K | |
![[SND]](/icons/sound2.gif) | retroreflection.mp3 | 20-Apr-2007 13:04 | 11K | |
![[SND]](/icons/sound2.gif) | retropulsion.mp3 | 20-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | retroperitoneally.mp3 | 20-Apr-2007 13:04 | 13K | |
![[SND]](/icons/sound2.gif) | retroperitoneal.mp3 | 20-Apr-2007 13:04 | 12K | |
![[SND]](/icons/sound2.gif) | retropack.mp3 | 20-Apr-2007 13:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | retrolental.mp3 | 20-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | retroject.mp3 | 20-Apr-2007 13:04 | 17K | |
![[SND]](/icons/sound2.gif) | retrogressive.mp3 | 20-Apr-2007 13:04 | 10K | |
![[SND]](/icons/sound2.gif) | retrogression.mp3 | 20-Apr-2007 13:04 | 9.5K | |
![[SND]](/icons/sound2.gif) | retrogress.mp3 | 20-Apr-2007 13:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | retrograde.mp3 | 20-Apr-2007 13:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | retrogradation.mp3 | 20-Apr-2007 13:03 | 11K | |
![[SND]](/icons/sound2.gif) | retroflexion.mp3 | 20-Apr-2007 13:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | retroflex.mp3 | 20-Apr-2007 13:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | retroflection.mp3 | 20-Apr-2007 13:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | retrofit.mp3 | 20-Apr-2007 13:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | retrofire.mp3 | 20-Apr-2007 13:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | retrodictive.mp3 | 20-Apr-2007 13:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | retrodiction.mp3 | 20-Apr-2007 13:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | retrodict.mp3 | 20-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | re-trodden.mp3 | 20-Apr-2007 13:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | re-trod.mp3 | 20-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | retrocessionaire.mp3 | 20-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | retrocession.mp3 | 20-Apr-2007 13:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | retrocede.mp3 | 20-Apr-2007 13:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | retroactivity.mp3 | 20-Apr-2007 13:03 | 11K | |
![[SND]](/icons/sound2.gif) | retroactive.mp3 | 20-Apr-2007 13:03 | 10K | |
![[SND]](/icons/sound2.gif) | retroaction.mp3 | 20-Apr-2007 13:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | retro.mp3 | 20-Apr-2007 13:03 | 6.4K | |
![[SND]](/icons/sound2.gif) | retriever.mp3 | 20-Apr-2007 13:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | retrieve.mp3 | 20-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | retrieval.mp3 | 20-Apr-2007 13:03 | 7.3K | |
![[SND]](/icons/sound2.gif) | retrievable.mp3 | 20-Apr-2007 13:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | retrievability.mp3 | 20-Apr-2007 13:03 | 11K | |
![[SND]](/icons/sound2.gif) | retributory.mp3 | 20-Apr-2007 13:03 | 9.5K | |
![[SND]](/icons/sound2.gif) | retributivism.mp3 | 20-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | retributive.mp3 | 20-Apr-2007 13:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | retribution.mp3 | 20-Apr-2007 13:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | retribalize.mp3 | 20-Apr-2007 13:03 | 17K | |
![[SND]](/icons/sound2.gif) | retribalization.mp3 | 20-Apr-2007 13:02 | 13K | |
![[SND]](/icons/sound2.gif) | retrial.mp3 | 20-Apr-2007 13:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | retrenchment.mp3 | 20-Apr-2007 13:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | retrench.mp3 | 20-Apr-2007 13:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | retree.mp3 | 20-Apr-2007 13:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | retreatism.mp3 | 20-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | retreatant.mp3 | 20-Apr-2007 13:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | retreat.mp3 | 20-Apr-2007 13:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | re-tread.mp3 | 20-Apr-2007 13:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | retread.mp3 | 20-Apr-2007 13:02 | 7.1K | |
![[SND]](/icons/sound2.gif) | retranslation.mp3 | 20-Apr-2007 13:02 | 10K | |
![[SND]](/icons/sound2.gif) | retranslate.mp3 | 20-Apr-2007 13:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | retral.mp3 | 20-Apr-2007 13:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | retrainee.mp3 | 20-Apr-2007 13:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | retrainable.mp3 | 20-Apr-2007 13:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | retrain.mp3 | 20-Apr-2007 13:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | retractor.mp3 | 20-Apr-2007 13:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | retractive.mp3 | 20-Apr-2007 13:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | retraction.mp3 | 20-Apr-2007 13:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | retractility.mp3 | 20-Apr-2007 13:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | retractile.mp3 | 20-Apr-2007 13:02 | 7.5K | |
![[SND]](/icons/sound2.gif) | retractable.mp3 | 20-Apr-2007 13:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | retract.mp3 | 20-Apr-2007 13:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | retrace.mp3 | 20-Apr-2007 13:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | retouch.mp3 | 20-Apr-2007 13:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | retortion.mp3 | 20-Apr-2007 13:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | retorted.mp3 | 20-Apr-2007 13:02 | 17K | |
![[SND]](/icons/sound2.gif) | retort.mp3 | 20-Apr-2007 13:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | retort pouch.mp3 | 20-Apr-2007 13:01 | 11K | |
![[SND]](/icons/sound2.gif) | retorsion.mp3 | 20-Apr-2007 13:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | retornado.mp3 | 20-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | retool.mp3 | 20-Apr-2007 13:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | retook.mp3 | 20-Apr-2007 13:01 | 6.3K | |
![[SND]](/icons/sound2.gif) | retold.mp3 | 20-Apr-2007 13:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | retiro.mp3 | 20-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | retiringly.mp3 | 20-Apr-2007 13:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | retiring.mp3 | 20-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | retirement.mp3 | 20-Apr-2007 13:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | retiree.mp3 | 20-Apr-2007 13:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | retiredness.mp3 | 20-Apr-2007 13:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | retiredly.mp3 | 20-Apr-2007 13:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | retired.mp3 | 20-Apr-2007 13:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | retire.mp3 | 20-Apr-2007 13:01 | 7.0K | |
![[SND]](/icons/sound2.gif) | retirant.mp3 | 20-Apr-2007 13:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | retiral.mp3 | 20-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | retiracy.mp3 | 20-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | retinular.mp3 | 20-Apr-2007 13:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | retinulae.mp3 | 20-Apr-2007 13:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | retinula.mp3 | 20-Apr-2007 13:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | retinue.mp3 | 20-Apr-2007 13:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | retinotectal.mp3 | 20-Apr-2007 13:01 | 9.5K | |
![[SND]](/icons/sound2.gif) | retinoscopy.mp3 | 20-Apr-2007 13:01 | 9.6K | |
![[SND]](/icons/sound2.gif) | retinoscope.mp3 | 20-Apr-2007 13:01 | 17K | |
![[SND]](/icons/sound2.gif) | retinopathy.mp3 | 20-Apr-2007 13:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | retinol.mp3 | 20-Apr-2007 13:01 | 7.1K | |
![[SND]](/icons/sound2.gif) | retinoid.mp3 | 20-Apr-2007 13:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | retinoic acid.mp3 | 20-Apr-2007 13:00 | 13K | |
![[SND]](/icons/sound2.gif) | retinoblastomata.mp3 | 20-Apr-2007 13:00 | 13K | |
![[SND]](/icons/sound2.gif) | retinoblastoma.mp3 | 20-Apr-2007 13:00 | 12K | |
![[SND]](/icons/sound2.gif) | retino.mp3 | 20-Apr-2007 13:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | retinitispigmentosa.mp3 | 20-Apr-2007 13:00 | 18K | |
![[SND]](/icons/sound2.gif) | retinitis.mp3 | 20-Apr-2007 13:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | retinitis pigmentosa.mp3 | 20-Apr-2007 13:00 | 16K | |
![[SND]](/icons/sound2.gif) | retinite.mp3 | 20-Apr-2007 13:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | retinispora.mp3 | 20-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | retinene.mp3 | 20-Apr-2007 13:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | retine.mp3 | 20-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | retinal.mp3 | 20-Apr-2007 13:00 | 6.8K | |
![[SND]](/icons/sound2.gif) | retinae.mp3 | 20-Apr-2007 13:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | retinaculum.mp3 | 20-Apr-2007 13:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | retinacula.mp3 | 20-Apr-2007 13:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | retina.mp3 | 20-Apr-2007 13:00 | 5.7K | |
![[SND]](/icons/sound2.gif) | retin.mp3 | 20-Apr-2007 13:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | retiform.mp3 | 20-Apr-2007 13:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | reticulum.mp3 | 20-Apr-2007 13:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | reticulosis.mp3 | 20-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | reticulose.mp3 | 20-Apr-2007 13:00 | 17K | |
![[SND]](/icons/sound2.gif) | reticuloendothelial.mp3 | 20-Apr-2007 13:00 | 15K | |
![[SND]](/icons/sound2.gif) | reticulocyte.mp3 | 20-Apr-2007 13:00 | 11K | |
![[SND]](/icons/sound2.gif) | reticule.mp3 | 20-Apr-2007 13:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | reticulation.mp3 | 20-Apr-2007 13:00 | 10K | |
![[SND]](/icons/sound2.gif) | reticulate.mp3 | 20-Apr-2007 13:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | reticular.mp3 | 20-Apr-2007 12:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | reticula.mp3 | 20-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | reticle.mp3 | 20-Apr-2007 12:59 | 5.7K | |
![[SND]](/icons/sound2.gif) | reticent.mp3 | 20-Apr-2007 12:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | reticency.mp3 | 20-Apr-2007 12:59 | 8.0K | |
![[SND]](/icons/sound2.gif) | reticence.mp3 | 20-Apr-2007 12:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | retiary.mp3 | 20-Apr-2007 12:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | retiarius.mp3 | 20-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | retia.mp3 | 20-Apr-2007 12:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | reti.mp3 | 20-Apr-2007 12:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | rethought.mp3 | 20-Apr-2007 12:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rethondes.mp3 | 20-Apr-2007 12:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | rethink.mp3 | 20-Apr-2007 12:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | retest.mp3 | 20-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | retepore.mp3 | 20-Apr-2007 12:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | retenue.mp3 | 20-Apr-2007 12:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | retentivity.mp3 | 20-Apr-2007 12:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | retentive.mp3 | 20-Apr-2007 12:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | retentionist.mp3 | 20-Apr-2007 12:59 | 17K | |
![[SND]](/icons/sound2.gif) | retention.mp3 | 20-Apr-2007 12:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | retene.mp3 | 20-Apr-2007 12:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | retem.mp3 | 20-Apr-2007 12:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | retell.mp3 | 20-Apr-2007 12:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | rete.mp3 | 20-Apr-2007 12:59 | 6.4K | |
![[SND]](/icons/sound2.gif) | retch.mp3 | 20-Apr-2007 12:59 | 5.7K | |
![[SND]](/icons/sound2.gif) | retarder.mp3 | 20-Apr-2007 12:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | retardee.mp3 | 20-Apr-2007 12:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | retarded.mp3 | 20-Apr-2007 12:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | retardation.mp3 | 20-Apr-2007 12:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | retardate.mp3 | 20-Apr-2007 12:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | retardant.mp3 | 20-Apr-2007 12:58 | 7.7K | |
![[SND]](/icons/sound2.gif) | retard.mp3 | 20-Apr-2007 12:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | retaliatory.mp3 | 20-Apr-2007 12:58 | 10K | |
![[SND]](/icons/sound2.gif) | retaliative.mp3 | 20-Apr-2007 12:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | retaliation.mp3 | 20-Apr-2007 12:58 | 10K | |
![[SND]](/icons/sound2.gif) | retaliate.mp3 | 20-Apr-2007 12:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | retaken.mp3 | 20-Apr-2007 12:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | retake.mp3 | 20-Apr-2007 12:58 | 6.1K | |
![[SND]](/icons/sound2.gif) | retainer.mp3 | 20-Apr-2007 12:58 | 7.1K | |
![[SND]](/icons/sound2.gif) | retain.mp3 | 20-Apr-2007 12:58 | 7.3K | |
![[SND]](/icons/sound2.gif) | retailing.mp3 | 20-Apr-2007 12:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | retail.mp3 | 20-Apr-2007 12:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | retable.mp3 | 20-Apr-2007 12:58 | 6.8K | |
![[SND]](/icons/sound2.gif) | ret.mp3 | 20-Apr-2007 12:58 | 4.6K | |
![[SND]](/icons/sound2.gif) | resveratrol.mp3 | 20-Apr-2007 12:58 | 9.6K | |
![[SND]](/icons/sound2.gif) | resuscitator.mp3 | 20-Apr-2007 12:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | resuscitative.mp3 | 20-Apr-2007 12:58 | 10K | |
![[SND]](/icons/sound2.gif) | resuscitation.mp3 | 20-Apr-2007 12:58 | 11K | |
![[SND]](/icons/sound2.gif) | resuscitate.mp3 | 20-Apr-2007 12:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | resurvey.mp3 | 20-Apr-2007 12:58 | 27K | |
![[SND]](/icons/sound2.gif) | resurrectionist.mp3 | 20-Apr-2007 12:58 | 11K | |
![[SND]](/icons/sound2.gif) | resurrectionism.mp3 | 20-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | resurrectionary.mp3 | 20-Apr-2007 12:58 | 17K | |
![[SND]](/icons/sound2.gif) | resurrectional.mp3 | 20-Apr-2007 12:58 | 9.1K | |
![[SND]](/icons/sound2.gif) | resurrection.mp3 | 20-Apr-2007 12:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | resurrect.mp3 | 20-Apr-2007 12:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | resurgent.mp3 | 20-Apr-2007 12:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | resurgence.mp3 | 20-Apr-2007 12:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | resurge.mp3 | 20-Apr-2007 12:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | resurgam.mp3 | 20-Apr-2007 12:57 | 9.6K | |
![[SND]](/icons/sound2.gif) | resurfacer.mp3 | 20-Apr-2007 12:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | resurface.mp3 | 20-Apr-2007 12:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | resurbia.mp3 | 20-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | resupine.mp3 | 20-Apr-2007 12:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | resupination.mp3 | 20-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | resupinate.mp3 | 20-Apr-2007 12:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | resumptive.mp3 | 20-Apr-2007 12:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | resumption.mp3 | 20-Apr-2007 12:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | resume.mp3 | 20-Apr-2007 12:57 | 7.7K | |
![[SND]](/icons/sound2.gif) | resultless.mp3 | 20-Apr-2007 12:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | resultingly.mp3 | 20-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | resultful.mp3 | 20-Apr-2007 12:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | resultant.mp3 | 20-Apr-2007 12:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | result.mp3 | 20-Apr-2007 12:57 | 6.8K | |
![[SND]](/icons/sound2.gif) | restructure.mp3 | 20-Apr-2007 12:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | restroom.mp3 | 20-Apr-2007 12:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | restrike.mp3 | 20-Apr-2007 12:57 | 7.3K | |
![[SND]](/icons/sound2.gif) | restrictor.mp3 | 20-Apr-2007 12:57 | 17K | |
![[SND]](/icons/sound2.gif) | restrictive.mp3 | 20-Apr-2007 12:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | restrictionist.mp3 | 20-Apr-2007 12:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | restrictionism.mp3 | 20-Apr-2007 12:57 | 10K | |
![[SND]](/icons/sound2.gif) | restriction.mp3 | 20-Apr-2007 12:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | restricted.mp3 | 20-Apr-2007 12:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | restrict.mp3 | 20-Apr-2007 12:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | restraint.mp3 | 20-Apr-2007 12:56 | 6.8K | |
![[SND]](/icons/sound2.gif) | restrainer.mp3 | 20-Apr-2007 12:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | restrainedly.mp3 | 20-Apr-2007 12:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | restrained.mp3 | 20-Apr-2007 12:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | restrainable.mp3 | 20-Apr-2007 12:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | restrain.mp3 | 20-Apr-2007 12:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | restore.mp3 | 20-Apr-2007 12:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | restorative.mp3 | 20-Apr-2007 12:56 | 9.1K | |
![[SND]](/icons/sound2.gif) | restorationism.mp3 | 20-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | restoration.mp3 | 20-Apr-2007 12:56 | 9.3K | |
![[SND]](/icons/sound2.gif) | restoral.mp3 | 20-Apr-2007 12:56 | 7.1K | |
![[SND]](/icons/sound2.gif) | restorable.mp3 | 20-Apr-2007 12:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | Reston.mp3 | 20-Apr-2007 12:56 | 5.5K | |
![[SND]](/icons/sound2.gif) | resto.mp3 | 20-Apr-2007 12:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | restless.mp3 | 20-Apr-2007 12:56 | 7.3K | |
![[SND]](/icons/sound2.gif) | restive.mp3 | 20-Apr-2007 12:56 | 6.6K | |
![[SND]](/icons/sound2.gif) | restitution.mp3 | 20-Apr-2007 12:56 | 9.3K | |
![[SND]](/icons/sound2.gif) | restitute.mp3 | 20-Apr-2007 12:56 | 7.7K | |
![[SND]](/icons/sound2.gif) | resting.mp3 | 20-Apr-2007 12:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | restiform.mp3 | 20-Apr-2007 12:56 | 17K | |
![[SND]](/icons/sound2.gif) | restiff.mp3 | 20-Apr-2007 12:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | restharrow.mp3 | 20-Apr-2007 12:56 | 8.4K | |
![[SND]](/icons/sound2.gif) | restfully.mp3 | 20-Apr-2007 12:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | restful.mp3 | 20-Apr-2007 12:55 | 6.1K | |
![[SND]](/icons/sound2.gif) | restenosis.mp3 | 20-Apr-2007 12:55 | 10K | |
![[SND]](/icons/sound2.gif) | rested.mp3 | 20-Apr-2007 12:55 | 6.6K | |
![[SND]](/icons/sound2.gif) | restaurateur.mp3 | 20-Apr-2007 12:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | restauranteur.mp3 | 20-Apr-2007 12:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | restaurant.mp3 | 20-Apr-2007 12:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | restatement.mp3 | 20-Apr-2007 12:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | restate.mp3 | 20-Apr-2007 12:55 | 6.8K | |
![[SND]](/icons/sound2.gif) | restartable.mp3 | 20-Apr-2007 12:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | restart.mp3 | 20-Apr-2007 12:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | rest.mp3 | 20-Apr-2007 12:55 | 5.7K | |
![[SND]](/icons/sound2.gif) | ressentiment.mp3 | 20-Apr-2007 12:55 | 11K | |
![[SND]](/icons/sound2.gif) | respublica.mp3 | 20-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | responsum.mp3 | 20-Apr-2007 12:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | responsory.mp3 | 20-Apr-2007 12:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | responsor.mp3 | 20-Apr-2007 12:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | responsiveness.mp3 | 20-Apr-2007 12:55 | 17K | |
![[SND]](/icons/sound2.gif) | responsive.mp3 | 20-Apr-2007 12:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | responsions.mp3 | 20-Apr-2007 12:55 | 9.8K | |
![[SND]](/icons/sound2.gif) | responsion.mp3 | 20-Apr-2007 12:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | responsibly.mp3 | 20-Apr-2007 12:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | responsible.mp3 | 20-Apr-2007 12:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | responsibility.mp3 | 20-Apr-2007 12:55 | 11K | |
![[SND]](/icons/sound2.gif) | responser.mp3 | 20-Apr-2007 12:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | response.mp3 | 20-Apr-2007 12:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | responsa.mp3 | 20-Apr-2007 12:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | responder.mp3 | 20-Apr-2007 12:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | respondent.mp3 | 20-Apr-2007 12:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | respondence.mp3 | 20-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | respond.mp3 | 20-Apr-2007 12:54 | 8.2K | |
![[SND]](/icons/sound2.gif) | resplendent.mp3 | 20-Apr-2007 12:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | resplendency.mp3 | 20-Apr-2007 12:54 | 9.6K | |
![[SND]](/icons/sound2.gif) | resplendence.mp3 | 20-Apr-2007 12:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | resplend.mp3 | 20-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | respite.mp3 | 20-Apr-2007 12:54 | 5.7K | |
![[SND]](/icons/sound2.gif) | respirometry.mp3 | 20-Apr-2007 12:54 | 10K | |
![[SND]](/icons/sound2.gif) | respirometric.mp3 | 20-Apr-2007 12:54 | 10K | |
![[SND]](/icons/sound2.gif) | respirometer.mp3 | 20-Apr-2007 12:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | respire.mp3 | 20-Apr-2007 12:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | respiratory.mp3 | 20-Apr-2007 12:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | respirator.mp3 | 20-Apr-2007 12:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | respiration.mp3 | 20-Apr-2007 12:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | respirate.mp3 | 20-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | respirable.mp3 | 20-Apr-2007 12:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | Respighi.mp3 | 20-Apr-2007 12:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | respicefinem.mp3 | 20-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | respice finem.mp3 | 20-Apr-2007 12:54 | 14K | |
![[SND]](/icons/sound2.gif) | respelling.mp3 | 20-Apr-2007 12:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | respell.mp3 | 20-Apr-2007 12:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | respectively.mp3 | 20-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | respective.mp3 | 20-Apr-2007 12:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | respecting.mp3 | 20-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | respectify.mp3 | 20-Apr-2007 12:54 | 17K | |
![[SND]](/icons/sound2.gif) | respectfully.mp3 | 20-Apr-2007 12:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | respectful.mp3 | 20-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | respecter.mp3 | 20-Apr-2007 12:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | respected.mp3 | 20-Apr-2007 12:53 | 17K | |
![[SND]](/icons/sound2.gif) | respectant.mp3 | 20-Apr-2007 12:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | respectably.mp3 | 20-Apr-2007 12:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | respectableness.mp3 | 20-Apr-2007 12:53 | 11K | |
![[SND]](/icons/sound2.gif) | respectable.mp3 | 20-Apr-2007 12:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | respectability.mp3 | 20-Apr-2007 12:53 | 10K | |
![[SND]](/icons/sound2.gif) | respect.mp3 | 20-Apr-2007 12:53 | 6.8K | |
![[SND]](/icons/sound2.gif) | resourcefully.mp3 | 20-Apr-2007 12:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | resourceful.mp3 | 20-Apr-2007 12:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | resource.mp3 | 20-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | resounding.mp3 | 20-Apr-2007 12:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | resound.mp3 | 20-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | resorter.mp3 | 20-Apr-2007 12:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | re-sort.mp3 | 20-Apr-2007 12:53 | 6.6K | |
![[SND]](/icons/sound2.gif) | resort.mp3 | 20-Apr-2007 12:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | resorptive.mp3 | 20-Apr-2007 12:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | resorption.mp3 | 20-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | resorcinolphthalein.mp3 | 20-Apr-2007 12:53 | 18K | |
![[SND]](/icons/sound2.gif) | resorcinol.mp3 | 20-Apr-2007 12:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | resorcin.mp3 | 20-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | resorb.mp3 | 20-Apr-2007 12:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | resonator.mp3 | 20-Apr-2007 12:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | resonate.mp3 | 20-Apr-2007 12:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | resonant.mp3 | 20-Apr-2007 12:53 | 7.0K | |
![[SND]](/icons/sound2.gif) | resonance.mp3 | 20-Apr-2007 12:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | resolvent.mp3 | 20-Apr-2007 12:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | resolved.mp3 | 20-Apr-2007 12:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | resolve.mp3 | 20-Apr-2007 12:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | resolvancy.mp3 | 20-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | resolvable.mp3 | 20-Apr-2007 12:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | resolutive.mp3 | 20-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | resolutioner.mp3 | 20-Apr-2007 12:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | resolution.mp3 | 20-Apr-2007 12:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | resoluteness.mp3 | 20-Apr-2007 12:52 | 9.5K | |
![[SND]](/icons/sound2.gif) | resolutely.mp3 | 20-Apr-2007 12:52 | 7.7K | |
![[SND]](/icons/sound2.gif) | resolute.mp3 | 20-Apr-2007 12:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | resoluble.mp3 | 20-Apr-2007 12:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | resole.mp3 | 20-Apr-2007 12:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | resojetengine.mp3 | 20-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | resnatron.mp3 | 20-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | resnais.mp3 | 20-Apr-2007 12:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | resmethrin.mp3 | 20-Apr-2007 12:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | resjudicata.mp3 | 20-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | resitting.mp3 | 20-Apr-2007 12:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | resit.mp3 | 20-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | resistor.mp3 | 20-Apr-2007 12:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | resistojet.mp3 | 20-Apr-2007 12:52 | 17K | |
![[SND]](/icons/sound2.gif) | resistless.mp3 | 20-Apr-2007 12:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | resistivity.mp3 | 20-Apr-2007 12:52 | 11K | |
![[SND]](/icons/sound2.gif) | resistive.mp3 | 20-Apr-2007 12:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | resistible.mp3 | 20-Apr-2007 12:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | resistibility.mp3 | 20-Apr-2007 12:51 | 11K | |
![[SND]](/icons/sound2.gif) | resister.mp3 | 20-Apr-2007 12:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | resistencia.mp3 | 20-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | resistate.mp3 | 20-Apr-2007 12:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | resistant.mp3 | 20-Apr-2007 12:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | resistance.mp3 | 20-Apr-2007 12:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | resistable.mp3 | 20-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | resist.mp3 | 20-Apr-2007 12:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | resipsaloquitur.mp3 | 20-Apr-2007 12:51 | 18K | |
![[SND]](/icons/sound2.gif) | resipiscence.mp3 | 20-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | resinous.mp3 | 20-Apr-2007 12:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | resinoid.mp3 | 20-Apr-2007 12:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | resining.mp3 | 20-Apr-2007 12:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | resinify.mp3 | 20-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | resiniferous.mp3 | 20-Apr-2007 12:51 | 17K | |
![[SND]](/icons/sound2.gif) | resinate.mp3 | 20-Apr-2007 12:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | resin.mp3 | 20-Apr-2007 12:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | resilient.mp3 | 20-Apr-2007 12:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | resiliency.mp3 | 20-Apr-2007 12:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | resilience.mp3 | 20-Apr-2007 12:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | resile.mp3 | 20-Apr-2007 12:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | resigner.mp3 | 20-Apr-2007 12:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | resignee.mp3 | 20-Apr-2007 12:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | resignedness.mp3 | 20-Apr-2007 12:51 | 10K | |
![[SND]](/icons/sound2.gif) | resignedly.mp3 | 20-Apr-2007 12:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | resigned.mp3 | 20-Apr-2007 12:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | resignation.mp3 | 20-Apr-2007 12:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | re-sign.mp3 | 20-Apr-2007 12:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | resign.mp3 | 20-Apr-2007 12:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | residuum.mp3 | 20-Apr-2007 12:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | residue.mp3 | 20-Apr-2007 12:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | residuary.mp3 | 20-Apr-2007 12:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | residually.mp3 | 20-Apr-2007 12:50 | 17K | |
![[SND]](/icons/sound2.gif) | residual.mp3 | 20-Apr-2007 12:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | residua.mp3 | 20-Apr-2007 12:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | residentiary.mp3 | 20-Apr-2007 12:49 | 17K | |
![[SND]](/icons/sound2.gif) | residentially.mp3 | 20-Apr-2007 12:49 | 9.1K | |
![[SND]](/icons/sound2.gif) | residential.mp3 | 20-Apr-2007 12:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | residenter.mp3 | 20-Apr-2007 12:49 | 17K | |
![[SND]](/icons/sound2.gif) | resident.mp3 | 20-Apr-2007 12:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | residency.mp3 | 20-Apr-2007 12:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | residence.mp3 | 20-Apr-2007 12:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | reside.mp3 | 20-Apr-2007 12:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | resid.mp3 | 20-Apr-2007 12:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | reshuffle.mp3 | 20-Apr-2007 12:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | resht.mp3 | 20-Apr-2007 12:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | reshape.mp3 | 20-Apr-2007 12:48 | 7.5K | |
![[SND]](/icons/sound2.gif) | resh.mp3 | 20-Apr-2007 12:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | resgestae.mp3 | 20-Apr-2007 12:48 | 17K | |
![[SND]](/icons/sound2.gif) | resettable.mp3 | 20-Apr-2007 12:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | reset.mp3 | 20-Apr-2007 12:48 | 6.6K | |
![[SND]](/icons/sound2.gif) | reservoir.mp3 | 20-Apr-2007 12:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | reservist.mp3 | 20-Apr-2007 12:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | reservedness.mp3 | 20-Apr-2007 12:47 | 11K | |
![[SND]](/icons/sound2.gif) | reservedly.mp3 | 20-Apr-2007 12:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | reserved.mp3 | 20-Apr-2007 12:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | reserve.mp3 | 20-Apr-2007 12:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | reservationist.mp3 | 20-Apr-2007 12:47 | 10K | |
![[SND]](/icons/sound2.gif) | reservation.mp3 | 20-Apr-2007 12:47 | 9.1K | |
![[SND]](/icons/sound2.gif) | reservable.mp3 | 20-Apr-2007 12:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | reserpine.mp3 | 20-Apr-2007 12:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | resentment.mp3 | 20-Apr-2007 12:47 | 8.2K | |
![[SND]](/icons/sound2.gif) | resentfully.mp3 | 20-Apr-2007 12:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | resentful.mp3 | 20-Apr-2007 12:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | resent.mp3 | 20-Apr-2007 12:47 | 7.0K | |
![[SND]](/icons/sound2.gif) | resend.mp3 | 20-Apr-2007 12:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | resembling.mp3 | 20-Apr-2007 12:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | resemble.mp3 | 20-Apr-2007 12:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | resemblant.mp3 | 20-Apr-2007 12:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | resemblance.mp3 | 20-Apr-2007 12:46 | 9.5K | |
![[SND]](/icons/sound2.gif) | reseed.mp3 | 20-Apr-2007 12:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | resedaceous.mp3 | 20-Apr-2007 12:46 | 17K | |
![[SND]](/icons/sound2.gif) | reseda.mp3 | 20-Apr-2007 12:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | resection.mp3 | 20-Apr-2007 12:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | resectable.mp3 | 20-Apr-2007 12:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | resectability.mp3 | 20-Apr-2007 12:46 | 11K | |
![[SND]](/icons/sound2.gif) | resect.mp3 | 20-Apr-2007 12:46 | 6.8K | |
![[SND]](/icons/sound2.gif) | reseaux.mp3 | 20-Apr-2007 12:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | reseau.mp3 | 20-Apr-2007 12:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | researchist.mp3 | 20-Apr-2007 12:46 | 8.6K | |
![[SND]](/icons/sound2.gif) | researchful.mp3 | 20-Apr-2007 12:46 | 17K | |
![[SND]](/icons/sound2.gif) | researchable.mp3 | 20-Apr-2007 12:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | research.mp3 | 20-Apr-2007 12:45 | 7.1K | |
![[SND]](/icons/sound2.gif) | rescue.mp3 | 20-Apr-2007 12:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | rescuable.mp3 | 20-Apr-2007 12:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | rescript.mp3 | 20-Apr-2007 12:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | rescissory.mp3 | 20-Apr-2007 12:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | rescission.mp3 | 20-Apr-2007 12:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | rescissible.mp3 | 20-Apr-2007 12:45 | 17K | |
![[SND]](/icons/sound2.gif) | rescindment.mp3 | 20-Apr-2007 12:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | rescind.mp3 | 20-Apr-2007 12:45 | 7.5K | |
![[SND]](/icons/sound2.gif) | reschedule.mp3 | 20-Apr-2007 12:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | rescale.mp3 | 20-Apr-2007 12:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | resaw.mp3 | 20-Apr-2007 12:45 | 27K | |
![[SND]](/icons/sound2.gif) | resale.mp3 | 20-Apr-2007 12:44 | 6.8K | |
![[SND]](/icons/sound2.gif) | resalable.mp3 | 20-Apr-2007 12:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | resadjudicata.mp3 | 20-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | res.mp3 | 20-Apr-2007 12:44 | 6.1K | |
![[SND]](/icons/sound2.gif) | res publica.mp3 | 20-Apr-2007 12:44 | 11K | |
![[SND]](/icons/sound2.gif) | res judicata.mp3 | 20-Apr-2007 12:44 | 11K | |
![[SND]](/icons/sound2.gif) | res gestae.mp3 | 20-Apr-2007 12:44 | 9.6K | |
![[SND]](/icons/sound2.gif) | res adjudicata.mp3 | 20-Apr-2007 12:44 | 12K | |
![[SND]](/icons/sound2.gif) | rerun.mp3 | 20-Apr-2007 12:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | rereward.mp3 | 20-Apr-2007 12:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | reremouse.mp3 | 20-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | reredos.mp3 | 20-Apr-2007 12:44 | 8.2K | |
![[SND]](/icons/sound2.gif) | reredorter.mp3 | 20-Apr-2007 12:44 | 17K | |
![[SND]](/icons/sound2.gif) | rerebrace.mp3 | 20-Apr-2007 12:43 | 17K | |
![[SND]](/icons/sound2.gif) | rerearch.mp3 | 20-Apr-2007 12:43 | 17K | |
![[SND]](/icons/sound2.gif) | reread.mp3 | 20-Apr-2007 12:43 | 17K | |
![[SND]](/icons/sound2.gif) | reran.mp3 | 20-Apr-2007 12:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | reradiation.mp3 | 20-Apr-2007 12:43 | 10K | |
![[SND]](/icons/sound2.gif) | reradiate.mp3 | 20-Apr-2007 12:43 | 8.2K | |
![[SND]](/icons/sound2.gif) | requite.mp3 | 20-Apr-2007 12:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | requital.mp3 | 20-Apr-2007 12:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | requisition.mp3 | 20-Apr-2007 12:43 | 9.1K | |
![[SND]](/icons/sound2.gif) | requisite.mp3 | 20-Apr-2007 12:43 | 6.6K | |
![[SND]](/icons/sound2.gif) | requirement.mp3 | 20-Apr-2007 12:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | require.mp3 | 20-Apr-2007 12:43 | 7.3K | |
![[SND]](/icons/sound2.gif) | requin.mp3 | 20-Apr-2007 12:43 | 17K | |
![[SND]](/icons/sound2.gif) | requiescatinpace.mp3 | 20-Apr-2007 12:43 | 27K | |
![[SND]](/icons/sound2.gif) | requiescat.mp3 | 20-Apr-2007 12:43 | 9.6K | |
![[SND]](/icons/sound2.gif) | requiescat in pace.mp3 | 20-Apr-2007 12:43 | 18K | |
![[SND]](/icons/sound2.gif) | requiem.mp3 | 20-Apr-2007 12:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | requestor.mp3 | 20-Apr-2007 12:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | request.mp3 | 20-Apr-2007 12:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | reputedly.mp3 | 20-Apr-2007 12:42 | 17K | |
![[SND]](/icons/sound2.gif) | reputed.mp3 | 20-Apr-2007 12:42 | 8.8K | |
![[SND]](/icons/sound2.gif) | repute.mp3 | 20-Apr-2007 12:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | reputational.mp3 | 20-Apr-2007 12:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | reputation.mp3 | 20-Apr-2007 12:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | reputably.mp3 | 20-Apr-2007 12:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | reputable.mp3 | 20-Apr-2007 12:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | reputability.mp3 | 20-Apr-2007 12:42 | 10K | |
![[SND]](/icons/sound2.gif) | repurpose.mp3 | 20-Apr-2007 12:42 | 9.3K | |
![[SND]](/icons/sound2.gif) | repurchase agreement.mp3 | 20-Apr-2007 12:42 | 12K | |
![[SND]](/icons/sound2.gif) | repulsive.mp3 | 20-Apr-2007 12:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | repulsion.mp3 | 20-Apr-2007 12:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | repulse.mp3 | 20-Apr-2007 12:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | repugnant.mp3 | 20-Apr-2007 12:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | repugnancy.mp3 | 20-Apr-2007 12:42 | 9.1K | |
![[SND]](/icons/sound2.gif) | repugnance.mp3 | 20-Apr-2007 12:42 | 9.5K | |
![[SND]](/icons/sound2.gif) | repugn.mp3 | 20-Apr-2007 12:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | repudiator.mp3 | 20-Apr-2007 12:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | repudiationist.mp3 | 20-Apr-2007 12:41 | 12K | |
![[SND]](/icons/sound2.gif) | repudiation.mp3 | 20-Apr-2007 12:41 | 10K | |
![[SND]](/icons/sound2.gif) | repudiate.mp3 | 20-Apr-2007 12:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | republish.mp3 | 20-Apr-2007 12:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | republication.mp3 | 20-Apr-2007 12:41 | 10K | |
![[SND]](/icons/sound2.gif) | republicanize.mp3 | 20-Apr-2007 12:41 | 11K | |
![[SND]](/icons/sound2.gif) | republicanism.mp3 | 20-Apr-2007 12:41 | 10K | |
![[SND]](/icons/sound2.gif) | republican.mp3 | 20-Apr-2007 12:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | Republica Oriental del Uruguay.mp3 | 20-Apr-2007 12:41 | 24K | |
![[SND]](/icons/sound2.gif) | republic.mp3 | 20-Apr-2007 12:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | repton.mp3 | 20-Apr-2007 12:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | reptilian.mp3 | 20-Apr-2007 12:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | reptilia.mp3 | 20-Apr-2007 12:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | reptile.mp3 | 20-Apr-2007 12:40 | 7.1K | |
![[SND]](/icons/sound2.gif) | reptant.mp3 | 20-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | reps.mp3 | 20-Apr-2007 12:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | reprovingly.mp3 | 20-Apr-2007 12:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | reprove.mp3 | 20-Apr-2007 12:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | reproval.mp3 | 20-Apr-2007 12:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | reprovable.mp3 | 20-Apr-2007 12:40 | 17K | |
![[SND]](/icons/sound2.gif) | reproof.mp3 | 20-Apr-2007 12:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | reprography.mp3 | 20-Apr-2007 12:40 | 9.1K | |
![[SND]](/icons/sound2.gif) | reprographics.mp3 | 20-Apr-2007 12:40 | 11K | |
![[SND]](/icons/sound2.gif) | reprographic.mp3 | 20-Apr-2007 12:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | reprographer.mp3 | 20-Apr-2007 12:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | reprogrammable.mp3 | 20-Apr-2007 12:40 | 10K | |
![[SND]](/icons/sound2.gif) | reprogram.mp3 | 20-Apr-2007 12:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | reproductive.mp3 | 20-Apr-2007 12:40 | 10K | |
![[SND]](/icons/sound2.gif) | reproduction.mp3 | 20-Apr-2007 12:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | reproducibly.mp3 | 20-Apr-2007 12:39 | 11K | |
![[SND]](/icons/sound2.gif) | reproducible.mp3 | 20-Apr-2007 12:39 | 9.8K | |
![[SND]](/icons/sound2.gif) | reproducibility.mp3 | 20-Apr-2007 12:39 | 12K | |
![[SND]](/icons/sound2.gif) | reproduce.mp3 | 20-Apr-2007 12:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | reprocess.mp3 | 20-Apr-2007 12:39 | 10K | |
![[SND]](/icons/sound2.gif) | reprobatory.mp3 | 20-Apr-2007 12:39 | 9.6K | |
![[SND]](/icons/sound2.gif) | reprobative.mp3 | 20-Apr-2007 12:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | reprobation.mp3 | 20-Apr-2007 12:39 | 9.5K | |
![[SND]](/icons/sound2.gif) | reprobate.mp3 | 20-Apr-2007 12:39 | 7.5K | |
![[SND]](/icons/sound2.gif) | reprobance.mp3 | 20-Apr-2007 12:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | reproachless.mp3 | 20-Apr-2007 12:39 | 17K | |
![[SND]](/icons/sound2.gif) | reproachingly.mp3 | 20-Apr-2007 12:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | reproachfully.mp3 | 20-Apr-2007 12:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | reproachful.mp3 | 20-Apr-2007 12:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | reproachable.mp3 | 20-Apr-2007 12:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | reproach.mp3 | 20-Apr-2007 12:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | repro.mp3 | 20-Apr-2007 12:38 | 7.0K | |
![[SND]](/icons/sound2.gif) | repristination.mp3 | 20-Apr-2007 12:38 | 10K | |
![[SND]](/icons/sound2.gif) | repristinate.mp3 | 20-Apr-2007 12:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | reprise.mp3 | 20-Apr-2007 12:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | reprisal.mp3 | 20-Apr-2007 12:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | reprinter.mp3 | 20-Apr-2007 12:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | reprint.mp3 | 20-Apr-2007 12:38 | 6.6K | |
![[SND]](/icons/sound2.gif) | reprimand.mp3 | 20-Apr-2007 12:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | reprieve.mp3 | 20-Apr-2007 12:37 | 7.1K | |
![[SND]](/icons/sound2.gif) | reprieval.mp3 | 20-Apr-2007 12:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | repressor.mp3 | 20-Apr-2007 12:37 | 7.0K | |
![[SND]](/icons/sound2.gif) | repressive.mp3 | 20-Apr-2007 12:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | repressionist.mp3 | 20-Apr-2007 12:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | repression.mp3 | 20-Apr-2007 12:37 | 7.3K | |
![[SND]](/icons/sound2.gif) | repressible.mp3 | 20-Apr-2007 12:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | repressibility.mp3 | 20-Apr-2007 12:37 | 11K | |
![[SND]](/icons/sound2.gif) | represser.mp3 | 20-Apr-2007 12:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | repressed.mp3 | 20-Apr-2007 12:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | re-press.mp3 | 20-Apr-2007 12:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | repress.mp3 | 20-Apr-2007 12:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | representedspeech.mp3 | 20-Apr-2007 12:37 | 17K | |
![[SND]](/icons/sound2.gif) | representativity.mp3 | 20-Apr-2007 12:36 | 12K | |
![[SND]](/icons/sound2.gif) | representative.mp3 | 20-Apr-2007 12:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | representationism.mp3 | 20-Apr-2007 12:36 | 17K | |
![[SND]](/icons/sound2.gif) | representationalist.mp3 | 20-Apr-2007 12:36 | 14K | |
![[SND]](/icons/sound2.gif) | representationalism.mp3 | 20-Apr-2007 12:36 | 14K | |
![[SND]](/icons/sound2.gif) | representational.mp3 | 20-Apr-2007 12:36 | 11K | |
![[SND]](/icons/sound2.gif) | re-presentation.mp3 | 20-Apr-2007 12:36 | 11K | |
![[SND]](/icons/sound2.gif) | representation.mp3 | 20-Apr-2007 12:36 | 10K | |
![[SND]](/icons/sound2.gif) | representable.mp3 | 20-Apr-2007 12:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | re-present.mp3 | 20-Apr-2007 12:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | represent.mp3 | 20-Apr-2007 12:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | reprehensive.mp3 | 20-Apr-2007 12:36 | 9.5K | |
![[SND]](/icons/sound2.gif) | reprehension.mp3 | 20-Apr-2007 12:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | reprehensibly.mp3 | 20-Apr-2007 12:35 | 9.8K | |
![[SND]](/icons/sound2.gif) | reprehensibleness.mp3 | 20-Apr-2007 12:35 | 12K | |
![[SND]](/icons/sound2.gif) | reprehensible.mp3 | 20-Apr-2007 12:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | reprehensibility.mp3 | 20-Apr-2007 12:35 | 12K | |
![[SND]](/icons/sound2.gif) | reprehend.mp3 | 20-Apr-2007 12:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | Repplier.mp3 | 20-Apr-2007 12:35 | 6.4K | |
![[SND]](/icons/sound2.gif) | reppledepple.mp3 | 20-Apr-2007 12:35 | 17K | |
![[SND]](/icons/sound2.gif) | repped.mp3 | 20-Apr-2007 12:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | repp.mp3 | 20-Apr-2007 12:35 | 4.8K | |
![[SND]](/icons/sound2.gif) | repower.mp3 | 20-Apr-2007 12:35 | 7.1K | |
![[SND]](/icons/sound2.gif) | repoussoir.mp3 | 20-Apr-2007 12:34 | 8.2K | |
![[SND]](/icons/sound2.gif) | repousse.mp3 | 20-Apr-2007 12:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | repoussage.mp3 | 20-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | repost.mp3 | 20-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | repossessor.mp3 | 20-Apr-2007 12:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | repossession.mp3 | 20-Apr-2007 12:34 | 9.1K | |
![[SND]](/icons/sound2.gif) | repossessed.mp3 | 20-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | repossess.mp3 | 20-Apr-2007 12:34 | 9.6K | |
![[SND]](/icons/sound2.gif) | repository.mp3 | 20-Apr-2007 12:34 | 10K | |
![[SND]](/icons/sound2.gif) | repositorium.mp3 | 20-Apr-2007 12:34 | 17K | |
![[SND]](/icons/sound2.gif) | reposition.mp3 | 20-Apr-2007 12:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | repositing.mp3 | 20-Apr-2007 12:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | reposited.mp3 | 20-Apr-2007 12:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | reposit.mp3 | 20-Apr-2007 12:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | reposefully.mp3 | 20-Apr-2007 12:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | reposeful.mp3 | 20-Apr-2007 12:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | repose.mp3 | 20-Apr-2007 12:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | reposal.mp3 | 20-Apr-2007 12:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | reportorially.mp3 | 20-Apr-2007 12:33 | 10K | |
![[SND]](/icons/sound2.gif) | reportorial.mp3 | 20-Apr-2007 12:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | reporter.mp3 | 20-Apr-2007 12:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | reportedly.mp3 | 20-Apr-2007 12:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | reportage.mp3 | 20-Apr-2007 12:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | reportable.mp3 | 20-Apr-2007 12:33 | 7.5K | |
![[SND]](/icons/sound2.gif) | report.mp3 | 20-Apr-2007 12:33 | 6.3K | |
![[SND]](/icons/sound2.gif) | repone.mp3 | 20-Apr-2007 12:33 | 17K | |
![[SND]](/icons/sound2.gif) | repondezsilvousplait.mp3 | 20-Apr-2007 12:33 | 17K | |
![[SND]](/icons/sound2.gif) | repondez s'il vous plait.mp3 | 20-Apr-2007 12:32 | 16K | |
![[SND]](/icons/sound2.gif) | repolarize.mp3 | 20-Apr-2007 12:32 | 10K | |
![[SND]](/icons/sound2.gif) | repolarization.mp3 | 20-Apr-2007 12:32 | 12K | |
![[SND]](/icons/sound2.gif) | repo.mp3 | 20-Apr-2007 12:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | reply.mp3 | 20-Apr-2007 12:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | replum.mp3 | 20-Apr-2007 12:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | replier.mp3 | 20-Apr-2007 12:32 | 7.7K | |
![[SND]](/icons/sound2.gif) | replicon.mp3 | 20-Apr-2007 12:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | replicative.mp3 | 20-Apr-2007 12:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | replication.mp3 | 20-Apr-2007 12:32 | 8.9K | |
![[SND]](/icons/sound2.gif) | replicate.mp3 | 20-Apr-2007 12:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | replicase.mp3 | 20-Apr-2007 12:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | replicar.mp3 | 20-Apr-2007 12:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | replicable.mp3 | 20-Apr-2007 12:32 | 7.3K | |
![[SND]](/icons/sound2.gif) | replicability.mp3 | 20-Apr-2007 12:31 | 11K | |
![[SND]](/icons/sound2.gif) | replica.mp3 | 20-Apr-2007 12:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | replevy.mp3 | 20-Apr-2007 12:31 | 7.0K | |
![[SND]](/icons/sound2.gif) | replevisable.mp3 | 20-Apr-2007 12:31 | 17K | |
![[SND]](/icons/sound2.gif) | replevin.mp3 | 20-Apr-2007 12:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | repleviable.mp3 | 20-Apr-2007 12:31 | 8.2K | |
![[SND]](/icons/sound2.gif) | repletion.mp3 | 20-Apr-2007 12:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | replete.mp3 | 20-Apr-2007 12:31 | 6.3K | |
![[SND]](/icons/sound2.gif) | replenishment.mp3 | 20-Apr-2007 12:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | replenishable.mp3 | 20-Apr-2007 12:31 | 9.1K | |
![[SND]](/icons/sound2.gif) | replenish.mp3 | 20-Apr-2007 12:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | repleader.mp3 | 20-Apr-2007 12:30 | 7.1K | |
![[SND]](/icons/sound2.gif) | replay.mp3 | 20-Apr-2007 12:30 | 7.3K | |
![[SND]](/icons/sound2.gif) | replate.mp3 | 20-Apr-2007 12:30 | 17K | |
![[SND]](/icons/sound2.gif) | replantation.mp3 | 20-Apr-2007 12:30 | 9.5K | |
![[SND]](/icons/sound2.gif) | replant.mp3 | 20-Apr-2007 12:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | replamineform.mp3 | 20-Apr-2007 12:30 | 17K | |
![[SND]](/icons/sound2.gif) | replacement.mp3 | 20-Apr-2007 12:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | replaceable.mp3 | 20-Apr-2007 12:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | replace.mp3 | 20-Apr-2007 12:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | repla.mp3 | 20-Apr-2007 12:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | repique.mp3 | 20-Apr-2007 12:29 | 17K | |
![[SND]](/icons/sound2.gif) | repine.mp3 | 20-Apr-2007 12:29 | 7.3K | |
![[SND]](/icons/sound2.gif) | repic.mp3 | 20-Apr-2007 12:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | repetitive.mp3 | 20-Apr-2007 12:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | repetitious.mp3 | 20-Apr-2007 12:29 | 9.6K | |
![[SND]](/icons/sound2.gif) | repetitional.mp3 | 20-Apr-2007 12:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | repetition.mp3 | 20-Apr-2007 12:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | repetiteur.mp3 | 20-Apr-2007 12:29 | 17K | |
![[SND]](/icons/sound2.gif) | repetend.mp3 | 20-Apr-2007 12:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | repertory.mp3 | 20-Apr-2007 12:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | repertoire.mp3 | 20-Apr-2007 12:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | reperfusion.mp3 | 20-Apr-2007 12:29 | 9.3K | |
![[SND]](/icons/sound2.gif) | repercussive.mp3 | 20-Apr-2007 12:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | repercussion.mp3 | 20-Apr-2007 12:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | Repentigny.mp3 | 20-Apr-2007 12:29 | 11K | |
![[SND]](/icons/sound2.gif) | repentant.mp3 | 20-Apr-2007 12:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | repentance.mp3 | 20-Apr-2007 12:28 | 8.0K | |
![[SND]](/icons/sound2.gif) | repent.mp3 | 20-Apr-2007 12:28 | 6.1K | |
![[SND]](/icons/sound2.gif) | repellent.mp3 | 20-Apr-2007 12:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | repellency.mp3 | 20-Apr-2007 12:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | repellant.mp3 | 20-Apr-2007 12:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | repel.mp3 | 20-Apr-2007 12:28 | 6.4K | |
![[SND]](/icons/sound2.gif) | repechage.mp3 | 20-Apr-2007 12:28 | 9.8K | |
![[SND]](/icons/sound2.gif) | repeating.mp3 | 20-Apr-2007 12:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | repeater.mp3 | 20-Apr-2007 12:28 | 6.6K | |
![[SND]](/icons/sound2.gif) | repeated.mp3 | 20-Apr-2007 12:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | repeatable.mp3 | 20-Apr-2007 12:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | repeatability.mp3 | 20-Apr-2007 12:28 | 10K | |
![[SND]](/icons/sound2.gif) | repeat.mp3 | 20-Apr-2007 12:28 | 5.9K | |
![[SND]](/icons/sound2.gif) | repealer.mp3 | 20-Apr-2007 12:28 | 7.1K | |
![[SND]](/icons/sound2.gif) | repealable.mp3 | 20-Apr-2007 12:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | repeal.mp3 | 20-Apr-2007 12:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | repdep.mp3 | 20-Apr-2007 12:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | repayment.mp3 | 20-Apr-2007 12:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | repayable.mp3 | 20-Apr-2007 12:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | repay.mp3 | 20-Apr-2007 12:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | repatriation.mp3 | 20-Apr-2007 12:27 | 11K | |
![[SND]](/icons/sound2.gif) | repatriate.mp3 | 20-Apr-2007 12:27 | 9.1K | |
![[SND]](/icons/sound2.gif) | repat.mp3 | 20-Apr-2007 12:27 | 17K | |
![[SND]](/icons/sound2.gif) | repast.mp3 | 20-Apr-2007 12:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | repassage.mp3 | 20-Apr-2007 12:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | repass.mp3 | 20-Apr-2007 12:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | repartition.mp3 | 20-Apr-2007 12:27 | 8.9K | |
![[SND]](/icons/sound2.gif) | repartimiento.mp3 | 20-Apr-2007 12:27 | 17K | |
![[SND]](/icons/sound2.gif) | repartee.mp3 | 20-Apr-2007 12:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | reparative.mp3 | 20-Apr-2007 12:27 | 8.4K | |
![[SND]](/icons/sound2.gif) | reparation.mp3 | 20-Apr-2007 12:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | reparable.mp3 | 20-Apr-2007 12:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | repand.mp3 | 20-Apr-2007 12:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | repairman.mp3 | 20-Apr-2007 12:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | repairer.mp3 | 20-Apr-2007 12:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | repairable.mp3 | 20-Apr-2007 12:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | repairability.mp3 | 20-Apr-2007 12:26 | 10K | |
![[SND]](/icons/sound2.gif) | repair.mp3 | 20-Apr-2007 12:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | repaint.mp3 | 20-Apr-2007 12:26 | 27K | |
![[SND]](/icons/sound2.gif) | repaid.mp3 | 20-Apr-2007 12:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | repackage.mp3 | 20-Apr-2007 12:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | rep.mp3 | 20-Apr-2007 12:26 | 4.8K | |
![[SND]](/icons/sound2.gif) | reovirus.mp3 | 20-Apr-2007 12:26 | 10K | |
![[SND]](/icons/sound2.gif) | reorganize.mp3 | 20-Apr-2007 12:26 | 10K | |
![[SND]](/icons/sound2.gif) | reorganizational.mp3 | 20-Apr-2007 12:26 | 12K | |
![[SND]](/icons/sound2.gif) | reorganization.mp3 | 20-Apr-2007 12:26 | 11K | |
![[SND]](/icons/sound2.gif) | reorder.mp3 | 20-Apr-2007 12:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | reopen.mp3 | 20-Apr-2007 12:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | reoffer.mp3 | 20-Apr-2007 12:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | Renwick.mp3 | 20-Apr-2007 12:26 | 6.3K | |
![[SND]](/icons/sound2.gif) | renvoi.mp3 | 20-Apr-2007 12:26 | 8.2K | |
![[SND]](/icons/sound2.gif) | renverse.mp3 | 20-Apr-2007 12:26 | 17K | |
![[SND]](/icons/sound2.gif) | renunciatory.mp3 | 20-Apr-2007 12:26 | 11K | |
![[SND]](/icons/sound2.gif) | renunciative.mp3 | 20-Apr-2007 12:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | renunciation.mp3 | 20-Apr-2007 12:25 | 10K | |
![[SND]](/icons/sound2.gif) | rentseck.mp3 | 20-Apr-2007 12:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | Renton.mp3 | 20-Apr-2007 12:25 | 6.4K | |
![[SND]](/icons/sound2.gif) | rentokil.mp3 | 20-Apr-2007 12:25 | 17K | |
![[SND]](/icons/sound2.gif) | rentier.mp3 | 20-Apr-2007 12:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | renter.mp3 | 20-Apr-2007 12:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | rentenmark.mp3 | 20-Apr-2007 12:25 | 17K | |
![[SND]](/icons/sound2.gif) | rented.mp3 | 20-Apr-2007 12:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | rente.mp3 | 20-Apr-2007 12:25 | 5.7K | |
![[SND]](/icons/sound2.gif) | rentals.mp3 | 20-Apr-2007 12:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | rental.mp3 | 20-Apr-2007 12:25 | 5.4K | |
![[SND]](/icons/sound2.gif) | rent-a-car.mp3 | 20-Apr-2007 12:25 | 6.8K | |
![[SND]](/icons/sound2.gif) | rentable.mp3 | 20-Apr-2007 12:25 | 6.1K | |
![[SND]](/icons/sound2.gif) | rentability.mp3 | 20-Apr-2007 12:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | renta.mp3 | 20-Apr-2007 12:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | rent.mp3 | 20-Apr-2007 12:25 | 4.5K | |
![[SND]](/icons/sound2.gif) | rensselaerite.mp3 | 20-Apr-2007 12:25 | 17K | |
![[SND]](/icons/sound2.gif) | renowned.mp3 | 20-Apr-2007 12:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | renown.mp3 | 20-Apr-2007 12:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | renovator.mp3 | 20-Apr-2007 12:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | renovative.mp3 | 20-Apr-2007 12:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | renovation.mp3 | 20-Apr-2007 12:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | renovate.mp3 | 20-Apr-2007 12:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | renovascular.mp3 | 20-Apr-2007 12:24 | 10K | |
![[SND]](/icons/sound2.gif) | renouncement.mp3 | 20-Apr-2007 12:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | renounce.mp3 | 20-Apr-2007 12:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | renomination.mp3 | 20-Apr-2007 12:24 | 11K | |
![[SND]](/icons/sound2.gif) | renominate.mp3 | 20-Apr-2007 12:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | renoma.mp3 | 20-Apr-2007 12:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | Renoir.mp3 | 20-Apr-2007 12:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | renography.mp3 | 20-Apr-2007 12:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | renographic.mp3 | 20-Apr-2007 12:24 | 9.1K | |
![[SND]](/icons/sound2.gif) | renogram.mp3 | 20-Apr-2007 12:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | Reno.mp3 | 20-Apr-2007 12:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | rennin.mp3 | 20-Apr-2007 12:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | rennies.mp3 | 20-Apr-2007 12:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | rennie.mp3 | 20-Apr-2007 12:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | rennet.mp3 | 20-Apr-2007 12:24 | 5.5K | |
![[SND]](/icons/sound2.gif) | Rennes.mp3 | 20-Apr-2007 12:24 | 6.1K | |
![[SND]](/icons/sound2.gif) | Renner.mp3 | 20-Apr-2007 12:23 | 5.5K | |
![[SND]](/icons/sound2.gif) | renminbi.mp3 | 20-Apr-2007 12:23 | 11K | |
![[SND]](/icons/sound2.gif) | renitent.mp3 | 20-Apr-2007 12:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | renitency.mp3 | 20-Apr-2007 12:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | renin.mp3 | 20-Apr-2007 12:23 | 6.4K | |
![[SND]](/icons/sound2.gif) | renig.mp3 | 20-Apr-2007 12:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | reniform.mp3 | 20-Apr-2007 12:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | renifleur.mp3 | 20-Apr-2007 12:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | Reni.mp3 | 20-Apr-2007 12:23 | 5.7K | |
![[SND]](/icons/sound2.gif) | Renfrewshire.mp3 | 20-Apr-2007 12:23 | 10K | |
![[SND]](/icons/sound2.gif) | Renfrew.mp3 | 20-Apr-2007 12:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | renewed.mp3 | 20-Apr-2007 12:23 | 8.2K | |
![[SND]](/icons/sound2.gif) | renewal.mp3 | 20-Apr-2007 12:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | renewably.mp3 | 20-Apr-2007 12:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | renewable.mp3 | 20-Apr-2007 12:23 | 7.5K | |
![[SND]](/icons/sound2.gif) | renewability.mp3 | 20-Apr-2007 12:23 | 10K | |
![[SND]](/icons/sound2.gif) | renew.mp3 | 20-Apr-2007 12:23 | 6.6K | |
![[SND]](/icons/sound2.gif) | renegue.mp3 | 20-Apr-2007 12:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | renegotiation.mp3 | 20-Apr-2007 12:22 | 12K | |
![[SND]](/icons/sound2.gif) | renegotiate.mp3 | 20-Apr-2007 12:22 | 11K | |
![[SND]](/icons/sound2.gif) | renegotiable.mp3 | 20-Apr-2007 12:22 | 9.8K | |
![[SND]](/icons/sound2.gif) | renege.mp3 | 20-Apr-2007 12:22 | 6.8K | |
![[SND]](/icons/sound2.gif) | renegado.mp3 | 20-Apr-2007 12:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | renegade.mp3 | 20-Apr-2007 12:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | renee.mp3 | 20-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | rene.mp3 | 20-Apr-2007 12:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | rendzina.mp3 | 20-Apr-2007 12:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | rendu.mp3 | 20-Apr-2007 12:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rendova.mp3 | 20-Apr-2007 12:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | rendition.mp3 | 20-Apr-2007 12:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | rendezvousing.mp3 | 20-Apr-2007 12:22 | 9.1K | |
![[SND]](/icons/sound2.gif) | rendezvouses.mp3 | 20-Apr-2007 12:22 | 9.8K | |
![[SND]](/icons/sound2.gif) | rendezvoused.mp3 | 20-Apr-2007 12:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | rendezvous.mp3 | 20-Apr-2007 12:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | rendering.mp3 | 20-Apr-2007 12:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | renderer.mp3 | 20-Apr-2007 12:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | renderable.mp3 | 20-Apr-2007 12:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | render.mp3 | 20-Apr-2007 12:22 | 5.7K | |
![[SND]](/icons/sound2.gif) | rendell.mp3 | 20-Apr-2007 12:21 | 8.4K | |
![[SND]](/icons/sound2.gif) | rended.mp3 | 20-Apr-2007 12:21 | 5.9K | |
![[SND]](/icons/sound2.gif) | rend.mp3 | 20-Apr-2007 12:21 | 6.4K | |
![[SND]](/icons/sound2.gif) | rencounter.mp3 | 20-Apr-2007 12:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | rencontre.mp3 | 20-Apr-2007 12:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | renault.mp3 | 20-Apr-2007 12:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | renaturing.mp3 | 20-Apr-2007 12:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | renature.mp3 | 20-Apr-2007 12:21 | 7.5K | |
![[SND]](/icons/sound2.gif) | renaturation.mp3 | 20-Apr-2007 12:21 | 11K | |
![[SND]](/icons/sound2.gif) | renata.mp3 | 20-Apr-2007 12:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | renascent.mp3 | 20-Apr-2007 12:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | renascence.mp3 | 20-Apr-2007 12:21 | 9.3K | |
![[SND]](/icons/sound2.gif) | renard.mp3 | 20-Apr-2007 12:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | Renan.mp3 | 20-Apr-2007 12:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | renal.mp3 | 20-Apr-2007 12:21 | 5.5K | |
![[SND]](/icons/sound2.gif) | renaissant.mp3 | 20-Apr-2007 12:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | renaissance.mp3 | 20-Apr-2007 12:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | rena.mp3 | 20-Apr-2007 12:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | remymartin.mp3 | 20-Apr-2007 12:21 | 17K | |
![[SND]](/icons/sound2.gif) | Remus.mp3 | 20-Apr-2007 12:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | remuneratory.mp3 | 20-Apr-2007 12:20 | 10K | |
![[SND]](/icons/sound2.gif) | remunerator.mp3 | 20-Apr-2007 12:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | remunerative.mp3 | 20-Apr-2007 12:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | remuneration.mp3 | 20-Apr-2007 12:20 | 9.6K | |
![[SND]](/icons/sound2.gif) | remunerate.mp3 | 20-Apr-2007 12:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | remuda.mp3 | 20-Apr-2007 12:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | remsleep.mp3 | 20-Apr-2007 12:20 | 17K | |
![[SND]](/icons/sound2.gif) | Remsen.mp3 | 20-Apr-2007 12:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | Remscheid.mp3 | 20-Apr-2007 12:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | remploy.mp3 | 20-Apr-2007 12:20 | 17K | |
![[SND]](/icons/sound2.gif) | remover.mp3 | 20-Apr-2007 12:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | removed.mp3 | 20-Apr-2007 12:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | removeable.mp3 | 20-Apr-2007 12:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | remove.mp3 | 20-Apr-2007 12:20 | 7.5K | |
![[SND]](/icons/sound2.gif) | removalist.mp3 | 20-Apr-2007 12:20 | 17K | |
![[SND]](/icons/sound2.gif) | removal.mp3 | 20-Apr-2007 12:20 | 7.3K | |
![[SND]](/icons/sound2.gif) | removably.mp3 | 20-Apr-2007 12:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | removableness.mp3 | 20-Apr-2007 12:20 | 11K | |
![[SND]](/icons/sound2.gif) | removable.mp3 | 20-Apr-2007 12:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | removability.mp3 | 20-Apr-2007 12:20 | 10K | |
![[SND]](/icons/sound2.gif) | remount.mp3 | 20-Apr-2007 12:20 | 6.3K | |
![[SND]](/icons/sound2.gif) | remould.mp3 | 20-Apr-2007 12:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | remoulade.mp3 | 20-Apr-2007 12:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | remotion.mp3 | 20-Apr-2007 12:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | remotely.mp3 | 20-Apr-2007 12:19 | 17K | |
![[SND]](/icons/sound2.gif) | remote.mp3 | 20-Apr-2007 12:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | remorseless.mp3 | 20-Apr-2007 12:19 | 9.6K | |
![[SND]](/icons/sound2.gif) | remorsefully.mp3 | 20-Apr-2007 12:19 | 9.1K | |
![[SND]](/icons/sound2.gif) | remorseful.mp3 | 20-Apr-2007 12:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | remorse.mp3 | 20-Apr-2007 12:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | remora.mp3 | 20-Apr-2007 12:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | remontoire.mp3 | 20-Apr-2007 12:19 | 17K | |
![[SND]](/icons/sound2.gif) | remontant.mp3 | 20-Apr-2007 12:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | remonstrator.mp3 | 20-Apr-2007 12:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | remonstrative.mp3 | 20-Apr-2007 12:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | remonstration.mp3 | 20-Apr-2007 12:19 | 9.8K | |
![[SND]](/icons/sound2.gif) | remonstrate.mp3 | 20-Apr-2007 12:19 | 8.8K | |
![[SND]](/icons/sound2.gif) | remonstrant.mp3 | 20-Apr-2007 12:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | remonstrance.mp3 | 20-Apr-2007 12:19 | 9.5K | |
![[SND]](/icons/sound2.gif) | remold.mp3 | 20-Apr-2007 12:19 | 17K | |
![[SND]](/icons/sound2.gif) | remolade.mp3 | 20-Apr-2007 12:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | remodel.mp3 | 20-Apr-2007 12:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | remo.mp3 | 20-Apr-2007 12:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | remnant.mp3 | 20-Apr-2007 12:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | remix.mp3 | 20-Apr-2007 12:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | remitter.mp3 | 20-Apr-2007 12:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | remittent.mp3 | 20-Apr-2007 12:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | remittee.mp3 | 20-Apr-2007 12:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | remittance.mp3 | 20-Apr-2007 12:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | remittal.mp3 | 20-Apr-2007 12:18 | 5.4K | |
![[SND]](/icons/sound2.gif) | remittable.mp3 | 20-Apr-2007 12:18 | 7.0K | |
![[SND]](/icons/sound2.gif) | remitment.mp3 | 20-Apr-2007 12:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | remit.mp3 | 20-Apr-2007 12:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | remissive.mp3 | 20-Apr-2007 12:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | remission.mp3 | 20-Apr-2007 12:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | remissibly.mp3 | 20-Apr-2007 12:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | remissible.mp3 | 20-Apr-2007 12:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | remiss.mp3 | 20-Apr-2007 12:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | remise.mp3 | 20-Apr-2007 12:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | remiped.mp3 | 20-Apr-2007 12:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | remint.mp3 | 20-Apr-2007 12:17 | 7.1K | |
![[SND]](/icons/sound2.gif) | reminiscer.mp3 | 20-Apr-2007 12:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | reminiscential.mp3 | 20-Apr-2007 12:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | reminiscent.mp3 | 20-Apr-2007 12:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | reminiscence.mp3 | 20-Apr-2007 12:17 | 10K | |
![[SND]](/icons/sound2.gif) | reminisce.mp3 | 20-Apr-2007 12:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | Remington.mp3 | 20-Apr-2007 12:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | remindful.mp3 | 20-Apr-2007 12:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | reminder.mp3 | 20-Apr-2007 12:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | remind.mp3 | 20-Apr-2007 12:17 | 8.8K | |
![[SND]](/icons/sound2.gif) | remigrant.mp3 | 20-Apr-2007 12:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | remiform.mp3 | 20-Apr-2007 12:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | remi.mp3 | 20-Apr-2007 12:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | remf.mp3 | 20-Apr-2007 12:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | remex.mp3 | 20-Apr-2007 12:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | remembrancer.mp3 | 20-Apr-2007 12:16 | 8.6K | |
![[SND]](/icons/sound2.gif) | remembrance.mp3 | 20-Apr-2007 12:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | remembering.mp3 | 20-Apr-2007 12:16 | 8.8K | |
![[SND]](/icons/sound2.gif) | rememberer.mp3 | 20-Apr-2007 12:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rememberable.mp3 | 20-Apr-2007 12:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | rememberability.mp3 | 20-Apr-2007 12:16 | 11K | |
![[SND]](/icons/sound2.gif) | remember.mp3 | 20-Apr-2007 12:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | remedy.mp3 | 20-Apr-2007 12:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | remediless.mp3 | 20-Apr-2007 12:16 | 17K | |
![[SND]](/icons/sound2.gif) | remediation.mp3 | 20-Apr-2007 12:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | remediate.mp3 | 20-Apr-2007 12:16 | 7.7K | |
![[SND]](/icons/sound2.gif) | remedially.mp3 | 20-Apr-2007 12:16 | 8.9K | |
![[SND]](/icons/sound2.gif) | remedial.mp3 | 20-Apr-2007 12:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | remediable.mp3 | 20-Apr-2007 12:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | remediability.mp3 | 20-Apr-2007 12:15 | 11K | |
![[SND]](/icons/sound2.gif) | reme.mp3 | 20-Apr-2007 12:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rembrandtesque.mp3 | 20-Apr-2007 12:15 | 9.6K | |
![[SND]](/icons/sound2.gif) | Rembrandt.mp3 | 20-Apr-2007 12:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | remblai.mp3 | 20-Apr-2007 12:15 | 17K | |
![[SND]](/icons/sound2.gif) | rematch.mp3 | 20-Apr-2007 12:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | remaster.mp3 | 20-Apr-2007 12:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | remarque.mp3 | 20-Apr-2007 12:15 | 6.8K | |
![[SND]](/icons/sound2.gif) | remarkably.mp3 | 20-Apr-2007 12:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | remarkable.mp3 | 20-Apr-2007 12:15 | 8.0K | |
![[SND]](/icons/sound2.gif) | remark.mp3 | 20-Apr-2007 12:15 | 6.3K | |
![[SND]](/icons/sound2.gif) | remap.mp3 | 20-Apr-2007 12:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | remanufacturer.mp3 | 20-Apr-2007 12:14 | 13K | |
![[SND]](/icons/sound2.gif) | remanufacture.mp3 | 20-Apr-2007 12:14 | 11K | |
![[SND]](/icons/sound2.gif) | remanet.mp3 | 20-Apr-2007 12:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | remanent.mp3 | 20-Apr-2007 12:14 | 6.8K | |
![[SND]](/icons/sound2.gif) | remanence.mp3 | 20-Apr-2007 12:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | remand.mp3 | 20-Apr-2007 12:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | reman.mp3 | 20-Apr-2007 12:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | remaker.mp3 | 20-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | remake.mp3 | 20-Apr-2007 12:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | remainderman.mp3 | 20-Apr-2007 12:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | remaindering.mp3 | 20-Apr-2007 12:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | remainder.mp3 | 20-Apr-2007 12:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | remain.mp3 | 20-Apr-2007 12:14 | 7.7K | |
![[SND]](/icons/sound2.gif) | Remagen.mp3 | 20-Apr-2007 12:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | remade.mp3 | 20-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | remacutetigisti.mp3 | 20-Apr-2007 12:13 | 18K | |
![[SND]](/icons/sound2.gif) | rem.mp3 | 20-Apr-2007 12:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | rem acu tetigisti.mp3 | 20-Apr-2007 12:13 | 16K | |
![[SND]](/icons/sound2.gif) | rely.mp3 | 20-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | relumine.mp3 | 20-Apr-2007 12:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | relume.mp3 | 20-Apr-2007 12:13 | 7.7K | |
![[SND]](/icons/sound2.gif) | reluctivity.mp3 | 20-Apr-2007 12:13 | 17K | |
![[SND]](/icons/sound2.gif) | reluctate.mp3 | 20-Apr-2007 12:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | reluctantly.mp3 | 20-Apr-2007 12:13 | 17K | |
![[SND]](/icons/sound2.gif) | reluctant.mp3 | 20-Apr-2007 12:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | reluctancy.mp3 | 20-Apr-2007 12:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | reluctance.mp3 | 20-Apr-2007 12:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | reluct.mp3 | 20-Apr-2007 12:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | relucent.mp3 | 20-Apr-2007 12:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | reltney.mp3 | 20-Apr-2007 12:12 | 8.6K | |
![[SND]](/icons/sound2.gif) | relocation.mp3 | 20-Apr-2007 12:12 | 9.5K | |
![[SND]](/icons/sound2.gif) | relocatee.mp3 | 20-Apr-2007 12:12 | 10K | |
![[SND]](/icons/sound2.gif) | relocate.mp3 | 20-Apr-2007 12:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | relocatable.mp3 | 20-Apr-2007 12:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | rello.mp3 | 20-Apr-2007 12:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | relleno.mp3 | 20-Apr-2007 12:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | relive.mp3 | 20-Apr-2007 12:12 | 7.7K | |
![[SND]](/icons/sound2.gif) | relishable.mp3 | 20-Apr-2007 12:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | relish.mp3 | 20-Apr-2007 12:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | reliquiae.mp3 | 20-Apr-2007 12:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | relique.mp3 | 20-Apr-2007 12:11 | 5.9K | |
![[SND]](/icons/sound2.gif) | reliquary.mp3 | 20-Apr-2007 12:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | relinquishment.mp3 | 20-Apr-2007 12:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | relinquish.mp3 | 20-Apr-2007 12:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | reline.mp3 | 20-Apr-2007 12:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | religiously.mp3 | 20-Apr-2007 12:11 | 17K | |
![[SND]](/icons/sound2.gif) | religious.mp3 | 20-Apr-2007 12:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | religiosity.mp3 | 20-Apr-2007 12:11 | 11K | |
![[SND]](/icons/sound2.gif) | religiose.mp3 | 20-Apr-2007 12:11 | 9.6K | |
![[SND]](/icons/sound2.gif) | religionless.mp3 | 20-Apr-2007 12:11 | 17K | |
![[SND]](/icons/sound2.gif) | religionize.mp3 | 20-Apr-2007 12:11 | 17K | |
![[SND]](/icons/sound2.gif) | religionist.mp3 | 20-Apr-2007 12:11 | 9.3K | |
![[SND]](/icons/sound2.gif) | religionism.mp3 | 20-Apr-2007 12:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | religioner.mp3 | 20-Apr-2007 12:10 | 17K | |
![[SND]](/icons/sound2.gif) | religion.mp3 | 20-Apr-2007 12:10 | 7.7K | |
![[SND]](/icons/sound2.gif) | religio-.mp3 | 20-Apr-2007 12:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | religio.mp3 | 20-Apr-2007 12:10 | 17K | |
![[SND]](/icons/sound2.gif) | religio loci.mp3 | 20-Apr-2007 12:10 | 13K | |
![[SND]](/icons/sound2.gif) | religieux.mp3 | 20-Apr-2007 12:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | religieuse.mp3 | 20-Apr-2007 12:10 | 17K | |
![[SND]](/icons/sound2.gif) | relievo.mp3 | 20-Apr-2007 12:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | reliever.mp3 | 20-Apr-2007 12:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | relievedly.mp3 | 20-Apr-2007 12:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | relieved.mp3 | 20-Apr-2007 12:10 | 17K | |
![[SND]](/icons/sound2.gif) | relieve.mp3 | 20-Apr-2007 12:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | relievable.mp3 | 20-Apr-2007 12:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | relier.mp3 | 20-Apr-2007 12:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | reliefer.mp3 | 20-Apr-2007 12:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | relief.mp3 | 20-Apr-2007 12:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | reliction.mp3 | 20-Apr-2007 12:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | relict.mp3 | 20-Apr-2007 12:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | relic.mp3 | 20-Apr-2007 12:09 | 5.2K | |
![[SND]](/icons/sound2.gif) | reliant.mp3 | 20-Apr-2007 12:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | reliance.mp3 | 20-Apr-2007 12:09 | 8.4K | |
![[SND]](/icons/sound2.gif) | reliably.mp3 | 20-Apr-2007 12:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | reliable.mp3 | 20-Apr-2007 12:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | reliability.mp3 | 20-Apr-2007 12:09 | 10K | |
![[SND]](/icons/sound2.gif) | relexify.mp3 | 20-Apr-2007 12:09 | 17K | |
![[SND]](/icons/sound2.gif) | releve.mp3 | 20-Apr-2007 12:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | relevant.mp3 | 20-Apr-2007 12:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | relevancy.mp3 | 20-Apr-2007 12:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | relevance.mp3 | 20-Apr-2007 12:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | relet.mp3 | 20-Apr-2007 12:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | relentless.mp3 | 20-Apr-2007 12:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | relent.mp3 | 20-Apr-2007 12:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | relegation.mp3 | 20-Apr-2007 12:08 | 9.3K | |
![[SND]](/icons/sound2.gif) | relegate.mp3 | 20-Apr-2007 12:08 | 7.5K | |
![[SND]](/icons/sound2.gif) | releasor.mp3 | 20-Apr-2007 12:08 | 17K | |
![[SND]](/icons/sound2.gif) | releaser.mp3 | 20-Apr-2007 12:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | releasee.mp3 | 20-Apr-2007 12:08 | 17K | |
![[SND]](/icons/sound2.gif) | re-lease.mp3 | 20-Apr-2007 12:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | release.mp3 | 20-Apr-2007 12:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | releasable.mp3 | 20-Apr-2007 12:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | relay.mp3 | 20-Apr-2007 12:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | relaxor.mp3 | 20-Apr-2007 12:07 | 17K | |
![[SND]](/icons/sound2.gif) | relaxin.mp3 | 20-Apr-2007 12:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | relaxedness.mp3 | 20-Apr-2007 12:07 | 10K | |
![[SND]](/icons/sound2.gif) | relaxedly.mp3 | 20-Apr-2007 12:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | relaxed.mp3 | 20-Apr-2007 12:07 | 7.5K | |
![[SND]](/icons/sound2.gif) | relaxative.mp3 | 20-Apr-2007 12:07 | 17K | |
![[SND]](/icons/sound2.gif) | relaxation.mp3 | 20-Apr-2007 12:07 | 9.6K | |
![[SND]](/icons/sound2.gif) | relaxant.mp3 | 20-Apr-2007 12:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | relax.mp3 | 20-Apr-2007 12:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | relatum.mp3 | 20-Apr-2007 12:06 | 17K | |
![[SND]](/icons/sound2.gif) | relator.mp3 | 20-Apr-2007 12:06 | 6.6K | |
![[SND]](/icons/sound2.gif) | relativize.mp3 | 20-Apr-2007 12:06 | 9.8K | |
![[SND]](/icons/sound2.gif) | relativity.mp3 | 20-Apr-2007 12:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | relativistically.mp3 | 20-Apr-2007 12:06 | 11K | |
![[SND]](/icons/sound2.gif) | relativistic.mp3 | 20-Apr-2007 12:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | relativist.mp3 | 20-Apr-2007 12:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | relativism.mp3 | 20-Apr-2007 12:06 | 9.3K | |
![[SND]](/icons/sound2.gif) | relativeness.mp3 | 20-Apr-2007 12:06 | 17K | |
![[SND]](/icons/sound2.gif) | relatively.mp3 | 20-Apr-2007 12:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | relative.mp3 | 20-Apr-2007 12:06 | 7.7K | |
![[SND]](/icons/sound2.gif) | relatival.mp3 | 20-Apr-2007 12:06 | 17K | |
![[SND]](/icons/sound2.gif) | relationship.mp3 | 20-Apr-2007 12:06 | 9.5K | |
![[SND]](/icons/sound2.gif) | relational.mp3 | 20-Apr-2007 12:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | relation.mp3 | 20-Apr-2007 12:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | related.mp3 | 20-Apr-2007 12:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | relate.mp3 | 20-Apr-2007 12:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | relatable.mp3 | 20-Apr-2007 12:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | relata.mp3 | 20-Apr-2007 12:05 | 8.0K | |
![[SND]](/icons/sound2.gif) | relapse.mp3 | 20-Apr-2007 12:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | relaid.mp3 | 20-Apr-2007 12:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | reladle.mp3 | 20-Apr-2007 12:05 | 17K | |
![[SND]](/icons/sound2.gif) | rel.mp3 | 20-Apr-2007 12:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | rejuvenize.mp3 | 20-Apr-2007 12:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | rejuvenescent.mp3 | 20-Apr-2007 12:05 | 10K | |
![[SND]](/icons/sound2.gif) | rejuvenescence.mp3 | 20-Apr-2007 12:05 | 11K | |
![[SND]](/icons/sound2.gif) | rejuvenesce.mp3 | 20-Apr-2007 12:04 | 17K | |
![[SND]](/icons/sound2.gif) | rejuvenator.mp3 | 20-Apr-2007 12:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | rejuvenation.mp3 | 20-Apr-2007 12:04 | 9.6K | |
![[SND]](/icons/sound2.gif) | rejuvenate.mp3 | 20-Apr-2007 12:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | rejoinder.mp3 | 20-Apr-2007 12:04 | 8.0K | |
![[SND]](/icons/sound2.gif) | rejoin.mp3 | 20-Apr-2007 12:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | rejoicingly.mp3 | 20-Apr-2007 12:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | rejoicing.mp3 | 20-Apr-2007 12:04 | 8.6K | |
![[SND]](/icons/sound2.gif) | rejoice.mp3 | 20-Apr-2007 12:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rejment.mp3 | 20-Apr-2007 12:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | rejigger.mp3 | 20-Apr-2007 12:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | rejig.mp3 | 20-Apr-2007 12:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | rejector.mp3 | 20-Apr-2007 12:04 | 7.3K | |
![[SND]](/icons/sound2.gif) | rejectivist.mp3 | 20-Apr-2007 12:03 | 17K | |
![[SND]](/icons/sound2.gif) | rejective.mp3 | 20-Apr-2007 12:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | rejectionist.mp3 | 20-Apr-2007 12:03 | 17K | |
![[SND]](/icons/sound2.gif) | rejection.mp3 | 20-Apr-2007 12:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | rejectingly.mp3 | 20-Apr-2007 12:03 | 8.9K | |
![[SND]](/icons/sound2.gif) | rejectee.mp3 | 20-Apr-2007 12:03 | 9.1K | |
![[SND]](/icons/sound2.gif) | rejectant.mp3 | 20-Apr-2007 12:03 | 17K | |
![[SND]](/icons/sound2.gif) | rejectamenta.mp3 | 20-Apr-2007 12:03 | 17K | |
![[SND]](/icons/sound2.gif) | reject.mp3 | 20-Apr-2007 12:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | rejasing.mp3 | 20-Apr-2007 12:03 | 17K | |
![[SND]](/icons/sound2.gif) | rejane.mp3 | 20-Apr-2007 12:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | reive.mp3 | 20-Apr-2007 12:03 | 5.5K | |
![[SND]](/icons/sound2.gif) | reith.mp3 | 20-Apr-2007 12:03 | 17K | |
![[SND]](/icons/sound2.gif) | reiterssyndrome.mp3 | 20-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | Reiter's syndrome.mp3 | 20-Apr-2007 12:02 | 11K | |
![[SND]](/icons/sound2.gif) | reiterative.mp3 | 20-Apr-2007 12:02 | 8.8K | |
![[SND]](/icons/sound2.gif) | reiteration.mp3 | 20-Apr-2007 12:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | reiterate.mp3 | 20-Apr-2007 12:02 | 7.3K | |
![[SND]](/icons/sound2.gif) | reiterant.mp3 | 20-Apr-2007 12:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | reitbok.mp3 | 20-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | reit.mp3 | 20-Apr-2007 12:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | reist.mp3 | 20-Apr-2007 12:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | reissue.mp3 | 20-Apr-2007 12:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | reischauer.mp3 | 20-Apr-2007 12:02 | 17K | |
![[SND]](/icons/sound2.gif) | reis.mp3 | 20-Apr-2007 12:02 | 6.4K | |
![[SND]](/icons/sound2.gif) | reinvestment.mp3 | 20-Apr-2007 12:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | reinvest.mp3 | 20-Apr-2007 12:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | reinvention.mp3 | 20-Apr-2007 12:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | reinvent.mp3 | 20-Apr-2007 12:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | reinterpretation.mp3 | 20-Apr-2007 12:01 | 11K | |
![[SND]](/icons/sound2.gif) | reinterpret.mp3 | 20-Apr-2007 12:01 | 8.8K | |
![[SND]](/icons/sound2.gif) | reintegrative.mp3 | 20-Apr-2007 12:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | reintegration.mp3 | 20-Apr-2007 12:01 | 9.3K | |
![[SND]](/icons/sound2.gif) | reintegrate.mp3 | 20-Apr-2007 12:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | reinsure.mp3 | 20-Apr-2007 12:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | reinsurance.mp3 | 20-Apr-2007 12:01 | 11K | |
![[SND]](/icons/sound2.gif) | reinstatement.mp3 | 20-Apr-2007 12:00 | 10K | |
![[SND]](/icons/sound2.gif) | reinstate.mp3 | 20-Apr-2007 12:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | reinsman.mp3 | 20-Apr-2007 12:00 | 7.3K | |
![[SND]](/icons/sound2.gif) | reinscribe.mp3 | 20-Apr-2007 12:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | reins.mp3 | 20-Apr-2007 12:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | reinhold.mp3 | 20-Apr-2007 12:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | Reinhardt.mp3 | 20-Apr-2007 12:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | reinfusion.mp3 | 20-Apr-2007 12:00 | 10K | |
![[SND]](/icons/sound2.gif) | reinfuse.mp3 | 20-Apr-2007 12:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | reinforcer.mp3 | 20-Apr-2007 12:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | reinforcement.mp3 | 20-Apr-2007 12:00 | 10K | |
![[SND]](/icons/sound2.gif) | reinforceable.mp3 | 20-Apr-2007 12:00 | 9.5K | |
![[SND]](/icons/sound2.gif) | reinforce.mp3 | 20-Apr-2007 11:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | reinfection.mp3 | 20-Apr-2007 11:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | reinfecta.mp3 | 20-Apr-2007 11:59 | 17K | |
![[SND]](/icons/sound2.gif) | Reines.mp3 | 20-Apr-2007 11:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | Reiner.mp3 | 20-Apr-2007 11:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | reinekefuchs.mp3 | 20-Apr-2007 11:59 | 17K | |
![[SND]](/icons/sound2.gif) | reindustrialize.mp3 | 20-Apr-2007 11:59 | 13K | |
![[SND]](/icons/sound2.gif) | reindustrialization.mp3 | 20-Apr-2007 11:59 | 14K | |
![[SND]](/icons/sound2.gif) | reindeer.mp3 | 20-Apr-2007 11:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | reincarnation.mp3 | 20-Apr-2007 11:59 | 11K | |
![[SND]](/icons/sound2.gif) | reincarnate.mp3 | 20-Apr-2007 11:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | rein.mp3 | 20-Apr-2007 11:59 | 6.1K | |
![[SND]](/icons/sound2.gif) | reims.mp3 | 20-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | reimpression.mp3 | 20-Apr-2007 11:58 | 8.6K | |
![[SND]](/icons/sound2.gif) | reimport.mp3 | 20-Apr-2007 11:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | reimbursement.mp3 | 20-Apr-2007 11:58 | 9.5K | |
![[SND]](/icons/sound2.gif) | reimburse.mp3 | 20-Apr-2007 11:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | reimbursable.mp3 | 20-Apr-2007 11:58 | 9.3K | |
![[SND]](/icons/sound2.gif) | reimagine.mp3 | 20-Apr-2007 11:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | reilly.mp3 | 20-Apr-2007 11:58 | 8.2K | |
![[SND]](/icons/sound2.gif) | Reiki.mp3 | 20-Apr-2007 11:58 | 6.6K | |
![[SND]](/icons/sound2.gif) | reigning.mp3 | 20-Apr-2007 11:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | reign.mp3 | 20-Apr-2007 11:58 | 6.3K | |
![[SND]](/icons/sound2.gif) | reigate.mp3 | 20-Apr-2007 11:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | reify.mp3 | 20-Apr-2007 11:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | reification.mp3 | 20-Apr-2007 11:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | reif.mp3 | 20-Apr-2007 11:57 | 7.9K | |
![[SND]](/icons/sound2.gif) | Reid.mp3 | 20-Apr-2007 11:57 | 5.4K | |
![[SND]](/icons/sound2.gif) | reichswehr.mp3 | 20-Apr-2007 11:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | reichsthaler.mp3 | 20-Apr-2007 11:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | Reichstein.mp3 | 20-Apr-2007 11:57 | 7.5K | |
![[SND]](/icons/sound2.gif) | reichstag.mp3 | 20-Apr-2007 11:57 | 8.6K | |
![[SND]](/icons/sound2.gif) | reichsrat.mp3 | 20-Apr-2007 11:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | reichspfennig.mp3 | 20-Apr-2007 11:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | reichsmark.mp3 | 20-Apr-2007 11:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | reichsfuhrer.mp3 | 20-Apr-2007 11:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | reichsbank.mp3 | 20-Apr-2007 11:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | Reichian.mp3 | 20-Apr-2007 11:56 | 7.0K | |
![[SND]](/icons/sound2.gif) | reichenberg.mp3 | 20-Apr-2007 11:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | reichenbachfalls.mp3 | 20-Apr-2007 11:56 | 18K | |
![[SND]](/icons/sound2.gif) | reiche.mp3 | 20-Apr-2007 11:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | Reich.mp3 | 20-Apr-2007 11:56 | 4.5K | |
![[SND]](/icons/sound2.gif) | rei.mp3 | 20-Apr-2007 11:55 | 17K | |
![[SND]](/icons/sound2.gif) | rehydration.mp3 | 20-Apr-2007 11:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | rehydrate.mp3 | 20-Apr-2007 11:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | rehydratable.mp3 | 20-Apr-2007 11:55 | 9.1K | |
![[SND]](/icons/sound2.gif) | rehovot.mp3 | 20-Apr-2007 11:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | rehouse.mp3 | 20-Apr-2007 11:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | rehoboam.mp3 | 20-Apr-2007 11:55 | 8.4K | |
![[SND]](/icons/sound2.gif) | Rehnquist.mp3 | 20-Apr-2007 11:55 | 7.7K | |
![[SND]](/icons/sound2.gif) | reheat.mp3 | 20-Apr-2007 11:55 | 17K | |
![[SND]](/icons/sound2.gif) | rehearse.mp3 | 20-Apr-2007 11:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | rehearsal.mp3 | 20-Apr-2007 11:55 | 7.0K | |
![[SND]](/icons/sound2.gif) | rehearing.mp3 | 20-Apr-2007 11:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | reheard.mp3 | 20-Apr-2007 11:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | rehear.mp3 | 20-Apr-2007 11:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | rehash.mp3 | 20-Apr-2007 11:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | rehabilitator.mp3 | 20-Apr-2007 11:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | rehabilitative.mp3 | 20-Apr-2007 11:54 | 11K | |
![[SND]](/icons/sound2.gif) | rehabilitation.mp3 | 20-Apr-2007 11:54 | 11K | |
![[SND]](/icons/sound2.gif) | rehabilitate.mp3 | 20-Apr-2007 11:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | rehabilitant.mp3 | 20-Apr-2007 11:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | rehaber.mp3 | 20-Apr-2007 11:54 | 17K | |
![[SND]](/icons/sound2.gif) | rehabber.mp3 | 20-Apr-2007 11:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | rehab.mp3 | 20-Apr-2007 11:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | regutol.mp3 | 20-Apr-2007 11:53 | 17K | |
![[SND]](/icons/sound2.gif) | regurgitation.mp3 | 20-Apr-2007 11:53 | 10K | |
![[SND]](/icons/sound2.gif) | regurgitate.mp3 | 20-Apr-2007 11:53 | 8.9K | |
![[SND]](/icons/sound2.gif) | regur.mp3 | 20-Apr-2007 11:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | regulus.mp3 | 20-Apr-2007 11:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | regulo.mp3 | 20-Apr-2007 11:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | reguline.mp3 | 20-Apr-2007 11:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | regulatory.mp3 | 20-Apr-2007 11:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | regulator.mp3 | 20-Apr-2007 11:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | regulative.mp3 | 20-Apr-2007 11:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | regulation.mp3 | 20-Apr-2007 11:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | regulate.mp3 | 20-Apr-2007 11:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | regularly.mp3 | 20-Apr-2007 11:52 | 8.2K | |
![[SND]](/icons/sound2.gif) | regularize.mp3 | 20-Apr-2007 11:52 | 11K | |
![[SND]](/icons/sound2.gif) | regularization.mp3 | 20-Apr-2007 11:52 | 11K | |
![[SND]](/icons/sound2.gif) | regularity.mp3 | 20-Apr-2007 11:52 | 9.6K | |
![[SND]](/icons/sound2.gif) | regular.mp3 | 20-Apr-2007 11:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | regulant.mp3 | 20-Apr-2007 11:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | regulable.mp3 | 20-Apr-2007 11:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | regula.mp3 | 20-Apr-2007 11:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | reguardant.mp3 | 20-Apr-2007 11:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | regrown.mp3 | 20-Apr-2007 11:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | regrow.mp3 | 20-Apr-2007 11:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | regroup.mp3 | 20-Apr-2007 11:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | regrew.mp3 | 20-Apr-2007 11:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | regrettably.mp3 | 20-Apr-2007 11:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | regrettable.mp3 | 20-Apr-2007 11:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | regretfully.mp3 | 20-Apr-2007 11:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | regretful.mp3 | 20-Apr-2007 11:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | regret.mp3 | 20-Apr-2007 11:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | regressor.mp3 | 20-Apr-2007 11:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | regressivity.mp3 | 20-Apr-2007 11:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | regressive.mp3 | 20-Apr-2007 11:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | regression.mp3 | 20-Apr-2007 11:50 | 7.5K | |
![[SND]](/icons/sound2.gif) | regress.mp3 | 20-Apr-2007 11:50 | 7.7K | |
![[SND]](/icons/sound2.gif) | regreet.mp3 | 20-Apr-2007 11:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | regrate.mp3 | 20-Apr-2007 11:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | regosol.mp3 | 20-Apr-2007 11:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | regolith.mp3 | 20-Apr-2007 11:50 | 7.0K | |
![[SND]](/icons/sound2.gif) | rego.mp3 | 20-Apr-2007 11:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | regnum.mp3 | 20-Apr-2007 11:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | regnierscranberria.mp3 | 20-Apr-2007 11:50 | 17K | |
![[SND]](/icons/sound2.gif) | regneg.mp3 | 20-Apr-2007 11:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | regnatpopulus.mp3 | 20-Apr-2007 11:49 | 17K | |
![[SND]](/icons/sound2.gif) | regnat populus.mp3 | 20-Apr-2007 11:49 | 15K | |
![[SND]](/icons/sound2.gif) | regnant.mp3 | 20-Apr-2007 11:49 | 6.4K | |
![[SND]](/icons/sound2.gif) | regnal.mp3 | 20-Apr-2007 11:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | regna.mp3 | 20-Apr-2007 11:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | regmaker.mp3 | 20-Apr-2007 11:49 | 17K | |
![[SND]](/icons/sound2.gif) | regma.mp3 | 20-Apr-2007 11:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | reglet.mp3 | 20-Apr-2007 11:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | regle.mp3 | 20-Apr-2007 11:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | regius.mp3 | 20-Apr-2007 11:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | regius professor.mp3 | 20-Apr-2007 11:48 | 12K | |
![[SND]](/icons/sound2.gif) | registry.mp3 | 20-Apr-2007 11:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | registration.mp3 | 20-Apr-2007 11:48 | 9.3K | |
![[SND]](/icons/sound2.gif) | registrate.mp3 | 20-Apr-2007 11:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | registrary.mp3 | 20-Apr-2007 11:48 | 17K | |
![[SND]](/icons/sound2.gif) | registrar.mp3 | 20-Apr-2007 11:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | registrant.mp3 | 20-Apr-2007 11:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | registrable.mp3 | 20-Apr-2007 11:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | registering.mp3 | 20-Apr-2007 11:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | registered.mp3 | 20-Apr-2007 11:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | registerable.mp3 | 20-Apr-2007 11:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | register.mp3 | 20-Apr-2007 11:47 | 7.5K | |
![[SND]](/icons/sound2.gif) | regista.mp3 | 20-Apr-2007 11:47 | 17K | |
![[SND]](/icons/sound2.gif) | regisseur.mp3 | 20-Apr-2007 11:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | regis.mp3 | 20-Apr-2007 11:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | regionally.mp3 | 20-Apr-2007 11:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | regionalize.mp3 | 20-Apr-2007 11:47 | 10K | |
![[SND]](/icons/sound2.gif) | regionalization.mp3 | 20-Apr-2007 11:47 | 11K | |
![[SND]](/icons/sound2.gif) | regionalistic.mp3 | 20-Apr-2007 11:47 | 9.3K | |
![[SND]](/icons/sound2.gif) | regionalist.mp3 | 20-Apr-2007 11:47 | 8.9K | |
![[SND]](/icons/sound2.gif) | regionalism.mp3 | 20-Apr-2007 11:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | regional.mp3 | 20-Apr-2007 11:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | region.mp3 | 20-Apr-2007 11:46 | 5.9K | |
![[SND]](/icons/sound2.gif) | regiomontanus.mp3 | 20-Apr-2007 11:46 | 17K | |
![[SND]](/icons/sound2.gif) | reginald.mp3 | 20-Apr-2007 11:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | Regina.mp3 | 20-Apr-2007 11:46 | 7.0K | |
![[SND]](/icons/sound2.gif) | regin.mp3 | 20-Apr-2007 11:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | regimentation.mp3 | 20-Apr-2007 11:46 | 10K | |
![[SND]](/icons/sound2.gif) | regimentals.mp3 | 20-Apr-2007 11:46 | 9.6K | |
![[SND]](/icons/sound2.gif) | regimental.mp3 | 20-Apr-2007 11:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | regiment.mp3 | 20-Apr-2007 11:46 | 6.4K | |
![[SND]](/icons/sound2.gif) | regimen.mp3 | 20-Apr-2007 11:46 | 6.3K | |
![[SND]](/icons/sound2.gif) | regime.mp3 | 20-Apr-2007 11:45 | 7.7K | |
![[SND]](/icons/sound2.gif) | regie.mp3 | 20-Apr-2007 11:45 | 8.2K | |
![[SND]](/icons/sound2.gif) | regicide.mp3 | 20-Apr-2007 11:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | regicidal.mp3 | 20-Apr-2007 11:45 | 8.0K | |
![[SND]](/icons/sound2.gif) | reggy.mp3 | 20-Apr-2007 11:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | reggioemilia.mp3 | 20-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | reggiocalabria.mp3 | 20-Apr-2007 11:45 | 17K | |
![[SND]](/icons/sound2.gif) | Reggio.mp3 | 20-Apr-2007 11:45 | 7.3K | |
![[SND]](/icons/sound2.gif) | Reggio nell'Emilia.mp3 | 20-Apr-2007 11:45 | 14K | |
![[SND]](/icons/sound2.gif) | Reggio di Calabria.mp3 | 20-Apr-2007 11:45 | 16K | |
![[SND]](/icons/sound2.gif) | reggie.mp3 | 20-Apr-2007 11:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | reggeism.mp3 | 20-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | regge.mp3 | 20-Apr-2007 11:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | Reggane.mp3 | 20-Apr-2007 11:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | reggae.mp3 | 20-Apr-2007 11:44 | 6.3K | |
![[SND]](/icons/sound2.gif) | reges.mp3 | 20-Apr-2007 11:44 | 17K | |
![[SND]](/icons/sound2.gif) | reger.mp3 | 20-Apr-2007 11:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | regental.mp3 | 20-Apr-2007 11:44 | 6.6K | |
![[SND]](/icons/sound2.gif) | regent.mp3 | 20-Apr-2007 11:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | Regensburg.mp3 | 20-Apr-2007 11:44 | 11K | |
![[SND]](/icons/sound2.gif) | regenerator.mp3 | 20-Apr-2007 11:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | regenerative.mp3 | 20-Apr-2007 11:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | regeneration.mp3 | 20-Apr-2007 11:43 | 10K | |
![[SND]](/icons/sound2.gif) | regeneratedcellulose.mp3 | 20-Apr-2007 11:43 | 27K | |
![[SND]](/icons/sound2.gif) | regenerate.mp3 | 20-Apr-2007 11:43 | 7.7K | |
![[SND]](/icons/sound2.gif) | regeneracy.mp3 | 20-Apr-2007 11:43 | 9.3K | |
![[SND]](/icons/sound2.gif) | regenerable.mp3 | 20-Apr-2007 11:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | regency.mp3 | 20-Apr-2007 11:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | regence.mp3 | 20-Apr-2007 11:43 | 7.9K | |
![[SND]](/icons/sound2.gif) | regelation.mp3 | 20-Apr-2007 11:43 | 17K | |
![[SND]](/icons/sound2.gif) | regelate.mp3 | 20-Apr-2007 11:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | regatta.mp3 | 20-Apr-2007 11:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | regardless.mp3 | 20-Apr-2007 11:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | regarding.mp3 | 20-Apr-2007 11:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | regardfully.mp3 | 20-Apr-2007 11:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | regardful.mp3 | 20-Apr-2007 11:42 | 8.2K | |
![[SND]](/icons/sound2.gif) | regardant.mp3 | 20-Apr-2007 11:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | regard.mp3 | 20-Apr-2007 11:42 | 7.5K | |
![[SND]](/icons/sound2.gif) | regan.mp3 | 20-Apr-2007 11:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | regally.mp3 | 20-Apr-2007 11:42 | 6.8K | |
![[SND]](/icons/sound2.gif) | regality.mp3 | 20-Apr-2007 11:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | regalism.mp3 | 20-Apr-2007 11:42 | 17K | |
![[SND]](/icons/sound2.gif) | regalia.mp3 | 20-Apr-2007 11:42 | 7.3K | |
![[SND]](/icons/sound2.gif) | regalement.mp3 | 20-Apr-2007 11:42 | 17K | |
![[SND]](/icons/sound2.gif) | regale.mp3 | 20-Apr-2007 11:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | regal.mp3 | 20-Apr-2007 11:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | regain.mp3 | 20-Apr-2007 11:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | reg.mp3 | 20-Apr-2007 11:41 | 5.7K | |
![[SND]](/icons/sound2.gif) | refute.mp3 | 20-Apr-2007 11:41 | 6.4K | |
![[SND]](/icons/sound2.gif) | refutative.mp3 | 20-Apr-2007 11:41 | 17K | |
![[SND]](/icons/sound2.gif) | refutation.mp3 | 20-Apr-2007 11:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | refutably.mp3 | 20-Apr-2007 11:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | refutable.mp3 | 20-Apr-2007 11:41 | 7.5K | |
![[SND]](/icons/sound2.gif) | refusnik.mp3 | 20-Apr-2007 11:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | refuser.mp3 | 20-Apr-2007 11:41 | 17K | |
![[SND]](/icons/sound2.gif) | refusenik.mp3 | 20-Apr-2007 11:41 | 8.6K | |
![[SND]](/icons/sound2.gif) | refuse.mp3 | 20-Apr-2007 11:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | refusal.mp3 | 20-Apr-2007 11:40 | 7.5K | |
![[SND]](/icons/sound2.gif) | refusable.mp3 | 20-Apr-2007 11:40 | 17K | |
![[SND]](/icons/sound2.gif) | refurbishment.mp3 | 20-Apr-2007 11:40 | 9.3K | |
![[SND]](/icons/sound2.gif) | refurbish.mp3 | 20-Apr-2007 11:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | refundable.mp3 | 20-Apr-2007 11:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | refundability.mp3 | 20-Apr-2007 11:40 | 10K | |
![[SND]](/icons/sound2.gif) | refund.mp3 | 20-Apr-2007 11:40 | 7.3K | |
![[SND]](/icons/sound2.gif) | refulgent.mp3 | 20-Apr-2007 11:40 | 7.7K | |
![[SND]](/icons/sound2.gif) | refulgence.mp3 | 20-Apr-2007 11:40 | 9.6K | |
![[SND]](/icons/sound2.gif) | refujew.mp3 | 20-Apr-2007 11:40 | 17K | |
![[SND]](/icons/sound2.gif) | refugium.mp3 | 20-Apr-2007 11:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | refugia.mp3 | 20-Apr-2007 11:39 | 8.4K | |
![[SND]](/icons/sound2.gif) | refugeeism.mp3 | 20-Apr-2007 11:39 | 10K | |
![[SND]](/icons/sound2.gif) | refugee.mp3 | 20-Apr-2007 11:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | refuge.mp3 | 20-Apr-2007 11:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | refuel.mp3 | 20-Apr-2007 11:39 | 7.3K | |
![[SND]](/icons/sound2.gif) | reft.mp3 | 20-Apr-2007 11:39 | 5.9K | |
![[SND]](/icons/sound2.gif) | refringent.mp3 | 20-Apr-2007 11:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | refringence.mp3 | 20-Apr-2007 11:39 | 17K | |
![[SND]](/icons/sound2.gif) | refrigeratory.mp3 | 20-Apr-2007 11:39 | 17K | |
![[SND]](/icons/sound2.gif) | refrigerator.mp3 | 20-Apr-2007 11:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | refrigeration.mp3 | 20-Apr-2007 11:39 | 11K | |
![[SND]](/icons/sound2.gif) | refrigerate.mp3 | 20-Apr-2007 11:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | refrigerant.mp3 | 20-Apr-2007 11:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | refried beans.mp3 | 20-Apr-2007 11:38 | 12K | |
![[SND]](/icons/sound2.gif) | refreshment.mp3 | 20-Apr-2007 11:38 | 8.6K | |
![[SND]](/icons/sound2.gif) | refreshingly.mp3 | 20-Apr-2007 11:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | refreshing.mp3 | 20-Apr-2007 11:38 | 8.2K | |
![[SND]](/icons/sound2.gif) | refreshful.mp3 | 20-Apr-2007 11:38 | 17K | |
![[SND]](/icons/sound2.gif) | refresher.mp3 | 20-Apr-2007 11:38 | 7.5K | |
![[SND]](/icons/sound2.gif) | refreshen.mp3 | 20-Apr-2007 11:38 | 7.7K | |
![[SND]](/icons/sound2.gif) | refresh.mp3 | 20-Apr-2007 11:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | refresco.mp3 | 20-Apr-2007 11:38 | 8.4K | |
![[SND]](/icons/sound2.gif) | refreezant.mp3 | 20-Apr-2007 11:38 | 17K | |
![[SND]](/icons/sound2.gif) | refrangibleness.mp3 | 20-Apr-2007 11:37 | 11K | |
![[SND]](/icons/sound2.gif) | refrangible.mp3 | 20-Apr-2007 11:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | refrangibility.mp3 | 20-Apr-2007 11:37 | 11K | |
![[SND]](/icons/sound2.gif) | refrainment.mp3 | 20-Apr-2007 11:37 | 8.4K | |
![[SND]](/icons/sound2.gif) | refrain.mp3 | 20-Apr-2007 11:37 | 7.9K | |
![[SND]](/icons/sound2.gif) | refractory.mp3 | 20-Apr-2007 11:37 | 8.6K | |
![[SND]](/icons/sound2.gif) | refractoriness.mp3 | 20-Apr-2007 11:37 | 11K | |
![[SND]](/icons/sound2.gif) | refractorily.mp3 | 20-Apr-2007 11:37 | 10K | |
![[SND]](/icons/sound2.gif) | refractor.mp3 | 20-Apr-2007 11:37 | 7.7K | |
![[SND]](/icons/sound2.gif) | refractometry.mp3 | 20-Apr-2007 11:37 | 11K | |
![[SND]](/icons/sound2.gif) | refractometric.mp3 | 20-Apr-2007 11:37 | 10K | |
![[SND]](/icons/sound2.gif) | refractometer.mp3 | 20-Apr-2007 11:37 | 10K | |
![[SND]](/icons/sound2.gif) | refractivity.mp3 | 20-Apr-2007 11:36 | 11K | |
![[SND]](/icons/sound2.gif) | refractive.mp3 | 20-Apr-2007 11:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | refraction.mp3 | 20-Apr-2007 11:36 | 8.2K | |
![[SND]](/icons/sound2.gif) | refractile.mp3 | 20-Apr-2007 11:36 | 7.9K | |
![[SND]](/icons/sound2.gif) | refract.mp3 | 20-Apr-2007 11:36 | 7.3K | |
![[SND]](/icons/sound2.gif) | reformist.mp3 | 20-Apr-2007 11:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | reformism.mp3 | 20-Apr-2007 11:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | reforming.mp3 | 20-Apr-2007 11:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | reformer.mp3 | 20-Apr-2007 11:36 | 7.1K | |
![[SND]](/icons/sound2.gif) | reformed.mp3 | 20-Apr-2007 11:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | reformatory.mp3 | 20-Apr-2007 11:36 | 9.6K | |
![[SND]](/icons/sound2.gif) | reformative.mp3 | 20-Apr-2007 11:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | reformational.mp3 | 20-Apr-2007 11:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | reformation.mp3 | 20-Apr-2007 11:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | reformate.mp3 | 20-Apr-2007 11:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | reformable.mp3 | 20-Apr-2007 11:35 | 7.7K | |
![[SND]](/icons/sound2.gif) | reformability.mp3 | 20-Apr-2007 11:35 | 11K | |
![[SND]](/icons/sound2.gif) | re-form.mp3 | 20-Apr-2007 11:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | reform.mp3 | 20-Apr-2007 11:35 | 7.5K | |
![[SND]](/icons/sound2.gif) | reforestation.mp3 | 20-Apr-2007 11:35 | 11K | |
![[SND]](/icons/sound2.gif) | reforest.mp3 | 20-Apr-2007 11:35 | 8.6K | |
![[SND]](/icons/sound2.gif) | refocus.mp3 | 20-Apr-2007 11:35 | 8.8K | |
![[SND]](/icons/sound2.gif) | reflux.mp3 | 20-Apr-2007 11:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | refluent.mp3 | 20-Apr-2007 11:34 | 7.7K | |
![[SND]](/icons/sound2.gif) | refluence.mp3 | 20-Apr-2007 11:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | reflow.mp3 | 20-Apr-2007 11:34 | 7.3K | |
![[SND]](/icons/sound2.gif) | reflexology.mp3 | 20-Apr-2007 11:34 | 11K | |
![[SND]](/icons/sound2.gif) | reflexologist.mp3 | 20-Apr-2007 11:34 | 12K | |
![[SND]](/icons/sound2.gif) | reflexivize.mp3 | 20-Apr-2007 11:34 | 17K | |
![[SND]](/icons/sound2.gif) | reflexivity.mp3 | 20-Apr-2007 11:34 | 9.8K | |
![[SND]](/icons/sound2.gif) | reflexive.mp3 | 20-Apr-2007 11:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | reflexion.mp3 | 20-Apr-2007 11:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | reflexible.mp3 | 20-Apr-2007 11:34 | 17K | |
![[SND]](/icons/sound2.gif) | reflexed.mp3 | 20-Apr-2007 11:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | reflex.mp3 | 20-Apr-2007 11:34 | 7.9K | |
![[SND]](/icons/sound2.gif) | reflet.mp3 | 20-Apr-2007 11:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | reflectorize.mp3 | 20-Apr-2007 11:33 | 11K | |
![[SND]](/icons/sound2.gif) | reflector.mp3 | 20-Apr-2007 11:33 | 7.7K | |
![[SND]](/icons/sound2.gif) | reflectometry.mp3 | 20-Apr-2007 11:33 | 11K | |
![[SND]](/icons/sound2.gif) | reflectometer.mp3 | 20-Apr-2007 11:33 | 10K | |
![[SND]](/icons/sound2.gif) | reflectivity.mp3 | 20-Apr-2007 11:33 | 17K | |
![[SND]](/icons/sound2.gif) | reflective.mp3 | 20-Apr-2007 11:33 | 8.6K | |
![[SND]](/icons/sound2.gif) | reflectional.mp3 | 20-Apr-2007 11:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | reflection.mp3 | 20-Apr-2007 11:33 | 8.0K | |
![[SND]](/icons/sound2.gif) | reflectance.mp3 | 20-Apr-2007 11:33 | 9.1K | |
![[SND]](/icons/sound2.gif) | reflect.mp3 | 20-Apr-2007 11:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | reflationary.mp3 | 20-Apr-2007 11:32 | 9.6K | |
![[SND]](/icons/sound2.gif) | reflation.mp3 | 20-Apr-2007 11:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | reflate.mp3 | 20-Apr-2007 11:32 | 6.8K | |
![[SND]](/icons/sound2.gif) | refit.mp3 | 20-Apr-2007 11:32 | 6.4K | |
![[SND]](/icons/sound2.gif) | refinish.mp3 | 20-Apr-2007 11:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | refinery.mp3 | 20-Apr-2007 11:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | refinement.mp3 | 20-Apr-2007 11:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | refined.mp3 | 20-Apr-2007 11:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | refine.mp3 | 20-Apr-2007 11:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | refinance.mp3 | 20-Apr-2007 11:32 | 9.6K | |
![[SND]](/icons/sound2.gif) | refillable.mp3 | 20-Apr-2007 11:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | refill.mp3 | 20-Apr-2007 11:31 | 7.1K | |
![[SND]](/icons/sound2.gif) | refigure.mp3 | 20-Apr-2007 11:31 | 8.0K | |
![[SND]](/icons/sound2.gif) | reffo.mp3 | 20-Apr-2007 11:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | referrer.mp3 | 20-Apr-2007 11:31 | 7.5K | |
![[SND]](/icons/sound2.gif) | referral.mp3 | 20-Apr-2007 11:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | referentially.mp3 | 20-Apr-2007 11:31 | 9.5K | |
![[SND]](/icons/sound2.gif) | referentiality.mp3 | 20-Apr-2007 11:31 | 12K | |
![[SND]](/icons/sound2.gif) | referential.mp3 | 20-Apr-2007 11:31 | 8.4K | |
![[SND]](/icons/sound2.gif) | referent.mp3 | 20-Apr-2007 11:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | referendum.mp3 | 20-Apr-2007 11:31 | 8.8K | |
![[SND]](/icons/sound2.gif) | referenda.mp3 | 20-Apr-2007 11:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | reference.mp3 | 20-Apr-2007 11:31 | 7.9K | |
![[SND]](/icons/sound2.gif) | referee.mp3 | 20-Apr-2007 11:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | referable.mp3 | 20-Apr-2007 11:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | refer.mp3 | 20-Apr-2007 11:30 | 7.0K | |
![[SND]](/icons/sound2.gif) | refel.mp3 | 20-Apr-2007 11:30 | 6.6K | |
![[SND]](/icons/sound2.gif) | refectory.mp3 | 20-Apr-2007 11:30 | 8.2K | |
![[SND]](/icons/sound2.gif) | refection.mp3 | 20-Apr-2007 11:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | refect.mp3 | 20-Apr-2007 11:30 | 6.8K | |
![[SND]](/icons/sound2.gif) | refashion.mp3 | 20-Apr-2007 11:30 | 8.0K | |
![[SND]](/icons/sound2.gif) | ref.mp3 | 20-Apr-2007 11:30 | 5.2K | |
![[SND]](/icons/sound2.gif) | reexport.mp3 | 20-Apr-2007 11:30 | 36K | |
![[SND]](/icons/sound2.gif) | reevesspheasant.mp3 | 20-Apr-2007 11:30 | 17K | |
![[SND]](/icons/sound2.gif) | reeve.mp3 | 20-Apr-2007 11:29 | 6.3K | |
![[SND]](/icons/sound2.gif) | reet.mp3 | 20-Apr-2007 11:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | reest.mp3 | 20-Apr-2007 11:29 | 5.7K | |
![[SND]](/icons/sound2.gif) | reesespeanutbuttercups.mp3 | 20-Apr-2007 11:29 | 27K | |
![[SND]](/icons/sound2.gif) | reese.mp3 | 20-Apr-2007 11:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | reesch.mp3 | 20-Apr-2007 11:29 | 8.2K | |
![[SND]](/icons/sound2.gif) | reep.mp3 | 20-Apr-2007 11:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | reentry.mp3 | 20-Apr-2007 11:29 | 8.0K | |
![[SND]](/icons/sound2.gif) | reentrant.mp3 | 20-Apr-2007 11:29 | 8.4K | |
![[SND]](/icons/sound2.gif) | reentrance.mp3 | 20-Apr-2007 11:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | reenter.mp3 | 20-Apr-2007 11:29 | 7.1K | |
![[SND]](/icons/sound2.gif) | reengineer.mp3 | 20-Apr-2007 11:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | reenforce.mp3 | 20-Apr-2007 11:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | reenactor.mp3 | 20-Apr-2007 11:28 | 9.3K | |
![[SND]](/icons/sound2.gif) | reenactment.mp3 | 20-Apr-2007 11:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | reenact.mp3 | 20-Apr-2007 11:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | reen.mp3 | 20-Apr-2007 11:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | reembroider.mp3 | 20-Apr-2007 11:28 | 9.1K | |
![[SND]](/icons/sound2.gif) | reem.mp3 | 20-Apr-2007 11:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | reelman.mp3 | 20-Apr-2007 11:28 | 17K | |
![[SND]](/icons/sound2.gif) | Reelfoot.mp3 | 20-Apr-2007 11:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | reeler.mp3 | 20-Apr-2007 11:28 | 6.3K | |
![[SND]](/icons/sound2.gif) | reelection.mp3 | 20-Apr-2007 11:28 | 8.4K | |
![[SND]](/icons/sound2.gif) | reelect.mp3 | 20-Apr-2007 11:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | reelable.mp3 | 20-Apr-2007 11:27 | 6.8K | |
![[SND]](/icons/sound2.gif) | reel.mp3 | 20-Apr-2007 11:27 | 5.2K | |
![[SND]](/icons/sound2.gif) | reeky.mp3 | 20-Apr-2007 11:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | reek.mp3 | 20-Apr-2007 11:27 | 4.8K | |
![[SND]](/icons/sound2.gif) | reefy.mp3 | 20-Apr-2007 11:27 | 6.3K | |
![[SND]](/icons/sound2.gif) | reefer.mp3 | 20-Apr-2007 11:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | reefable.mp3 | 20-Apr-2007 11:27 | 7.1K | |
![[SND]](/icons/sound2.gif) | reef.mp3 | 20-Apr-2007 11:27 | 5.5K | |
![[SND]](/icons/sound2.gif) | reedy.mp3 | 20-Apr-2007 11:27 | 6.4K | |
![[SND]](/icons/sound2.gif) | reeducative.mp3 | 20-Apr-2007 11:27 | 9.6K | |
![[SND]](/icons/sound2.gif) | reeducation.mp3 | 20-Apr-2007 11:27 | 10K | |
![[SND]](/icons/sound2.gif) | reeducate.mp3 | 20-Apr-2007 11:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | reedman.mp3 | 20-Apr-2007 11:26 | 7.7K | |
![[SND]](/icons/sound2.gif) | reedling.mp3 | 20-Apr-2007 11:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | reedlike.mp3 | 20-Apr-2007 11:26 | 6.6K | |
![[SND]](/icons/sound2.gif) | reedition.mp3 | 20-Apr-2007 11:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | reedit.mp3 | 20-Apr-2007 11:26 | 6.1K | |
![[SND]](/icons/sound2.gif) | reeding.mp3 | 20-Apr-2007 11:26 | 6.8K | |
![[SND]](/icons/sound2.gif) | reediness.mp3 | 20-Apr-2007 11:26 | 8.4K | |
![[SND]](/icons/sound2.gif) | reedify.mp3 | 20-Apr-2007 11:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | reeded.mp3 | 20-Apr-2007 11:26 | 5.9K | |
![[SND]](/icons/sound2.gif) | reedbuck.mp3 | 20-Apr-2007 11:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | reed.mp3 | 20-Apr-2007 11:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | reechy.mp3 | 20-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | reecho.mp3 | 20-Apr-2007 11:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | reebok.mp3 | 20-Apr-2007 11:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | reeb.mp3 | 20-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | ree.mp3 | 20-Apr-2007 11:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | redwood.mp3 | 20-Apr-2007 11:25 | 7.1K | |
![[SND]](/icons/sound2.gif) | Redwood City.mp3 | 20-Apr-2007 11:25 | 7.0K | |
![[SND]](/icons/sound2.gif) | red-winged blackbird.mp3 | 20-Apr-2007 11:25 | 13K | |
![[SND]](/icons/sound2.gif) | redwing.mp3 | 20-Apr-2007 11:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | redwat.mp3 | 20-Apr-2007 11:25 | 8.6K | |
![[SND]](/icons/sound2.gif) | redware.mp3 | 20-Apr-2007 11:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | reduzate.mp3 | 20-Apr-2007 11:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | redux.mp3 | 20-Apr-2007 11:24 | 7.7K | |
![[SND]](/icons/sound2.gif) | reduviid.mp3 | 20-Apr-2007 11:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | reduplicative.mp3 | 20-Apr-2007 11:24 | 9.5K | |
![[SND]](/icons/sound2.gif) | reduplication.mp3 | 20-Apr-2007 11:24 | 11K | |
![[SND]](/icons/sound2.gif) | reduplicate.mp3 | 20-Apr-2007 11:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | redundant.mp3 | 20-Apr-2007 11:24 | 8.0K | |
![[SND]](/icons/sound2.gif) | redundancy.mp3 | 20-Apr-2007 11:24 | 9.3K | |
![[SND]](/icons/sound2.gif) | reductor.mp3 | 20-Apr-2007 11:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | reductivism.mp3 | 20-Apr-2007 11:24 | 17K | |
![[SND]](/icons/sound2.gif) | reductive.mp3 | 20-Apr-2007 11:23 | 7.7K | |
![[SND]](/icons/sound2.gif) | reductionistic.mp3 | 20-Apr-2007 11:23 | 11K | |
![[SND]](/icons/sound2.gif) | reductionist.mp3 | 20-Apr-2007 11:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | reductionism.mp3 | 20-Apr-2007 11:23 | 10K | |
![[SND]](/icons/sound2.gif) | reductional.mp3 | 20-Apr-2007 11:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | reduction.mp3 | 20-Apr-2007 11:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | reductioadabsurdum.mp3 | 20-Apr-2007 11:23 | 27K | |
![[SND]](/icons/sound2.gif) | reductio ad absurdum.mp3 | 20-Apr-2007 11:23 | 17K | |
![[SND]](/icons/sound2.gif) | reductase.mp3 | 20-Apr-2007 11:23 | 9.3K | |
![[SND]](/icons/sound2.gif) | reductant.mp3 | 20-Apr-2007 11:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | reduct.mp3 | 20-Apr-2007 11:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | reducibly.mp3 | 20-Apr-2007 11:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | reducible.mp3 | 20-Apr-2007 11:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | reducibility.mp3 | 20-Apr-2007 11:22 | 10K | |
![[SND]](/icons/sound2.gif) | reducer.mp3 | 20-Apr-2007 11:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | reduced.mp3 | 20-Apr-2007 11:22 | 8.0K | |
![[SND]](/icons/sound2.gif) | reduce.mp3 | 20-Apr-2007 11:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | redtop.mp3 | 20-Apr-2007 11:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | red-tailed hawk.mp3 | 20-Apr-2007 11:22 | 12K | |
![[SND]](/icons/sound2.gif) | redstone.mp3 | 20-Apr-2007 11:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | redstart.mp3 | 20-Apr-2007 11:22 | 8.8K | |
![[SND]](/icons/sound2.gif) | redskin.mp3 | 20-Apr-2007 11:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | red-shouldered hawk.mp3 | 20-Apr-2007 11:22 | 13K | |
![[SND]](/icons/sound2.gif) | redshirt.mp3 | 20-Apr-2007 11:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | redshift.mp3 | 20-Apr-2007 11:21 | 8.8K | |
![[SND]](/icons/sound2.gif) | redshank.mp3 | 20-Apr-2007 11:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | red-shafted flicker.mp3 | 20-Apr-2007 11:21 | 14K | |
![[SND]](/icons/sound2.gif) | redroot.mp3 | 20-Apr-2007 11:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | redress.mp3 | 20-Apr-2007 11:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | redpoll.mp3 | 20-Apr-2007 11:21 | 8.0K | |
![[SND]](/icons/sound2.gif) | red-pencil.mp3 | 20-Apr-2007 11:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | redox.mp3 | 20-Apr-2007 11:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | redowa.mp3 | 20-Apr-2007 11:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | redout.mp3 | 20-Apr-2007 11:21 | 7.0K | |
![[SND]](/icons/sound2.gif) | redound.mp3 | 20-Apr-2007 11:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | redoubted.mp3 | 20-Apr-2007 11:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | redoubtably.mp3 | 20-Apr-2007 11:20 | 8.9K | |
![[SND]](/icons/sound2.gif) | redoubtable.mp3 | 20-Apr-2007 11:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | redoubt.mp3 | 20-Apr-2007 11:20 | 7.0K | |
![[SND]](/icons/sound2.gif) | redoublement.mp3 | 20-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | redouble.mp3 | 20-Apr-2007 11:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | redone.mp3 | 20-Apr-2007 11:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | redondobeach.mp3 | 20-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | Redondo Beach.mp3 | 20-Apr-2007 11:20 | 9.3K | |
![[SND]](/icons/sound2.gif) | redondilla.mp3 | 20-Apr-2007 11:20 | 17K | |
![[SND]](/icons/sound2.gif) | Redon.mp3 | 20-Apr-2007 11:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | redolent.mp3 | 20-Apr-2007 11:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | redolence.mp3 | 20-Apr-2007 11:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | redoing.mp3 | 20-Apr-2007 11:19 | 8.0K | |
![[SND]](/icons/sound2.gif) | redoes.mp3 | 20-Apr-2007 11:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | redo.mp3 | 20-Apr-2007 11:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | redness.mp3 | 20-Apr-2007 11:19 | 7.5K | |
![[SND]](/icons/sound2.gif) | rednecked.mp3 | 20-Apr-2007 11:19 | 8.2K | |
![[SND]](/icons/sound2.gif) | redneck.mp3 | 20-Apr-2007 11:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | Redmond.mp3 | 20-Apr-2007 11:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | redmombin.mp3 | 20-Apr-2007 11:19 | 17K | |
![[SND]](/icons/sound2.gif) | redly.mp3 | 20-Apr-2007 11:18 | 6.1K | |
![[SND]](/icons/sound2.gif) | redline.mp3 | 20-Apr-2007 11:18 | 10K | |
![[SND]](/icons/sound2.gif) | red-letter.mp3 | 20-Apr-2007 11:18 | 7.7K | |
![[SND]](/icons/sound2.gif) | redleggedgrasshopper.mp3 | 20-Apr-2007 11:18 | 17K | |
![[SND]](/icons/sound2.gif) | redleg.mp3 | 20-Apr-2007 11:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | redleadputty.mp3 | 20-Apr-2007 11:18 | 17K | |
![[SND]](/icons/sound2.gif) | redlead.mp3 | 20-Apr-2007 11:18 | 8.0K | |
![[SND]](/icons/sound2.gif) | Redlands.mp3 | 20-Apr-2007 11:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | redkowhai.mp3 | 20-Apr-2007 11:18 | 17K | |
![[SND]](/icons/sound2.gif) | redivivus.mp3 | 20-Apr-2007 11:18 | 9.1K | |
![[SND]](/icons/sound2.gif) | redistrict.mp3 | 20-Apr-2007 11:17 | 8.0K | |
![[SND]](/icons/sound2.gif) | redistributive.mp3 | 20-Apr-2007 11:17 | 11K | |
![[SND]](/icons/sound2.gif) | redistributionist.mp3 | 20-Apr-2007 11:17 | 14K | |
![[SND]](/icons/sound2.gif) | redistributional.mp3 | 20-Apr-2007 11:17 | 12K | |
![[SND]](/icons/sound2.gif) | redistribution.mp3 | 20-Apr-2007 11:17 | 11K | |
![[SND]](/icons/sound2.gif) | redistribute.mp3 | 20-Apr-2007 11:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | rediscountable.mp3 | 20-Apr-2007 11:17 | 11K | |
![[SND]](/icons/sound2.gif) | rediscount.mp3 | 20-Apr-2007 11:17 | 10K | |
![[SND]](/icons/sound2.gif) | redirection.mp3 | 20-Apr-2007 11:17 | 9.1K | |
![[SND]](/icons/sound2.gif) | redirect.mp3 | 20-Apr-2007 11:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | redintegrative.mp3 | 20-Apr-2007 11:17 | 10K | |
![[SND]](/icons/sound2.gif) | redintegration.mp3 | 20-Apr-2007 11:16 | 11K | |
![[SND]](/icons/sound2.gif) | redintegrate.mp3 | 20-Apr-2007 11:16 | 9.6K | |
![[SND]](/icons/sound2.gif) | redingote.mp3 | 20-Apr-2007 11:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | redid.mp3 | 20-Apr-2007 11:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | redial.mp3 | 20-Apr-2007 11:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | rediae.mp3 | 20-Apr-2007 11:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | redia.mp3 | 20-Apr-2007 11:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | redi.mp3 | 20-Apr-2007 11:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | red-hot.mp3 | 20-Apr-2007 11:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | redhot.mp3 | 20-Apr-2007 11:16 | 27K | |
![[SND]](/icons/sound2.gif) | redhorse.mp3 | 20-Apr-2007 11:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | redhind.mp3 | 20-Apr-2007 11:15 | 8.4K | |
![[SND]](/icons/sound2.gif) | redhibition.mp3 | 20-Apr-2007 11:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | redheaded.mp3 | 20-Apr-2007 11:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | redhead.mp3 | 20-Apr-2007 11:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | red-handed.mp3 | 20-Apr-2007 11:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | redgrave.mp3 | 20-Apr-2007 11:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | redford.mp3 | 20-Apr-2007 11:15 | 17K | |
![[SND]](/icons/sound2.gif) | redfish.mp3 | 20-Apr-2007 11:15 | 7.5K | |
![[SND]](/icons/sound2.gif) | redfield.mp3 | 20-Apr-2007 11:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | red-eye.mp3 | 20-Apr-2007 11:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | redeye gravy.mp3 | 20-Apr-2007 11:15 | 11K | |
![[SND]](/icons/sound2.gif) | redevelopment.mp3 | 20-Apr-2007 11:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | redevelop.mp3 | 20-Apr-2007 11:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | redesign.mp3 | 20-Apr-2007 11:14 | 9.5K | |
![[SND]](/icons/sound2.gif) | redescription.mp3 | 20-Apr-2007 11:14 | 10K | |
![[SND]](/icons/sound2.gif) | redescribe.mp3 | 20-Apr-2007 11:14 | 10K | |
![[SND]](/icons/sound2.gif) | redeployment.mp3 | 20-Apr-2007 11:14 | 9.8K | |
![[SND]](/icons/sound2.gif) | redeploy.mp3 | 20-Apr-2007 11:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | redemptory.mp3 | 20-Apr-2007 11:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | Redemptorist.mp3 | 20-Apr-2007 11:14 | 9.5K | |
![[SND]](/icons/sound2.gif) | redemptive.mp3 | 20-Apr-2007 11:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | redemptioner.mp3 | 20-Apr-2007 11:14 | 9.1K | |
![[SND]](/icons/sound2.gif) | redemption.mp3 | 20-Apr-2007 11:13 | 8.6K | |
![[SND]](/icons/sound2.gif) | redemptible.mp3 | 20-Apr-2007 11:13 | 17K | |
![[SND]](/icons/sound2.gif) | redefinition.mp3 | 20-Apr-2007 11:13 | 10K | |
![[SND]](/icons/sound2.gif) | redefine.mp3 | 20-Apr-2007 11:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | redeeming.mp3 | 20-Apr-2007 11:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | redeemer.mp3 | 20-Apr-2007 11:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | redeemable.mp3 | 20-Apr-2007 11:13 | 8.8K | |
![[SND]](/icons/sound2.gif) | redeem.mp3 | 20-Apr-2007 11:13 | 8.0K | |
![[SND]](/icons/sound2.gif) | redecorator.mp3 | 20-Apr-2007 11:13 | 9.8K | |
![[SND]](/icons/sound2.gif) | redecoration.mp3 | 20-Apr-2007 11:13 | 11K | |
![[SND]](/icons/sound2.gif) | redecorate.mp3 | 20-Apr-2007 11:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | redear.mp3 | 20-Apr-2007 11:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | rede.mp3 | 20-Apr-2007 11:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | reddy.mp3 | 20-Apr-2007 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | reddleman.mp3 | 20-Apr-2007 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | reddle.mp3 | 20-Apr-2007 11:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | redditch.mp3 | 20-Apr-2007 11:12 | 8.4K | |
![[SND]](/icons/sound2.gif) | reddish.mp3 | 20-Apr-2007 11:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | Redding.mp3 | 20-Apr-2007 11:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | reddening.mp3 | 20-Apr-2007 11:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | reddendum.mp3 | 20-Apr-2007 11:12 | 17K | |
![[SND]](/icons/sound2.gif) | redden.mp3 | 20-Apr-2007 11:12 | 6.1K | |
![[SND]](/icons/sound2.gif) | redd.mp3 | 20-Apr-2007 11:11 | 6.1K | |
![[SND]](/icons/sound2.gif) | redcoat.mp3 | 20-Apr-2007 11:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | redcap.mp3 | 20-Apr-2007 11:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | redbud.mp3 | 20-Apr-2007 11:11 | 7.5K | |
![[SND]](/icons/sound2.gif) | Redbridge.mp3 | 20-Apr-2007 11:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | redbrick.mp3 | 20-Apr-2007 11:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | redbreast.mp3 | 20-Apr-2007 11:11 | 8.6K | |
![[SND]](/icons/sound2.gif) | redbone.mp3 | 20-Apr-2007 11:11 | 8.0K | |
![[SND]](/icons/sound2.gif) | red-blooded.mp3 | 20-Apr-2007 11:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | redbird.mp3 | 20-Apr-2007 11:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | redbellydace.mp3 | 20-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | redbelly dace.mp3 | 20-Apr-2007 11:10 | 13K | |
![[SND]](/icons/sound2.gif) | redbankwhiteoak.mp3 | 20-Apr-2007 11:10 | 17K | |
![[SND]](/icons/sound2.gif) | red-bait.mp3 | 20-Apr-2007 11:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | redate.mp3 | 20-Apr-2007 11:10 | 7.5K | |
![[SND]](/icons/sound2.gif) | redassed.mp3 | 20-Apr-2007 11:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | redargue.mp3 | 20-Apr-2007 11:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | redan.mp3 | 20-Apr-2007 11:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | redactor.mp3 | 20-Apr-2007 11:10 | 7.3K | |
![[SND]](/icons/sound2.gif) | redactional.mp3 | 20-Apr-2007 11:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | redaction.mp3 | 20-Apr-2007 11:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | redact.mp3 | 20-Apr-2007 11:09 | 7.7K | |
![[SND]](/icons/sound2.gif) | red.mp3 | 20-Apr-2007 11:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | red sindhi.mp3 | 20-Apr-2007 11:09 | 9.6K | |
![[SND]](/icons/sound2.gif) | Red Cloud.mp3 | 20-Apr-2007 11:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | recycler.mp3 | 20-Apr-2007 11:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | recycle.mp3 | 20-Apr-2007 11:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | recyclable.mp3 | 20-Apr-2007 11:08 | 9.8K | |
![[SND]](/icons/sound2.gif) | recyclability.mp3 | 20-Apr-2007 11:08 | 11K | |
![[SND]](/icons/sound2.gif) | recvee.mp3 | 20-Apr-2007 11:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | recut.mp3 | 20-Apr-2007 11:08 | 6.6K | |
![[SND]](/icons/sound2.gif) | recuse.mp3 | 20-Apr-2007 11:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | recusant.mp3 | 20-Apr-2007 11:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | recusancy.mp3 | 20-Apr-2007 11:07 | 11K | |
![[SND]](/icons/sound2.gif) | recusal.mp3 | 20-Apr-2007 11:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | recurved.mp3 | 20-Apr-2007 11:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | recurve.mp3 | 20-Apr-2007 11:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | recurvate.mp3 | 20-Apr-2007 11:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | recursive.mp3 | 20-Apr-2007 11:07 | 8.0K | |
![[SND]](/icons/sound2.gif) | recursion.mp3 | 20-Apr-2007 11:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | recurring.mp3 | 20-Apr-2007 11:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | recurrent.mp3 | 20-Apr-2007 11:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | recurrence.mp3 | 20-Apr-2007 11:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | recur.mp3 | 20-Apr-2007 11:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | recuperator.mp3 | 20-Apr-2007 11:06 | 17K | |
![[SND]](/icons/sound2.gif) | recuperative.mp3 | 20-Apr-2007 11:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | recuperation.mp3 | 20-Apr-2007 11:06 | 10K | |
![[SND]](/icons/sound2.gif) | recuperate.mp3 | 20-Apr-2007 11:06 | 8.8K | |
![[SND]](/icons/sound2.gif) | recumbent.mp3 | 20-Apr-2007 11:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | recumbency.mp3 | 20-Apr-2007 11:06 | 9.6K | |
![[SND]](/icons/sound2.gif) | reculerpourmieuxsauter.mp3 | 20-Apr-2007 11:06 | 27K | |
![[SND]](/icons/sound2.gif) | reculer pour mieux sauter.mp3 | 20-Apr-2007 11:06 | 18K | |
![[SND]](/icons/sound2.gif) | rectus.mp3 | 20-Apr-2007 11:06 | 6.8K | |
![[SND]](/icons/sound2.gif) | rectum.mp3 | 20-Apr-2007 11:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | rectrix.mp3 | 20-Apr-2007 11:05 | 7.5K | |
![[SND]](/icons/sound2.gif) | rectrices.mp3 | 20-Apr-2007 11:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | rectory.mp3 | 20-Apr-2007 11:05 | 6.6K | |
![[SND]](/icons/sound2.gif) | rectorship.mp3 | 20-Apr-2007 11:05 | 8.6K | |
![[SND]](/icons/sound2.gif) | rectorial.mp3 | 20-Apr-2007 11:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | rectorate.mp3 | 20-Apr-2007 11:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | rector.mp3 | 20-Apr-2007 11:05 | 6.4K | |
![[SND]](/icons/sound2.gif) | rectocele.mp3 | 20-Apr-2007 11:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | recto.mp3 | 20-Apr-2007 11:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | rectitudinous.mp3 | 20-Apr-2007 11:05 | 10K | |
![[SND]](/icons/sound2.gif) | rectitude.mp3 | 20-Apr-2007 11:05 | 8.9K | |
![[SND]](/icons/sound2.gif) | rectilinearity.mp3 | 20-Apr-2007 11:04 | 12K | |
![[SND]](/icons/sound2.gif) | rectilinear.mp3 | 20-Apr-2007 11:04 | 9.1K | |
![[SND]](/icons/sound2.gif) | rectify.mp3 | 20-Apr-2007 11:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | rectifier.mp3 | 20-Apr-2007 11:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | rectification.mp3 | 20-Apr-2007 11:04 | 11K | |
![[SND]](/icons/sound2.gif) | rectifiable.mp3 | 20-Apr-2007 11:04 | 10K | |
![[SND]](/icons/sound2.gif) | rectifiability.mp3 | 20-Apr-2007 11:04 | 13K | |
![[SND]](/icons/sound2.gif) | recti.mp3 | 20-Apr-2007 11:04 | 7.0K | |
![[SND]](/icons/sound2.gif) | rectenna.mp3 | 20-Apr-2007 11:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | rectectomy.mp3 | 20-Apr-2007 11:04 | 17K | |
![[SND]](/icons/sound2.gif) | recte.mp3 | 20-Apr-2007 11:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | rectangularly.mp3 | 20-Apr-2007 11:04 | 11K | |
![[SND]](/icons/sound2.gif) | rectangularity.mp3 | 20-Apr-2007 11:03 | 12K | |
![[SND]](/icons/sound2.gif) | rectangular.mp3 | 20-Apr-2007 11:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | rectangle.mp3 | 20-Apr-2007 11:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | rectal.mp3 | 20-Apr-2007 11:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | recta.mp3 | 20-Apr-2007 11:03 | 5.7K | |
![[SND]](/icons/sound2.gif) | rect.mp3 | 20-Apr-2007 11:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | recrystallize.mp3 | 20-Apr-2007 11:03 | 12K | |
![[SND]](/icons/sound2.gif) | recrystallization.mp3 | 20-Apr-2007 11:03 | 13K | |
![[SND]](/icons/sound2.gif) | recruitment.mp3 | 20-Apr-2007 11:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | recruit.mp3 | 20-Apr-2007 11:03 | 6.8K | |
![[SND]](/icons/sound2.gif) | recrudescent.mp3 | 20-Apr-2007 11:03 | 10K | |
![[SND]](/icons/sound2.gif) | recrudescence.mp3 | 20-Apr-2007 11:03 | 11K | |
![[SND]](/icons/sound2.gif) | recrudesce.mp3 | 20-Apr-2007 11:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | recroom.mp3 | 20-Apr-2007 11:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | recriminatory.mp3 | 20-Apr-2007 11:02 | 11K | |
![[SND]](/icons/sound2.gif) | recriminative.mp3 | 20-Apr-2007 11:02 | 9.8K | |
![[SND]](/icons/sound2.gif) | recrimination.mp3 | 20-Apr-2007 11:02 | 10K | |
![[SND]](/icons/sound2.gif) | recriminate.mp3 | 20-Apr-2007 11:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | recriminalize.mp3 | 20-Apr-2007 11:02 | 17K | |
![[SND]](/icons/sound2.gif) | recrementitious.mp3 | 20-Apr-2007 11:02 | 17K | |
![[SND]](/icons/sound2.gif) | recrement.mp3 | 20-Apr-2007 11:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | re-creator.mp3 | 20-Apr-2007 11:02 | 9.5K | |
![[SND]](/icons/sound2.gif) | re-creative.mp3 | 20-Apr-2007 11:02 | 9.6K | |
![[SND]](/icons/sound2.gif) | recreative.mp3 | 20-Apr-2007 11:02 | 9.1K | |
![[SND]](/icons/sound2.gif) | recreationist.mp3 | 20-Apr-2007 11:01 | 11K | |
![[SND]](/icons/sound2.gif) | recreationalist.mp3 | 20-Apr-2007 11:01 | 17K | |
![[SND]](/icons/sound2.gif) | recreational.mp3 | 20-Apr-2007 11:01 | 11K | |
![[SND]](/icons/sound2.gif) | re-creation.mp3 | 20-Apr-2007 11:01 | 11K | |
![[SND]](/icons/sound2.gif) | recreation.mp3 | 20-Apr-2007 11:01 | 9.8K | |
![[SND]](/icons/sound2.gif) | re-create.mp3 | 20-Apr-2007 11:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | recreate.mp3 | 20-Apr-2007 11:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | re-creatable.mp3 | 20-Apr-2007 11:01 | 10K | |
![[SND]](/icons/sound2.gif) | recreant.mp3 | 20-Apr-2007 11:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | recovery.mp3 | 20-Apr-2007 11:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | recovering.mp3 | 20-Apr-2007 11:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | recoverer.mp3 | 20-Apr-2007 11:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | recoverable.mp3 | 20-Apr-2007 11:00 | 9.8K | |
![[SND]](/icons/sound2.gif) | recoverability.mp3 | 20-Apr-2007 11:00 | 11K | |
![[SND]](/icons/sound2.gif) | re-cover.mp3 | 20-Apr-2007 11:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | recover.mp3 | 20-Apr-2007 11:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | recourse.mp3 | 20-Apr-2007 11:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | recoupment.mp3 | 20-Apr-2007 11:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | recoupable.mp3 | 20-Apr-2007 11:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | recoup.mp3 | 20-Apr-2007 11:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | recountal.mp3 | 20-Apr-2007 11:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | recount.mp3 | 20-Apr-2007 11:00 | 7.7K | |
![[SND]](/icons/sound2.gif) | recordist.mp3 | 20-Apr-2007 11:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | recording.mp3 | 20-Apr-2007 11:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | recordholder.mp3 | 20-Apr-2007 11:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | recorder.mp3 | 20-Apr-2007 10:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | recordation.mp3 | 20-Apr-2007 10:59 | 9.8K | |
![[SND]](/icons/sound2.gif) | recordal.mp3 | 20-Apr-2007 10:59 | 8.2K | |
![[SND]](/icons/sound2.gif) | recordable.mp3 | 20-Apr-2007 10:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | record.mp3 | 20-Apr-2007 10:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | reconveyance.mp3 | 20-Apr-2007 10:59 | 11K | |
![[SND]](/icons/sound2.gif) | reconvey.mp3 | 20-Apr-2007 10:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | recontextualize.mp3 | 20-Apr-2007 10:59 | 14K | |
![[SND]](/icons/sound2.gif) | reconstructor.mp3 | 20-Apr-2007 10:59 | 11K | |
![[SND]](/icons/sound2.gif) | reconstructive.mp3 | 20-Apr-2007 10:59 | 11K | |
![[SND]](/icons/sound2.gif) | reconstructionist.mp3 | 20-Apr-2007 10:59 | 13K | |
![[SND]](/icons/sound2.gif) | reconstructionism.mp3 | 20-Apr-2007 10:59 | 13K | |
![[SND]](/icons/sound2.gif) | reconstruction.mp3 | 20-Apr-2007 10:59 | 11K | |
![[SND]](/icons/sound2.gif) | reconstructible.mp3 | 20-Apr-2007 10:58 | 12K | |
![[SND]](/icons/sound2.gif) | reconstruct.mp3 | 20-Apr-2007 10:58 | 10K | |
![[SND]](/icons/sound2.gif) | reconstitution.mp3 | 20-Apr-2007 10:58 | 12K | |
![[SND]](/icons/sound2.gif) | reconstitute.mp3 | 20-Apr-2007 10:58 | 10K | |
![[SND]](/icons/sound2.gif) | reconsideration.mp3 | 20-Apr-2007 10:58 | 12K | |
![[SND]](/icons/sound2.gif) | reconsider.mp3 | 20-Apr-2007 10:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | reconnoitring.mp3 | 20-Apr-2007 10:58 | 10K | |
![[SND]](/icons/sound2.gif) | reconnoitre.mp3 | 20-Apr-2007 10:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | reconnoiter.mp3 | 20-Apr-2007 10:58 | 8.8K | |
![[SND]](/icons/sound2.gif) | reconnaissance.mp3 | 20-Apr-2007 10:58 | 9.8K | |
![[SND]](/icons/sound2.gif) | reconfirmation.mp3 | 20-Apr-2007 10:58 | 12K | |
![[SND]](/icons/sound2.gif) | reconfirm.mp3 | 20-Apr-2007 10:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | recondition.mp3 | 20-Apr-2007 10:57 | 9.5K | |
![[SND]](/icons/sound2.gif) | recondite.mp3 | 20-Apr-2007 10:57 | 8.0K | |
![[SND]](/icons/sound2.gif) | reconciliatory.mp3 | 20-Apr-2007 10:57 | 13K | |
![[SND]](/icons/sound2.gif) | reconciliation.mp3 | 20-Apr-2007 10:57 | 13K | |
![[SND]](/icons/sound2.gif) | reconciliate.mp3 | 20-Apr-2007 10:57 | 17K | |
![[SND]](/icons/sound2.gif) | reconcilement.mp3 | 20-Apr-2007 10:57 | 11K | |
![[SND]](/icons/sound2.gif) | reconcile.mp3 | 20-Apr-2007 10:57 | 11K | |
![[SND]](/icons/sound2.gif) | reconcilable.mp3 | 20-Apr-2007 10:57 | 11K | |
![[SND]](/icons/sound2.gif) | reconcilability.mp3 | 20-Apr-2007 10:57 | 13K | |
![[SND]](/icons/sound2.gif) | recon.mp3 | 20-Apr-2007 10:57 | 8.4K | |
![[SND]](/icons/sound2.gif) | recomposition.mp3 | 20-Apr-2007 10:57 | 11K | |
![[SND]](/icons/sound2.gif) | recompose.mp3 | 20-Apr-2007 10:56 | 9.8K | |
![[SND]](/icons/sound2.gif) | recompense.mp3 | 20-Apr-2007 10:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | recommittal.mp3 | 20-Apr-2007 10:56 | 8.2K | |
![[SND]](/icons/sound2.gif) | recommitment.mp3 | 20-Apr-2007 10:56 | 9.8K | |
![[SND]](/icons/sound2.gif) | recommit.mp3 | 20-Apr-2007 10:56 | 7.9K | |
![[SND]](/icons/sound2.gif) | recommendatory.mp3 | 20-Apr-2007 10:56 | 12K | |
![[SND]](/icons/sound2.gif) | recommendation.mp3 | 20-Apr-2007 10:56 | 11K | |
![[SND]](/icons/sound2.gif) | recommendable.mp3 | 20-Apr-2007 10:56 | 9.3K | |
![[SND]](/icons/sound2.gif) | recommend.mp3 | 20-Apr-2007 10:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | recomfort.mp3 | 20-Apr-2007 10:56 | 17K | |
![[SND]](/icons/sound2.gif) | recombinoid.mp3 | 20-Apr-2007 10:56 | 17K | |
![[SND]](/icons/sound2.gif) | recombine.mp3 | 20-Apr-2007 10:55 | 9.6K | |
![[SND]](/icons/sound2.gif) | recombinational.mp3 | 20-Apr-2007 10:55 | 12K | |
![[SND]](/icons/sound2.gif) | recombination.mp3 | 20-Apr-2007 10:55 | 11K | |
![[SND]](/icons/sound2.gif) | recombinant.mp3 | 20-Apr-2007 10:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | recolte.mp3 | 20-Apr-2007 10:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | recollection.mp3 | 20-Apr-2007 10:55 | 9.5K | |
![[SND]](/icons/sound2.gif) | recollected.mp3 | 20-Apr-2007 10:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | re-collect.mp3 | 20-Apr-2007 10:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | recollect.mp3 | 20-Apr-2007 10:55 | 8.0K | |
![[SND]](/icons/sound2.gif) | recoinage.mp3 | 20-Apr-2007 10:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | recoin.mp3 | 20-Apr-2007 10:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | recoilless.mp3 | 20-Apr-2007 10:54 | 9.8K | |
![[SND]](/icons/sound2.gif) | recoil.mp3 | 20-Apr-2007 10:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | recognizor.mp3 | 20-Apr-2007 10:54 | 17K | |
![[SND]](/icons/sound2.gif) | recognizee.mp3 | 20-Apr-2007 10:54 | 17K | |
![[SND]](/icons/sound2.gif) | recognize.mp3 | 20-Apr-2007 10:54 | 9.3K | |
![[SND]](/icons/sound2.gif) | recognizant.mp3 | 20-Apr-2007 10:54 | 17K | |
![[SND]](/icons/sound2.gif) | recognizance.mp3 | 20-Apr-2007 10:54 | 11K | |
![[SND]](/icons/sound2.gif) | recognizably.mp3 | 20-Apr-2007 10:54 | 11K | |
![[SND]](/icons/sound2.gif) | recognizable.mp3 | 20-Apr-2007 10:54 | 11K | |
![[SND]](/icons/sound2.gif) | recognizability.mp3 | 20-Apr-2007 10:53 | 13K | |
![[SND]](/icons/sound2.gif) | recognition.mp3 | 20-Apr-2007 10:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | reclusive.mp3 | 20-Apr-2007 10:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | reclusion.mp3 | 20-Apr-2007 10:53 | 9.1K | |
![[SND]](/icons/sound2.gif) | recluse.mp3 | 20-Apr-2007 10:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | reclosable.mp3 | 20-Apr-2007 10:53 | 9.6K | |
![[SND]](/icons/sound2.gif) | reclivate.mp3 | 20-Apr-2007 10:53 | 17K | |
![[SND]](/icons/sound2.gif) | recliner.mp3 | 20-Apr-2007 10:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | recline.mp3 | 20-Apr-2007 10:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | reclinate.mp3 | 20-Apr-2007 10:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | reclame.mp3 | 20-Apr-2007 10:53 | 8.4K | |
![[SND]](/icons/sound2.gif) | reclamation.mp3 | 20-Apr-2007 10:52 | 10K | |
![[SND]](/icons/sound2.gif) | reclama.mp3 | 20-Apr-2007 10:52 | 17K | |
![[SND]](/icons/sound2.gif) | reclam.mp3 | 20-Apr-2007 10:52 | 17K | |
![[SND]](/icons/sound2.gif) | reclaimant.mp3 | 20-Apr-2007 10:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | reclaimable.mp3 | 20-Apr-2007 10:52 | 9.1K | |
![[SND]](/icons/sound2.gif) | reclaim.mp3 | 20-Apr-2007 10:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | reckoning.mp3 | 20-Apr-2007 10:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | reckoner.mp3 | 20-Apr-2007 10:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | reckon.mp3 | 20-Apr-2007 10:52 | 6.4K | |
![[SND]](/icons/sound2.gif) | Recklinghausen.mp3 | 20-Apr-2007 10:52 | 12K | |
![[SND]](/icons/sound2.gif) | reckless.mp3 | 20-Apr-2007 10:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | reck.mp3 | 20-Apr-2007 10:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | recite.mp3 | 20-Apr-2007 10:51 | 7.7K | |
![[SND]](/icons/sound2.gif) | recitativostromentato.mp3 | 20-Apr-2007 10:51 | 27K | |
![[SND]](/icons/sound2.gif) | recitativosecco.mp3 | 20-Apr-2007 10:51 | 18K | |
![[SND]](/icons/sound2.gif) | recitativoaccompagnato.mp3 | 20-Apr-2007 10:51 | 27K | |
![[SND]](/icons/sound2.gif) | recitativo.mp3 | 20-Apr-2007 10:51 | 10K | |
![[SND]](/icons/sound2.gif) | recitativi.mp3 | 20-Apr-2007 10:51 | 12K | |
![[SND]](/icons/sound2.gif) | recitative.mp3 | 20-Apr-2007 10:51 | 11K | |
![[SND]](/icons/sound2.gif) | recitation.mp3 | 20-Apr-2007 10:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | recitatif.mp3 | 20-Apr-2007 10:51 | 17K | |
![[SND]](/icons/sound2.gif) | recitalist.mp3 | 20-Apr-2007 10:51 | 10K | |
![[SND]](/icons/sound2.gif) | recital.mp3 | 20-Apr-2007 10:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | recision.mp3 | 20-Apr-2007 10:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | reciprocity.mp3 | 20-Apr-2007 10:50 | 11K | |
![[SND]](/icons/sound2.gif) | reciprocator.mp3 | 20-Apr-2007 10:50 | 10K | |
![[SND]](/icons/sound2.gif) | reciprocative.mp3 | 20-Apr-2007 10:50 | 10K | |
![[SND]](/icons/sound2.gif) | reciprocation.mp3 | 20-Apr-2007 10:50 | 11K | |
![[SND]](/icons/sound2.gif) | reciprocate.mp3 | 20-Apr-2007 10:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | reciprocally.mp3 | 20-Apr-2007 10:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | reciprocal.mp3 | 20-Apr-2007 10:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | recipient.mp3 | 20-Apr-2007 10:50 | 8.8K | |
![[SND]](/icons/sound2.gif) | recipience.mp3 | 20-Apr-2007 10:50 | 17K | |
![[SND]](/icons/sound2.gif) | recipe.mp3 | 20-Apr-2007 10:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | Recife.mp3 | 20-Apr-2007 10:49 | 7.0K | |
![[SND]](/icons/sound2.gif) | recidivous.mp3 | 20-Apr-2007 10:49 | 17K | |
![[SND]](/icons/sound2.gif) | recidivistic.mp3 | 20-Apr-2007 10:49 | 10K | |
![[SND]](/icons/sound2.gif) | recidivist.mp3 | 20-Apr-2007 10:49 | 9.6K | |
![[SND]](/icons/sound2.gif) | recidivism.mp3 | 20-Apr-2007 10:49 | 10K | |
![[SND]](/icons/sound2.gif) | recidivate.mp3 | 20-Apr-2007 10:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | recherche.mp3 | 20-Apr-2007 10:49 | 11K | |
![[SND]](/icons/sound2.gif) | recheck.mp3 | 20-Apr-2007 10:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | recheat.mp3 | 20-Apr-2007 10:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | rechauffe.mp3 | 20-Apr-2007 10:49 | 11K | |
![[SND]](/icons/sound2.gif) | recharger.mp3 | 20-Apr-2007 10:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | rechargeable.mp3 | 20-Apr-2007 10:48 | 9.1K | |
![[SND]](/icons/sound2.gif) | recharge.mp3 | 20-Apr-2007 10:48 | 9.6K | |
![[SND]](/icons/sound2.gif) | rechabite.mp3 | 20-Apr-2007 10:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | recessive.mp3 | 20-Apr-2007 10:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | recessionary.mp3 | 20-Apr-2007 10:48 | 9.8K | |
![[SND]](/icons/sound2.gif) | recessional.mp3 | 20-Apr-2007 10:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | recession.mp3 | 20-Apr-2007 10:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | recess.mp3 | 20-Apr-2007 10:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | recercelee.mp3 | 20-Apr-2007 10:48 | 17K | |
![[SND]](/icons/sound2.gif) | receptorology.mp3 | 20-Apr-2007 10:48 | 17K | |
![[SND]](/icons/sound2.gif) | receptor.mp3 | 20-Apr-2007 10:47 | 7.7K | |
![[SND]](/icons/sound2.gif) | receptivity.mp3 | 20-Apr-2007 10:47 | 11K | |
![[SND]](/icons/sound2.gif) | receptive.mp3 | 20-Apr-2007 10:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | receptionist.mp3 | 20-Apr-2007 10:47 | 9.6K | |
![[SND]](/icons/sound2.gif) | receptionism.mp3 | 20-Apr-2007 10:47 | 17K | |
![[SND]](/icons/sound2.gif) | reception.mp3 | 20-Apr-2007 10:47 | 8.4K | |
![[SND]](/icons/sound2.gif) | receptible.mp3 | 20-Apr-2007 10:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | receptaculum.mp3 | 20-Apr-2007 10:47 | 17K | |
![[SND]](/icons/sound2.gif) | receptacle.mp3 | 20-Apr-2007 10:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | recept.mp3 | 20-Apr-2007 10:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | recently.mp3 | 20-Apr-2007 10:47 | 17K | |
![[SND]](/icons/sound2.gif) | recent.mp3 | 20-Apr-2007 10:47 | 6.4K | |
![[SND]](/icons/sound2.gif) | recension.mp3 | 20-Apr-2007 10:47 | 8.6K | |
![[SND]](/icons/sound2.gif) | recency.mp3 | 20-Apr-2007 10:46 | 8.9K | |
![[SND]](/icons/sound2.gif) | receiving.mp3 | 20-Apr-2007 10:46 | 17K | |
![[SND]](/icons/sound2.gif) | receivership.mp3 | 20-Apr-2007 10:46 | 9.1K | |
![[SND]](/icons/sound2.gif) | receiver.mp3 | 20-Apr-2007 10:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | received.mp3 | 20-Apr-2007 10:46 | 8.0K | |
![[SND]](/icons/sound2.gif) | receive.mp3 | 20-Apr-2007 10:46 | 7.7K | |
![[SND]](/icons/sound2.gif) | receivables.mp3 | 20-Apr-2007 10:46 | 9.6K | |
![[SND]](/icons/sound2.gif) | receivable.mp3 | 20-Apr-2007 10:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | receiptor.mp3 | 20-Apr-2007 10:46 | 7.9K | |
![[SND]](/icons/sound2.gif) | receipt.mp3 | 20-Apr-2007 10:46 | 7.5K | |
![[SND]](/icons/sound2.gif) | recede.mp3 | 20-Apr-2007 10:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | recco.mp3 | 20-Apr-2007 10:46 | 8.4K | |
![[SND]](/icons/sound2.gif) | recce.mp3 | 20-Apr-2007 10:45 | 5.9K | |
![[SND]](/icons/sound2.gif) | recast.mp3 | 20-Apr-2007 10:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | recapture.mp3 | 20-Apr-2007 10:45 | 9.3K | |
![[SND]](/icons/sound2.gif) | recaption.mp3 | 20-Apr-2007 10:45 | 8.6K | |
![[SND]](/icons/sound2.gif) | recappable.mp3 | 20-Apr-2007 10:45 | 9.1K | |
![[SND]](/icons/sound2.gif) | recapitulation.mp3 | 20-Apr-2007 10:45 | 12K | |
![[SND]](/icons/sound2.gif) | recapitulate.mp3 | 20-Apr-2007 10:45 | 10K | |
![[SND]](/icons/sound2.gif) | recapitalize.mp3 | 20-Apr-2007 10:45 | 11K | |
![[SND]](/icons/sound2.gif) | recapitalization.mp3 | 20-Apr-2007 10:45 | 14K | |
![[SND]](/icons/sound2.gif) | recap.mp3 | 20-Apr-2007 10:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | recantation.mp3 | 20-Apr-2007 10:45 | 11K | |
![[SND]](/icons/sound2.gif) | recant.mp3 | 20-Apr-2007 10:45 | 7.9K | |
![[SND]](/icons/sound2.gif) | recanalize.mp3 | 20-Apr-2007 10:45 | 11K | |
![[SND]](/icons/sound2.gif) | recanalization.mp3 | 20-Apr-2007 10:44 | 14K | |
![[SND]](/icons/sound2.gif) | recamier.mp3 | 20-Apr-2007 10:44 | 11K | |
![[SND]](/icons/sound2.gif) | recallable.mp3 | 20-Apr-2007 10:44 | 8.8K | |
![[SND]](/icons/sound2.gif) | recallability.mp3 | 20-Apr-2007 10:44 | 11K | |
![[SND]](/icons/sound2.gif) | recall.mp3 | 20-Apr-2007 10:44 | 7.9K | |
![[SND]](/icons/sound2.gif) | recalescence.mp3 | 20-Apr-2007 10:44 | 17K | |
![[SND]](/icons/sound2.gif) | recalesce.mp3 | 20-Apr-2007 10:44 | 17K | |
![[SND]](/icons/sound2.gif) | recalcitrate.mp3 | 20-Apr-2007 10:44 | 17K | |
![[SND]](/icons/sound2.gif) | recalcitrant.mp3 | 20-Apr-2007 10:44 | 9.8K | |
![[SND]](/icons/sound2.gif) | recalcitrancy.mp3 | 20-Apr-2007 10:44 | 13K | |
![[SND]](/icons/sound2.gif) | recalcitrance.mp3 | 20-Apr-2007 10:44 | 11K | |
![[SND]](/icons/sound2.gif) | rec.mp3 | 20-Apr-2007 10:44 | 17K | |
![[SND]](/icons/sound2.gif) | rebutter.mp3 | 20-Apr-2007 10:44 | 6.4K | |
![[SND]](/icons/sound2.gif) | rebuttal.mp3 | 20-Apr-2007 10:43 | 6.4K | |
![[SND]](/icons/sound2.gif) | rebuttable.mp3 | 20-Apr-2007 10:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | rebut.mp3 | 20-Apr-2007 10:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | rebussicstantibus.mp3 | 20-Apr-2007 10:43 | 17K | |
![[SND]](/icons/sound2.gif) | rebus.mp3 | 20-Apr-2007 10:43 | 6.3K | |
![[SND]](/icons/sound2.gif) | rebuke.mp3 | 20-Apr-2007 10:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | rebuilt.mp3 | 20-Apr-2007 10:43 | 7.5K | |
![[SND]](/icons/sound2.gif) | rebuild.mp3 | 20-Apr-2007 10:43 | 8.0K | |
![[SND]](/icons/sound2.gif) | rebuff.mp3 | 20-Apr-2007 10:43 | 7.0K | |
![[SND]](/icons/sound2.gif) | rebroadcast.mp3 | 20-Apr-2007 10:43 | 11K | |
![[SND]](/icons/sound2.gif) | rebranch.mp3 | 20-Apr-2007 10:43 | 8.9K | |
![[SND]](/icons/sound2.gif) | rebozo.mp3 | 20-Apr-2007 10:43 | 8.8K | |
![[SND]](/icons/sound2.gif) | rebounding.mp3 | 20-Apr-2007 10:42 | 17K | |
![[SND]](/icons/sound2.gif) | rebounder.mp3 | 20-Apr-2007 10:42 | 7.9K | |
![[SND]](/icons/sound2.gif) | rebound.mp3 | 20-Apr-2007 10:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | rebote.mp3 | 20-Apr-2007 10:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | reboso.mp3 | 20-Apr-2007 10:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | reborn.mp3 | 20-Apr-2007 10:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | rebop.mp3 | 20-Apr-2007 10:42 | 8.0K | |
![[SND]](/icons/sound2.gif) | reboant.mp3 | 20-Apr-2007 10:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Reblochon.mp3 | 20-Apr-2007 10:42 | 9.6K | |
![[SND]](/icons/sound2.gif) | rebirth.mp3 | 20-Apr-2007 10:42 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rebild.mp3 | 20-Apr-2007 10:42 | 7.1K | |
![[SND]](/icons/sound2.gif) | rebellious.mp3 | 20-Apr-2007 10:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | rebellion.mp3 | 20-Apr-2007 10:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | rebeldom.mp3 | 20-Apr-2007 10:41 | 8.4K | |
![[SND]](/icons/sound2.gif) | rebel.mp3 | 20-Apr-2007 10:41 | 5.9K | |
![[SND]](/icons/sound2.gif) | Rebekah.mp3 | 20-Apr-2007 10:41 | 6.8K | |
![[SND]](/icons/sound2.gif) | rebeck.mp3 | 20-Apr-2007 10:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | rebecca.mp3 | 20-Apr-2007 10:41 | 7.9K | |
![[SND]](/icons/sound2.gif) | rebec.mp3 | 20-Apr-2007 10:41 | 6.1K | |
![[SND]](/icons/sound2.gif) | rebbetzin.mp3 | 20-Apr-2007 10:41 | 17K | |
![[SND]](/icons/sound2.gif) | rebbe.mp3 | 20-Apr-2007 10:41 | 5.4K | |
![[SND]](/icons/sound2.gif) | rebato.mp3 | 20-Apr-2007 10:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | rebated.mp3 | 20-Apr-2007 10:41 | 8.2K | |
![[SND]](/icons/sound2.gif) | rebate.mp3 | 20-Apr-2007 10:41 | 7.1K | |
![[SND]](/icons/sound2.gif) | rebarbative.mp3 | 20-Apr-2007 10:41 | 10K | |
![[SND]](/icons/sound2.gif) | rebar.mp3 | 20-Apr-2007 10:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | rebab.mp3 | 20-Apr-2007 10:40 | 7.9K | |
![[SND]](/icons/sound2.gif) | reba.mp3 | 20-Apr-2007 10:40 | 8.4K | |
![[SND]](/icons/sound2.gif) | reb.mp3 | 20-Apr-2007 10:40 | 5.7K | |
![[SND]](/icons/sound2.gif) | reaver.mp3 | 20-Apr-2007 10:40 | 8.2K | |
![[SND]](/icons/sound2.gif) | reave.mp3 | 20-Apr-2007 10:40 | 6.8K | |
![[SND]](/icons/sound2.gif) | Reaumur.mp3 | 20-Apr-2007 10:40 | 10K | |
![[SND]](/icons/sound2.gif) | reata.mp3 | 20-Apr-2007 10:40 | 7.0K | |
![[SND]](/icons/sound2.gif) | reast.mp3 | 20-Apr-2007 10:40 | 17K | |
![[SND]](/icons/sound2.gif) | reassuringly.mp3 | 20-Apr-2007 10:40 | 11K | |
![[SND]](/icons/sound2.gif) | reassure.mp3 | 20-Apr-2007 10:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | reassurance.mp3 | 20-Apr-2007 10:40 | 11K | |
![[SND]](/icons/sound2.gif) | reasonless.mp3 | 20-Apr-2007 10:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | reasoning.mp3 | 20-Apr-2007 10:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | reasoner.mp3 | 20-Apr-2007 10:39 | 7.0K | |
![[SND]](/icons/sound2.gif) | reasoned.mp3 | 20-Apr-2007 10:39 | 8.0K | |
![[SND]](/icons/sound2.gif) | reasonably.mp3 | 20-Apr-2007 10:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | reasonableness.mp3 | 20-Apr-2007 10:39 | 11K | |
![[SND]](/icons/sound2.gif) | reasonable.mp3 | 20-Apr-2007 10:39 | 8.6K | |
![[SND]](/icons/sound2.gif) | reasonability.mp3 | 20-Apr-2007 10:39 | 10K | |
![[SND]](/icons/sound2.gif) | reason.mp3 | 20-Apr-2007 10:39 | 7.1K | |
![[SND]](/icons/sound2.gif) | reasilvia.mp3 | 20-Apr-2007 10:39 | 17K | |
![[SND]](/icons/sound2.gif) | rearwards.mp3 | 20-Apr-2007 10:39 | 8.8K | |
![[SND]](/icons/sound2.gif) | rearward.mp3 | 20-Apr-2007 10:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | rearview mirror.mp3 | 20-Apr-2007 10:38 | 13K | |
![[SND]](/icons/sound2.gif) | rearmouse.mp3 | 20-Apr-2007 10:38 | 17K | |
![[SND]](/icons/sound2.gif) | rearmost.mp3 | 20-Apr-2007 10:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | rearmament.mp3 | 20-Apr-2007 10:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | rearm.mp3 | 20-Apr-2007 10:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | rearguard.mp3 | 20-Apr-2007 10:38 | 9.3K | |
![[SND]](/icons/sound2.gif) | rear-end.mp3 | 20-Apr-2007 10:38 | 9.8K | |
![[SND]](/icons/sound2.gif) | reardon.mp3 | 20-Apr-2007 10:38 | 17K | |
![[SND]](/icons/sound2.gif) | rear.mp3 | 20-Apr-2007 10:38 | 6.3K | |
![[SND]](/icons/sound2.gif) | rear guard.mp3 | 20-Apr-2007 10:38 | 11K | |
![[SND]](/icons/sound2.gif) | reapportionment.mp3 | 20-Apr-2007 10:37 | 12K | |
![[SND]](/icons/sound2.gif) | reapportion.mp3 | 20-Apr-2007 10:37 | 9.8K | |
![[SND]](/icons/sound2.gif) | reaphook.mp3 | 20-Apr-2007 10:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | reaper.mp3 | 20-Apr-2007 10:37 | 6.3K | |
![[SND]](/icons/sound2.gif) | reap.mp3 | 20-Apr-2007 10:37 | 5.2K | |
![[SND]](/icons/sound2.gif) | reamer.mp3 | 20-Apr-2007 10:37 | 5.9K | |
![[SND]](/icons/sound2.gif) | ream.mp3 | 20-Apr-2007 10:37 | 6.8K | |
![[SND]](/icons/sound2.gif) | realty.mp3 | 20-Apr-2007 10:37 | 7.5K | |
![[SND]](/icons/sound2.gif) | Realtor.mp3 | 20-Apr-2007 10:37 | 8.0K | |
![[SND]](/icons/sound2.gif) | realtist.mp3 | 20-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | realschule.mp3 | 20-Apr-2007 10:37 | 17K | |
![[SND]](/icons/sound2.gif) | realpolitik.mp3 | 20-Apr-2007 10:37 | 13K | |
![[SND]](/icons/sound2.gif) | realmism.mp3 | 20-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | realm.mp3 | 20-Apr-2007 10:36 | 6.8K | |
![[SND]](/icons/sound2.gif) | really.mp3 | 20-Apr-2007 10:36 | 5.7K | |
![[SND]](/icons/sound2.gif) | realizing.mp3 | 20-Apr-2007 10:36 | 17K | |
![[SND]](/icons/sound2.gif) | realize.mp3 | 20-Apr-2007 10:36 | 9.1K | |
![[SND]](/icons/sound2.gif) | realization.mp3 | 20-Apr-2007 10:36 | 11K | |
![[SND]](/icons/sound2.gif) | realizable.mp3 | 20-Apr-2007 10:36 | 9.8K | |
![[SND]](/icons/sound2.gif) | reality.mp3 | 20-Apr-2007 10:36 | 8.4K | |
![[SND]](/icons/sound2.gif) | realistically.mp3 | 20-Apr-2007 10:36 | 10K | |
![[SND]](/icons/sound2.gif) | realistic.mp3 | 20-Apr-2007 10:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | realist.mp3 | 20-Apr-2007 10:36 | 7.7K | |
![[SND]](/icons/sound2.gif) | realism.mp3 | 20-Apr-2007 10:36 | 8.0K | |
![[SND]](/icons/sound2.gif) | realignment.mp3 | 20-Apr-2007 10:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | realign.mp3 | 20-Apr-2007 10:35 | 9.5K | |
![[SND]](/icons/sound2.gif) | realia.mp3 | 20-Apr-2007 10:35 | 8.2K | |
![[SND]](/icons/sound2.gif) | realgar.mp3 | 20-Apr-2007 10:35 | 9.3K | |
![[SND]](/icons/sound2.gif) | reales.mp3 | 20-Apr-2007 10:35 | 8.9K | |
![[SND]](/icons/sound2.gif) | real.mp3 | 20-Apr-2007 10:35 | 6.6K | |
![[SND]](/icons/sound2.gif) | reaginic.mp3 | 20-Apr-2007 10:35 | 8.4K | |
![[SND]](/icons/sound2.gif) | reagin.mp3 | 20-Apr-2007 10:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | reaggregation.mp3 | 20-Apr-2007 10:35 | 12K | |
![[SND]](/icons/sound2.gif) | reaggregate.mp3 | 20-Apr-2007 10:35 | 10K | |
![[SND]](/icons/sound2.gif) | reagent.mp3 | 20-Apr-2007 10:35 | 7.9K | |
![[SND]](/icons/sound2.gif) | reagency.mp3 | 20-Apr-2007 10:35 | 17K | |
![[SND]](/icons/sound2.gif) | reaganomics.mp3 | 20-Apr-2007 10:34 | 8.8K | |
![[SND]](/icons/sound2.gif) | reaganism.mp3 | 20-Apr-2007 10:34 | 17K | |
![[SND]](/icons/sound2.gif) | Reaganesque.mp3 | 20-Apr-2007 10:34 | 8.0K | |
![[SND]](/icons/sound2.gif) | Reagan.mp3 | 20-Apr-2007 10:34 | 5.5K | |
![[SND]](/icons/sound2.gif) | reafforestation.mp3 | 20-Apr-2007 10:34 | 14K | |
![[SND]](/icons/sound2.gif) | reafforest.mp3 | 20-Apr-2007 10:34 | 10K | |
![[SND]](/icons/sound2.gif) | ready-witted.mp3 | 20-Apr-2007 10:34 | 8.6K | |
![[SND]](/icons/sound2.gif) | ready-made.mp3 | 20-Apr-2007 10:34 | 10K | |
![[SND]](/icons/sound2.gif) | ready.mp3 | 20-Apr-2007 10:34 | 5.9K | |
![[SND]](/icons/sound2.gif) | readwritehead.mp3 | 20-Apr-2007 10:34 | 17K | |
![[SND]](/icons/sound2.gif) | readthrough.mp3 | 20-Apr-2007 10:34 | 8.4K | |
![[SND]](/icons/sound2.gif) | readout.mp3 | 20-Apr-2007 10:34 | 7.1K | |
![[SND]](/icons/sound2.gif) | readonly.mp3 | 20-Apr-2007 10:33 | 17K | |
![[SND]](/icons/sound2.gif) | reading.mp3 | 20-Apr-2007 10:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | readiness.mp3 | 20-Apr-2007 10:33 | 7.9K | |
![[SND]](/icons/sound2.gif) | readily.mp3 | 20-Apr-2007 10:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | readiform.mp3 | 20-Apr-2007 10:33 | 17K | |
![[SND]](/icons/sound2.gif) | readership.mp3 | 20-Apr-2007 10:33 | 8.4K | |
![[SND]](/icons/sound2.gif) | readerly.mp3 | 20-Apr-2007 10:33 | 6.8K | |
![[SND]](/icons/sound2.gif) | reader.mp3 | 20-Apr-2007 10:33 | 6.1K | |
![[SND]](/icons/sound2.gif) | readeo.mp3 | 20-Apr-2007 10:33 | 8.2K | |
![[SND]](/icons/sound2.gif) | Reade.mp3 | 20-Apr-2007 10:33 | 5.7K | |
![[SND]](/icons/sound2.gif) | readathon.mp3 | 20-Apr-2007 10:33 | 17K | |
![[SND]](/icons/sound2.gif) | readably.mp3 | 20-Apr-2007 10:33 | 7.1K | |
![[SND]](/icons/sound2.gif) | readableness.mp3 | 20-Apr-2007 10:32 | 10K | |
![[SND]](/icons/sound2.gif) | readable.mp3 | 20-Apr-2007 10:32 | 7.1K | |
![[SND]](/icons/sound2.gif) | readability.mp3 | 20-Apr-2007 10:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | read.mp3 | 20-Apr-2007 10:32 | 6.6K | |
![[SND]](/icons/sound2.gif) | reactor.mp3 | 20-Apr-2007 10:32 | 8.4K | |
![[SND]](/icons/sound2.gif) | reactivity.mp3 | 20-Apr-2007 10:32 | 10K | |
![[SND]](/icons/sound2.gif) | reactive.mp3 | 20-Apr-2007 10:32 | 8.6K | |
![[SND]](/icons/sound2.gif) | reactivate.mp3 | 20-Apr-2007 10:32 | 8.8K | |
![[SND]](/icons/sound2.gif) | reactionaryism.mp3 | 20-Apr-2007 10:32 | 13K | |
![[SND]](/icons/sound2.gif) | reactionary.mp3 | 20-Apr-2007 10:32 | 10K | |
![[SND]](/icons/sound2.gif) | reaction.mp3 | 20-Apr-2007 10:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | reactant.mp3 | 20-Apr-2007 10:32 | 8.2K | |
![[SND]](/icons/sound2.gif) | reactance.mp3 | 20-Apr-2007 10:32 | 9.3K | |
![[SND]](/icons/sound2.gif) | react.mp3 | 20-Apr-2007 10:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | reach-me-down.mp3 | 20-Apr-2007 10:31 | 11K | |
![[SND]](/icons/sound2.gif) | reachless.mp3 | 20-Apr-2007 10:31 | 17K | |
![[SND]](/icons/sound2.gif) | reached.mp3 | 20-Apr-2007 10:31 | 8.6K | |
![[SND]](/icons/sound2.gif) | reachable.mp3 | 20-Apr-2007 10:31 | 7.3K | |
![[SND]](/icons/sound2.gif) | reach.mp3 | 20-Apr-2007 10:31 | 6.8K | |
![[SND]](/icons/sound2.gif) | reabsorb.mp3 | 20-Apr-2007 10:31 | 11K | |
![[SND]](/icons/sound2.gif) | re.mp3 | 20-Apr-2007 10:31 | 6.1K | |
![[SND]](/icons/sound2.gif) | re infecta.mp3 | 20-Apr-2007 10:31 | 12K | |
![[SND]](/icons/sound2.gif) | rcra.mp3 | 20-Apr-2007 10:31 | 17K | |
![[SND]](/icons/sound2.gif) | r-colored.mp3 | 20-Apr-2007 10:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | RBI.mp3 | 20-Apr-2007 10:30 | 10K | |
![[SND]](/icons/sound2.gif) | razzmatazz.mp3 | 20-Apr-2007 10:30 | 11K | |
![[SND]](/icons/sound2.gif) | razzle-dazzle.mp3 | 20-Apr-2007 10:30 | 12K | |
![[SND]](/icons/sound2.gif) | razzledazzle.mp3 | 20-Apr-2007 10:30 | 17K | |
![[SND]](/icons/sound2.gif) | razzle.mp3 | 20-Apr-2007 10:30 | 17K | |
![[SND]](/icons/sound2.gif) | razzia.mp3 | 20-Apr-2007 10:30 | 7.9K | |
![[SND]](/icons/sound2.gif) | razzberry.mp3 | 20-Apr-2007 10:30 | 8.4K | |
![[SND]](/icons/sound2.gif) | razzamatazz.mp3 | 20-Apr-2007 10:30 | 13K | |
![[SND]](/icons/sound2.gif) | razz.mp3 | 20-Apr-2007 10:30 | 7.7K | |
![[SND]](/icons/sound2.gif) | razorbill.mp3 | 20-Apr-2007 10:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | razor-backed.mp3 | 20-Apr-2007 10:30 | 9.8K | |
![[SND]](/icons/sound2.gif) | razorback.mp3 | 20-Apr-2007 10:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | razor.mp3 | 20-Apr-2007 10:29 | 7.5K | |
![[SND]](/icons/sound2.gif) | razoo.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | razonbomb.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | razmataz.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | razee.mp3 | 20-Apr-2007 10:29 | 8.6K | |
![[SND]](/icons/sound2.gif) | raze.mp3 | 20-Apr-2007 10:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | razakar.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | raza.mp3 | 20-Apr-2007 10:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | Raytown.mp3 | 20-Apr-2007 10:29 | 9.1K | |
![[SND]](/icons/sound2.gif) | raytheon.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | rayonny.mp3 | 20-Apr-2007 10:29 | 7.9K | |
![[SND]](/icons/sound2.gif) | rayonism.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | rayon.mp3 | 20-Apr-2007 10:29 | 7.7K | |
![[SND]](/icons/sound2.gif) | raynaudsdisease.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | raynal.mp3 | 20-Apr-2007 10:29 | 17K | |
![[SND]](/icons/sound2.gif) | raymond.mp3 | 20-Apr-2007 10:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | raylet.mp3 | 20-Apr-2007 10:28 | 17K | |
![[SND]](/icons/sound2.gif) | rayless.mp3 | 20-Apr-2007 10:28 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rayleigh.mp3 | 20-Apr-2007 10:28 | 5.7K | |
![[SND]](/icons/sound2.gif) | Rayleigh scattering.mp3 | 20-Apr-2007 10:28 | 14K | |
![[SND]](/icons/sound2.gif) | rayed.mp3 | 20-Apr-2007 10:28 | 7.5K | |
![[SND]](/icons/sound2.gif) | Rayburn.mp3 | 20-Apr-2007 10:28 | 6.8K | |
![[SND]](/icons/sound2.gif) | rayah.mp3 | 20-Apr-2007 10:28 | 7.9K | |
![[SND]](/icons/sound2.gif) | ray.mp3 | 20-Apr-2007 10:28 | 7.0K | |
![[SND]](/icons/sound2.gif) | rax.mp3 | 20-Apr-2007 10:28 | 7.3K | |
![[SND]](/icons/sound2.gif) | rawsthorn.mp3 | 20-Apr-2007 10:28 | 17K | |
![[SND]](/icons/sound2.gif) | rawlplug.mp3 | 20-Apr-2007 10:27 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rawlinson.mp3 | 20-Apr-2007 10:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | rawlings.mp3 | 20-Apr-2007 10:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | rawish.mp3 | 20-Apr-2007 10:27 | 17K | |
![[SND]](/icons/sound2.gif) | rawinsonde.mp3 | 20-Apr-2007 10:27 | 11K | |
![[SND]](/icons/sound2.gif) | rawin.mp3 | 20-Apr-2007 10:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | rawhide.mp3 | 20-Apr-2007 10:27 | 8.6K | |
![[SND]](/icons/sound2.gif) | rawest.mp3 | 20-Apr-2007 10:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | rawer.mp3 | 20-Apr-2007 10:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | rawboned.mp3 | 20-Apr-2007 10:27 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rawalpindi.mp3 | 20-Apr-2007 10:27 | 11K | |
![[SND]](/icons/sound2.gif) | raw.mp3 | 20-Apr-2007 10:27 | 6.1K | |
![[SND]](/icons/sound2.gif) | ravishment.mp3 | 20-Apr-2007 10:27 | 8.2K | |
![[SND]](/icons/sound2.gif) | ravishingly.mp3 | 20-Apr-2007 10:27 | 10K | |
![[SND]](/icons/sound2.gif) | ravishing.mp3 | 20-Apr-2007 10:27 | 7.9K | |
![[SND]](/icons/sound2.gif) | ravish.mp3 | 20-Apr-2007 10:27 | 7.7K | |
![[SND]](/icons/sound2.gif) | raviolis.mp3 | 20-Apr-2007 10:26 | 10K | |
![[SND]](/icons/sound2.gif) | ravioli.mp3 | 20-Apr-2007 10:26 | 9.3K | |
![[SND]](/icons/sound2.gif) | raving.mp3 | 20-Apr-2007 10:26 | 7.1K | |
![[SND]](/icons/sound2.gif) | ravined.mp3 | 20-Apr-2007 10:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | ravine.mp3 | 20-Apr-2007 10:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | ravin.mp3 | 20-Apr-2007 10:26 | 6.4K | |
![[SND]](/icons/sound2.gif) | ravigote.mp3 | 20-Apr-2007 10:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ravi.mp3 | 20-Apr-2007 10:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | raver.mp3 | 20-Apr-2007 10:26 | 5.7K | |
![[SND]](/icons/sound2.gif) | ravensbruck.mp3 | 20-Apr-2007 10:26 | 17K | |
![[SND]](/icons/sound2.gif) | ravenous.mp3 | 20-Apr-2007 10:26 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ravenna.mp3 | 20-Apr-2007 10:26 | 7.0K | |
![[SND]](/icons/sound2.gif) | ravening.mp3 | 20-Apr-2007 10:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | ravenhaired.mp3 | 20-Apr-2007 10:26 | 17K | |
![[SND]](/icons/sound2.gif) | ravener.mp3 | 20-Apr-2007 10:26 | 7.3K | |
![[SND]](/icons/sound2.gif) | raven.mp3 | 20-Apr-2007 10:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | ravelment.mp3 | 20-Apr-2007 10:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | ravelling.mp3 | 20-Apr-2007 10:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | raveling.mp3 | 20-Apr-2007 10:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | ravelin.mp3 | 20-Apr-2007 10:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | Ravelian.mp3 | 20-Apr-2007 10:25 | 7.7K | |
![[SND]](/icons/sound2.gif) | raveler.mp3 | 20-Apr-2007 10:25 | 7.3K | |
![[SND]](/icons/sound2.gif) | ravel.mp3 | 20-Apr-2007 10:25 | 6.6K | |
![[SND]](/icons/sound2.gif) | rave.mp3 | 20-Apr-2007 10:25 | 6.3K | |
![[SND]](/icons/sound2.gif) | ravanne.mp3 | 20-Apr-2007 10:25 | 17K | |
![[SND]](/icons/sound2.gif) | ravana.mp3 | 20-Apr-2007 10:25 | 7.9K | |
![[SND]](/icons/sound2.gif) | ravagement.mp3 | 20-Apr-2007 10:25 | 8.4K | |
![[SND]](/icons/sound2.gif) | ravage.mp3 | 20-Apr-2007 10:25 | 7.5K | |
![[SND]](/icons/sound2.gif) | rauwolfia.mp3 | 20-Apr-2007 10:25 | 11K | |
![[SND]](/icons/sound2.gif) | rauschenbusch.mp3 | 20-Apr-2007 10:25 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rauschenberg.mp3 | 20-Apr-2007 10:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | rauriki.mp3 | 20-Apr-2007 10:25 | 17K | |
![[SND]](/icons/sound2.gif) | raupo.mp3 | 20-Apr-2007 10:24 | 17K | |
![[SND]](/icons/sound2.gif) | raunchy.mp3 | 20-Apr-2007 10:24 | 7.1K | |
![[SND]](/icons/sound2.gif) | raunchiness.mp3 | 20-Apr-2007 10:24 | 8.8K | |
![[SND]](/icons/sound2.gif) | raunchily.mp3 | 20-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | raunch.mp3 | 20-Apr-2007 10:24 | 6.6K | |
![[SND]](/icons/sound2.gif) | raughty.mp3 | 20-Apr-2007 10:24 | 17K | |
![[SND]](/icons/sound2.gif) | raucous.mp3 | 20-Apr-2007 10:24 | 7.5K | |
![[SND]](/icons/sound2.gif) | ratty.mp3 | 20-Apr-2007 10:24 | 6.3K | |
![[SND]](/icons/sound2.gif) | rattrap.mp3 | 20-Apr-2007 10:24 | 8.4K | |
![[SND]](/icons/sound2.gif) | rattoon.mp3 | 20-Apr-2007 10:24 | 8.2K | |
![[SND]](/icons/sound2.gif) | ratton.mp3 | 20-Apr-2007 10:24 | 7.0K | |
![[SND]](/icons/sound2.gif) | rattly.mp3 | 20-Apr-2007 10:24 | 7.3K | |
![[SND]](/icons/sound2.gif) | rattlingly.mp3 | 20-Apr-2007 10:24 | 8.6K | |
![[SND]](/icons/sound2.gif) | rattling.mp3 | 20-Apr-2007 10:24 | 7.9K | |
![[SND]](/icons/sound2.gif) | rattleweed.mp3 | 20-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | rattletrap.mp3 | 20-Apr-2007 10:23 | 9.5K | |
![[SND]](/icons/sound2.gif) | rattlesnake.mp3 | 20-Apr-2007 10:23 | 10K | |
![[SND]](/icons/sound2.gif) | rattler.mp3 | 20-Apr-2007 10:23 | 7.3K | |
![[SND]](/icons/sound2.gif) | rattlepate.mp3 | 20-Apr-2007 10:23 | 8.0K | |
![[SND]](/icons/sound2.gif) | rattled.mp3 | 20-Apr-2007 10:23 | 8.4K | |
![[SND]](/icons/sound2.gif) | rattlebrained.mp3 | 20-Apr-2007 10:23 | 10K | |
![[SND]](/icons/sound2.gif) | rattlebrain.mp3 | 20-Apr-2007 10:23 | 10K | |
![[SND]](/icons/sound2.gif) | rattle.mp3 | 20-Apr-2007 10:23 | 5.5K | |
![[SND]](/icons/sound2.gif) | rattish.mp3 | 20-Apr-2007 10:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | rattigan.mp3 | 20-Apr-2007 10:23 | 7.9K | |
![[SND]](/icons/sound2.gif) | ratter.mp3 | 20-Apr-2007 10:23 | 6.8K | |
![[SND]](/icons/sound2.gif) | rattening.mp3 | 20-Apr-2007 10:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | ratten.mp3 | 20-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | ratteen.mp3 | 20-Apr-2007 10:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | ratted.mp3 | 20-Apr-2007 10:23 | 8.6K | |
![[SND]](/icons/sound2.gif) | ratte.mp3 | 20-Apr-2007 10:23 | 17K | |
![[SND]](/icons/sound2.gif) | rattat.mp3 | 20-Apr-2007 10:22 | 17K | |
![[SND]](/icons/sound2.gif) | rattan.mp3 | 20-Apr-2007 10:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | rattail.mp3 | 20-Apr-2007 10:22 | 8.2K | |
![[SND]](/icons/sound2.gif) | ratskeller.mp3 | 20-Apr-2007 10:22 | 17K | |
![[SND]](/icons/sound2.gif) | ratsbane.mp3 | 20-Apr-2007 10:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | rats.mp3 | 20-Apr-2007 10:22 | 7.0K | |
![[SND]](/icons/sound2.gif) | ratoon.mp3 | 20-Apr-2007 10:22 | 8.4K | |
![[SND]](/icons/sound2.gif) | Raton.mp3 | 20-Apr-2007 10:22 | 8.6K | |
![[SND]](/icons/sound2.gif) | ratomorphic.mp3 | 20-Apr-2007 10:22 | 17K | |
![[SND]](/icons/sound2.gif) | rato.mp3 | 20-Apr-2007 10:22 | 7.9K | |
![[SND]](/icons/sound2.gif) | ratline.mp3 | 20-Apr-2007 10:22 | 6.6K | |
![[SND]](/icons/sound2.gif) | ratlike.mp3 | 20-Apr-2007 10:22 | 7.5K | |
![[SND]](/icons/sound2.gif) | ratlam.mp3 | 20-Apr-2007 10:22 | 17K | |
![[SND]](/icons/sound2.gif) | ratite.mp3 | 20-Apr-2007 10:22 | 7.1K | |
![[SND]](/icons/sound2.gif) | ratisbon.mp3 | 20-Apr-2007 10:22 | 17K | |
![[SND]](/icons/sound2.gif) | rationing.mp3 | 20-Apr-2007 10:22 | 7.7K | |
![[SND]](/icons/sound2.gif) | rationalizer.mp3 | 20-Apr-2007 10:22 | 12K | |
![[SND]](/icons/sound2.gif) | rationalize.mp3 | 20-Apr-2007 10:22 | 11K | |
![[SND]](/icons/sound2.gif) | rationalization.mp3 | 20-Apr-2007 10:22 | 13K | |
![[SND]](/icons/sound2.gif) | rationalizable.mp3 | 20-Apr-2007 10:22 | 12K | |
![[SND]](/icons/sound2.gif) | rationality.mp3 | 20-Apr-2007 10:22 | 9.5K | |
![[SND]](/icons/sound2.gif) | rationalistically.mp3 | 20-Apr-2007 10:22 | 13K | |
![[SND]](/icons/sound2.gif) | rationalistic.mp3 | 20-Apr-2007 10:22 | 10K | |
![[SND]](/icons/sound2.gif) | rationalist.mp3 | 20-Apr-2007 10:21 | 10K | |
![[SND]](/icons/sound2.gif) | rationalism.mp3 | 20-Apr-2007 10:21 | 11K | |
![[SND]](/icons/sound2.gif) | rationale.mp3 | 20-Apr-2007 10:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | rational.mp3 | 20-Apr-2007 10:21 | 7.7K | |
![[SND]](/icons/sound2.gif) | ration.mp3 | 20-Apr-2007 10:21 | 7.1K | |
![[SND]](/icons/sound2.gif) | ratiometer.mp3 | 20-Apr-2007 10:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | ratiocinator.mp3 | 20-Apr-2007 10:21 | 11K | |
![[SND]](/icons/sound2.gif) | ratiocinative.mp3 | 20-Apr-2007 10:21 | 11K | |
![[SND]](/icons/sound2.gif) | ratiocination.mp3 | 20-Apr-2007 10:21 | 12K | |
![[SND]](/icons/sound2.gif) | ratiocinate.mp3 | 20-Apr-2007 10:21 | 11K | |
![[SND]](/icons/sound2.gif) | ratio.mp3 | 20-Apr-2007 10:21 | 7.9K | |
![[SND]](/icons/sound2.gif) | rating.mp3 | 20-Apr-2007 10:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | ratine.mp3 | 20-Apr-2007 10:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | ratify.mp3 | 20-Apr-2007 10:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | ratifier.mp3 | 20-Apr-2007 10:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | ratification.mp3 | 20-Apr-2007 10:21 | 11K | |
![[SND]](/icons/sound2.gif) | raticide.mp3 | 20-Apr-2007 10:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | Ratibor.mp3 | 20-Apr-2007 10:21 | 8.6K | |
![[SND]](/icons/sound2.gif) | rathskeller.mp3 | 20-Apr-2007 10:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | rathkespouch.mp3 | 20-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | ratherish.mp3 | 20-Apr-2007 10:21 | 17K | |
![[SND]](/icons/sound2.gif) | rather.mp3 | 20-Apr-2007 10:21 | 6.6K | |
![[SND]](/icons/sound2.gif) | rathenau.mp3 | 20-Apr-2007 10:21 | 8.2K | |
![[SND]](/icons/sound2.gif) | rathe.mp3 | 20-Apr-2007 10:20 | 6.4K | |
![[SND]](/icons/sound2.gif) | rathaus.mp3 | 20-Apr-2007 10:20 | 17K | |
![[SND]](/icons/sound2.gif) | ratha.mp3 | 20-Apr-2007 10:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | rath.mp3 | 20-Apr-2007 10:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | ratfish.mp3 | 20-Apr-2007 10:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | ratfink.mp3 | 20-Apr-2007 10:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | rater.mp3 | 20-Apr-2007 10:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | ratepayer.mp3 | 20-Apr-2007 10:20 | 8.4K | |
![[SND]](/icons/sound2.gif) | ratemeter.mp3 | 20-Apr-2007 10:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | ratel.mp3 | 20-Apr-2007 10:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | rateen.mp3 | 20-Apr-2007 10:20 | 17K | |
![[SND]](/icons/sound2.gif) | rateable.mp3 | 20-Apr-2007 10:20 | 6.6K | |
![[SND]](/icons/sound2.gif) | rate.mp3 | 20-Apr-2007 10:20 | 5.5K | |
![[SND]](/icons/sound2.gif) | ratchet.mp3 | 20-Apr-2007 10:20 | 6.1K | |
![[SND]](/icons/sound2.gif) | ratch.mp3 | 20-Apr-2007 10:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | ratbaggery.mp3 | 20-Apr-2007 10:20 | 17K | |
![[SND]](/icons/sound2.gif) | ratbag.mp3 | 20-Apr-2007 10:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | ratatouille.mp3 | 20-Apr-2007 10:20 | 9.8K | |
![[SND]](/icons/sound2.gif) | rat-a-tat-tat.mp3 | 20-Apr-2007 10:20 | 11K | |
![[SND]](/icons/sound2.gif) | rat-a-tat.mp3 | 20-Apr-2007 10:20 | 7.7K | |
![[SND]](/icons/sound2.gif) | ratatat.mp3 | 20-Apr-2007 10:20 | 8.0K | |
![[SND]](/icons/sound2.gif) | rataplan.mp3 | 20-Apr-2007 10:20 | 8.8K | |
![[SND]](/icons/sound2.gif) | ratan.mp3 | 20-Apr-2007 10:20 | 8.2K | |
![[SND]](/icons/sound2.gif) | ratal.mp3 | 20-Apr-2007 10:20 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ratak.mp3 | 20-Apr-2007 10:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | ratafia.mp3 | 20-Apr-2007 10:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | ratably.mp3 | 20-Apr-2007 10:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | ratable.mp3 | 20-Apr-2007 10:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | rata.mp3 | 20-Apr-2007 10:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | rat.mp3 | 20-Apr-2007 10:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | Rat Islands.mp3 | 20-Apr-2007 10:19 | 5.4K | |
![[SND]](/icons/sound2.gif) | rasure.mp3 | 20-Apr-2007 10:19 | 6.4K | |
![[SND]](/icons/sound2.gif) | rasty.mp3 | 20-Apr-2007 10:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | rastvorovincident.mp3 | 20-Apr-2007 10:19 | 27K | |
![[SND]](/icons/sound2.gif) | rastus.mp3 | 20-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | rastle.mp3 | 20-Apr-2007 10:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | raster.mp3 | 20-Apr-2007 10:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | Rastafarianism.mp3 | 20-Apr-2007 10:19 | 13K | |
![[SND]](/icons/sound2.gif) | Rastafarian.mp3 | 20-Apr-2007 10:19 | 11K | |
![[SND]](/icons/sound2.gif) | rastafari.mp3 | 20-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | Rasta.mp3 | 20-Apr-2007 10:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | rassle.mp3 | 20-Apr-2007 10:19 | 6.6K | |
![[SND]](/icons/sound2.gif) | rasshamra.mp3 | 20-Apr-2007 10:19 | 8.4K | |
![[SND]](/icons/sound2.gif) | rasse.mp3 | 20-Apr-2007 10:19 | 8.6K | |
![[SND]](/icons/sound2.gif) | rassclaat.mp3 | 20-Apr-2007 10:19 | 17K | |
![[SND]](/icons/sound2.gif) | raspy.mp3 | 20-Apr-2007 10:19 | 7.1K | |
![[SND]](/icons/sound2.gif) | Rasputin.mp3 | 20-Apr-2007 10:19 | 7.9K | |
![[SND]](/icons/sound2.gif) | raspingly.mp3 | 20-Apr-2007 10:18 | 9.3K | |
![[SND]](/icons/sound2.gif) | rasping.mp3 | 20-Apr-2007 10:18 | 8.6K | |
![[SND]](/icons/sound2.gif) | rasper.mp3 | 20-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | raspberry.mp3 | 20-Apr-2007 10:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | raspatory.mp3 | 20-Apr-2007 10:18 | 17K | |
![[SND]](/icons/sound2.gif) | rasp.mp3 | 20-Apr-2007 10:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | rasorial.mp3 | 20-Apr-2007 10:18 | 8.4K | |
![[SND]](/icons/sound2.gif) | rasophore.mp3 | 20-Apr-2007 10:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | rason.mp3 | 20-Apr-2007 10:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rasmussen.mp3 | 20-Apr-2007 10:18 | 7.5K | |
![[SND]](/icons/sound2.gif) | raskolnik.mp3 | 20-Apr-2007 10:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rask.mp3 | 20-Apr-2007 10:18 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rasht.mp3 | 20-Apr-2007 10:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | rashidaldin.mp3 | 20-Apr-2007 10:18 | 17K | |
![[SND]](/icons/sound2.gif) | rashida.mp3 | 20-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | rashi.mp3 | 20-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | rasher.mp3 | 20-Apr-2007 10:18 | 6.6K | |
![[SND]](/icons/sound2.gif) | Rashad.mp3 | 20-Apr-2007 10:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | rash.mp3 | 20-Apr-2007 10:18 | 6.8K | |
![[SND]](/icons/sound2.gif) | rase.mp3 | 20-Apr-2007 10:18 | 7.3K | |
![[SND]](/icons/sound2.gif) | raschel.mp3 | 20-Apr-2007 10:18 | 17K | |
![[SND]](/icons/sound2.gif) | rascasse.mp3 | 20-Apr-2007 10:18 | 7.9K | |
![[SND]](/icons/sound2.gif) | rascally.mp3 | 20-Apr-2007 10:18 | 8.2K | |
![[SND]](/icons/sound2.gif) | rascality.mp3 | 20-Apr-2007 10:18 | 9.6K | |
![[SND]](/icons/sound2.gif) | rascal.mp3 | 20-Apr-2007 10:17 | 7.5K | |
![[SND]](/icons/sound2.gif) | rasbora.mp3 | 20-Apr-2007 10:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | rasaddar.mp3 | 20-Apr-2007 10:17 | 17K | |
![[SND]](/icons/sound2.gif) | rasa.mp3 | 20-Apr-2007 10:17 | 7.9K | |
![[SND]](/icons/sound2.gif) | ras.mp3 | 20-Apr-2007 10:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | Ras Dashen.mp3 | 20-Apr-2007 10:17 | 10K | |
![[SND]](/icons/sound2.gif) | Ra's at Tib.mp3 | 20-Apr-2007 10:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | Ras al-Khaimah.mp3 | 20-Apr-2007 10:17 | 11K | |
![[SND]](/icons/sound2.gif) | Rarotonga.mp3 | 20-Apr-2007 10:17 | 9.5K | |
![[SND]](/icons/sound2.gif) | rarity.mp3 | 20-Apr-2007 10:17 | 6.8K | |
![[SND]](/icons/sound2.gif) | Raritan.mp3 | 20-Apr-2007 10:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | raring.mp3 | 20-Apr-2007 10:17 | 6.6K | |
![[SND]](/icons/sound2.gif) | rarify.mp3 | 20-Apr-2007 10:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | rareripe.mp3 | 20-Apr-2007 10:17 | 8.2K | |
![[SND]](/icons/sound2.gif) | rarely.mp3 | 20-Apr-2007 10:17 | 7.3K | |
![[SND]](/icons/sound2.gif) | rarefy.mp3 | 20-Apr-2007 10:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | rarefied.mp3 | 20-Apr-2007 10:17 | 8.6K | |
![[SND]](/icons/sound2.gif) | rarefactional.mp3 | 20-Apr-2007 10:17 | 11K | |
![[SND]](/icons/sound2.gif) | rarefaction.mp3 | 20-Apr-2007 10:17 | 11K | |
![[SND]](/icons/sound2.gif) | raree-show.mp3 | 20-Apr-2007 10:17 | 9.3K | |
![[SND]](/icons/sound2.gif) | rareeshow.mp3 | 20-Apr-2007 10:17 | 8.4K | |
![[SND]](/icons/sound2.gif) | rarebit.mp3 | 20-Apr-2007 10:16 | 6.1K | |
![[SND]](/icons/sound2.gif) | rare.mp3 | 20-Apr-2007 10:16 | 6.6K | |
![[SND]](/icons/sound2.gif) | rarae aves.mp3 | 20-Apr-2007 10:16 | 13K | |
![[SND]](/icons/sound2.gif) | raraavis.mp3 | 20-Apr-2007 10:16 | 17K | |
![[SND]](/icons/sound2.gif) | rara avises.mp3 | 20-Apr-2007 10:16 | 11K | |
![[SND]](/icons/sound2.gif) | rara avis.mp3 | 20-Apr-2007 10:16 | 10K | |
![[SND]](/icons/sound2.gif) | raptus.mp3 | 20-Apr-2007 10:16 | 7.9K | |
![[SND]](/icons/sound2.gif) | rapturous.mp3 | 20-Apr-2007 10:16 | 9.1K | |
![[SND]](/icons/sound2.gif) | raptured.mp3 | 20-Apr-2007 10:16 | 8.0K | |
![[SND]](/icons/sound2.gif) | rapture.mp3 | 20-Apr-2007 10:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | raptorial.mp3 | 20-Apr-2007 10:16 | 10K | |
![[SND]](/icons/sound2.gif) | raptor.mp3 | 20-Apr-2007 10:16 | 6.4K | |
![[SND]](/icons/sound2.gif) | raptness.mp3 | 20-Apr-2007 10:16 | 7.3K | |
![[SND]](/icons/sound2.gif) | raptly.mp3 | 20-Apr-2007 10:16 | 6.8K | |
![[SND]](/icons/sound2.gif) | Rapti.mp3 | 20-Apr-2007 10:16 | 7.0K | |
![[SND]](/icons/sound2.gif) | raptatorial.mp3 | 20-Apr-2007 10:16 | 17K | |
![[SND]](/icons/sound2.gif) | rapt.mp3 | 20-Apr-2007 10:16 | 5.9K | |
![[SND]](/icons/sound2.gif) | rapscallion.mp3 | 20-Apr-2007 10:16 | 9.8K | |
![[SND]](/icons/sound2.gif) | rapprochement.mp3 | 20-Apr-2007 10:16 | 11K | |
![[SND]](/icons/sound2.gif) | rapporteur.mp3 | 20-Apr-2007 10:16 | 11K | |
![[SND]](/icons/sound2.gif) | rapport.mp3 | 20-Apr-2007 10:16 | 8.2K | |
![[SND]](/icons/sound2.gif) | rappist.mp3 | 20-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rappini.mp3 | 20-Apr-2007 10:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | rapping.mp3 | 20-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rapper.mp3 | 20-Apr-2007 10:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | rappepie.mp3 | 20-Apr-2007 10:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | rappen.mp3 | 20-Apr-2007 10:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | rappel.mp3 | 20-Apr-2007 10:15 | 8.2K | |
![[SND]](/icons/sound2.gif) | rappee.mp3 | 20-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rapparee.mp3 | 20-Apr-2007 10:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rappahannock.mp3 | 20-Apr-2007 10:15 | 8.6K | |
![[SND]](/icons/sound2.gif) | rapp.mp3 | 20-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rapoush.mp3 | 20-Apr-2007 10:15 | 17K | |
![[SND]](/icons/sound2.gif) | rapist.mp3 | 20-Apr-2007 10:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | rapini.mp3 | 20-Apr-2007 10:15 | 7.7K | |
![[SND]](/icons/sound2.gif) | rapine.mp3 | 20-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rapier.mp3 | 20-Apr-2007 10:15 | 7.1K | |
![[SND]](/icons/sound2.gif) | rapido.mp3 | 20-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | rapidity.mp3 | 20-Apr-2007 10:15 | 7.3K | |
![[SND]](/icons/sound2.gif) | rapid-fire.mp3 | 20-Apr-2007 10:15 | 9.8K | |
![[SND]](/icons/sound2.gif) | Rapidan.mp3 | 20-Apr-2007 10:15 | 9.1K | |
![[SND]](/icons/sound2.gif) | rapid.mp3 | 20-Apr-2007 10:15 | 6.6K | |
![[SND]](/icons/sound2.gif) | Rapid City.mp3 | 20-Apr-2007 10:15 | 6.1K | |
![[SND]](/icons/sound2.gif) | raphides.mp3 | 20-Apr-2007 10:15 | 8.8K | |
![[SND]](/icons/sound2.gif) | raphide.mp3 | 20-Apr-2007 10:15 | 7.9K | |
![[SND]](/icons/sound2.gif) | raphia.mp3 | 20-Apr-2007 10:15 | 7.0K | |
![[SND]](/icons/sound2.gif) | raphe.mp3 | 20-Apr-2007 10:14 | 6.6K | |
![[SND]](/icons/sound2.gif) | Raphaelesque.mp3 | 20-Apr-2007 10:14 | 9.3K | |
![[SND]](/icons/sound2.gif) | Raphael.mp3 | 20-Apr-2007 10:14 | 8.0K | |
![[SND]](/icons/sound2.gif) | rapeseed.mp3 | 20-Apr-2007 10:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | rape.mp3 | 20-Apr-2007 10:14 | 5.5K | |
![[SND]](/icons/sound2.gif) | rapanui.mp3 | 20-Apr-2007 10:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rapallo.mp3 | 20-Apr-2007 10:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | rapacki.mp3 | 20-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | rapacity.mp3 | 20-Apr-2007 10:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | rapacious.mp3 | 20-Apr-2007 10:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rapa.mp3 | 20-Apr-2007 10:14 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rapa Nui.mp3 | 20-Apr-2007 10:14 | 7.5K | |
![[SND]](/icons/sound2.gif) | rap.mp3 | 20-Apr-2007 10:14 | 6.1K | |
![[SND]](/icons/sound2.gif) | raoultslaw.mp3 | 20-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | raoult.mp3 | 20-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | raob.mp3 | 20-Apr-2007 10:14 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rao.mp3 | 20-Apr-2007 10:14 | 5.9K | |
![[SND]](/icons/sound2.gif) | ranunculus.mp3 | 20-Apr-2007 10:14 | 10K | |
![[SND]](/icons/sound2.gif) | ranunculi.mp3 | 20-Apr-2007 10:14 | 11K | |
![[SND]](/icons/sound2.gif) | ranunculaceous.mp3 | 20-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | ranula.mp3 | 20-Apr-2007 10:14 | 7.0K | |
![[SND]](/icons/sound2.gif) | rantoul.mp3 | 20-Apr-2007 10:14 | 8.2K | |
![[SND]](/icons/sound2.gif) | rantipole.mp3 | 20-Apr-2007 10:14 | 17K | |
![[SND]](/icons/sound2.gif) | rantingly.mp3 | 20-Apr-2007 10:13 | 8.2K | |
![[SND]](/icons/sound2.gif) | rantankerous.mp3 | 20-Apr-2007 10:13 | 17K | |
![[SND]](/icons/sound2.gif) | rantan.mp3 | 20-Apr-2007 10:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | rant.mp3 | 20-Apr-2007 10:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | ransomer.mp3 | 20-Apr-2007 10:13 | 17K | |
![[SND]](/icons/sound2.gif) | ransome.mp3 | 20-Apr-2007 10:13 | 8.4K | |
![[SND]](/icons/sound2.gif) | ransom.mp3 | 20-Apr-2007 10:13 | 7.0K | |
![[SND]](/icons/sound2.gif) | ransack.mp3 | 20-Apr-2007 10:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | rannygazoo.mp3 | 20-Apr-2007 10:13 | 17K | |
![[SND]](/icons/sound2.gif) | Rannoch, Loch.mp3 | 20-Apr-2007 10:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | rankling.mp3 | 20-Apr-2007 10:13 | 7.5K | |
![[SND]](/icons/sound2.gif) | rankle.mp3 | 20-Apr-2007 10:13 | 6.3K | |
![[SND]](/icons/sound2.gif) | ranking.mp3 | 20-Apr-2007 10:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | Rankine.mp3 | 20-Apr-2007 10:13 | 6.6K | |
![[SND]](/icons/sound2.gif) | rankin.mp3 | 20-Apr-2007 10:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | ranki.mp3 | 20-Apr-2007 10:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | ranket.mp3 | 20-Apr-2007 10:13 | 7.9K | |
![[SND]](/icons/sound2.gif) | ranker.mp3 | 20-Apr-2007 10:13 | 6.4K | |
![[SND]](/icons/sound2.gif) | Ranke.mp3 | 20-Apr-2007 10:13 | 5.7K | |
![[SND]](/icons/sound2.gif) | rank-and-file.mp3 | 20-Apr-2007 10:13 | 11K | |
![[SND]](/icons/sound2.gif) | rank.mp3 | 20-Apr-2007 10:13 | 6.1K | |
![[SND]](/icons/sound2.gif) | rank and filer.mp3 | 20-Apr-2007 10:13 | 11K | |
![[SND]](/icons/sound2.gif) | ranjitsingh.mp3 | 20-Apr-2007 10:13 | 17K | |
![[SND]](/icons/sound2.gif) | Ranjit Singh.mp3 | 20-Apr-2007 10:13 | 11K | |
![[SND]](/icons/sound2.gif) | ranitidine.mp3 | 20-Apr-2007 10:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | raniridine.mp3 | 20-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | ranikhetdisease.mp3 | 20-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | ranid.mp3 | 20-Apr-2007 10:12 | 5.9K | |
![[SND]](/icons/sound2.gif) | rani.mp3 | 20-Apr-2007 10:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | rangy.mp3 | 20-Apr-2007 10:12 | 7.0K | |
![[SND]](/icons/sound2.gif) | rangpur.mp3 | 20-Apr-2007 10:12 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rangoon.mp3 | 20-Apr-2007 10:12 | 8.8K | |
![[SND]](/icons/sound2.gif) | ranger.mp3 | 20-Apr-2007 10:12 | 6.8K | |
![[SND]](/icons/sound2.gif) | rangeleylakes.mp3 | 20-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | Rangeley Lakes.mp3 | 20-Apr-2007 10:12 | 8.0K | |
![[SND]](/icons/sound2.gif) | rangeland.mp3 | 20-Apr-2007 10:12 | 9.6K | |
![[SND]](/icons/sound2.gif) | ranged.mp3 | 20-Apr-2007 10:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | range.mp3 | 20-Apr-2007 10:12 | 7.3K | |
![[SND]](/icons/sound2.gif) | rangatira.mp3 | 20-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | rang.mp3 | 20-Apr-2007 10:12 | 6.3K | |
![[SND]](/icons/sound2.gif) | ranfurlyshield.mp3 | 20-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | ranelaghgardens.mp3 | 20-Apr-2007 10:12 | 17K | |
![[SND]](/icons/sound2.gif) | ranee.mp3 | 20-Apr-2007 10:12 | 7.1K | |
![[SND]](/icons/sound2.gif) | rane.mp3 | 20-Apr-2007 10:12 | 7.9K | |
![[SND]](/icons/sound2.gif) | randy.mp3 | 20-Apr-2007 10:12 | 6.4K | |
![[SND]](/icons/sound2.gif) | randomize.mp3 | 20-Apr-2007 10:12 | 9.1K | |
![[SND]](/icons/sound2.gif) | randomization.mp3 | 20-Apr-2007 10:12 | 11K | |
![[SND]](/icons/sound2.gif) | randomicity.mp3 | 20-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | random.mp3 | 20-Apr-2007 10:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | Randolph.mp3 | 20-Apr-2007 10:11 | 6.6K | |
![[SND]](/icons/sound2.gif) | randmcnally.mp3 | 20-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | randie.mp3 | 20-Apr-2007 10:11 | 8.4K | |
![[SND]](/icons/sound2.gif) | Randers.mp3 | 20-Apr-2007 10:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | randem.mp3 | 20-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | randan.mp3 | 20-Apr-2007 10:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | randall.mp3 | 20-Apr-2007 10:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | rand.mp3 | 20-Apr-2007 10:11 | 7.0K | |
![[SND]](/icons/sound2.gif) | rancorous.mp3 | 20-Apr-2007 10:11 | 8.2K | |
![[SND]](/icons/sound2.gif) | rancor.mp3 | 20-Apr-2007 10:11 | 6.8K | |
![[SND]](/icons/sound2.gif) | rancidness.mp3 | 20-Apr-2007 10:11 | 9.1K | |
![[SND]](/icons/sound2.gif) | rancidity.mp3 | 20-Apr-2007 10:11 | 9.5K | |
![[SND]](/icons/sound2.gif) | rancid.mp3 | 20-Apr-2007 10:11 | 6.4K | |
![[SND]](/icons/sound2.gif) | rancho.mp3 | 20-Apr-2007 10:11 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rancho Santa Margarita.mp3 | 20-Apr-2007 10:11 | 11K | |
![[SND]](/icons/sound2.gif) | Rancho Palos Verdes.mp3 | 20-Apr-2007 10:11 | 11K | |
![[SND]](/icons/sound2.gif) | Rancho Cucamonga.mp3 | 20-Apr-2007 10:11 | 15K | |
![[SND]](/icons/sound2.gif) | ranchman.mp3 | 20-Apr-2007 10:11 | 7.3K | |
![[SND]](/icons/sound2.gif) | ranchito.mp3 | 20-Apr-2007 10:11 | 17K | |
![[SND]](/icons/sound2.gif) | Ranchi.mp3 | 20-Apr-2007 10:11 | 7.1K | |
![[SND]](/icons/sound2.gif) | ranchette.mp3 | 20-Apr-2007 10:11 | 7.9K | |
![[SND]](/icons/sound2.gif) | ranchero.mp3 | 20-Apr-2007 10:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | rancherie.mp3 | 20-Apr-2007 10:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | rancheria.mp3 | 20-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | ranchera.mp3 | 20-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | rancher.mp3 | 20-Apr-2007 10:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | ranch.mp3 | 20-Apr-2007 10:10 | 7.1K | |
![[SND]](/icons/sound2.gif) | rance.mp3 | 20-Apr-2007 10:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rancagua.mp3 | 20-Apr-2007 10:10 | 8.8K | |
![[SND]](/icons/sound2.gif) | ran.mp3 | 20-Apr-2007 10:10 | 5.5K | |
![[SND]](/icons/sound2.gif) | ramus.mp3 | 20-Apr-2007 10:10 | 7.0K | |
![[SND]](/icons/sound2.gif) | ramulose.mp3 | 20-Apr-2007 10:10 | 7.9K | |
![[SND]](/icons/sound2.gif) | ramtil.mp3 | 20-Apr-2007 10:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | ramstedt.mp3 | 20-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | ramstam.mp3 | 20-Apr-2007 10:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | ramson.mp3 | 20-Apr-2007 10:10 | 8.4K | |
![[SND]](/icons/sound2.gif) | ramsingh.mp3 | 20-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | ramshorn.mp3 | 20-Apr-2007 10:10 | 9.3K | |
![[SND]](/icons/sound2.gif) | ramshackle.mp3 | 20-Apr-2007 10:10 | 9.1K | |
![[SND]](/icons/sound2.gif) | Ramsgate.mp3 | 20-Apr-2007 10:10 | 8.2K | |
![[SND]](/icons/sound2.gif) | Ramsey.mp3 | 20-Apr-2007 10:10 | 6.3K | |
![[SND]](/icons/sound2.gif) | Ramses.mp3 | 20-Apr-2007 10:10 | 8.0K | |
![[SND]](/icons/sound2.gif) | ramsdeneyepiece.mp3 | 20-Apr-2007 10:10 | 18K | |
![[SND]](/icons/sound2.gif) | Ramsay.mp3 | 20-Apr-2007 10:10 | 6.4K | |
![[SND]](/icons/sound2.gif) | ramsarconvention.mp3 | 20-Apr-2007 10:10 | 17K | |
![[SND]](/icons/sound2.gif) | ramrod.mp3 | 20-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rampur.mp3 | 20-Apr-2007 10:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | ramp-up.mp3 | 20-Apr-2007 10:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | ramps.mp3 | 20-Apr-2007 10:09 | 8.6K | |
![[SND]](/icons/sound2.gif) | rampion.mp3 | 20-Apr-2007 10:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | rampike.mp3 | 20-Apr-2007 10:09 | 7.3K | |
![[SND]](/icons/sound2.gif) | ramphal.mp3 | 20-Apr-2007 10:09 | 17K | |
![[SND]](/icons/sound2.gif) | rampart.mp3 | 20-Apr-2007 10:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | rampant.mp3 | 20-Apr-2007 10:09 | 6.4K | |
![[SND]](/icons/sound2.gif) | rampancy.mp3 | 20-Apr-2007 10:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rampal.mp3 | 20-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | rampageous.mp3 | 20-Apr-2007 10:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | rampage.mp3 | 20-Apr-2007 10:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | ramp.mp3 | 20-Apr-2007 10:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | ramous.mp3 | 20-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ramos-Horta.mp3 | 20-Apr-2007 10:09 | 10K | |
![[SND]](/icons/sound2.gif) | ramosginfizz.mp3 | 20-Apr-2007 10:09 | 17K | |
![[SND]](/icons/sound2.gif) | ramose.mp3 | 20-Apr-2007 10:09 | 7.0K | |
![[SND]](/icons/sound2.gif) | Ramos.mp3 | 20-Apr-2007 10:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | ramonycajal.mp3 | 20-Apr-2007 10:09 | 17K | |
![[SND]](/icons/sound2.gif) | ramona.mp3 | 20-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | ramon.mp3 | 20-Apr-2007 10:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ramon y Cajal.mp3 | 20-Apr-2007 10:09 | 14K | |
![[SND]](/icons/sound2.gif) | rammy.mp3 | 20-Apr-2007 10:09 | 8.2K | |
![[SND]](/icons/sound2.gif) | rammish.mp3 | 20-Apr-2007 10:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | rammer.mp3 | 20-Apr-2007 10:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | rammelsbergite.mp3 | 20-Apr-2007 10:08 | 17K | |
![[SND]](/icons/sound2.gif) | ramjet.mp3 | 20-Apr-2007 10:08 | 7.3K | |
![[SND]](/icons/sound2.gif) | Ramist.mp3 | 20-Apr-2007 10:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | Ramism.mp3 | 20-Apr-2007 10:08 | 7.7K | |
![[SND]](/icons/sound2.gif) | ramillies.mp3 | 20-Apr-2007 10:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | ramillie.mp3 | 20-Apr-2007 10:08 | 8.0K | |
![[SND]](/icons/sound2.gif) | ramify.mp3 | 20-Apr-2007 10:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | ramiform.mp3 | 20-Apr-2007 10:08 | 8.2K | |
![[SND]](/icons/sound2.gif) | ramification.mp3 | 20-Apr-2007 10:08 | 11K | |
![[SND]](/icons/sound2.gif) | ramie.mp3 | 20-Apr-2007 10:08 | 6.4K | |
![[SND]](/icons/sound2.gif) | rami.mp3 | 20-Apr-2007 10:08 | 6.8K | |
![[SND]](/icons/sound2.gif) | Ramganga.mp3 | 20-Apr-2007 10:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | ramet.mp3 | 20-Apr-2007 10:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | Rameses.mp3 | 20-Apr-2007 10:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | ramequin.mp3 | 20-Apr-2007 10:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | ramentum.mp3 | 20-Apr-2007 10:08 | 8.4K | |
![[SND]](/icons/sound2.gif) | ramentaceous.mp3 | 20-Apr-2007 10:08 | 8.8K | |
![[SND]](/icons/sound2.gif) | ramen.mp3 | 20-Apr-2007 10:08 | 6.3K | |
![[SND]](/icons/sound2.gif) | ramekin.mp3 | 20-Apr-2007 10:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ramee.mp3 | 20-Apr-2007 10:08 | 7.0K | |
![[SND]](/icons/sound2.gif) | Rameau.mp3 | 20-Apr-2007 10:08 | 7.1K | |
![[SND]](/icons/sound2.gif) | rambutan.mp3 | 20-Apr-2007 10:08 | 7.9K | |
![[SND]](/icons/sound2.gif) | rambunctious.mp3 | 20-Apr-2007 10:08 | 9.5K | |
![[SND]](/icons/sound2.gif) | rambouillet.mp3 | 20-Apr-2007 10:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | ramboid.mp3 | 20-Apr-2007 10:07 | 8.2K | |
![[SND]](/icons/sound2.gif) | rambo.mp3 | 20-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | ramblingly.mp3 | 20-Apr-2007 10:07 | 9.1K | |
![[SND]](/icons/sound2.gif) | rambling.mp3 | 20-Apr-2007 10:07 | 7.7K | |
![[SND]](/icons/sound2.gif) | rambler.mp3 | 20-Apr-2007 10:07 | 7.1K | |
![[SND]](/icons/sound2.gif) | ramble.mp3 | 20-Apr-2007 10:07 | 6.4K | |
![[SND]](/icons/sound2.gif) | rambla.mp3 | 20-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | rambert.mp3 | 20-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | rambam.mp3 | 20-Apr-2007 10:07 | 17K | |
![[SND]](/icons/sound2.gif) | ramazan.mp3 | 20-Apr-2007 10:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | ramayana.mp3 | 20-Apr-2007 10:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | ramatgan.mp3 | 20-Apr-2007 10:07 | 17K | |
![[SND]](/icons/sound2.gif) | ramate.mp3 | 20-Apr-2007 10:07 | 6.6K | |
![[SND]](/icons/sound2.gif) | Ramat Gan.mp3 | 20-Apr-2007 10:07 | 10K | |
![[SND]](/icons/sound2.gif) | ramark.mp3 | 20-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ramapo Mountains.mp3 | 20-Apr-2007 10:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | ramapithecus.mp3 | 20-Apr-2007 10:07 | 17K | |
![[SND]](/icons/sound2.gif) | ramanuja.mp3 | 20-Apr-2007 10:07 | 8.4K | |
![[SND]](/icons/sound2.gif) | Raman.mp3 | 20-Apr-2007 10:07 | 6.1K | |
![[SND]](/icons/sound2.gif) | ramamorph.mp3 | 20-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | ramal.mp3 | 20-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ramakrishna.mp3 | 20-Apr-2007 10:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | ramage.mp3 | 20-Apr-2007 10:07 | 7.9K | |
![[SND]](/icons/sound2.gif) | ramadasocialism.mp3 | 20-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | Ramadan.mp3 | 20-Apr-2007 10:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | ramada.mp3 | 20-Apr-2007 10:06 | 7.3K | |
![[SND]](/icons/sound2.gif) | ramachandra.mp3 | 20-Apr-2007 10:06 | 8.6K | |
![[SND]](/icons/sound2.gif) | Rama.mp3 | 20-Apr-2007 10:06 | 6.1K | |
![[SND]](/icons/sound2.gif) | ram.mp3 | 20-Apr-2007 10:06 | 6.4K | |
![[SND]](/icons/sound2.gif) | ralstonpurina.mp3 | 20-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | ralphspooner.mp3 | 20-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | ralph.mp3 | 20-Apr-2007 10:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | raloxifene.mp3 | 20-Apr-2007 10:06 | 11K | |
![[SND]](/icons/sound2.gif) | rallyman.mp3 | 20-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | rallyist.mp3 | 20-Apr-2007 10:06 | 8.0K | |
![[SND]](/icons/sound2.gif) | rallying.mp3 | 20-Apr-2007 10:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | rallye.mp3 | 20-Apr-2007 10:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | rallycross.mp3 | 20-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | rally.mp3 | 20-Apr-2007 10:06 | 5.9K | |
![[SND]](/icons/sound2.gif) | ralline.mp3 | 20-Apr-2007 10:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | ralliform.mp3 | 20-Apr-2007 10:06 | 8.2K | |
![[SND]](/icons/sound2.gif) | rallicart.mp3 | 20-Apr-2007 10:06 | 17K | |
![[SND]](/icons/sound2.gif) | rallentando.mp3 | 20-Apr-2007 10:06 | 11K | |
![[SND]](/icons/sound2.gif) | rall.mp3 | 20-Apr-2007 10:06 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ralik.mp3 | 20-Apr-2007 10:06 | 5.4K | |
![[SND]](/icons/sound2.gif) | Raleigh.mp3 | 20-Apr-2007 10:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | Ralegh.mp3 | 20-Apr-2007 10:06 | 7.1K | |
![[SND]](/icons/sound2.gif) | rale.mp3 | 20-Apr-2007 10:05 | 6.8K | |
![[SND]](/icons/sound2.gif) | ral.mp3 | 20-Apr-2007 10:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | raku.mp3 | 20-Apr-2007 10:05 | 7.0K | |
![[SND]](/icons/sound2.gif) | rakish.mp3 | 20-Apr-2007 10:05 | 7.1K | |
![[SND]](/icons/sound2.gif) | rakija.mp3 | 20-Apr-2007 10:05 | 8.4K | |
![[SND]](/icons/sound2.gif) | raki.mp3 | 20-Apr-2007 10:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | raker.mp3 | 20-Apr-2007 10:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | rake-off.mp3 | 20-Apr-2007 10:05 | 7.3K | |
![[SND]](/icons/sound2.gif) | rakehelly.mp3 | 20-Apr-2007 10:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | rakehell.mp3 | 20-Apr-2007 10:05 | 8.2K | |
![[SND]](/icons/sound2.gif) | raked.mp3 | 20-Apr-2007 10:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | rake.mp3 | 20-Apr-2007 10:05 | 6.1K | |
![[SND]](/icons/sound2.gif) | rakata.mp3 | 20-Apr-2007 10:05 | 17K | |
![[SND]](/icons/sound2.gif) | raka.mp3 | 20-Apr-2007 10:05 | 17K | |
![[SND]](/icons/sound2.gif) | rajyasabha.mp3 | 20-Apr-2007 10:05 | 27K | |
![[SND]](/icons/sound2.gif) | Rajputana.mp3 | 20-Apr-2007 10:05 | 9.6K | |
![[SND]](/icons/sound2.gif) | Rajput.mp3 | 20-Apr-2007 10:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rajpoot.mp3 | 20-Apr-2007 10:05 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rajkot.mp3 | 20-Apr-2007 10:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rajasthani.mp3 | 20-Apr-2007 10:05 | 10K | |
![[SND]](/icons/sound2.gif) | Rajasthan.mp3 | 20-Apr-2007 10:05 | 10K | |
![[SND]](/icons/sound2.gif) | rajas.mp3 | 20-Apr-2007 10:05 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rajahmundry.mp3 | 20-Apr-2007 10:05 | 11K | |
![[SND]](/icons/sound2.gif) | rajah.mp3 | 20-Apr-2007 10:05 | 5.5K | |
![[SND]](/icons/sound2.gif) | Rajagopalachari.mp3 | 20-Apr-2007 10:04 | 15K | |
![[SND]](/icons/sound2.gif) | Rajab.mp3 | 20-Apr-2007 10:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | raja.mp3 | 20-Apr-2007 10:04 | 5.5K | |
![[SND]](/icons/sound2.gif) | raj.mp3 | 20-Apr-2007 10:04 | 6.6K | |
![[SND]](/icons/sound2.gif) | raita.mp3 | 20-Apr-2007 10:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | raisons d'etre.mp3 | 20-Apr-2007 10:04 | 11K | |
![[SND]](/icons/sound2.gif) | raisonneur.mp3 | 20-Apr-2007 10:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | raisonne.mp3 | 20-Apr-2007 10:04 | 17K | |
![[SND]](/icons/sound2.gif) | raisondetre.mp3 | 20-Apr-2007 10:04 | 17K | |
![[SND]](/icons/sound2.gif) | raisondetat.mp3 | 20-Apr-2007 10:04 | 17K | |
![[SND]](/icons/sound2.gif) | raison d'etre.mp3 | 20-Apr-2007 10:04 | 12K | |
![[SND]](/icons/sound2.gif) | raison d'etat.mp3 | 20-Apr-2007 10:04 | 11K | |
![[SND]](/icons/sound2.gif) | raising.mp3 | 20-Apr-2007 10:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | raisin.mp3 | 20-Apr-2007 10:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | raised.mp3 | 20-Apr-2007 10:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | raise.mp3 | 20-Apr-2007 10:04 | 7.5K | |
![[SND]](/icons/sound2.gif) | rais.mp3 | 20-Apr-2007 10:04 | 7.9K | |
![[SND]](/icons/sound2.gif) | Raipur.mp3 | 20-Apr-2007 10:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | rainy.mp3 | 20-Apr-2007 10:04 | 6.1K | |
![[SND]](/icons/sound2.gif) | rainwear.mp3 | 20-Apr-2007 10:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | rainwater.mp3 | 20-Apr-2007 10:04 | 8.2K | |
![[SND]](/icons/sound2.gif) | rainwash.mp3 | 20-Apr-2007 10:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | rainstorm.mp3 | 20-Apr-2007 10:04 | 10K | |
![[SND]](/icons/sound2.gif) | rainsquall.mp3 | 20-Apr-2007 10:04 | 9.3K | |
![[SND]](/icons/sound2.gif) | rainspout.mp3 | 20-Apr-2007 10:03 | 9.3K | |
![[SND]](/icons/sound2.gif) | rainproof.mp3 | 20-Apr-2007 10:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | rainout.mp3 | 20-Apr-2007 10:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | rainmaking.mp3 | 20-Apr-2007 10:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | rainmaker.mp3 | 20-Apr-2007 10:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | rainless.mp3 | 20-Apr-2007 10:03 | 8.6K | |
![[SND]](/icons/sound2.gif) | rainieriii.mp3 | 20-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | rainier.mp3 | 20-Apr-2007 10:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | Rainier, Mount.mp3 | 20-Apr-2007 10:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | Rainier III.mp3 | 20-Apr-2007 10:03 | 6.1K | |
![[SND]](/icons/sound2.gif) | rainfall.mp3 | 20-Apr-2007 10:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | rainey.mp3 | 20-Apr-2007 10:03 | 7.9K | |
![[SND]](/icons/sound2.gif) | raindrop.mp3 | 20-Apr-2007 10:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | raincoat.mp3 | 20-Apr-2007 10:03 | 7.7K | |
![[SND]](/icons/sound2.gif) | rainbow.mp3 | 20-Apr-2007 10:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | rainbird.mp3 | 20-Apr-2007 10:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | rain.mp3 | 20-Apr-2007 10:03 | 7.1K | |
![[SND]](/icons/sound2.gif) | Raimondi.mp3 | 20-Apr-2007 10:03 | 7.5K | |
![[SND]](/icons/sound2.gif) | raiment.mp3 | 20-Apr-2007 10:03 | 6.6K | |
![[SND]](/icons/sound2.gif) | railwayman.mp3 | 20-Apr-2007 10:03 | 17K | |
![[SND]](/icons/sound2.gif) | railway.mp3 | 20-Apr-2007 10:03 | 8.0K | |
![[SND]](/icons/sound2.gif) | rail-splitter.mp3 | 20-Apr-2007 10:03 | 9.6K | |
![[SND]](/icons/sound2.gif) | railroading.mp3 | 20-Apr-2007 10:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | railroad.mp3 | 20-Apr-2007 10:03 | 8.8K | |
![[SND]](/icons/sound2.gif) | railman.mp3 | 20-Apr-2007 10:03 | 8.2K | |
![[SND]](/icons/sound2.gif) | raillery.mp3 | 20-Apr-2007 10:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | railing.mp3 | 20-Apr-2007 10:02 | 7.0K | |
![[SND]](/icons/sound2.gif) | railhead.mp3 | 20-Apr-2007 10:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | railcar.mp3 | 20-Apr-2007 10:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | railbus.mp3 | 20-Apr-2007 10:02 | 8.4K | |
![[SND]](/icons/sound2.gif) | railbird.mp3 | 20-Apr-2007 10:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | railage.mp3 | 20-Apr-2007 10:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | rail.mp3 | 20-Apr-2007 10:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | raids.mp3 | 20-Apr-2007 10:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | raider.mp3 | 20-Apr-2007 10:02 | 6.6K | |
![[SND]](/icons/sound2.gif) | raid.mp3 | 20-Apr-2007 10:02 | 6.8K | |
![[SND]](/icons/sound2.gif) | raia.mp3 | 20-Apr-2007 10:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | rai.mp3 | 20-Apr-2007 10:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rahway.mp3 | 20-Apr-2007 10:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | rah-rah.mp3 | 20-Apr-2007 10:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | rahrah.mp3 | 20-Apr-2007 10:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | rahman.mp3 | 20-Apr-2007 10:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | rahab.mp3 | 20-Apr-2007 10:02 | 7.9K | |
![[SND]](/icons/sound2.gif) | rah.mp3 | 20-Apr-2007 10:02 | 5.9K | |
![[SND]](/icons/sound2.gif) | ragwort.mp3 | 20-Apr-2007 10:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | ragweed.mp3 | 20-Apr-2007 10:02 | 8.6K | |
![[SND]](/icons/sound2.gif) | Ragusa.mp3 | 20-Apr-2007 10:02 | 7.7K | |
![[SND]](/icons/sound2.gif) | raguly.mp3 | 20-Apr-2007 10:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | ragu.mp3 | 20-Apr-2007 10:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | ragtop.mp3 | 20-Apr-2007 10:02 | 8.0K | |
![[SND]](/icons/sound2.gif) | ragtime.mp3 | 20-Apr-2007 10:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | ragtag.mp3 | 20-Apr-2007 10:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | ragpicker.mp3 | 20-Apr-2007 10:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | ragout.mp3 | 20-Apr-2007 10:01 | 7.7K | |
![[SND]](/icons/sound2.gif) | Ragnarok.mp3 | 20-Apr-2007 10:01 | 8.6K | |
![[SND]](/icons/sound2.gif) | ragnarlodbrok.mp3 | 20-Apr-2007 10:01 | 17K | |
![[SND]](/icons/sound2.gif) | ragman.mp3 | 20-Apr-2007 10:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | raglan.mp3 | 20-Apr-2007 10:01 | 7.5K | |
![[SND]](/icons/sound2.gif) | raging.mp3 | 20-Apr-2007 10:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | ragi.mp3 | 20-Apr-2007 10:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | raggle-taggle.mp3 | 20-Apr-2007 10:01 | 10K | |
![[SND]](/icons/sound2.gif) | raggletaggle.mp3 | 20-Apr-2007 10:01 | 17K | |
![[SND]](/icons/sound2.gif) | raggle.mp3 | 20-Apr-2007 10:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | ragging.mp3 | 20-Apr-2007 10:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | raggedy.mp3 | 20-Apr-2007 10:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | ragged.mp3 | 20-Apr-2007 10:01 | 6.6K | |
![[SND]](/icons/sound2.gif) | ragg.mp3 | 20-Apr-2007 10:01 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rages.mp3 | 20-Apr-2007 10:01 | 8.0K | |
![[SND]](/icons/sound2.gif) | rager.mp3 | 20-Apr-2007 10:01 | 8.4K | |
![[SND]](/icons/sound2.gif) | ragee.mp3 | 20-Apr-2007 10:01 | 8.2K | |
![[SND]](/icons/sound2.gif) | rage.mp3 | 20-Apr-2007 10:01 | 6.8K | |
![[SND]](/icons/sound2.gif) | ragbag.mp3 | 20-Apr-2007 10:01 | 9.1K | |
![[SND]](/icons/sound2.gif) | ragazza.mp3 | 20-Apr-2007 10:01 | 17K | |
![[SND]](/icons/sound2.gif) | ragamuffin.mp3 | 20-Apr-2007 10:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | Ragae.mp3 | 20-Apr-2007 10:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | raga.mp3 | 20-Apr-2007 10:00 | 6.3K | |
![[SND]](/icons/sound2.gif) | rag.mp3 | 20-Apr-2007 10:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | raftsman.mp3 | 20-Apr-2007 10:00 | 8.4K | |
![[SND]](/icons/sound2.gif) | rafting.mp3 | 20-Apr-2007 10:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | raftered.mp3 | 20-Apr-2007 10:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | rafter.mp3 | 20-Apr-2007 10:00 | 6.4K | |
![[SND]](/icons/sound2.gif) | raft.mp3 | 20-Apr-2007 10:00 | 6.1K | |
![[SND]](/icons/sound2.gif) | Rafsanjani.mp3 | 20-Apr-2007 10:00 | 9.1K | |
![[SND]](/icons/sound2.gif) | rafraichissoir.mp3 | 20-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | rafinesque.mp3 | 20-Apr-2007 10:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | raffling.mp3 | 20-Apr-2007 10:00 | 7.5K | |
![[SND]](/icons/sound2.gif) | rafflesiaceous.mp3 | 20-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | rafflesia.mp3 | 20-Apr-2007 10:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | raffles.mp3 | 20-Apr-2007 10:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | raffle.mp3 | 20-Apr-2007 10:00 | 6.6K | |
![[SND]](/icons/sound2.gif) | raffish.mp3 | 20-Apr-2007 10:00 | 7.0K | |
![[SND]](/icons/sound2.gif) | raffinose.mp3 | 20-Apr-2007 10:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | raffine.mp3 | 20-Apr-2007 10:00 | 8.2K | |
![[SND]](/icons/sound2.gif) | raffinate.mp3 | 20-Apr-2007 10:00 | 8.0K | |
![[SND]](/icons/sound2.gif) | raffia.mp3 | 20-Apr-2007 10:00 | 7.1K | |
![[SND]](/icons/sound2.gif) | rafferty.mp3 | 20-Apr-2007 10:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | raffee.mp3 | 20-Apr-2007 10:00 | 7.9K | |
![[SND]](/icons/sound2.gif) | raffaelesque.mp3 | 20-Apr-2007 10:00 | 17K | |
![[SND]](/icons/sound2.gif) | raff.mp3 | 20-Apr-2007 10:00 | 5.9K | |
![[SND]](/icons/sound2.gif) | rafale.mp3 | 20-Apr-2007 09:59 | 17K | |
![[SND]](/icons/sound2.gif) | raf.mp3 | 20-Apr-2007 09:59 | 17K | |
![[SND]](/icons/sound2.gif) | raetic.mp3 | 20-Apr-2007 09:59 | 7.9K | |
![[SND]](/icons/sound2.gif) | Raetian.mp3 | 20-Apr-2007 09:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | Raetia.mp3 | 20-Apr-2007 09:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | Raemaekers.mp3 | 20-Apr-2007 09:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | Raeder.mp3 | 20-Apr-2007 09:59 | 5.7K | |
![[SND]](/icons/sound2.gif) | Raeburn.mp3 | 20-Apr-2007 09:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | Rae.mp3 | 20-Apr-2007 09:59 | 5.9K | |
![[SND]](/icons/sound2.gif) | radwaste.mp3 | 20-Apr-2007 09:59 | 8.4K | |
![[SND]](/icons/sound2.gif) | radular.mp3 | 20-Apr-2007 09:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | radulae.mp3 | 20-Apr-2007 09:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | radula.mp3 | 20-Apr-2007 09:59 | 7.0K | |
![[SND]](/icons/sound2.gif) | radon.mp3 | 20-Apr-2007 09:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | radome.mp3 | 20-Apr-2007 09:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | Radom.mp3 | 20-Apr-2007 09:59 | 8.6K | |
![[SND]](/icons/sound2.gif) | Radnorshire.mp3 | 20-Apr-2007 09:59 | 9.6K | |
![[SND]](/icons/sound2.gif) | Radnor.mp3 | 20-Apr-2007 09:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | radlib.mp3 | 20-Apr-2007 09:59 | 8.8K | |
![[SND]](/icons/sound2.gif) | radixes.mp3 | 20-Apr-2007 09:59 | 9.3K | |
![[SND]](/icons/sound2.gif) | radix.mp3 | 20-Apr-2007 09:59 | 7.3K | |
![[SND]](/icons/sound2.gif) | radius.mp3 | 20-Apr-2007 09:59 | 7.7K | |
![[SND]](/icons/sound2.gif) | radium.mp3 | 20-Apr-2007 09:59 | 7.1K | |
![[SND]](/icons/sound2.gif) | radish.mp3 | 20-Apr-2007 09:59 | 7.5K | |
![[SND]](/icons/sound2.gif) | radio-ulna.mp3 | 20-Apr-2007 09:58 | 9.8K | |
![[SND]](/icons/sound2.gif) | radiotracer.mp3 | 20-Apr-2007 09:58 | 11K | |
![[SND]](/icons/sound2.gif) | radiotoxologic.mp3 | 20-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | radiothorium.mp3 | 20-Apr-2007 09:58 | 11K | |
![[SND]](/icons/sound2.gif) | radiothon.mp3 | 20-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | radiotherapy.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radiotherapist.mp3 | 20-Apr-2007 09:58 | 13K | |
![[SND]](/icons/sound2.gif) | radiotelephony.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radiotelephone.mp3 | 20-Apr-2007 09:58 | 13K | |
![[SND]](/icons/sound2.gif) | radiotelemetry.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radiotelemetric.mp3 | 20-Apr-2007 09:58 | 13K | |
![[SND]](/icons/sound2.gif) | radiotelegraphy.mp3 | 20-Apr-2007 09:58 | 13K | |
![[SND]](/icons/sound2.gif) | radiotelegraph.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radio-tag.mp3 | 20-Apr-2007 09:58 | 10K | |
![[SND]](/icons/sound2.gif) | radiosurgery.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radiosonde.mp3 | 20-Apr-2007 09:58 | 11K | |
![[SND]](/icons/sound2.gif) | radiosensitivity.mp3 | 20-Apr-2007 09:58 | 13K | |
![[SND]](/icons/sound2.gif) | radiosensitive.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radioscopy.mp3 | 20-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | radioscope.mp3 | 20-Apr-2007 09:58 | 17K | |
![[SND]](/icons/sound2.gif) | radioprotective.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radioprotection.mp3 | 20-Apr-2007 09:58 | 12K | |
![[SND]](/icons/sound2.gif) | radiophoto.mp3 | 20-Apr-2007 09:58 | 10K | |
![[SND]](/icons/sound2.gif) | radiophone.mp3 | 20-Apr-2007 09:58 | 10K | |
![[SND]](/icons/sound2.gif) | radiopharmaceutical.mp3 | 20-Apr-2007 09:57 | 15K | |
![[SND]](/icons/sound2.gif) | radiophare.mp3 | 20-Apr-2007 09:57 | 17K | |
![[SND]](/icons/sound2.gif) | radiopaque.mp3 | 20-Apr-2007 09:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | radionuclide.mp3 | 20-Apr-2007 09:57 | 13K | |
![[SND]](/icons/sound2.gif) | radionics.mp3 | 20-Apr-2007 09:57 | 17K | |
![[SND]](/icons/sound2.gif) | radiomimetic.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radiometry.mp3 | 20-Apr-2007 09:57 | 9.6K | |
![[SND]](/icons/sound2.gif) | radiometrically.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radiometric.mp3 | 20-Apr-2007 09:57 | 9.8K | |
![[SND]](/icons/sound2.gif) | radiometer.mp3 | 20-Apr-2007 09:57 | 9.1K | |
![[SND]](/icons/sound2.gif) | radiomarti.mp3 | 20-Apr-2007 09:57 | 17K | |
![[SND]](/icons/sound2.gif) | radioman.mp3 | 20-Apr-2007 09:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | radiolytic.mp3 | 20-Apr-2007 09:57 | 9.3K | |
![[SND]](/icons/sound2.gif) | radiolysis.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radiolucent.mp3 | 20-Apr-2007 09:57 | 10K | |
![[SND]](/icons/sound2.gif) | radiolucency.mp3 | 20-Apr-2007 09:57 | 12K | |
![[SND]](/icons/sound2.gif) | radiology.mp3 | 20-Apr-2007 09:57 | 9.6K | |
![[SND]](/icons/sound2.gif) | radiologist.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radiologically.mp3 | 20-Apr-2007 09:57 | 12K | |
![[SND]](/icons/sound2.gif) | radiological.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radiologic.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radiolarian.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radiolaria.mp3 | 20-Apr-2007 09:57 | 11K | |
![[SND]](/icons/sound2.gif) | radioland.mp3 | 20-Apr-2007 09:56 | 17K | |
![[SND]](/icons/sound2.gif) | radiolabel.mp3 | 20-Apr-2007 09:56 | 9.8K | |
![[SND]](/icons/sound2.gif) | radioisotopically.mp3 | 20-Apr-2007 09:56 | 15K | |
![[SND]](/icons/sound2.gif) | radioisotopic.mp3 | 20-Apr-2007 09:56 | 13K | |
![[SND]](/icons/sound2.gif) | radioisotope.mp3 | 20-Apr-2007 09:56 | 12K | |
![[SND]](/icons/sound2.gif) | radioimmunoassayable.mp3 | 20-Apr-2007 09:56 | 18K | |
![[SND]](/icons/sound2.gif) | radioimmunoassay.mp3 | 20-Apr-2007 09:56 | 16K | |
![[SND]](/icons/sound2.gif) | radiography.mp3 | 20-Apr-2007 09:56 | 10K | |
![[SND]](/icons/sound2.gif) | radiographically.mp3 | 20-Apr-2007 09:56 | 12K | |
![[SND]](/icons/sound2.gif) | radiographic.mp3 | 20-Apr-2007 09:56 | 10K | |
![[SND]](/icons/sound2.gif) | radiographer.mp3 | 20-Apr-2007 09:56 | 10K | |
![[SND]](/icons/sound2.gif) | radiograph.mp3 | 20-Apr-2007 09:56 | 10K | |
![[SND]](/icons/sound2.gif) | radiogram.mp3 | 20-Apr-2007 09:56 | 10K | |
![[SND]](/icons/sound2.gif) | radiogenic.mp3 | 20-Apr-2007 09:56 | 9.5K | |
![[SND]](/icons/sound2.gif) | radioelement.mp3 | 20-Apr-2007 09:56 | 11K | |
![[SND]](/icons/sound2.gif) | radioecology.mp3 | 20-Apr-2007 09:56 | 13K | |
![[SND]](/icons/sound2.gif) | radiochromatogram.mp3 | 20-Apr-2007 09:56 | 13K | |
![[SND]](/icons/sound2.gif) | radiochemistry.mp3 | 20-Apr-2007 09:56 | 12K | |
![[SND]](/icons/sound2.gif) | radiochemist.mp3 | 20-Apr-2007 09:56 | 11K | |
![[SND]](/icons/sound2.gif) | radiochemically.mp3 | 20-Apr-2007 09:56 | 11K | |
![[SND]](/icons/sound2.gif) | radiochemical.mp3 | 20-Apr-2007 09:56 | 11K | |
![[SND]](/icons/sound2.gif) | radiocarbon-date.mp3 | 20-Apr-2007 09:56 | 14K | |
![[SND]](/icons/sound2.gif) | radiocarbon.mp3 | 20-Apr-2007 09:56 | 11K | |
![[SND]](/icons/sound2.gif) | radiobiology.mp3 | 20-Apr-2007 09:56 | 14K | |
![[SND]](/icons/sound2.gif) | radiobiologist.mp3 | 20-Apr-2007 09:55 | 14K | |
![[SND]](/icons/sound2.gif) | radiobiologically.mp3 | 20-Apr-2007 09:55 | 16K | |
![[SND]](/icons/sound2.gif) | radiobiological.mp3 | 20-Apr-2007 09:55 | 15K | |
![[SND]](/icons/sound2.gif) | radiobiologic.mp3 | 20-Apr-2007 09:55 | 13K | |
![[SND]](/icons/sound2.gif) | radioautography.mp3 | 20-Apr-2007 09:55 | 14K | |
![[SND]](/icons/sound2.gif) | radioautographic.mp3 | 20-Apr-2007 09:55 | 12K | |
![[SND]](/icons/sound2.gif) | radioautograph.mp3 | 20-Apr-2007 09:55 | 12K | |
![[SND]](/icons/sound2.gif) | radioallergosorbent.mp3 | 20-Apr-2007 09:55 | 16K | |
![[SND]](/icons/sound2.gif) | radioactivity.mp3 | 20-Apr-2007 09:55 | 12K | |
![[SND]](/icons/sound2.gif) | radioactive.mp3 | 20-Apr-2007 09:55 | 11K | |
![[SND]](/icons/sound2.gif) | radio.mp3 | 20-Apr-2007 09:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | radin.mp3 | 20-Apr-2007 09:55 | 7.9K | |
![[SND]](/icons/sound2.gif) | radii.mp3 | 20-Apr-2007 09:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | radiguet.mp3 | 20-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | radiesthesia.mp3 | 20-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | radiculose.mp3 | 20-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | radiculitis.mp3 | 20-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | radicular.mp3 | 20-Apr-2007 09:55 | 8.2K | |
![[SND]](/icons/sound2.gif) | radiclib.mp3 | 20-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | radicle.mp3 | 20-Apr-2007 09:55 | 7.1K | |
![[SND]](/icons/sound2.gif) | radicidation.mp3 | 20-Apr-2007 09:55 | 17K | |
![[SND]](/icons/sound2.gif) | radices.mp3 | 20-Apr-2007 09:55 | 9.3K | |
![[SND]](/icons/sound2.gif) | radicel.mp3 | 20-Apr-2007 09:55 | 8.6K | |
![[SND]](/icons/sound2.gif) | radicchio.mp3 | 20-Apr-2007 09:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | radicate.mp3 | 20-Apr-2007 09:54 | 17K | |
![[SND]](/icons/sound2.gif) | radicant.mp3 | 20-Apr-2007 09:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | radicand.mp3 | 20-Apr-2007 09:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | radically.mp3 | 20-Apr-2007 09:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | radicalize.mp3 | 20-Apr-2007 09:54 | 11K | |
![[SND]](/icons/sound2.gif) | radicalization.mp3 | 20-Apr-2007 09:54 | 13K | |
![[SND]](/icons/sound2.gif) | radicalism.mp3 | 20-Apr-2007 09:54 | 11K | |
![[SND]](/icons/sound2.gif) | radical.mp3 | 20-Apr-2007 09:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | radiatus.mp3 | 20-Apr-2007 09:54 | 8.6K | |
![[SND]](/icons/sound2.gif) | radiator.mp3 | 20-Apr-2007 09:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | radiative.mp3 | 20-Apr-2007 09:54 | 8.0K | |
![[SND]](/icons/sound2.gif) | radiationless.mp3 | 20-Apr-2007 09:54 | 11K | |
![[SND]](/icons/sound2.gif) | radiational.mp3 | 20-Apr-2007 09:54 | 9.5K | |
![[SND]](/icons/sound2.gif) | radiation.mp3 | 20-Apr-2007 09:54 | 9.1K | |
![[SND]](/icons/sound2.gif) | radiate.mp3 | 20-Apr-2007 09:54 | 6.8K | |
![[SND]](/icons/sound2.gif) | radiata.mp3 | 20-Apr-2007 09:54 | 8.4K | |
![[SND]](/icons/sound2.gif) | radiant.mp3 | 20-Apr-2007 09:54 | 7.7K | |
![[SND]](/icons/sound2.gif) | radiancy.mp3 | 20-Apr-2007 09:54 | 8.9K | |
![[SND]](/icons/sound2.gif) | radiance.mp3 | 20-Apr-2007 09:54 | 7.5K | |
![[SND]](/icons/sound2.gif) | radian.mp3 | 20-Apr-2007 09:54 | 7.1K | |
![[SND]](/icons/sound2.gif) | radially.mp3 | 20-Apr-2007 09:54 | 7.9K | |
![[SND]](/icons/sound2.gif) | radial.mp3 | 20-Apr-2007 09:54 | 7.0K | |
![[SND]](/icons/sound2.gif) | radial keratotomy.mp3 | 20-Apr-2007 09:53 | 15K | |
![[SND]](/icons/sound2.gif) | radi.mp3 | 20-Apr-2007 09:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | radhakrishnan.mp3 | 20-Apr-2007 09:53 | 17K | |
![[SND]](/icons/sound2.gif) | radha.mp3 | 20-Apr-2007 09:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | radford.mp3 | 20-Apr-2007 09:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | Radetzky.mp3 | 20-Apr-2007 09:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | radek.mp3 | 20-Apr-2007 09:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | radectomy.mp3 | 20-Apr-2007 09:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | radeau.mp3 | 20-Apr-2007 09:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | raddling.mp3 | 20-Apr-2007 09:53 | 7.1K | |
![[SND]](/icons/sound2.gif) | raddleman.mp3 | 20-Apr-2007 09:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | raddled.mp3 | 20-Apr-2007 09:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | raddle.mp3 | 20-Apr-2007 09:53 | 6.4K | |
![[SND]](/icons/sound2.gif) | raddie.mp3 | 20-Apr-2007 09:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | Radcliffe.mp3 | 20-Apr-2007 09:53 | 7.7K | |
![[SND]](/icons/sound2.gif) | radcliff.mp3 | 20-Apr-2007 09:53 | 8.0K | |
![[SND]](/icons/sound2.gif) | radarscope.mp3 | 20-Apr-2007 09:53 | 9.5K | |
![[SND]](/icons/sound2.gif) | radarman.mp3 | 20-Apr-2007 09:53 | 8.2K | |
![[SND]](/icons/sound2.gif) | radar.mp3 | 20-Apr-2007 09:53 | 7.5K | |
![[SND]](/icons/sound2.gif) | rada.mp3 | 20-Apr-2007 09:53 | 7.9K | |
![[SND]](/icons/sound2.gif) | rad.mp3 | 20-Apr-2007 09:52 | 7.0K | |
![[SND]](/icons/sound2.gif) | racy.mp3 | 20-Apr-2007 09:52 | 6.8K | |
![[SND]](/icons/sound2.gif) | racquetball.mp3 | 20-Apr-2007 09:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | racquet.mp3 | 20-Apr-2007 09:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | racoon.mp3 | 20-Apr-2007 09:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | raconteuse.mp3 | 20-Apr-2007 09:52 | 8.8K | |
![[SND]](/icons/sound2.gif) | raconteur.mp3 | 20-Apr-2007 09:52 | 11K | |
![[SND]](/icons/sound2.gif) | racontage.mp3 | 20-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | racon.mp3 | 20-Apr-2007 09:52 | 7.5K | |
![[SND]](/icons/sound2.gif) | raclette.mp3 | 20-Apr-2007 09:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | rack-renter.mp3 | 20-Apr-2007 09:52 | 8.6K | |
![[SND]](/icons/sound2.gif) | rackle.mp3 | 20-Apr-2007 09:52 | 6.3K | |
![[SND]](/icons/sound2.gif) | rackingly.mp3 | 20-Apr-2007 09:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | racking.mp3 | 20-Apr-2007 09:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rackham.mp3 | 20-Apr-2007 09:52 | 5.7K | |
![[SND]](/icons/sound2.gif) | rackful.mp3 | 20-Apr-2007 09:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | rackety.mp3 | 20-Apr-2007 09:52 | 7.3K | |
![[SND]](/icons/sound2.gif) | rackett.mp3 | 20-Apr-2007 09:52 | 7.9K | |
![[SND]](/icons/sound2.gif) | racketeering.mp3 | 20-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | racketeer.mp3 | 20-Apr-2007 09:52 | 8.4K | |
![[SND]](/icons/sound2.gif) | racket.mp3 | 20-Apr-2007 09:52 | 6.1K | |
![[SND]](/icons/sound2.gif) | racked.mp3 | 20-Apr-2007 09:52 | 8.0K | |
![[SND]](/icons/sound2.gif) | rackabones.mp3 | 20-Apr-2007 09:52 | 17K | |
![[SND]](/icons/sound2.gif) | rack.mp3 | 20-Apr-2007 09:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | racist.mp3 | 20-Apr-2007 09:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | racism.mp3 | 20-Apr-2007 09:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Racinian.mp3 | 20-Apr-2007 09:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | racing.mp3 | 20-Apr-2007 09:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | raciness.mp3 | 20-Apr-2007 09:51 | 8.2K | |
![[SND]](/icons/sound2.gif) | Racine.mp3 | 20-Apr-2007 09:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | racinage.mp3 | 20-Apr-2007 09:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | racily.mp3 | 20-Apr-2007 09:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | Raciborz.mp3 | 20-Apr-2007 09:51 | 8.8K | |
![[SND]](/icons/sound2.gif) | racially.mp3 | 20-Apr-2007 09:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | racialize.mp3 | 20-Apr-2007 09:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | racialistic.mp3 | 20-Apr-2007 09:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | racialist.mp3 | 20-Apr-2007 09:51 | 8.6K | |
![[SND]](/icons/sound2.gif) | racialism.mp3 | 20-Apr-2007 09:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | racial.mp3 | 20-Apr-2007 09:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | rachmones.mp3 | 20-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | rachmanism.mp3 | 20-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | Rachmaninoff.mp3 | 20-Apr-2007 09:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | rachitis.mp3 | 20-Apr-2007 09:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | rachitic.mp3 | 20-Apr-2007 09:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | rachis.mp3 | 20-Apr-2007 09:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | rachiotomy.mp3 | 20-Apr-2007 09:51 | 17K | |
![[SND]](/icons/sound2.gif) | rachilla.mp3 | 20-Apr-2007 09:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | rachides.mp3 | 20-Apr-2007 09:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | rachi.mp3 | 20-Apr-2007 09:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | rachet.mp3 | 20-Apr-2007 09:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | rachel.mp3 | 20-Apr-2007 09:50 | 7.9K | |
![[SND]](/icons/sound2.gif) | raceway.mp3 | 20-Apr-2007 09:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | racewalking.mp3 | 20-Apr-2007 09:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | racewalker.mp3 | 20-Apr-2007 09:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | racewalk.mp3 | 20-Apr-2007 09:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | racetracker.mp3 | 20-Apr-2007 09:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | racetrack.mp3 | 20-Apr-2007 09:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | racer.mp3 | 20-Apr-2007 09:50 | 6.1K | |
![[SND]](/icons/sound2.gif) | racemous.mp3 | 20-Apr-2007 09:50 | 17K | |
![[SND]](/icons/sound2.gif) | racemose.mp3 | 20-Apr-2007 09:50 | 8.2K | |
![[SND]](/icons/sound2.gif) | racemize.mp3 | 20-Apr-2007 09:50 | 10K | |
![[SND]](/icons/sound2.gif) | racemization.mp3 | 20-Apr-2007 09:50 | 12K | |
![[SND]](/icons/sound2.gif) | racemism.mp3 | 20-Apr-2007 09:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | racemiferous.mp3 | 20-Apr-2007 09:50 | 17K | |
![[SND]](/icons/sound2.gif) | racemic.mp3 | 20-Apr-2007 09:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | raceme.mp3 | 20-Apr-2007 09:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | racemate.mp3 | 20-Apr-2007 09:50 | 9.5K | |
![[SND]](/icons/sound2.gif) | racehorse.mp3 | 20-Apr-2007 09:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | racecourse.mp3 | 20-Apr-2007 09:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | race-baiting.mp3 | 20-Apr-2007 09:50 | 9.3K | |
![[SND]](/icons/sound2.gif) | race.mp3 | 20-Apr-2007 09:50 | 6.4K | |
![[SND]](/icons/sound2.gif) | Race, Cape.mp3 | 20-Apr-2007 09:49 | 6.8K | |
![[SND]](/icons/sound2.gif) | raccoon.mp3 | 20-Apr-2007 09:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | raca.mp3 | 20-Apr-2007 09:49 | 8.4K | |
![[SND]](/icons/sound2.gif) | rabot.mp3 | 20-Apr-2007 09:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | raborn.mp3 | 20-Apr-2007 09:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | rabirubia.mp3 | 20-Apr-2007 09:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | rabinowitz.mp3 | 20-Apr-2007 09:49 | 8.8K | |
![[SND]](/icons/sound2.gif) | Rabin.mp3 | 20-Apr-2007 09:49 | 7.3K | |
![[SND]](/icons/sound2.gif) | rabii.mp3 | 20-Apr-2007 09:49 | 17K | |
![[SND]](/icons/sound2.gif) | rabies.mp3 | 20-Apr-2007 09:49 | 7.5K | |
![[SND]](/icons/sound2.gif) | rabidly.mp3 | 20-Apr-2007 09:49 | 8.0K | |
![[SND]](/icons/sound2.gif) | rabidity.mp3 | 20-Apr-2007 09:49 | 8.2K | |
![[SND]](/icons/sound2.gif) | rabid.mp3 | 20-Apr-2007 09:49 | 6.3K | |
![[SND]](/icons/sound2.gif) | rabic.mp3 | 20-Apr-2007 09:49 | 6.1K | |
![[SND]](/icons/sound2.gif) | Rabi.mp3 | 20-Apr-2007 09:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | Rabelaisian.mp3 | 20-Apr-2007 09:49 | 9.8K | |
![[SND]](/icons/sound2.gif) | Rabelais.mp3 | 20-Apr-2007 09:49 | 7.1K | |
![[SND]](/icons/sound2.gif) | rabbling.mp3 | 20-Apr-2007 09:49 | 7.9K | |
![[SND]](/icons/sound2.gif) | rabble-rousing.mp3 | 20-Apr-2007 09:49 | 10K | |
![[SND]](/icons/sound2.gif) | rabble-rouser.mp3 | 20-Apr-2007 09:49 | 10K | |
![[SND]](/icons/sound2.gif) | rabblement.mp3 | 20-Apr-2007 09:49 | 7.7K | |
![[SND]](/icons/sound2.gif) | rabble.mp3 | 20-Apr-2007 09:49 | 5.9K | |
![[SND]](/icons/sound2.gif) | rabbity.mp3 | 20-Apr-2007 09:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | rabbitry.mp3 | 20-Apr-2007 09:48 | 7.7K | |
![[SND]](/icons/sound2.gif) | rabbitoh.mp3 | 20-Apr-2007 09:48 | 17K | |
![[SND]](/icons/sound2.gif) | rabbiter.mp3 | 20-Apr-2007 09:48 | 8.2K | |
![[SND]](/icons/sound2.gif) | rabbitbrush.mp3 | 20-Apr-2007 09:48 | 8.8K | |
![[SND]](/icons/sound2.gif) | rabbit.mp3 | 20-Apr-2007 09:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | rabbinite.mp3 | 20-Apr-2007 09:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | rabbinism.mp3 | 20-Apr-2007 09:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | rabbinically.mp3 | 20-Apr-2007 09:48 | 8.6K | |
![[SND]](/icons/sound2.gif) | rabbinical.mp3 | 20-Apr-2007 09:48 | 8.4K | |
![[SND]](/icons/sound2.gif) | rabbinic.mp3 | 20-Apr-2007 09:48 | 7.1K | |
![[SND]](/icons/sound2.gif) | rabbinate.mp3 | 20-Apr-2007 09:48 | 6.8K | |
![[SND]](/icons/sound2.gif) | rabbin.mp3 | 20-Apr-2007 09:48 | 6.1K | |
![[SND]](/icons/sound2.gif) | rabbi.mp3 | 20-Apr-2007 09:48 | 7.0K | |
![[SND]](/icons/sound2.gif) | rabbet.mp3 | 20-Apr-2007 09:48 | 5.9K | |
![[SND]](/icons/sound2.gif) | rabbathammon.mp3 | 20-Apr-2007 09:48 | 17K | |
![[SND]](/icons/sound2.gif) | Rabbath Ammon.mp3 | 20-Apr-2007 09:48 | 6.4K | |
![[SND]](/icons/sound2.gif) | rabban.mp3 | 20-Apr-2007 09:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | rabbah.mp3 | 20-Apr-2007 09:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rabbah Ammon.mp3 | 20-Apr-2007 09:48 | 9.5K | |
![[SND]](/icons/sound2.gif) | Rabaul.mp3 | 20-Apr-2007 09:48 | 8.0K | |
![[SND]](/icons/sound2.gif) | rabato.mp3 | 20-Apr-2007 09:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | Rabat.mp3 | 20-Apr-2007 09:48 | 7.3K | |
![[SND]](/icons/sound2.gif) | rabal.mp3 | 20-Apr-2007 09:48 | 7.9K | |
![[SND]](/icons/sound2.gif) | Raba.mp3 | 20-Apr-2007 09:48 | 5.7K | |
![[SND]](/icons/sound2.gif) | rab.mp3 | 20-Apr-2007 09:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | raasclat.mp3 | 20-Apr-2007 09:47 | 17K | |
![[SND]](/icons/sound2.gif) | raas.mp3 | 20-Apr-2007 09:47 | 8.0K | |
![[SND]](/icons/sound2.gif) | raamses.mp3 | 20-Apr-2007 09:47 | 17K | |
![[SND]](/icons/sound2.gif) | raab.mp3 | 20-Apr-2007 09:47 | 7.9K | |
![[SND]](/icons/sound2.gif) | Ra.mp3 | 20-Apr-2007 09:47 | 5.5K | |
![[SND]](/icons/sound2.gif) | r.mp3 | 20-Apr-2007 09:47 | 5.7K | |
![[SND]](/icons/sound2.gif) | R factor.mp3 | 20-Apr-2007 09:47 | 9.3K | |
|